diff options
Diffstat (limited to 'src/client/views')
55 files changed, 1139 insertions, 451 deletions
diff --git a/src/client/views/AntimodeMenu.scss b/src/client/views/AntimodeMenu.scss index 2bac03af4..8a0e5480e 100644 --- a/src/client/views/AntimodeMenu.scss +++ b/src/client/views/AntimodeMenu.scss @@ -6,9 +6,9 @@ z-index: 10001; height: $antimodemenu-height; background: $dark-gray; - box-shadow: 3px 3px 3px rgba(0, 0, 0, 0.25); + border-bottom: $standard-border; + // box-shadow: 3px 3px 3px rgba(0, 0, 0, 0.25); // border-radius: 0px 6px 6px 6px; - z-index: 1001; display: flex; &.with-rows { diff --git a/src/client/views/DocumentButtonBar.scss b/src/client/views/DocumentButtonBar.scss index 2a0b494f5..157f3a4f2 100644 --- a/src/client/views/DocumentButtonBar.scss +++ b/src/client/views/DocumentButtonBar.scss @@ -44,18 +44,19 @@ $linkGap : 3px; } .documentButtonBar { - margin-top: $linkGap; - grid-column: 1/4; - width: max-content; - height: auto; display: flex; flex-direction: row; + gap: 3px; } .documentButtonBar-button { - pointer-events: auto; - padding-right: 5px; - width: 25px; + cursor: pointer; + display: flex; + width: 30px; + height: 30px; + align-content: center; + justify-content: center; + align-items: center; } .documentButtonBar-linker { diff --git a/src/client/views/DocumentButtonBar.tsx b/src/client/views/DocumentButtonBar.tsx index a5d80cd22..1e5380971 100644 --- a/src/client/views/DocumentButtonBar.tsx +++ b/src/client/views/DocumentButtonBar.tsx @@ -3,7 +3,7 @@ import { FontAwesomeIcon } from "@fortawesome/react-fontawesome"; import { Tooltip } from '@material-ui/core'; import { action, computed, observable, runInAction } from "mobx"; import { observer } from "mobx-react"; -import { Doc } from "../../fields/Doc"; +import { Doc, DocCastAsync } from "../../fields/Doc"; import { RichTextField } from '../../fields/RichTextField'; import { Cast, NumCast, StrCast } from "../../fields/Types"; import { emptyFunction, setupMoveUpEvents, simulateMouseClick } from "../../Utils"; @@ -24,7 +24,7 @@ import { DocumentView } from './nodes/DocumentView'; import { GoogleRef } from "./nodes/formattedText/FormattedTextBox"; import { TemplateMenu } from "./TemplateMenu"; import React = require("react"); -import { PresBox } from './nodes/PresBox'; +import { PresBox } from './nodes/trails/PresBox'; import { undoBatch } from '../util/UndoManager'; import { CollectionViewType } from './collections/CollectionView'; const higflyout = require("@hig/flyout"); @@ -348,16 +348,17 @@ export class DocumentButtonBar extends React.Component<{ views: () => (DocumentV if (!this.view0) return (null); const isText = this.view0.props.Document[this.view0.LayoutFieldKey] instanceof RichTextField; + const doc = this.view0?.props.Document; const considerPull = isText && this.considerGoogleDocsPull; const considerPush = isText && this.considerGoogleDocsPush; return <div className="documentButtonBar"> <div className="documentButtonBar-button"> <DocumentLinksButton View={this.view0} AlwaysOn={true} InMenu={true} StartLink={true} /> </div> - {DocumentLinksButton.StartLink || !Doc.UserDoc()["documentLinksButton-fullMenu"] ? <div className="documentButtonBar-button"> + {(DocumentLinksButton.StartLink || Doc.UserDoc()["documentLinksButton-fullMenu"]) && DocumentLinksButton.StartLink != doc ? <div className="documentButtonBar-button"> <DocumentLinksButton View={this.view0} AlwaysOn={true} InMenu={true} StartLink={false} /> </div> : (null)} - {!Doc.UserDoc()["documentLinksButton-fullMenu"] ? (null) : <div className="documentButtonBar-button"> + {/*!Doc.UserDoc()["documentLinksButton-fullMenu"] ? (null) : <div className="documentButtonBar-button"> {this.templateButton} </div> /*<div className="documentButtonBar-button"> diff --git a/src/client/views/DocumentDecorations.scss b/src/client/views/DocumentDecorations.scss index 1715f35e7..952d8d150 100644 --- a/src/client/views/DocumentDecorations.scss +++ b/src/client/views/DocumentDecorations.scss @@ -263,7 +263,6 @@ $linkGap : 3px; } .link-button-container { - padding: $linkGap; border-radius: 10px; width: max-content; height: auto; @@ -271,6 +270,9 @@ $linkGap : 3px; flex-direction: row; z-index: 998; position: absolute; + justify-content: center; + align-items: center; + gap: 5px; background: $medium-gray; } diff --git a/src/client/views/LightboxView.scss b/src/client/views/LightboxView.scss index 4ea2dc2d6..5d42cd97f 100644 --- a/src/client/views/LightboxView.scss +++ b/src/client/views/LightboxView.scss @@ -1,3 +1,32 @@ + + .lightboxView-navBtn { + margin: auto; + position: absolute; + right: 10; + top: 10; + background: transparent; + border-radius: 8; + color:white; + opacity: 0.7; + width: 35; + &:hover { + opacity: 1; + } + } + .lightboxView-tabBtn { + margin: auto; + position: absolute; + right: 35; + top: 10; + background: transparent; + border-radius: 8; + color:white; + opacity: 0.7; + width: 35; + &:hover { + opacity: 1; + } + } .lightboxView-frame { position: absolute; top: 0; left: 0; @@ -15,7 +44,6 @@ position: relative; background: transparent; border-radius: 8; - color:white; opacity: 0.7; width: 35; &:hover { diff --git a/src/client/views/LightboxView.tsx b/src/client/views/LightboxView.tsx index ce36d9182..88739fe91 100644 --- a/src/client/views/LightboxView.tsx +++ b/src/client/views/LightboxView.tsx @@ -1,19 +1,20 @@ import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'; -import { action, computed, observable, trace } from 'mobx'; +import { action, computed, observable } from 'mobx'; import { observer } from 'mobx-react'; import "normalize.css"; import * as React from 'react'; import { Doc, DocListCast, Opt } from '../../fields/Doc'; import { Cast, NumCast, StrCast } from '../../fields/Types'; -import { emptyFunction, returnEmptyDoclist, returnEmptyFilter, returnTrue, returnFalse } from '../../Utils'; +import { emptyFunction, returnEmptyDoclist, returnEmptyFilter, returnFalse, returnTrue } from '../../Utils'; import { DocUtils } from '../documents/Documents'; import { DocumentManager } from '../util/DocumentManager'; import { LinkManager } from '../util/LinkManager'; import { SelectionManager } from '../util/SelectionManager'; import { Transform } from '../util/Transform'; +import { CollectionDockingView } from './collections/CollectionDockingView'; import { TabDocView } from './collections/TabDocView'; import "./LightboxView.scss"; -import { DocumentView, ViewAdjustment } from './nodes/DocumentView'; +import { DocumentView } from './nodes/DocumentView'; import { DefaultStyleProvider, wavyBorderPath } from './StyleProvider'; interface LightboxViewProps { @@ -160,7 +161,7 @@ export class LightboxView extends React.Component<LightboxViewProps> { const { doc, target } = LightboxView._history?.lastElement(); const docView = DocumentManager.Instance.getLightboxDocumentView(target || doc); if (docView) { - LightboxView._docTarget = undefined; + LightboxView._docTarget = target; const focusSpeed = 1000; doc._viewTransition = `transform ${focusSpeed}ms`; if (!target) docView.ComponentView?.shrinkWrap?.(); @@ -197,7 +198,6 @@ export class LightboxView extends React.Component<LightboxViewProps> { TabDocView.PinDoc(coll, { hidePresBox: true }); } } - setTimeout(LightboxView.Next); } future = () => LightboxView._future; @@ -228,7 +228,6 @@ export class LightboxView extends React.Component<LightboxViewProps> { const targetView = target && DocumentManager.Instance.getLightboxDocumentView(target); if (doc === r.props.Document && (!target || target === doc)) r.ComponentView?.shrinkWrap?.(); else target && targetView?.focus(target, { willZoom: true, scale: 0.9, instant: true }); - LightboxView._docTarget = undefined; })); })} Document={LightboxView.LightboxDoc} @@ -270,7 +269,16 @@ export class LightboxView extends React.Component<LightboxViewProps> { LightboxView.Next(); })} <LightboxTourBtn navBtn={this.navBtn} future={this.future} stepInto={this.stepInto} tourMap={this.tourMap} /> - <div className="lightboxView-navBtn" title={"toggle fit width"} style={{ position: "absolute", right: 10, top: 10, color: "white" }} + <div className="lightboxView-tabBtn" title={"open in tab"} + onClick={e => { + e.stopPropagation(); + CollectionDockingView.AddSplit(LightboxView._docTarget || LightboxView._doc!, "onRight"); + SelectionManager.DeselectAll(); + LightboxView.SetLightboxDoc(undefined); + }}> + <FontAwesomeIcon icon={"file-download"} size="2x" /> + </div> + <div className="lightboxView-navBtn" title={"toggle fit width"} onClick={e => { e.stopPropagation(); LightboxView.LightboxDoc!._fitWidth = !LightboxView.LightboxDoc!._fitWidth; }}> <FontAwesomeIcon icon={"arrows-alt-h"} size="2x" /> </div> diff --git a/src/client/views/MainView.scss b/src/client/views/MainView.scss index 07ca0257c..d913f2069 100644 --- a/src/client/views/MainView.scss +++ b/src/client/views/MainView.scss @@ -22,10 +22,6 @@ height: 100%; } -.mainContent-div-flyout { - left: calc(-1 * var(--flyoutHandleWidth)); -} - // add nodes menu. Note that the + button is actually an input label, not an actual button. .mainView-docButtons { position: absolute; @@ -111,6 +107,14 @@ user-select: none; } +.properties-container { + height: 100%; + position: relative; + left: 100%; + top: calc(-100% - 36px); + z-index: 3000; +} + .mainView-propertiesDragger { //background-color: rgb(140, 139, 139); background-color: $light-gray; @@ -118,7 +122,6 @@ width: 17px; position: absolute; top: 50%; - border: 1px black solid; border-radius: 0; border-top-left-radius: 10px; border-bottom-left-radius: 10px; @@ -141,18 +144,6 @@ } } -.mainiView-propertiesView { - display: flex; - flex-direction: column; - height: 100%; - position: absolute; - right: 0; - top: 0; - border-left: solid 1px; - z-index: 100000; - cursor: auto; -} - .mainView-innerContent, .mainView-innerContent-dark { display: contents; flex-direction: row; @@ -171,10 +162,10 @@ } .propertiesView { - right: 0; + left: 0; position: absolute; z-index: 2; - background-color: $medium-gray; + background-color: $light-gray; .editable-title { background-color: $light-gray; } @@ -220,6 +211,7 @@ .mainView-menuPanel { min-width: var(--menuPanelWidth); background-color: $dark-gray; + border-right: $standard-border; .collectionStackingView { scrollbar-width: none; @@ -419,31 +411,4 @@ display: block; width: 500px; height: 1000px; -} - -.lm_drag_tab { - padding: 0; - width: 15px !important; - height: 15px !important; - position: relative !important; - display: inline-flex !important; - align-items: center; - top: 0 !important; - right: unset !important; - left: 0 !important; -} -.lm_close_tab { - padding: 0; - width: 15px !important; - height: 15px !important; - position: relative !important; - display: inline-flex !important; - align-items: center; - top: 0 !important; - right: unset !important; - left: 0 !important; -} -.lm_tab, .lm_tab_active { - display: flex !important; - padding-right: 0 !important; }
\ No newline at end of file diff --git a/src/client/views/MainView.tsx b/src/client/views/MainView.tsx index f34851b00..49f4f7a6e 100644 --- a/src/client/views/MainView.tsx +++ b/src/client/views/MainView.tsx @@ -63,6 +63,8 @@ import { PreviewCursor } from './PreviewCursor'; import { PropertiesView } from './PropertiesView'; import { SearchBox } from './search/SearchBox'; import { DefaultStyleProvider, DashboardStyleProvider, StyleProp } from './StyleProvider'; +import { TopBar } from './topbar/TopBar'; +import { Colors } from './global/globalEnums'; const _global = (window /* browser */ || global /* node */) as any; @observer @@ -78,7 +80,7 @@ export class MainView extends React.Component { @observable private _sidebarContent: any = this.userDoc?.sidebar; @observable private _flyoutWidth: number = 0; - @computed private get topOffset() { return (CollectionMenu.Instance?.Pinned ? 35 : 0) + Number(SEARCH_PANEL_HEIGHT.replace("px", "")); } + @computed private get topOffset() { return Number(SEARCH_PANEL_HEIGHT.replace("px", "")); } //TODO remove @computed private get leftOffset() { return this.menuPanelWidth() - 2; } @computed private get userDoc() { return Doc.UserDoc(); } @computed private get darkScheme() { return BoolCast(CurrentUserUtils.ActiveDashboard?.darkScheme); } @@ -178,12 +180,12 @@ export class MainView extends React.Component { const targets = document.elementsFromPoint(e.x, e.y); if (targets.length) { const targClass = targets[0].className.toString(); - if (SearchBox.Instance._searchbarOpen || SearchBox.Instance.open) { - const check = targets.some((thing) => - (thing.className === "collectionSchemaView-searchContainer" || (thing as any)?.dataset.icon === "filter" || - thing.className === "collectionSchema-header-menuOptions")); - !check && SearchBox.Instance.resetSearch(true); - } + // if (SearchBox.Instance._searchbarOpen || SearchBox.Instance.open) { + // const check = targets.some((thing) => + // (thing.className === "collectionSchemaView-searchContainer" || (thing as any)?.dataset.icon === "filter" || + // thing.className === "collectionSchema-header-menuOptions")); + // !check && SearchBox.Instance.resetSearch(true); + // } !targClass.includes("contextMenu") && ContextMenu.Instance.closeMenu(); !["timeline-menu-desc", "timeline-menu-item", "timeline-menu-input"].includes(targClass) && TimelineMenu.Instance.closeMenu(); } @@ -192,7 +194,7 @@ export class MainView extends React.Component { initEventListeners = () => { window.addEventListener("drop", e => e.preventDefault(), false); // prevent default behavior of navigating to a new web page window.addEventListener("dragover", e => e.preventDefault(), false); - document.addEventListener("pointermove", action(e => SearchBox.Instance._undoBackground = UndoManager.batchCounter ? "#000000a8" : undefined)); + // document.addEventListener("pointermove", action(e => SearchBox.Instance._undoBackground = UndoManager.batchCounter ? "#000000a8" : undefined)); document.addEventListener("pointerdown", this.globalPointerDown); document.addEventListener("click", (e: MouseEvent) => { if (!e.cancelBubble) { @@ -242,8 +244,9 @@ export class MainView extends React.Component { } getPWidth = () => this._panelWidth - this.propertiesWidth(); - getPHeight = () => this._panelHeight; + getPHeight = () => this._panelHeight - (CollectionMenu.Instance?.Pinned ? 35 : 0); getContentsHeight = () => this._panelHeight; + getMenuPanelHeight = () => this._panelHeight + (CollectionMenu.Instance?.Pinned ? 35 : 0); @computed get mainDocView() { return <DocumentView key="main" @@ -275,10 +278,12 @@ export class MainView extends React.Component { @computed get dockingContent() { return <div key="docking" className={`mainContent-div${this._flyoutWidth ? "-flyout" : ""}`} onDrop={e => { e.stopPropagation(); e.preventDefault(); }} + // style={{ minWidth: `calc(100% - ${this._flyoutWidth + this.menuPanelWidth() + this.propertiesWidth()}px)`, width: `calc(100% - ${this._flyoutWidth + this.propertiesWidth()}px)` }}> + // FIXME update with property panel width style={{ minWidth: `calc(100% - ${this._flyoutWidth + this.menuPanelWidth() + this.propertiesWidth()}px)`, transform: LightboxView.LightboxDoc ? "scale(0.0001)" : undefined, - width: `calc(100% - ${this._flyoutWidth + this.menuPanelWidth() + this.propertiesWidth()}px)` + //TODO:glr width: `calc(100% - ${this._flyoutWidth + this.menuPanelWidth() + this.propertiesWidth()}px)` }}> {!this.mainContainer ? (null) : this.mainDocView} </div>; @@ -358,7 +363,7 @@ export class MainView extends React.Component { removeDocument={returnFalse} ScreenToLocalTransform={this.sidebarScreenToLocal} PanelWidth={this.menuPanelWidth} - PanelHeight={this.getContentsHeight} + PanelHeight={this.getMenuPanelHeight} renderDepth={0} docViewPath={returnEmptyDoclist} focus={DocUtils.DefaultFocus} @@ -401,20 +406,27 @@ export class MainView extends React.Component { } @computed get mainInnerContent() { + const width = this.propertiesWidth() + this._flyoutWidth + this.menuPanelWidth(); + const transform = this._flyoutWidth ? 'translate(-28px, 0px)' : undefined; return <> {this.menuPanel} <div key="inner" className={`mainView-innerContent${this.darkScheme ? "-dark" : ""}`}> {this.flyout} - <div className="mainView-libraryHandle" style={{ display: !this._flyoutWidth ? "none" : undefined, }} onPointerDown={this.onFlyoutPointerDown} > + <div className="mainView-libraryHandle" style={{ display: !this._flyoutWidth ? "none" : undefined }} onPointerDown={this.onFlyoutPointerDown} > <FontAwesomeIcon icon="chevron-left" color={this.darkScheme ? "white" : "black"} style={{ opacity: "50%" }} size="sm" /> </div> + <div className="mainView-innerContainer" style={{ width: `calc(100% - ${width}px)`, transform: transform }}> + <CollectionMenu /> - {this.dockingContent} + {this.dockingContent} - <div className="mainView-propertiesDragger" key="props" onPointerDown={this.onPropertiesPointerDown} style={{ right: this.propertiesWidth() - 1 }}> - <FontAwesomeIcon icon={this.propertiesWidth() < 10 ? "chevron-left" : "chevron-right"} color={this.darkScheme ? "white" : "black"} size="sm" /> + <div className="mainView-propertiesDragger" key="props" onPointerDown={this.onPropertiesPointerDown} style={{ right: this._flyoutWidth ? 0 : this.propertiesWidth() - 1 }}> + <FontAwesomeIcon icon={this.propertiesWidth() < 10 ? "chevron-left" : "chevron-right"} color={this.darkScheme ? Colors.WHITE : Colors.BLACK} size="sm" /> + </div> + <div className="properties-container"> + {this.propertiesWidth() < 10 ? (null) : <PropertiesView styleProvider={DefaultStyleProvider} width={this.propertiesWidth()} height={this.getContentsHeight()} />} + </div> </div> - {this.propertiesWidth() < 10 ? (null) : <PropertiesView styleProvider={DefaultStyleProvider} width={this.propertiesWidth()} height={this.getContentsHeight()} />} </div> </>; } @@ -525,35 +537,8 @@ export class MainView extends React.Component { @computed get search() { TraceMobx(); - return <div className="mainView-searchPanel"> - <SearchBox Document={CurrentUserUtils.MySearchPanelDoc} - DataDoc={CurrentUserUtils.MySearchPanelDoc} - fieldKey="data" - dropAction="move" - isSelected={returnTrue} - isContentActive={returnTrue} - select={returnTrue} - setHeight={returnFalse} - addDocument={undefined} - addDocTab={this.addDocTabFunc} - pinToPres={emptyFunction} - rootSelected={returnTrue} - styleProvider={DefaultStyleProvider} - layerProvider={undefined} - removeDocument={undefined} - ScreenToLocalTransform={Transform.Identity} - PanelWidth={this.getPWidth} - PanelHeight={this.getPHeight} - renderDepth={0} - focus={DocUtils.DefaultFocus} - docViewPath={returnEmptyDoclist} - whenChildContentsActiveChanged={emptyFunction} - bringToFront={emptyFunction} - docFilters={returnEmptyFilter} - docRangeFilters={returnEmptyFilter} - searchFilterDocs={returnEmptyDoclist} - ContainingCollectionView={undefined} - ContainingCollectionDoc={undefined} /> + return <div className="mainView-topbar"> + <TopBar /> </div>; } @@ -605,7 +590,6 @@ export class MainView extends React.Component { <GoogleAuthenticationManager /> <DocumentDecorations boundsLeft={this.leftOffset} boundsTop={this.topOffset} /> {this.search} - <CollectionMenu /> {LinkDescriptionPopup.descriptionPopup ? <LinkDescriptionPopup /> : null} {DocumentLinksButton.LinkEditorDocView ? <LinkMenu docView={DocumentLinksButton.LinkEditorDocView} changeFlyout={emptyFunction} /> : (null)} {LinkDocPreview.LinkInfo ? <LinkDocPreview {...LinkDocPreview.LinkInfo} /> : (null)} diff --git a/src/client/views/MarqueeAnnotator.tsx b/src/client/views/MarqueeAnnotator.tsx index 717bd0768..805cda95c 100644 --- a/src/client/views/MarqueeAnnotator.tsx +++ b/src/client/views/MarqueeAnnotator.tsx @@ -120,9 +120,11 @@ export class MarqueeAnnotator extends React.Component<MarqueeAnnotatorProps> { return marqueeAnno; } - const textRegionAnno = Docs.Create.HTMLAnchorDocument([], { annotationOn: this.props.rootDoc, title: "Selection on " + this.props.rootDoc.title, _width: 1, _height: 1 }); + const textRegionAnno = Docs.Create.HTMLAnchorDocument([], { annotationOn: this.props.rootDoc, backgroundColor: "transparent", title: "Selection on " + this.props.rootDoc.title }); + let minX = Number.MAX_VALUE; let maxX = -Number.MAX_VALUE; let minY = Number.MAX_VALUE; + let maxY = -Number.MIN_VALUE; const annoDocs: Doc[] = []; savedAnnoMap.forEach((value: HTMLDivElement[], key: number) => value.map(anno => { const textRegion = new Doc(); @@ -135,12 +137,16 @@ export class MarqueeAnnotator extends React.Component<MarqueeAnnotatorProps> { annoDocs.push(textRegion); anno.remove(); minY = Math.min(NumCast(textRegion.y), minY); + minX = Math.min(NumCast(textRegion.x), minX); + maxY = Math.max(NumCast(textRegion.y) + NumCast(textRegion._height), maxY); maxX = Math.max(NumCast(textRegion.x) + NumCast(textRegion._width), maxX); })); const textRegionAnnoProto = Doc.GetProto(textRegionAnno); textRegionAnnoProto.y = Math.max(minY, 0); - textRegionAnnoProto.x = Math.max(maxX, 0); + textRegionAnnoProto.x = Math.max(minX, 0); + textRegionAnnoProto.height = Math.max(maxY, 0) - Math.max(minY, 0); + textRegionAnnoProto.width = Math.max(maxX, 0) - Math.max(minX, 0); // mainAnnoDocProto.text = this._selectionText; textRegionAnnoProto.textInlineAnnotations = new List<Doc>(annoDocs); savedAnnoMap.clear(); diff --git a/src/client/views/PropertiesView.tsx b/src/client/views/PropertiesView.tsx index 4df3e4f00..8136edf04 100644 --- a/src/client/views/PropertiesView.tsx +++ b/src/client/views/PropertiesView.tsx @@ -24,7 +24,7 @@ import { EditableView } from "./EditableView"; import { InkStrokeProperties } from "./InkStrokeProperties"; import { DocumentView, StyleProviderFunc } from "./nodes/DocumentView"; import { KeyValueBox } from "./nodes/KeyValueBox"; -import { PresBox } from "./nodes/PresBox"; +import { PresBox } from "./nodes/trails/PresBox"; import { PropertiesButtons } from "./PropertiesButtons"; import { PropertiesDocContextSelector } from "./PropertiesDocContextSelector"; import "./PropertiesView.scss"; diff --git a/src/client/views/SidebarAnnos.tsx b/src/client/views/SidebarAnnos.tsx index 9c5a54574..c5ae82c61 100644 --- a/src/client/views/SidebarAnnos.tsx +++ b/src/client/views/SidebarAnnos.tsx @@ -79,7 +79,7 @@ export class SidebarAnnos extends React.Component<FieldViewProps & ExtraProps> { sidebarStyleProvider = (doc: Opt<Doc>, props: Opt<FieldViewProps | DocumentViewProps>, property: string) => { if (property === StyleProp.ShowTitle) { - return doc === this.props.rootDoc ? 0 : StrCast(this.props.layoutDoc["sidebar-childShowTitle"], "title"); + return doc === this.props.rootDoc ? undefined : StrCast(this.props.layoutDoc["sidebar-childShowTitle"], "title"); } return this.props.styleProvider?.(doc, props, property); } diff --git a/src/client/views/StyleProvider.tsx b/src/client/views/StyleProvider.tsx index 6b94539c9..c9e532745 100644 --- a/src/client/views/StyleProvider.tsx +++ b/src/client/views/StyleProvider.tsx @@ -101,7 +101,7 @@ export function DefaultStyleProvider(doc: Opt<Doc>, props: Opt<DocumentViewProps const backColor = backgroundCol(); if (!backColor) return undefined; const nonAlphaColor = backColor.startsWith("#") ? (backColor as string).substring(0, 7) : - backColor.startsWith("rgba") ? backColor.replace(/,.[^,]*\)/, ")").replace("rgba", "rgb") : backColor + backColor.startsWith("rgba") ? backColor.replace(/,.[^,]*\)/, ")").replace("rgba", "rgb") : backColor; const col = Color(nonAlphaColor).rgb(); const colsum = (col.red() + col.green() + col.blue()); if (colsum / col.alpha() > 400 || col.alpha() < 0.25) return Colors.DARK_GRAY; @@ -174,6 +174,7 @@ export function DefaultStyleProvider(doc: Opt<Doc>, props: Opt<DocumentViewProps } } case StyleProp.PointerEvents: + if (doc?.type === DocumentType.MARKER) return "none"; if (props?.pointerEvents === "none") return "none"; const layer = doc && props?.layerProvider?.(doc); if (opacity() === 0 || (doc?.type === DocumentType.INK && !docProps?.treeViewDoc) || doc?.isInkMask) return "none"; diff --git a/src/client/views/_nodeModuleOverrides.scss b/src/client/views/_nodeModuleOverrides.scss index 56346b68b..fd0ac9d5c 100644 --- a/src/client/views/_nodeModuleOverrides.scss +++ b/src/client/views/_nodeModuleOverrides.scss @@ -1,8 +1,50 @@ +@import "./global/globalCssVariables"; // this file is for overriding all the css from installed node modules // goldenlayout stuff div .lm_header { background: $dark-gray; + overflow: hidden; + height: 27px !important; +} + +/* Width */ +.lm_header::-webkit-scrollbar { + -webkit-appearance: none; + display: none; +} + +/* Width */ +.lm_header:hover::-webkit-scrollbar { + -webkit-appearance: none; + display: block; + height: 0px; +} + +/* Track */ +.lm_header:hover::-webkit-scrollbar-track { + -webkit-appearance: none; + display: none; +} + +/* Handle */ +.lm_header:hover::-webkit-scrollbar-thumb { + -webkit-appearance: none; + background: $dark-gray; +} + +/* Handle on hover */ +.lm_header:hover::-webkit-scrollbar-thumb:hover { + -webkit-appearance: none; + background: $dark-gray; +} + +.lm_tabs { + display: flex; + position: absolute; + width: calc(100% - 60px); + overflow: scroll; + background: $dark-gray; } .lm_tab { @@ -15,7 +57,14 @@ div .lm_header { } .lm_header .lm_controls { - right: 1em !important; + align-items: center; + position: absolute; + background-color: $dark-gray; + border-radius: 5px; + display: flex; + justify-content: space-evenly; + height: 23px; + width: 65px; } // @TODO the ril__navgiation buttons in the img gallery are a lil messed up but I can't figure out diff --git a/src/client/views/collections/CollectionDockingView.scss b/src/client/views/collections/CollectionDockingView.scss index a054f0ae1..77e7b86ea 100644 --- a/src/client/views/collections/CollectionDockingView.scss +++ b/src/client/views/collections/CollectionDockingView.scss @@ -1,40 +1,46 @@ -@import "../../views/global/globalCssVariables.scss"; +@import "../global/globalCssVariables.scss"; .lm_title { - margin-top: 3px; - border-radius: 5px; - border: solid 0px dimgray; - border-width: 2px 2px 0px; - height: 20px; - transform: translate(0px, -3px); + -webkit-appearance: none; + display: inline-block; + align-self: center; + align-items: center; + height: 100%; + overflow: hidden; + text-overflow: ellipsis; + background: transparent; + border: solid 0px transparent; cursor: grab; + color: $black; } .lm_title.focus-visible { + -webkit-appearance: none; cursor: text; } .lm_title_wrap { overflow: hidden; - height: 19px; - margin-top: -2px; - display: inline-block; + align-items: center; + align-self: center; + background: transparent; + width: max-content; + height: 100%; + display: flex; } .lm_active .lm_title { - border: solid 1px lightgray; -} - -.lm_header .lm_tab .lm_close_tab { - position: absolute; - text-align: center; + -webkit-appearance: none; + // font-weight: 700; } .lm_header .lm_tab { - padding-right: 20px; - margin-top: -1px; - border-bottom: 1px black; + padding: 0px; + opacity: 0.7; + box-shadow: none; + height: 24px; + // border-bottom: 1px black; .collectionDockingView-gear { display: none; @@ -42,9 +48,13 @@ } .lm_header .lm_tab.lm_active { - padding-right: 20px; - margin-top: 1px; - border-bottom: unset; + padding: 0; + opacity: 1; + margin: 0; + box-shadow: none; + height: 27px; + margin-right: 2px; + // border-bottom: unset; .collectionDockingView-gear { display: inline-block; @@ -55,6 +65,41 @@ display: inline; } +.lm_drag_tab { + padding: 0; + width: 15px !important; + height: 15px !important; + position: relative !important; + display: inline-flex !important; + align-items: center; + top: 0 !important; + right: unset !important; + left: 0 !important; +} + +.lm_close_tab { + padding: 0; + align-self: center; + margin-right: 5px; + background-color: black; + border-radius: 3px; + opacity: 1 !important; + width: 15px !important; + height: 15px !important; + position: relative !important; + display: inline-flex !important; + align-items: center; + top: 0 !important; + right: unset !important; + left: 0 !important; +} + +.lm_tab, +.lm_tab_active { + display: flex !important; + padding-right: 0 !important; +} + .collectiondockingview-container { width: 100%; height: 100%; @@ -82,16 +127,17 @@ } .lm_content { - background: white; + background: $white; } .lm_controls>li { - opacity: 0.6; - transform: scale(1.2); + opacity: 1; + transform: scale(1); } .lm_controls .lm_popout { - background-image: url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAABUAAAAUCAAAAABHICnvAAAABGdBTUEAALGPC/xhBQAAACBjSFJNAAB6JgAAgIQAAPoAAACA6AAAdTAAAOpgAAA6mAAAF3CculE8AAAAAmJLR0QAAKqNIzIAAAAHdElNRQfkCBsXMgbrEyzaAAAAT0lEQVQY02NgIAcIu8tgEW3/u4IDQ5B14/8LQlhFhckVFfCJjIyIOfP/QWpEZGSQJFS05s9fIPj3/z+YmseCTxS7CZS7DI+PsYcOjpAkDAA6H0KZxzDzlgAAACV0RVh0ZGF0ZTpjcmVhdGUAMjAyMC0wOC0yN1QyMzo1MDowNi0wNDowMDvgVpQAAAAldEVYdGRhdGU6bW9kaWZ5ADIwMjAtMDgtMjdUMjM6NTA6MDYtMDQ6MDBKve4oAAAAAElFTkSuQmCC) + transform: rotate(45deg); + background-image: url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAAkAAAAJCAYAAADgkQYQAAAAQUlEQVR4nHXOQQ4AMAgCQeT/f6aXpsGK3jSTuCVJAAr7iBdoAwCKd0nwfaAdHbYERw5b44+E8JoBjEYGMBq5gAYP3usUDu2IvoUAAAAASUVORK5CYII=); } .lm_maximised .lm_controls .lm_maximise { @@ -311,8 +357,6 @@ background: transparent url("../../../../node_modules/flexlayout-react/images/restore.png") no-repeat center; } - .flexlayout__popup_menu {} - .flexlayout__popup_menu_item { padding: 2px 10px 2px 10px; color: #ddd; diff --git a/src/client/views/collections/CollectionDockingView.tsx b/src/client/views/collections/CollectionDockingView.tsx index 388f9a909..a8471f8e2 100644 --- a/src/client/views/collections/CollectionDockingView.tsx +++ b/src/client/views/collections/CollectionDockingView.tsx @@ -445,4 +445,4 @@ Scripting.addGlobal(function openInLightbox(doc: any) { LightboxView.AddDocTab(d "opens up document in a lightbox", "(doc: any)"); Scripting.addGlobal(function openOnRight(doc: any) { return CollectionDockingView.AddSplit(doc, "right"); }, "opens up document in tab on right side of the screen", "(doc: any)"); -Scripting.addGlobal(function useRightSplit(doc: any, shiftKey?: boolean) { CollectionDockingView.ReplaceTab(doc, "right", undefined, shiftKey); }); +Scripting.addGlobal(function useRightSplit(doc: any, shiftKey?: boolean) { CollectionDockingView.ReplaceTab(doc, "right", undefined, shiftKey); });
\ No newline at end of file diff --git a/src/client/views/collections/CollectionLinearView.scss b/src/client/views/collections/CollectionLinearView.scss index ec8805907..86610ac20 100644 --- a/src/client/views/collections/CollectionLinearView.scss +++ b/src/client/views/collections/CollectionLinearView.scss @@ -20,19 +20,21 @@ } .bottomPopup-background { - padding-right: 14px; + background: $light-blue; + display: flex; height: 35; - transform: translate3d(6px, 5px, 0px); - padding-top: 6.5px; - padding-bottom: 7px; - padding-left: 5px; + transform: translate3d(6px, 0px, 0px); + align-content: center; + justify-content: center; + align-items: center; } .bottomPopup-text { + color: black; display: inline; white-space: nowrap; padding-left: 8px; - padding-right: 4px; + padding-right: 20px; vertical-align: middle; font-size: 12.5px; } @@ -43,8 +45,8 @@ padding-left: 8px; padding-right: 8px; vertical-align: middle; - background-color: lightgrey; - border-radius: 5.5px; + background-color: #efefef; + border-radius: 3px; color: black; margin-right: 5px; } @@ -52,11 +54,12 @@ .bottomPopup-exit { display: inline; white-space: nowrap; + margin-right: 10px; padding-left: 8px; padding-right: 8px; vertical-align: middle; - background-color: lightgrey; - border-radius: 5.5px; + background-color: #f3b6b6; + border-radius: 3px; color: black; } diff --git a/src/client/views/collections/CollectionLinearView.tsx b/src/client/views/collections/CollectionLinearView.tsx index e0b90304b..52c836556 100644 --- a/src/client/views/collections/CollectionLinearView.tsx +++ b/src/client/views/collections/CollectionLinearView.tsx @@ -167,24 +167,22 @@ export class CollectionLinearView extends CollectionSubView(LinearDocument) { })} </div> {DocumentLinksButton.StartLink ? <span className="bottomPopup-background" style={{ - background: backgroundColor === color ? "black" : backgroundColor, pointerEvents: "all" }} onPointerDown={e => e.stopPropagation()} > <span className="bottomPopup-text" > - Creating link from: {DocumentLinksButton.AnnotationId ? "Annotation in " : " "} {StrCast(DocumentLinksButton.StartLink.title).length < 51 ? DocumentLinksButton.StartLink.title : StrCast(DocumentLinksButton.StartLink.title).slice(0, 50) + '...'} + Creating link from: <b>{DocumentLinksButton.AnnotationId ? "Annotation in " : " "} {StrCast(DocumentLinksButton.StartLink.title).length < 51 ? DocumentLinksButton.StartLink.title : StrCast(DocumentLinksButton.StartLink.title).slice(0, 50) + '...'}</b> </span> - <Tooltip title={<><div className="dash-tooltip">{LinkDescriptionPopup.showDescriptions ? "Turn off description pop-up" : - "Turn on description pop-up"} </div></>} placement="top"> + <Tooltip title={<><div className="dash-tooltip">{"Toggle description pop-up"} </div></>} placement="top"> <span className="bottomPopup-descriptions" onClick={this.changeDescriptionSetting}> Labels: {LinkDescriptionPopup.showDescriptions ? LinkDescriptionPopup.showDescriptions : "ON"} </span> </Tooltip> - <Tooltip title={<><div className="dash-tooltip">Exit link clicking mode </div></>} placement="top"> + <Tooltip title={<><div className="dash-tooltip">Exit linking mode</div></>} placement="top"> <span className="bottomPopup-exit" onClick={this.exitLongLinks}> - Clear + Stop </span> </Tooltip> diff --git a/src/client/views/collections/CollectionMenu.scss b/src/client/views/collections/CollectionMenu.scss index c0fc774d3..f04b19ef7 100644 --- a/src/client/views/collections/CollectionMenu.scss +++ b/src/client/views/collections/CollectionMenu.scss @@ -38,10 +38,10 @@ border: unset; .collectionMenu-divider { - height: 85%; + height: 100%; margin-left: 3px; margin-right: 3px; - width: 1.5px; + width: 2px; background-color: $medium-gray; } diff --git a/src/client/views/collections/CollectionMenu.tsx b/src/client/views/collections/CollectionMenu.tsx index 6e6fabd0d..a9b978c4e 100644 --- a/src/client/views/collections/CollectionMenu.tsx +++ b/src/client/views/collections/CollectionMenu.tsx @@ -29,7 +29,7 @@ import { ActiveFillColor, ActiveInkColor, SetActiveArrowEnd, SetActiveArrowStart import { CollectionFreeFormDocumentView } from "../nodes/CollectionFreeFormDocumentView"; import { DocumentView } from "../nodes/DocumentView"; import { RichTextMenu } from "../nodes/formattedText/RichTextMenu"; -import { PresBox } from "../nodes/PresBox"; +import { PresBox } from "../nodes/trails/PresBox"; import "./CollectionMenu.scss"; import { CollectionViewType, COLLECTION_BORDER_WIDTH } from "./CollectionView"; import { TabDocView } from "./TabDocView"; diff --git a/src/client/views/collections/CollectionSubView.tsx b/src/client/views/collections/CollectionSubView.tsx index f39443ae2..a5d27f038 100644 --- a/src/client/views/collections/CollectionSubView.tsx +++ b/src/client/views/collections/CollectionSubView.tsx @@ -454,7 +454,7 @@ export function CollectionSubView<T, X>(schemaCtor: (doc: Doc) => T, moreProps?: if (completed) completed(set); else { if (isFreeformView && generatedDocuments.length > 1) { - addDocument(DocUtils.pileup(generatedDocuments, options.x!, options.y!)!); + addDocument(DocUtils.pileup(generatedDocuments, options.x!, options.y!)); } else { generatedDocuments.forEach(addDocument); } diff --git a/src/client/views/collections/CollectionTimeView.tsx b/src/client/views/collections/CollectionTimeView.tsx index f41043179..339163510 100644 --- a/src/client/views/collections/CollectionTimeView.tsx +++ b/src/client/views/collections/CollectionTimeView.tsx @@ -37,7 +37,7 @@ export class CollectionTimeView extends CollectionSubView(doc => doc) { @observable _focusRangeFilters: Opt<string[]>; getAnchor = () => { - const anchor = Docs.Create.TextanchorDocument({ + const anchor = Docs.Create.HTMLAnchorDocument({ title: ComputedField.MakeFunction(`"${this.pivotField}"])`) as any, annotationOn: this.rootDoc }); diff --git a/src/client/views/collections/TabDocView.scss b/src/client/views/collections/TabDocView.scss index 9acbc4f85..a963f1cb9 100644 --- a/src/client/views/collections/TabDocView.scss +++ b/src/client/views/collections/TabDocView.scss @@ -1,19 +1,62 @@ input.lm_title:focus, -input.lm_title -{ +input.lm_title { max-width: unset !important; + outline: none; transition-delay: unset; - width: 100%; + width: max-content; cursor: text; } + input.lm_title { transition-delay: 0.35s; - width: 100px; + width: max-content; cursor: pointer; } -.tabDocView-drag { - margin: auto; + +.lm_iconWrap { + display: flex; + color: black; + width: 15px; + height: 15px; + align-items: center; + align-self: center; + justify-content: center; + margin: 3px; + border-radius: 20%; + + .moreInfoDot { + background-color: white; + border-radius: 100%; + width: 3px; + height: 3px; + margin: 0.5px; + } +} + +.ffMenu { + display: grid; + grid-auto-rows: 35px; + grid-auto-columns: auto auto auto auto auto; + right: 10px; + bottom: 50px; + position: absolute; + min-height: 35px; + height: max-content; + border: solid 2px black; + border-radius: 5px; + background-color: #bddbe6; + width: max-content; + min-width: 35px; + + .ffMenuButton { + display: flex; + width: 35px; + height: 35px; + align-items: center; + justify-content: center; + } } + .miniMap-hidden, .miniMap { position: absolute; @@ -37,6 +80,7 @@ input.lm_title { } } } + .miniMap-hidden { position: absolute; bottom: 0; @@ -46,7 +90,8 @@ input.lm_title { transform: translate(20px, 20px) rotate(45deg); border-radius: 30px; padding: 2px; - > svg { + + >svg { margin-top: 3px; transform: translate(0px, 7px); } diff --git a/src/client/views/collections/TabDocView.tsx b/src/client/views/collections/TabDocView.tsx index 7e2f7811e..a24f1eb7a 100644 --- a/src/client/views/collections/TabDocView.tsx +++ b/src/client/views/collections/TabDocView.tsx @@ -1,3 +1,4 @@ +import { IconProp } from '@fortawesome/fontawesome-svg-core'; import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'; import { Tooltip } from '@material-ui/core'; import 'golden-layout/src/css/goldenlayout-base.css'; @@ -9,9 +10,9 @@ import * as ReactDOM from 'react-dom'; import { DataSym, Doc, DocListCast, DocListCastAsync, HeightSym, Opt, WidthSym } from "../../../fields/Doc"; import { Id } from '../../../fields/FieldSymbols'; import { FieldId } from "../../../fields/RefField"; -import { Cast, NumCast, StrCast, BoolCast } from "../../../fields/Types"; +import { BoolCast, Cast, NumCast, StrCast } from "../../../fields/Types"; import { TraceMobx } from '../../../fields/util'; -import { emptyFunction, returnEmptyDoclist, returnFalse, returnTrue, setupMoveUpEvents, Utils } from "../../../Utils"; +import { emptyFunction, lightOrDark, returnEmptyDoclist, returnFalse, returnTrue, setupMoveUpEvents, Utils } from "../../../Utils"; import { DocServer } from "../../DocServer"; import { DocUtils } from '../../documents/Documents'; import { DocumentType } from '../../documents/DocumentTypes'; @@ -24,15 +25,15 @@ import { Transform } from '../../util/Transform'; import { undoBatch, UndoManager } from "../../util/UndoManager"; import { LightboxView } from '../LightboxView'; import { DocFocusOptions, DocumentView, DocumentViewProps } from "../nodes/DocumentView"; -import { FieldViewProps } from '../nodes/FieldView'; -import { PinProps, PresBox, PresMovement } from '../nodes/PresBox'; +import { PinProps, PresBox, PresMovement } from '../nodes/trails'; import { DefaultLayerProvider, DefaultStyleProvider, StyleLayers, StyleProp } from '../StyleProvider'; import { CollectionDockingView } from './CollectionDockingView'; import { CollectionDockingViewMenu } from './CollectionDockingViewMenu'; import { CollectionFreeFormView } from './collectionFreeForm/CollectionFreeFormView'; -import { CollectionViewType, CollectionView } from './CollectionView'; +import { CollectionView, CollectionViewType } from './CollectionView'; import "./TabDocView.scss"; import React = require("react"); +import Color = require('color'); const _global = (window /* browser */ || global /* node */) as any; interface TabDocViewProps { @@ -52,6 +53,14 @@ export class TabDocView extends React.Component<TabDocViewProps> { @computed get layoutDoc() { return this._document && Doc.Layout(this._document); } @computed get tabColor() { return StrCast(this._document?._backgroundColor, StrCast(this._document?.backgroundColor, DefaultStyleProvider(this._document, undefined, StyleProp.BackgroundColor))); } + @computed get tabTextColor() { return this._document?.type === DocumentType.PRES ? "black" : StrCast(this._document?._color, StrCast(this._document?.color, DefaultStyleProvider(this._document, undefined, StyleProp.Color))); } + // @computed get renderBounds() { + // const bounds = this._document ? Cast(this._document._renderContentBounds, listSpec("number"), [0, 0, this.returnMiniSize(), this.returnMiniSize()]) : [0, 0, 0, 0]; + // const xbounds = bounds[2] - bounds[0]; + // const ybounds = bounds[3] - bounds[1]; + // const dim = Math.max(xbounds, ybounds); + // return { l: bounds[0] + xbounds / 2 - dim / 2, t: bounds[1] + ybounds / 2 - dim / 2, cx: bounds[0] + xbounds / 2, cy: bounds[1] + ybounds / 2, dim }; + // } get stack() { return (this.props as any).glContainer.parent.parent; } get tab() { return (this.props as any).glContainer.tab; } @@ -65,15 +74,25 @@ export class TabDocView extends React.Component<TabDocViewProps> { tab.contentItem.config.fixed && (tab.contentItem.parent.config.fixed = true); tab.DashDoc = doc; CollectionDockingView.Instance.tabMap.add(tab); - + const iconType: IconProp = Doc.toIcon(doc); // setup the title element and set its size according to the # of chars in the title. Show the full title when clicked. const titleEle = tab.titleElement[0]; + const iconWrap = document.createElement("div"); + const closeWrap = document.createElement("div"); + + titleEle.size = StrCast(doc.title).length + 3; titleEle.value = doc.title; titleEle.onchange = undoBatch(action((e: any) => { titleEle.size = e.currentTarget.value.length + 3; Doc.GetProto(doc).title = e.currentTarget.value; })); + + const dragBtnDown = (e: React.PointerEvent) => { + setupMoveUpEvents(this, e, e => !e.defaultPrevented && DragManager.StartDocumentDrag([iconWrap], new DragManager.DocumentDragData([doc], doc.dropAction as dropActionType), e.clientX, e.clientY), returnFalse, emptyFunction); + }; + + if (tab.element[0].children[1].children.length === 1) { const toggle = document.createElement("div"); toggle.style.width = "10px"; @@ -83,18 +102,42 @@ export class TabDocView extends React.Component<TabDocViewProps> { toggle.style.borderTopRightRadius = "7px"; toggle.style.position = "relative"; toggle.style.display = "inline-block"; - toggle.style.background = "gray"; - toggle.style.borderLeft = "solid 1px black"; + toggle.style.background = "transparent"; toggle.onclick = (e: MouseEvent) => { if (tab.contentItem === tab.header.parent.getActiveContentItem()) { tab.DashDoc.activeLayer = tab.DashDoc.activeLayer ? undefined : StyleLayers.Background; } }; - tab.element[0].style.borderTopRightRadius = "8px"; - tab.element[0].children[1].appendChild(toggle); - tab._disposers.layerDisposer = reaction(() => - ({ layer: tab.DashDoc.activeLayer, color: this.tabColor }), - ({ layer, color }) => toggle.style.background = !layer ? color : "dimgrey", { fireImmediately: true }); + iconWrap.className = "lm_iconWrap"; + iconWrap.id = "lm_iconWrap"; + closeWrap.className = "lm_iconWrap"; + closeWrap.id = "lm_closeWrap"; + closeWrap.onclick = (e: MouseEvent) => { + tab.header.parent.contentItem.remove(); + Doc.AddDocToList(CurrentUserUtils.MyRecentlyClosed, "data", tab.DashDoc, undefined, true, true); + }; + const docIcon = <FontAwesomeIcon onPointerDown={dragBtnDown} icon={iconType} />; + const closeIcon = <FontAwesomeIcon icon={"times"} />; + ReactDOM.render(docIcon, iconWrap); + ReactDOM.render(closeIcon, closeWrap); + // tab.element[0].append(closeWrap); + tab.element[0].prepend(iconWrap); + tab._disposers.layerDisposer = reaction(() => ({ layer: tab.DashDoc.activeLayer, color: this.tabColor }), + ({ layer, color }) => { + const textColor = lightOrDark(this.tabColor); //not working with StyleProp.Color + titleEle.style.color = textColor; + titleEle.style.backgroundColor = "transparent"; + iconWrap.style.color = textColor; + closeWrap.style.color = textColor; + moreInfoDrag.style.backgroundColor = textColor; + tab.element[0].style.background = !layer ? color : "dimgrey"; + }, { fireImmediately: true }); + // TODO:glr fix + // tab.element[0].style.borderTopRightRadius = "8px"; + // tab.element[0].children[1].appendChild(toggle); + // tab._disposers.layerDisposer = reaction(() => + // ({ layer: tab.DashDoc.activeLayer, color: this.tabColor }), + // ({ layer, color }) => toggle.style.background = !layer ? color : "dimgrey", { fireImmediately: true }); } // shifts the focus to this tab when another tab is dragged over it tab.element[0].onmouseenter = (e: MouseEvent) => { @@ -103,13 +146,11 @@ export class TabDocView extends React.Component<TabDocViewProps> { tab.setActive(true); } }; - const dragBtnDown = (e: React.PointerEvent) => { - setupMoveUpEvents(this, e, e => !e.defaultPrevented && DragManager.StartDocumentDrag([dragHdl], new DragManager.DocumentDragData([doc], doc.dropAction as dropActionType), e.clientX, e.clientY), returnFalse, emptyFunction); - }; + // select the tab document when the tab is directly clicked and activate the tab whenver the tab document is selected titleEle.onpointerdown = action((e: any) => { - if (e.target.className !== "lm_close_tab") { + if (e.target.className !== "lm_iconWrap") { if (this.view) SelectionManager.SelectView(this.view, false); else this._activated = true; if (Date.now() - titleEle.lastClick < 1000) titleEle.select(); @@ -123,25 +164,30 @@ export class TabDocView extends React.Component<TabDocViewProps> { const toggle = tab.element[0].children[1].children[0] as HTMLInputElement; selected && tab.contentItem !== tab.header.parent.getActiveContentItem() && UndoManager.RunInBatch(() => tab.header.parent.setActiveContentItem(tab.contentItem), "tab switch"); - toggle.style.fontWeight = selected ? "bold" : ""; - toggle.style.textTransform = selected ? "uppercase" : ""; + // toggle.style.fontWeight = selected ? "bold" : ""; + // toggle.style.textTransform = selected ? "uppercase" : ""; })); //attach the selection doc buttons menu to the drag handle - const stack = tab.contentItem.parent; - const dragHdl = document.createElement("div"); - dragHdl.className = "lm_drag_tab"; + const stack: HTMLDivElement = tab.contentItem.parent; + const header: HTMLDivElement = tab; + console.log("Stack: " + stack.id, stack.className) + stack.onscroll = action((e: any) => { + console.log('scrolling...') + }) + const moreInfoDrag = document.createElement("div"); + moreInfoDrag.className = "lm_iconWrap"; tab._disposers.buttonDisposer = reaction(() => this.view, view => - view && [ReactDOM.render(<span className="tabDocView-drag" onPointerDown={dragBtnDown}><CollectionDockingViewMenu views={() => [view]} Stack={stack} /></span>, dragHdl), tab._disposers.buttonDisposer?.()], + view && [ReactDOM.render(<span><CollectionDockingViewMenu views={() => [view]} Stack={stack} /></span>, moreInfoDrag), tab._disposers.buttonDisposer?.()], { fireImmediately: true }); - tab.reactComponents = [dragHdl]; - tab.closeElement.before(dragHdl); + // tab.reactComponents = [moreInfoDrag]; + // tab.element[0].children[3].before(moreInfoDrag); // highlight the tab when the tab document is brushed in any part of the UI tab._disposers.reactionDisposer = reaction(() => ({ title: doc.title, degree: Doc.IsBrushedDegree(doc) }), ({ title, degree }) => { titleEle.value = title; - titleEle.style.padding = degree ? 0 : 2; - titleEle.style.border = `${["gray", "gray", "gray"][degree]} ${["none", "dashed", "solid"][degree]} 2px`; + // titleEle.style.padding = degree ? 0 : 2; + // titleEle.style.border = `${["gray", "gray", "gray"][degree]} ${["none", "dashed", "solid"][degree]} 2px`; }, { fireImmediately: true }); // clean up the tab when it is closed @@ -221,9 +267,9 @@ export class TabDocView extends React.Component<TabDocViewProps> { })).observe(this.props.glContainer._element[0]); this.props.glContainer.layoutManager.on("activeContentItemChanged", this.onActiveContentItemChanged); this.props.glContainer.tab?.isActive && this.onActiveContentItemChanged(undefined); - this._tabReaction = reaction(() => ({ selected: this.active(), title: this.tab?.titleElement[0] }), - ({ selected, title }) => title && (title.style.backgroundColor = selected ? "white" : ""), - { fireImmediately: true }); + // this._tabReaction = reaction(() => ({ selected: this.active(), title: this.tab?.titleElement[0] }), + // ({ selected, title }) => title && (title.style.backgroundColor = selected ? "white" : ""), + // { fireImmediately: true }); } componentWillUnmount() { @@ -243,10 +289,10 @@ export class TabDocView extends React.Component<TabDocViewProps> { } // adds a tab to the layout based on the locaiton parameter which can be: - // close[:{left,right,top,bottom}] - e.g., "close" will close the tab, "close:left" will close the left tab, + // close[:{left,right,top,bottom}] - e.g., "close" will close the tab, "close:left" will close the left tab, // add[:{left,right,top,bottom}] - e.g., "add" will add a tab to the current stack, "add:right" will add a tab on the right - // replace[:{left,right,top,bottom,<any string>}] - e.g., "replace" will replace the current stack contents, - // "replace:right" - will replace the stack on the right named "right" if it exists, or create a stack on the right with that name, + // replace[:{left,right,top,bottom,<any string>}] - e.g., "replace" will replace the current stack contents, + // "replace:right" - will replace the stack on the right named "right" if it exists, or create a stack on the right with that name, // "replace:monkeys" - will replace any tab that has the label 'monkeys', or a tab with that label will be created by default on the right // inPlace - will add the document to any collection along the path from the document to the docking view that has a field isInPlaceContainer. if none is found, inPlace adds a tab to current stack addDocTab = (doc: Doc, location: string) => { @@ -460,4 +506,4 @@ export class TabMinimapView extends React.Component<TabMinimapViewProps> { </div> </div>; } -}
\ No newline at end of file +} diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx index a4e310e6c..143d8e070 100644 --- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx +++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx @@ -38,7 +38,7 @@ import { CollectionFreeFormDocumentView } from "../../nodes/CollectionFreeFormDo import { DocFocusOptions, DocumentView, DocumentViewProps, ViewAdjustment, ViewSpecPrefix } from "../../nodes/DocumentView"; import { FormattedTextBox } from "../../nodes/formattedText/FormattedTextBox"; import { pageSchema } from "../../nodes/ImageBox"; -import { PresBox } from "../../nodes/PresBox"; +import { PresBox } from "../../nodes/trails/PresBox"; import { StyleLayers, StyleProp } from "../../StyleProvider"; import { CollectionDockingView } from "../CollectionDockingView"; import { CollectionSubView } from "../CollectionSubView"; @@ -48,6 +48,7 @@ import { CollectionFreeFormRemoteCursors } from "./CollectionFreeFormRemoteCurso import "./CollectionFreeFormView.scss"; import { MarqueeView } from "./MarqueeView"; import React = require("react"); +import { DocumentType } from "../../../documents/DocumentTypes"; export const panZoomSchema = createSchema({ _panX: "number", @@ -834,10 +835,10 @@ export class CollectionFreeFormView extends CollectionSubView<PanZoomDocument, P map(doc => ({ ...this.childDataProvider(doc, ""), ...this.childSizeProvider(doc, "") })); if (measuredDocs.length) { const ranges = measuredDocs.reduce(({ xrange, yrange }, { x, y, width, height }) => // computes range of content - ({ - xrange: { min: Math.min(xrange.min, x), max: Math.max(xrange.max, x + width) }, - yrange: { min: Math.min(yrange.min, y), max: Math.max(yrange.max, y + height) } - }) + ({ + xrange: { min: Math.min(xrange.min, x), max: Math.max(xrange.max, x + width) }, + yrange: { min: Math.min(yrange.min, y), max: Math.max(yrange.max, y + height) } + }) , { xrange: { min: Number.MAX_VALUE, max: -Number.MAX_VALUE }, yrange: { min: Number.MAX_VALUE, max: -Number.MAX_VALUE } @@ -1486,7 +1487,8 @@ export class CollectionFreeFormView extends CollectionSubView<PanZoomDocument, P onDragOver={e => e.preventDefault()} onContextMenu={this.onContextMenu} style={{ - pointerEvents: this.backgroundEvents ? "all" : this.props.pointerEvents as any, + pointerEvents: this.props.Document.type === DocumentType.MARKER ? "none" : // bcz: ugh.. this is here to prevent markers, which render as freeform views, from grabbing events -- need a better approach. + this.backgroundEvents ? "all" : this.props.pointerEvents as any, transform: `scale(${this.contentScaling || 1})`, width: `${100 / (this.contentScaling || 1)}%`, height: this.isAnnotationOverlay && this.Document.scrollHeight ? this.Document.scrollHeight : `${100 / (this.contentScaling || 1)}%`// : this.isAnnotationOverlay ? (this.Document.scrollHeight ? this.Document.scrollHeight : "100%") : this.props.PanelHeight() diff --git a/src/client/views/collections/collectionFreeForm/MarqueeView.tsx b/src/client/views/collections/collectionFreeForm/MarqueeView.tsx index b1f2750c3..846d28214 100644 --- a/src/client/views/collections/collectionFreeForm/MarqueeView.tsx +++ b/src/client/views/collections/collectionFreeForm/MarqueeView.tsx @@ -19,7 +19,8 @@ import { Transform } from "../../../util/Transform"; import { undoBatch, UndoManager } from "../../../util/UndoManager"; import { ContextMenu } from "../../ContextMenu"; import { FormattedTextBox } from "../../nodes/formattedText/FormattedTextBox"; -import { PresBox, PresMovement } from "../../nodes/PresBox"; +import { PresBox } from "../../nodes/trails/PresBox"; +import { PresMovement } from "../../nodes/trails/PresEnums"; import { PreviewCursor } from "../../PreviewCursor"; import { CollectionDockingView } from "../CollectionDockingView"; import { SubCollectionViewProps } from "../CollectionSubView"; @@ -368,8 +369,8 @@ export class MarqueeView extends React.Component<SubCollectionViewProps & Marque SelectionManager.DeselectAll(); selected.forEach(d => this.props.removeDocument?.(d)); const newCollection = DocUtils.pileup(selected, this.Bounds.left + this.Bounds.width / 2, this.Bounds.top + this.Bounds.height / 2); - this.props.addDocument?.(newCollection!); - this.props.selectDocuments([newCollection!]); + this.props.addDocument?.(newCollection); + this.props.selectDocuments([newCollection]); MarqueeOptionsMenu.Instance.fadeOut(true); this.hideMarquee(); } diff --git a/src/client/views/collections/collectionSchema/CollectionSchemaCells.tsx b/src/client/views/collections/collectionSchema/CollectionSchemaCells.tsx index 90f64f163..fd99abce5 100644 --- a/src/client/views/collections/collectionSchema/CollectionSchemaCells.tsx +++ b/src/client/views/collections/collectionSchema/CollectionSchemaCells.tsx @@ -103,6 +103,7 @@ export class CollectionSchemaCell extends React.Component<CellProps> { this.props.changeFocusedCellByIndex(this.props.row, this.props.col); this.props.setPreviewDoc(this.props.rowProps.original); + console.log("click cell"); let url: string; if (url = StrCast(this.props.rowProps.row.href)) { try { @@ -246,13 +247,13 @@ export class CollectionSchemaCell extends React.Component<CellProps> { } else { // check if the input is a number let inputIsNum = true; - for (let s of value) { - if (isNaN(parseInt(s)) && !(s == ".") && !(s == ",")) { + for (const s of value) { + if (isNaN(parseInt(s)) && !(s === ".") && !(s === ",")) { inputIsNum = false; } } // check if the input is a boolean - let inputIsBool: boolean = value == "false" || value == "true"; + const inputIsBool: boolean = value === "false" || value === "true"; // what to do in the case if (!inputIsNum && !inputIsBool && !value.startsWith("=")) { // if it's not a number, it's a string, and should be processed as such @@ -263,12 +264,12 @@ export class CollectionSchemaCell extends React.Component<CellProps> { const vsqLength = valueSansQuotes.length; // get rid of outer quotes valueSansQuotes = valueSansQuotes.substring(value.startsWith("\"") ? 1 : 0, - valueSansQuotes.charAt(vsqLength - 1) == "\"" ? vsqLength - 1 : vsqLength); + valueSansQuotes.charAt(vsqLength - 1) === "\"" ? vsqLength - 1 : vsqLength); } let inputAsString = '"'; // escape any quotes in the string for (const i of valueSansQuotes) { - if (i == '"') { + if (i === '"') { inputAsString += '\\"'; } else { inputAsString += i; @@ -278,7 +279,7 @@ export class CollectionSchemaCell extends React.Component<CellProps> { inputAsString += '"'; //two options here: we can strip off outer quotes or we can figure out what's going on with the script const script = CompileScript(inputAsString, { requiredType: type, typecheck: false, editable: true, addReturn: true, params: { this: Doc.name, $r: "number", $c: "number", $: "any" } }); - const changeMade = inputAsString.length !== value.length || inputAsString.length - 2 !== value.length + const changeMade = inputAsString.length !== value.length || inputAsString.length - 2 !== value.length; script.compiled && (retVal = this.applyToDoc(changeMade ? this._rowDoc : this._rowDataDoc, this.props.row, this.props.col, script.run)); // handle numbers and expressions } else if (inputIsNum || value.startsWith("=")) { @@ -286,18 +287,18 @@ export class CollectionSchemaCell extends React.Component<CellProps> { const inputscript = value.substring(value.startsWith("=") ? 1 : 0); // if commas are not stripped, the parser only considers the numbers after the last comma let inputSansCommas = ""; - for (let s of inputscript) { - if (!(s == ",")) { + for (const s of inputscript) { + if (!(s === ",")) { inputSansCommas += s; } } const script = CompileScript(inputSansCommas, { requiredType: type, typecheck: false, editable: true, addReturn: true, params: { this: Doc.name, $r: "number", $c: "number", $: "any" } }); - const changeMade = value.length !== value.length || value.length - 2 !== value.length + const changeMade = value.length !== value.length || value.length - 2 !== value.length; script.compiled && (retVal = this.applyToDoc(changeMade ? this._rowDoc : this._rowDataDoc, this.props.row, this.props.col, script.run)); // handle booleans } else if (inputIsBool) { const script = CompileScript(value, { requiredType: type, typecheck: false, editable: true, addReturn: true, params: { this: Doc.name, $r: "number", $c: "number", $: "any" } }); - const changeMade = value.length !== value.length || value.length - 2 !== value.length + const changeMade = value.length !== value.length || value.length - 2 !== value.length; script.compiled && (retVal = this.applyToDoc(changeMade ? this._rowDoc : this._rowDataDoc, this.props.row, this.props.col, script.run)); } } diff --git a/src/client/views/global/globalCssVariables.scss b/src/client/views/global/globalCssVariables.scss index ead5e166e..a9f33c4da 100644 --- a/src/client/views/global/globalCssVariables.scss +++ b/src/client/views/global/globalCssVariables.scss @@ -11,6 +11,8 @@ $medium-blue: #4476F7; $pink: #E0217D; $yellow: #F5D747; +$logout-red: #ca4444; + $drop-shadow: "#32323215"; //padding @@ -21,8 +23,6 @@ $large-padding: 32px; //icon sizes $icon-size: 28px; -$antimodemenu-height: 36px; - // fonts $sans-serif: "Noto Sans", sans-serif; $large-header: 16px; @@ -33,11 +33,16 @@ $small-text: 9px; // misc values $border-radius: 0.3em; $search-thumnail-size: 130; +$topbar-height: 32px; +$antimodemenu-height: 36px; // dragged items $contextMenu-zindex: 100000; // context menu shows up over everything $radialMenu-zindex: 100000; // context menu shows up over everything +// borders +$standard-border: solid 1px #9F9F9F; + $searchpanel-height: 32px; $mainTextInput-zindex: 999; // then text input overlay so that it's context menu will appear over decorations, etc $docDecorations-zindex: 998; // then doc decorations appear over everything else diff --git a/src/client/views/global/globalEnums.tsx b/src/client/views/global/globalEnums.tsx index 1e0381c33..2aeb8e338 100644 --- a/src/client/views/global/globalEnums.tsx +++ b/src/client/views/global/globalEnums.tsx @@ -31,4 +31,8 @@ export enum Padding { export enum IconSizes { ICON_SIZE = "28px", +} + +export enum Borders { + STANDARD = "solid 1px #9F9F9F" }
\ No newline at end of file diff --git a/src/client/views/linking/LinkEditor.scss b/src/client/views/linking/LinkEditor.scss index 839ebf894..e45a91d57 100644 --- a/src/client/views/linking/LinkEditor.scss +++ b/src/client/views/linking/LinkEditor.scss @@ -22,7 +22,7 @@ .linkEditor-info { //border-bottom: 0.5px solid $light-gray; //padding-bottom: 1px; - padding-top: 5px; + padding: 12px; padding-left: 5px; //margin-bottom: 6px; display: flex; @@ -61,7 +61,7 @@ } .linkEditor-description { - padding-left: 6.5px; + padding-left: 26px; padding-right: 6.5px; padding-bottom: 3.5px; @@ -107,9 +107,9 @@ } .linkEditor-followingDropdown { - padding-left: 6.5px; + padding-left: 26px; padding-right: 6.5px; - padding-bottom: 6px; + padding-bottom: 15px; &:hover { cursor: pointer; diff --git a/src/client/views/linking/LinkMenu.scss b/src/client/views/linking/LinkMenu.scss index a2ea42999..19c6463d3 100644 --- a/src/client/views/linking/LinkMenu.scss +++ b/src/client/views/linking/LinkMenu.scss @@ -7,20 +7,19 @@ z-index: 2001; .linkMenu-list, - .linkMenu-listEditor - { + .linkMenu-listEditor { display: inline-block; position: relative; - border: 1px solid black; - box-shadow: 3px 3px 1.5px grey; + border: 1px solid #e4e4e4; + box-shadow: 0 10px 20px rgba(0, 0, 0, 0.19), 0 6px 6px rgba(0, 0, 0, 0.23); background: white; - min-width: 170px; - max-height: 170px; + max-height: 230px; overflow-y: scroll; z-index: 10; - } - .linkMenu-list { + } + + .linkMenu-list { white-space: nowrap; overflow-x: hidden; width: 240px; @@ -46,13 +45,13 @@ } .linkMenu-group-name { + padding: 10px; &:hover { - p { - background-color: lightgray; - - } + // p { + // background-color: lightgray; + // } p.expand-one { width: calc(100% + 20px); @@ -65,10 +64,9 @@ p { width: 100%; - //padding: 4px 6px; line-height: 12px; border-radius: 5px; - font-weight: bold; + text-transform: capitalize; } .linkEditor-tableButton { diff --git a/src/client/views/linking/LinkMenu.tsx b/src/client/views/linking/LinkMenu.tsx index c7888c5ee..6fc860447 100644 --- a/src/client/views/linking/LinkMenu.tsx +++ b/src/client/views/linking/LinkMenu.tsx @@ -15,6 +15,9 @@ interface Props { changeFlyout: () => void; } +/** + * the outermost component for the link menu of a node that contains a list of its linked nodes + */ @observer export class LinkMenu extends React.Component<Props> { private _editorRef = React.createRef<HTMLDivElement>(); @@ -36,6 +39,11 @@ export class LinkMenu extends React.Component<Props> { } } + /** + * maps each link to a JSX element to be rendered + * @param groups LinkManager containing info of all of the links + * @returns list of link JSX elements if there at least one linked element + */ renderAllGroups = (groups: Map<string, Array<Doc>>): Array<JSX.Element> => { const linkItems = Array.from(groups.entries()).map(group => <LinkMenuGroup diff --git a/src/client/views/linking/LinkMenuGroup.tsx b/src/client/views/linking/LinkMenuGroup.tsx index 74af78234..c7586a467 100644 --- a/src/client/views/linking/LinkMenuGroup.tsx +++ b/src/client/views/linking/LinkMenuGroup.tsx @@ -40,7 +40,7 @@ export class LinkMenuGroup extends React.Component<LinkMenuGroupProps> { return ( <div className="linkMenu-group" ref={this._menuRef}> <div className="linkMenu-group-name"> - <p className={this.props.groupType === "*" || this.props.groupType === "" ? "" : "expand-one"} > {this.props.groupType}:</p> + <p className={this.props.groupType === "*" || this.props.groupType === "" ? "" : "expand-one"}> {this.props.groupType}:</p> </div> <div className="linkMenu-group-wrapper"> {groupItems} diff --git a/src/client/views/linking/LinkMenuItem.scss b/src/client/views/linking/LinkMenuItem.scss index 4f9881565..90722daf9 100644 --- a/src/client/views/linking/LinkMenuItem.scss +++ b/src/client/views/linking/LinkMenuItem.scss @@ -4,7 +4,7 @@ // border-top: 0.5px solid $medium-gray; position: relative; display: flex; - border-bottom: 0.5px solid black; + border-top: 0.5px solid #cdcdcd; padding-left: 6.5px; padding-right: 2px; @@ -55,8 +55,8 @@ .linkMenu-destination-title { text-decoration: none; - color: rgb(85, 120, 196); - font-size: 14px; + color: #4476F7; + font-size: 16px; padding-bottom: 2px; padding-right: 4px; margin-right: 4px; @@ -76,7 +76,7 @@ text-decoration: none; font-style: italic; color: rgb(95, 97, 102); - font-size: 10px; + font-size: 9px; margin-left: 20px; max-width: 125px; height: auto; diff --git a/src/client/views/linking/LinkPopup.scss b/src/client/views/linking/LinkPopup.scss new file mode 100644 index 000000000..8ae65158d --- /dev/null +++ b/src/client/views/linking/LinkPopup.scss @@ -0,0 +1,45 @@ +.linkPopup-container { + background: white; + box-shadow: 0 10px 20px rgba(0, 0, 0, 0.19), 0 6px 6px rgba(0, 0, 0, 0.23); + top: 35px; + height: 200px; + width: 200px; + position: absolute; + padding: 15px; + border-radius: 3px; + + input { + border: 1px solid #b9b9b9; + border-radius: 20px; + height: 25px; + width: 100%; + padding-left: 10px; + } + + .divider { + margin: 10px 0; + height: 20px; + width: 100%; + + .line { + height: 1px; + background-color: #b9b9b9; + width: 100%; + position: relative; + top: 12px; + } + + .divider-text { + width: 20px; + background-color: white; + text-align: center; + position: relative; + margin: auto; + } + } + + + .searchBox-container { + background: pink; + } +}
\ No newline at end of file diff --git a/src/client/views/linking/LinkPopup.tsx b/src/client/views/linking/LinkPopup.tsx new file mode 100644 index 000000000..2c4b718f4 --- /dev/null +++ b/src/client/views/linking/LinkPopup.tsx @@ -0,0 +1,114 @@ +import { IconProp } from '@fortawesome/fontawesome-svg-core'; +import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'; +import { Tooltip } from '@material-ui/core'; +import { action, observable, runInAction } from 'mobx'; +import { observer } from "mobx-react"; +import { Doc, DocListCast } from '../../../fields/Doc'; +import { Cast, StrCast } from '../../../fields/Types'; +import { WebField } from '../../../fields/URLField'; +import { emptyFunction, setupMoveUpEvents, returnFalse, returnTrue, returnEmptyDoclist, returnEmptyFilter } from '../../../Utils'; +import { DocumentType } from '../../documents/DocumentTypes'; +import { DocumentManager } from '../../util/DocumentManager'; +import { DragManager } from '../../util/DragManager'; +import { Hypothesis } from '../../util/HypothesisUtils'; +import { LinkManager } from '../../util/LinkManager'; +import { undoBatch } from '../../util/UndoManager'; +import { DocumentLinksButton } from '../nodes/DocumentLinksButton'; +import { DocumentView, DocumentViewSharedProps } from '../nodes/DocumentView'; +import { LinkDocPreview } from '../nodes/LinkDocPreview'; +import './LinkPopup.scss'; +import React = require("react"); +import { CurrentUserUtils } from '../../util/CurrentUserUtils'; +import { DefaultStyleProvider } from '../StyleProvider'; +import { Transform } from '../../util/Transform'; +import { DocUtils } from '../../documents/Documents'; +import { SearchBox } from '../search/SearchBox'; +import { EditorView } from 'prosemirror-view'; +import { FormattedTextBox } from '../nodes/formattedText/FormattedTextBox'; + +interface LinkPopupProps { + showPopup: boolean; + // groupType: string; + // linkDoc: Doc; + // docView: DocumentView; + // sourceDoc: Doc; +} + +/** + * Popup component for creating links from text to Dash documents + */ + +@observer +export class LinkPopup extends React.Component<LinkPopupProps> { + @observable private linkURL: string = ""; + @observable public view?: EditorView; + + + + // TODO: should check for valid URL + @undoBatch + makeLinkToURL = (target: string, lcoation: string) => { + ((this.view as any)?.TextView as FormattedTextBox).makeLinkAnchor(undefined, "onRadd:rightight", target, target); + } + + @action + onLinkChange = (e: React.ChangeEvent<HTMLInputElement>) => { + this.linkURL = e.target.value; + console.log(this.linkURL) + } + + + getPWidth = () => 500; + getPHeight = () => 500; + + render() { + const popupVisibility = this.props.showPopup ? "block" : "none"; + return ( + <div className="linkPopup-container" style={{ display: popupVisibility }}> + <div className="linkPopup-url-container"> + <input autoComplete="off" type="text" value={this.linkURL} placeholder="Enter URL..." onChange={this.onLinkChange} /> + <button onPointerDown={e => this.makeLinkToURL(this.linkURL, "add:right")} + style={{ display: "block", margin: "10px auto", }}>Apply hyperlink</button> + </div> + <div className="divider"> + <div className="line"></div> + <p className="divider-text">or</p> + </div> + <div className="linkPopup-document-search-container"> + {/* <i></i> + <input defaultValue={""} autoComplete="off" type="text" placeholder="Search for Document..." id="search-input" + className="linkPopup-searchBox searchBox-input" /> */} + + <SearchBox Document={CurrentUserUtils.MySearchPanelDoc} + DataDoc={CurrentUserUtils.MySearchPanelDoc} + fieldKey="data" + dropAction="move" + isSelected={returnTrue} + isContentActive={returnTrue} + select={returnTrue} + setHeight={returnFalse} + addDocument={undefined} + addDocTab={returnTrue} + pinToPres={emptyFunction} + rootSelected={returnTrue} + styleProvider={DefaultStyleProvider} + layerProvider={undefined} + removeDocument={undefined} + ScreenToLocalTransform={Transform.Identity} + PanelWidth={this.getPWidth} + PanelHeight={this.getPHeight} + renderDepth={0} + focus={DocUtils.DefaultFocus} + docViewPath={returnEmptyDoclist} + whenChildContentsActiveChanged={emptyFunction} + bringToFront={emptyFunction} + docFilters={returnEmptyFilter} + docRangeFilters={returnEmptyFilter} + searchFilterDocs={returnEmptyDoclist} + ContainingCollectionView={undefined} + ContainingCollectionDoc={undefined} /> + </div> + </div> + ); + } +}
\ No newline at end of file diff --git a/src/client/views/nodes/DocumentContentsView.tsx b/src/client/views/nodes/DocumentContentsView.tsx index 9b75cd8f9..3d2cdf5a4 100644 --- a/src/client/views/nodes/DocumentContentsView.tsx +++ b/src/client/views/nodes/DocumentContentsView.tsx @@ -11,7 +11,7 @@ import { CollectionFreeFormView } from "../collections/collectionFreeForm/Collec import { CollectionSchemaView } from "../collections/collectionSchema/CollectionSchemaView"; import { CollectionView } from "../collections/CollectionView"; import { InkingStroke } from "../InkingStroke"; -import { PresElementBox } from "../presentationview/PresElementBox"; +import { PresElementBox } from "../nodes/trails/PresElementBox"; import { SearchBox } from "../search/SearchBox"; import { DashWebRTCVideo } from "../webcam/DashWebRTCVideo"; import { YoutubeBox } from "./../../apis/youtube/YoutubeBox"; @@ -32,7 +32,7 @@ import { LabelBox } from "./LabelBox"; import { LinkAnchorBox } from "./LinkAnchorBox"; import { LinkBox } from "./LinkBox"; import { PDFBox } from "./PDFBox"; -import { PresBox } from "./PresBox"; +import { PresBox } from "./trails/PresBox"; import { ScreenshotBox } from "./ScreenshotBox"; import { ScriptingBox } from "./ScriptingBox"; import { SliderBox } from "./SliderBox"; diff --git a/src/client/views/nodes/DocumentLinksButton.scss b/src/client/views/nodes/DocumentLinksButton.scss index daffaf9e7..9bab72d55 100644 --- a/src/client/views/nodes/DocumentLinksButton.scss +++ b/src/client/views/nodes/DocumentLinksButton.scss @@ -1,16 +1,27 @@ @import "../global/globalCssVariables.scss"; +.documentLinksButton-menu { + width: 100%; + height: 100%; + position: relative; + display: flex; + align-content: center; + justify-content: center; + align-items: center; +} + .documentLinksButton-cont { min-width: 20; min-height: 20; position: absolute; } + .documentLinksButton, .documentLinksButton-endLink, .documentLinksButton-startLink { - height: 20px; - width: 20px; + height: 25px; + width: 25px; position: absolute; border-radius: 50%; opacity: 0.9; @@ -37,23 +48,21 @@ font-weight: bold; &:hover { - background: $medium-gray; transform: scale(1.05); cursor: pointer; } } .documentLinksButton-endLink { - border: red solid 2px; - + border: $medium-blue 2px dashed; + color: $medium-blue; &:hover { - background: deepskyblue; + background: $light-gray; transform: scale(1.05); cursor: pointer; } } .documentLinksButton-startLink { - border: red solid 2px; - background-color: rgba(255, 192, 203, 0.5); + background-color: $medium-blue; }
\ No newline at end of file diff --git a/src/client/views/nodes/DocumentLinksButton.tsx b/src/client/views/nodes/DocumentLinksButton.tsx index a6d07374a..cec06d2d4 100644 --- a/src/client/views/nodes/DocumentLinksButton.tsx +++ b/src/client/views/nodes/DocumentLinksButton.tsx @@ -20,6 +20,7 @@ import './DocumentLinksButton.scss'; import { DocServer } from "../../DocServer"; import { LightboxView } from "../LightboxView"; import { cat } from "shelljs"; +import { Colors } from "../global/globalEnums"; const higflyout = require("@hig/flyout"); export const { anchorPoints } = higflyout; @@ -30,12 +31,12 @@ interface DocumentLinksButtonProps { Offset?: (number | undefined)[]; AlwaysOn?: boolean; InMenu?: boolean; - StartLink?: boolean; + StartLink?: boolean; //whether the link HAS been started (i.e. now needs to be completed) } @observer export class DocumentLinksButton extends React.Component<DocumentLinksButtonProps, {}> { private _linkButton = React.createRef<HTMLDivElement>(); - @observable public static StartLink: Doc | undefined; + @observable public static StartLink: Doc | undefined; //origin's Doc, if defined @observable public static StartLinkView: DocumentView | undefined; @observable public static AnnotationId: string | undefined; @observable public static AnnotationUri: string | undefined; @@ -45,6 +46,7 @@ export class DocumentLinksButton extends React.Component<DocumentLinksButtonProp public static invisibleWebRef = React.createRef<HTMLDivElement>(); @action public static ClearLinkEditor() { DocumentLinksButton.LinkEditorDocView = undefined; } + @action @undoBatch onLinkButtonMoved = (e: PointerEvent) => { if (this.props.InMenu && this.props.StartLink) { @@ -120,7 +122,7 @@ export class DocumentLinksButton extends React.Component<DocumentLinksButtonProp if (DocumentLinksButton.StartLink === this.props.View.props.Document) { DocumentLinksButton.StartLink = undefined; DocumentLinksButton.StartLinkView = undefined; - } else { + } else { //if this LinkButton's Document is undefined DocumentLinksButton.StartLink = this.props.View.props.Document; DocumentLinksButton.StartLinkView = this.props.View; } @@ -131,6 +133,7 @@ export class DocumentLinksButton extends React.Component<DocumentLinksButtonProp } } + completeLink = (e: React.PointerEvent): void => { setupMoveUpEvents(this, e, returnFalse, emptyFunction, undoBatch(action((e, doubleTap) => { if (doubleTap && !this.props.StartLink) { @@ -141,7 +144,7 @@ export class DocumentLinksButton extends React.Component<DocumentLinksButtonProp } else if (DocumentLinksButton.StartLink && DocumentLinksButton.StartLink !== this.props.View.props.Document) { const sourceDoc = DocumentLinksButton.StartLink; const targetDoc = this.props.View.ComponentView?.getAnchor?.() || this.props.View.Document; - const linkDoc = DocUtils.MakeLink({ doc: sourceDoc }, { doc: targetDoc }, "long drag"); + const linkDoc = DocUtils.MakeLink({ doc: sourceDoc }, { doc: targetDoc }, "links"); //why is long drag here when this is used for completing links by clicking? LinkManager.currentLink = linkDoc; @@ -184,7 +187,7 @@ export class DocumentLinksButton extends React.Component<DocumentLinksButtonProp } else if (startLink !== endLink) { endLink = endLinkView?.docView?._componentView?.getAnchor?.() || endLink; startLink = DocumentLinksButton.StartLinkView?.docView?._componentView?.getAnchor?.() || startLink; - const linkDoc = DocUtils.MakeLink({ doc: startLink }, { doc: endLink }, DocumentLinksButton.AnnotationId ? "hypothes.is annotation" : "long drag", undefined, undefined, true); + const linkDoc = DocUtils.MakeLink({ doc: startLink }, { doc: endLink }, DocumentLinksButton.AnnotationId ? "hypothes.is annotation" : "link", undefined, undefined, true); LinkManager.currentLink = linkDoc; @@ -242,45 +245,57 @@ export class DocumentLinksButton extends React.Component<DocumentLinksButtonProp return results; } + /** + * gets the JSX of the link button (btn used to start/complete links) OR the link-view button (btn on bottom left of each linked node) + */ @computed get linkButtonInner() { const btnDim = this.props.InMenu ? "20px" : "30px"; const link = <img style={{ width: "22px", height: "16px" }} src={`/assets/${"link.png"}`} />; - return <div className="documentLinksButton-cont" ref={this._linkButton} - style={{ left: this.props.Offset?.[0], top: this.props.Offset?.[1], right: this.props.Offset?.[2], bottom: this.props.Offset?.[3] }} - > - <div className={"documentLinksButton"} - onPointerDown={this.onLinkButtonDown} onClick={this.onLinkClick} - style={{ - backgroundColor: this.props.InMenu ? "" : "#add8e6", - color: this.props.InMenu ? "white" : "black", - width: btnDim, - height: btnDim, - }} > - {this.props.InMenu ? - this.props.StartLink ? - <FontAwesomeIcon className="documentdecorations-icon" icon="link" size="sm" /> - : link - : Array.from(this.filteredLinks).length} - </div> - {this.props.InMenu && !this.props.StartLink && DocumentLinksButton.StartLink !== this.props.View.props.Document ? - <div className={"documentLinksButton-endLink"} + return (!this.props.InMenu ? + <div className="documentLinksButton-cont" ref={this._linkButton} + style={{ left: this.props.Offset?.[0], top: this.props.Offset?.[1], right: this.props.Offset?.[2], bottom: this.props.Offset?.[3] }} + > + <div className={"documentLinksButton"} + onPointerDown={this.onLinkButtonDown} onClick={this.onLinkClick} style={{ - width: btnDim, height: btnDim, - backgroundColor: DocumentLinksButton.StartLink ? "" : "grey", - opacity: DocumentLinksButton.StartLink ? "" : "50%", - border: DocumentLinksButton.StartLink ? "" : "none", - cursor: DocumentLinksButton.StartLink ? "pointer" : "default" - }} - onPointerDown={DocumentLinksButton.StartLink && this.completeLink} - onClick={e => DocumentLinksButton.StartLink && DocumentLinksButton.finishLinkClick(e.clientX, e.clientY, DocumentLinksButton.StartLink, this.props.View.props.Document, true, this.props.View)} /> - : (null) - } - {DocumentLinksButton.StartLink === this.props.View.props.Document && this.props.InMenu && this.props.StartLink ? - <div className={"documentLinksButton-startLink"} onPointerDown={this.clearLinks} onClick={this.clearLinks} style={{ width: btnDim, height: btnDim }} /> - : (null) - } - </div >; + backgroundColor: Colors.LIGHT_BLUE, + color: Colors.BLACK, + width: btnDim, + height: btnDim, + }}> + {Array.from(this.filteredLinks).length} + </div> + </div> + : + <div className="documentLinksButton-menu"> + {this.props.InMenu && !this.props.StartLink && DocumentLinksButton.StartLink !== this.props.View.props.Document ? //if the origin node is not this node + <div className={"documentLinksButton-endLink"} + style={{ + width: btnDim, height: btnDim, + backgroundColor: DocumentLinksButton.StartLink ? "" : Colors.LIGHT_GRAY, + opacity: DocumentLinksButton.StartLink ? "" : "50%", + border: DocumentLinksButton.StartLink ? "" : "none", + cursor: DocumentLinksButton.StartLink ? "pointer" : "default" + }} + onPointerDown={DocumentLinksButton.StartLink && this.completeLink} + onClick={e => DocumentLinksButton.StartLink && DocumentLinksButton.finishLinkClick(e.clientX, e.clientY, DocumentLinksButton.StartLink, this.props.View.props.Document, true, this.props.View)}> + {this.props.StartLink ? + <FontAwesomeIcon className="documentdecorations-icon" icon="link" size="sm" /> + : link} + </div> + : (null) + } + { + this.props.InMenu ? //if link has been started from current node, then set behavior of link button to deactivate linking when clicked again + <div className={'documentLinksButton' + (DocumentLinksButton.StartLink === this.props.View.props.Document && this.props.StartLink) ? '-startLink' : ''} onPointerDown={this.clearLinks} onClick={this.clearLinks} style={{ width: btnDim, height: btnDim }}> + {this.props.StartLink ? + <FontAwesomeIcon className="documentdecorations-icon" icon="link" size="sm" /> + : link} + </div> + : (null)} + </div> + ) } render() { @@ -290,6 +305,7 @@ export class DocumentLinksButton extends React.Component<DocumentLinksButtonProp const buttonTitle = "Tap to view links; double tap to open link collection"; const title = this.props.InMenu ? menuTitle : buttonTitle; + //render circular tooltip if it isn't set to invisible and show the number of doc links the node has, and render inner-menu link button for starting/stopping links if currently in menu return !Array.from(this.filteredLinks).length && !this.props.AlwaysOn ? (null) : this.props.InMenu && (DocumentLinksButton.StartLink || this.props.StartLink) ? <Tooltip title={<div className="dash-tooltip">{title}</div>}> diff --git a/src/client/views/nodes/DocumentView.scss b/src/client/views/nodes/DocumentView.scss index 8f86417d6..7f164ca48 100644 --- a/src/client/views/nodes/DocumentView.scss +++ b/src/client/views/nodes/DocumentView.scss @@ -147,7 +147,7 @@ .documentView-titleWrapper, .documentView-titleWrapper-hover { overflow: hidden; - color: white; + color: $black; transform-origin: top left; top: 0; width: 100%; diff --git a/src/client/views/nodes/DocumentView.tsx b/src/client/views/nodes/DocumentView.tsx index 60fa462ad..80a014926 100644 --- a/src/client/views/nodes/DocumentView.tsx +++ b/src/client/views/nodes/DocumentView.tsx @@ -43,7 +43,7 @@ import { DocumentLinksButton } from './DocumentLinksButton'; import "./DocumentView.scss"; import { LinkAnchorBox } from './LinkAnchorBox'; import { LinkDocPreview } from "./LinkDocPreview"; -import { PresBox } from './PresBox'; +import { PresBox } from './trails/PresBox'; import { RadialMenu } from './RadialMenu'; import React = require("react"); import { ScriptingBox } from "./ScriptingBox"; diff --git a/src/client/views/nodes/FontIconBox.tsx b/src/client/views/nodes/FontIconBox.tsx index 6ae4b9726..0d415e238 100644 --- a/src/client/views/nodes/FontIconBox.tsx +++ b/src/client/views/nodes/FontIconBox.tsx @@ -14,6 +14,7 @@ import { DocComponent } from '../DocComponent'; import { StyleProp } from '../StyleProvider'; import { FieldView, FieldViewProps } from './FieldView'; import './FontIconBox.scss'; +import { Colors } from '../global/globalEnums'; const FontIconSchema = createSchema({ icon: "string", }); @@ -47,7 +48,7 @@ export class FontIconBox extends DocComponent<FieldViewProps, FontIconDocument>( const icon = StrCast(this.dataDoc.icon, "user") as any; const presSize = shape === 'round' ? 25 : 30; const presTrailsIcon = <img src={`/assets/${"presTrails.png"}`} - style={{ width: presSize, height: presSize, filter: `invert(${color === "white" ? "100%" : "0%"})`, marginBottom: "5px" }} />; + style={{ width: presSize, height: presSize, filter: `invert(${color === Colors.DARK_GRAY ? "0%" : "100%"})`, marginBottom: "5px" }} />; const button = <button className={`menuButton-${shape}`} onContextMenu={this.specificContextMenu} style={{ backgroundColor: backgroundColor, }}> <div className="menuButton-wrap"> diff --git a/src/client/views/nodes/ImageBox.tsx b/src/client/views/nodes/ImageBox.tsx index d876ae818..cfd43bb62 100644 --- a/src/client/views/nodes/ImageBox.tsx +++ b/src/client/views/nodes/ImageBox.tsx @@ -340,7 +340,7 @@ export class ImageBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp @action finishMarquee = () => { this._marqueeing = undefined; - this.props.select(false) + this.props.select(false); } render() { diff --git a/src/client/views/nodes/WebBox.tsx b/src/client/views/nodes/WebBox.tsx index 88e38712a..f5b1f96f2 100644 --- a/src/client/views/nodes/WebBox.tsx +++ b/src/client/views/nodes/WebBox.tsx @@ -162,7 +162,8 @@ export class WebBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps scrollFocus = (doc: Doc, smooth: boolean) => { if (this._sidebarRef?.current?.makeDocUnfiltered(doc)) return 1; if (doc !== this.rootDoc && this._outerRef.current) { - const scrollTo = doc.type === DocumentType.TEXTANCHOR ? NumCast(doc.y) : Utils.scrollIntoView(NumCast(doc.y), doc[HeightSym](), NumCast(this.layoutDoc._scrollTop), this.props.PanelHeight() / (this.props.scaling?.() || 1)); + const windowHeight = this.props.PanelHeight() / (this.props.scaling?.() || 1); + const scrollTo = Utils.scrollIntoView(NumCast(doc.y), doc[HeightSym](), NumCast(this.layoutDoc._scrollTop), windowHeight, windowHeight * .1); if (scrollTo !== undefined) { const focusSpeed = smooth ? 500 : 0; this._initialScroll !== undefined && (this._initialScroll = scrollTo); diff --git a/src/client/views/nodes/formattedText/FormattedTextBox.tsx b/src/client/views/nodes/formattedText/FormattedTextBox.tsx index 6dd63fb47..140d39929 100644 --- a/src/client/views/nodes/formattedText/FormattedTextBox.tsx +++ b/src/client/views/nodes/formattedText/FormattedTextBox.tsx @@ -215,6 +215,7 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp AnchorMenu.Instance.Status = "marquee"; AnchorMenu.Instance.Highlight = action((color: string, isLinkButton: boolean) => { this._editorView?.state && RichTextMenu.Instance.insertHighlight(color, this._editorView.state, this._editorView?.dispatch); + console.log("highlight") return undefined; }); /** @@ -787,7 +788,7 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp } componentDidMount() { - this.props.setContentView?.(this); // this tells the DocumentView that this AudioBox is the "content" of the document. this allows the DocumentView to indirectly call getAnchor() on the AudioBox when making a link. + !this.props.dontSelectOnLoad && this.props.setContentView?.(this); // this tells the DocumentView that this AudioBox is the "content" of the document. this allows the DocumentView to indirectly call getAnchor() on the AudioBox when making a link. this._cachedLinks = DocListCast(this.Document.links); this._disposers.breakupDictation = reaction(() => DocumentManager.Instance.RecordingEvent, this.breakupDictation); this._disposers.autoHeight = reaction(() => this.autoHeight, autoHeight => autoHeight && this.tryUpdateScrollHeight()); diff --git a/src/client/views/nodes/formattedText/RichTextMenu.tsx b/src/client/views/nodes/formattedText/RichTextMenu.tsx index 59b2d3753..2523dda38 100644 --- a/src/client/views/nodes/formattedText/RichTextMenu.tsx +++ b/src/client/views/nodes/formattedText/RichTextMenu.tsx @@ -852,6 +852,7 @@ export class RichTextMenu extends AntimodeMenu<AntimodeMenuProps> { @undoBatch makeLinkToURL = (target: string, lcoation: string) => { ((this.view as any)?.TextView as FormattedTextBox).makeLinkAnchor(undefined, "onRadd:rightight", target, target); + console.log((this.view as any)?.TextView); } @undoBatch @@ -963,7 +964,7 @@ export class RichTextMenu extends AntimodeMenu<AntimodeMenuProps> { this.createHighlighterButton(), this.createLinkButton(), this.createBrushButton(), - <div className="richTextMenu-divider" key="divider 2" />, + <div className="collectionMenu-divider" key="divider 2" />, this.createButton("align-left", "Align Left", this.activeAlignment === "left", this.alignLeft), this.createButton("align-center", "Align Center", this.activeAlignment === "center", this.alignCenter), this.createButton("align-right", "Align Right", this.activeAlignment === "right", this.alignRight), @@ -976,7 +977,7 @@ export class RichTextMenu extends AntimodeMenu<AntimodeMenuProps> { const row2 = <div className="antimodeMenu-row row-2" key="row2"> {this.collapsed ? this.getDragger() : (null)} <div key="row 2" style={{ display: this.collapsed ? "none" : undefined }}> - <div className="richTextMenu-divider" key="divider 3" /> + <div className="collectionMenu-divider" key="divider 3" /> {[this.createMarksDropdown(this.activeFontSize, this.fontSizeOptions, "font size", action((val: string) => { this.activeFontSize = val; SelectionManager.Views().map(dv => dv.props.Document._fontSize = val); @@ -985,12 +986,12 @@ export class RichTextMenu extends AntimodeMenu<AntimodeMenuProps> { this.activeFontFamily = val; SelectionManager.Views().map(dv => dv.props.Document._fontFamily = val); })), - <div className="richTextMenu-divider" key="divider 4" />, + <div className="collectionMenu-divider" key="divider 4" />, this.createNodesDropdown(this.activeListType, this.listTypeOptions, "list type", () => ({})), this.createButton("sort-amount-down", "Summarize", undefined, this.insertSummarizer), this.createButton("quote-left", "Blockquote", undefined, this.insertBlockquote), - this.createButton("minus", "Horizontal Rule", undefined, this.insertHorizontalRule), - <div className="richTextMenu-divider" key="divider 5" />,]} + this.createButton("minus", "Horizontal Rule", undefined, this.insertHorizontalRule) + ]} </div> {/* <div key="collapser"> {<div key="collapser"> diff --git a/src/client/views/nodes/PresBox.scss b/src/client/views/nodes/trails/PresBox.scss index 5d1c5f4eb..06932d145 100644 --- a/src/client/views/nodes/PresBox.scss +++ b/src/client/views/nodes/trails/PresBox.scss @@ -1,4 +1,4 @@ -@import "../global/globalCssVariables"; +@import "../../global/globalCssVariables"; .presBox-cont { cursor: auto; @@ -889,7 +889,7 @@ height: 13; font-size: 12; display: flex; - background-color: #white; + background-color: $white; } .subtitle { @@ -926,7 +926,7 @@ .presBox-buttons { position: relative; width: 100%; - background: gray; + background: $medium-gray; min-height: 35px; padding-top: 5px; padding-bottom: 5px; diff --git a/src/client/views/nodes/PresBox.tsx b/src/client/views/nodes/trails/PresBox.tsx index f3fb6ff17..5cb9866f8 100644 --- a/src/client/views/nodes/PresBox.tsx +++ b/src/client/views/nodes/trails/PresBox.tsx @@ -5,67 +5,33 @@ import { action, computed, IReactionDisposer, observable, ObservableMap, reactio import { observer } from "mobx-react"; import { ColorState, SketchPicker } from "react-color"; import { Bounce, Fade, Flip, LightSpeed, Roll, Rotate, Zoom } from 'react-reveal'; -import { Doc, DocListCast, DocListCastAsync, FieldResult } from "../../../fields/Doc"; -import { documentSchema } from "../../../fields/documentSchemas"; -import { InkTool } from "../../../fields/InkField"; -import { List } from "../../../fields/List"; -import { PrefetchProxy } from "../../../fields/Proxy"; -import { listSpec, makeInterface } from "../../../fields/Schema"; -import { ScriptField } from "../../../fields/ScriptField"; -import { BoolCast, Cast, NumCast, StrCast } from "../../../fields/Types"; -import { returnFalse, returnOne, returnTrue, emptyFunction } from '../../../Utils'; -import { Docs } from "../../documents/Documents"; -import { DocumentType } from "../../documents/DocumentTypes"; -import { CurrentUserUtils } from "../../util/CurrentUserUtils"; -import { DocumentManager } from "../../util/DocumentManager"; -import { Scripting } from "../../util/Scripting"; -import { SelectionManager } from "../../util/SelectionManager"; -import { undoBatch, UndoManager } from "../../util/UndoManager"; -import { CollectionDockingView } from "../collections/CollectionDockingView"; -import { CollectionView, CollectionViewType } from "../collections/CollectionView"; -import { TabDocView } from "../collections/TabDocView"; -import { ViewBoxBaseComponent } from "../DocComponent"; -import { CollectionFreeFormDocumentView } from "./CollectionFreeFormDocumentView"; -import { FieldView, FieldViewProps } from './FieldView'; +import { Doc, DocListCast, DocListCastAsync, FieldResult } from "../../../../fields/Doc"; +import { documentSchema } from "../../../../fields/documentSchemas"; +import { InkTool } from "../../../../fields/InkField"; +import { List } from "../../../../fields/List"; +import { PrefetchProxy } from "../../../../fields/Proxy"; +import { listSpec, makeInterface } from "../../../../fields/Schema"; +import { ScriptField } from "../../../../fields/ScriptField"; +import { BoolCast, Cast, NumCast, StrCast } from "../../../../fields/Types"; +import { emptyFunction, returnFalse, returnOne, returnTrue } from '../../../../Utils'; +import { Docs } from "../../../documents/Documents"; +import { DocumentType } from "../../../documents/DocumentTypes"; +import { CurrentUserUtils } from "../../../util/CurrentUserUtils"; +import { DocumentManager } from "../../../util/DocumentManager"; +import { Scripting } from "../../../util/Scripting"; +import { SelectionManager } from "../../../util/SelectionManager"; +import { undoBatch, UndoManager } from "../../../util/UndoManager"; +import { CollectionDockingView } from "../../collections/CollectionDockingView"; +import { CollectionView, CollectionViewType } from "../../collections/CollectionView"; +import { TabDocView } from "../../collections/TabDocView"; +import { ViewBoxBaseComponent } from "../../DocComponent"; +import { Colors } from "../../global/globalEnums"; +import { LightboxView } from "../../LightboxView"; +import { CollectionFreeFormDocumentView } from "../CollectionFreeFormDocumentView"; +import { FieldView, FieldViewProps } from '../FieldView'; import "./PresBox.scss"; import Color = require("color"); -import { LightboxView } from "../LightboxView"; - -export enum PresMovement { - Zoom = "zoom", - Pan = "pan", - Jump = "jump", - None = "none", -} - -export enum PresEffect { - Zoom = "Zoom", - Lightspeed = "Lightspeed", - Fade = "Fade in", - Flip = "Flip", - Rotate = "Rotate", - Bounce = "Bounce", - Roll = "Roll", - None = "None", - Left = "left", - Right = "right", - Center = "center", - Top = "top", - Bottom = "bottom" -} - -enum PresStatus { - Autoplay = "auto", - Manual = "manual", - Edit = "edit" -} - -export enum PresColor { - LightBlue = "#AEDDF8", - DarkBlue = "#5B9FDD", - LightBackground = "#ececec", - SlideBackground = "#d5dce2", -} +import { PresEffect, PresStatus, PresMovement } from "./PresEnums"; export class PinProps { audioRange?: boolean; @@ -1198,9 +1164,9 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema> {this.scrollable ? "Scroll to pinned view" : !isPinWithView ? "No movement" : "Pan & Zoom to pinned view"} </div> : - <div className="presBox-dropdown" onClick={action(e => { e.stopPropagation(); this.openMovementDropdown = !this.openMovementDropdown; })} style={{ borderBottomLeftRadius: this.openMovementDropdown ? 0 : 5, border: this.openMovementDropdown ? `solid 2px ${PresColor.DarkBlue}` : 'solid 1px black' }}> + <div className="presBox-dropdown" onClick={action(e => { e.stopPropagation(); this.openMovementDropdown = !this.openMovementDropdown; })} style={{ borderBottomLeftRadius: this.openMovementDropdown ? 0 : 5, border: this.openMovementDropdown ? `solid 2px ${Colors.MEDIUM_BLUE}` : 'solid 1px black' }}> {this.setMovementName(activeItem.presMovement, activeItem)} - <FontAwesomeIcon className='presBox-dropdownIcon' style={{ gridColumn: 2, color: this.openMovementDropdown ? PresColor.DarkBlue : 'black' }} icon={"angle-down"} /> + <FontAwesomeIcon className='presBox-dropdownIcon' style={{ gridColumn: 2, color: this.openMovementDropdown ? Colors.MEDIUM_BLUE : 'black' }} icon={"angle-down"} /> <div className={'presBox-dropdownOptions'} id={'presBoxMovementDropdown'} onPointerDown={e => e.stopPropagation()} style={{ display: this.openMovementDropdown ? "grid" : "none" }}> <div className={`presBox-dropdownOption ${activeItem.presMovement === PresMovement.None ? "active" : ""}`} onPointerDown={e => e.stopPropagation()} onClick={() => this.updateMovement(PresMovement.None)}>None</div> <div className={`presBox-dropdownOption ${activeItem.presMovement === PresMovement.Zoom ? "active" : ""}`} onPointerDown={e => e.stopPropagation()} onClick={() => this.updateMovement(PresMovement.Zoom)}>Pan {"&"} Zoom</div> @@ -1245,7 +1211,7 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema> <div className="ribbon-doubleButton"> {isPresCollection ? (null) : <Tooltip title={<><div className="dash-tooltip">{"Hide before presented"}</div></>}><div className={`ribbon-toggle ${activeItem.presHideBefore ? "active" : ""}`} onClick={() => this.updateHideBefore(activeItem)}>Hide before</div></Tooltip>} {isPresCollection ? (null) : <Tooltip title={<><div className="dash-tooltip">{"Hide after presented"}</div></>}><div className={`ribbon-toggle ${activeItem.presHideAfter ? "active" : ""}`} onClick={() => this.updateHideAfter(activeItem)}>Hide after</div></Tooltip>} - <Tooltip title={<><div className="dash-tooltip">{"Open in lightbox view"}</div></>}><div className="ribbon-toggle" style={{ backgroundColor: activeItem.openDocument ? PresColor.LightBlue : "" }} onClick={() => this.updateOpenDoc(activeItem)}>Lightbox</div></Tooltip> + <Tooltip title={<><div className="dash-tooltip">{"Open in lightbox view"}</div></>}><div className="ribbon-toggle" style={{ backgroundColor: activeItem.openDocument ? Colors.LIGHT_BLUE : "" }} onClick={() => this.updateOpenDoc(activeItem)}>Lightbox</div></Tooltip> </div> {(type === DocumentType.AUDIO || type === DocumentType.VID) ? (null) : <> <div className="ribbon-doubleButton" > @@ -1280,9 +1246,9 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema> </div> {isPresCollection ? (null) : <div className="ribbon-box"> Effects - <div className="presBox-dropdown" onClick={action(e => { e.stopPropagation(); this.openEffectDropdown = !this.openEffectDropdown; })} style={{ borderBottomLeftRadius: this.openEffectDropdown ? 0 : 5, border: this.openEffectDropdown ? `solid 2px ${PresColor.DarkBlue}` : 'solid 1px black' }}> + <div className="presBox-dropdown" onClick={action(e => { e.stopPropagation(); this.openEffectDropdown = !this.openEffectDropdown; })} style={{ borderBottomLeftRadius: this.openEffectDropdown ? 0 : 5, border: this.openEffectDropdown ? `solid 2px ${Colors.MEDIUM_BLUE}` : 'solid 1px black' }}> {effect} - <FontAwesomeIcon className='presBox-dropdownIcon' style={{ gridColumn: 2, color: this.openEffectDropdown ? PresColor.DarkBlue : 'black' }} icon={"angle-down"} /> + <FontAwesomeIcon className='presBox-dropdownIcon' style={{ gridColumn: 2, color: this.openEffectDropdown ? Colors.MEDIUM_BLUE : 'black' }} icon={"angle-down"} /> <div className={'presBox-dropdownOptions'} id={'presBoxMovementDropdown'} style={{ display: this.openEffectDropdown ? "grid" : "none" }} onPointerDown={e => e.stopPropagation()}> <div className={`presBox-dropdownOption ${targetDoc.presEffect === PresEffect.None || !targetDoc.presEffect ? "active" : ""}`} onPointerDown={e => e.stopPropagation()} onClick={() => this.updateEffect(PresEffect.None)}>None</div> <div className={`presBox-dropdownOption ${targetDoc.presEffect === PresEffect.Fade ? "active" : ""}`} onPointerDown={e => e.stopPropagation()} onClick={() => this.updateEffect(PresEffect.Fade)}>Fade In</div> @@ -1299,11 +1265,11 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema> </div> </div> <div className="effectDirection" style={{ display: effect === 'None' ? "none" : "grid", width: 40 }}> - <Tooltip title={<><div className="dash-tooltip">{"Enter from left"}</div></>}><div style={{ gridColumn: 1, gridRow: 2, justifySelf: 'center', color: targetDoc.presEffectDirection === PresEffect.Left ? PresColor.LightBlue : "black", cursor: "pointer" }} onClick={() => this.updateEffectDirection(PresEffect.Left)}><FontAwesomeIcon icon={"angle-right"} /></div></Tooltip> - <Tooltip title={<><div className="dash-tooltip">{"Enter from right"}</div></>}><div style={{ gridColumn: 3, gridRow: 2, justifySelf: 'center', color: targetDoc.presEffectDirection === PresEffect.Right ? PresColor.LightBlue : "black", cursor: "pointer" }} onClick={() => this.updateEffectDirection(PresEffect.Right)}><FontAwesomeIcon icon={"angle-left"} /></div></Tooltip> - <Tooltip title={<><div className="dash-tooltip">{"Enter from top"}</div></>}><div style={{ gridColumn: 2, gridRow: 1, justifySelf: 'center', color: targetDoc.presEffectDirection === PresEffect.Top ? PresColor.LightBlue : "black", cursor: "pointer" }} onClick={() => this.updateEffectDirection(PresEffect.Top)}><FontAwesomeIcon icon={"angle-down"} /></div></Tooltip> - <Tooltip title={<><div className="dash-tooltip">{"Enter from bottom"}</div></>}><div style={{ gridColumn: 2, gridRow: 3, justifySelf: 'center', color: targetDoc.presEffectDirection === PresEffect.Bottom ? PresColor.LightBlue : "black", cursor: "pointer" }} onClick={() => this.updateEffectDirection(PresEffect.Bottom)}><FontAwesomeIcon icon={"angle-up"} /></div></Tooltip> - <Tooltip title={<><div className="dash-tooltip">{"Enter from center"}</div></>}><div style={{ gridColumn: 2, gridRow: 2, width: 10, height: 10, alignSelf: 'center', justifySelf: 'center', border: targetDoc.presEffectDirection === PresEffect.Center || !targetDoc.presEffectDirection ? `solid 2px ${PresColor.LightBlue}` : "solid 2px black", borderRadius: "100%", cursor: "pointer" }} onClick={() => this.updateEffectDirection(PresEffect.Center)}></div></Tooltip> + <Tooltip title={<><div className="dash-tooltip">{"Enter from left"}</div></>}><div style={{ gridColumn: 1, gridRow: 2, justifySelf: 'center', color: targetDoc.presEffectDirection === PresEffect.Left ? Colors.LIGHT_BLUE : "black", cursor: "pointer" }} onClick={() => this.updateEffectDirection(PresEffect.Left)}><FontAwesomeIcon icon={"angle-right"} /></div></Tooltip> + <Tooltip title={<><div className="dash-tooltip">{"Enter from right"}</div></>}><div style={{ gridColumn: 3, gridRow: 2, justifySelf: 'center', color: targetDoc.presEffectDirection === PresEffect.Right ? Colors.LIGHT_BLUE : "black", cursor: "pointer" }} onClick={() => this.updateEffectDirection(PresEffect.Right)}><FontAwesomeIcon icon={"angle-left"} /></div></Tooltip> + <Tooltip title={<><div className="dash-tooltip">{"Enter from top"}</div></>}><div style={{ gridColumn: 2, gridRow: 1, justifySelf: 'center', color: targetDoc.presEffectDirection === PresEffect.Top ? Colors.LIGHT_BLUE : "black", cursor: "pointer" }} onClick={() => this.updateEffectDirection(PresEffect.Top)}><FontAwesomeIcon icon={"angle-down"} /></div></Tooltip> + <Tooltip title={<><div className="dash-tooltip">{"Enter from bottom"}</div></>}><div style={{ gridColumn: 2, gridRow: 3, justifySelf: 'center', color: targetDoc.presEffectDirection === PresEffect.Bottom ? Colors.LIGHT_BLUE : "black", cursor: "pointer" }} onClick={() => this.updateEffectDirection(PresEffect.Bottom)}><FontAwesomeIcon icon={"angle-up"} /></div></Tooltip> + <Tooltip title={<><div className="dash-tooltip">{"Enter from center"}</div></>}><div style={{ gridColumn: 2, gridRow: 2, width: 10, height: 10, alignSelf: 'center', justifySelf: 'center', border: targetDoc.presEffectDirection === PresEffect.Center || !targetDoc.presEffectDirection ? `solid 2px ${Colors.LIGHT_BLUE}` : "solid 2px black", borderRadius: "100%", cursor: "pointer" }} onClick={() => this.updateEffectDirection(PresEffect.Center)}></div></Tooltip> </div> </div>} <div className="ribbon-final-box"> @@ -1356,7 +1322,7 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema> <> {this.panable || this.scrollable || this.targetDoc.type === DocumentType.COMPARISON ? 'Pinned view' : (null)} <div className="ribbon-doubleButton"> - <Tooltip title={<><div className="dash-tooltip">{activeItem.presPinView ? "Turn off pin with view" : "Turn on pin with view"}</div></>}><div className="ribbon-toggle" style={{ width: 20, padding: 0, backgroundColor: activeItem.presPinView ? PresColor.LightBlue : "" }} + <Tooltip title={<><div className="dash-tooltip">{activeItem.presPinView ? "Turn off pin with view" : "Turn on pin with view"}</div></>}><div className="ribbon-toggle" style={{ width: 20, padding: 0, backgroundColor: activeItem.presPinView ? Colors.LIGHT_BLUE : "" }} onClick={() => { activeItem.presPinView = !activeItem.presPinView; targetDoc.presPinView = activeItem.presPinView; @@ -1496,7 +1462,7 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema> <div className="slider-text" style={{ fontWeight: 500 }}> Start time (s) </div> - <div id={"startTime"} className="slider-number" style={{ backgroundColor: PresColor.LightBackground }}> + <div id={"startTime"} className="slider-number" style={{ backgroundColor: Colors.LIGHT_GRAY }}> <input className="presBox-input" style={{ textAlign: 'center', width: 30, height: 15, fontSize: 10 }} type="number" value={NumCast(activeItem.presStartTime)} @@ -1508,7 +1474,7 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema> <div className="slider-text" style={{ fontWeight: 500 }}> Duration (s) </div> - <div className="slider-number" style={{ backgroundColor: PresColor.LightBlue }}> + <div className="slider-number" style={{ backgroundColor: Colors.LIGHT_BLUE }}> {Math.round((NumCast(activeItem.presEndTime) - NumCast(activeItem.presStartTime)) * 10) / 10} </div> </div> @@ -1516,7 +1482,7 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema> <div className="slider-text" style={{ fontWeight: 500 }}> End time (s) </div> - <div id={"endTime"} className="slider-number" style={{ backgroundColor: PresColor.LightBackground }}> + <div id={"endTime"} className="slider-number" style={{ backgroundColor: Colors.LIGHT_GRAY }}> <input className="presBox-input" style={{ textAlign: 'center', width: 30, height: 15, fontSize: 10 }} type="number" value={NumCast(activeItem.presEndTime)} @@ -1534,16 +1500,16 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema> this._batch = UndoManager.StartBatch("presEndTime"); const endBlock = document.getElementById("endTime"); if (endBlock) { - endBlock.style.color = PresColor.LightBackground; - endBlock.style.backgroundColor = PresColor.DarkBlue; + endBlock.style.color = Colors.LIGHT_GRAY; + endBlock.style.backgroundColor = Colors.MEDIUM_BLUE; } }} onPointerUp={() => { this._batch?.end(); const endBlock = document.getElementById("endTime"); if (endBlock) { - endBlock.style.color = "black"; - endBlock.style.backgroundColor = PresColor.LightBackground; + endBlock.style.color = Colors.BLACK; + endBlock.style.backgroundColor = Colors.LIGHT_GRAY; } }} onChange={(e: React.ChangeEvent<HTMLInputElement>) => { @@ -1558,16 +1524,16 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema> this._batch = UndoManager.StartBatch("presStartTime"); const startBlock = document.getElementById("startTime"); if (startBlock) { - startBlock.style.color = PresColor.LightBackground; - startBlock.style.backgroundColor = PresColor.DarkBlue; + startBlock.style.color = Colors.LIGHT_GRAY; + startBlock.style.backgroundColor = Colors.MEDIUM_BLUE; } }} onPointerUp={() => { this._batch?.end(); const startBlock = document.getElementById("startTime"); if (startBlock) { - startBlock.style.color = "black"; - startBlock.style.backgroundColor = PresColor.LightBackground; + startBlock.style.color = Colors.BLACK; + startBlock.style.backgroundColor = Colors.LIGHT_GRAY; } }} onChange={(e: React.ChangeEvent<HTMLInputElement>) => { @@ -1651,15 +1617,15 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema> <div> <div className={'presBox-toolbar-dropdown'} style={{ display: this.newDocumentTools && this.layoutDoc.presStatus === "edit" ? "inline-flex" : "none" }} onClick={e => e.stopPropagation()} onPointerUp={e => e.stopPropagation()} onPointerDown={e => e.stopPropagation()}> <div className="layout-container" style={{ height: 'max-content' }}> - <div className="layout" style={{ border: this.layout === 'blank' ? `solid 2px ${PresColor.DarkBlue}` : '' }} onClick={action(() => { this.layout = 'blank'; this.createNewSlide(this.layout); })} /> - <div className="layout" style={{ border: this.layout === 'title' ? `solid 2px ${PresColor.DarkBlue}` : '' }} onClick={action(() => { this.layout = 'title'; this.createNewSlide(this.layout); })}> + <div className="layout" style={{ border: this.layout === 'blank' ? `solid 2px ${Colors.MEDIUM_BLUE}` : '' }} onClick={action(() => { this.layout = 'blank'; this.createNewSlide(this.layout); })} /> + <div className="layout" style={{ border: this.layout === 'title' ? `solid 2px ${Colors.MEDIUM_BLUE}` : '' }} onClick={action(() => { this.layout = 'title'; this.createNewSlide(this.layout); })}> <div className="title">Title</div> <div className="subtitle">Subtitle</div> </div> - <div className="layout" style={{ border: this.layout === 'header' ? `solid 2px ${PresColor.DarkBlue}` : '' }} onClick={action(() => { this.layout = 'header'; this.createNewSlide(this.layout); })}> + <div className="layout" style={{ border: this.layout === 'header' ? `solid 2px ${Colors.MEDIUM_BLUE}` : '' }} onClick={action(() => { this.layout = 'header'; this.createNewSlide(this.layout); })}> <div className="title" style={{ alignSelf: 'center', fontSize: 10 }}>Section header</div> </div> - <div className="layout" style={{ border: this.layout === 'content' ? `solid 2px ${PresColor.DarkBlue}` : '' }} onClick={action(() => { this.layout = 'content'; this.createNewSlide(this.layout); })}> + <div className="layout" style={{ border: this.layout === 'content' ? `solid 2px ${Colors.MEDIUM_BLUE}` : '' }} onClick={action(() => { this.layout = 'content'; this.createNewSlide(this.layout); })}> <div className="title" style={{ alignSelf: 'center' }}>Title</div> <div className="content">Text goes here</div> </div> @@ -1691,26 +1657,26 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema> <div className="ribbon-box"> Choose type: <div className="ribbon-doubleButton"> - <div title="Text" className={'ribbon-toggle'} style={{ background: this.addFreeform ? "" : PresColor.LightBlue }} onClick={action(() => this.addFreeform = !this.addFreeform)}>Text</div> - <div title="Freeform" className={'ribbon-toggle'} style={{ background: this.addFreeform ? PresColor.LightBlue : "" }} onClick={action(() => this.addFreeform = !this.addFreeform)}>Freeform</div> + <div title="Text" className={'ribbon-toggle'} style={{ background: this.addFreeform ? "" : Colors.LIGHT_BLUE }} onClick={action(() => this.addFreeform = !this.addFreeform)}>Text</div> + <div title="Freeform" className={'ribbon-toggle'} style={{ background: this.addFreeform ? Colors.LIGHT_BLUE : "" }} onClick={action(() => this.addFreeform = !this.addFreeform)}>Freeform</div> </div> </div> <div className="ribbon-box" style={{ display: this.addFreeform ? "grid" : "none" }}> Preset layouts: <div className="layout-container" style={{ height: this.openLayouts ? 'max-content' : '75px' }}> - <div className="layout" style={{ border: this.layout === 'blank' ? `solid 2px ${PresColor.DarkBlue}` : '' }} onClick={action(() => this.layout = 'blank')} /> - <div className="layout" style={{ border: this.layout === 'title' ? `solid 2px ${PresColor.DarkBlue}` : '' }} onClick={action(() => this.layout = 'title')}> + <div className="layout" style={{ border: this.layout === 'blank' ? `solid 2px ${Colors.MEDIUM_BLUE}` : '' }} onClick={action(() => this.layout = 'blank')} /> + <div className="layout" style={{ border: this.layout === 'title' ? `solid 2px ${Colors.MEDIUM_BLUE}` : '' }} onClick={action(() => this.layout = 'title')}> <div className="title">Title</div> <div className="subtitle">Subtitle</div> </div> - <div className="layout" style={{ border: this.layout === 'header' ? `solid 2px ${PresColor.DarkBlue}` : '' }} onClick={action(() => this.layout = 'header')}> + <div className="layout" style={{ border: this.layout === 'header' ? `solid 2px ${Colors.MEDIUM_BLUE}` : '' }} onClick={action(() => this.layout = 'header')}> <div className="title" style={{ alignSelf: 'center', fontSize: 10 }}>Section header</div> </div> - <div className="layout" style={{ border: this.layout === 'content' ? `solid 2px ${PresColor.DarkBlue}` : '' }} onClick={action(() => this.layout = 'content')}> + <div className="layout" style={{ border: this.layout === 'content' ? `solid 2px ${Colors.MEDIUM_BLUE}` : '' }} onClick={action(() => this.layout = 'content')}> <div className="title" style={{ alignSelf: 'center' }}>Title</div> <div className="content">Text goes here</div> </div> - <div className="layout" style={{ border: this.layout === 'twoColumns' ? `solid 2px ${PresColor.DarkBlue}` : '' }} onClick={action(() => this.layout = 'twoColumns')}> + <div className="layout" style={{ border: this.layout === 'twoColumns' ? `solid 2px ${Colors.MEDIUM_BLUE}` : '' }} onClick={action(() => this.layout = 'twoColumns')}> <div className="title" style={{ alignSelf: 'center', gridColumn: '1/3' }}>Title</div> <div className="content" style={{ gridColumn: 1, gridRow: 2 }}>Column one text</div> <div className="content" style={{ gridColumn: 2, gridRow: 2 }}>Column two text</div> @@ -1869,8 +1835,8 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema> <div className="ribbon-box"> {this.stringType} selected <div className="ribbon-doubleButton" style={{ borderTop: 'solid 1px darkgrey', display: (targetDoc.type === DocumentType.COL && targetDoc._viewType === 'freeform') || targetDoc.type === DocumentType.IMG || targetDoc.type === DocumentType.RTF ? "inline-flex" : "none" }}> - <div className="ribbon-toggle" style={{ backgroundColor: activeItem.presProgressivize ? PresColor.LightBlue : "" }} onClick={this.progressivizeChild}>Contents</div> - <div className="ribbon-toggle" style={{ opacity: activeItem.presProgressivize ? 1 : 0.4, backgroundColor: targetDoc.editProgressivize ? PresColor.LightBlue : "" }} onClick={this.editProgressivize}>Edit</div> + <div className="ribbon-toggle" style={{ backgroundColor: activeItem.presProgressivize ? Colors.LIGHT_BLUE : "" }} onClick={this.progressivizeChild}>Contents</div> + <div className="ribbon-toggle" style={{ opacity: activeItem.presProgressivize ? 1 : 0.4, backgroundColor: targetDoc.editProgressivize ? Colors.LIGHT_BLUE : "" }} onClick={this.editProgressivize}>Edit</div> </div> <div className="ribbon-doubleButton" style={{ display: activeItem.presProgressivize ? "inline-flex" : "none" }}> <div className="presBox-subheading">Active text color</div> @@ -1885,12 +1851,12 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema> </div> {this.viewedColorPicker} <div className="ribbon-doubleButton" style={{ borderTop: 'solid 1px darkgrey', display: (targetDoc.type === DocumentType.COL && targetDoc._viewType === 'freeform') || targetDoc.type === DocumentType.IMG ? "inline-flex" : "none" }}> - <div className="ribbon-toggle" style={{ backgroundColor: activeItem.zoomProgressivize ? PresColor.LightBlue : "" }} onClick={this.progressivizeZoom}>Zoom</div> - <div className="ribbon-toggle" style={{ opacity: activeItem.zoomProgressivize ? 1 : 0.4, backgroundColor: activeItem.editZoomProgressivize ? PresColor.LightBlue : "" }} onClick={this.editZoomProgressivize}>Edit</div> + <div className="ribbon-toggle" style={{ backgroundColor: activeItem.zoomProgressivize ? Colors.LIGHT_BLUE : "" }} onClick={this.progressivizeZoom}>Zoom</div> + <div className="ribbon-toggle" style={{ opacity: activeItem.zoomProgressivize ? 1 : 0.4, backgroundColor: activeItem.editZoomProgressivize ? Colors.LIGHT_BLUE : "" }} onClick={this.editZoomProgressivize}>Edit</div> </div> <div className="ribbon-doubleButton" style={{ borderTop: 'solid 1px darkgrey', display: targetDoc._viewType === "stacking" || targetDoc.type === DocumentType.PDF || targetDoc.type === DocumentType.WEB || targetDoc.type === DocumentType.RTF ? "inline-flex" : "none" }}> - <div className="ribbon-toggle" style={{ backgroundColor: activeItem.scrollProgressivize ? PresColor.LightBlue : "" }} onClick={this.progressivizeScroll}>Scroll</div> - <div className="ribbon-toggle" style={{ opacity: activeItem.scrollProgressivize ? 1 : 0.4, backgroundColor: targetDoc.editScrollProgressivize ? PresColor.LightBlue : "" }} onClick={this.editScrollProgressivize}>Edit</div> + <div className="ribbon-toggle" style={{ backgroundColor: activeItem.scrollProgressivize ? Colors.LIGHT_BLUE : "" }} onClick={this.progressivizeScroll}>Scroll</div> + <div className="ribbon-toggle" style={{ opacity: activeItem.scrollProgressivize ? 1 : 0.4, backgroundColor: targetDoc.editScrollProgressivize ? Colors.LIGHT_BLUE : "" }} onClick={this.editScrollProgressivize}>Edit</div> </div> </div> <div className="ribbon-final-box"> @@ -1900,7 +1866,7 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema> <div key="back" title="back frame" className="backKeyframe" onClick={e => { e.stopPropagation(); this.prevKeyframe(targetDoc, activeItem); }}> <FontAwesomeIcon icon={"caret-left"} size={"lg"} /> </div> - <div key="num" title="toggle view all" className="numKeyframe" style={{ color: targetDoc.keyFrameEditing ? "white" : "black", backgroundColor: targetDoc.keyFrameEditing ? PresColor.DarkBlue : PresColor.LightBlue }} + <div key="num" title="toggle view all" className="numKeyframe" style={{ color: targetDoc.keyFrameEditing ? "white" : "black", backgroundColor: targetDoc.keyFrameEditing ? Colors.MEDIUM_BLUE : Colors.LIGHT_BLUE }} onClick={action(() => targetDoc.keyFrameEditing = !targetDoc.keyFrameEditing)} > {NumCast(targetDoc._currentFrame)} </div> @@ -1914,7 +1880,7 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema> {this.frameListHeader} {this.frameList} </div> - <div className="ribbon-toggle" style={{ height: 20, backgroundColor: PresColor.LightBlue }} onClick={() => console.log(" TODO: play frames")}>Play</div> + <div className="ribbon-toggle" style={{ height: 20, backgroundColor: Colors.LIGHT_BLUE }} onClick={() => console.log(" TODO: play frames")}>Play</div> </div> </div> </div> @@ -2130,7 +2096,7 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema> tags.push(<div style={{ position: 'absolute', display: doc.displayMovement ? "block" : "none" }}>{this.checkMovementLists(doc, doc["x-indexed"], doc["y-indexed"])}</div>); } tags.push( - <div className="progressivizeButton" key={index} onPointerLeave={() => { if (NumCast(targetDoc._currentFrame) < NumCast(doc.appearFrame)) doc.opacity = 0; }} onPointerOver={() => { if (NumCast(targetDoc._currentFrame) < NumCast(doc.appearFrame)) doc.opacity = 0.5; }} onClick={e => { this.toggleDisplayMovement(doc); e.stopPropagation(); }} style={{ backgroundColor: doc.displayMovement ? PresColor.LightBlue : "#c8c8c8", top: NumCast(doc.y), left: NumCast(doc.x) }}> + <div className="progressivizeButton" key={index} onPointerLeave={() => { if (NumCast(targetDoc._currentFrame) < NumCast(doc.appearFrame)) doc.opacity = 0; }} onPointerOver={() => { if (NumCast(targetDoc._currentFrame) < NumCast(doc.appearFrame)) doc.opacity = 0.5; }} onClick={e => { this.toggleDisplayMovement(doc); e.stopPropagation(); }} style={{ backgroundColor: doc.displayMovement ? Colors.LIGHT_BLUE : "#c8c8c8", top: NumCast(doc.y), left: NumCast(doc.x) }}> <div className="progressivizeButton-prev"><FontAwesomeIcon icon={"caret-left"} size={"lg"} onClick={e => { e.stopPropagation(); this.prevAppearFrame(doc, index); }} /></div> <div className="progressivizeButton-frame">{doc.appearFrame}</div> <div className="progressivizeButton-next"><FontAwesomeIcon icon={"caret-right"} size={"lg"} onClick={e => { e.stopPropagation(); this.nextAppearFrame(doc, index); }} /></div> @@ -2213,6 +2179,8 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema> const mode = StrCast(this.rootDoc._viewType) as CollectionViewType; const isMini: boolean = this.toolbarWidth <= 100; const presKeyEvents: boolean = (this.isPres && this._presKeyEventsActive && this.rootDoc === Doc.UserDoc().activePresentation); + const activeColor = Colors.LIGHT_BLUE; + const inactiveColor = Colors.WHITE; return (mode === CollectionViewType.Carousel3D) ? (null) : ( <div id="toolbarContainer" className={'presBox-toolbar'}> {/* <Tooltip title={<><div className="dash-tooltip">{"Add new slide"}</div></>}><div className={`toolbar-button ${this.newDocumentTools ? "active" : ""}`} onClick={action(() => this.newDocumentTools = !this.newDocumentTools)}> @@ -2220,7 +2188,7 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema> <FontAwesomeIcon className={`dropdown ${this.newDocumentTools ? "active" : ""}`} icon={"angle-down"} /> </div></Tooltip> */} <Tooltip title={<><div className="dash-tooltip">{"View paths"}</div></>}> - <div style={{ opacity: this.childDocs.length > 1 && this.layoutDoc.presCollection ? 1 : 0.3, color: this._pathBoolean ? PresColor.DarkBlue : 'white', width: isMini ? "100%" : undefined }} className={"toolbar-button"} onClick={this.childDocs.length > 1 && this.layoutDoc.presCollection ? this.viewPaths : undefined}> + <div style={{ opacity: this.childDocs.length > 1 && this.layoutDoc.presCollection ? 1 : 0.3, color: this._pathBoolean ? Colors.MEDIUM_BLUE : 'white', width: isMini ? "100%" : undefined }} className={"toolbar-button"} onClick={this.childDocs.length > 1 && this.layoutDoc.presCollection ? this.viewPaths : undefined}> <FontAwesomeIcon icon={"exchange-alt"} /> </div> </Tooltip> @@ -2229,7 +2197,7 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema> <div className="toolbar-divider" /> {/* <Tooltip title={<><div className="dash-tooltip">{this._expandBoolean ? "Minimize all" : "Expand all"}</div></>}> <div className={"toolbar-button"} - style={{ color: this._expandBoolean ? PresColors.DarkBlue : 'white' }} + style={{ color: this._expandBoolean ? Colors.MEDIUM_BLUE : 'white' }} onClick={this.toggleExpandMode}> <FontAwesomeIcon icon={"eye"} /> </div> @@ -2237,12 +2205,12 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema> <div className="toolbar-divider" /> */} <Tooltip title={<><div className="dash-tooltip">{presKeyEvents ? "Keys are active" : "Keys are not active - click anywhere on the presentation trail to activate keys"}</div></>}> <div className="toolbar-button" style={{ cursor: presKeyEvents ? 'default' : 'pointer', position: 'absolute', right: 30, fontSize: 16 }}> - <FontAwesomeIcon className={"toolbar-thumbtack"} icon={"keyboard"} style={{ color: presKeyEvents ? PresColor.DarkBlue : 'white' }} /> + <FontAwesomeIcon className={"toolbar-thumbtack"} icon={"keyboard"} style={{ color: presKeyEvents ? activeColor : inactiveColor }} /> </div> </Tooltip> <Tooltip title={<><div className="dash-tooltip">{propTitle}</div></>}> <div className="toolbar-button" style={{ position: 'absolute', right: 4, fontSize: 16 }} onClick={this.toggleProperties}> - <FontAwesomeIcon className={"toolbar-thumbtack"} icon={propIcon} style={{ color: CurrentUserUtils.propertiesWidth > 0 ? PresColor.DarkBlue : 'white' }} /> + <FontAwesomeIcon className={"toolbar-thumbtack"} icon={propIcon} style={{ color: CurrentUserUtils.propertiesWidth > 0 ? activeColor : inactiveColor }} /> </div> </Tooltip> </> @@ -2379,7 +2347,7 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema> const presStart: boolean = !this.layoutDoc.presLoop && (this.itemIndex === 0); // Case 1: There are still other frames and should go through all frames before going to next slide return (<div className="presPanelOverlay" style={{ display: this.layoutDoc.presStatus !== "edit" ? "inline-flex" : "none" }}> - <Tooltip title={<><div className="dash-tooltip">{"Loop"}</div></>}><div className="presPanel-button" style={{ color: this.layoutDoc.presLoop ? PresColor.DarkBlue : 'white' }} onClick={() => this.layoutDoc.presLoop = !this.layoutDoc.presLoop}><FontAwesomeIcon icon={"redo-alt"} /></div></Tooltip> + <Tooltip title={<><div className="dash-tooltip">{"Loop"}</div></>}><div className="presPanel-button" style={{ color: this.layoutDoc.presLoop ? Colors.MEDIUM_BLUE : 'white' }} onClick={() => this.layoutDoc.presLoop = !this.layoutDoc.presLoop}><FontAwesomeIcon icon={"redo-alt"} /></div></Tooltip> <div className="presPanel-divider"></div> <div className="presPanel-button" style={{ opacity: presStart ? 0.4 : 1 }} onClick={() => { this.back(); if (this._presTimer) { clearTimeout(this._presTimer); this.layoutDoc.presStatus = PresStatus.Manual; } }}><FontAwesomeIcon icon={"arrow-left"} /></div> <Tooltip title={<><div className="dash-tooltip">{this.layoutDoc.presStatus === PresStatus.Autoplay ? "Pause" : "Autoplay"}</div></>}><div className="presPanel-button" onClick={this.startOrPause}><FontAwesomeIcon icon={this.layoutDoc.presStatus === PresStatus.Autoplay ? "pause" : "play"} /></div></Tooltip> @@ -2418,8 +2386,8 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema> const presStart: boolean = !this.layoutDoc.presLoop && (this.itemIndex === 0); return CurrentUserUtils.OverlayDocs.includes(this.rootDoc) ? <div className="miniPres"> - <div className="presPanelOverlay" style={{ display: "inline-flex", height: 30, background: '#323232', top: 0, zIndex: 3000000, boxShadow: presKeyEvents ? '0 0 0px 3px ' + PresColor.DarkBlue : undefined }}> - <Tooltip title={<><div className="dash-tooltip">{"Loop"}</div></>}><div className="presPanel-button" style={{ color: this.layoutDoc.presLoop ? PresColor.DarkBlue : undefined }} onClick={() => this.layoutDoc.presLoop = !this.layoutDoc.presLoop}><FontAwesomeIcon icon={"redo-alt"} /></div></Tooltip> + <div className="presPanelOverlay" style={{ display: "inline-flex", height: 30, background: '#323232', top: 0, zIndex: 3000000, boxShadow: presKeyEvents ? '0 0 0px 3px ' + Colors.MEDIUM_BLUE : undefined }}> + <Tooltip title={<><div className="dash-tooltip">{"Loop"}</div></>}><div className="presPanel-button" style={{ color: this.layoutDoc.presLoop ? Colors.MEDIUM_BLUE : undefined }} onClick={() => this.layoutDoc.presLoop = !this.layoutDoc.presLoop}><FontAwesomeIcon icon={"redo-alt"} /></div></Tooltip> <div className="presPanel-divider"></div> <div className="presPanel-button" style={{ opacity: presStart ? 0.4 : 1 }} onClick={() => { this.back(); if (this._presTimer) { clearTimeout(this._presTimer); this.layoutDoc.presStatus = PresStatus.Manual; } }}><FontAwesomeIcon icon={"arrow-left"} /></div> <Tooltip title={<><div className="dash-tooltip">{this.layoutDoc.presStatus === PresStatus.Autoplay ? "Pause" : "Autoplay"}</div></>}><div className="presPanel-button" onClick={this.startOrPause}><FontAwesomeIcon icon={this.layoutDoc.presStatus === "auto" ? "pause" : "play"} /></div></Tooltip> diff --git a/src/client/views/presentationview/PresElementBox.scss b/src/client/views/nodes/trails/PresElementBox.scss index 1ad4b820e..1ad4b820e 100644 --- a/src/client/views/presentationview/PresElementBox.scss +++ b/src/client/views/nodes/trails/PresElementBox.scss diff --git a/src/client/views/presentationview/PresElementBox.tsx b/src/client/views/nodes/trails/PresElementBox.tsx index f15d51764..5e713c3cf 100644 --- a/src/client/views/presentationview/PresElementBox.tsx +++ b/src/client/views/nodes/trails/PresElementBox.tsx @@ -2,27 +2,29 @@ import { FontAwesomeIcon } from "@fortawesome/react-fontawesome"; import { Tooltip } from "@material-ui/core"; import { action, computed, IReactionDisposer, observable, reaction } from "mobx"; import { observer } from "mobx-react"; -import { DataSym, Doc, Opt } from "../../../fields/Doc"; -import { documentSchema } from '../../../fields/documentSchemas'; -import { Id } from "../../../fields/FieldSymbols"; -import { createSchema, makeInterface } from '../../../fields/Schema'; -import { Cast, NumCast, StrCast } from "../../../fields/Types"; -import { emptyFunction, returnFalse, returnTrue, setupMoveUpEvents, emptyPath, returnEmptyDoclist } from "../../../Utils"; -import { DocumentType } from "../../documents/DocumentTypes"; -import { CurrentUserUtils } from "../../util/CurrentUserUtils"; -import { DocumentManager } from "../../util/DocumentManager"; -import { DragManager } from "../../util/DragManager"; -import { Transform } from "../../util/Transform"; -import { undoBatch } from "../../util/UndoManager"; -import { ViewBoxBaseComponent } from '../DocComponent'; -import { EditableView } from "../EditableView"; -import { DocumentView, DocumentViewProps } from "../nodes/DocumentView"; -import { FieldView, FieldViewProps } from '../nodes/FieldView'; -import { PresBox, PresColor, PresMovement } from "../nodes/PresBox"; -import { StyleProp } from "../StyleProvider"; +import { DataSym, Doc, Opt } from "../../../../fields/Doc"; +import { documentSchema } from '../../../../fields/documentSchemas'; +import { Id } from "../../../../fields/FieldSymbols"; +import { createSchema, makeInterface } from '../../../../fields/Schema'; +import { Cast, NumCast, StrCast } from "../../../../fields/Types"; +import { emptyFunction, returnFalse, returnTrue, setupMoveUpEvents, emptyPath, returnEmptyDoclist } from "../../../../Utils"; +import { DocumentType } from "../../../documents/DocumentTypes"; +import { CurrentUserUtils } from "../../../util/CurrentUserUtils"; +import { DocumentManager } from "../../../util/DocumentManager"; +import { DragManager } from "../../../util/DragManager"; +import { Transform } from "../../../util/Transform"; +import { undoBatch } from "../../../util/UndoManager"; +import { ViewBoxBaseComponent } from '../../DocComponent'; +import { EditableView } from "../../EditableView"; +import { DocumentView, DocumentViewProps } from "../../nodes/DocumentView"; +import { FieldView, FieldViewProps } from '../../nodes/FieldView'; +import { PresBox } from "./PresBox"; +import { Colors } from "../../global/globalEnums"; +import { StyleProp } from "../../StyleProvider"; import "./PresElementBox.scss"; import React = require("react"); -import { DocUtils } from "../../documents/Documents"; +import { DocUtils } from "../../../documents/Documents"; +import { PresMovement } from "./PresEnums"; export const presSchema = createSchema({ presentationTargetDoc: Doc, @@ -210,11 +212,11 @@ export class PresElementBox extends ViewBoxBaseComponent<FieldViewProps, PresDoc const height = slide.clientHeight; const halfLine = height / 2; if (y <= halfLine) { - slide.style.borderTop = "solid 2px #5B9FDD"; + slide.style.borderTop = `solid 2px ${Colors.MEDIUM_BLUE}`; slide.style.borderBottom = "0px"; } else if (y > halfLine) { slide.style.borderTop = "0px"; - slide.style.borderBottom = "solid 2px #5B9FDD"; + slide.style.borderBottom = `solid 2px ${Colors.MEDIUM_BLUE}`; } } document.removeEventListener("pointermove", this.onPointerMove); @@ -292,7 +294,7 @@ export class PresElementBox extends ViewBoxBaseComponent<FieldViewProps, PresDoc const miniView: boolean = this.toolbarWidth <= 110; const presBox: Doc = this.presBox; //presBox const presBoxColor: string = StrCast(presBox._backgroundColor); - const presColorBool: boolean = presBoxColor ? (presBoxColor !== "white" && presBoxColor !== "transparent") : false; + const presColorBool: boolean = presBoxColor ? (presBoxColor !== Colors.WHITE && presBoxColor !== "transparent") : false; const targetDoc: Doc = this.targetDoc; const activeItem: Doc = this.rootDoc; return ( @@ -300,7 +302,7 @@ export class PresElementBox extends ViewBoxBaseComponent<FieldViewProps, PresDoc key={this.props.Document[Id] + this.indexInPres} ref={this._itemRef} style={{ - backgroundColor: presColorBool ? isSelected ? "rgba(250,250,250,0.3)" : "transparent" : isSelected ? "#AEDDF8" : "transparent", + backgroundColor: presColorBool ? isSelected ? "rgba(250,250,250,0.3)" : "transparent" : isSelected ? Colors.LIGHT_BLUE : "transparent", opacity: this._dragging ? 0.3 : 1 }} onClick={e => { @@ -356,7 +358,7 @@ export class PresElementBox extends ViewBoxBaseComponent<FieldViewProps, PresDoc style={{ zIndex: 1000 - this.indexInPres, fontWeight: 700, - backgroundColor: activeItem.groupWithUp ? presColorBool ? presBoxColor : PresColor.DarkBlue : undefined, + backgroundColor: activeItem.groupWithUp ? presColorBool ? presBoxColor : Colors.MEDIUM_BLUE : undefined, height: activeItem.groupWithUp ? 53 : 18, transform: activeItem.groupWithUp ? "translate(0, -17px)" : undefined }}> diff --git a/src/client/views/nodes/trails/PresEnums.ts b/src/client/views/nodes/trails/PresEnums.ts new file mode 100644 index 000000000..93ab323fb --- /dev/null +++ b/src/client/views/nodes/trails/PresEnums.ts @@ -0,0 +1,28 @@ +export enum PresMovement { + Zoom = "zoom", + Pan = "pan", + Jump = "jump", + None = "none", +} + +export enum PresEffect { + Zoom = "Zoom", + Lightspeed = "Lightspeed", + Fade = "Fade in", + Flip = "Flip", + Rotate = "Rotate", + Bounce = "Bounce", + Roll = "Roll", + None = "None", + Left = "left", + Right = "right", + Center = "center", + Top = "top", + Bottom = "bottom" +} + +export enum PresStatus { + Autoplay = "auto", + Manual = "manual", + Edit = "edit" +}
\ No newline at end of file diff --git a/src/client/views/nodes/trails/index.ts b/src/client/views/nodes/trails/index.ts new file mode 100644 index 000000000..8f3f7b03a --- /dev/null +++ b/src/client/views/nodes/trails/index.ts @@ -0,0 +1,3 @@ +export * from "./PresBox"; +export * from "./PresElementBox"; +export * from "./PresEnums";
\ No newline at end of file diff --git a/src/client/views/pdf/AnchorMenu.tsx b/src/client/views/pdf/AnchorMenu.tsx index c24c4eaaf..70ca19842 100644 --- a/src/client/views/pdf/AnchorMenu.tsx +++ b/src/client/views/pdf/AnchorMenu.tsx @@ -10,6 +10,7 @@ import { AntimodeMenu, AntimodeMenuProps } from "../AntimodeMenu"; import { ButtonDropdown } from "../nodes/formattedText/RichTextMenu"; import "./AnchorMenu.scss"; import { SelectionManager } from "../../util/SelectionManager"; +import { LinkPopup } from "../linking/LinkPopup"; @observer export class AnchorMenu extends AntimodeMenu<AntimodeMenuProps> { @@ -38,6 +39,7 @@ export class AnchorMenu extends AntimodeMenu<AntimodeMenuProps> { @observable private _valueValue: string = ""; @observable private _added: boolean = false; @observable private highlightColor: string = "rgba(245, 230, 95, 0.616)"; + @observable private _showLinkPopup: boolean = false; @observable public _colorBtn = false; @observable public Highlighting: boolean = false; @@ -80,6 +82,14 @@ export class AnchorMenu extends AntimodeMenu<AntimodeMenuProps> { } } + @action + toggleLinkPopup = (e: React.MouseEvent) => { + //ignore the potential null type error because this method cannot be called unless the user selects text and clicks the link button + console.log(window.getSelection().toString()) + //change popup visibility field to visible + this._showLinkPopup = !this._showLinkPopup; + } + @computed get highlighter() { const button = <button className="antimodeMenu-button color-preview-button" title="" key="highlighter-button" onClick={this.highlightClicked}> @@ -136,6 +146,14 @@ export class AnchorMenu extends AntimodeMenu<AntimodeMenuProps> { <FontAwesomeIcon icon="comment-alt" size="lg" /> </button> </Tooltip>, + + //NOTE: link popup is currently incomplete + // <Tooltip key="link" title={<div className="dash-tooltip">{"Link selected text to document or URL"}</div>}> + // <button className="antimodeMenu-button link" onPointerDown={this.toggleLinkPopup} style={{}}> + // <FontAwesomeIcon icon="link" size="lg" /> + // </button> + // </Tooltip>, + // <LinkPopup showPopup={this._showLinkPopup} /> ] : [ <Tooltip key="trash" title={<div className="dash-tooltip">{"Remove Link Anchor"}</div>}> <button className="antimodeMenu-button" onPointerDown={this.Delete}> diff --git a/src/client/views/pdf/PDFViewer.tsx b/src/client/views/pdf/PDFViewer.tsx index 4a50dccf3..e8c7a4ab0 100644 --- a/src/client/views/pdf/PDFViewer.tsx +++ b/src/client/views/pdf/PDFViewer.tsx @@ -184,7 +184,8 @@ export class PDFViewer extends React.Component<IViewerProps> { const mainCont = this._mainCont.current; let focusSpeed: Opt<number>; if (doc !== this.props.rootDoc && mainCont && this._pdfViewer) { - const scrollTo = Utils.scrollIntoView(NumCast(doc.y), doc[HeightSym](), NumCast(this.props.layoutDoc._scrollTop), this.props.PanelHeight() / (this.props.scaling?.() || 1)); + const windowHeight = this.props.PanelHeight() / (this.props.scaling?.() || 1); + const scrollTo = Utils.scrollIntoView(NumCast(doc.y), doc[HeightSym](), NumCast(this.props.layoutDoc._scrollTop), windowHeight, .1 * windowHeight); if (scrollTo !== undefined) { focusSpeed = 500; diff --git a/src/client/views/topbar/TopBar.scss b/src/client/views/topbar/TopBar.scss new file mode 100644 index 000000000..ebdf030e7 --- /dev/null +++ b/src/client/views/topbar/TopBar.scss @@ -0,0 +1,213 @@ +@import "../global/globalCssVariables"; + +.topbar-container { + display: flex; + flex-direction: column; + width: 100%; + position: relative; + font-size: 10px; + line-height: 1; + overflow-y: auto; + overflow-x: visible; + background: $dark-gray; + overflow: visible; + z-index: 1000; + + .topbar-bar { + height: $topbar-height; + display: grid; + grid-auto-columns: 33.3% 33.3% 33.3%; + align-items: center; + background-color: $dark-gray; + + .topBar-icon { + cursor: pointer; + font-size: 12px; + width: fit-content; + display: flex; + justify-content: center; + gap: 4px; + align-items: center; + justify-self: center; + align-self: center; + border-radius: 5px; + padding: 5px; + transition: linear 0.1s; + color: $black; + background-color: $light-gray; + } + + .topBar-icon:hover { + background-color: $light-blue; + } + + + .topbar-center { + grid-column: 2; + display: inline-flex; + justify-content: center; + align-items: center; + gap: 5px; + + .topbar-lozenge-dashboard { + display: flex; + + .topbar-dashboards { + display: inline-flex; + } + + .topbar-dashSelect { + border: none; + background-color: $dark-gray; + color: $white; + font-family: 'Roboto'; + font-size: 17; + font-weight: 500; + + &:hover { + cursor: pointer; + } + } + } + } + + + .topbar-right { + grid-column: 3; + position: relative; + display: flex; + justify-content: flex-end; + gap: 5px; + margin-right: 5px; + } + + .topbar-left { + grid-column: 1; + color: black; + font-family: 'Roboto'; + position: relative; + display: flex; + width: 450; + gap: 5px; + + .topBar-icon:hover { + background-color: $logout-red; + } + + .topbar-lozenge-user, + .topbar-lozenge { + height: 23; + font-size: 12; + color: white; + font-family: 'Roboto'; + font-weight: 400; + padding: 4px; + align-self: center; + margin-left: 7px; + display: flex; + align-items: center; + + .topbar-dashSelect { + border: none; + background-color: transparent; + color: black; + font-family: 'Roboto'; + font-size: 17; + font-weight: 500; + + &:hover { + cursor: pointer; + } + } + } + + .topbar-logoff { + border-radius: 3px; + background: olivedrab; + color: white; + display: none; + margin-left: 5px; + padding: 1px 2px 1px 2px; + cursor: pointer; + } + + .topbar-logoff { + background: red; + } + + .topbar-lozenge-user:hover { + .topbar-logoff { + display: inline-block; + } + } + } + + .topbar-barChild { + + &.topbar-collection { + flex: 0 1 auto; + margin-left: 2px; + margin-right: 2px + } + + &.topbar-input { + margin:5px; + border-radius:20px; + border:$dark-gray; + display: block; + width: 130px; + -webkit-transition: width 0.4s; + transition: width 0.4s; + /* align-self: stretch; */ + outline: none; + + &:focus { + width: 500px; + outline: none; + } + } + + &.topbar-filter { + align-self: stretch; + + button { + transform: none; + + &:hover { + transform: none; + } + } + } + + &.topbar-submit { + margin-left: 2px; + margin-right: 2px + } + + &.topbar-close { + color: $white; + max-height: $topbar-height; + } + } + } +} + +.topbar-results { + display: flex; + flex-direction: column; + top: 300px; + display: flex; + flex-direction: column; + height: 100%; + overflow: visible; + + .no-result { + width: 500px; + background: $light-gray; + padding: 10px; + height: 50px; + text-transform: uppercase; + text-align: left; + font-weight: bold; + } +}
\ No newline at end of file diff --git a/src/client/views/topbar/TopBar.tsx b/src/client/views/topbar/TopBar.tsx new file mode 100644 index 000000000..bd9935333 --- /dev/null +++ b/src/client/views/topbar/TopBar.tsx @@ -0,0 +1,67 @@ +import { FontAwesomeIcon } from "@fortawesome/react-fontawesome"; +import { observer } from "mobx-react"; +import * as React from 'react'; +import { Doc, DocListCast } from '../../../fields/Doc'; +import { Id } from '../../../fields/FieldSymbols'; +import { StrCast } from '../../../fields/Types'; +import { Utils } from '../../../Utils'; +import { CurrentUserUtils } from "../../util/CurrentUserUtils"; +import { SettingsManager } from "../../util/SettingsManager"; +import { undoBatch } from "../../util/UndoManager"; +import { Borders, Colors } from "../global/globalEnums"; +import "./TopBar.scss"; + +/** + * REACT TYPE: FUNCTIONAL + * ABOUT: This is the topbar in Dash, which included the current Dashboard as well as access to information on the user + * and settings and help buttons. Future scope for this bar is to include the collaborators that are on the same Dashboard. + */ +@observer +export class TopBar extends React.Component { + render() { + const myDashboards = DocListCast(CurrentUserUtils.MyDashboards.data); + return ( + //TODO:glr Add support for light / dark mode + <div style={{ pointerEvents: "all" }} className="topbar-container"> + <div className="topbar-bar" style={{ background: Colors.DARK_GRAY, borderBottom: Borders.STANDARD }}> + <div className="topbar-left"> + <div className="topbar-lozenge-user"> + {`${Doc.CurrentUserEmail}`} + </div> + <div className="topbar-icon" onClick={() => window.location.assign(Utils.prepend("/logout"))}> + {"Sign out"} + </div> + </div> + <div className="topbar-center" > + <div className="topbar-lozenge-dashboard"> + <select className="topbar-dashSelect" onChange={e => CurrentUserUtils.openDashboard(Doc.UserDoc(), myDashboards[Number(e.target.value)])} + value={myDashboards.indexOf(CurrentUserUtils.ActiveDashboard)} + style={{ color: Colors.WHITE }}> + {myDashboards.map((dash, i) => <option key={dash[Id]} value={i}> {StrCast(dash.title)} </option>)} + </select> + </div> + <div className="topbar-dashboards"> + <div className="topbar-icon" onClick={undoBatch(() => CurrentUserUtils.createNewDashboard(Doc.UserDoc()))} + > + {"New"}<FontAwesomeIcon icon="plus"></FontAwesomeIcon> + </div> + {Doc.UserDoc().noviceMode ? (null) : <div className="topbar-icon" onClick={undoBatch(() => CurrentUserUtils.snapshotDashboard(Doc.UserDoc()))} + > + {"Snapshot"}<FontAwesomeIcon icon="camera"></FontAwesomeIcon> + </div>} + </div> + </div> + <div className="topbar-right" > + <div className="topbar-icon"> + {"Help"}<FontAwesomeIcon icon="question-circle"></FontAwesomeIcon> + </div> + <div className="topbar-icon" onClick={() => SettingsManager.Instance.open()}> + {"Settings"}<FontAwesomeIcon icon="cog"></FontAwesomeIcon> + </div> + + </div> + </div> + </div > + ); + } +}
\ No newline at end of file |
