aboutsummaryrefslogtreecommitdiff
path: root/src/client
diff options
context:
space:
mode:
Diffstat (limited to 'src/client')
-rw-r--r--src/client/ClientRecommender.scss2
-rw-r--r--src/client/DocServer.ts2
-rw-r--r--src/client/apis/google_docs/GooglePhotosClientUtils.ts2
-rw-r--r--src/client/documents/DocumentTypes.ts4
-rw-r--r--src/client/documents/Documents.ts139
-rw-r--r--src/client/goldenLayout.js3090
-rw-r--r--src/client/util/CaptureManager.scss2
-rw-r--r--src/client/util/CurrentUserUtils.ts164
-rw-r--r--src/client/util/DocumentManager.ts6
-rw-r--r--src/client/util/DragManager.ts37
-rw-r--r--src/client/util/GroupMemberView.tsx1
-rw-r--r--src/client/util/HypothesisUtils.ts2
-rw-r--r--src/client/util/InteractionUtils.tsx2
-rw-r--r--src/client/util/LinkManager.ts38
-rw-r--r--src/client/util/Scripting.ts2
-rw-r--r--src/client/util/SelectionManager.ts5
-rw-r--r--src/client/util/SettingsManager.scss4
-rw-r--r--src/client/util/SettingsManager.tsx79
-rw-r--r--src/client/util/SharingManager.tsx78
-rw-r--r--src/client/views/.DS_Storebin10244 -> 10244 bytes
-rw-r--r--src/client/views/AntimodeMenu.scss8
-rw-r--r--src/client/views/ContextMenu.scss20
-rw-r--r--src/client/views/ContextMenu.tsx2
-rw-r--r--src/client/views/DocComponent.tsx23
-rw-r--r--src/client/views/DocumentButtonBar.scss51
-rw-r--r--src/client/views/DocumentButtonBar.tsx35
-rw-r--r--src/client/views/DocumentDecorations.scss34
-rw-r--r--src/client/views/DocumentDecorations.tsx6
-rw-r--r--src/client/views/EditableView.scss8
-rw-r--r--src/client/views/GestureOverlay.tsx2
-rw-r--r--src/client/views/GlobalKeyHandler.ts4
-rw-r--r--src/client/views/InkControls.tsx142
-rw-r--r--src/client/views/InkHandles.tsx124
-rw-r--r--src/client/views/InkStroke.scss11
-rw-r--r--src/client/views/InkStrokeProperties.ts375
-rw-r--r--src/client/views/InkingStroke.scss11
-rw-r--r--src/client/views/InkingStroke.tsx216
-rw-r--r--src/client/views/LightboxView.scss30
-rw-r--r--src/client/views/LightboxView.tsx22
-rw-r--r--src/client/views/Main.scss6
-rw-r--r--src/client/views/Main.tsx1
-rw-r--r--src/client/views/MainView.scss115
-rw-r--r--src/client/views/MainView.tsx63
-rw-r--r--src/client/views/MarqueeAnnotator.tsx37
-rw-r--r--src/client/views/PropertiesButtons.scss16
-rw-r--r--src/client/views/PropertiesView.scss37
-rw-r--r--src/client/views/PropertiesView.tsx6
-rw-r--r--src/client/views/SidebarAnnos.tsx39
-rw-r--r--src/client/views/StyleProvider.tsx43
-rw-r--r--src/client/views/TemplateMenu.scss6
-rw-r--r--src/client/views/_nodeModuleOverrides.scss53
-rw-r--r--src/client/views/animationtimeline/Keyframe.scss10
-rw-r--r--src/client/views/animationtimeline/Keyframe.tsx2
-rw-r--r--src/client/views/animationtimeline/Timeline.scss6
-rw-r--r--src/client/views/animationtimeline/TimelineMenu.scss10
-rw-r--r--src/client/views/animationtimeline/TimelineOverview.scss2
-rw-r--r--src/client/views/animationtimeline/Track.scss6
-rw-r--r--src/client/views/collections/CollectionDockingView.scss114
-rw-r--r--src/client/views/collections/CollectionDockingView.tsx56
-rw-r--r--src/client/views/collections/CollectionLinearView.scss38
-rw-r--r--src/client/views/collections/CollectionLinearView.tsx10
-rw-r--r--src/client/views/collections/CollectionMenu.scss147
-rw-r--r--src/client/views/collections/CollectionMenu.tsx9
-rw-r--r--src/client/views/collections/CollectionPileView.tsx15
-rw-r--r--src/client/views/collections/CollectionSchemaView.tsx34
-rw-r--r--src/client/views/collections/CollectionStackingView.scss14
-rw-r--r--src/client/views/collections/CollectionStackingView.tsx6
-rw-r--r--src/client/views/collections/CollectionSubView.tsx51
-rw-r--r--src/client/views/collections/CollectionTimeView.tsx14
-rw-r--r--src/client/views/collections/CollectionTreeView.scss8
-rw-r--r--src/client/views/collections/CollectionTreeView.tsx2
-rw-r--r--src/client/views/collections/CollectionView.scss4
-rw-r--r--src/client/views/collections/CollectionView.tsx16
-rw-r--r--src/client/views/collections/TabDocView.scss59
-rw-r--r--src/client/views/collections/TabDocView.tsx123
-rw-r--r--src/client/views/collections/TreeView.scss6
-rw-r--r--src/client/views/collections/TreeView.tsx39
-rw-r--r--src/client/views/collections/collectionFreeForm/CollectionFreeFormLayoutEngines.tsx5
-rw-r--r--src/client/views/collections/collectionFreeForm/CollectionFreeFormRemoteCursors.scss2
-rw-r--r--src/client/views/collections/collectionFreeForm/CollectionFreeFormView.scss4
-rw-r--r--src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx29
-rw-r--r--src/client/views/collections/collectionFreeForm/MarqueeView.tsx7
-rw-r--r--src/client/views/collections/collectionMulticolumn/CollectionMulticolumnView.tsx4
-rw-r--r--src/client/views/collections/collectionMulticolumn/CollectionMultirowView.tsx4
-rw-r--r--src/client/views/collections/collectionSchema/CollectionSchemaCells.tsx (renamed from src/client/views/collections/CollectionSchemaCells.tsx)113
-rw-r--r--src/client/views/collections/collectionSchema/CollectionSchemaHeaders.tsx (renamed from src/client/views/collections/CollectionSchemaHeaders.tsx)16
-rw-r--r--src/client/views/collections/collectionSchema/CollectionSchemaMovableColumn.tsx128
-rw-r--r--src/client/views/collections/collectionSchema/CollectionSchemaMovableRow.tsx (renamed from src/client/views/collections/CollectionSchemaMovableTableHOC.tsx)141
-rw-r--r--src/client/views/collections/collectionSchema/CollectionSchemaView.scss (renamed from src/client/views/collections/CollectionSchemaView.scss)117
-rw-r--r--src/client/views/collections/collectionSchema/CollectionSchemaView.tsx575
-rw-r--r--src/client/views/collections/collectionSchema/SchemaTable.tsx (renamed from src/client/views/collections/SchemaTable.tsx)50
-rw-r--r--src/client/views/global/globalCssVariables.scss (renamed from src/client/views/globalCssVariables.scss)58
-rw-r--r--src/client/views/global/globalCssVariables.scss.d.ts (renamed from src/client/views/globalCssVariables.scss.d.ts)0
-rw-r--r--src/client/views/global/globalEnums.tsx38
-rw-r--r--src/client/views/linking/LinkEditor.scss22
-rw-r--r--src/client/views/linking/LinkMenu.scss28
-rw-r--r--src/client/views/linking/LinkMenu.tsx8
-rw-r--r--src/client/views/linking/LinkMenuGroup.tsx2
-rw-r--r--src/client/views/linking/LinkMenuItem.scss20
-rw-r--r--src/client/views/linking/LinkPopup.scss45
-rw-r--r--src/client/views/linking/LinkPopup.tsx114
-rw-r--r--src/client/views/nodes/AudioBox.tsx2
-rw-r--r--src/client/views/nodes/DocumentContentsView.tsx19
-rw-r--r--src/client/views/nodes/DocumentLinksButton.scss57
-rw-r--r--src/client/views/nodes/DocumentLinksButton.tsx160
-rw-r--r--src/client/views/nodes/DocumentView.scss8
-rw-r--r--src/client/views/nodes/DocumentView.tsx30
-rw-r--r--src/client/views/nodes/FieldView.tsx6
-rw-r--r--src/client/views/nodes/FontIconBox.scss13
-rw-r--r--src/client/views/nodes/FontIconBox.tsx3
-rw-r--r--src/client/views/nodes/ImageBox.tsx32
-rw-r--r--src/client/views/nodes/KeyValueBox.scss20
-rw-r--r--src/client/views/nodes/KeyValuePair.scss2
-rw-r--r--src/client/views/nodes/LinkDescriptionPopup.scss65
-rw-r--r--src/client/views/nodes/LinkDocPreview.tsx4
-rw-r--r--src/client/views/nodes/PDFBox.scss5
-rw-r--r--src/client/views/nodes/PDFBox.tsx63
-rw-r--r--src/client/views/nodes/RadialMenu.scss4
-rw-r--r--src/client/views/nodes/ScreenshotBox.tsx8
-rw-r--r--src/client/views/nodes/VideoBox.tsx10
-rw-r--r--src/client/views/nodes/WebBox.scss3
-rw-r--r--src/client/views/nodes/WebBox.tsx56
-rw-r--r--src/client/views/nodes/formattedText/DashFieldView.scss11
-rw-r--r--src/client/views/nodes/formattedText/FormattedTextBox.scss8
-rw-r--r--src/client/views/nodes/formattedText/FormattedTextBox.tsx86
-rw-r--r--src/client/views/nodes/formattedText/RichTextMenu.scss4
-rw-r--r--src/client/views/nodes/formattedText/RichTextMenu.tsx21
-rw-r--r--src/client/views/nodes/formattedText/TooltipTextMenu.scss10
-rw-r--r--src/client/views/nodes/trails/PresBox.scss (renamed from src/client/views/nodes/PresBox.scss)144
-rw-r--r--src/client/views/nodes/trails/PresBox.tsx (renamed from src/client/views/nodes/PresBox.tsx)184
-rw-r--r--src/client/views/nodes/trails/PresElementBox.scss (renamed from src/client/views/presentationview/PresElementBox.scss)0
-rw-r--r--src/client/views/nodes/trails/PresElementBox.tsx (renamed from src/client/views/presentationview/PresElementBox.tsx)50
-rw-r--r--src/client/views/nodes/trails/PresEnums.ts28
-rw-r--r--src/client/views/nodes/trails/index.ts3
-rw-r--r--src/client/views/pdf/AnchorMenu.tsx20
-rw-r--r--src/client/views/pdf/PDFViewer.tsx13
-rw-r--r--src/client/views/search/CheckBox.scss6
-rw-r--r--src/client/views/search/CollectionFilters.scss2
-rw-r--r--src/client/views/search/IconBar.scss2
-rw-r--r--src/client/views/search/IconButton.scss6
-rw-r--r--src/client/views/search/IconButton.tsx4
-rw-r--r--src/client/views/search/NaviconButton.scss4
-rw-r--r--src/client/views/search/SearchBox.scss2
-rw-r--r--src/client/views/search/SearchBox.tsx29
-rw-r--r--src/client/views/search/SelectorContextMenu.scss6
-rw-r--r--src/client/views/search/ToggleBar.scss8
-rw-r--r--src/client/views/topbar/TopBar.scss217
-rw-r--r--src/client/views/topbar/TopBar.tsx66
-rw-r--r--src/client/views/webcam/DashWebRTCVideo.scss2
149 files changed, 5428 insertions, 3614 deletions
diff --git a/src/client/ClientRecommender.scss b/src/client/ClientRecommender.scss
index 3f9102f15..178c7fdab 100644
--- a/src/client/ClientRecommender.scss
+++ b/src/client/ClientRecommender.scss
@@ -1,4 +1,4 @@
-// @import "/views/globalCssVariables.scss";
+// @import "/views/global/globalCssVariables.scss";
.space{
border: 1px dashed blue;
diff --git a/src/client/DocServer.ts b/src/client/DocServer.ts
index 1d7497cf8..59278d2af 100644
--- a/src/client/DocServer.ts
+++ b/src/client/DocServer.ts
@@ -225,7 +225,7 @@ export namespace DocServer {
* the server if the document has not been cached.
* @param id the id of the requested document
*/
- const _GetRefFieldImpl = (id: string, force: boolean = false): Promise<Opt<RefField>> => {
+ const _GetRefFieldImpl = async (id: string, force: boolean = false): Promise<Opt<RefField>> => {
// an initial pass through the cache to determine whether the document needs to be fetched,
// is already in the process of being fetched or already exists in the
// cache
diff --git a/src/client/apis/google_docs/GooglePhotosClientUtils.ts b/src/client/apis/google_docs/GooglePhotosClientUtils.ts
index 899e65a16..ff9460b62 100644
--- a/src/client/apis/google_docs/GooglePhotosClientUtils.ts
+++ b/src/client/apis/google_docs/GooglePhotosClientUtils.ts
@@ -285,7 +285,7 @@ export namespace GooglePhotos {
const photos = await endpoint();
const albumId = StrCast(collection.albumId);
if (albumId && albumId.length) {
- const enrichment = new photos.TextEnrichment(content || Utils.prepend("/doc/" + collection[Id]));
+ const enrichment = new photos.TextEnrichment(content || Doc.globalServerPath(collection));
const position = new photos.AlbumPosition(photos.AlbumPosition.POSITIONS.FIRST_IN_ALBUM);
const enrichmentItem = await photos.albums.addEnrichment(albumId, enrichment, position);
if (enrichmentItem) {
diff --git a/src/client/documents/DocumentTypes.ts b/src/client/documents/DocumentTypes.ts
index 8565784b4..dba7ff907 100644
--- a/src/client/documents/DocumentTypes.ts
+++ b/src/client/documents/DocumentTypes.ts
@@ -18,7 +18,7 @@ export enum DocumentType {
LABEL = "label", // simple text label
BUTTON = "button", // onClick button
WEBCAM = "webcam", // webcam
- HTMLANCHOR = "htmlanchor", // text selection anchor in PDF/Web
+ MARKER = "marker", // generic marker document not intended to be viewed independently of its context (e.g., for text selections in PDF/Web/RTF)
DATE = "date", // calendar view of a date
SCRIPTING = "script", // script editor
EQUATION = "equation", // equation editor
@@ -40,6 +40,4 @@ export enum DocumentType {
LINKDB = "linkdb", // database of links ??? why do we have this
SCRIPTDB = "scriptdb", // database of scripts
GROUPDB = "groupdb", // database of groups
-
- TEXTANCHOR = "textanchor" // selection of text in a text box
} \ No newline at end of file
diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts
index 24682cbd0..142c37ea4 100644
--- a/src/client/documents/Documents.ts
+++ b/src/client/documents/Documents.ts
@@ -30,7 +30,7 @@ import { CollectionDockingView } from "../views/collections/CollectionDockingVie
import { CollectionView, CollectionViewType } from "../views/collections/CollectionView";
import { ContextMenu } from "../views/ContextMenu";
import { ContextMenuProps } from "../views/ContextMenuItem";
-import { DFLT_IMAGE_NATIVE_DIM } from "../views/globalCssVariables.scss";
+import { DFLT_IMAGE_NATIVE_DIM } from "../views/global/globalCssVariables.scss";
import { ActiveArrowEnd, ActiveArrowStart, ActiveDash, ActiveFillColor, ActiveInkBezierApprox, ActiveInkColor, ActiveInkWidth, InkingStroke } from "../views/InkingStroke";
import { AudioBox } from "../views/nodes/AudioBox";
import { ColorBox } from "../views/nodes/ColorBox";
@@ -45,14 +45,14 @@ import { LabelBox } from "../views/nodes/LabelBox";
import { LinkBox } from "../views/nodes/LinkBox";
import { LinkDescriptionPopup } from "../views/nodes/LinkDescriptionPopup";
import { PDFBox } from "../views/nodes/PDFBox";
-import { PresBox } from "../views/nodes/PresBox";
+import { PresBox } from "../views/nodes/trails/PresBox";
import { ScreenshotBox } from "../views/nodes/ScreenshotBox";
import { ScriptingBox } from "../views/nodes/ScriptingBox";
import { SliderBox } from "../views/nodes/SliderBox";
import { TaskCompletionBox } from "../views/nodes/TaskCompletedBox";
import { VideoBox } from "../views/nodes/VideoBox";
import { WebBox } from "../views/nodes/WebBox";
-import { PresElementBox } from "../views/presentationview/PresElementBox";
+import { PresElementBox } from "../views/nodes/trails/PresElementBox";
import { SearchBox } from "../views/search/SearchBox";
import { DashWebRTCVideo } from "../views/webcam/DashWebRTCVideo";
import { DocumentType } from "./DocumentTypes";
@@ -427,7 +427,7 @@ export namespace Docs {
[DocumentType.PRESELEMENT, {
layout: { view: PresElementBox, dataField: defaultDataKey }
}],
- [DocumentType.HTMLANCHOR, {
+ [DocumentType.MARKER, {
layout: { view: CollectionView, dataField: defaultDataKey },
options: { links: ComputedField.MakeFunction("links(self)") as any, hideLinkButton: true }
}],
@@ -452,10 +452,6 @@ export namespace Docs {
layout: { view: EmptyBox, dataField: defaultDataKey },
options: { links: ComputedField.MakeFunction("links(self)") as any }
}],
- [DocumentType.TEXTANCHOR, {
- layout: { view: EmptyBox, dataField: defaultDataKey },
- options: { targetDropAction: "move", links: ComputedField.MakeFunction("links(self)") as any, hideLinkButton: true }
- }]
]);
const suffix = "Proto";
@@ -554,84 +550,6 @@ export namespace Docs {
export namespace Create {
/**
- * Synchronously returns a collection into which
- * the device documents will be put. This is initially empty,
- * but gets populated by updates from the web socket. When everything is over,
- * this function cleans up after itself.
- * s
- * Look at Websocket.ts for the server-side counterpart to this
- * function.
- */
- export function Buxton() {
- let responded = false;
- const loading = new Doc;
- loading.title = "Please wait for the import script...";
- const parent = TreeDocument([loading], {
- title: "The Buxton Collection",
- _width: 400,
- _height: 400
- });
- const parentProto = Doc.GetProto(parent);
- const { _socket } = DocServer;
-
- // just in case, clean up
- _socket.off(MessageStore.BuxtonDocumentResult.Message);
- _socket.off(MessageStore.BuxtonImportComplete.Message);
-
- // this is where the client handles the receipt of a new valid parsed document
- Utils.AddServerHandler(_socket, MessageStore.BuxtonDocumentResult, ({ device, invalid: errors }) => {
- if (!responded) {
- responded = true;
- parentProto.data = new List<Doc>();
- }
- if (device) {
- const { title, __images, additionalMedia } = device;
- delete device.__images;
- delete device.additionalMedia;
- const { ImageDocument, StackingDocument } = Docs.Create;
- const constructed = __images.map(({ url, nativeWidth, nativeHeight }) => ({ url: Utils.prepend(url), nativeWidth, nativeHeight }));
- const deviceImages = constructed.map(({ url, nativeWidth, nativeHeight }, i) => {
- const imageDoc = ImageDocument(url, {
- title: `image${i}.${extname(url)}`,
- _nativeWidth: nativeWidth,
- _nativeHeight: nativeHeight
- });
- const media = additionalMedia[i];
- if (media) {
- for (const key of Object.keys(media)) {
- imageDoc[`additionalMedia_${key}`] = Utils.prepend(`/files/${key}/buxton/${media[key]}`);
- }
- }
- return imageDoc;
- });
- // the main document we create
- const doc = StackingDocument(deviceImages, { title, hero: new ImageField(constructed[0].url) });
- doc.nameAliases = new List<string>([title.toLowerCase()]);
- // add the parsed attributes to this main document
- Doc.Get.FromJson({ data: device, appendToExisting: { targetDoc: Doc.GetProto(doc) } });
- Doc.AddDocToList(parentProto, "data", doc);
- } else if (errors) {
- console.log("Documents:" + errors);
- } else {
- alert("A Buxton document import was completely empty (??)");
- }
- });
-
- // when the import is complete, we stop listening for these creation
- // and termination events and alert the user
- Utils.AddServerHandler(_socket, MessageStore.BuxtonImportComplete, ({ deviceCount, errorCount }) => {
- _socket.off(MessageStore.BuxtonDocumentResult.Message);
- _socket.off(MessageStore.BuxtonImportComplete.Message);
- alert(`Successfully imported ${deviceCount} device${deviceCount === 1 ? "" : "s"}, with ${errorCount} error${errorCount === 1 ? "" : "s"}, in ${(Date.now() - startTime) / 1000} seconds.`);
- });
- const startTime = Date.now();
- Utils.Emit(_socket, MessageStore.BeginBuxtonImport, ""); // signal the server to start importing
- return parent; // synchronously return the collection, to be populateds
- }
-
- Scripting.addGlobal(Buxton);
-
- /**
* This function receives the relevant document prototype and uses
* it to create a new of that base-level prototype, or the
* underlying data document, which it then delegates again
@@ -660,7 +578,9 @@ export namespace Docs {
dataProps[`${fieldKey}-lastModified`] = new DateField;
dataProps["acl-Override"] = "None";
dataProps["acl-Public"] = Doc.UserDoc()?.defaultAclPrivate ? SharingPermissions.None : SharingPermissions.Add;
+
dataProps[fieldKey] = data;
+
// so that the list of annotations is already initialised, prevents issues in addonly.
// without this, if a doc has no annotations but the user has AddOnly privileges, they won't be able to add an annotation because they would have needed to create the field's list which they don't have permissions to do.
dataProps[fieldKey + "-annotations"] = new List<Doc>();
@@ -670,16 +590,16 @@ export namespace Docs {
viewProps["acl-Override"] = "None";
viewProps["acl-Public"] = Doc.UserDoc()?.defaultAclPrivate ? SharingPermissions.None : SharingPermissions.Add;
const viewDoc = Doc.assign(Doc.MakeDelegate(dataDoc, delegId), viewProps, true, true);
- ![DocumentType.LINK, DocumentType.TEXTANCHOR, DocumentType.LABEL].includes(viewDoc.type as any) && DocUtils.MakeLinkToActiveAudio(() => viewDoc);
+ ![DocumentType.LINK, DocumentType.MARKER, DocumentType.LABEL].includes(viewDoc.type as any) && DocUtils.MakeLinkToActiveAudio(() => viewDoc);
- !Doc.IsSystem(dataDoc) && ![DocumentType.HTMLANCHOR, DocumentType.KVP, DocumentType.LINK, DocumentType.LINKANCHOR, DocumentType.TEXTANCHOR].includes(proto.type as any) &&
+ !Doc.IsSystem(dataDoc) && ![DocumentType.MARKER, DocumentType.KVP, DocumentType.LINK, DocumentType.LINKANCHOR].includes(proto.type as any) &&
!dataDoc.isFolder && !dataProps.annotationOn && Doc.AddDocToList(Cast(Doc.UserDoc().myFileOrphans, Doc, null), "data", dataDoc);
return viewDoc;
}
export function ImageDocument(url: string, options: DocumentOptions = {}) {
- const imgField = new ImageField(new URL(url));
+ const imgField = new ImageField(url);
return InstanceFromProto(Prototypes.get(DocumentType.IMG), imgField, { title: path.basename(url), ...options });
}
@@ -693,11 +613,11 @@ export namespace Docs {
}
export function VideoDocument(url: string, options: DocumentOptions = {}) {
- return InstanceFromProto(Prototypes.get(DocumentType.VID), new VideoField(new URL(url)), options);
+ return InstanceFromProto(Prototypes.get(DocumentType.VID), new VideoField(url), options);
}
export function YoutubeDocument(url: string, options: DocumentOptions = {}) {
- return InstanceFromProto(Prototypes.get(DocumentType.YOUTUBE), new YoutubeField(new URL(url)), options);
+ return InstanceFromProto(Prototypes.get(DocumentType.YOUTUBE), new YoutubeField(url), options);
}
export function WebCamDocument(url: string, options: DocumentOptions = {}) {
@@ -713,7 +633,7 @@ export namespace Docs {
}
export function AudioDocument(url: string, options: DocumentOptions = {}) {
- return InstanceFromProto(Prototypes.get(DocumentType.AUDIO), new AudioField(new URL(url)),
+ return InstanceFromProto(Prototypes.get(DocumentType.AUDIO), new AudioField(url),
{ ...options, backgroundColor: ComputedField.MakeFunction("this._mediaState === 'playing' ? 'green':'gray'") as any });
}
@@ -786,11 +706,11 @@ export namespace Docs {
}
export function PdfDocument(url: string, options: DocumentOptions = {}) {
- return InstanceFromProto(Prototypes.get(DocumentType.PDF), new PdfField(new URL(url)), options);
+ return InstanceFromProto(Prototypes.get(DocumentType.PDF), new PdfField(url), options);
}
export function WebDocument(url: string, options: DocumentOptions = {}) {
- return InstanceFromProto(Prototypes.get(DocumentType.WEB), url ? new WebField(new URL(url)) : undefined, options);
+ return InstanceFromProto(Prototypes.get(DocumentType.WEB), url ? new WebField(url) : undefined, options);
}
export function HtmlDocument(html: string, options: DocumentOptions = {}) {
@@ -802,7 +722,7 @@ export namespace Docs {
}
export function TextanchorDocument(options: DocumentOptions = {}, id?: string) {
- return InstanceFromProto(Prototypes.get(DocumentType.TEXTANCHOR), undefined, options, id);
+ return InstanceFromProto(Prototypes.get(DocumentType.MARKER), undefined, options, id);
}
export function FreeformDocument(documents: Array<Doc>, options: DocumentOptions, id?: string) {
@@ -811,7 +731,7 @@ export namespace Docs {
return inst;
}
export function HTMLAnchorDocument(documents: Array<Doc>, options: DocumentOptions, id?: string) {
- return InstanceFromProto(Prototypes.get(DocumentType.HTMLANCHOR), new List(documents), options, id);
+ return InstanceFromProto(Prototypes.get(DocumentType.MARKER), new List(documents), options, id);
}
export function PileDocument(documents: Array<Doc>, options: DocumentOptions, id?: string) {
@@ -838,8 +758,8 @@ export namespace Docs {
return InstanceFromProto(Prototypes.get(DocumentType.COL), new List(documents), { schemaHeaders: new List(schemaHeaders), ...options, _viewType: CollectionViewType.Schema });
}
- export function TreeDocument(documents: Array<Doc>, options: DocumentOptions, id?: string) {
- return InstanceFromProto(Prototypes.get(DocumentType.COL), new List(documents), { ...options, _viewType: CollectionViewType.Tree }, id);
+ export function TreeDocument(documents: Array<Doc>, options: DocumentOptions, id?: string, protoId?: string) {
+ return InstanceFromProto(Prototypes.get(DocumentType.COL), new List(documents), { ...options, _viewType: CollectionViewType.Tree }, id, undefined, protoId);
}
export function StackingDocument(documents: Array<Doc>, options: DocumentOptions, id?: string, protoId?: string) {
@@ -889,8 +809,8 @@ export namespace Docs {
}
export function DockDocument(documents: Array<Doc>, config: string, options: DocumentOptions, id?: string) {
- const tabs = TreeDocument(documents, { title: "On-Screen Tabs", childDontRegisterViews: true, freezeChildren: "remove|add", treeViewExpandedViewLock: true, treeViewExpandedView: "data", _fitWidth: true, system: true });
- const all = TreeDocument([], { title: "Off-Screen Tabs", childDontRegisterViews: true, freezeChildren: "add", treeViewExpandedViewLock: true, treeViewExpandedView: "data", system: true });
+ const tabs = TreeDocument(documents, { title: "On-Screen Tabs", childDontRegisterViews: true, freezeChildren: "remove|add", treeViewExpandedViewLock: true, treeViewExpandedView: "data", _fitWidth: true, system: true, isFolder: true });
+ const all = TreeDocument([], { title: "Off-Screen Tabs", childDontRegisterViews: true, freezeChildren: "add", treeViewExpandedViewLock: true, treeViewExpandedView: "data", system: true, isFolder: true });
return InstanceFromProto(Prototypes.get(DocumentType.COL), new List([tabs, all]), { freezeChildren: "remove|add", treeViewExpandedViewLock: true, treeViewExpandedView: "data", ...options, _viewType: CollectionViewType.Docking, dockingConfig: config }, id);
}
@@ -1329,16 +1249,12 @@ export namespace DocUtils {
d._timecodeToShow = undefined; // bcz: this should be automatic somehow.. along with any other properties that were logically associated with the original collection
});
});
- if (x !== undefined && y !== undefined) {
- const newCollection = Docs.Create.PileDocument(docList, { title: "pileup", x: x - 55, y: y - 55, _width: 110, _height: 100, _overflow: "visible" });
- newCollection.x = NumCast(newCollection.x) + NumCast(newCollection._width) / 2 - 55;
- newCollection.y = NumCast(newCollection.y) + NumCast(newCollection._height) / 2 - 55;
- newCollection._width = newCollection._height = 110;
- //newCollection.borderRounding = "40px";
- newCollection._jitterRotation = 10;
- newCollection._backgroundColor = "gray";
- return newCollection;
- }
+ const newCollection = Docs.Create.PileDocument(docList, { title: "pileup", x: (x || 0) - 55, y: (y || 0) - 55, _width: 110, _height: 100, _overflow: "visible" });
+ newCollection.x = NumCast(newCollection.x) + NumCast(newCollection._width) / 2 - 55;
+ newCollection.y = NumCast(newCollection.y) + NumCast(newCollection._height) / 2 - 55;
+ newCollection._width = newCollection._height = 110;
+ newCollection._jitterRotation = 10;
+ return newCollection;
}
export function LeavePushpin(doc: Doc, annotationField: string) {
@@ -1436,4 +1352,7 @@ Scripting.addGlobal(function generateLinkTitle(self: Doc) {
const anchor2title = self.anchor2 && self.anchor2 !== self ? Cast(self.anchor2, Doc, null).title : "<?>";
const relation = self.linkRelationship || "to";
return `${anchor1title} (${relation}) ${anchor2title}`;
+});
+Scripting.addGlobal(function openTabAlias(tab: Doc) {
+ CollectionDockingView.AddSplit(Doc.MakeAlias(tab), "right");
}); \ No newline at end of file
diff --git a/src/client/goldenLayout.js b/src/client/goldenLayout.js
index 9cfea7f3f..238f1ac0a 100644
--- a/src/client/goldenLayout.js
+++ b/src/client/goldenLayout.js
@@ -82,16 +82,16 @@
return target;
};
- /**
- * This is based on Paul Irish's shim, but looks quite odd in comparison. Why?
- * Because
- * a) it shouldn't affect the global requestAnimationFrame function
- * b) it shouldn't pass on the time that has passed
- *
- * @param {Function} fn
- *
- * @returns {void}
- */
+ /**
+ * This is based on Paul Irish's shim, but looks quite odd in comparison. Why?
+ * Because
+ * a) it shouldn't affect the global requestAnimationFrame function
+ * b) it shouldn't pass on the time that has passed
+ *
+ * @param {Function} fn
+ *
+ * @returns {void}
+ */
lm.utils.animFrame = function (fn) {
return (window.requestAnimationFrame ||
window.webkitRequestAnimationFrame ||
@@ -178,16 +178,16 @@
.replace('.', '');
};
- /**
- * A basic XSS filter. It is ultimately up to the
- * implementing developer to make sure their particular
- * applications and usecases are save from cross site scripting attacks
- *
- * @param {String} input
- * @param {Boolean} keepTags
- *
- * @returns {String} filtered input
- */
+ /**
+ * A basic XSS filter. It is ultimately up to the
+ * implementing developer to make sure their particular
+ * applications and usecases are save from cross site scripting attacks
+ *
+ * @param {String} input
+ * @param {Boolean} keepTags
+ *
+ * @returns {String} filtered input
+ */
lm.utils.filterXss = function (input, keepTags) {
var output = input
@@ -206,41 +206,41 @@
}
};
- /**
- * Removes html tags from a string
- *
- * @param {String} input
- *
- * @returns {String} input without tags
- */
+ /**
+ * Removes html tags from a string
+ *
+ * @param {String} input
+ *
+ * @returns {String} input without tags
+ */
lm.utils.stripTags = function (input) {
return $.trim(input.replace(/(<([^>]+)>)/ig, ''));
};
- /**
- * A generic and very fast EventEmitter
- * implementation. On top of emitting the
- * actual event it emits an
- *
- * lm.utils.EventEmitter.ALL_EVENT
- *
- * event for every event triggered. This allows
- * to hook into it and proxy events forwards
- *
- * @constructor
- */
+ /**
+ * A generic and very fast EventEmitter
+ * implementation. On top of emitting the
+ * actual event it emits an
+ *
+ * lm.utils.EventEmitter.ALL_EVENT
+ *
+ * event for every event triggered. This allows
+ * to hook into it and proxy events forwards
+ *
+ * @constructor
+ */
lm.utils.EventEmitter = function () {
this._mSubscriptions = {};
this._mSubscriptions[lm.utils.EventEmitter.ALL_EVENT] = [];
- /**
- * Listen for events
- *
- * @param {String} sEvent The name of the event to listen to
- * @param {Function} fCallback The callback to execute when the event occurs
- * @param {[Object]} oContext The value of the this pointer within the callback function
- *
- * @returns {void}
- */
+ /**
+ * Listen for events
+ *
+ * @param {String} sEvent The name of the event to listen to
+ * @param {Function} fCallback The callback to execute when the event occurs
+ * @param {[Object]} oContext The value of the this pointer within the callback function
+ *
+ * @returns {void}
+ */
this.on = function (sEvent, fCallback, oContext) {
if (!lm.utils.isFunction(fCallback)) {
throw new Error('Tried to listen to event ' + sEvent + ' with non-function callback ' + fCallback);
@@ -253,14 +253,14 @@
this._mSubscriptions[sEvent].push({ fn: fCallback, ctx: oContext });
};
- /**
- * Emit an event and notify listeners
- *
- * @param {String} sEvent The name of the event
- * @param {Mixed} various additional arguments that will be passed to the listener
- *
- * @returns {void}
- */
+ /**
+ * Emit an event and notify listeners
+ *
+ * @param {String} sEvent The name of the event
+ * @param {Mixed} various additional arguments that will be passed to the listener
+ *
+ * @returns {void}
+ */
this.emit = function (sEvent) {
var i, ctx, args;
@@ -286,15 +286,15 @@
}
};
- /**
- * Removes a listener for an event, or all listeners if no callback and context is provided.
- *
- * @param {String} sEvent The name of the event
- * @param {Function} fCallback The previously registered callback method (optional)
- * @param {Object} oContext The previously registered context (optional)
- *
- * @returns {void}
- */
+ /**
+ * Removes a listener for an event, or all listeners if no callback and context is provided.
+ *
+ * @param {String} sEvent The name of the event
+ * @param {Function} fCallback The previously registered callback method (optional)
+ * @param {Object} oContext The previously registered context (optional)
+ *
+ * @returns {void}
+ */
this.unbind = function (sEvent, fCallback, oContext) {
if (!this._mSubscriptions[sEvent]) {
throw new Error('No subscribtions to unsubscribe for event ' + sEvent);
@@ -318,28 +318,28 @@
}
};
- /**
- * Alias for unbind
- */
+ /**
+ * Alias for unbind
+ */
this.off = this.unbind;
- /**
- * Alias for emit
- */
+ /**
+ * Alias for emit
+ */
this.trigger = this.emit;
};
- /**
- * The name of the event that's triggered for every other event
- *
- * usage
- *
- * myEmitter.on( lm.utils.EventEmitter.ALL_EVENT, function( eventName, argsArray ){
- * //do stuff
- * });
- *
- * @type {String}
- */
+ /**
+ * The name of the event that's triggered for every other event
+ *
+ * usage
+ *
+ * myEmitter.on( lm.utils.EventEmitter.ALL_EVENT, function( eventName, argsArray ){
+ * //do stuff
+ * });
+ *
+ * @type {String}
+ */
lm.utils.EventEmitter.ALL_EVENT = '__all';
lm.utils.DragListener = function (eElement, nButtonCode) {
lm.utils.EventEmitter.call(this);
@@ -349,14 +349,14 @@
this._eBody = $(document.body);
this._nButtonCode = nButtonCode || 0;
- /**
- * The delay after which to start the drag in milliseconds
- */
+ /**
+ * The delay after which to start the drag in milliseconds
+ */
this._nDelay = 200;
- /**
- * The distance the mouse needs to be moved to qualify as a drag
- */
+ /**
+ * The distance the mouse needs to be moved to qualify as a drag
+ */
this._nDistance = 10;//TODO - works better with delay only
this._nX = 0;
@@ -459,16 +459,16 @@
};
}
});
- /**
- * The main class that will be exposed as GoldenLayout.
- *
- * @public
- * @constructor
- * @param {GoldenLayout config} config
- * @param {[DOM element container]} container Can be a jQuery selector string or a Dom element. Defaults to body
- *
- * @returns {VOID}
- */
+ /**
+ * The main class that will be exposed as GoldenLayout.
+ *
+ * @public
+ * @constructor
+ * @param {GoldenLayout config} config
+ * @param {[DOM element container]} container Can be a jQuery selector string or a Dom element. Defaults to body
+ *
+ * @returns {VOID}
+ */
lm.LayoutManager = function (config, container) {
if (!$ || typeof $.noConflict !== 'function') {
@@ -521,59 +521,59 @@
};
};
- /**
- * Hook that allows to access private classes
- */
+ /**
+ * Hook that allows to access private classes
+ */
lm.LayoutManager.__lm = lm;
- /**
- * Takes a GoldenLayout configuration object and
- * replaces its keys and values recursively with
- * one letter codes
- *
- * @static
- * @public
- * @param {Object} config A GoldenLayout config object
- *
- * @returns {Object} minified config
- */
+ /**
+ * Takes a GoldenLayout configuration object and
+ * replaces its keys and values recursively with
+ * one letter codes
+ *
+ * @static
+ * @public
+ * @param {Object} config A GoldenLayout config object
+ *
+ * @returns {Object} minified config
+ */
lm.LayoutManager.minifyConfig = function (config) {
return (new lm.utils.ConfigMinifier()).minifyConfig(config);
};
- /**
- * Takes a configuration Object that was previously minified
- * using minifyConfig and returns its original version
- *
- * @static
- * @public
- * @param {Object} minifiedConfig
- *
- * @returns {Object} the original configuration
- */
+ /**
+ * Takes a configuration Object that was previously minified
+ * using minifyConfig and returns its original version
+ *
+ * @static
+ * @public
+ * @param {Object} minifiedConfig
+ *
+ * @returns {Object} the original configuration
+ */
lm.LayoutManager.unminifyConfig = function (config) {
return (new lm.utils.ConfigMinifier()).unminifyConfig(config);
};
lm.utils.copy(lm.LayoutManager.prototype, {
- /**
- * Register a component with the layout manager. If a configuration node
- * of type component is reached it will look up componentName and create the
- * associated component
- *
- * {
- * type: "component",
- * componentName: "EquityNewsFeed",
- * componentState: { "feedTopic": "us-bluechips" }
- * }
- *
- * @public
- * @param {String} name
- * @param {Function} constructor
- *
- * @returns {void}
- */
+ /**
+ * Register a component with the layout manager. If a configuration node
+ * of type component is reached it will look up componentName and create the
+ * associated component
+ *
+ * {
+ * type: "component",
+ * componentName: "EquityNewsFeed",
+ * componentState: { "feedTopic": "us-bluechips" }
+ * }
+ *
+ * @public
+ * @param {String} name
+ * @param {Function} constructor
+ *
+ * @returns {void}
+ */
registerComponent: function (name, constructor) {
if (typeof constructor !== 'function') {
throw new Error('Please register a constructor function');
@@ -586,12 +586,12 @@
this._components[name] = constructor;
},
- /**
- * Creates a layout configuration object based on the the current state
- *
- * @public
- * @returns {Object} GoldenLayout configuration
- */
+ /**
+ * Creates a layout configuration object based on the the current state
+ *
+ * @public
+ * @returns {Object} GoldenLayout configuration
+ */
toConfig: function (root) {
var config, next, i;
@@ -603,18 +603,18 @@
throw new Error('Root must be a ContentItem');
}
- /*
- * settings & labels
- */
+ /*
+ * settings & labels
+ */
config = {
settings: lm.utils.copy({}, this.config.settings),
dimensions: lm.utils.copy({}, this.config.dimensions),
labels: lm.utils.copy({}, this.config.labels)
};
- /*
- * Content
- */
+ /*
+ * Content
+ */
config.content = [];
next = function (configNode, item) {
var key, i;
@@ -641,30 +641,30 @@
next(config, this.root);
}
- /*
- * Retrieve config for subwindows
- */
+ /*
+ * Retrieve config for subwindows
+ */
this._$reconcilePopoutWindows();
config.openPopouts = [];
for (i = 0; i < this.openPopouts.length; i++) {
config.openPopouts.push(this.openPopouts[i].toConfig());
}
- /*
- * Add maximised item
- */
+ /*
+ * Add maximised item
+ */
config.maximisedItemId = this._maximisedItem ? '__glMaximised' : null;
return config;
},
- /**
- * Returns a previously registered component
- *
- * @public
- * @param {String} name The name used
- *
- * @returns {Function}
- */
+ /**
+ * Returns a previously registered component
+ *
+ * @public
+ * @param {String} name The name used
+ *
+ * @returns {Function}
+ */
getComponent: function (name) {
if (this._components[name] === undefined) {
throw new lm.errors.ConfigurationError('Unknown component "' + name + '"');
@@ -673,44 +673,44 @@
return this._components[name];
},
- /**
- * Creates the actual layout. Must be called after all initial components
- * are registered. Recurses through the configuration and sets up
- * the item tree.
- *
- * If called before the document is ready it adds itself as a listener
- * to the document.ready event
- *
- * @public
- *
- * @returns {void}
- */
+ /**
+ * Creates the actual layout. Must be called after all initial components
+ * are registered. Recurses through the configuration and sets up
+ * the item tree.
+ *
+ * If called before the document is ready it adds itself as a listener
+ * to the document.ready event
+ *
+ * @public
+ *
+ * @returns {void}
+ */
init: function () {
- /**
- * Create the popout windows straight away. If popouts are blocked
- * an error is thrown on the same 'thread' rather than a timeout and can
- * be caught. This also prevents any further initilisation from taking place.
- */
+ /**
+ * Create the popout windows straight away. If popouts are blocked
+ * an error is thrown on the same 'thread' rather than a timeout and can
+ * be caught. This also prevents any further initilisation from taking place.
+ */
if (this._subWindowsCreated === false) {
this._createSubWindows();
this._subWindowsCreated = true;
}
- /**
- * If the document isn't ready yet, wait for it.
- */
+ /**
+ * If the document isn't ready yet, wait for it.
+ */
if (document.readyState === 'loading' || document.body === null) {
$(document).ready(lm.utils.fnBind(this.init, this));
return;
}
- /**
- * If this is a subwindow, wait a few milliseconds for the original
- * page's js calls to be executed, then replace the bodies content
- * with GoldenLayout
- */
+ /**
+ * If this is a subwindow, wait a few milliseconds for the original
+ * page's js calls to be executed, then replace the bodies content
+ * with GoldenLayout
+ */
if (this.isSubWindow === true && this._creationTimeoutPassed === false) {
setTimeout(lm.utils.fnBind(this.init, this), 7);
this._creationTimeoutPassed = true;
@@ -732,15 +732,15 @@
this.emit('initialised');
},
- /**
- * Updates the layout managers size
- *
- * @public
- * @param {[int]} width height in pixels
- * @param {[int]} height width in pixels
- *
- * @returns {void}
- */
+ /**
+ * Updates the layout managers size
+ *
+ * @public
+ * @param {[int]} width height in pixels
+ * @param {[int]} height width in pixels
+ *
+ * @returns {void}
+ */
updateSize: function (width, height) {
if (arguments.length === 2) {
this.width = width;
@@ -763,13 +763,13 @@
}
},
- /**
- * Destroys the LayoutManager instance itself as well as every ContentItem
- * within it. After this is called nothing should be left of the LayoutManager.
- *
- * @public
- * @returns {void}
- */
+ /**
+ * Destroys the LayoutManager instance itself as well as every ContentItem
+ * within it. After this is called nothing should be left of the LayoutManager.
+ *
+ * @public
+ * @returns {void}
+ */
destroy: function () {
if (this.isInitialised === false) {
return;
@@ -793,16 +793,16 @@
this._dragSources = [];
},
- /**
- * Recursively creates new item tree structures based on a provided
- * ItemConfiguration object
- *
- * @public
- * @param {Object} config ItemConfig
- * @param {[ContentItem]} parent The item the newly created item should be a child of
- *
- * @returns {lm.items.ContentItem}
- */
+ /**
+ * Recursively creates new item tree structures based on a provided
+ * ItemConfiguration object
+ *
+ * @public
+ * @param {Object} config ItemConfig
+ * @param {[ContentItem]} parent The item the newly created item should be a child of
+ *
+ * @returns {lm.items.ContentItem}
+ */
createContentItem: function (config, parent) {
var typeErrorMsg, contentItem;
@@ -823,9 +823,9 @@
}
- /**
- * We add an additional stack around every component that's not within a stack anyways.
- */
+ /**
+ * We add an additional stack around every component that's not within a stack anyways.
+ */
if (
// If this is a component
config.type === 'component' &&
@@ -851,17 +851,17 @@
return contentItem;
},
- /**
- * Creates a popout window with the specified content and dimensions
- *
- * @param {Object|lm.itemsAbstractContentItem} configOrContentItem
- * @param {[Object]} dimensions A map with width, height, left and top
- * @param {[String]} parentId the id of the element this item will be appended to
- * when popIn is called
- * @param {[Number]} indexInParent The position of this item within its parent element
+ /**
+ * Creates a popout window with the specified content and dimensions
+ *
+ * @param {Object|lm.itemsAbstractContentItem} configOrContentItem
+ * @param {[Object]} dimensions A map with width, height, left and top
+ * @param {[String]} parentId the id of the element this item will be appended to
+ * when popIn is called
+ * @param {[Number]} indexInParent The position of this item within its parent element
- * @returns {lm.controls.BrowserPopout}
- */
+ * @returns {lm.controls.BrowserPopout}
+ */
createPopout: function (configOrContentItem, dimensions, parentId, indexInParent) {
var config = configOrContentItem,
isItem = configOrContentItem instanceof lm.items.AbstractContentItem,
@@ -879,14 +879,14 @@
config = this.toConfig(configOrContentItem).content;
parentId = lm.utils.getUniqueId();
- /**
- * If the item is the only component within a stack or for some
- * other reason the only child of its parent the parent will be destroyed
- * when the child is removed.
- *
- * In order to support this we move up the tree until we find something
- * that will remain after the item is being popped out
- */
+ /**
+ * If the item is the only component within a stack or for some
+ * other reason the only child of its parent the parent will be destroyed
+ * when the child is removed.
+ *
+ * In order to support this we move up the tree until we find something
+ * that will remain after the item is being popped out
+ */
parent = configOrContentItem.parent;
child = configOrContentItem;
while (parent.contentItems.length === 1 && !parent.isRoot) {
@@ -946,16 +946,16 @@
return browserPopout;
},
- /**
- * Attaches DragListener to any given DOM element
- * and turns it into a way of creating new ContentItems
- * by 'dragging' the DOM element into the layout
- *
- * @param {jQuery DOM element} element
- * @param {Object|Function} itemConfig for the new item to be created, or a function which will provide it
- *
- * @returns {void}
- */
+ /**
+ * Attaches DragListener to any given DOM element
+ * and turns it into a way of creating new ContentItems
+ * by 'dragging' the DOM element into the layout
+ *
+ * @param {jQuery DOM element} element
+ * @param {Object|Function} itemConfig for the new item to be created, or a function which will provide it
+ *
+ * @returns {void}
+ */
createDragSource: function (element, itemConfig) {
this.config.settings.constrainDragToContainer = false;
var dragSource = new lm.controls.DragSource($(element), itemConfig, this);
@@ -964,17 +964,17 @@
return dragSource;
},
- /**
- * Programmatically selects an item. This deselects
- * the currently selected item, selects the specified item
- * and emits a selectionChanged event
- *
- * @param {lm.item.AbstractContentItem} item#
- * @param {[Boolean]} _$silent Wheather to notify the item of its selection
- * @event selectionChanged
- *
- * @returns {VOID}
- */
+ /**
+ * Programmatically selects an item. This deselects
+ * the currently selected item, selects the specified item
+ * and emits a selectionChanged event
+ *
+ * @param {lm.item.AbstractContentItem} item#
+ * @param {[Boolean]} _$silent Wheather to notify the item of its selection
+ * @event selectionChanged
+ *
+ * @returns {VOID}
+ */
selectItem: function (item, _$silent) {
if (this.config.settings.selectionEnabled !== true) {
@@ -998,9 +998,9 @@
this.emit('selectionChanged', item);
},
- /*************************
- * PACKAGE PRIVATE
- *************************/
+ /*************************
+ * PACKAGE PRIVATE
+ *************************/
_$maximiseItem: function (contentItem) {
if (this._maximisedItem !== null) {
this._$minimiseItem(this._maximisedItem);
@@ -1028,20 +1028,20 @@
this.emit('stateChanged');
},
- /**
- * This method is used to get around sandboxed iframe restrictions.
- * If 'allow-top-navigation' is not specified in the iframe's 'sandbox' attribute
- * (as is the case with codepens) the parent window is forbidden from calling certain
- * methods on the child, such as window.close() or setting document.location.href.
- *
- * This prevented GoldenLayout popouts from popping in in codepens. The fix is to call
- * _$closeWindow on the child window's gl instance which (after a timeout to disconnect
- * the invoking method from the close call) closes itself.
- *
- * @packagePrivate
- *
- * @returns {void}
- */
+ /**
+ * This method is used to get around sandboxed iframe restrictions.
+ * If 'allow-top-navigation' is not specified in the iframe's 'sandbox' attribute
+ * (as is the case with codepens) the parent window is forbidden from calling certain
+ * methods on the child, such as window.close() or setting document.location.href.
+ *
+ * This prevented GoldenLayout popouts from popping in in codepens. The fix is to call
+ * _$closeWindow on the child window's gl instance which (after a timeout to disconnect
+ * the invoking method from the close call) closes itself.
+ *
+ * @packagePrivate
+ *
+ * @returns {void}
+ */
_$closeWindow: function () {
window.setTimeout(function () {
window.close();
@@ -1088,13 +1088,13 @@
var i, area, allContentItems = this._getAllContentItems();
this._itemAreas = [];
- /**
- * If the last item is dragged out, highlight the entire container size to
- * allow to re-drop it. allContentItems[ 0 ] === this.root at this point
- *
- * Don't include root into the possible drop areas though otherwise since it
- * will used for every gap in the layout, e.g. splitters
- */
+ /**
+ * If the last item is dragged out, highlight the entire container size to
+ * allow to re-drop it. allContentItems[ 0 ] === this.root at this point
+ *
+ * Don't include root into the possible drop areas though otherwise since it
+ * will used for every gap in the layout, e.g. splitters
+ */
if (allContentItems.length === 1) {
this._itemAreas.push(this.root._$getArea());
return;
@@ -1124,18 +1124,18 @@
}
},
- /**
- * Takes a contentItem or a configuration and optionally a parent
- * item and returns an initialised instance of the contentItem.
- * If the contentItem is a function, it is first called
- *
- * @packagePrivate
- *
- * @param {lm.items.AbtractContentItem|Object|Function} contentItemOrConfig
- * @param {lm.items.AbtractContentItem} parent Only necessary when passing in config
- *
- * @returns {lm.items.AbtractContentItem}
- */
+ /**
+ * Takes a contentItem or a configuration and optionally a parent
+ * item and returns an initialised instance of the contentItem.
+ * If the contentItem is a function, it is first called
+ *
+ * @packagePrivate
+ *
+ * @param {lm.items.AbtractContentItem|Object|Function} contentItemOrConfig
+ * @param {lm.items.AbtractContentItem} parent Only necessary when passing in config
+ *
+ * @returns {lm.items.AbtractContentItem}
+ */
_$normalizeContentItem: function (contentItemOrConfig, parent) {
if (!contentItemOrConfig) {
throw new Error('No content item defined');
@@ -1158,15 +1158,15 @@
}
},
- /**
- * Iterates through the array of open popout windows and removes the ones
- * that are effectively closed. This is necessary due to the lack of reliably
- * listening for window.close / unload events in a cross browser compatible fashion.
- *
- * @packagePrivate
- *
- * @returns {void}
- */
+ /**
+ * Iterates through the array of open popout windows and removes the ones
+ * that are effectively closed. This is necessary due to the lack of reliably
+ * listening for window.close / unload events in a cross browser compatible fashion.
+ *
+ * @packagePrivate
+ *
+ * @returns {void}
+ */
_$reconcilePopoutWindows: function () {
var openPopouts = [], i;
@@ -1185,17 +1185,17 @@
},
- /***************************
- * PRIVATE
- ***************************/
- /**
- * Returns a flattened array of all content items,
- * regardles of level or type
- *
- * @private
- *
- * @returns {void}
- */
+ /***************************
+ * PRIVATE
+ ***************************/
+ /**
+ * Returns a flattened array of all content items,
+ * regardles of level or type
+ *
+ * @private
+ *
+ * @returns {void}
+ */
_getAllContentItems: function () {
var allContentItems = [];
@@ -1214,13 +1214,13 @@
return allContentItems;
},
- /**
- * Binds to DOM/BOM events on init
- *
- * @private
- *
- * @returns {void}
- */
+ /**
+ * Binds to DOM/BOM events on init
+ *
+ * @private
+ *
+ * @returns {void}
+ */
_bindEvents: function () {
if (this._isFullPage) {
$(window).resize(this._resizeFunction);
@@ -1228,27 +1228,27 @@
$(window).on('unload beforeunload', this._unloadFunction);
},
- /**
- * Debounces resize events
- *
- * @private
- *
- * @returns {void}
- */
+ /**
+ * Debounces resize events
+ *
+ * @private
+ *
+ * @returns {void}
+ */
_onResize: function () {
clearTimeout(this._resizeTimeoutId);
this._resizeTimeoutId = setTimeout(lm.utils.fnBind(this.updateSize, this), 100);
},
- /**
- * Extends the default config with the user specific settings and applies
- * derivations. Please note that there's a seperate method (AbstractContentItem._extendItemNode)
- * that deals with the extension of item configs
- *
- * @param {Object} config
- * @static
- * @returns {Object} config
- */
+ /**
+ * Extends the default config with the user specific settings and applies
+ * derivations. Please note that there's a seperate method (AbstractContentItem._extendItemNode)
+ * that deals with the extension of item configs
+ *
+ * @param {Object} config
+ * @static
+ * @returns {Object} config
+ */
_createConfig: function (config) {
var windowConfigKey = lm.utils.getQueryStringParam('gl-window');
@@ -1283,14 +1283,14 @@
return config;
},
- /**
- * This is executed when GoldenLayout detects that it is run
- * within a previously opened popout window.
- *
- * @private
- *
- * @returns {void}
- */
+ /**
+ * This is executed when GoldenLayout detects that it is run
+ * within a previously opened popout window.
+ *
+ * @private
+ *
+ * @returns {void}
+ */
_adjustToWindowMode: function () {
var popInButton = $('<div class="lm_popin" title="' + this.config.labels.popin + '">' +
'<div class="lm_icon"></div>' +
@@ -1310,26 +1310,26 @@
.css('visibility', 'visible')
.append(popInButton);
- /*
- * This seems a bit pointless, but actually causes a reflow/re-evaluation getting around
- * slickgrid's "Cannot find stylesheet." bug in chrome
- */
+ /*
+ * This seems a bit pointless, but actually causes a reflow/re-evaluation getting around
+ * slickgrid's "Cannot find stylesheet." bug in chrome
+ */
var x = document.body.offsetHeight; // jshint ignore:line
- /*
- * Expose this instance on the window object
- * to allow the opening window to interact with
- * it
- */
+ /*
+ * Expose this instance on the window object
+ * to allow the opening window to interact with
+ * it
+ */
window.__glInstance = this;
},
- /**
- * Creates Subwindows (if there are any). Throws an error
- * if popouts are blocked.
- *
- * @returns {void}
- */
+ /**
+ * Creates Subwindows (if there are any). Throws an error
+ * if popouts are blocked.
+ *
+ * @returns {void}
+ */
_createSubWindows: function () {
var i, popout;
@@ -1345,13 +1345,13 @@
}
},
- /**
- * Determines what element the layout will be created in
- *
- * @private
- *
- * @returns {void}
- */
+ /**
+ * Determines what element the layout will be created in
+ *
+ * @private
+ *
+ * @returns {void}
+ */
_setContainer: function () {
var container = $(this.container || 'body');
@@ -1377,13 +1377,13 @@
this.container = container;
},
- /**
- * Kicks of the initial, recursive creation chain
- *
- * @param {Object} config GoldenLayout Config
- *
- * @returns {void}
- */
+ /**
+ * Kicks of the initial, recursive creation chain
+ *
+ * @param {Object} config GoldenLayout Config
+ *
+ * @returns {void}
+ */
_create: function (config) {
var errorMsg;
@@ -1410,12 +1410,12 @@
}
},
- /**
- * Called when the window is closed or the user navigates away
- * from the page
- *
- * @returns {void}
- */
+ /**
+ * Called when the window is closed or the user navigates away
+ * from the page
+ *
+ * @returns {void}
+ */
_onUnload: function () {
if (this.config.settings.closePopoutsOnUnload === true) {
for (var i = 0; i < this.openPopouts.length; i++) {
@@ -1424,11 +1424,11 @@
}
},
- /**
- * Adjusts the number of columns to be lower to fit the screen and still maintain minItemWidth.
- *
- * @returns {void}
- */
+ /**
+ * Adjusts the number of columns to be lower to fit the screen and still maintain minItemWidth.
+ *
+ * @returns {void}
+ */
_adjustColumnsResponsive: function () {
// If there is no min width set, or not content items, do nothing.
@@ -1470,21 +1470,21 @@
this._updatingColumnsResponsive = false;
},
- /**
- * Determines if responsive layout should be used.
- *
- * @returns {bool} - True if responsive layout should be used; otherwise false.
- */
+ /**
+ * Determines if responsive layout should be used.
+ *
+ * @returns {bool} - True if responsive layout should be used; otherwise false.
+ */
_useResponsiveLayout: function () {
return this.config.settings && (this.config.settings.responsiveMode == 'always' || (this.config.settings.responsiveMode == 'onload' && this._firstLoad));
},
- /**
- * Adds all children of a node to another container recursively.
- * @param {object} container - Container to add child content items to.
- * @param {object} node - Node to search for content items.
- * @returns {void}
- */
+ /**
+ * Adds all children of a node to another container recursively.
+ * @param {object} container - Container to add child content items to.
+ * @param {object} node - Node to search for content items.
+ * @returns {void}
+ */
_addChildContentItemsToContainer: function (container, node) {
if (node.type === 'stack') {
node.contentItems.forEach(function (item) {
@@ -1499,10 +1499,10 @@
}
},
- /**
- * Finds all the stack containers.
- * @returns {array} - The found stack containers.
- */
+ /**
+ * Finds all the stack containers.
+ * @returns {array} - The found stack containers.
+ */
_findAllStackContainers: function () {
var stackContainers = [];
this._findAllStackContainersRecursive(stackContainers, this.root);
@@ -1510,14 +1510,14 @@
return stackContainers;
},
- /**
- * Finds all the stack containers.
- *
- * @param {array} - Set of containers to populate.
- * @param {object} - Current node to process.
- *
- * @returns {void}
- */
+ /**
+ * Finds all the stack containers.
+ *
+ * @param {array} - Set of containers to populate.
+ * @param {object} - Current node to process.
+ *
+ * @returns {void}
+ */
_findAllStackContainersRecursive: function (stackContainers, node) {
node.contentItems.forEach(lm.utils.fnBind(function (item) {
if (item.type == 'stack') {
@@ -1530,9 +1530,9 @@
}
});
- /**
- * Expose the Layoutmanager as the single entrypoint using UMD
- */
+ /**
+ * Expose the Layoutmanager as the single entrypoint using UMD
+ */
(function () {
/* global define */
if (typeof define === 'function' && define.amd) {
@@ -1567,15 +1567,15 @@
showCloseIcon: true,
responsiveMode: 'onload', // Can be onload, always, or none.
tabOverlapAllowance: 0, // maximum pixel overlap per tab
- reorderOnTabMenuClick: true,
+ reorderOnTabMenuClick: false, //do not reorder! - horizontal scroll
tabControlOffset: 10
},
dimensions: {
- borderWidth: 5,
+ borderWidth: 3,
borderGrabWidth: 5,
minItemHeight: 10,
- minItemWidth: 10,
- headerHeight: 20,
+ minItemWidth: 20,
+ headerHeight: 27,
dragProxyWidth: 300,
dragProxyHeight: 200
},
@@ -1611,36 +1611,36 @@
lm.utils.copy(lm.container.ItemContainer.prototype, {
- /**
- * Get the inner DOM element the container's content
- * is intended to live in
- *
- * @returns {DOM element}
- */
+ /**
+ * Get the inner DOM element the container's content
+ * is intended to live in
+ *
+ * @returns {DOM element}
+ */
getElement: function () {
return this._contentElement;
},
- /**
- * Hide the container. Notifies the containers content first
- * and then hides the DOM node. If the container is already hidden
- * this should have no effect
- *
- * @returns {void}
- */
+ /**
+ * Hide the container. Notifies the containers content first
+ * and then hides the DOM node. If the container is already hidden
+ * this should have no effect
+ *
+ * @returns {void}
+ */
hide: function () {
this.emit('hide');
this.isHidden = true;
this._element.hide();
},
- /**
- * Shows a previously hidden container. Notifies the
- * containers content first and then shows the DOM element.
- * If the container is already visible this has no effect.
- *
- * @returns {void}
- */
+ /**
+ * Shows a previously hidden container. Notifies the
+ * containers content first and then shows the DOM element.
+ * If the container is already visible this has no effect.
+ *
+ * @returns {void}
+ */
show: function () {
this.emit('show');
this.isHidden = false;
@@ -1651,19 +1651,19 @@
}
},
- /**
- * Set the size from within the container. Traverses up
- * the item tree until it finds a row or column element
- * and resizes its items accordingly.
- *
- * If this container isn't a descendant of a row or column
- * it returns false
- * @todo Rework!!!
- * @param {Number} width The new width in pixel
- * @param {Number} height The new height in pixel
- *
- * @returns {Boolean} resizeSuccesful
- */
+ /**
+ * Set the size from within the container. Traverses up
+ * the item tree until it finds a row or column element
+ * and resizes its items accordingly.
+ *
+ * If this container isn't a descendant of a row or column
+ * it returns false
+ * @todo Rework!!!
+ * @param {Number} width The new width in pixel
+ * @param {Number} height The new height in pixel
+ *
+ * @returns {Boolean} resizeSuccesful
+ */
setSize: function (width, height) {
var rowOrColumn = this.parent,
rowOrColumnChild = this,
@@ -1679,9 +1679,9 @@
rowOrColumn = rowOrColumn.parent;
- /**
- * No row or column has been found
- */
+ /**
+ * No row or column has been found
+ */
if (rowOrColumn.isRoot) {
return false;
}
@@ -1707,13 +1707,13 @@
return true;
},
- /**
- * Closes the container if it is closable. Can be called by
- * both the component within at as well as the contentItem containing
- * it. Emits a close event before the container itself is closed.
- *
- * @returns {void}
- */
+ /**
+ * Closes the container if it is closable. Can be called by
+ * both the component within at as well as the contentItem containing
+ * it. Emits a close event before the container itself is closed.
+ *
+ * @returns {void}
+ */
close: function () {
if (this._config.isClosable) {
this.emit('close');
@@ -1721,55 +1721,55 @@
}
},
- /**
- * Returns the current state object
- *
- * @returns {Object} state
- */
+ /**
+ * Returns the current state object
+ *
+ * @returns {Object} state
+ */
getState: function () {
return this._config.componentState;
},
- /**
- * Merges the provided state into the current one
- *
- * @param {Object} state
- *
- * @returns {void}
- */
+ /**
+ * Merges the provided state into the current one
+ *
+ * @param {Object} state
+ *
+ * @returns {void}
+ */
extendState: function (state) {
this.setState($.extend(true, this.getState(), state));
},
- /**
- * Notifies the layout manager of a stateupdate
- *
- * @param {serialisable} state
- */
+ /**
+ * Notifies the layout manager of a stateupdate
+ *
+ * @param {serialisable} state
+ */
setState: function (state) {
this._config.componentState = state;
this.parent.emitBubblingEvent('stateChanged');
},
- /**
- * Set's the components title
- *
- * @param {String} title
- */
+ /**
+ * Set's the components title
+ *
+ * @param {String} title
+ */
setTitle: function (title) {
this.parent.setTitle(title);
},
- /**
- * Set's the containers size. Called by the container's component.
- * To set the size programmatically from within the container please
- * use the public setSize method
- *
- * @param {[Int]} width in px
- * @param {[Int]} height in px
- *
- * @returns {void}
- */
+ /**
+ * Set's the containers size. Called by the container's component.
+ * To set the size programmatically from within the container please
+ * use the public setSize method
+ *
+ * @param {[Int]} width in px
+ * @param {[Int]} height in px
+ *
+ * @returns {void}
+ */
_$setSize: function (width, height) {
if (width !== this.width || height !== this.height) {
this.width = width;
@@ -1784,22 +1784,22 @@
}
});
- /**
- * Pops a content item out into a new browser window.
- * This is achieved by
- *
- * - Creating a new configuration with the content item as root element
- * - Serializing and minifying the configuration
- * - Opening the current window's URL with the configuration as a GET parameter
- * - GoldenLayout when opened in the new window will look for the GET parameter
- * and use it instead of the provided configuration
- *
- * @param {Object} config GoldenLayout item config
- * @param {Object} dimensions A map with width, height, top and left
- * @param {String} parentId The id of the element the item will be appended to on popIn
- * @param {Number} indexInParent The position of this element within its parent
- * @param {lm.LayoutManager} layoutManager
- */
+ /**
+ * Pops a content item out into a new browser window.
+ * This is achieved by
+ *
+ * - Creating a new configuration with the content item as root element
+ * - Serializing and minifying the configuration
+ * - Opening the current window's URL with the configuration as a GET parameter
+ * - GoldenLayout when opened in the new window will look for the GET parameter
+ * and use it instead of the provided configuration
+ *
+ * @param {Object} config GoldenLayout item config
+ * @param {Object} dimensions A map with width, height, top and left
+ * @param {String} parentId The id of the element the item will be appended to on popIn
+ * @param {Number} indexInParent The position of this element within its parent
+ * @param {lm.LayoutManager} layoutManager
+ */
lm.controls.BrowserPopout = function (config, dimensions, parentId, indexInParent, layoutManager) {
lm.utils.EventEmitter.call(this);
this.isInitialised = false;
@@ -1853,10 +1853,10 @@
}
},
- /**
- * Returns the popped out item to its original position. If the original
- * parent isn't available anymore it falls back to the layout's topmost element
- */
+ /**
+ * Returns the popped out item to its original position. If the original
+ * parent isn't available anymore it falls back to the layout's topmost element
+ */
popIn: function () {
var childConfig,
parentItem,
@@ -1864,22 +1864,22 @@
if (this._parentId) {
- /*
- * The $.extend call seems a bit pointless, but it's crucial to
- * copy the config returned by this.getGlInstance().toConfig()
- * onto a new object. Internet Explorer keeps the references
- * to objects on the child window, resulting in the following error
- * once the child window is closed:
- *
- * The callee (server [not server application]) is not available and disappeared
- */
+ /*
+ * The $.extend call seems a bit pointless, but it's crucial to
+ * copy the config returned by this.getGlInstance().toConfig()
+ * onto a new object. Internet Explorer keeps the references
+ * to objects on the child window, resulting in the following error
+ * once the child window is closed:
+ *
+ * The callee (server [not server application]) is not available and disappeared
+ */
childConfig = $.extend(true, {}, this.getGlInstance().toConfig()).content[0];
parentItem = this._layoutManager.root.getItemsById(this._parentId)[0];
- /*
- * Fallback if parentItem is not available. Either add it to the topmost
- * item or make it the topmost item if the layout is empty
- */
+ /*
+ * Fallback if parentItem is not available. Either add it to the topmost
+ * item or make it the topmost item if the layout is empty
+ */
if (!parentItem) {
if (this._layoutManager.root.contentItems.length > 0) {
parentItem = this._layoutManager.root.contentItems[0];
@@ -1894,28 +1894,28 @@
this.close();
},
- /**
- * Creates the URL and window parameter
- * and opens a new window
- *
- * @private
- *
- * @returns {void}
- */
+ /**
+ * Creates the URL and window parameter
+ * and opens a new window
+ *
+ * @private
+ *
+ * @returns {void}
+ */
_createWindow: function () {
var checkReadyInterval,
url = this._createUrl(),
- /**
- * Bogus title to prevent re-usage of existing window with the
- * same title. The actual title will be set by the new window's
- * GoldenLayout instance if it detects that it is in subWindowMode
- */
+ /**
+ * Bogus title to prevent re-usage of existing window with the
+ * same title. The actual title will be set by the new window's
+ * GoldenLayout instance if it detects that it is in subWindowMode
+ */
title = Math.floor(Math.random() * 1000000).toString(36),
- /**
- * The options as used in the window.open string
- */
+ /**
+ * The options as used in the window.open string
+ */
options = this._serializeWindowOptions({
width: this._dimensions.width,
height: this._dimensions.height,
@@ -1946,12 +1946,12 @@
.on('load', lm.utils.fnBind(this._positionWindow, this))
.on('unload beforeunload', lm.utils.fnBind(this._onClose, this));
- /**
- * Polling the childwindow to find out if GoldenLayout has been initialised
- * doesn't seem optimal, but the alternatives - adding a callback to the parent
- * window or raising an event on the window object - both would introduce knowledge
- * about the parent to the child window which we'd rather avoid
- */
+ /**
+ * Polling the childwindow to find out if GoldenLayout has been initialised
+ * doesn't seem optimal, but the alternatives - adding a callback to the parent
+ * window or raising an event on the window object - both would introduce knowledge
+ * about the parent to the child window which we'd rather avoid
+ */
checkReadyInterval = setInterval(lm.utils.fnBind(function () {
if (this._popoutWindow.__glInstance && this._popoutWindow.__glInstance.isInitialised) {
this._onInitialised();
@@ -1960,13 +1960,13 @@
}, this), 10);
},
- /**
- * Serialises a map of key:values to a window options string
- *
- * @param {Object} windowOptions
- *
- * @returns {String} serialised window options
- */
+ /**
+ * Serialises a map of key:values to a window options string
+ *
+ * @param {Object} windowOptions
+ *
+ * @returns {String} serialised window options
+ */
_serializeWindowOptions: function (windowOptions) {
var windowOptionsString = [], key;
@@ -1977,12 +1977,12 @@
return windowOptionsString.join(',');
},
- /**
- * Creates the URL for the new window, including the
- * config GET parameter
- *
- * @returns {String} URL
- */
+ /**
+ * Creates the URL for the new window, including the
+ * config GET parameter
+ *
+ * @returns {String} URL
+ */
_createUrl: function () {
var config = { content: this._config },
storageKey = 'gl-window-config-' + lm.utils.getUniqueId(),
@@ -2008,57 +2008,57 @@
}
},
- /**
- * Move the newly created window roughly to
- * where the component used to be.
- *
- * @private
- *
- * @returns {void}
- */
+ /**
+ * Move the newly created window roughly to
+ * where the component used to be.
+ *
+ * @private
+ *
+ * @returns {void}
+ */
_positionWindow: function () {
this._popoutWindow.moveTo(this._dimensions.left, this._dimensions.top);
this._popoutWindow.focus();
},
- /**
- * Callback when the new window is opened and the GoldenLayout instance
- * within it is initialised
- *
- * @returns {void}
- */
+ /**
+ * Callback when the new window is opened and the GoldenLayout instance
+ * within it is initialised
+ *
+ * @returns {void}
+ */
_onInitialised: function () {
this.isInitialised = true;
this.getGlInstance().on('popIn', this.popIn, this);
this.emit('initialised');
},
- /**
- * Invoked 50ms after the window unload event
- *
- * @private
- *
- * @returns {void}
- */
+ /**
+ * Invoked 50ms after the window unload event
+ *
+ * @private
+ *
+ * @returns {void}
+ */
_onClose: function () {
setTimeout(lm.utils.fnBind(this.emit, this, ['closed']), 50);
}
});
- /**
- * This class creates a temporary container
- * for the component whilst it is being dragged
- * and handles drag events
- *
- * @constructor
- * @private
- *
- * @param {Number} x The initial x position
- * @param {Number} y The initial y position
- * @param {lm.utils.DragListener} dragListener
- * @param {lm.LayoutManager} layoutManager
- * @param {lm.item.AbstractContentItem} contentItem
- * @param {lm.item.AbstractContentItem} originalParent
- */
+ /**
+ * This class creates a temporary container
+ * for the component whilst it is being dragged
+ * and handles drag events
+ *
+ * @constructor
+ * @private
+ *
+ * @param {Number} x The initial x position
+ * @param {Number} y The initial y position
+ * @param {lm.utils.DragListener} dragListener
+ * @param {lm.LayoutManager} layoutManager
+ * @param {lm.item.AbstractContentItem} contentItem
+ * @param {lm.item.AbstractContentItem} originalParent
+ */
lm.controls.DragProxy = function (x, y, dragListener, layoutManager, contentItem, originalParent) {
lm.utils.EventEmitter.call(this);
@@ -2120,19 +2120,19 @@
lm.utils.copy(lm.controls.DragProxy.prototype, {
- /**
- * Callback on every mouseMove event during a drag. Determines if the drag is
- * still within the valid drag area and calls the layoutManager to highlight the
- * current drop area
- *
- * @param {Number} offsetX The difference from the original x position in px
- * @param {Number} offsetY The difference from the original y position in px
- * @param {jQuery DOM event} event
- *
- * @private
- *
- * @returns {void}
- */
+ /**
+ * Callback on every mouseMove event during a drag. Determines if the drag is
+ * still within the valid drag area and calls the layoutManager to highlight the
+ * current drop area
+ *
+ * @param {Number} offsetX The difference from the original x position in px
+ * @param {Number} offsetY The difference from the original y position in px
+ * @param {jQuery DOM event} event
+ *
+ * @private
+ *
+ * @returns {void}
+ */
_onDrag: function (offsetX, offsetY, event) {
event = event.originalEvent && event.originalEvent.touches ? event.originalEvent.touches[0] : event;
@@ -2148,16 +2148,16 @@
this._setDropPosition(x, y);
},
- /**
- * Sets the target position, highlighting the appropriate area
- *
- * @param {Number} x The x position in px
- * @param {Number} y The y position in px
- *
- * @private
- *
- * @returns {void}
- */
+ /**
+ * Sets the target position, highlighting the appropriate area
+ *
+ * @param {Number} x The x position in px
+ * @param {Number} y The y position in px
+ *
+ * @private
+ *
+ * @returns {void}
+ */
_setDropPosition: function (x, y) {
this.element.css({ left: x, top: y });
this._area = this._layoutManager._$getArea(x, y);
@@ -2168,43 +2168,43 @@
}
},
- /**
- * Callback when the drag has finished. Determines the drop area
- * and adds the child to it
- *
- * @private
- *
- * @returns {void}
- */
+ /**
+ * Callback when the drag has finished. Determines the drop area
+ * and adds the child to it
+ *
+ * @private
+ *
+ * @returns {void}
+ */
_onDrop: function () {
this._layoutManager.dropTargetIndicator.hide();
- /*
- * Valid drop area found
- */
+ /*
+ * Valid drop area found
+ */
if (this._area !== null) {
this._area.contentItem._$onDrop(this._contentItem, this._area);
- /**
- * No valid drop area available at present, but one has been found before.
- * Use it
- */
+ /**
+ * No valid drop area available at present, but one has been found before.
+ * Use it
+ */
} else if (this._lastValidArea !== null) {
this._lastValidArea.contentItem._$onDrop(this._contentItem, this._lastValidArea);
- /**
- * No valid drop area found during the duration of the drag. Return
- * content item to its original position if a original parent is provided.
- * (Which is not the case if the drag had been initiated by createDragSource)
- */
+ /**
+ * No valid drop area found during the duration of the drag. Return
+ * content item to its original position if a original parent is provided.
+ * (Which is not the case if the drag had been initiated by createDragSource)
+ */
} else if (this._originalParent) {
this._originalParent.addChild(this._contentItem);
- /**
- * The drag didn't ultimately end up with adding the content item to
- * any container. In order to ensure clean up happens, destroy the
- * content item.
- */
+ /**
+ * The drag didn't ultimately end up with adding the content item to
+ * any container. In order to ensure clean up happens, destroy the
+ * content item.
+ */
} else {
this._contentItem._$destroy();
}
@@ -2215,18 +2215,18 @@
this._layoutManager.emit('itemDropped', this._contentItem);
},
- /**
- * Removes the item from its original position within the tree
- *
- * @private
- *
- * @returns {void}
- */
+ /**
+ * Removes the item from its original position within the tree
+ *
+ * @private
+ *
+ * @returns {void}
+ */
_updateTree: function () {
- /**
- * parent is null if the drag had been initiated by a external drag source
- */
+ /**
+ * parent is null if the drag had been initiated by a external drag source
+ */
if (this._contentItem.parent) {
this._contentItem.parent.removeChild(this._contentItem, true);
}
@@ -2234,13 +2234,13 @@
this._contentItem._$setParent(this);
},
- /**
- * Updates the Drag Proxie's dimensions
- *
- * @private
- *
- * @returns {void}
- */
+ /**
+ * Updates the Drag Proxie's dimensions
+ *
+ * @private
+ *
+ * @returns {void}
+ */
_setDimensions: function () {
var dimensions = this._layoutManager.config.dimensions,
width = dimensions.dragProxyWidth,
@@ -2259,16 +2259,16 @@
}
});
- /**
- * Allows for any DOM item to create a component on drag
- * start tobe dragged into the Layout
- *
- * @param {jQuery element} element
- * @param {Object} itemConfig the configuration for the contentItem that will be created
- * @param {LayoutManager} layoutManager
- *
- * @constructor
- */
+ /**
+ * Allows for any DOM item to create a component on drag
+ * start tobe dragged into the Layout
+ *
+ * @param {jQuery element} element
+ * @param {Object} itemConfig the configuration for the contentItem that will be created
+ * @param {LayoutManager} layoutManager
+ *
+ * @constructor
+ */
lm.controls.DragSource = function (element, itemConfig, layoutManager) {
this._element = element;
this._itemConfig = itemConfig;
@@ -2280,11 +2280,11 @@
lm.utils.copy(lm.controls.DragSource.prototype, {
- /**
- * Called initially and after every drag
- *
- * @returns {void}
- */
+ /**
+ * Called initially and after every drag
+ *
+ * @returns {void}
+ */
_createDragListener: function () {
if (this._dragListener !== null) {
this._dragListener.destroy();
@@ -2306,14 +2306,14 @@
}
},
- /**
- * Callback for the DragListener's dragStart event
- *
- * @param {int} x the x position of the mouse on dragStart
- * @param {int} y the x position of the mouse on dragStart
- *
- * @returns {void}
- */
+ /**
+ * Callback for the DragListener's dragStart event
+ *
+ * @param {int} x the x position of the mouse on dragStart
+ * @param {int} y the x position of the mouse on dragStart
+ *
+ * @returns {void}
+ */
_onDragStart: function (x, y) {
var itemConfig = this._itemConfig;
if (lm.utils.isFunction(itemConfig)) {
@@ -2355,12 +2355,12 @@
this.element.hide();
}
});
- /**
- * This class represents a header above a Stack ContentItem.
- *
- * @param {lm.LayoutManager} layoutManager
- * @param {lm.item.AbstractContentItem} parent
- */
+ /**
+ * This class represents a header above a Stack ContentItem.
+ *
+ * @param {lm.LayoutManager} layoutManager
+ * @param {lm.item.AbstractContentItem} parent
+ */
lm.controls.Header = function (layoutManager, parent) {
lm.utils.EventEmitter.call(this);
@@ -2390,24 +2390,24 @@
this._createControls();
};
+ // '<ul class="lm_tabdropdown_list"></ul>',
lm.controls.Header._template = [
'<div class="lm_header">',
'<ul class="lm_tabs"></ul>',
'<ul class="lm_controls"></ul>',
- '<ul class="lm_tabdropdown_list"></ul>',
'</div>'
].join('');
lm.utils.copy(lm.controls.Header.prototype, {
- /**
- * Creates a new tab and associates it with a contentItem
- *
- * @param {lm.item.AbstractContentItem} contentItem
- * @param {Integer} index The position of the tab
- *
- * @returns {void}
- */
+ /**
+ * Creates a new tab and associates it with a contentItem
+ *
+ * @param {lm.item.AbstractContentItem} contentItem
+ * @param {Integer} index The position of the tab
+ *
+ * @returns {void}
+ */
createTab: function (contentItem, index) {
var tab, i;
@@ -2441,13 +2441,13 @@
this._updateTabSizes();
},
- /**
- * Finds a tab based on the contentItem its associated with and removes it.
- *
- * @param {lm.item.AbstractContentItem} contentItem
- *
- * @returns {void}
- */
+ /**
+ * Finds a tab based on the contentItem its associated with and removes it.
+ *
+ * @param {lm.item.AbstractContentItem} contentItem
+ *
+ * @returns {void}
+ */
removeTab: function (contentItem) {
for (var i = 0; i < this.tabs.length; i++) {
if (this.tabs[i].contentItem === contentItem) {
@@ -2460,11 +2460,11 @@
throw new Error('contentItem is not controlled by this header');
},
- /**
- * The programmatical equivalent of clicking a Tab.
- *
- * @param {lm.item.AbstractContentItem} contentItem
- */
+ /**
+ * The programmatical equivalent of clicking a Tab.
+ *
+ * @param {lm.item.AbstractContentItem} contentItem
+ */
setActiveContentItem: function (contentItem) {
var i, j, isActive, activeTab;
@@ -2477,32 +2477,33 @@
}
}
- if (this.layoutManager.config.settings.reorderOnTabMenuClick) {
- /**
- * If the tab selected was in the dropdown, move everything down one to make way for this one to be the first.
- * This will make sure the most used tabs stay visible.
- */
- if (this._lastVisibleTabIndex !== -1 && this.parent.config.activeItemIndex > this._lastVisibleTabIndex) {
- activeTab = this.tabs[this.parent.config.activeItemIndex];
- for (j = this.parent.config.activeItemIndex; j > 0; j--) {
- this.tabs[j] = this.tabs[j - 1];
- }
- this.tabs[0] = activeTab;
- this.parent.config.activeItemIndex = 0;
- }
- }
+ // glr: removed for new tab manager
+ // if (this.layoutManager.config.settings.reorderOnTabMenuClick) {
+ // /**
+ // * If the tab selected was in the dropdown, move everything down one to make way for this one to be the first.
+ // * This will make sure the most used tabs stay visible.
+ // */
+ // if (this._lastVisibleTabIndex !== -1 && this.parent.config.activeItemIndex > this._lastVisibleTabIndex) {
+ // activeTab = this.tabs[this.parent.config.activeItemIndex];
+ // for (j = this.parent.config.activeItemIndex; j > 0; j--) {
+ // this.tabs[j] = this.tabs[j - 1];
+ // }
+ // this.tabs[0] = activeTab;
+ // this.parent.config.activeItemIndex = 0;
+ // }
+ // }
this._updateTabSizes();
this.parent.emitBubblingEvent('stateChanged');
},
- /**
- * Programmatically operate with header position.
- *
- * @param {string} position one of ('top','left','right','bottom') to set or empty to get it.
- *
- * @returns {string} previous header position
- */
+ /**
+ * Programmatically operate with header position.
+ *
+ * @param {string} position one of ('top','left','right','bottom') to set or empty to get it.
+ *
+ * @returns {string} previous header position
+ */
position: function (position) {
var previous = this.parent._header.show;
if (previous && !this.parent._side)
@@ -2514,14 +2515,14 @@
return previous;
},
- /**
- * Programmatically set closability.
- *
- * @package private
- * @param {Boolean} isClosable Whether to enable/disable closability.
- *
- * @returns {Boolean} Whether the action was successful
- */
+ /**
+ * Programmatically set closability.
+ *
+ * @package private
+ * @param {Boolean} isClosable Whether to enable/disable closability.
+ *
+ * @returns {Boolean} Whether the action was successful
+ */
_$setClosable: function (isClosable) {
if (this.closeButton && this._isClosable()) {
this.closeButton.element[isClosable ? "show" : "hide"]();
@@ -2531,13 +2532,13 @@
return false;
},
- /**
- * Destroys the entire header
- *
- * @package private
- *
- * @returns {void}
- */
+ /**
+ * Destroys the entire header
+ *
+ * @package private
+ *
+ * @returns {void}
+ */
_$destroy: function () {
this.emit('destroy', this);
@@ -2548,20 +2549,20 @@
this.element.remove();
},
- /**
- * get settings from header
- *
- * @returns {string} when exists
- */
+ /**
+ * get settings from header
+ *
+ * @returns {string} when exists
+ */
_getHeaderSetting: function (name) {
if (name in this.parent._header)
return this.parent._header[name];
},
- /**
- * Creates the popout, maximise and close buttons in the header's top right corner
- *
- * @returns {void}
- */
+ /**
+ * Creates the popout, maximise and close buttons in the header's top right corner
+ *
+ * @returns {void}
+ */
_createControls: function () {
var closeStack,
popout,
@@ -2573,26 +2574,26 @@
tabDropdownLabel,
showTabDropdown;
- /**
- * Dropdown to show additional tabs.
- */
+ /**
+ * Dropdown to show additional tabs.
+ */
showTabDropdown = lm.utils.fnBind(this._showAdditionalTabsDropdown, this);
tabDropdownLabel = this.layoutManager.config.labels.tabDropdown;
- this.tabDropdownButton = new lm.controls.HeaderButton(this, tabDropdownLabel, 'lm_tabdropdown', showTabDropdown);
- this.tabDropdownButton.element.hide();
+ // this.tabDropdownButton = new lm.controls.HeaderButton(this, tabDropdownLabel, 'lm_tabdropdown', showTabDropdown);
+ // this.tabDropdownButton.element.hide();
- /**
- * Popout control to launch component in new window.
- */
+ /**
+ * Popout control to launch component in new window.
+ */
if (this._getHeaderSetting('popout')) {
popout = lm.utils.fnBind(this._onPopoutClick, this);
label = this._getHeaderSetting('popout');
new lm.controls.HeaderButton(this, label, 'lm_popout', popout);
}
- /**
- * Maximise control - set the component to the full size of the layout
- */
+ /**
+ * Maximise control - set the component to the full size of the layout
+ */
if (this._getHeaderSetting('maximise')) {
maximise = lm.utils.fnBind(this.parent.toggleMaximise, this.parent);
maximiseLabel = this._getHeaderSetting('maximise');
@@ -2608,9 +2609,9 @@
});
}
- /**
- * Close button
- */
+ /**
+ * Close button
+ */
if (this._isClosable()) {
closeStack = lm.utils.fnBind(this.parent.remove, this.parent);
label = this._getHeaderSetting('close');
@@ -2618,30 +2619,30 @@
}
},
- /**
- * Shows drop down for additional tabs when there are too many to display.
- *
- * @returns {void}
- */
+ /**
+ * Shows drop down for additional tabs when there are too many to display.
+ *
+ * @returns {void}
+ */
_showAdditionalTabsDropdown: function () {
this.tabDropdownContainer.show();
},
- /**
- * Hides drop down for additional tabs when there are too many to display.
- *
- * @returns {void}
- */
+ /**
+ * Hides drop down for additional tabs when there are too many to display.
+ *
+ * @returns {void}
+ */
_hideAdditionalTabsDropdown: function (e) {
this.tabDropdownContainer.hide();
},
- /**
- * Checks whether the header is closable based on the parent config and
- * the global config.
- *
- * @returns {Boolean} Whether the header is closable.
- */
+ /**
+ * Checks whether the header is closable based on the parent config and
+ * the global config.
+ *
+ * @returns {Boolean} Whether the header is closable.
+ */
_isClosable: function () {
return this.parent.config.isClosable && this.layoutManager.config.settings.showCloseIcon;
},
@@ -2655,32 +2656,29 @@
},
- /**
- * Invoked when the header's background is clicked (not it's tabs or controls)
- *
- * @param {jQuery DOM event} event
- *
- * @returns {void}
- */
+ /**
+ * Invoked when the header's background is clicked (not it's tabs or controls)
+ *
+ * @param {jQuery DOM event} event
+ *
+ * @returns {void}
+ */
_onHeaderClick: function (event) {
if (event.target === this.element[0]) {
this.parent.select();
}
},
- /**
- * Pushes the tabs to the tab dropdown if the available space is not sufficient
- *
- * @returns {void}
- */
+ /**
+ * Pushes the tabs to the tab dropdown if the available space is not sufficient
+ *
+ * @returns {void}
+ */
_updateTabSizes: function (showTabMenu) {
if (this.tabs.length === 0) {
return;
}
- //Show the menu based on function argument
- this.tabDropdownButton.element.toggle(showTabMenu === true);
-
var size = function (val) {
return val ? 'width' : 'height';
};
@@ -2835,14 +2833,14 @@
}
});
- /**
- * Represents an individual tab within a Stack's header
- *
- * @param {lm.controls.Header} header
- * @param {lm.items.AbstractContentItem} contentItem
- *
- * @constructor
- */
+ /**
+ * Represents an individual tab within a Stack's header
+ *
+ * @param {lm.controls.Header} header
+ * @param {lm.items.AbstractContentItem} contentItem
+ *
+ * @constructor
+ */
lm.controls.Tab = function (header, contentItem) {
this.header = header;
this.contentItem = contentItem;
@@ -2888,37 +2886,37 @@
}
};
- /**
- * The tab's html template
- *
- * @type {String}
- */
+ /**
+ * The tab's html template
+ *
+ * @type {String}
+ */
lm.controls.Tab._template = '<li class="lm_tab"><i class="lm_left"></i>' +
'<div class="lm_title_wrap"><input class="lm_title"/></div><div class="lm_close_tab"></div>' +
'<i class="lm_right"></i></li>';
lm.utils.copy(lm.controls.Tab.prototype, {
- /**
- * Sets the tab's title to the provided string and sets
- * its title attribute to a pure text representation (without
- * html tags) of the same string.
- *
- * @public
- * @param {String} title can contain html
- */
+ /**
+ * Sets the tab's title to the provided string and sets
+ * its title attribute to a pure text representation (without
+ * html tags) of the same string.
+ *
+ * @public
+ * @param {String} title can contain html
+ */
setTitle: function (title) {
this.element.attr('title', lm.utils.stripTags(title));
this.titleElement.html(title);
},
- /**
- * Sets this tab's active state. To programmatically
- * switch tabs, use header.setActiveContentItem( item ) instead.
- *
- * @public
- * @param {Boolean} isActive
- */
+ /**
+ * Sets this tab's active state. To programmatically
+ * switch tabs, use header.setActiveContentItem( item ) instead.
+ *
+ * @public
+ * @param {Boolean} isActive
+ */
setActive: function (isActive) {
if (isActive === this.isActive) {
return;
@@ -2932,12 +2930,12 @@
}
},
- /**
- * Destroys the tab
- *
- * @private
- * @returns {void}
- */
+ /**
+ * Destroys the tab
+ *
+ * @private
+ * @returns {void}
+ */
_$destroy: function () {
this._layoutManager.emit('tabDestroyed', this);
this.element.off('mousedown touchstart', this._onTabClickFn);
@@ -2950,15 +2948,15 @@
this.element.remove();
},
- /**
- * Callback for the DragListener
- *
- * @param {Number} x The tabs absolute x position
- * @param {Number} y The tabs absolute y position
- *
- * @private
- * @returns {void}
- */
+ /**
+ * Callback for the DragListener
+ *
+ * @param {Number} x The tabs absolute x position
+ * @param {Number} y The tabs absolute y position
+ *
+ * @private
+ * @returns {void}
+ */
_onDragStart: function (x, y) {
if (this.contentItem.parent.isMaximised === true) {
this.contentItem.parent.toggleMaximise();
@@ -2973,14 +2971,14 @@
);
},
- /**
- * Callback when the tab is clicked
- *
- * @param {jQuery DOM event} event
- *
- * @private
- * @returns {void}
- */
+ /**
+ * Callback when the tab is clicked
+ *
+ * @param {jQuery DOM event} event
+ *
+ * @private
+ * @returns {void}
+ */
_onTabClick: function (event) {
// left mouse button or tap
if (event.button === 0 || event.type === 'touchstart') {
@@ -2995,30 +2993,30 @@
}
},
- /**
- * Callback when the tab's close button is
- * clicked
- *
- * @param {jQuery DOM event} event
- *
- * @private
- * @returns {void}
- */
+ /**
+ * Callback when the tab's close button is
+ * clicked
+ *
+ * @param {jQuery DOM event} event
+ *
+ * @private
+ * @returns {void}
+ */
_onCloseClick: function (event) {
event.stopPropagation();
this.header.parent.removeChild(this.contentItem);
},
- /**
- * Callback to capture tab close button mousedown
- * to prevent tab from activating.
- *
- * @param (jQuery DOM event) event
- *
- * @private
- * @returns {void}
- */
+ /**
+ * Callback to capture tab close button mousedown
+ * to prevent tab from activating.
+ *
+ * @param (jQuery DOM event) event
+ *
+ * @private
+ * @returns {void}
+ */
_onCloseMousedown: function (event) {
event.stopPropagation();
}
@@ -3040,9 +3038,9 @@
},
transitionElements: function (fromElement, toElement) {
- /**
- * TODO - This is not quite as cool as expected. Review.
- */
+ /**
+ * TODO - This is not quite as cool as expected. Review.
+ */
return;
this._toElement = toElement;
this._animationStartTime = lm.utils.now();
@@ -3096,27 +3094,27 @@
lm.errors.ConfigurationError.prototype = new Error();
- /**
- * This is the baseclass that all content items inherit from.
- * Most methods provide a subset of what the sub-classes do.
- *
- * It also provides a number of functions for tree traversal
- *
- * @param {lm.LayoutManager} layoutManager
- * @param {item node configuration} config
- * @param {lm.item} parent
- *
- * @event stateChanged
- * @event beforeItemDestroyed
- * @event itemDestroyed
- * @event itemCreated
- * @event componentCreated
- * @event rowCreated
- * @event columnCreated
- * @event stackCreated
- *
- * @constructor
- */
+ /**
+ * This is the baseclass that all content items inherit from.
+ * Most methods provide a subset of what the sub-classes do.
+ *
+ * It also provides a number of functions for tree traversal
+ *
+ * @param {lm.LayoutManager} layoutManager
+ * @param {item node configuration} config
+ * @param {lm.item} parent
+ *
+ * @event stateChanged
+ * @event beforeItemDestroyed
+ * @event itemDestroyed
+ * @event itemCreated
+ * @event componentCreated
+ * @event rowCreated
+ * @event columnCreated
+ * @event stackCreated
+ *
+ * @constructor
+ */
lm.items.AbstractContentItem = function (layoutManager, config, parent) {
lm.utils.EventEmitter.call(this);
@@ -3146,26 +3144,26 @@
lm.utils.copy(lm.items.AbstractContentItem.prototype, {
- /**
- * Set the size of the component and its children, called recursively
- *
- * @abstract
- * @returns void
- */
+ /**
+ * Set the size of the component and its children, called recursively
+ *
+ * @abstract
+ * @returns void
+ */
setSize: function () {
throw new Error('Abstract Method');
},
- /**
- * Calls a method recursively downwards on the tree
- *
- * @param {String} functionName the name of the function to be called
- * @param {[Array]}functionArguments optional arguments that are passed to every function
- * @param {[bool]} bottomUp Call methods from bottom to top, defaults to false
- * @param {[bool]} skipSelf Don't invoke the method on the class that calls it, defaults to false
- *
- * @returns {void}
- */
+ /**
+ * Calls a method recursively downwards on the tree
+ *
+ * @param {String} functionName the name of the function to be called
+ * @param {[Array]}functionArguments optional arguments that are passed to every function
+ * @param {[bool]} bottomUp Call methods from bottom to top, defaults to false
+ * @param {[bool]} skipSelf Don't invoke the method on the class that calls it, defaults to false
+ *
+ * @returns {void}
+ */
callDownwards: function (functionName, functionArguments, bottomUp, skipSelf) {
var i;
@@ -3180,53 +3178,53 @@
}
},
- /**
- * Removes a child node (and its children) from the tree
- *
- * @param {lm.items.ContentItem} contentItem
- *
- * @returns {void}
- */
+ /**
+ * Removes a child node (and its children) from the tree
+ *
+ * @param {lm.items.ContentItem} contentItem
+ *
+ * @returns {void}
+ */
removeChild: function (contentItem, keepChild) {
- /*
- * Get the position of the item that's to be removed within all content items this node contains
- */
+ /*
+ * Get the position of the item that's to be removed within all content items this node contains
+ */
var index = lm.utils.indexOf(contentItem, this.contentItems);
- /*
- * Make sure the content item to be removed is actually a child of this item
- */
+ /*
+ * Make sure the content item to be removed is actually a child of this item
+ */
if (index === -1) {
throw new Error('Can\'t remove child item. Unknown content item');
}
- /**
- * Call ._$destroy on the content item. This also calls ._$destroy on all its children
- */
+ /**
+ * Call ._$destroy on the content item. This also calls ._$destroy on all its children
+ */
if (keepChild !== true) {
this.contentItems[index]._$destroy();
}
- /**
- * Remove the content item from this nodes array of children
- */
+ /**
+ * Remove the content item from this nodes array of children
+ */
this.contentItems.splice(index, 1);
- /**
- * Remove the item from the configuration
- */
+ /**
+ * Remove the item from the configuration
+ */
this.config.content.splice(index, 1);
- /**
- * If this node still contains other content items, adjust their size
- */
+ /**
+ * If this node still contains other content items, adjust their size
+ */
if (this.contentItems.length > 0) {
this.callDownwards('setSize');
- /**
- * If this was the last content item, remove this node as well
- */
+ /**
+ * If this was the last content item, remove this node as well
+ */
} else if (!(this instanceof lm.items.Root) && this.config.isClosable === true) {
const stack = this;
const rowOrCol = stack.parent;
@@ -3244,14 +3242,14 @@
}
},
- /**
- * Sets up the tree structure for the newly added child
- * The responsibility for the actual DOM manipulations lies
- * with the concrete item
- *
- * @param {lm.items.AbstractContentItem} contentItem
- * @param {[Int]} index If omitted item will be appended
- */
+ /**
+ * Sets up the tree structure for the newly added child
+ * The responsibility for the actual DOM manipulations lies
+ * with the concrete item
+ *
+ * @param {lm.items.AbstractContentItem} contentItem
+ * @param {[Int]} index If omitted item will be appended
+ */
addChild: function (contentItem, index) {
if (index === undefined) {
index = this.contentItems.length;
@@ -3271,15 +3269,15 @@
}
},
- /**
- * Replaces oldChild with newChild. This used to use jQuery.replaceWith... which for
- * some reason removes all event listeners, so isn't really an option.
- *
- * @param {lm.item.AbstractContentItem} oldChild
- * @param {lm.item.AbstractContentItem} newChild
- *
- * @returns {void}
- */
+ /**
+ * Replaces oldChild with newChild. This used to use jQuery.replaceWith... which for
+ * some reason removes all event listeners, so isn't really an option.
+ *
+ * @param {lm.item.AbstractContentItem} oldChild
+ * @param {lm.item.AbstractContentItem} newChild
+ *
+ * @returns {void}
+ */
replaceChild: function (oldChild, newChild, _$destroyOldChild) {
newChild = this.layoutManager._$normalizeContentItem(newChild);
@@ -3293,23 +3291,23 @@
parentNode.replaceChild(newChild.element[0], oldChild.element[0]);
- /*
- * Optionally destroy the old content item
- */
+ /*
+ * Optionally destroy the old content item
+ */
if (_$destroyOldChild === true) {
oldChild.parent = null;
oldChild._$destroy();
}
- /*
- * Wire the new contentItem into the tree
- */
+ /*
+ * Wire the new contentItem into the tree
+ */
this.contentItems[index] = newChild;
newChild.parent = this;
- /*
- * Update tab reference
- */
+ /*
+ * Update tab reference
+ */
if (this.isStack) {
this.header.tabs[index].contentItem = newChild;
}
@@ -3322,33 +3320,33 @@
this.callDownwards('setSize');
},
- /**
- * Convenience method.
- * Shorthand for this.parent.removeChild( this )
- *
- * @returns {void}
- */
+ /**
+ * Convenience method.
+ * Shorthand for this.parent.removeChild( this )
+ *
+ * @returns {void}
+ */
remove: function () {
this.parent.removeChild(this);
},
- /**
- * Removes the component from the layout and creates a new
- * browser window with the component and its children inside
- *
- * @returns {lm.controls.BrowserPopout}
- */
+ /**
+ * Removes the component from the layout and creates a new
+ * browser window with the component and its children inside
+ *
+ * @returns {lm.controls.BrowserPopout}
+ */
popout: function () {
var browserPopout = this.layoutManager.createPopout(this);
this.emitBubblingEvent('stateChanged');
return browserPopout;
},
- /**
- * Maximises the Item or minimises it if it is already maximised
- *
- * @returns {void}
- */
+ /**
+ * Maximises the Item or minimises it if it is already maximised
+ *
+ * @returns {void}
+ */
toggleMaximise: function (e) {
e && e.preventDefault();
if (this.isMaximised === true) {
@@ -3361,11 +3359,11 @@
this.emitBubblingEvent('stateChanged');
},
- /**
- * Selects the item if it is not already selected
- *
- * @returns {void}
- */
+ /**
+ * Selects the item if it is not already selected
+ *
+ * @returns {void}
+ */
select: function () {
if (this.layoutManager.selectedItem !== this) {
this.layoutManager.selectItem(this, true);
@@ -3373,11 +3371,11 @@
}
},
- /**
- * De-selects the item if it is selected
- *
- * @returns {void}
- */
+ /**
+ * De-selects the item if it is selected
+ *
+ * @returns {void}
+ */
deselect: function () {
if (this.layoutManager.selectedItem === this) {
this.layoutManager.selectedItem = null;
@@ -3385,28 +3383,28 @@
}
},
- /**
- * Set this component's title
- *
- * @public
- * @param {String} title
- *
- * @returns {void}
- */
+ /**
+ * Set this component's title
+ *
+ * @public
+ * @param {String} title
+ *
+ * @returns {void}
+ */
setTitle: function (title) {
this.config.title = title;
this.emit('titleChanged', title);
this.emit('stateChanged');
},
- /**
- * Checks whether a provided id is present
- *
- * @public
- * @param {String} id
- *
- * @returns {Boolean} isPresent
- */
+ /**
+ * Checks whether a provided id is present
+ *
+ * @public
+ * @param {String} id
+ *
+ * @returns {Boolean} isPresent
+ */
hasId: function (id) {
if (!this.config.id) {
return false;
@@ -3417,15 +3415,15 @@
}
},
- /**
- * Adds an id. Adds it as a string if the component doesn't
- * have an id yet or creates/uses an array
- *
- * @public
- * @param {String} id
- *
- * @returns {void}
- */
+ /**
+ * Adds an id. Adds it as a string if the component doesn't
+ * have an id yet or creates/uses an array
+ *
+ * @public
+ * @param {String} id
+ *
+ * @returns {void}
+ */
addId: function (id) {
if (this.hasId(id)) {
return;
@@ -3440,15 +3438,15 @@
}
},
- /**
- * Removes an existing id. Throws an error
- * if the id is not present
- *
- * @public
- * @param {String} id
- *
- * @returns {void}
- */
+ /**
+ * Removes an existing id. Throws an error
+ * if the id is not present
+ *
+ * @public
+ * @param {String} id
+ *
+ * @returns {void}
+ */
removeId: function (id) {
if (!this.hasId(id)) {
throw new Error('Id not found');
@@ -3462,9 +3460,9 @@
}
},
- /****************************************
- * SELECTOR
- ****************************************/
+ /****************************************
+ * SELECTOR
+ ****************************************/
getItemsByFilter: function (filter) {
var result = [],
next = function (contentItem) {
@@ -3508,9 +3506,9 @@
return instances;
},
- /****************************************
- * PACKAGE PRIVATE
- ****************************************/
+ /****************************************
+ * PACKAGE PRIVATE
+ ****************************************/
_$getItemsByProperty: function (key, value) {
return this.getItemsByFilter(function (item) {
return item[key] === value;
@@ -3555,11 +3553,11 @@
}
},
- /**
- * Destroys this item ands its children
- *
- * @returns {void}
- */
+ /**
+ * Destroys this item ands its children
+ *
+ * @returns {void}
+ */
_$destroy: function () {
this.emitBubblingEvent('beforeItemDestroyed');
this.callDownwards('_$destroy', [], true, true);
@@ -3567,17 +3565,17 @@
this.emitBubblingEvent('itemDestroyed');
},
- /**
- * Returns the area the component currently occupies in the format
- *
- * {
- * x1: int
- * xy: int
- * y1: int
- * y2: int
- * contentItem: contentItem
- * }
- */
+ /**
+ * Returns the area the component currently occupies in the format
+ *
+ * {
+ * x1: int
+ * xy: int
+ * y1: int
+ * y2: int
+ * contentItem: contentItem
+ * }
+ */
_$getArea: function (element) {
element = element || this.element;
@@ -3595,17 +3593,17 @@
};
},
- /**
- * The tree of content items is created in two steps: First all content items are instantiated,
- * then init is called recursively from top to bottem. This is the basic init function,
- * it can be used, extended or overwritten by the content items
- *
- * Its behaviour depends on the content item
- *
- * @package private
- *
- * @returns {void}
- */
+ /**
+ * The tree of content items is created in two steps: First all content items are instantiated,
+ * then init is called recursively from top to bottem. This is the basic init function,
+ * it can be used, extended or overwritten by the content items
+ *
+ * Its behaviour depends on the content item
+ *
+ * @package private
+ *
+ * @returns {void}
+ */
_$init: function () {
var i;
this.setSize();
@@ -3619,26 +3617,26 @@
this.emitBubblingEvent(this.type + 'Created');
},
- /**
- * Emit an event that bubbles up the item tree.
- *
- * @param {String} name The name of the event
- *
- * @returns {void}
- */
+ /**
+ * Emit an event that bubbles up the item tree.
+ *
+ * @param {String} name The name of the event
+ *
+ * @returns {void}
+ */
emitBubblingEvent: function (name) {
var event = new lm.utils.BubblingEvent(name, this);
this.emit(name, event);
},
- /**
- * Private method, creates all content items for this node at initialisation time
- * PLEASE NOTE, please see addChild for adding contentItems add runtime
- * @private
- * @param {configuration item node} config
- *
- * @returns {void}
- */
+ /**
+ * Private method, creates all content items for this node at initialisation time
+ * PLEASE NOTE, please see addChild for adding contentItems add runtime
+ * @private
+ * @param {configuration item node} config
+ *
+ * @returns {void}
+ */
_createContentItems: function (config) {
var oContentItem, i;
@@ -3652,13 +3650,13 @@
}
},
- /**
- * Extends an item configuration node with default settings
- * @private
- * @param {configuration item node} config
- *
- * @returns {configuration item node} extended config
- */
+ /**
+ * Extends an item configuration node with default settings
+ * @private
+ * @param {configuration item node} config
+ *
+ * @returns {configuration item node} extended config
+ */
_extendItemNode: function (config) {
for (var key in lm.config.itemDefaultConfig) {
@@ -3670,26 +3668,26 @@
return config;
},
- /**
- * Called for every event on the item tree. Decides whether the event is a bubbling
- * event and propagates it to its parent
- *
- * @param {String} name the name of the event
- * @param {lm.utils.BubblingEvent} event
- *
- * @returns {void}
- */
+ /**
+ * Called for every event on the item tree. Decides whether the event is a bubbling
+ * event and propagates it to its parent
+ *
+ * @param {String} name the name of the event
+ * @param {lm.utils.BubblingEvent} event
+ *
+ * @returns {void}
+ */
_propagateEvent: function (name, event) {
if (event instanceof lm.utils.BubblingEvent &&
event.isPropagationStopped === false &&
this.isInitialised === true) {
- /**
- * In some cases (e.g. if an element is created from a DragSource) it
- * doesn't have a parent and is not below root. If that's the case
- * propagate the bubbling event from the top level of the substree directly
- * to the layoutManager
- */
+ /**
+ * In some cases (e.g. if an element is created from a DragSource) it
+ * doesn't have a parent and is not below root. If that's the case
+ * propagate the bubbling event from the top level of the substree directly
+ * to the layoutManager
+ */
if (this.isRoot === false && this.parent) {
this.parent.emit.apply(this.parent, Array.prototype.slice.call(arguments, 0));
} else {
@@ -3698,16 +3696,16 @@
}
},
- /**
- * All raw events bubble up to the root element. Some events that
- * are propagated to - and emitted by - the layoutManager however are
- * only string-based, batched and sanitized to make them more usable
- *
- * @param {String} name the name of the event
- *
- * @private
- * @returns {void}
- */
+ /**
+ * All raw events bubble up to the root element. Some events that
+ * are propagated to - and emitted by - the layoutManager however are
+ * only string-based, batched and sanitized to make them more usable
+ *
+ * @param {String} name the name of the event
+ *
+ * @private
+ * @returns {void}
+ */
_scheduleEventPropagationToLayoutManager: function (name, event) {
if (lm.utils.indexOf(name, this._throttledEvents) === -1) {
this.layoutManager.emit(name, event.origin);
@@ -3720,25 +3718,25 @@
},
- /**
- * Callback for events scheduled by _scheduleEventPropagationToLayoutManager
- *
- * @param {String} name the name of the event
- *
- * @private
- * @returns {void}
- */
+ /**
+ * Callback for events scheduled by _scheduleEventPropagationToLayoutManager
+ *
+ * @param {String} name the name of the event
+ *
+ * @private
+ * @returns {void}
+ */
_propagateEventToLayoutManager: function (name, event) {
this._pendingEventPropagations[name] = false;
this.layoutManager.emit(name, event);
}
});
- /**
- * @param {[type]} layoutManager [description]
- * @param {[type]} config [description]
- * @param {[type]} parent [description]
- */
+ /**
+ * @param {[type]} layoutManager [description]
+ * @param {[type]} config [description]
+ * @param {[type]} parent [description]
+ */
lm.items.Component = function (layoutManager, config, parent) {
lm.items.AbstractContentItem.call(this, layoutManager, config, parent);
@@ -3798,11 +3796,11 @@
lm.items.AbstractContentItem.prototype._$destroy.call(this);
},
- /**
- * Dragging onto a component directly is not an option
- *
- * @returns null
- */
+ /**
+ * Dragging onto a component directly is not an option
+ *
+ * @returns null
+ */
_$getArea: function () {
return null;
}
@@ -3841,9 +3839,9 @@
this.element.width(width);
this.element.height(height);
- /*
- * Root can be empty
- */
+ /*
+ * Root can be empty
+ */
if (this.contentItems[0]) {
this.contentItems[0].element.width(width);
this.contentItems[0].element.height(height);
@@ -3917,18 +3915,18 @@
lm.utils.copy(lm.items.RowOrColumn.prototype, {
- /**
- * Add a new contentItem to the Row or Column
- *
- * @param {lm.item.AbstractContentItem} contentItem
- * @param {[int]} index The position of the new item within the Row or Column.
- * If no index is provided the item will be added to the end
- * @param {[bool]} _$suspendResize If true the items won't be resized. This will leave the item in
- * an inconsistent state and is only intended to be used if multiple
- * children need to be added in one go and resize is called afterwards
- *
- * @returns {void}
- */
+ /**
+ * Add a new contentItem to the Row or Column
+ *
+ * @param {lm.item.AbstractContentItem} contentItem
+ * @param {[int]} index The position of the new item within the Row or Column.
+ * If no index is provided the item will be added to the end
+ * @param {[bool]} _$suspendResize If true the items won't be resized. This will leave the item in
+ * an inconsistent state and is only intended to be used if multiple
+ * children need to be added in one go and resize is called afterwards
+ *
+ * @returns {void}
+ */
addChild: function (contentItem, index, _$suspendResize) {
var newItemSize, itemSize, i, splitterElement;
@@ -3986,14 +3984,14 @@
},
- /**
- * Removes a child of this element
- *
- * @param {lm.items.AbstractContentItem} contentItem
- * @param {boolean} keepChild If true the child will be removed, but not destroyed
- *
- * @returns {void}
- */
+ /**
+ * Removes a child of this element
+ *
+ * @param {lm.items.AbstractContentItem} contentItem
+ * @param {boolean} keepChild If true the child will be removed, but not destroyed
+ *
+ * @returns {void}
+ */
removeChild: function (contentItem, keepChild) {
var removedItemSize = contentItem.config[this._dimension],
index = lm.utils.indexOf(contentItem, this.contentItems),
@@ -4005,10 +4003,10 @@
throw new Error('Can\'t remove child. ContentItem is not child of this Row or Column');
}
- /**
- * Remove the splitter before the item or after if the item happens
- * to be the first in the row/column
- */
+ /**
+ * Remove the splitter before the item or after if the item happens
+ * to be the first in the row/column
+ */
if (this._splitter[splitterIndex]) {
this._splitter[splitterIndex]._$destroy();
this._splitter.splice(splitterIndex, 1);
@@ -4019,9 +4017,9 @@
if (this.contentItems[i].config.fixed)
fixedItemSize += this.contentItems[i].config[this._dimension];
}
- /**
- * Allocate the space that the removed item occupied to the remaining items
- */
+ /**
+ * Allocate the space that the removed item occupied to the remaining items
+ */
for (i = 0; i < this.contentItems.length; i++) {
if (this.contentItems[i].config.fixed)
;
@@ -4044,14 +4042,14 @@
}
},
- /**
- * Replaces a child of this Row or Column with another contentItem
- *
- * @param {lm.items.AbstractContentItem} oldChild
- * @param {lm.items.AbstractContentItem} newChild
- *
- * @returns {void}
- */
+ /**
+ * Replaces a child of this Row or Column with another contentItem
+ *
+ * @param {lm.items.AbstractContentItem} oldChild
+ * @param {lm.items.AbstractContentItem} newChild
+ *
+ * @returns {void}
+ */
replaceChild: function (oldChild, newChild) {
var size = oldChild.config[this._dimension];
lm.items.AbstractContentItem.prototype.replaceChild.call(this, oldChild, newChild);
@@ -4060,11 +4058,11 @@
this.emitBubblingEvent('stateChanged');
},
- /**
- * Called whenever the dimensions of this item or one of its parents change
- *
- * @returns {void}
- */
+ /**
+ * Called whenever the dimensions of this item or one of its parents change
+ *
+ * @returns {void}
+ */
setSize: function () {
if (this.contentItems.length > 0) {
this._calculateRelativeSizes();
@@ -4074,15 +4072,15 @@
this.emit('resize');
},
- /**
- * Invoked recursively by the layout manager. AbstractContentItem.init appends
- * the contentItem's DOM elements to the container, RowOrColumn init adds splitters
- * in between them
- *
- * @package private
- * @override AbstractContentItem._$init
- * @returns {void}
- */
+ /**
+ * Invoked recursively by the layout manager. AbstractContentItem.init appends
+ * the contentItem's DOM elements to the container, RowOrColumn init adds splitters
+ * in between them
+ *
+ * @package private
+ * @override AbstractContentItem._$init
+ * @returns {void}
+ */
_$init: function () {
if (this.isInitialised === true) return;
@@ -4095,15 +4093,15 @@
}
},
- /**
- * Turns the relative sizes calculated by _calculateRelativeSizes into
- * absolute pixel values and applies them to the children's DOM elements
- *
- * Assigns additional pixels to counteract Math.floor
- *
- * @private
- * @returns {void}
- */
+ /**
+ * Turns the relative sizes calculated by _calculateRelativeSizes into
+ * absolute pixel values and applies them to the children's DOM elements
+ *
+ * Assigns additional pixels to counteract Math.floor
+ *
+ * @private
+ * @returns {void}
+ */
_setAbsoluteSizes: function () {
var i,
sizeData = this._calculateAbsoluteSizes();
@@ -4123,10 +4121,10 @@
}
},
- /**
- * Calculates the absolute sizes of all of the children of this Item.
- * @returns {object} - Set with absolute sizes and additional pixels.
- */
+ /**
+ * Calculates the absolute sizes of all of the children of this Item.
+ * @returns {object} - Set with absolute sizes and additional pixels.
+ */
_calculateAbsoluteSizes: function () {
var i,
totalSplitterSize = (this.contentItems.length - 1) * this._splitterSize,
@@ -4164,27 +4162,27 @@
};
},
- /**
- * Calculates the relative sizes of all children of this Item. The logic
- * is as follows:
- *
- * - Add up the total size of all items that have a configured size
- *
- * - If the total == 100 (check for floating point errors)
- * Excellent, job done
- *
- * - If the total is > 100,
- * set the size of items without set dimensions to 1/3 and add this to the total
- * set the size off all items so that the total is hundred relative to their original size
- *
- * - If the total is < 100
- * If there are items without set dimensions, distribute the remainder to 100 evenly between them
- * If there are no items without set dimensions, increase all items sizes relative to
- * their original size so that they add up to 100
- *
- * @private
- * @returns {void}
- */
+ /**
+ * Calculates the relative sizes of all children of this Item. The logic
+ * is as follows:
+ *
+ * - Add up the total size of all items that have a configured size
+ *
+ * - If the total == 100 (check for floating point errors)
+ * Excellent, job done
+ *
+ * - If the total is > 100,
+ * set the size of items without set dimensions to 1/3 and add this to the total
+ * set the size off all items so that the total is hundred relative to their original size
+ *
+ * - If the total is < 100
+ * If there are items without set dimensions, distribute the remainder to 100 evenly between them
+ * If there are no items without set dimensions, increase all items sizes relative to
+ * their original size so that they add up to 100
+ *
+ * @private
+ * @returns {void}
+ */
_calculateRelativeSizes: function () {
var i,
@@ -4200,17 +4198,17 @@
}
}
- /**
- * Everything adds up to hundred, all good :-)
- */
+ /**
+ * Everything adds up to hundred, all good :-)
+ */
if (Math.round(total) === 100) {
this._respectMinItemWidth();
return;
}
- /**
- * Allocate the remaining size to the items without a set dimension
- */
+ /**
+ * Allocate the remaining size to the items without a set dimension
+ */
if (Math.round(total) < 100 && itemsWithoutSetDimension.length > 0) {
for (i = 0; i < itemsWithoutSetDimension.length; i++) {
itemsWithoutSetDimension[i].config[dimension] = (100 - total) / itemsWithoutSetDimension.length;
@@ -4219,12 +4217,12 @@
return;
}
- /**
- * If the total is > 100, but there are also items without a set dimension left, assing 50
- * as their dimension and add it to the total
- *
- * This will be reset in the next step
- */
+ /**
+ * If the total is > 100, but there are also items without a set dimension left, assing 50
+ * as their dimension and add it to the total
+ *
+ * This will be reset in the next step
+ */
if (Math.round(total) > 100) {
for (i = 0; i < itemsWithoutSetDimension.length; i++) {
itemsWithoutSetDimension[i].config[dimension] = 50;
@@ -4232,9 +4230,9 @@
}
}
- /**
- * Set every items size relative to 100 relative to its size to total
- */
+ /**
+ * Set every items size relative to 100 relative to its size to total
+ */
for (i = 0; i < this.contentItems.length; i++) {
this.contentItems[i].config[dimension] = (this.contentItems[i].config[dimension] / total) * 100;
}
@@ -4242,10 +4240,10 @@
this._respectMinItemWidth();
},
- /**
- * Adjusts the column widths to respect the dimensions minItemWidth if set.
- * @returns {}
- */
+ /**
+ * Adjusts the column widths to respect the dimensions minItemWidth if set.
+ * @returns {}
+ */
_respectMinItemWidth: function () {
var minItemWidth = this.layoutManager.config.dimensions ? (this.layoutManager.config.dimensions.minItemWidth || 0) : 0,
sizeData = null,
@@ -4266,9 +4264,9 @@
sizeData = this._calculateAbsoluteSizes();
- /**
- * Figure out how much we are under the min item size total and how much room we have to use.
- */
+ /**
+ * Figure out how much we are under the min item size total and how much room we have to use.
+ */
for (var i = 0; i < this.contentItems.length; i++) {
contentItem = this.contentItems[i];
@@ -4288,16 +4286,16 @@
allEntries.push(entry);
}
- /**
- * If there is nothing under min, or there is not enough over to make up the difference, do nothing.
- */
+ /**
+ * If there is nothing under min, or there is not enough over to make up the difference, do nothing.
+ */
if (totalUnderMin === 0 || totalUnderMin > totalOverMin) {
return;
}
- /**
- * Evenly reduce all columns that are over the min item width to make up the difference.
- */
+ /**
+ * Evenly reduce all columns that are over the min item width to make up the difference.
+ */
reducePercent = totalUnderMin / totalOverMin;
remainingWidth = totalUnderMin;
for (i = 0; i < entriesOverMin.length; i++) {
@@ -4307,31 +4305,31 @@
entry.width -= reducedWidth;
}
- /**
- * Take anything remaining from the last item.
- */
+ /**
+ * Take anything remaining from the last item.
+ */
if (remainingWidth !== 0) {
allEntries[allEntries.length - 1].width -= remainingWidth;
}
- /**
- * Set every items size relative to 100 relative to its size to total
- */
+ /**
+ * Set every items size relative to 100 relative to its size to total
+ */
for (i = 0; i < this.contentItems.length; i++) {
this.contentItems[i].config.width = (allEntries[i].width / sizeData.totalWidth) * 100;
}
},
- /**
- * Instantiates a new lm.controls.Splitter, binds events to it and adds
- * it to the array of splitters at the position specified as the index argument
- *
- * What it doesn't do though is append the splitter to the DOM
- *
- * @param {Int} index The position of the splitter
- *
- * @returns {lm.controls.Splitter}
- */
+ /**
+ * Instantiates a new lm.controls.Splitter, binds events to it and adds
+ * it to the array of splitters at the position specified as the index argument
+ *
+ * What it doesn't do though is append the splitter to the DOM
+ *
+ * @param {Int} index The position of the splitter
+ *
+ * @returns {lm.controls.Splitter}
+ */
_createSplitter: function (index) {
var splitter;
splitter = new lm.controls.Splitter(this._isColumn, this._splitterSize, this._splitterGrabSize);
@@ -4342,16 +4340,16 @@
return splitter;
},
- /**
- * Locates the instance of lm.controls.Splitter in the array of
- * registered splitters and returns a map containing the contentItem
- * before and after the splitters, both of which are affected if the
- * splitter is moved
- *
- * @param {lm.controls.Splitter} splitter
- *
- * @returns {Object} A map of contentItems that the splitter affects
- */
+ /**
+ * Locates the instance of lm.controls.Splitter in the array of
+ * registered splitters and returns a map containing the contentItem
+ * before and after the splitters, both of which are affected if the
+ * splitter is moved
+ *
+ * @param {lm.controls.Splitter} splitter
+ *
+ * @returns {Object} A map of contentItems that the splitter affects
+ */
_getItemsForSplitter: function (splitter) {
var index = lm.utils.indexOf(splitter, this._splitter);
@@ -4361,11 +4359,11 @@
};
},
- /**
- * Gets the minimum dimensions for the given item configuration array
- * @param item
- * @private
- */
+ /**
+ * Gets the minimum dimensions for the given item configuration array
+ * @param item
+ * @private
+ */
_getMinimumDimensions: function (arr) {
var minWidth = 0, minHeight = 0;
@@ -4377,14 +4375,14 @@
return { horizontal: minWidth, vertical: minHeight };
},
- /**
- * Invoked when a splitter's dragListener fires dragStart. Calculates the splitters
- * movement area once (so that it doesn't need calculating on every mousemove event)
- *
- * @param {lm.controls.Splitter} splitter
- *
- * @returns {void}
- */
+ /**
+ * Invoked when a splitter's dragListener fires dragStart. Calculates the splitters
+ * movement area once (so that it doesn't need calculating on every mousemove event)
+ *
+ * @param {lm.controls.Splitter} splitter
+ *
+ * @returns {void}
+ */
_onSplitterDragStart: function (splitter) {
var items = this._getItemsForSplitter(splitter),
minSize = this.layoutManager.config.dimensions[this._isColumn ? 'minItemHeight' : 'minItemWidth'];
@@ -4400,16 +4398,16 @@
this._splitterMaxPosition = items.after.element[this._dimension]() - (afterMinSize || minSize);
},
- /**
- * Invoked when a splitter's DragListener fires drag. Updates the splitters DOM position,
- * but not the sizes of the elements the splitter controls in order to minimize resize events
- *
- * @param {lm.controls.Splitter} splitter
- * @param {Int} offsetX Relative pixel values to the splitters original position. Can be negative
- * @param {Int} offsetY Relative pixel values to the splitters original position. Can be negative
- *
- * @returns {void}
- */
+ /**
+ * Invoked when a splitter's DragListener fires drag. Updates the splitters DOM position,
+ * but not the sizes of the elements the splitter controls in order to minimize resize events
+ *
+ * @param {lm.controls.Splitter} splitter
+ * @param {Int} offsetX Relative pixel values to the splitters original position. Can be negative
+ * @param {Int} offsetY Relative pixel values to the splitters original position. Can be negative
+ *
+ * @returns {void}
+ */
_onSplitterDrag: function (splitter, offsetX, offsetY) {
var offset = this._isColumn ? offsetY : offsetX;
@@ -4419,15 +4417,15 @@
}
},
- /**
- * Invoked when a splitter's DragListener fires dragStop. Resets the splitters DOM position,
- * and applies the new sizes to the elements before and after the splitter and their children
- * on the next animation frame
- *
- * @param {lm.controls.Splitter} splitter
- *
- * @returns {void}
- */
+ /**
+ * Invoked when a splitter's DragListener fires dragStop. Resets the splitters DOM position,
+ * and applies the new sizes to the elements before and after the splitter and their children
+ * on the next animation frame
+ *
+ * @param {lm.controls.Splitter} splitter
+ *
+ * @returns {void}
+ */
_onSplitterDragStop: function (splitter) {
var items = this._getItemsForSplitter(splitter),
@@ -4575,13 +4573,13 @@
this.emitBubblingEvent('stateChanged');
},
- /**
- * Validates that the stack is still closable or not. If a stack is able
- * to close, but has a non closable component added to it, the stack is no
- * longer closable until all components are closable.
- *
- * @returns {void}
- */
+ /**
+ * Validates that the stack is still closable or not. If a stack is able
+ * to close, but has a non closable component added to it, the stack is no
+ * longer closable until all components are closable.
+ *
+ * @returns {void}
+ */
_$validateClosability: function () {
var contentItem,
isClosable,
@@ -4607,51 +4605,51 @@
},
- /**
- * Ok, this one is going to be the tricky one: The user has dropped {contentItem} onto this stack.
- *
- * It was dropped on either the stacks header or the top, right, bottom or left bit of the content area
- * (which one of those is stored in this._dropSegment). Now, if the user has dropped on the header the case
- * is relatively clear: We add the item to the existing stack... job done (might be good to have
- * tab reordering at some point, but lets not sweat it right now)
- *
- * If the item was dropped on the content part things are a bit more complicated. If it was dropped on either the
- * top or bottom region we need to create a new column and place the items accordingly.
- * Unless, of course if the stack is already within a column... in which case we want
- * to add the newly created item to the existing column...
- * either prepend or append it, depending on wether its top or bottom.
- *
- * Same thing for rows and left / right drop segments... so in total there are 9 things that can potentially happen
- * (left, top, right, bottom) * is child of the right parent (row, column) + header drop
- *
- * @param {lm.item} contentItem
- *
- * @returns {void}
- */
+ /**
+ * Ok, this one is going to be the tricky one: The user has dropped {contentItem} onto this stack.
+ *
+ * It was dropped on either the stacks header or the top, right, bottom or left bit of the content area
+ * (which one of those is stored in this._dropSegment). Now, if the user has dropped on the header the case
+ * is relatively clear: We add the item to the existing stack... job done (might be good to have
+ * tab reordering at some point, but lets not sweat it right now)
+ *
+ * If the item was dropped on the content part things are a bit more complicated. If it was dropped on either the
+ * top or bottom region we need to create a new column and place the items accordingly.
+ * Unless, of course if the stack is already within a column... in which case we want
+ * to add the newly created item to the existing column...
+ * either prepend or append it, depending on wether its top or bottom.
+ *
+ * Same thing for rows and left / right drop segments... so in total there are 9 things that can potentially happen
+ * (left, top, right, bottom) * is child of the right parent (row, column) + header drop
+ *
+ * @param {lm.item} contentItem
+ *
+ * @returns {void}
+ */
_$onDrop: function (contentItem) {
- /*
- * The item was dropped on the header area. Just add it as a child of this stack and
- * get the hell out of this logic
- */
+ /*
+ * The item was dropped on the header area. Just add it as a child of this stack and
+ * get the hell out of this logic
+ */
if (this._dropSegment === 'header') {
this._resetHeaderDropZone();
this.addChild(contentItem, this._dropIndex);
return;
}
- /*
- * The stack is empty. Let's just add the element.
- */
+ /*
+ * The stack is empty. Let's just add the element.
+ */
if (this._dropSegment === 'body') {
this.addChild(contentItem);
return;
}
- /*
- * The item was dropped on the top-, left-, bottom- or right- part of the content. Let's
- * aggregate some conditions to make the if statements later on more readable
- */
+ /*
+ * The item was dropped on the top-, left-, bottom- or right- part of the content. Let's
+ * aggregate some conditions to make the if statements later on more readable
+ */
var isVertical = this._dropSegment === 'top' || this._dropSegment === 'bottom',
isHorizontal = this._dropSegment === 'left' || this._dropSegment === 'right',
insertBefore = this._dropSegment === 'top' || this._dropSegment === 'left',
@@ -4662,9 +4660,9 @@
stack,
rowOrColumn;
- /*
- * The content item can be either a component or a stack. If it is a component, wrap it into a stack
- */
+ /*
+ * The content item can be either a component or a stack. If it is a component, wrap it into a stack
+ */
if (contentItem.isComponent) {
stack = this.layoutManager.createContentItem({
type: 'stack',
@@ -4675,20 +4673,20 @@
contentItem = stack;
}
- /*
- * If the item is dropped on top or bottom of a column or left and right of a row, it's already
- * layd out in the correct way. Just add it as a child
- */
+ /*
+ * If the item is dropped on top or bottom of a column or left and right of a row, it's already
+ * layd out in the correct way. Just add it as a child
+ */
if (hasCorrectParent) {
index = lm.utils.indexOf(this, this.parent.contentItems);
this.parent.addChild(contentItem, insertBefore ? index : index + 1, true);
this.config[dimension] *= 0.5;
contentItem.config[dimension] = this.config[dimension];
this.parent.callDownwards('setSize');
- /*
- * This handles items that are dropped on top or bottom of a row or left / right of a column. We need
- * to create the appropriate contentItem for them to live in
- */
+ /*
+ * This handles items that are dropped on top or bottom of a row or left / right of a column. We need
+ * to create the appropriate contentItem for them to live in
+ */
} else {
type = isVertical ? 'column' : 'row';
rowOrColumn = this.layoutManager.createContentItem({ type: type }, this);
@@ -4703,15 +4701,15 @@
}
},
- /**
- * If the user hovers above the header part of the stack, indicate drop positions for tabs.
- * otherwise indicate which segment of the body the dragged item would be dropped on
- *
- * @param {Int} x Absolute Screen X
- * @param {Int} y Absolute Screen Y
- *
- * @returns {void}
- */
+ /**
+ * If the user hovers above the header part of the stack, indicate drop positions for tabs.
+ * otherwise indicate which segment of the body the dragged item would be dropped on
+ *
+ * @param {Int} x Absolute Screen X
+ * @param {Int} y Absolute Screen Y
+ *
+ * @returns {void}
+ */
_$highlightDropZone: function (x, y) {
var segment, area;
@@ -4761,17 +4759,17 @@
}
};
- /**
- * If this Stack is a parent to rows, columns or other stacks only its
- * header is a valid dropzone.
- */
+ /**
+ * If this Stack is a parent to rows, columns or other stacks only its
+ * header is a valid dropzone.
+ */
if (this._activeContentItem && this._activeContentItem.isComponent === false) {
return headerArea;
}
- /**
- * Highlight the entire body if the stack is empty
- */
+ /**
+ * Highlight the entire body if the stack is empty
+ */
if (this.contentItems.length === 0) {
this._contentAreaDimensions.body = {
@@ -4875,7 +4873,7 @@
this.layoutManager.dropTargetIndicator.highlightArea({
x1: headerOffset.left,
x2: headerOffset.left + 100,
- y1: headerOffset.top + this.header.element.height() - 20,
+ y1: headerOffset.top + this.header.element.height() - 25,
y2: headerOffset.top + this.header.element.height()
});
@@ -4971,13 +4969,13 @@
lm.utils.BubblingEvent.prototype.stopPropagation = function () {
this.isPropagationStopped = true;
};
- /**
- * Minifies and unminifies configs by replacing frequent keys
- * and values with one letter substitutes. Config options must
- * retain array position/index, add new options at the end.
- *
- * @constructor
- */
+ /**
+ * Minifies and unminifies configs by replacing frequent keys
+ * and values with one letter substitutes. Config options must
+ * retain array position/index, add new options at the end.
+ *
+ * @constructor
+ */
lm.utils.ConfigMinifier = function () {
this._keys = [
'settings',
@@ -5037,154 +5035,154 @@
lm.utils.copy(lm.utils.ConfigMinifier.prototype, {
- /**
- * Takes a GoldenLayout configuration object and
- * replaces its keys and values recursively with
- * one letter counterparts
- *
- * @param {Object} config A GoldenLayout config object
- *
- * @returns {Object} minified config
- */
+ /**
+ * Takes a GoldenLayout configuration object and
+ * replaces its keys and values recursively with
+ * one letter counterparts
+ *
+ * @param {Object} config A GoldenLayout config object
+ *
+ * @returns {Object} minified config
+ */
minifyConfig: function (config) {
var min = {};
this._nextLevel(config, min, '_min');
return min;
},
- /**
- * Takes a configuration Object that was previously minified
- * using minifyConfig and returns its original version
- *
- * @param {Object} minifiedConfig
- *
- * @returns {Object} the original configuration
- */
+ /**
+ * Takes a configuration Object that was previously minified
+ * using minifyConfig and returns its original version
+ *
+ * @param {Object} minifiedConfig
+ *
+ * @returns {Object} the original configuration
+ */
unminifyConfig: function (minifiedConfig) {
var orig = {};
this._nextLevel(minifiedConfig, orig, '_max');
return orig;
},
- /**
- * Recursive function, called for every level of the config structure
- *
- * @param {Array|Object} orig
- * @param {Array|Object} min
- * @param {String} translationFn
- *
- * @returns {void}
- */
+ /**
+ * Recursive function, called for every level of the config structure
+ *
+ * @param {Array|Object} orig
+ * @param {Array|Object} min
+ * @param {String} translationFn
+ *
+ * @returns {void}
+ */
_nextLevel: function (from, to, translationFn) {
var key, minKey;
for (key in from) {
- /**
- * For in returns array indices as keys, so let's cast them to numbers
- */
+ /**
+ * For in returns array indices as keys, so let's cast them to numbers
+ */
if (from instanceof Array) key = parseInt(key, 10);
- /**
- * In case something has extended Object prototypes
- */
+ /**
+ * In case something has extended Object prototypes
+ */
if (!from.hasOwnProperty(key)) continue;
- /**
- * Translate the key to a one letter substitute
- */
+ /**
+ * Translate the key to a one letter substitute
+ */
minKey = this[translationFn](key, this._keys);
- /**
- * For Arrays and Objects, create a new Array/Object
- * on the minified object and recurse into it
- */
+ /**
+ * For Arrays and Objects, create a new Array/Object
+ * on the minified object and recurse into it
+ */
if (typeof from[key] === 'object') {
to[minKey] = from[key] instanceof Array ? [] : {};
this._nextLevel(from[key], to[minKey], translationFn);
- /**
- * For primitive values (Strings, Numbers, Boolean etc.)
- * minify the value
- */
+ /**
+ * For primitive values (Strings, Numbers, Boolean etc.)
+ * minify the value
+ */
} else {
to[minKey] = this[translationFn](from[key], this._values);
}
}
},
- /**
- * Minifies value based on a dictionary
- *
- * @param {String|Boolean} value
- * @param {Array<String|Boolean>} dictionary
- *
- * @returns {String} The minified version
- */
+ /**
+ * Minifies value based on a dictionary
+ *
+ * @param {String|Boolean} value
+ * @param {Array<String|Boolean>} dictionary
+ *
+ * @returns {String} The minified version
+ */
_min: function (value, dictionary) {
- /**
- * If a value actually is a single character, prefix it
- * with ___ to avoid mistaking it for a minification code
- */
+ /**
+ * If a value actually is a single character, prefix it
+ * with ___ to avoid mistaking it for a minification code
+ */
if (typeof value === 'string' && value.length === 1) {
return '___' + value;
}
var index = lm.utils.indexOf(value, dictionary);
- /**
- * value not found in the dictionary, return it unmodified
- */
+ /**
+ * value not found in the dictionary, return it unmodified
+ */
if (index === -1) {
return value;
- /**
- * value found in dictionary, return its base36 counterpart
- */
+ /**
+ * value found in dictionary, return its base36 counterpart
+ */
} else {
return index.toString(36);
}
},
_max: function (value, dictionary) {
- /**
- * value is a single character. Assume that it's a translation
- * and return the original value from the dictionary
- */
+ /**
+ * value is a single character. Assume that it's a translation
+ * and return the original value from the dictionary
+ */
if (typeof value === 'string' && value.length === 1) {
return dictionary[parseInt(value, 36)];
}
- /**
- * value originally was a single character and was prefixed with ___
- * to avoid mistaking it for a translation. Remove the prefix
- * and return the original character
- */
+ /**
+ * value originally was a single character and was prefixed with ___
+ * to avoid mistaking it for a translation. Remove the prefix
+ * and return the original character
+ */
if (typeof value === 'string' && value.substr(0, 3) === '___') {
return value[3];
}
- /**
- * value was not minified
- */
+ /**
+ * value was not minified
+ */
return value;
}
});
- /**
- * An EventEmitter singleton that propagates events
- * across multiple windows. This is a little bit trickier since
- * windows are allowed to open childWindows in their own right
- *
- * This means that we deal with a tree of windows. Hence the rules for event propagation are:
- *
- * - Propagate events from this layout to both parents and children
- * - Propagate events from parent to this and children
- * - Propagate events from children to the other children (but not the emitting one) and the parent
- *
- * @constructor
- *
- * @param {lm.LayoutManager} layoutManager
- */
+ /**
+ * An EventEmitter singleton that propagates events
+ * across multiple windows. This is a little bit trickier since
+ * windows are allowed to open childWindows in their own right
+ *
+ * This means that we deal with a tree of windows. Hence the rules for event propagation are:
+ *
+ * - Propagate events from this layout to both parents and children
+ * - Propagate events from parent to this and children
+ * - Propagate events from children to the other children (but not the emitting one) and the parent
+ *
+ * @constructor
+ *
+ * @param {lm.LayoutManager} layoutManager
+ */
lm.utils.EventHub = function (layoutManager) {
lm.utils.EventEmitter.call(this);
this._layoutManager = layoutManager;
@@ -5195,15 +5193,15 @@
$(window).on('gl_child_event', this._boundOnEventFromChild);
};
- /**
- * Called on every event emitted on this eventHub, regardles of origin.
- *
- * @private
- *
- * @param {Mixed}
- *
- * @returns {void}
- */
+ /**
+ * Called on every event emitted on this eventHub, regardles of origin.
+ *
+ * @private
+ *
+ * @param {Mixed}
+ *
+ * @returns {void}
+ */
lm.utils.EventHub.prototype._onEventFromThis = function () {
var args = Array.prototype.slice.call(arguments);
@@ -5217,40 +5215,40 @@
this._childEventSource = null;
};
- /**
- * Called by the parent layout.
- *
- * @param {Array} args Event name + arguments
- *
- * @returns {void}
- */
+ /**
+ * Called by the parent layout.
+ *
+ * @param {Array} args Event name + arguments
+ *
+ * @returns {void}
+ */
lm.utils.EventHub.prototype._$onEventFromParent = function (args) {
this._dontPropagateToParent = args[0];
this.emit.apply(this, args);
};
- /**
- * Callback for child events raised on the window
- *
- * @param {DOMEvent} event
- * @private
- *
- * @returns {void}
- */
+ /**
+ * Callback for child events raised on the window
+ *
+ * @param {DOMEvent} event
+ * @private
+ *
+ * @returns {void}
+ */
lm.utils.EventHub.prototype._onEventFromChild = function (event) {
this._childEventSource = event.originalEvent.__gl;
this.emit.apply(this, event.originalEvent.__glArgs);
};
- /**
- * Propagates the event to the parent by emitting
- * it on the parent's DOM window
- *
- * @param {Array} args Event name + arguments
- * @private
- *
- * @returns {void}
- */
+ /**
+ * Propagates the event to the parent by emitting
+ * it on the parent's DOM window
+ *
+ * @param {Array} args Event name + arguments
+ * @private
+ *
+ * @returns {void}
+ */
lm.utils.EventHub.prototype._propagateToParent = function (args) {
var event,
eventName = 'gl_child_event';
@@ -5274,14 +5272,14 @@
}
};
- /**
- * Propagate events to children
- *
- * @param {Array} args Event name + arguments
- * @private
- *
- * @returns {void}
- */
+ /**
+ * Propagate events to children
+ *
+ * @param {Array} args Event name + arguments
+ * @private
+ *
+ * @returns {void}
+ */
lm.utils.EventHub.prototype._propagateToChildren = function (args) {
var childGl, i;
@@ -5295,25 +5293,25 @@
};
- /**
- * Destroys the EventHub
- *
- * @public
- * @returns {void}
- */
+ /**
+ * Destroys the EventHub
+ *
+ * @public
+ * @returns {void}
+ */
lm.utils.EventHub.prototype.destroy = function () {
$(window).off('gl_child_event', this._boundOnEventFromChild);
};
- /**
- * A specialised GoldenLayout component that binds GoldenLayout container
- * lifecycle events to react components
- *
- * @constructor
- *
- * @param {lm.container.ItemContainer} container
- * @param {Object} state state is not required for react components
- */
+ /**
+ * A specialised GoldenLayout component that binds GoldenLayout container
+ * lifecycle events to react components
+ *
+ * @constructor
+ *
+ * @param {lm.container.ItemContainer} container
+ * @param {Object} state state is not required for react components
+ */
lm.utils.ReactComponentHandler = function (container, state) {
this._reactComponent = null;
this._originalComponentWillUpdate = null;
@@ -5326,15 +5324,15 @@
lm.utils.copy(lm.utils.ReactComponentHandler.prototype, {
- /**
- * Creates the react class and component and hydrates it with
- * the initial state - if one is present
- *
- * By default, react's getInitialState will be used
- *
- * @private
- * @returns {void}
- */
+ /**
+ * Creates the react class and component and hydrates it with
+ * the initial state - if one is present
+ *
+ * By default, react's getInitialState will be used
+ *
+ * @private
+ * @returns {void}
+ */
_render: function () {
this._reactComponent = ReactDOM.render(this._getReactComponent(), this._container.getElement()[0]);
this._originalComponentWillUpdate = this._reactComponent.componentWillUpdate || function () {
@@ -5345,36 +5343,36 @@
}
},
- /**
- * Removes the component from the DOM and thus invokes React's unmount lifecycle
- *
- * @private
- * @returns {void}
- */
+ /**
+ * Removes the component from the DOM and thus invokes React's unmount lifecycle
+ *
+ * @private
+ * @returns {void}
+ */
_destroy: function () {
ReactDOM.unmountComponentAtNode(this._container.getElement()[0]);
this._container.off('open', this._render, this);
this._container.off('destroy', this._destroy, this);
},
- /**
- * Hooks into React's state management and applies the componentstate
- * to GoldenLayout
- *
- * @private
- * @returns {void}
- */
+ /**
+ * Hooks into React's state management and applies the componentstate
+ * to GoldenLayout
+ *
+ * @private
+ * @returns {void}
+ */
_onUpdate: function (nextProps, nextState) {
this._container.setState(nextState);
this._originalComponentWillUpdate.call(this._reactComponent, nextProps, nextState);
},
- /**
- * Retrieves the react class from GoldenLayout's registry
- *
- * @private
- * @returns {React.Class}
- */
+ /**
+ * Retrieves the react class from GoldenLayout's registry
+ *
+ * @private
+ * @returns {React.Class}
+ */
_getReactClass: function () {
var componentName = this._container._config.component;
var reactClass;
@@ -5393,12 +5391,12 @@
return reactClass;
},
- /**
- * Copies and extends the properties array and returns the React element
- *
- * @private
- * @returns {React.Element}
- */
+ /**
+ * Copies and extends the properties array and returns the React element
+ *
+ * @private
+ * @returns {React.Element}
+ */
_getReactComponent: function () {
var defaultProps = {
glEventHub: this._container.layoutManager.eventHub,
diff --git a/src/client/util/CaptureManager.scss b/src/client/util/CaptureManager.scss
index 71539ee1e..a5024247e 100644
--- a/src/client/util/CaptureManager.scss
+++ b/src/client/util/CaptureManager.scss
@@ -1,4 +1,4 @@
-@import "../views/globalCssVariables";
+@import "../views/global/globalCssVariables";
.capture-interface {
//background-color: whitesmoke !important;
diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts
index 734b96b1e..9a634017a 100644
--- a/src/client/util/CurrentUserUtils.ts
+++ b/src/client/util/CurrentUserUtils.ts
@@ -1,14 +1,15 @@
-import { computed, observable, reaction, action } from "mobx";
+import { computed, observable, reaction } from "mobx";
import * as rp from 'request-promise';
-import { DataSym, Doc, DocListCast, DocListCastAsync, AclReadonly } from "../../fields/Doc";
+import { DataSym, Doc, DocListCast, DocListCastAsync } from "../../fields/Doc";
import { Id } from "../../fields/FieldSymbols";
+import { InkTool } from "../../fields/InkField";
import { List } from "../../fields/List";
import { PrefetchProxy } from "../../fields/Proxy";
import { RichTextField } from "../../fields/RichTextField";
import { listSpec } from "../../fields/Schema";
import { SchemaHeaderField } from "../../fields/SchemaHeaderField";
import { ComputedField, ScriptField } from "../../fields/ScriptField";
-import { BoolCast, Cast, NumCast, PromiseValue, StrCast, DateCast } from "../../fields/Types";
+import { BoolCast, Cast, DateCast, NumCast, PromiseValue, StrCast } from "../../fields/Types";
import { nullAudio } from "../../fields/URLField";
import { SharingPermissions } from "../../fields/util";
import { Utils } from "../../Utils";
@@ -19,6 +20,7 @@ import { Networking } from "../Network";
import { CollectionDockingView } from "../views/collections/CollectionDockingView";
import { DimUnit } from "../views/collections/collectionMulticolumn/CollectionMulticolumnView";
import { CollectionView, CollectionViewType } from "../views/collections/CollectionView";
+import { Colors } from "../views/global/globalEnums";
import { MainView } from "../views/MainView";
import { FormattedTextBox } from "../views/nodes/formattedText/FormattedTextBox";
import { LabelBox } from "../views/nodes/LabelBox";
@@ -31,12 +33,10 @@ import { LinkManager } from "./LinkManager";
import { Scripting } from "./Scripting";
import { SearchUtil } from "./SearchUtil";
import { SelectionManager } from "./SelectionManager";
-import { UndoManager } from "./UndoManager";
+import { ColorScheme } from "./SettingsManager";
+import { SharingManager } from "./SharingManager";
import { SnappingManager } from "./SnappingManager";
-import { InkTool } from "../../fields/InkField";
-import { computedFn } from "mobx-utils";
-import { CollectionSchemaBooleanCell } from "../views/collections/CollectionSchemaCells";
-import { Console } from "console";
+import { UndoManager } from "./UndoManager";
export let resolvedPorts: { server: number, socket: number };
@@ -409,12 +409,23 @@ export class CurrentUserUtils {
selection: { type: "text", anchor: 1, head: 1 },
storedMarks: []
};
- const headerTemplate = Docs.Create.RTFDocument(new RichTextField(JSON.stringify(json), ""), { title: "header", version: headerViewVersion, target: doc, _height: 70, _headerPointerEvents: "all", _headerHeight: 12, _headerFontSize: 9, _autoHeight: true, system: true, cloneFieldFilter: new List<string>(["system"]) }, "header"); // text needs to be a space to allow templateText to be created
+ const headerTemplate = Docs.Create.RTFDocument(new RichTextField(JSON.stringify(json), ""), {
+ title: "text", version: headerViewVersion, target: doc, _height: 70, _headerPointerEvents: "all",
+ _headerHeight: 12, _headerFontSize: 9, _autoHeight: true, system: true, _fitWidth: true,
+ cloneFieldFilter: new List<string>(["system"])
+ }, "header");
+ const headerBtnHgt = 10;
headerTemplate[DataSym].layout =
- "<div style={'height:100%'}>" +
- " <FormattedTextBox {...props} fieldKey={'header'} dontSelectOnLoad={'true'} ignoreAutoHeight={'true'} pointerEvents='{this._headerPointerEvents||`none`}' fontSize='{this._headerFontSize}px' height='{this._headerHeight}px' background='{this._headerColor||this.target.mySharedDocs.userColor}' />" +
- " <FormattedTextBox {...props} fieldKey={'text'} position='absolute' top='{(this._headerHeight)*scale}px' height='calc({100/scale}% - {this._headerHeight}px)'/>" +
- "</div>";
+ "<HTMLdiv transformOrigin='top left' width='{100/scale}%' height='{100/scale}%' transform='scale({scale})'>" +
+ ` <FormattedTextBox {...props} dontScale='true' fieldKey={'text'} height='calc(100% - ${headerBtnHgt}px - {this._headerHeight}px)'/>` +
+ " <FormattedTextBox {...props} dontScale='true' fieldKey={'header'} dontSelectOnLoad='true' ignoreAutoHeight='true' fontSize='{this._headerFontSize}px' height='{(this._headerHeight||1)}px' background='{this._headerColor ||this.target.mySharedDocs.userColor||`lightGray`}' />" +
+ ` <HTMLdiv fontSize='${headerBtnHgt - 1}px' height='${headerBtnHgt}px' background='yellow' onClick={‘(this._headerHeight=scale*Math.min(Math.max(1,this._height-30),this._headerHeight===1?50:1)) && (this._autoHeightMargins=this._headerHeight+${headerBtnHgt})’} >Metadata</HTMLdiv>` +
+ "</HTMLdiv>";
+
+ // "<div style={'height:100%'}>" +
+ // " <FormattedTextBox {...props} fieldKey={'header'} dontSelectOnLoad={'true'} ignoreAutoHeight={'true'} pointerEvents='{this._headerPointerEvents||`none`}' fontSize='{this._headerFontSize}px' height='{this._headerHeight}px' background='{this._headerColor||this.target.mySharedDocs.userColor}' />" +
+ // " <FormattedTextBox {...props} fieldKey={'text'} position='absolute' top='{(this._headerHeight)*scale}px' height='calc({100/scale}% - {this._headerHeight}px)'/>" +
+ // "</div>";
(headerTemplate.proto as Doc).isTemplateDoc = makeTemplate(headerTemplate.proto as Doc, true, "headerView");
doc.emptyHeader = headerTemplate;
((doc.emptyHeader as Doc).proto as Doc)["dragFactory-count"] = 0;
@@ -465,7 +476,7 @@ export class CurrentUserUtils {
{ toolTip: "Tap to create a videoWall", title: "Wall", icon: "photo-video", click: 'openOnRight(copyDragFactory(this.dragFactory))', drag: 'copyDragFactory(this.dragFactory)', dragFactory: doc.emptyWall as Doc },
{ toolTip: "Tap to create an audio recorder in a new pane, drag for an audio recorder", title: "Audio", icon: "microphone", click: 'openOnRight(copyDragFactory(this.dragFactory))', drag: 'copyDragFactory(this.dragFactory)', dragFactory: doc.emptyAudio as Doc, noviceMode: true },
{ toolTip: "Tap to create a button in a new pane, drag for a button", title: "Button", icon: "bolt", click: 'openOnRight(copyDragFactory(this.dragFactory))', drag: 'copyDragFactory(this.dragFactory)', dragFactory: doc.emptyButton as Doc },
- { toolTip: "Tap to create a presentation in a new pane, drag for a presentation", title: "Trails", icon: "pres-trail", click: 'openOnRight(Doc.UserDoc().activePresentation = copyDragFactory(this.dragFactory))', drag: `Doc.UserDoc().activePresentation = copyDragFactory(this.dragFactory)`, dragFactory: doc.emptyPresentation as Doc, noviceMode: true },
+ // { toolTip: "Tap to create a presentation in a new pane, drag for a presentation", title: "Trails", icon: "pres-trail", click: 'openOnRight(Doc.UserDoc().activePresentation = copyDragFactory(this.dragFactory))', drag: `Doc.UserDoc().activePresentation = copyDragFactory(this.dragFactory)`, dragFactory: doc.emptyPresentation as Doc, noviceMode: true },
{ toolTip: "Tap to create a scripting box in a new pane, drag for a scripting box", title: "Script", icon: "terminal", click: 'openOnRight(copyDragFactory(this.dragFactory))', drag: 'copyDragFactory(this.dragFactory)', dragFactory: doc.emptyScript as Doc },
{ toolTip: "Tap to create a mobile view in a new pane, drag for a mobile view", title: "Phone", icon: "mobile", click: 'openOnRight(Doc.UserDoc().activeMobileMenu)', drag: 'this.dragFactory', dragFactory: doc.activeMobileMenu as Doc },
{ toolTip: "Tap to create a custom header note document, drag for a custom header note", title: "Custom", icon: "window-maximize", click: 'openOnRight(delegateDragFactory(this.dragFactory))', drag: 'delegateDragFactory(this.dragFactory)', dragFactory: doc.emptyHeader as Doc },
@@ -526,10 +537,9 @@ export class CurrentUserUtils {
{ title: "Import", target: Cast(doc.myImportPanel, Doc, null), icon: "upload", click: 'selectMainMenu(self)' },
{ title: "Recently Closed", target: Cast(doc.myRecentlyClosedDocs, Doc, null), icon: "archive", click: 'selectMainMenu(self)' },
{ title: "Sharing", target: Cast(doc.mySharedDocs, Doc, null), icon: "users", click: 'selectMainMenu(self)', watchedDocuments: doc.mySharedDocs as Doc },
- // { title: "Filter", target: Cast(doc.currentFilter, Doc, null), icon: "filter", click: 'selectMainMenu(self)' },
{ title: "Pres. Trails", target: Cast(doc.myPresentations, Doc, null), icon: "pres-trail", click: 'selectMainMenu(self)' },
- { title: "Help", target: undefined as any, icon: "question-circle", click: 'selectMainMenu(self)' },
- { title: "Settings", target: undefined as any, icon: "cog", click: 'selectMainMenu(self)' },
+ // { title: "Help", target: undefined as any, icon: "question-circle", click: 'selectMainMenu(self)' },
+ // { title: "Settings", target: undefined as any, icon: "cog", click: 'selectMainMenu(self)' },
{ title: "User Doc", target: Cast(doc.myUserDoc, Doc, null), icon: "address-card", click: 'selectMainMenu(self)' },
];
}
@@ -547,7 +557,6 @@ export class CurrentUserUtils {
dontUndo: true,
title,
target,
- backgroundColor: "black",
_dropAction: "alias",
_removeDropProperties: new List<string>(["dropAction", "_stayInCollection"]),
_width: 60,
@@ -575,8 +584,10 @@ export class CurrentUserUtils {
title: "menuItemPanel",
childDropAction: "alias",
_chromeHidden: true,
+ backgroundColor: Colors.DARK_GRAY,
+ boxShadow: "rgba(0,0,0,0)",
dropConverter: ScriptField.MakeScript("convertToButtons(dragData)", { dragData: DragManager.DocumentDragData.name }),
- backgroundColor: "black", ignoreClick: true,
+ ignoreClick: true,
_gridGap: 0,
_yMargin: 0,
_yPadding: 0, _xMargin: 0, _autoHeight: false, _width: 60, _columnWidth: 60, _lockedPosition: true, system: true
@@ -586,8 +597,6 @@ export class CurrentUserUtils {
PromiseValue(Cast(doc.menuStack, Doc)).then(stack => {
stack && PromiseValue(stack.data).then(btns => {
DocListCastAsync(btns).then(bts => bts?.forEach(btn => {
- btn.color = "white";
- btn._backgroundColor = "";
btn.dontUndo = true;
btn.system = true;
if (btn.title === "Catalog" || btn.title === "My Files") { // migration from Catalog to My Files
@@ -746,7 +755,7 @@ export class CurrentUserUtils {
if (doc.myTools === undefined) {
const toolsStack = new PrefetchProxy(Docs.Create.StackingDocument([doc.myCreators as Doc, doc.myColorPicker as Doc], {
title: "My Tools", _width: 500, _yMargin: 20, ignoreClick: true, _lockedPosition: true, _forceActive: true,
- system: true, _stayInCollection: true, _hideContextMenu: true, _chromeHidden: true,
+ system: true, _stayInCollection: true, _hideContextMenu: true, _chromeHidden: true, boxShadow: "0 0",
})) as any as Doc;
doc.myTools = toolsStack;
@@ -758,10 +767,10 @@ export class CurrentUserUtils {
await doc.myDashboards;
if (doc.myDashboards === undefined) {
doc.myDashboards = new PrefetchProxy(Docs.Create.TreeDocument([], {
- title: "My Dashboards", _height: 400, childHideLinkButton: true,
+ title: "My Dashboards", _showTitle: "title", _height: 400, childHideLinkButton: true,
treeViewHideTitle: true, _xMargin: 5, _yMargin: 5, _gridGap: 5, _forceActive: true, childDropAction: "alias",
treeViewTruncateTitleWidth: 150, ignoreClick: true,
- _lockedPosition: true, boxShadow: "0 0", childDontRegisterViews: true, targetDropAction: "same", system: true
+ _lockedPosition: true, boxShadow: "0 0", childDontRegisterViews: true, targetDropAction: "same", treeViewType: "fileSystem", isFolder: true, system: true
}));
const newDashboard = ScriptField.MakeScript(`createNewDashboard(Doc.UserDoc())`);
(doc.myDashboards as any as Doc).contextMenuScripts = new List<ScriptField>([newDashboard!]);
@@ -774,7 +783,7 @@ export class CurrentUserUtils {
await doc.myPresentations;
if (doc.myPresentations === undefined) {
doc.myPresentations = new PrefetchProxy(Docs.Create.TreeDocument([], {
- title: "My Presentations", _height: 100,
+ title: "My Trails", _showTitle: "title", _height: 100,
treeViewHideTitle: true, _xMargin: 5, _yMargin: 5, _gridGap: 5, _forceActive: true, childDropAction: "alias",
treeViewTruncateTitleWidth: 150, ignoreClick: true,
_lockedPosition: true, boxShadow: "0 0", childDontRegisterViews: true, targetDropAction: "same", system: true
@@ -793,7 +802,7 @@ export class CurrentUserUtils {
doc.myFileOrphans = Docs.Create.TreeDocument([], { title: "Unfiled", _stayInCollection: true, system: true, isFolder: true });
doc.myFileRoot = Docs.Create.TreeDocument([], { title: "file root", _stayInCollection: true, system: true, isFolder: true });
doc.myFilesystem = new PrefetchProxy(Docs.Create.TreeDocument([doc.myFileRoot as Doc, doc.myFileOrphans as Doc], {
- title: "My Documents", _height: 100,
+ title: "My Documents", _showTitle: "title", _height: 100,
treeViewHideTitle: true, _xMargin: 5, _yMargin: 5, _gridGap: 5, _forceActive: true, childDropAction: "alias",
treeViewTruncateTitleWidth: 150, ignoreClick: true,
isFolder: true, treeViewType: "fileSystem", childHideLinkButton: true,
@@ -807,7 +816,7 @@ export class CurrentUserUtils {
// setup Recently Closed library item
if (doc.myRecentlyClosedDocs === undefined) {
doc.myRecentlyClosedDocs = new PrefetchProxy(Docs.Create.TreeDocument([], {
- title: "Recently Closed", treeViewShowClearButton: true, childHideLinkButton: true,
+ title: "Recently Closed", _showTitle: "title", treeViewShowClearButton: true, childHideLinkButton: true,
treeViewHideTitle: true, _xMargin: 5, _yMargin: 5, _gridGap: 5, _forceActive: true, childDropAction: "alias",
treeViewTruncateTitleWidth: 150, ignoreClick: true,
_lockedPosition: true, boxShadow: "0 0", childDontRegisterViews: true, targetDropAction: "same", system: true
@@ -839,7 +848,7 @@ export class CurrentUserUtils {
doc.treeViewOpen = true;
doc.treeViewExpandedView = "fields";
doc.myUserDoc = new PrefetchProxy(Docs.Create.TreeDocument([doc], {
- treeViewHideTitle: true, _xMargin: 5, _yMargin: 5, _gridGap: 5, _forceActive: true, title: "My UserDoc",
+ treeViewHideTitle: true, _xMargin: 5, _yMargin: 5, _gridGap: 5, _forceActive: true, title: "My UserDoc", _showTitle: "title",
treeViewTruncateTitleWidth: 150, ignoreClick: true,
_lockedPosition: true, boxShadow: "0 0", childDontRegisterViews: true, targetDropAction: "same", system: true
})) as any as Doc;
@@ -859,11 +868,11 @@ export class CurrentUserUtils {
static async setupSidebarButtons(doc: Doc) {
CurrentUserUtils.setupSidebarContainer(doc);
await CurrentUserUtils.setupToolsBtnPanel(doc);
+ CurrentUserUtils.setupImportSidebar(doc);
CurrentUserUtils.setupDashboards(doc);
CurrentUserUtils.setupPresentations(doc);
CurrentUserUtils.setupFilesystem(doc);
CurrentUserUtils.setupRecentlyClosedDocs(doc);
- // CurrentUserUtils.setupFilterDocs(doc);
CurrentUserUtils.setupUserDoc(doc);
}
@@ -891,6 +900,7 @@ export class CurrentUserUtils {
(doc["dockedBtn-undo"] as Doc).dontUndo = true;
(doc["dockedBtn-redo"] as Doc).dontUndo = true;
}
+
// sets up the default set of documents to be shown in the Overlay layer
static setupOverlays(doc: Doc) {
if (doc.myOverlayDocs === undefined) {
@@ -922,9 +932,10 @@ export class CurrentUserUtils {
if (doc.mySharedDocs === undefined) {
let sharedDocs = Docs.newAccount ? undefined : await DocServer.GetRefField(sharingDocumentId + "outer");
if (!sharedDocs) {
- sharedDocs = Docs.Create.StackingDocument([], {
- title: "My SharedDocs", childDropAction: "alias", system: true, contentPointerEvents: "none", childLimitHeight: 0, _yMargin: 50, _gridGap: 15,
- _showTitle: "title", ignoreClick: true, _lockedPosition: true, "acl-Public": SharingPermissions.Add, "_acl-Public": SharingPermissions.Add, _chromeHidden: true,
+ sharedDocs = Docs.Create.TreeDocument([], {
+ title: "My SharedDocs", childDropAction: "alias", system: true, contentPointerEvents: "all", childLimitHeight: 0, _yMargin: 50, _gridGap: 15,
+ _showTitle: "title", ignoreClick: true, _lockedPosition: true, "acl-Public": SharingPermissions.Add, "_acl-Public": SharingPermissions.Add,
+ _chromeHidden: true, boxShadow: "0 0",
}, sharingDocumentId + "outer", sharingDocumentId);
(sharedDocs as Doc)["acl-Public"] = (sharedDocs as Doc)[DataSym]["acl-Public"] = SharingPermissions.Add;
}
@@ -939,14 +950,14 @@ export class CurrentUserUtils {
static setupImportSidebar(doc: Doc) {
if (doc.myImportDocs === undefined) {
doc.myImportDocs = new PrefetchProxy(Docs.Create.StackingDocument([], {
- title: "My ImportDocuments", _forceActive: true, ignoreClick: true, _showTitle: "title", _stayInCollection: true, _hideContextMenu: true, childLimitHeight: 0,
+ title: "My ImportDocuments", _forceActive: true, ignoreClick: true, _stayInCollection: true, _hideContextMenu: true, childLimitHeight: 0,
childDropAction: "alias", _autoHeight: true, _yMargin: 50, _gridGap: 15, _lockedPosition: true, system: true, _chromeHidden: true,
}));
}
if (doc.myImportPanel === undefined) {
const uploads = Cast(doc.myImportDocs, Doc, null);
const newUpload = CurrentUserUtils.ficon({ onClick: ScriptField.MakeScript("importDocument()"), toolTip: "Import External document", _stayInCollection: true, _hideContextMenu: true, title: "Import", icon: "upload", system: true });
- doc.myImportPanel = new PrefetchProxy(Docs.Create.StackingDocument([newUpload, uploads], { title: "My ImportPanel", _yMargin: 20, ignoreClick: true, _chromeHidden: true, _stayInCollection: true, _hideContextMenu: true, _lockedPosition: true, system: true }));
+ doc.myImportPanel = new PrefetchProxy(Docs.Create.StackingDocument([newUpload, uploads], { title: "My ImportPanel", _yMargin: 20, _showTitle: "title", ignoreClick: true, _chromeHidden: true, _stayInCollection: true, _hideContextMenu: true, _lockedPosition: true, system: true, boxShadow: "0 0" }));
}
}
@@ -1017,10 +1028,14 @@ export class CurrentUserUtils {
const mygroups = groups?.filter(group => JSON.parse(StrCast(group.members)).includes(Doc.CurrentUserEmail)) || [];
SnappingManager.SetCachedGroups(["Public", ...mygroups?.map(g => StrCast(g.title))]);
}, { fireImmediately: true });
+ // Document properties on load
doc.system = true;
+ doc.darkScheme = ColorScheme.Dark;
doc.noviceMode = doc.noviceMode === undefined ? "true" : doc.noviceMode;
doc.title = Doc.CurrentUserEmail;
doc._raiseWhenDragged = true;
+ doc._showLabel = false;
+ doc._showMenuLabel = true;
doc.activeInkColor = StrCast(doc.activeInkColor, "rgb(0, 0, 0)");
doc.activeInkWidth = StrCast(doc.activeInkWidth, "1");
doc.activeInkBezier = StrCast(doc.activeInkBezier, "0");
@@ -1209,14 +1224,37 @@ export class CurrentUserUtils {
};
const freeformDoc = CurrentUserUtils.GuestTarget || Docs.Create.FreeformDocument([], freeformOptions);
const dashboardDoc = Docs.Create.StandardCollectionDockingDocument([{ doc: freeformDoc, initialWidth: 600 }], { title: `Dashboard ${dashboardCount}` }, id, "row");
+ freeformDoc.context = dashboardDoc;
+
+ // switching the tabs from the datadoc to the regular doc
+ const dashboardTabs = dashboardDoc[DataSym].data;
+ dashboardDoc[DataSym].data = new List<Doc>();
+ dashboardDoc.data = dashboardTabs;
+
+ // collating all docs on the dashboard to make a data-all field
+ const allDocs = new List<Doc>();
+ const allDocs2 = new List<Doc>(); // Array.from, spread, splice all cause so stack or acl issues for some reason
+ DocListCast(dashboardTabs).forEach(doc => {
+ const tabDocs = DocListCast(doc.data);
+ allDocs.push(...tabDocs);
+ allDocs2.push(...tabDocs);
+ });
+ dashboardDoc[DataSym]["data-all"] = allDocs;
+ dashboardDoc["data-all"] = allDocs2;
+ DocListCast(dashboardDoc.data).forEach(doc => doc.dashboard = dashboardDoc);
+ DocListCast(dashboardDoc.data)[1].data = ComputedField.MakeFunction(`dynamicOffScreenDocs(self.dashboard)`) as any;
+
Doc.AddDocToList(myPresentations, "data", presentation);
userDoc.activePresentation = presentation;
- const toggleTheme = ScriptField.MakeScript(`self.darkScheme = !self.darkScheme`);
+ const toggleTheme = ScriptField.MakeScript(`Doc.UserDoc().darkScheme = !Doc.UserDoc().darkScheme`);
const toggleComic = ScriptField.MakeScript(`toggleComicMode()`);
const snapshotDashboard = ScriptField.MakeScript(`snapshotDashboard()`);
const createDashboard = ScriptField.MakeScript(`createNewDashboard()`);
- dashboardDoc.contextMenuScripts = new List<ScriptField>([toggleTheme!, toggleComic!, snapshotDashboard!, createDashboard!]);
- dashboardDoc.contextMenuLabels = new List<string>(["Toggle Theme Colors", "Toggle Comic Mode", "Snapshot Dashboard", "Create Dashboard"]);
+ const shareDashboard = ScriptField.MakeScript(`shareDashboard(self)`);
+ const addToDashboards = ScriptField.MakeScript(`addToDashboards(self)`);
+ const removeDashboard = ScriptField.MakeScript('removeDashboard(self)');
+ dashboardDoc.contextMenuScripts = new List<ScriptField>([toggleTheme!, toggleComic!, snapshotDashboard!, createDashboard!, shareDashboard!, addToDashboards!, removeDashboard!]);
+ dashboardDoc.contextMenuLabels = new List<string>(["Toggle Theme Colors", "Toggle Comic Mode", "Snapshot Dashboard", "Create Dashboard", "Share Dashboard", "Add to Dashboards", "Remove Dashboard"]);
Doc.AddDocToList(dashboards, "data", dashboardDoc);
CurrentUserUtils.openDashboard(userDoc, dashboardDoc);
@@ -1268,5 +1306,53 @@ Scripting.addGlobal(function links(doc: any) { return new List(LinkManager.Insta
"returns all the links to the document or its annotations", "(doc: any)");
Scripting.addGlobal(function importDocument() { return CurrentUserUtils.importDocument(); },
"imports files from device directly into the import sidebar");
-Scripting.addGlobal(function toggleComicMode() { Doc.UserDoc().renderStyle = Doc.UserDoc().renderStyle === "comic" ? undefined : "comic"; },
- "toggle between regular rendeing and an informal sketch/comic style");
+Scripting.addGlobal(function shareDashboard(dashboard: Doc) {
+ SharingManager.Instance.open(undefined, dashboard);
+},
+ "opens sharing dialog for Dashboard");
+Scripting.addGlobal(async function removeDashboard(dashboard: Doc) {
+ const dashboards = await DocListCastAsync(CurrentUserUtils.MyDashboards.data);
+ if (dashboards && dashboards.length > 1) {
+ if (dashboard === CurrentUserUtils.ActiveDashboard) CurrentUserUtils.openDashboard(Doc.UserDoc(), dashboards.find(doc => doc !== dashboard)!);
+ Doc.RemoveDocFromList(CurrentUserUtils.MyDashboards, "data", dashboard);
+ }
+},
+ "Remove Dashboard from Dashboards");
+Scripting.addGlobal(async function addToDashboards(dashboard: Doc) {
+ const dashboardAlias = Doc.MakeAlias(dashboard);
+
+ const allDocs = await DocListCastAsync(dashboard[DataSym]["data-all"]);
+
+ // moves the data-all field from the datadoc to the layoutdoc, necessary for off screen docs tab to function properly
+ dashboard["data-all"] = new List<Doc>(allDocs);
+ dashboardAlias["data-all"] = new List<Doc>((allDocs || []).map(doc => Doc.MakeAlias(doc)));
+
+ const dockingConfig = JSON.parse(StrCast(dashboardAlias.dockingConfig));
+ dockingConfig.content = [];
+ dashboardAlias.dockingConfig = JSON.stringify(dockingConfig);
+
+
+ dashboardAlias.data = new List<Doc>(DocListCast(dashboard.data).map(tabFolder => Doc.MakeAlias(tabFolder)));
+ DocListCast(dashboardAlias.data).forEach(doc => doc.dashboard = dashboardAlias);
+ DocListCast(dashboardAlias.data)[0].data = new List<Doc>();
+ DocListCast(dashboardAlias.data)[1].data = ComputedField.MakeFunction(`dynamicOffScreenDocs(self.dashboard)`) as any;
+ Doc.AddDocToList(CurrentUserUtils.MyDashboards, "data", dashboardAlias);
+ CurrentUserUtils.openDashboard(Doc.UserDoc(), dashboardAlias);
+},
+ "adds Dashboard to set of Dashboards");
+
+/**
+ * Dynamically computes which docs should be rendered in the off-screen tabs tree of a dashboard.
+ */
+Scripting.addGlobal(function dynamicOffScreenDocs(dashboard: Doc) {
+ if (dashboard[DataSym] instanceof Doc) {
+ const allDocs = DocListCast(dashboard["data-all"]);
+ const onScreenTab = DocListCast(dashboard.data)[0];
+ const onScreenDocs = DocListCast(onScreenTab.data);
+ return new List<Doc>(allDocs.reduce((result: Doc[], doc) => {
+ !onScreenDocs.includes(doc) && !onScreenDocs.includes(doc.aliasOf as Doc) && (result.push(doc));
+ return result;
+ }, []));
+ }
+ return [];
+});
diff --git a/src/client/util/DocumentManager.ts b/src/client/util/DocumentManager.ts
index 304215a8f..9c6100249 100644
--- a/src/client/util/DocumentManager.ts
+++ b/src/client/util/DocumentManager.ts
@@ -28,7 +28,7 @@ export class DocumentManager {
DocListCast(view.rootDoc.links).forEach(link => {
const whichOtherAnchor = view.props.LayoutTemplateString?.includes("anchor2") ? "anchor1" : "anchor2";
const otherDoc = link && (link[whichOtherAnchor] as Doc);
- const otherDocAnno = otherDoc?.type === DocumentType.TEXTANCHOR ? otherDoc.annotationOn as Doc : undefined;
+ const otherDocAnno = DocumentType.MARKER === otherDoc?.type ? otherDoc.annotationOn as Doc : undefined;
otherDoc && DocumentManager.Instance.DocumentViews?.filter(dv => Doc.AreProtosEqual(dv.rootDoc, otherDoc) || Doc.AreProtosEqual(dv.rootDoc, otherDocAnno)).
forEach(otherView => {
if (otherView.rootDoc.type !== DocumentType.LINK || otherView.props.LayoutTemplateString !== view.props.LayoutTemplateString) {
@@ -162,8 +162,8 @@ export class DocumentManager {
const contextDoc = contextDocs?.find(doc => Doc.AreProtosEqual(doc, targetDoc) || Doc.AreProtosEqual(doc, annotatedDoc)) ? docContext : undefined;
const targetDocContext = contextDoc || annotatedDoc;
const targetDocContextView = targetDocContext && getFirstDocView(targetDocContext);
- const focusView = !docView && targetDoc.type === DocumentType.TEXTANCHOR && annoContainerView ? annoContainerView : docView;
- if (!docView && annoContainerView && !focusView) {
+ const focusView = !docView && targetDoc.type === DocumentType.MARKER && annoContainerView ? annoContainerView : docView;
+ if (!docView && annoContainerView) {
annoContainerView.focus(targetDoc); // this allows something like a PDF view to remove its doc filters to expose the target so that it can be found in the retry code below
}
if (focusView) {
diff --git a/src/client/util/DragManager.ts b/src/client/util/DragManager.ts
index d8c2f913e..5e16de617 100644
--- a/src/client/util/DragManager.ts
+++ b/src/client/util/DragManager.ts
@@ -1,4 +1,4 @@
-import { action, observable, runInAction } from "mobx";
+import { action } from "mobx";
import { DateField } from "../../fields/DateField";
import { Doc, Field, Opt } from "../../fields/Doc";
import { List } from "../../fields/List";
@@ -7,14 +7,23 @@ import { listSpec } from "../../fields/Schema";
import { SchemaHeaderField } from "../../fields/SchemaHeaderField";
import { ScriptField } from "../../fields/ScriptField";
import { Cast, NumCast, ScriptCast, StrCast } from "../../fields/Types";
-import { emptyFunction, returnTrue } from "../../Utils";
+import { emptyFunction } from "../../Utils";
import { Docs, DocUtils } from "../documents/Documents";
-import * as globalCssVariables from "../views/globalCssVariables.scss";
-import { UndoManager } from "./UndoManager";
-import { SnappingManager } from "./SnappingManager";
+import * as globalCssVariables from "../views/global/globalCssVariables.scss";
import { DocumentView } from "../views/nodes/DocumentView";
+import { SnappingManager } from "./SnappingManager";
+import { UndoManager } from "./UndoManager";
export type dropActionType = "alias" | "copy" | "move" | "same" | "proto" | "none" | undefined; // undefined = move, "same" = move but don't call removeDropProperties
+
+/**
+ * Initialize drag
+ * @param _reference: The HTMLElement that is being dragged
+ * @param docFunc: The Dash document being moved
+ * @param moveFunc: The function called when the document is moved
+ * @param dropAction: What to do with the document when it is dropped
+ * @param dragStarted: Method to call when the drag is started
+ */
export function SetupDrag(
_reference: React.RefObject<HTMLElement>,
docFunc: () => Doc | Promise<Doc> | undefined,
@@ -210,16 +219,16 @@ export namespace DragManager {
dropDoc instanceof Doc && DocUtils.MakeLinkToActiveAudio(() => dropDoc);
return dropDoc;
};
- const finishDrag = (e: DragCompleteEvent) => {
+ const finishDrag = async (e: DragCompleteEvent) => {
const docDragData = e.docDragData;
dropEvent?.(); // glr: optional additional function to be called - in this case with presentation trails
if (docDragData && !docDragData.droppedDocuments.length) {
docDragData.dropAction = dragData.userDropAction || dragData.dropAction;
docDragData.droppedDocuments =
- dragData.draggedDocuments.map(d => !dragData.isSelectionMove && !dragData.userDropAction && ScriptCast(d.onDragStart) ? addAudioTag(ScriptCast(d.onDragStart).script.run({ this: d }).result) :
+ await Promise.all(dragData.draggedDocuments.map(async d => !dragData.isSelectionMove && !dragData.userDropAction && ScriptCast(d.onDragStart) ? addAudioTag(ScriptCast(d.onDragStart).script.run({ this: d }).result) :
docDragData.dropAction === "alias" ? Doc.MakeAlias(d) :
docDragData.dropAction === "proto" ? Doc.GetProto(d) :
- docDragData.dropAction === "copy" ? Doc.MakeClone(d) : d);
+ docDragData.dropAction === "copy" ? (await Doc.MakeClone(d)).clone : d));
!["same", "proto"].includes(docDragData.dropAction as any) && docDragData.droppedDocuments.forEach((drop: Doc, i: number) => {
const dragProps = Cast(dragData.draggedDocuments[i].removeDropProperties, listSpec("string"), []);
const remProps = (dragData?.removeDropProperties || []).concat(Array.from(dragProps));
@@ -340,7 +349,7 @@ export namespace DragManager {
dragLabel.style.zIndex = "100001";
dragLabel.style.fontSize = "10px";
dragLabel.style.position = "absolute";
- dragLabel.innerText = "press 'a' to embed on drop"; // bcz: need to move this to a status bar
+ dragLabel.innerText = "drag titlebar to embed on drop"; // bcz: need to move this to a status bar
dragDiv.appendChild(dragLabel);
DragManager.Root().appendChild(dragDiv);
}
@@ -427,7 +436,7 @@ export namespace DragManager {
SnappingManager.clearSnapLines();
batch.end();
});
- const moveHandler = (e: PointerEvent) => {
+ const moveHandler = async (e: PointerEvent) => {
e.preventDefault(); // required or dragging text menu link item ends up dragging the link button as native drag/drop
if (dragData instanceof DocumentDragData) {
dragData.userDropAction = e.ctrlKey && e.altKey ? "copy" : e.ctrlKey ? "alias" : dragData.defaultDropAction;
@@ -438,7 +447,7 @@ export namespace DragManager {
dragData.removeDocument?.(dragData.draggedDocuments[0]);
}
AbortDrag();
- finishDrag?.(new DragCompleteEvent(true, dragData));
+ await finishDrag?.(new DragCompleteEvent(true, dragData));
DragManager.StartWindowDrag?.({
pageX: e.pageX,
pageY: e.pageY,
@@ -509,7 +518,7 @@ export namespace DragManager {
`translate(${(xs[i] += moveVec.x) + (options?.offsetX || 0)}px, ${(ys[i] += moveVec.y) + (options?.offsetY || 0)}px) scale(${scaleXs[i]}, ${scaleYs[i]})`)
);
};
- const upHandler = (e: PointerEvent) => {
+ const upHandler = async (e: PointerEvent) => {
dispatchDrag(document.elementFromPoint(e.x, e.y) || document.body, e, new DragCompleteEvent(false, dragData), snapDrag(e, xFromLeft, yFromTop, xFromRight, yFromBottom), finishDrag, options);
endDrag();
};
@@ -517,7 +526,7 @@ export namespace DragManager {
document.addEventListener("pointerup", upHandler);
}
- function dispatchDrag(target: Element, e: PointerEvent, complete: DragCompleteEvent, pos: { x: number, y: number }, finishDrag?: (e: DragCompleteEvent) => void, options?: DragOptions) {
+ async function dispatchDrag(target: Element, e: PointerEvent, complete: DragCompleteEvent, pos: { x: number, y: number }, finishDrag?: (e: DragCompleteEvent) => void, options?: DragOptions) {
const dropArgs = {
bubbles: true,
detail: {
@@ -531,7 +540,7 @@ export namespace DragManager {
}
};
target.dispatchEvent(new CustomEvent<DropEvent>("dashPreDrop", dropArgs));
- finishDrag?.(complete);
+ await finishDrag?.(complete);
target.dispatchEvent(new CustomEvent<DropEvent>("dashOnDrop", dropArgs));
options?.dragComplete?.(complete);
}
diff --git a/src/client/util/GroupMemberView.tsx b/src/client/util/GroupMemberView.tsx
index 927200ed3..b7f89794d 100644
--- a/src/client/util/GroupMemberView.tsx
+++ b/src/client/util/GroupMemberView.tsx
@@ -50,7 +50,6 @@ export class GroupMemberView extends React.Component<GroupMemberViewProps> {
onChange={selectedOption => GroupManager.Instance.addMemberToGroup(this.props.group, (selectedOption as UserOptions).value)}
placeholder={"Add members"}
value={null}
- closeMenuOnSelect={true}
styles={{
dropdownIndicator: (base, state) => ({
...base,
diff --git a/src/client/util/HypothesisUtils.ts b/src/client/util/HypothesisUtils.ts
index 8ddfce772..635673025 100644
--- a/src/client/util/HypothesisUtils.ts
+++ b/src/client/util/HypothesisUtils.ts
@@ -126,7 +126,7 @@ export namespace Hypothesis {
});
const annotationId = StrCast(linkDoc.annotationId);
- const linkUrl = Utils.prepend("/doc/" + sourceDoc[Id]);
+ const linkUrl = Doc.globalServerPath(sourceDoc);
const interval = setInterval(() => {// keep trying to edit until annotations have loaded and editing is successful
!success && document.dispatchEvent(new CustomEvent<{ targetUrl: string, id: string }>("deleteLink", {
detail: { targetUrl: linkUrl, id: annotationId },
diff --git a/src/client/util/InteractionUtils.tsx b/src/client/util/InteractionUtils.tsx
index 01d00db30..ba935e3bf 100644
--- a/src/client/util/InteractionUtils.tsx
+++ b/src/client/util/InteractionUtils.tsx
@@ -208,7 +208,7 @@ export namespace InteractionUtils {
<polyline
points={strpts}
style={{
- filter: drawHalo ? "url(#inkSelectionHalo)" : undefined,
+ // filter: drawHalo ? "url(#inkSelectionHalo)" : undefined,
fill: fill ? fill : "none",
opacity: strokeWidth !== width ? 0.5 : undefined,
pointerEvents: pevents as any,
diff --git a/src/client/util/LinkManager.ts b/src/client/util/LinkManager.ts
index 3c3d5c3b8..08f4ac9b7 100644
--- a/src/client/util/LinkManager.ts
+++ b/src/client/util/LinkManager.ts
@@ -1,15 +1,14 @@
+import { observable, observe, action } from "mobx";
import { computedFn } from "mobx-utils";
-import { Doc, DocListCast, Opt, DirectLinksSym, Field } from "../../fields/Doc";
-import { BoolCast, Cast, StrCast, PromiseValue } from "../../fields/Types";
+import { DirectLinksSym, Doc, DocListCast, Field, Opt } from "../../fields/Doc";
+import { List } from "../../fields/List";
+import { ProxyField } from "../../fields/Proxy";
+import { BoolCast, Cast, PromiseValue, StrCast } from "../../fields/Types";
import { LightboxView } from "../views/LightboxView";
import { DocumentViewSharedProps, ViewAdjustment } from "../views/nodes/DocumentView";
import { DocumentManager } from "./DocumentManager";
import { SharingManager } from "./SharingManager";
import { UndoManager } from "./UndoManager";
-import { observe, observable, reaction } from "mobx";
-import { listSpec } from "../../fields/Schema";
-import { List } from "../../fields/List";
-import { ProxyField } from "../../fields/Proxy";
type CreateViewFunc = (doc: Doc, followLinkLocation: string, finished?: () => void) => void;
/*
@@ -34,7 +33,7 @@ export class LinkManager {
LinkManager._instance = this;
setTimeout(() => {
LinkManager.userDocs = [Doc.LinkDBDoc().data as Doc, ...SharingManager.Instance.users.map(user => user.linkDatabase)];
- const addLinkToDoc = (link: Doc): any => {
+ const addLinkToDoc = action((link: Doc): any => {
const a1 = link?.anchor1;
const a2 = link?.anchor2;
if (a1 instanceof Promise || a2 instanceof Promise) return PromiseValue(a1).then(a1 => PromiseValue(a2).then(a2 => addLinkToDoc(link)));
@@ -43,8 +42,8 @@ export class LinkManager {
Doc.GetProto(a2)[DirectLinksSym].add(link);
Doc.GetProto(link)[DirectLinksSym].add(link);
}
- };
- const remLinkFromDoc = (link: Doc): any => {
+ });
+ const remLinkFromDoc = action((link: Doc): any => {
const a1 = link?.anchor1;
const a2 = link?.anchor2;
if (a1 instanceof Promise || a2 instanceof Promise) return PromiseValue(a1).then(a1 => PromiseValue(a2).then(a2 => remLinkFromDoc(link)));
@@ -53,7 +52,7 @@ export class LinkManager {
Doc.GetProto(a2)[DirectLinksSym].delete(link);
Doc.GetProto(link)[DirectLinksSym].delete(link);
}
- };
+ });
const watchUserLinks = (userLinks: List<Doc>) => {
const toRealField = (field: Field) => field instanceof ProxyField ? field.value() : field; // see List.ts. data structure is not a simple list of Docs, but a list of ProxyField/Fields
observe(userLinks, change => {
@@ -75,8 +74,10 @@ export class LinkManager {
});
}
- public addLink(linkDoc: Doc) {
- return Doc.AddDocToList(Doc.LinkDBDoc(), "data", linkDoc);
+ public addLink(linkDoc: Doc, checkExists = false) {
+ if (!checkExists || !DocListCast(Doc.LinkDBDoc().data).includes(linkDoc)) {
+ Doc.AddDocToList(Doc.LinkDBDoc(), "data", linkDoc);
+ }
}
public deleteLink(linkDoc: Doc) { return Doc.RemoveDocFromList(Doc.LinkDBDoc(), "data", linkDoc); }
public deleteAllLinksOnAnchor(anchor: Doc) { LinkManager.Instance.relatedLinker(anchor).forEach(linkDoc => LinkManager.Instance.deleteLink(linkDoc)); }
@@ -85,19 +86,6 @@ export class LinkManager {
public getAllDirectLinks(anchor: Doc): Doc[] {
return Array.from(Doc.GetProto(anchor)[DirectLinksSym]);
} // finds all links that contain the given anchor
- public getAllLinks(): Doc[] { return []; }//this.allLinks(); }
-
- // allLinks = computedFn(function allLinks(this: any): Doc[] {
- // const linkData = Doc.LinkDBDoc().data;
- // const lset = new Set<Doc>(DocListCast(linkData));
- // SharingManager.Instance.users.forEach(user => DocListCast(user.linkDatabase?.data).forEach(doc => lset.add(doc)));
- // LinkManager.Instance.allLinks().filter(link => {
- // const a1 = Cast(link?.anchor1, Doc, null);
- // const a2 = Cast(link?.anchor2, Doc, null);
- // return link && ((a1?.author !== undefined && a2?.author !== undefined) || link.author === Doc.CurrentUserEmail) && (Doc.AreProtosEqual(anchor, a1) || Doc.AreProtosEqual(anchor, a2) || Doc.AreProtosEqual(link, anchor));
- // });
- // return Array.from(lset);
- // }, true);
relatedLinker = computedFn(function relatedLinker(this: any, anchor: Doc): Doc[] {
const lfield = Doc.LayoutFieldKey(anchor);
diff --git a/src/client/util/Scripting.ts b/src/client/util/Scripting.ts
index c3c3083be..f981f84cd 100644
--- a/src/client/util/Scripting.ts
+++ b/src/client/util/Scripting.ts
@@ -181,7 +181,7 @@ function Run(script: string | undefined, customParams: string[], diagnostics: an
if (batch) {
batch.end();
}
- onError?.(error);
+ onError?.(script + " " + error);
return { success: false, error, result: errorVal };
}
};
diff --git a/src/client/util/SelectionManager.ts b/src/client/util/SelectionManager.ts
index ca5ef75d2..dbcc49f3d 100644
--- a/src/client/util/SelectionManager.ts
+++ b/src/client/util/SelectionManager.ts
@@ -1,9 +1,10 @@
import { action, observable, ObservableMap } from "mobx";
import { computedFn } from "mobx-utils";
import { Doc, Opt } from "../../fields/Doc";
-import { CollectionSchemaView } from "../views/collections/CollectionSchemaView";
+import { CollectionSchemaView } from "../views/collections/collectionSchema/CollectionSchemaView";
import { CollectionViewType } from "../views/collections/CollectionView";
import { DocumentView } from "../views/nodes/DocumentView";
+import { DocumentType } from "../documents/DocumentTypes";
export namespace SelectionManager {
@@ -22,7 +23,7 @@ export namespace SelectionManager {
@action
SelectView(docView: DocumentView, ctrlPressed: boolean): void {
// if doc is not in SelectedDocuments, add it
- if (!manager.SelectedViews.get(docView)) {
+ if (!manager.SelectedViews.get(docView) && docView.props.Document.type !== DocumentType.MARKER) {
if (!ctrlPressed) {
this.DeselectAll();
}
diff --git a/src/client/util/SettingsManager.scss b/src/client/util/SettingsManager.scss
index d8342ea56..c9db94419 100644
--- a/src/client/util/SettingsManager.scss
+++ b/src/client/util/SettingsManager.scss
@@ -1,4 +1,4 @@
-@import "../views/globalCssVariables";
+@import "../views/global/globalCssVariables";
.settings-interface {
//background-color: whitesmoke !important;
@@ -264,7 +264,7 @@
//margin-top: 4px;
&:hover {
- background: $main-accent;
+ background: $medium-gray;
}
}
diff --git a/src/client/util/SettingsManager.tsx b/src/client/util/SettingsManager.tsx
index 777394b05..3987497b8 100644
--- a/src/client/util/SettingsManager.tsx
+++ b/src/client/util/SettingsManager.tsx
@@ -18,6 +18,12 @@ const higflyout = require("@hig/flyout");
export const { anchorPoints } = higflyout;
export const Flyout = higflyout.default;
+export enum ColorScheme {
+ Dark = "Dark",
+ Light = "Light",
+ System = "Match System"
+}
+
@observer
export class SettingsManager extends React.Component<{}> {
public static Instance: SettingsManager;
@@ -32,7 +38,7 @@ export class SettingsManager extends React.Component<{}> {
@observable activeTab = "Accounts";
@computed get backgroundColor() { return Doc.UserDoc().activeCollectionBackground; }
-
+ @computed get colorScheme() { return Doc.UserDoc().colorScheme; }
constructor(props: {}) {
super(props);
@@ -69,6 +75,28 @@ export class SettingsManager extends React.Component<{}> {
else DocServer.Control.makeEditable();
});
+ @undoBatch
+ @action
+ changeColorScheme = action((e: React.ChangeEvent) => {
+ const scheme: ColorScheme = (e.currentTarget as any).value;
+ switch (scheme) {
+ case ColorScheme.Light:
+ Doc.UserDoc().colorScheme = ColorScheme.Light;
+ addStyleSheetRule(SettingsManager._settingsStyle, "lm_header", { background: "#d3d3d3 !important" });
+ break;
+ case ColorScheme.Dark:
+ Doc.UserDoc().colorScheme = ColorScheme.Dark;
+ addStyleSheetRule(SettingsManager._settingsStyle, "lm_header", { background: "black !important" });
+ break;
+ case ColorScheme.System: default:
+ window.matchMedia('(prefers-color-scheme: dark)').addEventListener('change', e => {
+ Doc.UserDoc().colorScheme = e.matches ? ColorScheme.Dark : ColorScheme.Light;
+ });
+ break;
+ }
+ });
+
+
@computed get colorsContent() {
const colorBox = (func: (color: ColorState) => void) => <SketchPicker onChange={func} color={StrCast(this.backgroundColor)}
presetColors={['#D0021B', '#F5A623', '#F8E71C', '#8B572A', '#7ED321', '#417505',
@@ -90,8 +118,7 @@ export class SettingsManager extends React.Component<{}> {
</Flyout>
</div>;
- const fontFamilies = ["Times New Roman", "Arial", "Georgia", "Comic Sans MS", "Tahoma", "Impact", "Crimson Text"];
- const fontSizes = ["7px", "8px", "9px", "10px", "12px", "14px", "16px", "18px", "20px", "24px", "32px", "48px", "72px"];
+ const colorSchemes = [ColorScheme.Light, ColorScheme.Dark, ColorScheme.System];
return <div className="colors-content">
<div className="preferences-color">
@@ -102,14 +129,11 @@ export class SettingsManager extends React.Component<{}> {
<div className="preferences-color-text">Border/Header Color</div>
{userColorFlyout}
</div>
- <div className="preferences-font">
- <div className="preferences-font-text">Default Font</div>
- <div className="preferences-font-controls">
- <select className="size-select" onChange={this.changeFontSize} value={StrCast(Doc.UserDoc().fontSize, "7px")}>
- {fontSizes.map(size => <option key={size} value={size} defaultValue={StrCast(Doc.UserDoc().fontSize)}> {size} </option>)}
- </select>
- <select className="font-select" onChange={this.changeFontFamily} value={StrCast(Doc.UserDoc().fontFamily, "Times New Roman")} >
- {fontFamilies.map(font => <option key={font} value={font} defaultValue={StrCast(Doc.UserDoc().fontFamily)}> {font} </option>)}
+ <div className="preferences-colorScheme">
+ <div className="preferences-color-text">Color Scheme</div>
+ <div className="preferences-color-controls">
+ <select className="scheme-select" onChange={this.changeColorScheme} defaultValue={StrCast(Doc.UserDoc().colorScheme)}>
+ {colorSchemes.map(scheme => <option key={scheme} value={scheme}> {scheme} </option>)}
</select>
</div>
</div>
@@ -132,6 +156,16 @@ export class SettingsManager extends React.Component<{}> {
checked={BoolCast(Doc.UserDoc()._raiseWhenDragged)} />
<div className="preferences-check">Raise on drag</div>
</div>
+ <div>
+ <input type="checkbox" onChange={e => Doc.UserDoc()._showLabel = !Doc.UserDoc()._showLabel}
+ checked={BoolCast(Doc.UserDoc()._showLabel)} />
+ <div className="preferences-check">Show tool button labels</div>
+ </div>
+ <div>
+ <input type="checkbox" onChange={e => Doc.UserDoc()._showMenuLabel = !Doc.UserDoc()._showMenuLabel}
+ checked={BoolCast(Doc.UserDoc()._showMenuLabel)} />
+ <div className="preferences-check">Show menu button labels</div>
+ </div>
</div>;
}
@@ -149,6 +183,27 @@ export class SettingsManager extends React.Component<{}> {
</div>;
}
+ @computed get textContent() {
+
+ const fontFamilies = ["Times New Roman", "Arial", "Georgia", "Comic Sans MS", "Tahoma", "Impact", "Crimson Text", "Roboto"];
+ const fontSizes = ["7px", "8px", "9px", "10px", "12px", "14px", "16px", "18px", "20px", "24px", "32px", "48px", "72px"];
+
+ return (
+ <div className="tab-content appearances-content">
+ <div className="preferences-font">
+ <div className="preferences-font-text">Default Font</div>
+ <div className="preferences-font-controls">
+ <select className="size-select" onChange={this.changeFontSize} value={StrCast(Doc.UserDoc().fontSize, "7px")}>
+ {fontSizes.map(size => <option key={size} value={size} defaultValue={StrCast(Doc.UserDoc().fontSize)}> {size} </option>)}
+ </select>
+ <select className="font-select" onChange={this.changeFontFamily} value={StrCast(Doc.UserDoc().fontFamily, "Times New Roman")} >
+ {fontFamilies.map(font => <option key={font} value={font} defaultValue={StrCast(Doc.UserDoc().fontFamily)}> {font} </option>)}
+ </select>
+ </div>
+ </div>
+ </div>);
+ }
+
@action
changeVal = (e: React.ChangeEvent, pass: string) => {
const value = (e.target as any).value;
@@ -228,7 +283,7 @@ export class SettingsManager extends React.Component<{}> {
// { title: "Accounts", ele: this.accountsContent }, { title: "Preferences", ele: this.preferencesContent }];
const tabs = [{ title: "Accounts", ele: this.accountsContent }, { title: "Modes", ele: this.modesContent },
- { title: "Appearance", ele: this.appearanceContent }];
+ { title: "Appearance", ele: this.appearanceContent }, { title: "Text", ele: this.textContent }];
return <div className="settings-interface">
<div className="settings-panel">
diff --git a/src/client/util/SharingManager.tsx b/src/client/util/SharingManager.tsx
index dc5f488b2..d283510b7 100644
--- a/src/client/util/SharingManager.tsx
+++ b/src/client/util/SharingManager.tsx
@@ -5,7 +5,7 @@ import { observer } from "mobx-react";
import * as React from "react";
import Select from "react-select";
import * as RequestPromise from "request-promise";
-import { AclAddonly, AclAdmin, AclEdit, AclPrivate, AclReadonly, AclSym, DataSym, Doc, DocListCast, DocListCastAsync, Opt } from "../../fields/Doc";
+import { AclAddonly, AclAdmin, AclEdit, AclPrivate, AclReadonly, AclSym, AclUnset, DataSym, Doc, DocListCast, DocListCastAsync, Opt } from "../../fields/Doc";
import { List } from "../../fields/List";
import { Cast, NumCast, StrCast } from "../../fields/Types";
import { distributeAcls, GetEffectiveAcl, normalizeEmail, SharingPermissions, TraceMobx } from "../../fields/util";
@@ -17,6 +17,7 @@ import { MainViewModal } from "../views/MainViewModal";
import { DocumentView } from "../views/nodes/DocumentView";
import { TaskCompletionBox } from "../views/nodes/TaskCompletedBox";
import { SearchBox } from "../views/search/SearchBox";
+import { CurrentUserUtils } from "./CurrentUserUtils";
import { DocumentManager } from "./DocumentManager";
import { GroupManager, UserOptions } from "./GroupManager";
import { GroupMemberView } from "./GroupMemberView";
@@ -38,7 +39,7 @@ interface GroupedOptions {
}
// const SharingKey = "sharingPermissions";
-// const PublicKey = "publicLinkPermissions";
+// const PublicKey = "all";
// const DefaultColor = "black";
// used to differentiate between individuals and groups when sharing
@@ -90,7 +91,7 @@ export class SharingManager extends React.Component<{}> {
]);
// private get linkVisible() {
- // return this.sharingDoc ? this.sharingDoc[PublicKey] !== SharingPermissions.None : false;
+ // return this.targetDoc ? this.targetDoc["acl-" + PublicKey] !== SharingPermissions.None : false;
// }
public open = (target?: DocumentView, target_doc?: Doc) => {
@@ -172,10 +173,11 @@ export class SharingManager extends React.Component<{}> {
const target = targetDoc || this.targetDoc!;
const acl = `acl-${normalizeEmail(user.email)}`;
const myAcl = `acl-${Doc.CurrentUserEmailNormalized}`;
+ const isDashboard = DocListCast(CurrentUserUtils.MyDashboards.data).indexOf(target) !== -1;
const docs = SelectionManager.Views().length < 2 ? [target] : SelectionManager.Views().map(docView => docView.props.Document);
return !docs.map(doc => {
- doc.author === Doc.CurrentUserEmail && !doc[myAcl] && distributeAcls(myAcl, SharingPermissions.Admin, doc);
+ doc.author === Doc.CurrentUserEmail && !doc[myAcl] && distributeAcls(myAcl, SharingPermissions.Admin, doc, undefined, undefined, isDashboard);
if (permission === SharingPermissions.None) {
if (doc[acl] && doc[acl] !== SharingPermissions.None) doc.numUsersShared = NumCast(doc.numUsersShared, 1) - 1;
@@ -184,8 +186,9 @@ export class SharingManager extends React.Component<{}> {
if (!doc[acl] || doc[acl] === SharingPermissions.None) doc.numUsersShared = NumCast(doc.numUsersShared, 0) + 1;
}
- distributeAcls(acl, permission as SharingPermissions, doc);
+ distributeAcls(acl, permission as SharingPermissions, doc, undefined, undefined, isDashboard);
+ this.setDashboardBackground(doc, permission as SharingPermissions);
if (permission !== SharingPermissions.None) return Doc.AddDocToList(sharingDoc, storage, doc);
else return GetEffectiveAcl(doc, user.email) === AclPrivate && Doc.RemoveDocFromList(sharingDoc, storage, (doc.aliasOf as Doc || doc));
}).some(success => !success);
@@ -201,12 +204,13 @@ export class SharingManager extends React.Component<{}> {
const target = targetDoc || this.targetDoc!;
const key = normalizeEmail(StrCast(group.title));
const acl = `acl-${key}`;
+ const isDashboard = DocListCast(CurrentUserUtils.MyDashboards.data).indexOf(target) !== -1;
const docs = SelectionManager.Views().length < 2 ? [target] : SelectionManager.Views().map(docView => docView.props.Document);
// ! ensures it returns true if document has been shared successfully, false otherwise
return !docs.map(doc => {
- doc.author === Doc.CurrentUserEmail && !doc[`acl-${Doc.CurrentUserEmailNormalized}`] && distributeAcls(`acl-${Doc.CurrentUserEmailNormalized}`, SharingPermissions.Admin, doc);
+ doc.author === Doc.CurrentUserEmail && !doc[`acl-${Doc.CurrentUserEmailNormalized}`] && distributeAcls(`acl-${Doc.CurrentUserEmailNormalized}`, SharingPermissions.Admin, doc, undefined, undefined, isDashboard);
if (permission === SharingPermissions.None) {
if (doc[acl] && doc[acl] !== SharingPermissions.None) doc.numGroupsShared = NumCast(doc.numGroupsShared, 1) - 1;
@@ -215,7 +219,8 @@ export class SharingManager extends React.Component<{}> {
if (!doc[acl] || doc[acl] === SharingPermissions.None) doc.numGroupsShared = NumCast(doc.numGroupsShared, 0) + 1;
}
- distributeAcls(acl, permission as SharingPermissions, doc);
+ distributeAcls(acl, permission as SharingPermissions, doc, undefined, undefined, isDashboard);
+ this.setDashboardBackground(doc, permission as SharingPermissions);
if (group instanceof Doc) {
const members: string[] = JSON.parse(StrCast(group.members));
@@ -264,13 +269,34 @@ export class SharingManager extends React.Component<{}> {
});
}
else {
+ const dashboards = DocListCast(CurrentUserUtils.MyDashboards.data);
docs.forEach(doc => {
- if (GetEffectiveAcl(doc) === AclAdmin) distributeAcls(`acl-${shareWith}`, permission, doc);
+ const isDashboard = dashboards.indexOf(doc) !== -1;
+ if (GetEffectiveAcl(doc) === AclAdmin) distributeAcls(`acl-${shareWith}`, permission, doc, undefined, undefined, isDashboard);
});
}
}
/**
+ * Sets the background of the Dashboard if it has been shared as a visual indicator
+ */
+ setDashboardBackground = async (doc: Doc, permission: SharingPermissions) => {
+ if (Doc.IndexOf(doc, DocListCast(CurrentUserUtils.MyDashboards.data)) !== -1) {
+ if (permission !== SharingPermissions.None) {
+ doc.isShared = true;
+ doc.backgroundColor = "green";
+ }
+ else {
+ const acls = doc[DataSym][AclSym];
+ if (Object.keys(acls).every(key => key === `acl-${Doc.CurrentUserEmailNormalized}` ? true : [AclUnset, AclPrivate].includes(acls[key]))) {
+ doc.isShared = undefined;
+ doc.backgroundColor = undefined;
+ }
+ }
+ }
+ }
+
+ /**
* Removes the documents shared with a user through a group when the user is removed from the group.
* @param group
* @param emailId
@@ -294,10 +320,11 @@ export class SharingManager extends React.Component<{}> {
*/
removeGroup = (group: Doc) => {
if (group.docsShared) {
+ const dashboards = DocListCast(CurrentUserUtils.MyDashboards.data);
DocListCast(group.docsShared).forEach(doc => {
const acl = `acl-${StrCast(group.title)}`;
-
- distributeAcls(acl, SharingPermissions.None, doc);
+ const isDashboard = dashboards.indexOf(doc) !== -1;
+ distributeAcls(acl, SharingPermissions.None, doc, undefined, undefined, isDashboard);
const members: string[] = JSON.parse(StrCast(group.members));
const users: ValidatedUser[] = this.users.filter(({ user: { email } }) => members.includes(email));
@@ -310,11 +337,11 @@ export class SharingManager extends React.Component<{}> {
// private setExternalSharing = (permission: string) => {
- // const sharingDoc = this.sharingDoc;
- // if (!sharingDoc) {
+ // const targetDoc = this.targetDoc;
+ // if (!targetDoc) {
// return;
// }
- // sharingDoc[PublicKey] = permission;
+ // targetDoc["acl-" + PublicKey] = permission;
// }
// private get sharingUrl() {
@@ -423,16 +450,16 @@ export class SharingManager extends React.Component<{}> {
}
}
- distributeOverCollection = (targetDoc?: Doc) => {
- const target = targetDoc || this.targetDoc!;
+ // distributeOverCollection = (targetDoc?: Doc) => {
+ // const target = targetDoc || this.targetDoc!;
- const docs = SelectionManager.Views().length < 2 ? [target] : SelectionManager.Views().map(docView => docView.props.Document);
- docs.forEach(doc => {
- for (const [key, value] of Object.entries(doc[AclSym])) {
- distributeAcls(key, this.AclMap.get(value)! as SharingPermissions, target);
- }
- });
- }
+ // const docs = SelectionManager.Views().length < 2 ? [target] : SelectionManager.Views().map(docView => docView.props.Document);
+ // docs.forEach(doc => {
+ // for (const [key, value] of Object.entries(doc[AclSym])) {
+ // distributeAcls(key, this.AclMap.get(value)! as SharingPermissions, target);
+ // }
+ // });
+ // }
/**
* Sorting algorithm to sort users.
@@ -565,7 +592,7 @@ export class SharingManager extends React.Component<{}> {
// the list of groups shared with
const groupListMap: (Doc | { title: string })[] = groups.filter(({ title }) => docs.length > 1 ? commonKeys.includes(`acl-${normalizeEmail(StrCast(title))}`) : true);
- groupListMap.unshift({ title: "Public" });//, { title: "Override" });
+ groupListMap.unshift({ title: "Public" });//, { title: "ALL" });
const groupListContents = groupListMap.map(group => {
const groupKey = `acl-${StrCast(group.title)}`;
const uniform = docs.every(doc => this.layoutDocAcls ? doc?.[AclSym]?.[groupKey] === docs[0]?.[AclSym]?.[groupKey] : doc?.[DataSym]?.[AclSym]?.[groupKey] === docs[0]?.[DataSym]?.[AclSym]?.[groupKey]);
@@ -614,6 +641,11 @@ export class SharingManager extends React.Component<{}> {
<div className={"close-button"} onClick={this.close}>
<FontAwesomeIcon icon={"times"} color={"black"} size={"lg"} />
</div>
+ {/* {this.linkVisible ?
+ <div>
+ {this.sharingUrl}
+ </div> :
+ (null)} */}
{<div className="share-container">
<div className="share-setup">
<Select
diff --git a/src/client/views/.DS_Store b/src/client/views/.DS_Store
index 33e624ef4..e4ac87aad 100644
--- a/src/client/views/.DS_Store
+++ b/src/client/views/.DS_Store
Binary files differ
diff --git a/src/client/views/AntimodeMenu.scss b/src/client/views/AntimodeMenu.scss
index a275901be..8a0e5480e 100644
--- a/src/client/views/AntimodeMenu.scss
+++ b/src/client/views/AntimodeMenu.scss
@@ -1,14 +1,14 @@
-@import "./globalCssVariables";
+@import "./global/globalCssVariables";
.antimodeMenu-cont {
position: absolute;
z-index: 10001;
height: $antimodemenu-height;
- background: #323232;
- box-shadow: 3px 3px 3px rgba(0, 0, 0, 0.25);
+ background: $dark-gray;
+ border-bottom: $standard-border;
+ // box-shadow: 3px 3px 3px rgba(0, 0, 0, 0.25);
// border-radius: 0px 6px 6px 6px;
- z-index: 1001;
display: flex;
&.with-rows {
diff --git a/src/client/views/ContextMenu.scss b/src/client/views/ContextMenu.scss
index b514de5f2..795529780 100644
--- a/src/client/views/ContextMenu.scss
+++ b/src/client/views/ContextMenu.scss
@@ -1,10 +1,10 @@
-@import "globalCssVariables";
+@import "global/globalCssVariables";
.contextMenu-cont {
position: absolute;
display: flex;
z-index: $contextMenu-zindex;
- box-shadow: $intermediate-color 0.2vw 0.2vw 0.4vw;
+ box-shadow: $medium-gray 0.2vw 0.2vw 0.4vw;
flex-direction: column;
background: whitesmoke;
padding-top: 10px;
@@ -14,17 +14,17 @@
}
// .contextMenu-item:first-child {
-// background: $intermediate-color;
-// color: $light-color;
+// background: $medium-gray;
+// color: $white;
// }
// .contextMenu-item:first-child::placeholder {
-// color: $light-color;
+// color: $white;
// }
// .contextMenu-item:first-child:hover {
-// background: $intermediate-color;
-// color: $light-color;
+// background: $medium-gray;
+// color: $white;
// }
.contextMenu-subMenu-cont {
@@ -94,7 +94,7 @@
.contextMenu-item:hover {
border-width: .11px;
border-style: none;
- border-color: $intermediate-color; // rgb(187, 186, 186);
+ border-color: $medium-gray; // rgb(187, 186, 186);
border-bottom-style: solid;
border-top-style: solid;
@@ -122,7 +122,7 @@
transition: all .1s;
border-width: .11px;
border-style: none;
- border-color: $intermediate-color; // rgb(187, 186, 186);
+ border-color: $medium-gray; // rgb(187, 186, 186);
// padding: 10px 0px 10px 0px;
white-space: nowrap;
font-size: 13px;
@@ -137,7 +137,7 @@
.contextMenu-item:hover {
transition: all 0.1s ease;
- background: $lighter-alt-accent;
+ background: $light-blue;
}
.contextMenu-description {
diff --git a/src/client/views/ContextMenu.tsx b/src/client/views/ContextMenu.tsx
index d96de72e3..c4fabbf99 100644
--- a/src/client/views/ContextMenu.tsx
+++ b/src/client/views/ContextMenu.tsx
@@ -218,7 +218,7 @@ export class ContextMenu extends React.Component {
@computed get menuItems() {
if (!this._searchString) {
- return this._items.map(item => <ContextMenuItem {...item} noexpand={this.itemsNeedSearch ? true : (item as any).noexpand} key={item.description} closeMenu={this.closeMenu} />);
+ return this._items.map((item, ind) => <ContextMenuItem {...item} noexpand={this.itemsNeedSearch ? true : (item as any).noexpand} key={ind + item.description} closeMenu={this.closeMenu} />);
}
return this.filteredViews;
}
diff --git a/src/client/views/DocComponent.tsx b/src/client/views/DocComponent.tsx
index a878a7afb..fc36c7e43 100644
--- a/src/client/views/DocComponent.tsx
+++ b/src/client/views/DocComponent.tsx
@@ -7,7 +7,7 @@ import { InteractionUtils } from '../util/InteractionUtils';
import { List } from '../../fields/List';
import { DateField } from '../../fields/DateField';
import { ScriptField } from '../../fields/ScriptField';
-import { GetEffectiveAcl, SharingPermissions, distributeAcls, denormalizeEmail } from '../../fields/util';
+import { GetEffectiveAcl, SharingPermissions, distributeAcls, denormalizeEmail, inheritParentAcls } from '../../fields/util';
import { CurrentUserUtils } from '../util/CurrentUserUtils';
import { DocUtils } from '../documents/Documents';
import { returnFalse } from '../../Utils';
@@ -107,19 +107,12 @@ export function ViewBoxAnnotatableComponent<P extends ViewBoxAnnotatableProps, T
// key where data is stored
@computed get fieldKey() { return this.props.fieldKey; }
- private AclMap = new Map<symbol, string>([
- [AclPrivate, SharingPermissions.None],
- [AclReadonly, SharingPermissions.View],
- [AclAddonly, SharingPermissions.Add],
- [AclEdit, SharingPermissions.Edit],
- [AclAdmin, SharingPermissions.Admin]
- ]);
lookupField = (field: string) => ScriptCast((this.layoutDoc as any).lookupField)?.script.run({ self: this.layoutDoc, data: this.rootDoc, field: field }).result;
styleFromLayoutString = (scale: number) => {
const style: { [key: string]: any } = {};
- const divKeys = ["width", "height", "fontSize", "left", "background", "top", "pointerEvents", "position"];
+ const divKeys = ["width", "height", "fontSize", "transform", "left", "background", "left", "right", "top", "bottom", "pointerEvents", "position"];
const replacer = (match: any, expr: string, offset: any, string: any) => { // bcz: this executes a script to convert a property expression string: { script } into a value
return ScriptField.MakeFunction(expr, { self: Doc.name, this: Doc.name, scale: "number" })?.script.run({ self: this.rootDoc, this: this.layoutDoc, scale }).result as string || "";
};
@@ -154,7 +147,10 @@ export function ViewBoxAnnotatableComponent<P extends ViewBoxAnnotatableProps, T
leavePushpin && DocUtils.LeavePushpin(doc, annotationKey ?? this.annotationKey);
Doc.RemoveDocFromList(targetDataDoc, annotationKey ?? this.annotationKey, doc);
doc.context = undefined;
- recent && Doc.AddDocToList(recent, "data", doc, undefined, true, true);
+ if (recent) {
+ Doc.RemoveDocFromList(recent, "data", doc);
+ Doc.AddDocToList(recent, "data", doc, undefined, true, true);
+ }
});
this.props.select(false);
return true;
@@ -198,15 +194,14 @@ export function ViewBoxAnnotatableComponent<P extends ViewBoxAnnotatableProps, T
if (this.props.Document[AclSym] && Object.keys(this.props.Document[AclSym]).length) {
added.forEach(d => {
for (const [key, value] of Object.entries(this.props.Document[AclSym])) {
- if (d.author === denormalizeEmail(key.substring(4)) && !d.aliasOf) distributeAcls(key, SharingPermissions.Admin, d, true);
- //else if (this.props.Document[key] === SharingPermissions.Admin) distributeAcls(key, SharingPermissions.Add, d, true);
- // else distributeAcls(key, this.AclMap.get(value) as SharingPermissions, d, true);
+ if (d.author === denormalizeEmail(key.substring(4)) && !d.aliasOf) distributeAcls(key, SharingPermissions.Admin, d);
}
});
}
if (effectiveAcl === AclAddonly) {
added.map(doc => {
+ if ([AclAdmin, AclEdit].includes(GetEffectiveAcl(doc))) inheritParentAcls(CurrentUserUtils.ActiveDashboard, doc);
doc.context = this.props.Document;
if (annotationKey ?? this._annotationKey) Doc.GetProto(doc).annotationOn = this.props.Document;
this.props.layerProvider?.(doc, true);
@@ -220,6 +215,8 @@ export function ViewBoxAnnotatableComponent<P extends ViewBoxAnnotatableProps, T
doc._stayInCollection = undefined;
doc.context = this.props.Document;
if (annotationKey ?? this._annotationKey) Doc.GetProto(doc).annotationOn = this.props.Document;
+
+ inheritParentAcls(CurrentUserUtils.ActiveDashboard, doc);
});
const annoDocs = targetDataDoc[annotationKey ?? this.annotationKey] as List<Doc>;
if (annoDocs) annoDocs.push(...added);
diff --git a/src/client/views/DocumentButtonBar.scss b/src/client/views/DocumentButtonBar.scss
index 09ae14016..a112f4745 100644
--- a/src/client/views/DocumentButtonBar.scss
+++ b/src/client/views/DocumentButtonBar.scss
@@ -1,4 +1,4 @@
-@import "globalCssVariables";
+@import "global/globalCssVariables";
$linkGap : 3px;
@@ -7,13 +7,13 @@ $linkGap : 3px;
}
.documentButtonBar-linkButton-empty:hover {
- background: $main-accent;
+ background: $medium-gray;
transform: scale(1.05);
cursor: pointer;
}
.documentButtonBar-linkButton-nonempty:hover {
- background: $main-accent;
+ background: $medium-gray;
transform: scale(1.05);
cursor: pointer;
}
@@ -25,8 +25,8 @@ $linkGap : 3px;
border-radius: 50%;
opacity: 0.9;
pointer-events: auto;
- background-color: $dark-color;
- color: $light-color;
+ background-color: $dark-gray;
+ color: $white;
text-transform: uppercase;
letter-spacing: 2px;
font-size: 75%;
@@ -37,39 +37,60 @@ $linkGap : 3px;
align-items: center;
&:hover {
- background: $main-accent;
+ background: $medium-gray;
transform: scale(1.05);
cursor: pointer;
}
}
.documentButtonBar {
- margin-top: $linkGap;
- grid-column: 1/4;
- width: max-content;
- height: auto;
display: flex;
flex-direction: row;
}
.documentButtonBar-button {
- pointer-events: auto;
- padding-right: 5px;
- width: 25px;
+ cursor: pointer;
+ display: flex;
+ width: 30px;
+ height: 30px;
+ align-content: center;
+ justify-content: center;
+ align-items: center;
}
+// depracated (now use .documentButtonBar-icon) for standard buttons
.documentButtonBar-linker {
height: 20px;
width: 20px;
text-align: center;
border-radius: 50%;
pointer-events: auto;
- background-color: $dark-color;
+ background-color: $dark-gray;
+ border: none;
+ transition: 0.2s ease all;
+
+ &:hover {
+ background-color: $medium-gray;
+ }
+}
+
+.documentButtonBar-icon {
+ height: 80%;
+ width: 80%;
+ font-size: 100%;
+ text-align: center;
+ border-radius: 50%;
+ pointer-events: auto;
+ background-color: $dark-gray;
border: none;
transition: 0.2s ease all;
+ display: flex;
+ align-content: center;
+ justify-content: center;
+ align-items: center;
&:hover {
- background-color: $main-accent;
+ background-color: $black;
}
}
diff --git a/src/client/views/DocumentButtonBar.tsx b/src/client/views/DocumentButtonBar.tsx
index a5d80cd22..df1e6899d 100644
--- a/src/client/views/DocumentButtonBar.tsx
+++ b/src/client/views/DocumentButtonBar.tsx
@@ -3,7 +3,7 @@ import { FontAwesomeIcon } from "@fortawesome/react-fontawesome";
import { Tooltip } from '@material-ui/core';
import { action, computed, observable, runInAction } from "mobx";
import { observer } from "mobx-react";
-import { Doc } from "../../fields/Doc";
+import { Doc, DocCastAsync } from "../../fields/Doc";
import { RichTextField } from '../../fields/RichTextField';
import { Cast, NumCast, StrCast } from "../../fields/Types";
import { emptyFunction, setupMoveUpEvents, simulateMouseClick } from "../../Utils";
@@ -24,7 +24,7 @@ import { DocumentView } from './nodes/DocumentView';
import { GoogleRef } from "./nodes/formattedText/FormattedTextBox";
import { TemplateMenu } from "./TemplateMenu";
import React = require("react");
-import { PresBox } from './nodes/PresBox';
+import { PresBox } from './nodes/trails/PresBox';
import { undoBatch } from '../util/UndoManager';
import { CollectionViewType } from './collections/CollectionView';
const higflyout = require("@hig/flyout");
@@ -110,7 +110,7 @@ export class DocumentButtonBar extends React.Component<{ views: () => (DocumentV
const animation = this.isAnimatingPulse ? "shadow-pulse 1s linear infinite" : "none";
return !targetDoc ? (null) : <Tooltip title={<><div className="dash-tooltip">{`${published ? "Push" : "Publish"} to Google Docs`}</div></>}>
<div
- className="documentButtonBar-linker"
+ className="documentButtonBar-button"
style={{ animation }}
onClick={async () => {
await GoogleAuthenticationManager.Instance.fetchOrGenerateAccessToken();
@@ -139,7 +139,7 @@ export class DocumentButtonBar extends React.Component<{ views: () => (DocumentV
return !targetDoc || !dataDoc || !dataDoc[GoogleRef] ? (null) : <Tooltip
title={<><div className="dash-tooltip">{title}</div></>}>
- <div className="documentButtonBar-linker"
+ <div className="documentButtonBar-button"
style={{ backgroundColor: this.pullColor }}
onPointerEnter={action(e => {
if (e.altKey) {
@@ -188,8 +188,8 @@ export class DocumentButtonBar extends React.Component<{ views: () => (DocumentV
const targetDoc = this.view0?.props.Document;
return !targetDoc ? (null) : <Tooltip title={
<div className="dash-tooltip">{"follow primary link on click"}</div>}>
- <div className="documentButtonBar-linker"
- style={{ color: targetDoc.isLinkButton ? "black" : "white", backgroundColor: targetDoc.isLinkButton ? "white" : "black" }}
+ <div className="documentButtonBar-icon"
+ style={{ color: targetDoc.isLinkButton ? "black" : "white" }}
onClick={undoBatch(e => this.props.views().map(view => view?.docView?.toggleFollowLink(undefined, false, false)))}>
<FontAwesomeIcon className="documentdecorations-icon" size="sm" icon="hand-point-right" />
</div>
@@ -200,7 +200,7 @@ export class DocumentButtonBar extends React.Component<{ views: () => (DocumentV
const targetDoc = this.view0?.props.Document;
return !targetDoc ? (null) : <Tooltip title={
<div className="dash-tooltip">{SelectionManager.Views().length > 1 ? "Pin multiple documents to presentation" : "Pin to presentation"}</div>}>
- <div className="documentButtonBar-linker"
+ <div className="documentButtonBar-icon"
style={{ color: "white" }}
onClick={undoBatch(e => this.props.views().map(view => view && TabDocView.PinDoc(view.props.Document, { setPosition: e.shiftKey ? true : undefined })))}>
<FontAwesomeIcon className="documentdecorations-icon" size="sm" icon="map-pin" />
@@ -243,7 +243,7 @@ export class DocumentButtonBar extends React.Component<{ views: () => (DocumentV
const presPinWithViewIcon = <img src="/assets/pinWithView.png" style={{ margin: "auto", width: 17, transform: 'translate(0, 1px)' }} />;
const targetDoc = this.view0?.props.Document;
return !targetDoc ? (null) : <Tooltip title={<><div className="dash-tooltip">{"Pin with current view"}</div></>}>
- <div className="documentButtonBar-linker" onClick={() => this.pinWithView(targetDoc)}>
+ <div className="documentButtonBar-icon" onClick={() => this.pinWithView(targetDoc)}>
{presPinWithViewIcon}
</div>
</Tooltip>;
@@ -253,8 +253,8 @@ export class DocumentButtonBar extends React.Component<{ views: () => (DocumentV
get shareButton() {
const targetDoc = this.view0?.props.Document;
return !targetDoc ? (null) : <Tooltip title={<><div className="dash-tooltip">{"Open Sharing Manager"}</div></>}>
- <div className="documentButtonBar-linker" style={{ color: "white" }} onClick={e => SharingManager.Instance.open(this.view0, targetDoc)}>
- <FontAwesomeIcon className="documentdecorations-icon" size="sm" icon="users" />
+ <div className="documentButtonBar-icon" style={{ color: "white" }} onClick={e => SharingManager.Instance.open(this.view0, targetDoc)}>
+ <FontAwesomeIcon className="documentdecorations-icon" icon="users" />
</div></Tooltip >;
}
@@ -262,8 +262,8 @@ export class DocumentButtonBar extends React.Component<{ views: () => (DocumentV
get menuButton() {
const targetDoc = this.view0?.props.Document;
return !targetDoc ? (null) : <Tooltip title={<><div className="dash-tooltip">{`Open Context Menu`}</div></>}>
- <div className="documentButtonBar-linker" style={{ color: "white", cursor: "pointer" }} onClick={e => this.openContextMenu(e)}>
- <FontAwesomeIcon className="documentdecorations-icon" size="sm" icon="bars" />
+ <div className="documentButtonBar-icon" style={{ color: "white", cursor: "pointer" }} onClick={e => this.openContextMenu(e)}>
+ <FontAwesomeIcon className="documentdecorations-icon" icon="bars" />
</div></Tooltip >;
}
@@ -271,9 +271,9 @@ export class DocumentButtonBar extends React.Component<{ views: () => (DocumentV
get moreButton() {
const targetDoc = this.view0?.props.Document;
return !targetDoc ? (null) : <Tooltip title={<><div className="dash-tooltip">{`${CurrentUserUtils.propertiesWidth > 0 ? "Close" : "Open"} Properties Panel`}</div></>}>
- <div className="documentButtonBar-linker" style={{ color: "white", cursor: "e-resize" }} onClick={action(e =>
+ <div className="documentButtonBar-icon" style={{ color: "white", cursor: "e-resize" }} onClick={action(e =>
CurrentUserUtils.propertiesWidth = CurrentUserUtils.propertiesWidth > 0 ? 0 : 250)}>
- <FontAwesomeIcon className="documentdecorations-icon" size="sm" icon="ellipsis-h"
+ <FontAwesomeIcon className="documentdecorations-icon" icon="ellipsis-h"
/>
</div></Tooltip >;
}
@@ -286,7 +286,7 @@ export class DocumentButtonBar extends React.Component<{ views: () => (DocumentV
<Flyout anchorPoint={anchorPoints.LEFT_TOP}
content={<MetadataEntryMenu docs={this.props.views().filter(dv => dv).map(dv => dv!.props.Document)} suggestWithFunction /> /* tfs: @bcz This might need to be the data document? */}>
<div className={"documentButtonBar-linkButton-" + "empty"} onPointerDown={e => e.stopPropagation()} >
- {<FontAwesomeIcon className="documentdecorations-icon" icon="tag" size="sm" />}
+ {<FontAwesomeIcon className="documentdecorations-icon" icon="tag" />}
</div>
</Flyout>
</div></Tooltip>;
@@ -348,16 +348,17 @@ export class DocumentButtonBar extends React.Component<{ views: () => (DocumentV
if (!this.view0) return (null);
const isText = this.view0.props.Document[this.view0.LayoutFieldKey] instanceof RichTextField;
+ const doc = this.view0?.props.Document;
const considerPull = isText && this.considerGoogleDocsPull;
const considerPush = isText && this.considerGoogleDocsPush;
return <div className="documentButtonBar">
<div className="documentButtonBar-button">
<DocumentLinksButton View={this.view0} AlwaysOn={true} InMenu={true} StartLink={true} />
</div>
- {DocumentLinksButton.StartLink || !Doc.UserDoc()["documentLinksButton-fullMenu"] ? <div className="documentButtonBar-button">
+ {(DocumentLinksButton.StartLink || Doc.UserDoc()["documentLinksButton-fullMenu"]) && DocumentLinksButton.StartLink != doc ? <div className="documentButtonBar-button">
<DocumentLinksButton View={this.view0} AlwaysOn={true} InMenu={true} StartLink={false} />
</div> : (null)}
- {!Doc.UserDoc()["documentLinksButton-fullMenu"] ? (null) : <div className="documentButtonBar-button">
+ {/*!Doc.UserDoc()["documentLinksButton-fullMenu"] ? (null) : <div className="documentButtonBar-button">
{this.templateButton}
</div>
/*<div className="documentButtonBar-button">
diff --git a/src/client/views/DocumentDecorations.scss b/src/client/views/DocumentDecorations.scss
index db2d56aa8..316f63240 100644
--- a/src/client/views/DocumentDecorations.scss
+++ b/src/client/views/DocumentDecorations.scss
@@ -1,4 +1,4 @@
-@import "globalCssVariables";
+@import "global/globalCssVariables";
$linkGap : 3px;
@@ -49,7 +49,7 @@ $linkGap : 3px;
.documentDecorations-bottomResizer,
.documentDecorations-rightResizer {
pointer-events: auto;
- background: $alt-accent;
+ background: $medium-gray;
opacity: 0.1;
&:hover {
opacity: 1;
@@ -251,19 +251,18 @@ $linkGap : 3px;
}
.linkButton-empty:hover {
- background: $main-accent;
+ background: $medium-gray;
transform: scale(1.05);
cursor: pointer;
}
.linkButton-nonempty:hover {
- background: $main-accent;
+ background: $medium-gray;
transform: scale(1.05);
cursor: pointer;
}
.link-button-container {
- padding: $linkGap;
border-radius: 10px;
width: max-content;
height: auto;
@@ -271,7 +270,10 @@ $linkGap : 3px;
flex-direction: row;
z-index: 998;
position: absolute;
- background: $alt-accent;
+ justify-content: center;
+ align-items: center;
+ gap: 5px;
+ background: $medium-gray;
}
.linkButtonWrapper {
@@ -286,8 +288,8 @@ $linkGap : 3px;
text-align: center;
border-radius: 50%;
pointer-events: auto;
- color: $dark-color;
- border: $dark-color 1px solid;
+ color: $dark-gray;
+ border: $dark-gray 1px solid;
}
.linkButton-linker:hover {
@@ -302,8 +304,8 @@ $linkGap : 3px;
border-radius: 50%;
opacity: 0.9;
pointer-events: auto;
- background-color: $dark-color;
- color: $light-color;
+ background-color: $dark-gray;
+ color: $white;
text-transform: uppercase;
letter-spacing: 2px;
font-size: 75%;
@@ -314,7 +316,7 @@ $linkGap : 3px;
align-items: center;
&:hover {
- background: $main-accent;
+ background: $medium-gray;
transform: scale(1.05);
cursor: pointer;
}
@@ -334,7 +336,7 @@ $linkGap : 3px;
}
.documentdecorations-icon {
- margin-top: 3px;
+ margin: 0px;
}
.templating-button,
.docDecs-tagButton {
@@ -343,13 +345,13 @@ $linkGap : 3px;
border-radius: 50%;
opacity: 0.9;
font-size: 14;
- background-color: $dark-color;
- color: $light-color;
+ background-color: $dark-gray;
+ color: $white;
text-align: center;
cursor: pointer;
&:hover {
- background: $main-accent;
+ background: $medium-gray;
transform: scale(1.05);
}
}
@@ -365,7 +367,7 @@ $linkGap : 3px;
width: max-content;
font-family: $sans-serif;
font-size: 12px;
- background-color: $light-color-secondary;
+ background-color: $light-gray;
padding: 2px 12px;
list-style: none;
diff --git a/src/client/views/DocumentDecorations.tsx b/src/client/views/DocumentDecorations.tsx
index bf939d57c..d24ab974c 100644
--- a/src/client/views/DocumentDecorations.tsx
+++ b/src/client/views/DocumentDecorations.tsx
@@ -201,7 +201,7 @@ export class DocumentDecorations extends React.Component<{ boundsLeft: number, b
(e: PointerEvent, down: number[], delta: number[]) => {
const movement = { X: delta[0], Y: e.clientY - down[1] };
const angle = Math.max(1, Math.abs(movement.Y / 10));
- InkStrokeProperties.Instance?.rotate(2 * movement.X / angle * (Math.PI / 180));
+ InkStrokeProperties.Instance?.rotateInk(2 * movement.X / angle * (Math.PI / 180));
return false;
},
() => this._rotateUndo?.end(),
@@ -235,7 +235,7 @@ export class DocumentDecorations extends React.Component<{ boundsLeft: number, b
this._resizeUndo = UndoManager.StartBatch("DocDecs resize");
this._snapX = e.pageX;
this._snapY = e.pageY;
- DragManager.docsBeingDragged.forEach(doc => this._dragHeights.set(doc, { start: NumCast(doc._height), lowest: NumCast(doc._height) }));
+ SelectionManager.Views().forEach(docView => this._dragHeights.set(docView.layoutDoc, { start: NumCast(docView.rootDoc._height), lowest: NumCast(docView.rootDoc._height) }));
}
onPointerMove = (e: PointerEvent, down: number[], move: number[]): boolean => {
@@ -382,7 +382,7 @@ export class DocumentDecorations extends React.Component<{ boundsLeft: number, b
SnappingManager.clearSnapLines();
// detect autoHeight gesture and apply
- DragManager.docsBeingDragged.map(doc => ({ doc, hgts: this._dragHeights.get(doc) }))
+ SelectionManager.Views().map(docView => ({ doc: docView.layoutDoc, hgts: this._dragHeights.get(docView.layoutDoc) }))
.filter(pair => pair.hgts && pair.hgts.lowest < pair.hgts.start && pair.hgts.lowest <= 20)
.forEach(pair => pair.doc._autoHeight = true);
//need to change points for resize, or else rotation/control points will fail.
diff --git a/src/client/views/EditableView.scss b/src/client/views/EditableView.scss
index 5dc0c1962..1aebedf2e 100644
--- a/src/client/views/EditableView.scss
+++ b/src/client/views/EditableView.scss
@@ -26,4 +26,10 @@
width: 100%;
background: inherit;
pointer-events: all;
-} \ No newline at end of file
+}
+
+.editableView-input:focus {
+ border: none;
+ outline: none;
+}
+ \ No newline at end of file
diff --git a/src/client/views/GestureOverlay.tsx b/src/client/views/GestureOverlay.tsx
index 491bf18b2..6a4f55bef 100644
--- a/src/client/views/GestureOverlay.tsx
+++ b/src/client/views/GestureOverlay.tsx
@@ -634,7 +634,7 @@ export class GestureOverlay extends Touchable {
} else {
this._points = [];
}
- CollectionFreeFormViewChrome.Instance.primCreated();
+ CollectionFreeFormViewChrome.Instance?.primCreated();
}
makePolygon = (shape: string, gesture: boolean) => {
diff --git a/src/client/views/GlobalKeyHandler.ts b/src/client/views/GlobalKeyHandler.ts
index 2a3cb36c7..0127d3080 100644
--- a/src/client/views/GlobalKeyHandler.ts
+++ b/src/client/views/GlobalKeyHandler.ts
@@ -88,8 +88,6 @@ export class KeyManager {
private unmodified = action((keyname: string, e: KeyboardEvent) => {
switch (keyname) {
- case "a": SnappingManager.GetIsDragging() && (DragManager.CanEmbed = true);
- break;
case "u":
if (document.activeElement?.tagName === "INPUT" || document.activeElement?.tagName === "TEXTAREA") {
return { stopPropagation: false, preventDefault: false };
@@ -115,7 +113,7 @@ export class KeyManager {
case "escape":
DocumentLinksButton.StartLink = undefined;
DocumentLinksButton.StartLinkView = undefined;
- InkStrokeProperties.Instance && (InkStrokeProperties.Instance._controlBtn = false);
+ InkStrokeProperties.Instance && (InkStrokeProperties.Instance._controlButton = false);
CurrentUserUtils.SelectedTool = InkTool.None;
var doDeselect = true;
if (SnappingManager.GetIsDragging()) {
diff --git a/src/client/views/InkControls.tsx b/src/client/views/InkControls.tsx
new file mode 100644
index 000000000..6213a4075
--- /dev/null
+++ b/src/client/views/InkControls.tsx
@@ -0,0 +1,142 @@
+import React = require("react");
+import { observable, action } from "mobx";
+import { observer } from "mobx-react";
+import { InkStrokeProperties } from "./InkStrokeProperties";
+import { setupMoveUpEvents, emptyFunction } from "../../Utils";
+import { UndoManager } from "../util/UndoManager";
+import { ControlPoint, InkData, PointData } from "../../fields/InkField";
+import { Transform } from "../util/Transform";
+import { Colors } from "./global/globalEnums";
+import { Doc } from "../../fields/Doc";
+import { listSpec } from "../../fields/Schema";
+import { Cast } from "../../fields/Types";
+
+export interface InkControlProps {
+ inkDoc: Doc;
+ data: InkData;
+ addedPoints: PointData[];
+ format: number[];
+ ScreenToLocalTransform: () => Transform;
+}
+
+@observer
+export class InkControls extends React.Component<InkControlProps> {
+ @observable private _overControl = -1;
+ @observable private _overAddPoint = -1;
+
+ /**
+ * Handles the movement of a selected control point when the user clicks and drags.
+ * @param controlIndex The index of the currently selected control point.
+ */
+ @action
+ onControlDown = (e: React.PointerEvent, controlIndex: number): void => {
+ if (InkStrokeProperties.Instance) {
+ InkStrokeProperties.Instance.moveControl(0, 0, 1);
+ const controlUndo = UndoManager.StartBatch("DocDecs set radius");
+ const screenScale = this.props.ScreenToLocalTransform().Scale;
+ const order = controlIndex % 4;
+ const handleIndexA = order === 2 ? controlIndex - 1 : controlIndex - 2;
+ const handleIndexB = order === 2 ? controlIndex + 2 : controlIndex + 1;
+ const brokenIndices = Cast(this.props.inkDoc.brokenInkIndices, listSpec("number"));
+ setupMoveUpEvents(this, e,
+ (e: PointerEvent, down: number[], delta: number[]) => {
+ InkStrokeProperties.Instance?.moveControl(-delta[0] * screenScale, -delta[1] * screenScale, controlIndex);
+ return false;
+ },
+ () => controlUndo?.end(),
+ action((e: PointerEvent, doubleTap: boolean | undefined) => {
+ if (doubleTap && brokenIndices && brokenIndices.includes(controlIndex)) {
+ InkStrokeProperties.Instance?.snapHandleTangent(controlIndex, handleIndexA, handleIndexB);
+ }
+ }));
+ }
+ }
+
+ /**
+ * Deletes the currently selected point.
+ */
+ @action
+ onDelete = (e: KeyboardEvent) => {
+ if (["-", "Backspace", "Delete"].includes(e.key)) {
+ if (InkStrokeProperties.Instance?.deletePoints()) e.stopPropagation();
+ }
+ }
+
+ /**
+ * Changes the current selected control point.
+ */
+ @action
+ changeCurrPoint = (i: number) => {
+ if (InkStrokeProperties.Instance) {
+ InkStrokeProperties.Instance._currentPoint = i;
+ document.addEventListener("keydown", this.onDelete, true);
+ }
+ }
+
+ /**
+ * Updates whether a user has hovered over a particular control point or point that could be added
+ * on click.
+ */
+ @action onEnterControl = (i: number) => { this._overControl = i; };
+ @action onLeaveControl = () => { this._overControl = -1; };
+ @action onEnterAddPoint = (i: number) => { this._overAddPoint = i; };
+ @action onLeaveAddPoint = () => { this._overAddPoint = -1; };
+
+ render() {
+ const formatInstance = InkStrokeProperties.Instance;
+ if (!formatInstance) return (null);
+
+ // Accessing the current ink's data and extracting all control points.
+ const data = this.props.data;
+ const controlPoints: ControlPoint[] = [];
+ if (data.length >= 4) {
+ for (let i = 0; i <= data.length - 4; i += 4) {
+ controlPoints.push({ X: data[i].X, Y: data[i].Y, I: i });
+ controlPoints.push({ X: data[i + 3].X, Y: data[i + 3].Y, I: i + 3 });
+ }
+ }
+ const addedPoints = this.props.addedPoints;
+ const [left, top, scaleX, scaleY, strokeWidth] = this.props.format;
+
+ return (
+ <>
+ {addedPoints.map((pts, i) =>
+ <svg height="10" width="10" key={`add${i}`}>
+ <circle
+ cx={(pts.X - left - strokeWidth / 2) * scaleX + strokeWidth / 2}
+ cy={(pts.Y - top - strokeWidth / 2) * scaleY + strokeWidth / 2}
+ r={strokeWidth / 1.5}
+ stroke={this._overAddPoint === i ? Colors.MEDIUM_BLUE : "transparent"}
+ strokeWidth={0} fill={this._overAddPoint === i ? Colors.MEDIUM_BLUE : "transparent"}
+ onPointerDown={() => { formatInstance?.addPoints(pts.X, pts.Y, addedPoints, i, controlPoints); }}
+ onMouseEnter={() => this.onEnterAddPoint(i)}
+ onMouseLeave={this.onLeaveAddPoint}
+ pointerEvents="all"
+ cursor="all-scroll"
+ />
+ </svg>
+ )}
+ {controlPoints.map((control, i) =>
+ <svg height="10" width="10" key={`ctrl${i}`}>
+ <rect
+ x={(control.X - left - strokeWidth / 2) * scaleX}
+ y={(control.Y - top - strokeWidth / 2) * scaleY}
+ height={this._overControl === i ? strokeWidth * 1.5 : strokeWidth}
+ width={this._overControl === i ? strokeWidth * 1.5 : strokeWidth}
+ strokeWidth={strokeWidth / 6} stroke={Colors.MEDIUM_BLUE}
+ fill={formatInstance?._currentPoint === control.I ? Colors.MEDIUM_BLUE : Colors.WHITE}
+ onPointerDown={(e) => {
+ this.changeCurrPoint(control.I);
+ this.onControlDown(e, control.I);
+ }}
+ onMouseEnter={() => this.onEnterControl(i)}
+ onMouseLeave={this.onLeaveControl}
+ pointerEvents="all"
+ cursor="default"
+ />
+ </svg>
+ )}
+ </>
+ );
+ }
+} \ No newline at end of file
diff --git a/src/client/views/InkHandles.tsx b/src/client/views/InkHandles.tsx
new file mode 100644
index 000000000..f1eb4b9db
--- /dev/null
+++ b/src/client/views/InkHandles.tsx
@@ -0,0 +1,124 @@
+import React = require("react");
+import { observable, action } from "mobx";
+import { observer } from "mobx-react";
+import { InkStrokeProperties } from "./InkStrokeProperties";
+import { setupMoveUpEvents, emptyFunction } from "../../Utils";
+import { UndoManager } from "../util/UndoManager";
+import { InkData, HandlePoint, HandleLine } from "../../fields/InkField";
+import { Transform } from "../util/Transform";
+import { Doc } from "../../fields/Doc";
+import { listSpec } from "../../fields/Schema";
+import { List } from "../../fields/List";
+import { Cast } from "../../fields/Types";
+import { Colors } from "./global/globalEnums";
+
+export interface InkHandlesProps {
+ inkDoc: Doc;
+ data: InkData;
+ format: number[];
+ ScreenToLocalTransform: () => Transform;
+}
+
+@observer
+export class InkHandles extends React.Component<InkHandlesProps> {
+ /**
+ * Handles the movement of a selected handle point when the user clicks and drags.
+ * @param handleNum The index of the currently selected handle point.
+ */
+ onHandleDown = (e: React.PointerEvent, handleIndex: number): void => {
+ if (InkStrokeProperties.Instance) {
+ InkStrokeProperties.Instance.moveControl(0, 0, 1);
+ const controlUndo = UndoManager.StartBatch("DocDecs set radius");
+ const screenScale = this.props.ScreenToLocalTransform().Scale;
+ const order = handleIndex % 4;
+ const oppositeHandleIndex = order === 1 ? handleIndex - 3 : handleIndex + 3;
+ const controlIndex = order === 1 ? handleIndex - 1 : handleIndex + 2;
+ document.addEventListener("keydown", (e: KeyboardEvent) => this.onBreakTangent(e, controlIndex), true);
+ setupMoveUpEvents(this, e, (e: PointerEvent, down: number[], delta: number[]) => {
+ InkStrokeProperties.Instance?.moveHandle(-delta[0] * screenScale, -delta[1] * screenScale, handleIndex, oppositeHandleIndex, controlIndex);
+ return false;
+ }, () => controlUndo?.end(), emptyFunction
+ );
+ }
+ }
+
+ /**
+ * Breaks tangent handle movement when ‘Alt’ key is held down. Adds the current handle index and
+ * its matching (opposite) handle to a list of broken handle indices.
+ * @param handleNum The index of the currently selected handle point.
+ */
+ @action
+ onBreakTangent = (e: KeyboardEvent, controlIndex: number) => {
+ const doc: Doc = this.props.inkDoc;
+ if (["Alt"].includes(e.key)) {
+ e.stopPropagation();
+ if (doc) {
+ const brokenIndices = Cast(doc.brokenInkIndices, listSpec("number")) || new List;
+ if (brokenIndices && !brokenIndices.includes(controlIndex)) {
+ brokenIndices.push(controlIndex);
+ }
+ doc.brokenInkIndices = brokenIndices;
+ }
+ }
+ }
+
+ render() {
+ const formatInstance = InkStrokeProperties.Instance;
+ if (!formatInstance) return (null);
+
+ // Accessing the current ink's data and extracting all handle points and handle lines.
+ const data = this.props.data;
+ const handlePoints: HandlePoint[] = [];
+ const handleLines: HandleLine[] = [];
+ if (data.length >= 4) {
+ for (let i = 0; i <= data.length - 4; i += 4) {
+ handlePoints.push({ X: data[i + 1].X, Y: data[i + 1].Y, I: i + 1, dot1: i, dot2: i === 0 ? i : i - 1 });
+ handlePoints.push({ X: data[i + 2].X, Y: data[i + 2].Y, I: i + 2, dot1: i + 3, dot2: i === data.length ? i + 3 : i + 4 });
+ }
+ // Adding first and last (single) handle lines.
+ handleLines.push({ X1: data[0].X, Y1: data[0].Y, X2: data[0].X, Y2: data[0].Y, X3: data[1].X, Y3: data[1].Y, dot1: 0, dot2: 0 });
+ handleLines.push({ X1: data[data.length - 2].X, Y1: data[data.length - 2].Y, X2: data[data.length - 1].X, Y2: data[data.length - 1].Y, X3: data[data.length - 1].X, Y3: data[data.length - 1].Y, dot1: data.length - 1, dot2: data.length - 1 });
+ for (let i = 2; i < data.length - 4; i += 4) {
+ handleLines.push({ X1: data[i].X, Y1: data[i].Y, X2: data[i + 1].X, Y2: data[i + 1].Y, X3: data[i + 3].X, Y3: data[i + 3].Y, dot1: i + 1, dot2: i + 2 });
+ }
+ }
+ const [left, top, scaleX, scaleY, strokeWidth] = this.props.format;
+
+ return (
+ <>
+ {handlePoints.map((pts, i) =>
+ <svg height="10" width="10" key={`hdl${i}`}>
+ <circle
+ cx={(pts.X - left - strokeWidth / 2) * scaleX + strokeWidth / 2}
+ cy={(pts.Y - top - strokeWidth / 2) * scaleY + strokeWidth / 2}
+ r={strokeWidth / 2}
+ strokeWidth={0}
+ fill={Colors.MEDIUM_BLUE}
+ onPointerDown={(e) => this.onHandleDown(e, pts.I)}
+ pointerEvents="all"
+ cursor="default"
+ display={(pts.dot1 === formatInstance._currentPoint || pts.dot2 === formatInstance._currentPoint) ? "inherit" : "none"} />
+ </svg>)}
+ {handleLines.map((pts, i) =>
+ <svg height="100" width="100" key={`line${i}`}>
+ <line
+ x1={(pts.X1 - left - strokeWidth / 2) * scaleX + strokeWidth / 2}
+ y1={(pts.Y1 - top - strokeWidth / 2) * scaleY + strokeWidth / 2}
+ x2={(pts.X2 - left - strokeWidth / 2) * scaleX + strokeWidth / 2}
+ y2={(pts.Y2 - top - strokeWidth / 2) * scaleY + strokeWidth / 2}
+ stroke={Colors.MEDIUM_BLUE}
+ strokeWidth={strokeWidth / 4}
+ display={(pts.dot1 === formatInstance._currentPoint || pts.dot2 === formatInstance._currentPoint) ? "inherit" : "none"} />
+ <line
+ x1={(pts.X2 - left - strokeWidth / 2) * scaleX + strokeWidth / 2}
+ y1={(pts.Y2 - top - strokeWidth / 2) * scaleY + strokeWidth / 2}
+ x2={(pts.X3 - left - strokeWidth / 2) * scaleX + strokeWidth / 2}
+ y2={(pts.Y3 - top - strokeWidth / 2) * scaleY + strokeWidth / 2}
+ stroke={Colors.MEDIUM_BLUE}
+ strokeWidth={strokeWidth / 4}
+ display={(pts.dot1 === formatInstance._currentPoint || pts.dot2 === formatInstance._currentPoint) ? "inherit" : "none"} />
+ </svg>)}
+ </>
+ );
+ }
+} \ No newline at end of file
diff --git a/src/client/views/InkStroke.scss b/src/client/views/InkStroke.scss
new file mode 100644
index 000000000..812a79bd5
--- /dev/null
+++ b/src/client/views/InkStroke.scss
@@ -0,0 +1,11 @@
+.inkStroke {
+ mix-blend-mode: multiply;
+ stroke-linejoin: round;
+ stroke-linecap: round;
+ overflow: visible !important;
+ transform-origin: top left;
+
+ svg:not(:root) {
+ overflow: visible !important;
+ }
+}
diff --git a/src/client/views/InkStrokeProperties.ts b/src/client/views/InkStrokeProperties.ts
index b13b04f68..76ca5b5ec 100644
--- a/src/client/views/InkStrokeProperties.ts
+++ b/src/client/views/InkStrokeProperties.ts
@@ -1,124 +1,44 @@
import { action, computed, observable } from "mobx";
-import { ColorState } from 'react-color';
-import { Doc, Field, Opt } from "../../fields/Doc";
+import { Doc, DocListCast, Field, Opt } from "../../fields/Doc";
import { Document } from "../../fields/documentSchemas";
-import { InkField, InkData } from "../../fields/InkField";
+import { InkField, InkData, PointData, ControlPoint } from "../../fields/InkField";
+import { List } from "../../fields/List";
+import { listSpec } from "../../fields/Schema";
import { Cast, NumCast } from "../../fields/Types";
import { DocumentType } from "../documents/DocumentTypes";
import { SelectionManager } from "../util/SelectionManager";
import { undoBatch } from "../util/UndoManager";
-import { bool } from "sharp";
export class InkStrokeProperties {
static Instance: InkStrokeProperties | undefined;
- private _lastFill = "#D0021B";
- private _lastLine = "#D0021B";
- private _lastDash = "2";
- private _inkDocs: { x: number, y: number, width: number, height: number }[] = [];
-
@observable _lock = false;
- @observable _controlBtn = false;
- @observable _currPoint = -1;
+ @observable _controlButton = false;
+ @observable _currentPoint = -1;
- getField(key: string) {
- return this.selectedInk?.reduce((p, i) =>
- (p === undefined || (p && p === i.rootDoc[key])) && i.rootDoc[key] !== "0" ? Field.toString(i.rootDoc[key] as Field) : "", undefined as Opt<string>);
+ constructor() {
+ InkStrokeProperties.Instance = this;
}
@computed get selectedInk() {
const inks = SelectionManager.Views().filter(i => Document(i.rootDoc).type === DocumentType.INK);
return inks.length ? inks : undefined;
}
- @computed get unFilled() { return this.selectedInk?.reduce((p, i) => p && !i.rootDoc.fillColor ? true : false, true) || false; }
- @computed get unStrokd() { return this.selectedInk?.reduce((p, i) => p && !i.rootDoc.color ? true : false, true) || false; }
- @computed get solidFil() { return this.selectedInk?.reduce((p, i) => p && i.rootDoc.fillColor ? true : false, true) || false; }
- @computed get solidStk() { return this.selectedInk?.reduce((p, i) => p && i.rootDoc.color && (!i.rootDoc.strokeDash || i.rootDoc.strokeDash === "0") ? true : false, true) || false; }
- @computed get dashdStk() { return !this.unStrokd && this.getField("strokeDash") || ""; }
- @computed get colorFil() { const ccol = this.getField("fillColor") || ""; ccol && (this._lastFill = ccol); return ccol; }
- @computed get colorStk() { const ccol = this.getField("color") || ""; ccol && (this._lastLine = ccol); return ccol; }
- @computed get widthStk() { return this.getField("strokeWidth") || "1"; }
- @computed get markHead() { return this.getField("strokeStartMarker") || ""; }
- @computed get markTail() { return this.getField("strokeEndMarker") || ""; }
- @computed get shapeHgt() { return this.getField("_height"); }
- @computed get shapeWid() { return this.getField("_width"); }
- @computed get shapeXps() { return this.getField("x"); }
- @computed get shapeYps() { return this.getField("y"); }
- @computed get shapeRot() { return this.getField("rotation"); }
- set unFilled(value) { this.colorFil = value ? "" : this._lastFill; }
- set solidFil(value) { this.unFilled = !value; }
- set colorFil(value) { value && (this._lastFill = value); this.selectedInk?.forEach(i => i.rootDoc.fillColor = value ? value : undefined); }
- set colorStk(value) { value && (this._lastLine = value); this.selectedInk?.forEach(i => i.rootDoc.color = value ? value : undefined); }
- set markHead(value) { this.selectedInk?.forEach(i => i.rootDoc.strokeStartMarker = value); }
- set markTail(value) { this.selectedInk?.forEach(i => i.rootDoc.strokeEndMarker = value); }
- set unStrokd(value) { this.colorStk = value ? "" : this._lastLine; }
- set solidStk(value) { this.dashdStk = ""; this.unStrokd = !value; }
- set dashdStk(value) {
- value && (this._lastDash = value) && (this.unStrokd = false);
- this.selectedInk?.forEach(i => i.rootDoc.strokeDash = value ? this._lastDash : undefined);
- }
- set shapeXps(value) { this.selectedInk?.forEach(i => i.rootDoc.x = Number(value)); }
- set shapeYps(value) { this.selectedInk?.forEach(i => i.rootDoc.y = Number(value)); }
- set shapeRot(value) { this.selectedInk?.forEach(i => i.rootDoc.rotation = Number(value)); }
- set widthStk(value) { this.selectedInk?.forEach(i => i.rootDoc.strokeWidth = Number(value)); }
- set shapeWid(value) {
- this.selectedInk?.filter(i => i.rootDoc._width && i.rootDoc._height).forEach(i => {
- const oldWidth = NumCast(i.rootDoc._width);
- i.rootDoc._width = Number(value);
- this._lock && (i.rootDoc._height = (i.rootDoc._width * NumCast(i.rootDoc._height)) / oldWidth);
- });
- }
- set shapeHgt(value) {
- this.selectedInk?.filter(i => i.rootDoc._width && i.rootDoc._height).forEach(i => {
- const oldHeight = NumCast(i.rootDoc._height);
- i.rootDoc._height = Number(value);
- this._lock && (i.rootDoc._width = (i.rootDoc._height * NumCast(i.rootDoc._width)) / oldHeight);
- });
- }
-
- constructor() {
- InkStrokeProperties.Instance = this;
- }
- @undoBatch
- @action
- addPoints = (x: number, y: number, pts: { X: number, Y: number }[], index: number, control: { X: number, Y: number }[]) => {
- this.selectedInk?.forEach(action(inkView => {
- if (this.selectedInk?.length === 1) {
- const doc = Document(inkView.rootDoc);
- if (doc.type === DocumentType.INK) {
- const ink = Cast(doc.data, InkField)?.inkData;
- if (ink) {
- const newPoints: { X: number, Y: number }[] = [];
- var counter = 0;
- for (var k = 0; k < index; k++) {
- control.forEach(pt => (pts[k].X === pt.X && pts[k].Y === pt.Y) && counter++);
- }
- //decide where to put the new coordinate
- const spNum = Math.floor(counter / 2) * 4 + 2;
-
- for (var i = 0; i < spNum; i++) {
- ink[i] && newPoints.push({ X: ink[i].X, Y: ink[i].Y });
- }
- for (var j = 0; j < 4; j++) {
- newPoints.push({ X: x, Y: y });
-
- }
- for (var i = spNum; i < ink.length; i++) {
- newPoints.push({ X: ink[i].X, Y: ink[i].Y });
- }
- this._currPoint = -1;
- Doc.GetProto(doc).data = new InkField(newPoints);
- }
- }
- }
- }));
+ getField(key: string) {
+ return this.selectedInk?.reduce((p, i) =>
+ (p === undefined || (p && p === i.rootDoc[key])) && i.rootDoc[key] !== "0" ? Field.toString(i.rootDoc[key] as Field) : "", undefined as Opt<string>);
}
+ /**
+ * Helper function that enables other functions to be applied to a particular ink instance.
+ * @param func The inputted function.
+ * @param requireCurrPoint Indicates whether the current selected point is needed.
+ */
applyFunction = (func: (doc: Doc, ink: InkData, ptsXscale: number, ptsYscale: number) => { X: number, Y: number }[] | undefined, requireCurrPoint: boolean = false) => {
var appliedFunc = false;
this.selectedInk?.forEach(action(inkView => {
- if (this.selectedInk?.length === 1 && (!requireCurrPoint || this._currPoint !== -1)) {
+ if (this.selectedInk?.length === 1 && (!requireCurrPoint || this._currentPoint !== -1)) {
const doc = Document(inkView.rootDoc);
if (doc.type === DocumentType.INK && doc.width && doc.height) {
const ink = Cast(doc.data, InkField)?.inkData;
@@ -145,17 +65,136 @@ export class InkStrokeProperties {
return appliedFunc;
}
+ /**
+ * Adds a new control point to the ink instance when editing its format.
+ * @param index The index of the new point.
+ * @param control The list of all control points of the ink.
+ */
+ @undoBatch
+ @action
+ addPoints = (x: number, y: number, points: InkData, index: number, controls: { X: number, Y: number }[]) => {
+ this.applyFunction((doc: Doc, ink: InkData) => {
+ const newControl = { X: x, Y: y };
+ const newPoints: InkData = [];
+ let [counter, start, end] = [0, 0, 0];
+ for (let k = 0; k < points.length; k++) {
+ if (end === 0) {
+ controls.forEach((control) => {
+ if (control.X === points[k].X && control.Y === points[k].Y) {
+ if (k < index) {
+ counter++;
+ start = k;
+ } else if (k > index) {
+ end = k;
+ }
+ }
+ });
+ }
+ }
+ if (end === 0) end = points.length - 1;
+ // Index of new control point with regards to the ink data.
+ const newIndex = Math.floor(counter / 2) * 4 + 2;
+ // Creating new ink data with the new control point and handle points inputted.
+ for (let i = 0; i < ink.length; i++) {
+ if (i === newIndex) {
+ const [handleA, handleB] = this.getNewHandlePoints(points.slice(start, index + 1), points.slice(index, end), newControl);
+ newPoints.push(handleA, newControl, newControl, handleB);
+ // Adjusting the magnitude of the left handle line of the right neighboring control point.
+ const [rightControl, rightHandle] = [points[end], ink[i]];
+ const scaledVector = this.getScaledHandlePoint(false, start, end, index, rightControl, rightHandle);
+ rightHandle && newPoints.push({ X: rightControl.X - scaledVector.X, Y: rightControl.Y - scaledVector.Y });
+ } else if (i === newIndex - 1) {
+ // Adjusting the magnitude of the right handle line of the left neighboring control point.
+ const [leftControl, leftHandle] = [points[start], ink[i]];
+ const scaledVector = this.getScaledHandlePoint(true, start, end, index, leftControl, leftHandle);
+ leftHandle && newPoints.push({ X: leftControl.X - scaledVector.X, Y: leftControl.Y - scaledVector.Y });
+ } else {
+ ink[i] && newPoints.push({ X: ink[i].X, Y: ink[i].Y });
+ }
+
+ }
+ let brokenIndices = Cast(doc.brokenInkIndices, listSpec("number"));
+ // Updating the indices of the control points whose handle tangency has been broken.
+ if (brokenIndices) {
+ brokenIndices = new List(brokenIndices.map((control) => {
+ if (control >= newIndex) {
+ return control + 4;
+ } else {
+ return control;
+ }
+ }));
+ }
+ doc.brokenInkIndices = brokenIndices;
+ this._currentPoint = -1;
+ return newPoints;
+ });
+ }
+
+ /**
+ * Scales a handle point of a control point that is adjacent to a newly added one.
+ * @param isLeft Determines if the current control point is on the left or right side of the newly added one.
+ * @param start Beginning index of curve from the left control point to the newly added one.
+ * @param end Final index of curve from the newly added control point to its right neighbor.
+ */
+ getScaledHandlePoint(isLeft: boolean, start: number, end: number, index: number, control: PointData, handle: PointData) {
+ const prevSize = end - start;
+ const newSize = isLeft ? index - start : end - index;
+ const handleVector = { X: control.X - handle.X, Y: control.Y - handle.Y };
+ const scaledVector = { X: handleVector.X * (newSize / prevSize), Y: handleVector.Y * (newSize / prevSize) };
+ return scaledVector;
+ }
+
+ /**
+ * Determines the position of the handle points of a newly added control point by finding the
+ * tangent vectors to the split curve at the new control. Given the properties of Bézier curves,
+ * the tangent vector to a control point is equivalent to the first/last (depending on the direction
+ * of the curve) leg of the Bézier curve's derivative.
+ * (Source: https://pages.mtu.edu/~shene/COURSES/cs3621/NOTES/spline/Bezier/bezier-der.html)
+ *
+ * @param C The curve represented by all points from the previous control until the newly added point.
+ * @param D The curve represented by all points from the newly added point to the next control.
+ * @param newControl The newly added control point.
+ */
+ getNewHandlePoints = (C: PointData[], D: PointData[], newControl: PointData) => {
+ const [m, n] = [C.length, D.length];
+ let handleSizeA = Math.sqrt((Math.pow(newControl.X - C[0].X, 2)) + (Math.pow(newControl.Y - C[0].Y, 2)));
+ let handleSizeB = Math.sqrt((Math.pow(D[n - 1].X - newControl.X, 2)) + (Math.pow(D[n - 1].Y - newControl.Y, 2)));
+ // Scaling adjustments to improve the ratio between the magnitudes of the two handle lines.
+ // (Ensures that the new point added doesn't augment the inital shape of the curve much).
+ if (handleSizeA < 75 && handleSizeB < 75) {
+ handleSizeA *= 3;
+ handleSizeB *= 3;
+ }
+ if (Math.abs(handleSizeA - handleSizeB) < 50) {
+ handleSizeA *= 5;
+ handleSizeB *= 5;
+ } else if (Math.abs(handleSizeA - handleSizeB) < 150) {
+ handleSizeA *= 2;
+ handleSizeB *= 2;
+ }
+ // Finding the last leg of the derivative curve of C.
+ const dC = { X: (handleSizeA / n) * (C[m - 1].X - C[m - 2].X), Y: (handleSizeA / n) * (C[m - 1].Y - C[m - 2].Y) };
+ // Finding the first leg of the derivative curve of D.
+ const dD = { X: (handleSizeB / m) * (D[1].X - D[0].X), Y: (handleSizeB / m) * (D[1].Y - D[0].Y) };
+ const handleA = { X: newControl.X - dC.X, Y: newControl.Y - dC.Y };
+ const handleB = { X: newControl.X + dD.X, Y: newControl.Y + dD.Y };
+ return [handleA, handleB];
+ }
+
+ /**
+ * Deletes the current control point of the selected ink instance.
+ */
@undoBatch
@action
deletePoints = () => this.applyFunction((doc: Doc, ink: InkData) => {
- var newPoints: { X: number, Y: number }[] = [];
- const toRemove = Math.floor(((this._currPoint + 2) / 4));
- for (var i = 0; i < ink.length; i++) {
+ const newPoints: { X: number, Y: number }[] = [];
+ const toRemove = Math.floor(((this._currentPoint + 2) / 4));
+ for (let i = 0; i < ink.length; i++) {
if (Math.floor((i + 2) / 4) !== toRemove && (toRemove !== 0 || i > 3)) {
newPoints.push({ X: ink[i].X, Y: ink[i].Y });
}
}
- this._currPoint = -1;
+ this._currentPoint = -1;
if (newPoints.length < 4) return undefined;
if (newPoints.length === 4) {
const newerPoints: { X: number, Y: number }[] = [];
@@ -166,12 +205,16 @@ export class InkStrokeProperties {
return newerPoints;
}
return newPoints;
- }, true);
+ }, true)
+ /**
+ * Rotates the entire selected ink instance.
+ * @param angle The angle at which to rotate the ink in radians.
+ */
@undoBatch
@action
- rotate = (angle: number) => {
- this.applyFunction((doc: Doc, ink: InkData, ptsXscale: number, ptsYscale: number) => {
+ rotateInk = (angle: number) => {
+ this.applyFunction((doc: Doc, ink: InkData, xScale: number, yScale: number) => {
const oldXrange = (xs => ({ coord: NumCast(doc.x), min: Math.min(...xs), max: Math.max(...xs) }))(ink.map(p => p.X));
const oldYrange = (ys => ({ coord: NumCast(doc.y), min: Math.min(...ys), max: Math.max(...ys) }))(ink.map(p => p.Y));
const centerPoint = { X: (oldXrange.min + oldXrange.max) / 2, Y: (oldYrange.min + oldYrange.max) / 2 };
@@ -186,42 +229,116 @@ export class InkStrokeProperties {
});
}
+ /**
+ * Handles the movement/scaling of a control point.
+ */
@undoBatch
@action
- control = (xDiff: number, yDiff: number, controlNum: number) =>
- this.applyFunction((doc: Doc, ink: InkData, ptsXscale: number, ptsYscale: number) => {
+ moveControl = (deltaX: number, deltaY: number, controlIndex: number) =>
+ this.applyFunction((doc: Doc, ink: InkData, xScale: number, yScale: number) => {
const newPoints: { X: number, Y: number }[] = [];
- const order = controlNum % 4;
+ const order = controlIndex % 4;
for (var i = 0; i < ink.length; i++) {
- newPoints.push(
- (controlNum === i ||
- (order === 0 && i === controlNum + 1) ||
- (order === 0 && controlNum !== 0 && i === controlNum - 2) ||
- (order === 0 && controlNum !== 0 && i === controlNum - 1) ||
- (order === 3 && i === controlNum - 1) ||
- (order === 3 && controlNum !== ink.length - 1 && i === controlNum + 1) ||
- (order === 3 && controlNum !== ink.length - 1 && i === controlNum + 2) ||
- ((ink[0].X === ink[ink.length - 1].X) && (ink[0].Y === ink[ink.length - 1].Y) && (i === 0 || i === ink.length - 1) && (controlNum === 0 || controlNum === ink.length - 1))
- ) ?
- { X: ink[i].X - xDiff / ptsXscale, Y: ink[i].Y - yDiff / ptsYscale } :
- { X: ink[i].X, Y: ink[i].Y });
+ const leftHandlePoint = order === 0 && i === controlIndex + 1;
+ const rightHandlePoint = order === 0 && controlIndex !== 0 && i === controlIndex - 2;
+ if (controlIndex === i ||
+ leftHandlePoint ||
+ rightHandlePoint ||
+ (order === 0 && controlIndex !== 0 && i === controlIndex - 1) ||
+ (order === 3 && i === controlIndex - 1) ||
+ (order === 3 && controlIndex !== ink.length - 1 && i === controlIndex + 1) ||
+ (order === 3 && controlIndex !== ink.length - 1 && i === controlIndex + 2) ||
+ ((ink[0].X === ink[ink.length - 1].X) && (ink[0].Y === ink[ink.length - 1].Y) && (i === 0 || i === ink.length - 1) && (controlIndex === 0 || controlIndex === ink.length - 1))) {
+ newPoints.push({ X: ink[i].X - deltaX / xScale, Y: ink[i].Y - deltaY / yScale });
+ } else {
+ newPoints.push({ X: ink[i].X, Y: ink[i].Y });
+ }
}
return newPoints;
+ })
+
+ /**
+ * Snaps a control point with broken tangency back to synced rotation.
+ * @param handleIndexA The handle point that retains its current position.
+ * @param handleIndexB The handle point that is rotated to be 180 degrees from its opposite.
+ */
+ snapHandleTangent = (controlIndex: number, handleIndexA: number, handleIndexB: number) => {
+ this.applyFunction((doc: Doc, ink: InkData) => {
+ const brokenIndices = Cast(doc.brokenInkIndices, listSpec("number"));
+ if (brokenIndices) {
+ brokenIndices.splice(brokenIndices.indexOf(controlIndex), 1);
+ doc.brokenInkIndices = brokenIndices;
+ const [controlPoint, handleA, handleB] = [ink[controlIndex], ink[handleIndexA], ink[handleIndexB]];
+ const oppositeHandleA = this.rotatePoint(handleA, controlPoint, Math.PI);
+ const angleDifference = this.angleChange(handleB, oppositeHandleA, controlPoint);
+ const newHandleB = this.rotatePoint(handleB, controlPoint, angleDifference);
+ ink[handleIndexB] = newHandleB;
+ return ink;
+ }
});
+ }
- @undoBatch
+ /**
+ * Rotates the target point about the origin point for a given angle (radians).
+ */
@action
- switchStk = (color: ColorState) => {
- const val = String(color.hex);
- this.colorStk = val;
- return true;
+ rotatePoint = (target: PointData, origin: PointData, angle: number) => {
+ let rotatedTarget = { X: target.X - origin.X, Y: target.Y - origin.Y };
+ const newX = Math.cos(angle) * rotatedTarget.X - Math.sin(angle) * rotatedTarget.Y;
+ const newY = Math.sin(angle) * rotatedTarget.X + Math.cos(angle) * rotatedTarget.Y;
+ rotatedTarget.X = newX + origin.X;
+ rotatedTarget.Y = newY + origin.Y;
+ return rotatedTarget;
+ }
+
+ /**
+ * Finds the angle (in radians) between two inputted vectors.
+ *
+ * α = arccos(a·b / |a|·|b|), where a and b are both vectors.
+ */
+ angleBetweenTwoVectors = (vectorA: PointData, vectorB: PointData) => {
+ const magnitudeA = Math.sqrt(vectorA.X * vectorA.X + vectorA.Y * vectorA.Y);
+ const magnitudeB = Math.sqrt(vectorB.X * vectorB.X + vectorB.Y * vectorB.Y);
+ // Normalizing the vectors.
+ vectorA = { X: vectorA.X / magnitudeA, Y: vectorA.Y / magnitudeA };
+ vectorB = { X: vectorB.X / magnitudeB, Y: vectorB.Y / magnitudeB };
+ const dotProduct = vectorB.X * vectorA.X + vectorB.Y * vectorA.Y;
+ return Math.acos(dotProduct);
}
+ /**
+ * Finds the angle difference (in radians) between two vectors relative to an arbitrary origin.
+ */
+ angleChange = (a: PointData, b: PointData, origin: PointData) => {
+ // Finding vector representation of inputted points relative to new origin.
+ const vectorA = { X: a.X - origin.X, Y: a.Y - origin.Y };
+ const vectorB = { X: b.X - origin.X, Y: b.Y - origin.Y };
+ const crossProduct = vectorB.X * vectorA.Y - vectorB.Y * vectorA.X;
+ // Determining whether rotation is clockwise or counterclockwise.
+ const sign = crossProduct < 0 ? 1 : -1;
+ const theta = this.angleBetweenTwoVectors(vectorA, vectorB);
+ return sign * theta;
+ }
+
+ /**
+ * Handles the movement/scaling of a handle point.
+ */
@undoBatch
@action
- switchFil = (color: ColorState) => {
- const val = String(color.hex);
- this.colorFil = val;
- return true;
- }
+ moveHandle = (deltaX: number, deltaY: number, handleIndex: number, oppositeHandleIndex: number, controlIndex: number) =>
+ this.applyFunction((doc: Doc, ink: InkData, xScale: number, yScale: number) => {
+ const oldHandlePoint = ink[handleIndex];
+ let oppositeHandlePoint = ink[oppositeHandleIndex];
+ const controlPoint = ink[controlIndex];
+ const newHandlePoint = { X: ink[handleIndex].X - deltaX / xScale, Y: ink[handleIndex].Y - deltaY / yScale };
+ ink[handleIndex] = newHandlePoint;
+ const brokenIndices = Cast(doc.brokenInkIndices, listSpec("number"));
+ // Rotate opposite handle if user hasn't held 'Alt' key or not first/final control (which have only 1 handle).
+ if ((!brokenIndices || !brokenIndices?.includes(controlIndex)) && handleIndex !== 1 && handleIndex !== ink.length - 2) {
+ const angle = this.angleChange(oldHandlePoint, newHandlePoint, controlPoint);
+ oppositeHandlePoint = this.rotatePoint(oppositeHandlePoint, controlPoint, angle);
+ ink[oppositeHandleIndex] = oppositeHandlePoint;
+ }
+ return ink;
+ })
} \ No newline at end of file
diff --git a/src/client/views/InkingStroke.scss b/src/client/views/InkingStroke.scss
deleted file mode 100644
index 30ab1967e..000000000
--- a/src/client/views/InkingStroke.scss
+++ /dev/null
@@ -1,11 +0,0 @@
-.inkingStroke {
- mix-blend-mode: multiply;
- stroke-linejoin: round;
- stroke-linecap: round;
- overflow: visible !important;
- transform-origin: top left;
-
- svg:not(:root) {
- overflow: visible !important;
- }
-} \ No newline at end of file
diff --git a/src/client/views/InkingStroke.tsx b/src/client/views/InkingStroke.tsx
index 449019ca8..63cefbf67 100644
--- a/src/client/views/InkingStroke.tsx
+++ b/src/client/views/InkingStroke.tsx
@@ -1,4 +1,5 @@
-import { action } from "mobx";
+import React = require("react");
+import { action, observable } from "mobx";
import { observer } from "mobx-react";
import { Doc } from "../../fields/Doc";
import { documentSchema } from "../../fields/documentSchemas";
@@ -10,25 +11,35 @@ import { setupMoveUpEvents, emptyFunction, returnFalse } from "../../Utils";
import { CognitiveServices } from "../cognitive_services/CognitiveServices";
import { InteractionUtils } from "../util/InteractionUtils";
import { Scripting } from "../util/Scripting";
-import { UndoManager } from "../util/UndoManager";
import { ContextMenu } from "./ContextMenu";
import { ViewBoxBaseComponent } from "./DocComponent";
-import "./InkingStroke.scss";
+import "./InkStroke.scss";
import { FieldView, FieldViewProps } from "./nodes/FieldView";
-import React = require("react");
import { InkStrokeProperties } from "./InkStrokeProperties";
import { CurrentUserUtils } from "../util/CurrentUserUtils";
+import { InkControls } from "./InkControls";
+import { InkHandles } from "./InkHandles";
+import { Colors } from "./global/globalEnums";
type InkDocument = makeInterface<[typeof documentSchema]>;
const InkDocument = makeInterface(documentSchema);
@observer
export class InkingStroke extends ViewBoxBaseComponent<FieldViewProps, InkDocument>(InkDocument) {
- private _controlUndo?: UndoManager.Batch;
+ static readonly MaskDim = 50000;
+ @observable private _properties?: InkStrokeProperties;
+
+ constructor(props: FieldViewProps & InkDocument) {
+ super(props);
+
+ this._properties = InkStrokeProperties.Instance;
+ }
- public static LayoutString(fieldStr: string) { return FieldView.LayoutString(InkingStroke, fieldStr); }
+ public static LayoutString(fieldStr: string) {
+ return FieldView.LayoutString(InkingStroke, fieldStr);
+ }
- private analyzeStrokes = () => {
+ analyzeStrokes() {
const data: InkData = Cast(this.dataDoc[this.fieldKey], InkField)?.inkData ?? [];
CognitiveServices.Inking.Appliers.ConcatenateHandwriting(this.dataDoc, ["inkAnalysis", "handwriting"], [data]);
}
@@ -41,149 +52,65 @@ export class InkingStroke extends ViewBoxBaseComponent<FieldViewProps, InkDocume
inkDoc._stayInCollection = inkDoc.isInkMask ? true : undefined;
});
- @action
- onControlDown = (e: React.PointerEvent, controlNum: number): void => {
- if (InkStrokeProperties.Instance) {
- InkStrokeProperties.Instance.control(0, 0, 1);
- const controlUndo = UndoManager.StartBatch("DocDecs set radius");
- const screenScale = this.props.ScreenToLocalTransform().Scale;
- setupMoveUpEvents(this, e,
- (e: PointerEvent, down: number[], delta: number[]) => {
- InkStrokeProperties.Instance?.control(-delta[0] * screenScale, -delta[1] * screenScale, controlNum);
- return false;
- },
- () => controlUndo?.end(), emptyFunction);
- }
- }
-
- @action
- changeCurrPoint = (i: number) => {
- if (InkStrokeProperties.Instance) {
- InkStrokeProperties.Instance._currPoint = i;
- document.addEventListener("keydown", this.delPts, true);
+ /**
+ * Handles the movement of the entire ink object when the user clicks and drags.
+ */
+ onPointerDown = (e: React.PointerEvent) => {
+ if (this.props.isSelected(true)) {
+ setupMoveUpEvents(this, e, returnFalse, emptyFunction,
+ action((e: PointerEvent, doubleTap: boolean | undefined) =>
+ doubleTap && this._properties && (this._properties._controlButton = true))
+ );
}
}
+ /**
+ * Ensures the ink controls and handles aren't rendered when the current ink stroke is reselected.
+ */
@action
- delPts = (e: KeyboardEvent) => {
- if (["-", "Backspace", "Delete"].includes(e.key)) {
- if (InkStrokeProperties.Instance?.deletePoints()) e.stopPropagation();
+ toggleControlButton = () => {
+ if (!this.props.isSelected() && this._properties) {
+ this._properties._controlButton = false;
}
}
- onPointerDown = (e: React.PointerEvent) => {
- if (this.props.isSelected(true)) {
- setupMoveUpEvents(this, e, returnFalse, emptyFunction, action((e: PointerEvent, doubleTap: boolean | undefined) =>
- doubleTap && InkStrokeProperties.Instance && (InkStrokeProperties.Instance._controlBtn = true)));
- }
- }
-
- public static MaskDim = 50000;
render() {
TraceMobx();
- const formatInstance = InkStrokeProperties.Instance;
- if (!formatInstance) return (null);
+ this.toggleControlButton();
+ // Extracting the ink data and formatting information of the current ink stroke.
const data: InkData = Cast(this.dataDoc[this.fieldKey], InkField)?.inkData ?? [];
- // const strokeWidth = Number(StrCast(this.layoutDoc.strokeWidth, ActiveInkWidth()));
+ const inkDoc: Doc = this.layoutDoc;
const strokeWidth = Number(this.layoutDoc.strokeWidth);
- const xs = data.map(p => p.X);
- const ys = data.map(p => p.Y);
- const lineTop = Math.min(...ys);
- const lineBot = Math.max(...ys);
- const lineLft = Math.min(...xs);
- const lineRgt = Math.max(...xs);
- const left = lineLft - strokeWidth / 2;
+ const lineTop = Math.min(...data.map(p => p.Y));
+ const lineBottom = Math.max(...data.map(p => p.Y));
+ const lineLeft = Math.min(...data.map(p => p.X));
+ const lineRight = Math.max(...data.map(p => p.X));
+ const left = lineLeft - strokeWidth / 2;
const top = lineTop - strokeWidth / 2;
- const right = lineRgt + strokeWidth / 2;
- const bottom = lineBot + strokeWidth / 2;
+ const right = lineRight + strokeWidth / 2;
+ const bottom = lineBottom + strokeWidth / 2;
const width = Math.max(1, right - left);
const height = Math.max(1, bottom - top);
const scaleX = width === strokeWidth ? 1 : (this.props.PanelWidth() - strokeWidth) / (width - strokeWidth);
const scaleY = height === strokeWidth ? 1 : (this.props.PanelHeight() - strokeWidth) / (height - strokeWidth);
const strokeColor = StrCast(this.layoutDoc.color, "");
-
- const points = InteractionUtils.CreatePolyline(data, left, top, strokeColor, strokeWidth, strokeWidth,
- StrCast(this.layoutDoc.strokeBezier), StrCast(this.layoutDoc.fillColor, "none"),
- StrCast(this.layoutDoc.strokeStartMarker), StrCast(this.layoutDoc.strokeEndMarker),
- StrCast(this.layoutDoc.strokeDash), scaleX, scaleY, "", "none", this.props.isSelected() && strokeWidth <= 5 && lineBot - lineTop > 1 && lineRgt - lineLft > 1, false);
-
- const hpoints = InteractionUtils.CreatePolyline(data, left, top,
- this.props.isSelected() && strokeWidth > 5 ? strokeColor : "transparent", strokeWidth, (strokeWidth + 15),
- StrCast(this.layoutDoc.strokeBezier), StrCast(this.layoutDoc.fillColor, "none"),
- "none", "none", undefined, scaleX, scaleY, "", this.props.layerProvider?.(this.props.Document) === false ? "none" : "visiblepainted", false, true);
-
- //points for adding
- const apoints = InteractionUtils.CreatePoints(data, left, top, strokeColor, strokeWidth, strokeWidth,
- StrCast(this.layoutDoc.strokeBezier), StrCast(this.layoutDoc.fillColor, "none"),
- StrCast(this.layoutDoc.strokeStartMarker), StrCast(this.layoutDoc.strokeEndMarker),
- StrCast(this.layoutDoc.strokeDash), scaleX, scaleY, "", "none", this.props.isSelected() && strokeWidth <= 5, false);
-
- const controlPoints: { X: number, Y: number, I: number }[] = [];
- const handlePoints: { X: number, Y: number, I: number, dot1: number, dot2: number }[] = [];
- const handleLine: { X1: number, Y1: number, X2: number, Y2: number, X3: number, Y3: number, dot1: number, dot2: number }[] = [];
- if (data.length >= 4) {
- for (var i = 0; i <= data.length - 4; i += 4) {
- controlPoints.push({ X: data[i].X, Y: data[i].Y, I: i });
- controlPoints.push({ X: data[i + 3].X, Y: data[i + 3].Y, I: i + 3 });
- handlePoints.push({ X: data[i + 1].X, Y: data[i + 1].Y, I: i + 1, dot1: i, dot2: i === 0 ? i : i - 1 });
- handlePoints.push({ X: data[i + 2].X, Y: data[i + 2].Y, I: i + 2, dot1: i + 3, dot2: i === data.length ? i + 3 : i + 4 });
- }
-
- handleLine.push({ X1: data[0].X, Y1: data[0].Y, X2: data[0].X, Y2: data[0].Y, X3: data[1].X, Y3: data[1].Y, dot1: 0, dot2: 0 });
- for (var i = 2; i < data.length - 4; i += 4) {
-
- handleLine.push({ X1: data[i].X, Y1: data[i].Y, X2: data[i + 1].X, Y2: data[i + 1].Y, X3: data[i + 3].X, Y3: data[i + 3].Y, dot1: i + 1, dot2: i + 2 });
-
- }
- handleLine.push({ X1: data[data.length - 2].X, Y1: data[data.length - 2].Y, X2: data[data.length - 1].X, Y2: data[data.length - 1].Y, X3: data[data.length - 1].X, Y3: data[data.length - 1].Y, dot1: data.length - 1, dot2: data.length - 1 });
-
- for (var i = 0; i <= data.length - 4; i += 4) {
- handlePoints.push({ X: data[i + 1].X, Y: data[i + 1].Y, I: i + 1, dot1: i, dot2: i === 0 ? i : i - 1 });
- handlePoints.push({ X: data[i + 2].X, Y: data[i + 2].Y, I: i + 2, dot1: i + 3, dot2: i === data.length ? i + 3 : i + 4 });
- }
- }
- // if (data.length <= 4) {
- // handlePoints = [];
- // handleLine = [];
- // controlPoints = [];
- // for (var i = 0; i < data.length; i++) {
- // controlPoints.push({ X: data[i].X, Y: data[i].Y, I: i });
- // }
-
- // }
const dotsize = Math.max(width * scaleX, height * scaleY) / 40;
- const addpoints = apoints.map((pts, i) =>
- <svg height="10" width="10" key={`add${i}`}>
- <circle cx={(pts.X - left - strokeWidth / 2) * scaleX + strokeWidth / 2} cy={(pts.Y - top - strokeWidth / 2) * scaleY + strokeWidth / 2} r={strokeWidth / 2} stroke="invisible" strokeWidth={dotsize / 2} fill="invisible"
- onPointerDown={(e) => { formatInstance.addPoints(pts.X, pts.Y, apoints, i, controlPoints); }} pointerEvents="all" cursor="all-scroll"
- />
- </svg>);
- const handles = handlePoints.map((pts, i) =>
- <svg height="10" width="10" key={`hdl${i}`}>
- <circle cx={(pts.X - left - strokeWidth / 2) * scaleX + strokeWidth / 2} cy={(pts.Y - top - strokeWidth / 2) * scaleY + strokeWidth / 2} r={strokeWidth} strokeWidth={0} fill="green"
- onPointerDown={(e) => this.onControlDown(e, pts.I)} pointerEvents="all" cursor="default" display={(pts.dot1 === formatInstance._currPoint || pts.dot2 === formatInstance._currPoint) ? "inherit" : "none"} />
- </svg>);
-
- const controls = controlPoints.map((pts, i) =>
- <svg height="10" width="10" key={`ctrl${i}`}>
- <circle cx={(pts.X - left - strokeWidth / 2) * scaleX + strokeWidth / 2} cy={(pts.Y - top - strokeWidth / 2) * scaleY + strokeWidth / 2} r={strokeWidth / 2} strokeWidth={0} fill="red"
- onPointerDown={(e) => { this.changeCurrPoint(pts.I); this.onControlDown(e, pts.I); }} pointerEvents="all" cursor="default"
- />
- </svg>);
- const handleLines = handleLine.map((pts, i) =>
- <svg height="100" width="100" key={`line${i}`} >
- <line x1={(pts.X1 - left - strokeWidth / 2) * scaleX + strokeWidth / 2} y1={(pts.Y1 - top - strokeWidth / 2) * scaleY + strokeWidth / 2}
- x2={(pts.X2 - left - strokeWidth / 2) * scaleX + strokeWidth / 2} y2={(pts.Y2 - top - strokeWidth / 2) * scaleY + strokeWidth / 2} stroke="green" strokeWidth={dotsize / 6}
- display={(pts.dot1 === formatInstance._currPoint || pts.dot2 === formatInstance._currPoint) ? "inherit" : "none"} />
- <line x1={(pts.X2 - left - strokeWidth / 2) * scaleX + strokeWidth / 2} y1={(pts.Y2 - top - strokeWidth / 2) * scaleY + strokeWidth / 2}
- x2={(pts.X3 - left - strokeWidth / 2) * scaleX + strokeWidth / 2} y2={(pts.Y3 - top - strokeWidth / 2) * scaleY + strokeWidth / 2} stroke="green" strokeWidth={dotsize / 6}
- display={(pts.dot1 === formatInstance._currPoint || pts.dot2 === formatInstance._currPoint) ? "inherit" : "none"} />
- </svg>);
-
+ // Visually renders the polygonal line made by the user.
+ const inkLine = InteractionUtils.CreatePolyline(data, left, top, strokeColor, strokeWidth, strokeWidth, StrCast(this.layoutDoc.strokeBezier), StrCast(this.layoutDoc.fillColor, "none"), StrCast(this.layoutDoc.strokeStartMarker),
+ StrCast(this.layoutDoc.strokeEndMarker), StrCast(this.layoutDoc.strokeDash), scaleX, scaleY, "", "none", this.props.isSelected() && strokeWidth <= 5 && lineBottom - lineTop > 1 && lineRight - lineLeft > 1, false);
+ // Thin blue line indicating that the current ink stroke is selected.
+ const selectedLine = InteractionUtils.CreatePolyline(data, left - strokeWidth / 3, top - strokeWidth / 3, Colors.MEDIUM_BLUE, strokeWidth / 6, strokeWidth / 6, StrCast(this.layoutDoc.strokeBezier), StrCast(this.layoutDoc.fillColor, "none"),
+ StrCast(this.layoutDoc.strokeStartMarker), StrCast(this.layoutDoc.strokeEndMarker), StrCast(this.layoutDoc.strokeDash), scaleX, scaleY, "", "none", this.props.isSelected() && strokeWidth <= 5 && lineBottom - lineTop > 1 && lineRight - lineLeft > 1, false);
+ // Invisible polygonal line that enables the ink to be selected by the user.
+ const clickableLine = InteractionUtils.CreatePolyline(data, left, top, this.props.isSelected() && strokeWidth > 5 ? strokeColor : "transparent", strokeWidth, strokeWidth + 15, StrCast(this.layoutDoc.strokeBezier),
+ StrCast(this.layoutDoc.fillColor, "none"), "none", "none", undefined, scaleX, scaleY, "", this.props.layerProvider?.(this.props.Document) === false ? "none" : "visiblepainted", false, true);
+ // Set of points rendered upon the ink that can be added if a user clicks on one.
+ const addedPoints = InteractionUtils.CreatePoints(data, left, top, strokeColor, strokeWidth, strokeWidth, StrCast(this.layoutDoc.strokeBezier), StrCast(this.layoutDoc.fillColor, "none"), StrCast(this.layoutDoc.strokeStartMarker),
+ StrCast(this.layoutDoc.strokeEndMarker), StrCast(this.layoutDoc.strokeDash), scaleX, scaleY, "", "none", this.props.isSelected() && strokeWidth <= 5, false);
return (
- <svg className="inkingStroke"
+ <svg className="inkStroke"
style={{
pointerEvents: this.props.Document.isInkMask && this.props.layerProvider?.(this.props.Document) !== false ? "all" : "none",
transform: this.props.Document.isInkMask ? `translate(${InkingStroke.MaskDim / 2}px, ${InkingStroke.MaskDim / 2}px)` : undefined,
@@ -196,19 +123,28 @@ export class InkingStroke extends ViewBoxBaseComponent<FieldViewProps, InkDocume
if (cm) {
!Doc.UserDoc().noviceMode && cm.addItem({ description: "Recognize Writing", event: this.analyzeStrokes, icon: "paint-brush" });
cm.addItem({ description: "Toggle Mask", event: () => InkingStroke.toggleMask(this.rootDoc), icon: "paint-brush" });
- cm.addItem({ description: "Edit Points", event: action(() => formatInstance._controlBtn = !formatInstance._controlBtn), icon: "paint-brush" });
- //cm.addItem({ description: "Format Shape...", event: this.formatShape, icon: "paint-brush" });
+ cm.addItem({ description: "Edit Points", event: action(() => { if (this._properties) { this._properties._controlButton = !this._properties._controlButton; } }), icon: "paint-brush" });
}
}}
- ><defs>
- </defs>
- {hpoints}
- {points}
- {formatInstance._controlBtn && this.props.isSelected() ? addpoints : ""}
- {formatInstance._controlBtn && this.props.isSelected() ? handleLines : ""}
- {formatInstance._controlBtn && this.props.isSelected() ? handles : ""}
- {formatInstance._controlBtn && this.props.isSelected() ? controls : ""}
-
+ >
+
+ {clickableLine}
+ {inkLine}
+ {this.props.isSelected() ? selectedLine : ""}
+ {this.props.isSelected() && this._properties?._controlButton ?
+ <>
+ <InkControls
+ inkDoc={inkDoc}
+ data={data}
+ addedPoints={addedPoints}
+ format={[left, top, scaleX, scaleY, strokeWidth]}
+ ScreenToLocalTransform={this.props.ScreenToLocalTransform} />
+ <InkHandles
+ inkDoc={inkDoc}
+ data={data}
+ format={[left, top, scaleX, scaleY, strokeWidth]}
+ ScreenToLocalTransform={this.props.ScreenToLocalTransform} />
+ </> : ""}
</svg>
);
}
diff --git a/src/client/views/LightboxView.scss b/src/client/views/LightboxView.scss
index 4ea2dc2d6..5d42cd97f 100644
--- a/src/client/views/LightboxView.scss
+++ b/src/client/views/LightboxView.scss
@@ -1,3 +1,32 @@
+
+ .lightboxView-navBtn {
+ margin: auto;
+ position: absolute;
+ right: 10;
+ top: 10;
+ background: transparent;
+ border-radius: 8;
+ color:white;
+ opacity: 0.7;
+ width: 35;
+ &:hover {
+ opacity: 1;
+ }
+ }
+ .lightboxView-tabBtn {
+ margin: auto;
+ position: absolute;
+ right: 35;
+ top: 10;
+ background: transparent;
+ border-radius: 8;
+ color:white;
+ opacity: 0.7;
+ width: 35;
+ &:hover {
+ opacity: 1;
+ }
+ }
.lightboxView-frame {
position: absolute;
top: 0; left: 0;
@@ -15,7 +44,6 @@
position: relative;
background: transparent;
border-radius: 8;
- color:white;
opacity: 0.7;
width: 35;
&:hover {
diff --git a/src/client/views/LightboxView.tsx b/src/client/views/LightboxView.tsx
index ce36d9182..88739fe91 100644
--- a/src/client/views/LightboxView.tsx
+++ b/src/client/views/LightboxView.tsx
@@ -1,19 +1,20 @@
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome';
-import { action, computed, observable, trace } from 'mobx';
+import { action, computed, observable } from 'mobx';
import { observer } from 'mobx-react';
import "normalize.css";
import * as React from 'react';
import { Doc, DocListCast, Opt } from '../../fields/Doc';
import { Cast, NumCast, StrCast } from '../../fields/Types';
-import { emptyFunction, returnEmptyDoclist, returnEmptyFilter, returnTrue, returnFalse } from '../../Utils';
+import { emptyFunction, returnEmptyDoclist, returnEmptyFilter, returnFalse, returnTrue } from '../../Utils';
import { DocUtils } from '../documents/Documents';
import { DocumentManager } from '../util/DocumentManager';
import { LinkManager } from '../util/LinkManager';
import { SelectionManager } from '../util/SelectionManager';
import { Transform } from '../util/Transform';
+import { CollectionDockingView } from './collections/CollectionDockingView';
import { TabDocView } from './collections/TabDocView';
import "./LightboxView.scss";
-import { DocumentView, ViewAdjustment } from './nodes/DocumentView';
+import { DocumentView } from './nodes/DocumentView';
import { DefaultStyleProvider, wavyBorderPath } from './StyleProvider';
interface LightboxViewProps {
@@ -160,7 +161,7 @@ export class LightboxView extends React.Component<LightboxViewProps> {
const { doc, target } = LightboxView._history?.lastElement();
const docView = DocumentManager.Instance.getLightboxDocumentView(target || doc);
if (docView) {
- LightboxView._docTarget = undefined;
+ LightboxView._docTarget = target;
const focusSpeed = 1000;
doc._viewTransition = `transform ${focusSpeed}ms`;
if (!target) docView.ComponentView?.shrinkWrap?.();
@@ -197,7 +198,6 @@ export class LightboxView extends React.Component<LightboxViewProps> {
TabDocView.PinDoc(coll, { hidePresBox: true });
}
}
- setTimeout(LightboxView.Next);
}
future = () => LightboxView._future;
@@ -228,7 +228,6 @@ export class LightboxView extends React.Component<LightboxViewProps> {
const targetView = target && DocumentManager.Instance.getLightboxDocumentView(target);
if (doc === r.props.Document && (!target || target === doc)) r.ComponentView?.shrinkWrap?.();
else target && targetView?.focus(target, { willZoom: true, scale: 0.9, instant: true });
- LightboxView._docTarget = undefined;
}));
})}
Document={LightboxView.LightboxDoc}
@@ -270,7 +269,16 @@ export class LightboxView extends React.Component<LightboxViewProps> {
LightboxView.Next();
})}
<LightboxTourBtn navBtn={this.navBtn} future={this.future} stepInto={this.stepInto} tourMap={this.tourMap} />
- <div className="lightboxView-navBtn" title={"toggle fit width"} style={{ position: "absolute", right: 10, top: 10, color: "white" }}
+ <div className="lightboxView-tabBtn" title={"open in tab"}
+ onClick={e => {
+ e.stopPropagation();
+ CollectionDockingView.AddSplit(LightboxView._docTarget || LightboxView._doc!, "onRight");
+ SelectionManager.DeselectAll();
+ LightboxView.SetLightboxDoc(undefined);
+ }}>
+ <FontAwesomeIcon icon={"file-download"} size="2x" />
+ </div>
+ <div className="lightboxView-navBtn" title={"toggle fit width"}
onClick={e => { e.stopPropagation(); LightboxView.LightboxDoc!._fitWidth = !LightboxView.LightboxDoc!._fitWidth; }}>
<FontAwesomeIcon icon={"arrows-alt-h"} size="2x" />
</div>
diff --git a/src/client/views/Main.scss b/src/client/views/Main.scss
index b1ad4868c..c8e64b5c4 100644
--- a/src/client/views/Main.scss
+++ b/src/client/views/Main.scss
@@ -1,4 +1,4 @@
-@import "globalCssVariables";
+@import "global/globalCssVariables";
@import "nodeModuleOverrides";
:root {
@@ -54,7 +54,7 @@ button {
background: black;
outline: none;
border: 0px;
- color: $light-color;
+ color: $white;
text-transform: uppercase;
letter-spacing: 2px;
font-size: 75%;
@@ -63,7 +63,7 @@ button {
}
button:hover {
- background: $main-accent;
+ background: $medium-gray;
transform: scale(1.05);
cursor: pointer;
}
diff --git a/src/client/views/Main.tsx b/src/client/views/Main.tsx
index 60327f1bf..7553c8118 100644
--- a/src/client/views/Main.tsx
+++ b/src/client/views/Main.tsx
@@ -12,6 +12,7 @@ import { LinkManager } from "../util/LinkManager";
AssignAllExtensions();
(async () => {
+ MainView.Live = window.location.search.includes("live");
window.location.search.includes("safe") && CollectionView.SetSafeMode(true);
const info = await CurrentUserUtils.loadCurrentUser();
if (info.id !== "__guest__") {
diff --git a/src/client/views/MainView.scss b/src/client/views/MainView.scss
index 3f04a0f3a..d913f2069 100644
--- a/src/client/views/MainView.scss
+++ b/src/client/views/MainView.scss
@@ -1,4 +1,4 @@
-@import "globalCssVariables";
+@import "global/globalCssVariables";
@import "nodeModuleOverrides";
@@ -22,10 +22,6 @@
height: 100%;
}
-.mainContent-div-flyout {
- left: calc(-1 * var(--flyoutHandleWidth));
-}
-
// add nodes menu. Note that the + button is actually an input label, not an actual button.
.mainView-docButtons {
position: absolute;
@@ -56,50 +52,50 @@
touch-action: none;
.searchBox-container {
- background: lightgray;
+ background: $light-gray;
}
}
.mainView-container {
- color: black;
+ color: $dark-gray;
.lm_title {
- background: #cacaca;
- color: black;
+ background: $light-gray;
+ color: $dark-gray;
}
}
.mainView-container-dark {
- color: lightgray;
+ color: $light-gray;
.lm_goldenlayout {
- background: dimgray;
+ background: $medium-gray;
}
.lm_title {
- background: black;
+ background: $dark-gray;
color: unset;
}
.marquee {
- border-color: white;
+ border-color: $white;
}
#search-input {
- background: lightgray;
+ background: $light-gray;
}
.searchBox-container {
- background: rgb(45, 45, 45);
+ background: $dark-gray;
}
.contextMenu-cont,
.contextMenu-item {
- background: dimGray;
+ background: $medium-gray;
}
.contextMenu-item:hover {
- background: gray;
+ background: $medium-gray;
}
}
@@ -111,14 +107,21 @@
user-select: none;
}
+.properties-container {
+ height: 100%;
+ position: relative;
+ left: 100%;
+ top: calc(-100% - 36px);
+ z-index: 3000;
+}
+
.mainView-propertiesDragger {
//background-color: rgb(140, 139, 139);
- background-color: lightgrey;
+ background-color: $light-gray;
height: 55px;
width: 17px;
position: absolute;
top: 50%;
- border: 1px black solid;
border-radius: 0;
border-top-left-radius: 10px;
border-bottom-left-radius: 10px;
@@ -141,18 +144,6 @@
}
}
-.mainiView-propertiesView {
- display: flex;
- flex-direction: column;
- height: 100%;
- position: absolute;
- right: 0;
- top: 0;
- border-left: solid 1px;
- z-index: 100000;
- cursor: auto;
-}
-
.mainView-innerContent, .mainView-innerContent-dark {
display: contents;
flex-direction: row;
@@ -163,43 +154,43 @@
flex-direction: column;
position: relative;
height: 100%;
- background: dimgray;
+ background: $medium-gray;
.documentView-node-topmost {
- background: lightgrey;
+ background: $light-gray;
}
}
.propertiesView {
- right: 0;
+ left: 0;
position: absolute;
z-index: 2;
- background-color: rgb(159, 159, 159);
+ background-color: $light-gray;
.editable-title {
- background-color: lightgrey;
+ background-color: $light-gray;
}
}
}
.mainView-libraryHandle {
- background-color: lightgrey;
+ background-color: $light-gray;
}
.mainView-innerContent-dark
{
.propertiesView {
background-color: #252525;
input {
- background-color: dimgrey;
+ background-color: $medium-gray;
}
.propertiesView-sharingTable
{
- background-color: dimgrey;
+ background-color: $medium-gray;
}
.editable-title {
- background-color: dimgrey;
+ background-color: $medium-gray;
}
.propertiesView-field {
- background-color: dimgrey;
+ background-color: $medium-gray;
}
}
.mainView-propertiesDragger,
@@ -209,17 +200,18 @@
}
.mainView-container-dark {
.contextMenu-cont {
- background: dimgrey;
- color: white;
+ background: $medium-gray;
+ color: $white;
input::placeholder {
- color:white;
+ color:$white;
}
}
}
.mainView-menuPanel {
min-width: var(--menuPanelWidth);
- background-color: #121721;
+ background-color: $dark-gray;
+ border-right: $standard-border;
.collectionStackingView {
scrollbar-width: none;
@@ -233,13 +225,13 @@
padding: 7px;
padding-left: 7px;
width: 100%;
- background: black;
+ background: $dark-gray;
.mainView-menuPanel-button-wrap {
width: 45px;
/* padding: 5px; */
touch-action: none;
- background: black;
+ background: $dark-gray;
transform-origin: top left;
/* margin-bottom: 5px; */
margin-top: 5px;
@@ -247,7 +239,7 @@
border-radius: 8px;
&:hover {
- background: rgb(61, 61, 61);
+ background: $black;
cursor: pointer;
}
}
@@ -419,31 +411,4 @@
display: block;
width: 500px;
height: 1000px;
-}
-
-.lm_drag_tab {
- padding: 0;
- width: 15px !important;
- height: 15px !important;
- position: relative !important;
- display: inline-flex !important;
- align-items: center;
- top: 0 !important;
- right: unset !important;
- left: 0 !important;
-}
-.lm_close_tab {
- padding: 0;
- width: 15px !important;
- height: 15px !important;
- position: relative !important;
- display: inline-flex !important;
- align-items: center;
- top: 0 !important;
- right: unset !important;
- left: 0 !important;
-}
-.lm_tab, .lm_tab_active {
- display: flex !important;
- padding-right: 0 !important;
} \ No newline at end of file
diff --git a/src/client/views/MainView.tsx b/src/client/views/MainView.tsx
index 35222e91f..6ff8825ed 100644
--- a/src/client/views/MainView.tsx
+++ b/src/client/views/MainView.tsx
@@ -13,7 +13,7 @@ import { List } from '../../fields/List';
import { PrefetchProxy } from '../../fields/Proxy';
import { BoolCast, PromiseValue, StrCast } from '../../fields/Types';
import { TraceMobx } from '../../fields/util';
-import { emptyFunction, emptyPath, returnEmptyDoclist, returnEmptyFilter, returnFalse, returnTrue, setupMoveUpEvents, simulateMouseClick, Utils } from '../../Utils';
+import { emptyFunction, returnEmptyDoclist, returnEmptyFilter, returnFalse, returnTrue, setupMoveUpEvents, simulateMouseClick, Utils } from '../../Utils';
import { GoogleAuthenticationManager } from '../apis/GoogleAuthenticationManager';
import { DocServer } from '../DocServer';
import { Docs, DocUtils } from '../documents/Documents';
@@ -29,28 +29,27 @@ import { SettingsManager } from '../util/SettingsManager';
import { SharingManager } from '../util/SharingManager';
import { SnappingManager } from '../util/SnappingManager';
import { Transform } from '../util/Transform';
-import { undoBatch, UndoManager } from '../util/UndoManager';
import { TimelineMenu } from './animationtimeline/TimelineMenu';
import { CollectionDockingView } from './collections/CollectionDockingView';
import { MarqueeOptionsMenu } from './collections/collectionFreeForm/MarqueeOptionsMenu';
import { CollectionLinearView } from './collections/CollectionLinearView';
import { CollectionMenu } from './collections/CollectionMenu';
import { CollectionViewType } from './collections/CollectionView';
+import "./collections/TreeView.scss";
import { ContextMenu } from './ContextMenu';
import { DictationOverlay } from './DictationOverlay';
import { DocumentDecorations } from './DocumentDecorations';
import { GestureOverlay } from './GestureOverlay';
-import { MENU_PANEL_WIDTH, SEARCH_PANEL_HEIGHT } from './globalCssVariables.scss';
+import { MENU_PANEL_WIDTH, SEARCH_PANEL_HEIGHT } from './global/globalCssVariables.scss';
+import { Colors } from './global/globalEnums';
import { KeyManager } from './GlobalKeyHandler';
import { InkStrokeProperties } from './InkStrokeProperties';
import { LightboxView } from './LightboxView';
import { LinkMenu } from './linking/LinkMenu';
import "./MainView.scss";
-import "./collections/TreeView.scss";
import { AudioBox } from './nodes/AudioBox';
import { DocumentLinksButton } from './nodes/DocumentLinksButton';
-import { DocumentView, DocumentViewProps, DocAfterFocusFunc } from './nodes/DocumentView';
-import { FieldViewProps } from './nodes/FieldView';
+import { DocumentView } from './nodes/DocumentView';
import { FormattedTextBox } from './nodes/formattedText/FormattedTextBox';
import { LinkDescriptionPopup } from './nodes/LinkDescriptionPopup';
import { LinkDocPreview } from './nodes/LinkDocPreview';
@@ -61,13 +60,14 @@ import { OverlayView } from './OverlayView';
import { AnchorMenu } from './pdf/AnchorMenu';
import { PreviewCursor } from './PreviewCursor';
import { PropertiesView } from './PropertiesView';
-import { SearchBox } from './search/SearchBox';
-import { DefaultStyleProvider, DashboardStyleProvider, StyleProp } from './StyleProvider';
+import { DashboardStyleProvider, DefaultStyleProvider } from './StyleProvider';
+import { TopBar } from './topbar/TopBar';
const _global = (window /* browser */ || global /* node */) as any;
@observer
export class MainView extends React.Component {
public static Instance: MainView;
+ public static Live: boolean = false;
private _docBtnRef = React.createRef<HTMLDivElement>();
@observable public LastButton: Opt<Doc>;
@observable private _windowWidth: number = 0;
@@ -78,7 +78,7 @@ export class MainView extends React.Component {
@observable private _sidebarContent: any = this.userDoc?.sidebar;
@observable private _flyoutWidth: number = 0;
- @computed private get topOffset() { return (CollectionMenu.Instance?.Pinned ? 35 : 0) + Number(SEARCH_PANEL_HEIGHT.replace("px", "")); }
+ @computed private get topOffset() { return Number(SEARCH_PANEL_HEIGHT.replace("px", "")); } //TODO remove
@computed private get leftOffset() { return this.menuPanelWidth() - 2; }
@computed private get userDoc() { return Doc.UserDoc(); }
@computed private get darkScheme() { return BoolCast(CurrentUserUtils.ActiveDashboard?.darkScheme); }
@@ -103,8 +103,9 @@ export class MainView extends React.Component {
}
new InkStrokeProperties();
this._sidebarContent.proto = undefined;
- DocServer.setPlaygroundFields(["x", "y", "dataTransition", "_autoHeight", "_showSidebar", "_sidebarWidthPercent", "_width", "_height", "_viewTransition", "_panX", "_panY", "_viewScale", "_scrollTop", "hidden", "_curPage", "_viewType", "_chromeHidden"]); // can play with these fields on someone else's
-
+ if (!MainView.Live) {
+ DocServer.setPlaygroundFields(["x", "y", "dataTransition", "_autoHeight", "_showSidebar", "showSidebar", "_sidebarWidthPercent", "_width", "_height", "width", "height", "_viewTransition", "_panX", "_panY", "_viewScale", "_scrollTop", "hidden", "_curPage", "_viewType", "_chromeHidden", "nativeWidth", "_nativeWidth"]); // can play with these fields on someone else's
+ }
DocServer.GetRefField("rtfProto").then(proto => (proto instanceof Doc) && reaction(() => StrCast(proto.BROADCAST_MESSAGE), msg => msg && alert(msg)));
const tag = document.createElement('script');
@@ -192,7 +193,7 @@ export class MainView extends React.Component {
initEventListeners = () => {
window.addEventListener("drop", e => e.preventDefault(), false); // prevent default behavior of navigating to a new web page
window.addEventListener("dragover", e => e.preventDefault(), false);
- //document.addEventListener("pointermove", action(e => SearchBox.Instance._undoBackground = UndoManager.batchCounter ? "#000000a8" : undefined));
+ // document.addEventListener("pointermove", action(e => SearchBox.Instance._undoBackground = UndoManager.batchCounter ? "#000000a8" : undefined));
document.addEventListener("pointerdown", this.globalPointerDown);
document.addEventListener("click", (e: MouseEvent) => {
if (!e.cancelBubble) {
@@ -242,8 +243,9 @@ export class MainView extends React.Component {
}
getPWidth = () => this._panelWidth - this.propertiesWidth();
- getPHeight = () => this._panelHeight;
+ getPHeight = () => this._panelHeight - (CollectionMenu.Instance?.Pinned ? 35 : 0);
getContentsHeight = () => this._panelHeight;
+ getMenuPanelHeight = () => this._panelHeight + (CollectionMenu.Instance?.Pinned ? 35 : 0);
@computed get mainDocView() {
return <DocumentView key="main"
@@ -275,10 +277,12 @@ export class MainView extends React.Component {
@computed get dockingContent() {
return <div key="docking" className={`mainContent-div${this._flyoutWidth ? "-flyout" : ""}`} onDrop={e => { e.stopPropagation(); e.preventDefault(); }}
+ // style={{ minWidth: `calc(100% - ${this._flyoutWidth + this.menuPanelWidth() + this.propertiesWidth()}px)`, width: `calc(100% - ${this._flyoutWidth + this.propertiesWidth()}px)` }}>
+ // FIXME update with property panel width
style={{
minWidth: `calc(100% - ${this._flyoutWidth + this.menuPanelWidth() + this.propertiesWidth()}px)`,
transform: LightboxView.LightboxDoc ? "scale(0.0001)" : undefined,
- width: `calc(100% - ${this._flyoutWidth + this.menuPanelWidth() + this.propertiesWidth()}px)`
+ //TODO:glr width: `calc(100% - ${this._flyoutWidth + this.menuPanelWidth() + this.propertiesWidth()}px)`
}}>
{!this.mainContainer ? (null) : this.mainDocView}
</div>;
@@ -358,7 +362,7 @@ export class MainView extends React.Component {
removeDocument={returnFalse}
ScreenToLocalTransform={this.sidebarScreenToLocal}
PanelWidth={this.menuPanelWidth}
- PanelHeight={this.getContentsHeight}
+ PanelHeight={this.getMenuPanelHeight}
renderDepth={0}
docViewPath={returnEmptyDoclist}
focus={DocUtils.DefaultFocus}
@@ -397,20 +401,27 @@ export class MainView extends React.Component {
}
@computed get mainInnerContent() {
+ const width = this.propertiesWidth() + this._flyoutWidth + this.menuPanelWidth();
+ const transform = this._flyoutWidth ? 'translate(-28px, 0px)' : undefined;
return <>
{this.menuPanel}
<div key="inner" className={`mainView-innerContent${this.darkScheme ? "-dark" : ""}`}>
{this.flyout}
- <div className="mainView-libraryHandle" style={{ display: !this._flyoutWidth ? "none" : undefined, }} onPointerDown={this.onFlyoutPointerDown} >
+ <div className="mainView-libraryHandle" style={{ display: !this._flyoutWidth ? "none" : undefined }} onPointerDown={this.onFlyoutPointerDown} >
<FontAwesomeIcon icon="chevron-left" color={this.darkScheme ? "white" : "black"} style={{ opacity: "50%" }} size="sm" />
</div>
+ <div className="mainView-innerContainer" style={{ width: `calc(100% - ${width}px)`, transform: transform }}>
+ <CollectionMenu />
- {this.dockingContent}
+ {this.dockingContent}
- <div className="mainView-propertiesDragger" key="props" onPointerDown={this.onPropertiesPointerDown} style={{ right: this.propertiesWidth() - 1 }}>
- <FontAwesomeIcon icon={this.propertiesWidth() < 10 ? "chevron-left" : "chevron-right"} color={this.darkScheme ? "white" : "black"} size="sm" />
+ <div className="mainView-propertiesDragger" key="props" onPointerDown={this.onPropertiesPointerDown} style={{ right: this._flyoutWidth ? 0 : this.propertiesWidth() - 1 }}>
+ <FontAwesomeIcon icon={this.propertiesWidth() < 10 ? "chevron-left" : "chevron-right"} color={this.darkScheme ? Colors.WHITE : Colors.BLACK} size="sm" />
+ </div>
+ <div className="properties-container">
+ {this.propertiesWidth() < 10 ? (null) : <PropertiesView styleProvider={DefaultStyleProvider} width={this.propertiesWidth()} height={this.getContentsHeight()} />}
+ </div>
</div>
- {this.propertiesWidth() < 10 ? (null) : <PropertiesView styleProvider={DefaultStyleProvider} width={this.propertiesWidth()} height={this.getContentsHeight()} />}
</div>
</>;
}
@@ -519,6 +530,13 @@ export class MainView extends React.Component {
</svg>;
}
+ @computed get topbar() {
+ TraceMobx();
+ return <div className="mainView-topbar">
+ <TopBar />
+ </div>;
+ }
+
@computed get invisibleWebBox() { // see note under the makeLink method in HypothesisUtils.ts
return !DocumentLinksButton.invisibleWebDoc ? null :
<div className="mainView-invisibleWebRef" ref={DocumentLinksButton.invisibleWebRef}>
@@ -566,8 +584,7 @@ export class MainView extends React.Component {
<GroupManager />
<GoogleAuthenticationManager />
<DocumentDecorations boundsLeft={this.leftOffset} boundsTop={this.topOffset} />
- {/*this.search*/}
- <CollectionMenu />
+ {this.topbar}
{LinkDescriptionPopup.descriptionPopup ? <LinkDescriptionPopup /> : null}
{DocumentLinksButton.LinkEditorDocView ? <LinkMenu docView={DocumentLinksButton.LinkEditorDocView} changeFlyout={emptyFunction} /> : (null)}
{LinkDocPreview.LinkInfo ? <LinkDocPreview {...LinkDocPreview.LinkInfo} /> : (null)}
@@ -585,7 +602,7 @@ export class MainView extends React.Component {
{this.snapLines}
<div className="mainView-webRef" ref={this.makeWebRef} />
<LightboxView PanelWidth={this._windowWidth} PanelHeight={this._windowHeight} maxBorder={[200, 50]} />
- </div>);
+ </div >);
}
makeWebRef = (ele: HTMLDivElement) => {
diff --git a/src/client/views/MarqueeAnnotator.tsx b/src/client/views/MarqueeAnnotator.tsx
index d2074d653..805cda95c 100644
--- a/src/client/views/MarqueeAnnotator.tsx
+++ b/src/client/views/MarqueeAnnotator.tsx
@@ -65,10 +65,9 @@ export class MarqueeAnnotator extends React.Component<MarqueeAnnotatorProps> {
doc.addEventListener("pointermove", this.onSelectMove);
doc.addEventListener("pointerup", this.onSelectEnd);
- AnchorMenu.Instance.OnClick = (e: PointerEvent) => {
- this.props.anchorMenuClick?.()?.(this.highlight("rgba(173, 216, 230, 0.75)", true));
- };
+ AnchorMenu.Instance.OnClick = (e: PointerEvent) => this.props.anchorMenuClick?.()?.(this.highlight("rgba(173, 216, 230, 0.75)", true));
AnchorMenu.Instance.Highlight = this.highlight;
+ AnchorMenu.Instance.GetAnchor = (savedAnnotations?: ObservableMap<number, HTMLDivElement[]>) => this.highlight("rgba(173, 216, 230, 0.75)", true, savedAnnotations);
/**
* This function is used by the AnchorMenu to create an anchor highlight and a new linked text annotation.
* It also initiates a Drag/Drop interaction to place the text annotation.
@@ -103,11 +102,13 @@ export class MarqueeAnnotator extends React.Component<MarqueeAnnotatorProps> {
@undoBatch
@action
- makeAnnotationDocument = (color: string, isLinkButton?: boolean): Opt<Doc> => {
- if (this.props.savedAnnotations.size === 0) return undefined;
- if ((Array.from(this.props.savedAnnotations.values())[0][0] as any).marqueeing) {
+ makeAnnotationDocument = (color: string, isLinkButton?: boolean, savedAnnotations?: ObservableMap<number, HTMLDivElement[]>): Opt<Doc> => {
+ const savedAnnoMap = savedAnnotations ?? this.props.savedAnnotations;
+ if (savedAnnoMap.size === 0) return undefined;
+ const savedAnnos = Array.from(savedAnnoMap.values())[0];
+ if (savedAnnos.length && (savedAnnos[0] as any).marqueeing) {
const scale = this.props.scaling?.() || 1;
- const anno = Array.from(this.props.savedAnnotations.values())[0][0];
+ const anno = savedAnnos[0];
const containerOffset = this.props.containerOffset?.() || [0, 0];
const marqueeAnno = Docs.Create.FreeformDocument([], { _isLinkButton: isLinkButton, backgroundColor: color, annotationOn: this.props.rootDoc, title: "Annotation on " + this.props.rootDoc.title });
marqueeAnno.x = (parseInt(anno.style.left || "0") - containerOffset[0]) / scale;
@@ -115,15 +116,17 @@ export class MarqueeAnnotator extends React.Component<MarqueeAnnotatorProps> {
marqueeAnno._height = parseInt(anno.style.height || "0") / scale;
marqueeAnno._width = parseInt(anno.style.width || "0") / scale;
anno.remove();
- this.props.savedAnnotations.clear();
+ savedAnnoMap.clear();
return marqueeAnno;
}
- const textRegionAnno = Docs.Create.HTMLAnchorDocument([], { annotationOn: this.props.rootDoc, title: "Selection on " + this.props.rootDoc.title, _width: 1, _height: 1 });
+ const textRegionAnno = Docs.Create.HTMLAnchorDocument([], { annotationOn: this.props.rootDoc, backgroundColor: "transparent", title: "Selection on " + this.props.rootDoc.title });
+ let minX = Number.MAX_VALUE;
let maxX = -Number.MAX_VALUE;
let minY = Number.MAX_VALUE;
+ let maxY = -Number.MIN_VALUE;
const annoDocs: Doc[] = [];
- this.props.savedAnnotations.forEach((value: HTMLDivElement[], key: number) => value.map(anno => {
+ savedAnnoMap.forEach((value: HTMLDivElement[], key: number) => value.map(anno => {
const textRegion = new Doc();
textRegion.x = parseInt(anno.style.left ?? "0");
textRegion.y = parseInt(anno.style.top ?? "0");
@@ -134,23 +137,27 @@ export class MarqueeAnnotator extends React.Component<MarqueeAnnotatorProps> {
annoDocs.push(textRegion);
anno.remove();
minY = Math.min(NumCast(textRegion.y), minY);
+ minX = Math.min(NumCast(textRegion.x), minX);
+ maxY = Math.max(NumCast(textRegion.y) + NumCast(textRegion._height), maxY);
maxX = Math.max(NumCast(textRegion.x) + NumCast(textRegion._width), maxX);
}));
const textRegionAnnoProto = Doc.GetProto(textRegionAnno);
textRegionAnnoProto.y = Math.max(minY, 0);
- textRegionAnnoProto.x = Math.max(maxX, 0);
+ textRegionAnnoProto.x = Math.max(minX, 0);
+ textRegionAnnoProto.height = Math.max(maxY, 0) - Math.max(minY, 0);
+ textRegionAnnoProto.width = Math.max(maxX, 0) - Math.max(minX, 0);
// mainAnnoDocProto.text = this._selectionText;
textRegionAnnoProto.textInlineAnnotations = new List<Doc>(annoDocs);
- this.props.savedAnnotations.clear();
+ savedAnnoMap.clear();
return textRegionAnno;
}
@action
- highlight = (color: string, isLinkButton: boolean) => {
+ highlight = (color: string, isLinkButton: boolean, savedAnnotations?: ObservableMap<number, HTMLDivElement[]>) => {
// creates annotation documents for current highlights
const effectiveAcl = GetEffectiveAcl(this.props.rootDoc[DataSym]);
- const annotationDoc = [AclAddonly, AclEdit, AclAdmin].includes(effectiveAcl) && this.makeAnnotationDocument(color, isLinkButton);
- annotationDoc && this.props.addDocument(annotationDoc);
+ const annotationDoc = [AclAddonly, AclEdit, AclAdmin].includes(effectiveAcl) && this.makeAnnotationDocument(color, isLinkButton, savedAnnotations);
+ !savedAnnotations && annotationDoc && this.props.addDocument(annotationDoc);
return annotationDoc as Doc ?? undefined;
}
diff --git a/src/client/views/PropertiesButtons.scss b/src/client/views/PropertiesButtons.scss
index 29d2bfcb7..484522bc7 100644
--- a/src/client/views/PropertiesButtons.scss
+++ b/src/client/views/PropertiesButtons.scss
@@ -1,4 +1,4 @@
-@import "globalCssVariables";
+@import "global/globalCssVariables";
$linkGap : 3px;
@@ -7,13 +7,13 @@ $linkGap : 3px;
}
.propertiesButtons-linkButton-empty:hover {
- background: $main-accent;
+ background: $medium-gray;
transform: scale(1.05);
cursor: pointer;
}
.propertiesButtons-linkButton-nonempty:hover {
- background: $main-accent;
+ background: $medium-gray;
transform: scale(1.05);
cursor: pointer;
}
@@ -24,7 +24,7 @@ $linkGap : 3px;
width: 29px;
border-radius: 6px;
pointer-events: auto;
- background-color: #121721;
+ background-color: $dark-gray;
color: #fcfbf7;
text-transform: uppercase;
letter-spacing: 2px;
@@ -38,18 +38,18 @@ $linkGap : 3px;
margin-left: 4px;
&:hover {
- background: $main-accent;
+ background: $medium-gray;
transform: scale(1.05);
cursor: pointer;
}
}
.propertiesButtons-linkButton-empty.toggle-on {
background-color: white;
- color: black;
+ color: $dark-gray;
}
.propertiesButtons-linkButton-empty.toggle-hover {
background-color: gray;
- color: black;
+ color: $dark-gray;
}
.propertiesButtons-linkButton-empty.toggle-off {
color: white;
@@ -111,7 +111,7 @@ $linkGap : 3px;
margin-left: 4px;
&:hover {
- background: $main-accent;
+ background: $medium-gray;
transform: scale(1.05);
cursor: pointer;
}
diff --git a/src/client/views/PropertiesView.scss b/src/client/views/PropertiesView.scss
index fa45a065d..321b83f52 100644
--- a/src/client/views/PropertiesView.scss
+++ b/src/client/views/PropertiesView.scss
@@ -1,6 +1,8 @@
+@import "./global/globalCssVariables.scss";
+
.propertiesView {
height: 100%;
- font-family: "Noto Sans";
+ font-family: "Roboto";
cursor: auto;
overflow-x: hidden;
@@ -28,9 +30,7 @@
color: grey;
cursor: pointer;
}
-
}
-
}
.propertiesView-name {
@@ -80,7 +80,6 @@
padding-bottom: 10px;
padding-top: 8px;
}
-
}
.propertiesView-sharing {
@@ -140,8 +139,6 @@
}
}
-
-
.change-buttons {
display: flex;
@@ -216,7 +213,6 @@
}
}
-
.propertiesView-appearance {
//border-bottom: 1px solid black;
//padding: 8.5px;
@@ -305,7 +301,7 @@
.notify-button-icon {
width: 6px;
height: 6.5px;
- margin-left: .5px;
+ margin-left: 0.5px;
}
&:hover {
@@ -331,7 +327,6 @@
}
.propertiesView-sharingTable {
-
// whatever's commented out - add it back in when adding the buttons
// border: 1.5px solid black;
@@ -347,7 +342,6 @@
width: 92%;
.propertiesView-sharingTable-item {
-
display: flex;
// padding: 5px;
padding: 3px;
@@ -421,7 +415,6 @@
cursor: pointer;
}
}
-
}
.propertiesView-fields-checkbox {
@@ -468,7 +461,6 @@
}
.propertiesView-contexts {
-
.propertiesView-contexts-title {
font-weight: bold;
font-size: 12.5px;
@@ -499,11 +491,9 @@
overflow: hidden;
padding: 10px;
}
-
}
.propertiesView-layout {
-
.propertiesView-layout-title {
font-weight: bold;
font-size: 12.5px;
@@ -534,7 +524,6 @@
overflow: hidden;
padding: 10px;
}
-
}
.propertiesView-presTrails {
@@ -576,7 +565,6 @@
}
.inking-button {
-
display: flex;
.inking-button-points {
@@ -635,7 +623,6 @@
}
.inputBox {
-
margin-top: 10px;
display: flex;
height: 19px;
@@ -658,7 +645,6 @@
}
.inputBox-button {
-
.inputBox-button-up {
background-color: #333333;
height: 9px;
@@ -690,7 +676,6 @@
cursor: pointer;
}
}
-
}
}
@@ -767,7 +752,6 @@
}
.widthAndDash {
-
.width {
.width-top {
display: flex;
@@ -792,13 +776,11 @@
}
.arrows {
-
display: flex;
margin-bottom: 3px;
margin-left: 4px;
.arrows-head {
-
display: flex;
margin-right: 35px;
@@ -827,7 +809,6 @@
}
.dashed {
-
display: flex;
margin-left: 64px;
margin-bottom: 6px;
@@ -844,19 +825,15 @@
}
.editable-title {
- border: none;
padding: 6px;
padding-bottom: 2px;
- background: #eeeeee;
- border-top: 1px solid;
- border-left: 1px solid;
+ border: solid 1px $dark-gray;
&:hover {
- border: 0.75px solid rgb(122, 28, 28);
+ border: 0.75px solid $medium-blue;
}
}
-
.properties-flyout {
grid-column: 2/4;
-} \ No newline at end of file
+}
diff --git a/src/client/views/PropertiesView.tsx b/src/client/views/PropertiesView.tsx
index d09d949ff..8136edf04 100644
--- a/src/client/views/PropertiesView.tsx
+++ b/src/client/views/PropertiesView.tsx
@@ -24,7 +24,7 @@ import { EditableView } from "./EditableView";
import { InkStrokeProperties } from "./InkStrokeProperties";
import { DocumentView, StyleProviderFunc } from "./nodes/DocumentView";
import { KeyValueBox } from "./nodes/KeyValueBox";
-import { PresBox } from "./nodes/PresBox";
+import { PresBox } from "./nodes/trails/PresBox";
import { PropertiesButtons } from "./PropertiesButtons";
import { PropertiesDocContextSelector } from "./PropertiesDocContextSelector";
import "./PropertiesView.scss";
@@ -86,7 +86,7 @@ export class PropertiesView extends React.Component<PropertiesViewProps> {
@observable openSlideOptions: boolean = false;
@observable inOptions: boolean = false;
- @observable _controlBtn: boolean = false;
+ @observable _controlButton: boolean = false;
@observable _lock: boolean = false;
componentDidMount() {
@@ -540,7 +540,7 @@ export class PropertiesView extends React.Component<PropertiesViewProps> {
const formatInstance = InkStrokeProperties.Instance;
return !formatInstance ? (null) : <div className="inking-button">
<Tooltip title={<div className="dash-tooltip">{"Edit points"}</div>}>
- <div className="inking-button-points" onPointerDown={action(() => formatInstance._controlBtn = !formatInstance._controlBtn)} style={{ backgroundColor: formatInstance._controlBtn ? "black" : "" }}>
+ <div className="inking-button-points" onPointerDown={action(() => formatInstance._controlButton = !formatInstance._controlButton)} style={{ backgroundColor: formatInstance._controlButton ? "black" : "" }}>
<FontAwesomeIcon icon="bezier-curve" color="white" size="lg" />
</div>
</Tooltip>
diff --git a/src/client/views/SidebarAnnos.tsx b/src/client/views/SidebarAnnos.tsx
index 59ff1c340..f1d168a22 100644
--- a/src/client/views/SidebarAnnos.tsx
+++ b/src/client/views/SidebarAnnos.tsx
@@ -23,6 +23,7 @@ interface ExtraProps {
layoutDoc: Doc;
rootDoc: Doc;
dataDoc: Doc;
+ showSidebar: boolean;
whenChildContentsActiveChanged: (isActive: boolean) => void;
ScreenToLocalTransform: () => Transform;
sidebarAddDocument: (doc: (Doc | Doc[]), suffix: string) => boolean;
@@ -31,18 +32,22 @@ interface ExtraProps {
}
@observer
export class SidebarAnnos extends React.Component<FieldViewProps & ExtraProps> {
+ constructor(props: Readonly<FieldViewProps & ExtraProps>) {
+ super(props);
+ // this.props.dataDoc[this.sidebarKey] = new List<Doc>(); // bcz: can't do this here. it blows away existing things and isn't a robust solution for making sure the field exists -- instead this should happen when the document is created and/or shared
+ }
_stackRef = React.createRef<CollectionStackingView>();
@computed get allHashtags() {
const keys = new Set<string>();
- DocListCast(this.props.rootDoc[this.sidebarKey()]).forEach(doc => SearchBox.documentKeys(doc).forEach(key => keys.add(key)));
+ DocListCast(this.props.rootDoc[this.sidebarKey]).forEach(doc => SearchBox.documentKeys(doc).forEach(key => keys.add(key)));
return Array.from(keys.keys()).filter(key => key[0]).filter(key => !key.startsWith("_") && (key[0] === "#" || key[0] === key[0].toUpperCase())).sort();
}
@computed get allUsers() {
const keys = new Set<string>();
- DocListCast(this.props.rootDoc[this.sidebarKey()]).forEach(doc => keys.add(StrCast(doc.author)));
+ DocListCast(this.props.rootDoc[this.sidebarKey]).forEach(doc => keys.add(StrCast(doc.author)));
return Array.from(keys.keys()).sort();
}
- get filtersKey() { return "_" + this.sidebarKey() + "-docFilters"; }
+ get filtersKey() { return "_" + this.sidebarKey + "-docFilters"; }
anchorMenuClick = (anchor: Doc) => {
const startup = StrListCast(this.props.rootDoc.docFilters).map(filter => filter.split(":")[0]).join(" ");
@@ -59,7 +64,7 @@ export class SidebarAnnos extends React.Component<FieldViewProps & ExtraProps> {
this._stackRef.current?.focusDocument(target);
}
makeDocUnfiltered = (doc: Doc) => {
- if (DocListCast(this.props.rootDoc[this.sidebarKey()]).includes(doc)) {
+ if (DocListCast(this.props.rootDoc[this.sidebarKey]).includes(doc)) {
if (this.props.layoutDoc[this.filtersKey]) {
this.props.layoutDoc[this.filtersKey] = new List<string>();
return true;
@@ -67,36 +72,39 @@ export class SidebarAnnos extends React.Component<FieldViewProps & ExtraProps> {
}
return false;
}
- sidebarKey = () => this.props.fieldKey + "-sidebar";
+
+ get sidebarKey() { return this.props.fieldKey + "-sidebar"; }
filtersHeight = () => 38;
screenToLocalTransform = () => this.props.ScreenToLocalTransform().translate(Doc.NativeWidth(this.props.dataDoc), 0).scale(this.props.scaling?.() || 1);
- panelWidth = () => !this.props.layoutDoc._showSidebar ? 0 : this.props.layoutDoc.type === DocumentType.RTF ? this.props.PanelWidth() : (NumCast(this.props.layoutDoc.nativeWidth) - Doc.NativeWidth(this.props.dataDoc)) * this.props.PanelWidth() / NumCast(this.props.layoutDoc.nativeWidth);
+ panelWidth = () => !this.props.showSidebar ? 0 : this.props.layoutDoc.type === DocumentType.RTF ? this.props.PanelWidth() : (NumCast(this.props.layoutDoc.nativeWidth) - Doc.NativeWidth(this.props.dataDoc)) * this.props.PanelWidth() / NumCast(this.props.layoutDoc.nativeWidth);
panelHeight = () => this.props.PanelHeight() - this.filtersHeight();
- addDocument = (doc: Doc | Doc[]) => this.props.sidebarAddDocument(doc, this.sidebarKey());
- moveDocument = (doc: Doc | Doc[], targetCollection: Doc | undefined, addDocument: (doc: Doc | Doc[]) => boolean) => this.props.moveDocument(doc, targetCollection, addDocument, this.sidebarKey());
- removeDocument = (doc: Doc | Doc[]) => this.props.removeDocument(doc, this.sidebarKey());
+ addDocument = (doc: Doc | Doc[]) => this.props.sidebarAddDocument(doc, this.sidebarKey);
+ moveDocument = (doc: Doc | Doc[], targetCollection: Doc | undefined, addDocument: (doc: Doc | Doc[]) => boolean) => this.props.moveDocument(doc, targetCollection, addDocument, this.sidebarKey);
+ removeDocument = (doc: Doc | Doc[]) => this.props.removeDocument(doc, this.sidebarKey);
docFilters = () => [...StrListCast(this.props.layoutDoc._docFilters), ...StrListCast(this.props.layoutDoc[this.filtersKey])];
sidebarStyleProvider = (doc: Opt<Doc>, props: Opt<FieldViewProps | DocumentViewProps>, property: string) => {
- if (property === StyleProp.ShowTitle) return StrCast(this.props.layoutDoc["sidebar-childShowTitle"], "title");
+ if (property === StyleProp.ShowTitle) {
+ return doc === this.props.rootDoc ? undefined : StrCast(this.props.layoutDoc["sidebar-childShowTitle"], "title");
+ }
return this.props.styleProvider?.(doc, props, property);
}
render() {
const renderTag = (tag: string) => {
const active = StrListCast(this.props.rootDoc[this.filtersKey]).includes(`${tag}:${tag}:check`);
return <div key={tag} className={`sidebarAnnos-filterTag${active ? "-active" : ""}`}
- onClick={e => Doc.setDocFilter(this.props.rootDoc, tag, tag, "check", true, this.sidebarKey(), e.shiftKey)}>
+ onClick={e => Doc.setDocFilter(this.props.rootDoc, tag, tag, "check", true, this.sidebarKey, e.shiftKey)}>
{tag}
</div>;
};
const renderUsers = (user: string) => {
const active = StrListCast(this.props.rootDoc[this.filtersKey]).includes(`author:${user}:check`);
return <div key={user} className={`sidebarAnnos-filterUser${active ? "-active" : ""}`}
- onClick={e => Doc.setDocFilter(this.props.rootDoc, "author", user, "check", true, this.sidebarKey(), e.shiftKey)}>
+ onClick={e => Doc.setDocFilter(this.props.rootDoc, "author", user, "check", true, this.sidebarKey, e.shiftKey)}>
{user}
</div>;
};
- return !this.props.layoutDoc._showSidebar ? (null) :
+ return !this.props.showSidebar ? (null) :
<div style={{
position: "absolute", pointerEvents: this.props.isContentActive() ? "all" : undefined, top: 0, right: 0,
background: this.props.styleProvider?.(this.props.rootDoc, this.props, StyleProp.WidgetColor),
@@ -116,7 +124,8 @@ export class SidebarAnnos extends React.Component<FieldViewProps & ExtraProps> {
PanelWidth={this.panelWidth}
styleProvider={this.sidebarStyleProvider}
docFilters={this.docFilters}
- scaleField={this.sidebarKey() + "-scale"}
+ scaleField={this.sidebarKey + "-scale"}
+ setHeight={(height) => this.props.setHeight(height + this.filtersHeight())}
isAnnotationOverlay={false}
select={emptyFunction}
scaling={returnOne}
@@ -129,7 +138,7 @@ export class SidebarAnnos extends React.Component<FieldViewProps & ExtraProps> {
ScreenToLocalTransform={this.screenToLocalTransform}
renderDepth={this.props.renderDepth + 1}
viewType={CollectionViewType.Stacking}
- fieldKey={this.sidebarKey()}
+ fieldKey={this.sidebarKey}
pointerEvents={"all"}
/>
</div>
diff --git a/src/client/views/StyleProvider.tsx b/src/client/views/StyleProvider.tsx
index e670420d1..c9e532745 100644
--- a/src/client/views/StyleProvider.tsx
+++ b/src/client/views/StyleProvider.tsx
@@ -1,4 +1,5 @@
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome';
+import { Colors } from './global/globalEnums';
import { IconProp } from '@fortawesome/fontawesome-svg-core';
import 'golden-layout/src/css/goldenlayout-base.css';
import 'golden-layout/src/css/goldenlayout-dark-theme.css';
@@ -97,16 +98,16 @@ export function DefaultStyleProvider(doc: Opt<Doc>, props: Opt<DocumentViewProps
case StyleProp.Color:
const docColor: Opt<string> = StrCast(doc?.[fieldKey + "color"], StrCast(doc?._color));
if (docColor) return docColor;
- const backColor = backgroundCol();// || (darkScheme() ? "black" : "white");
+ const backColor = backgroundCol();
if (!backColor) return undefined;
const nonAlphaColor = backColor.startsWith("#") ? (backColor as string).substring(0, 7) :
backColor.startsWith("rgba") ? backColor.replace(/,.[^,]*\)/, ")").replace("rgba", "rgb") : backColor;
const col = Color(nonAlphaColor).rgb();
const colsum = (col.red() + col.green() + col.blue());
- if (colsum / col.alpha() > 400 || col.alpha() < 0.25) return "black";
- return "white";
+ if (colsum / col.alpha() > 400 || col.alpha() < 0.25) return Colors.DARK_GRAY;
+ return Colors.WHITE;
case StyleProp.Hidden: return BoolCast(doc?._hidden);
- case StyleProp.BorderRounding: return StrCast(doc?.[fieldKey + "borderRounding"]);
+ case StyleProp.BorderRounding: return StrCast(doc?.[fieldKey + "borderRounding"], doc?._viewType === CollectionViewType.Pile ? "50%" : "");
case StyleProp.TitleHeight: return 15;
case StyleProp.BorderPath: return comicStyle() && props?.renderDepth ? { path: wavyBorderPath(props?.PanelWidth?.() || 0, props?.PanelHeight?.() || 0), fill: wavyBorderPath(props?.PanelWidth?.() || 0, props?.PanelHeight?.() || 0, .08), width: 3 } : { path: undefined, width: 0 };
case StyleProp.JitterRotation: return comicStyle() ? random(-1, 1, NumCast(doc?.x), NumCast(doc?.y)) * ((props?.PanelWidth() || 0) > (props?.PanelHeight() || 0) ? 5 : 10) : 0;
@@ -114,38 +115,38 @@ export function DefaultStyleProvider(doc: Opt<Doc>, props: Opt<DocumentViewProps
doc?.type === DocumentType.RTF) && showTitle() && !StrCast(doc?.showTitle).includes(":hover") ? 15 : 0;
case StyleProp.BackgroundColor: {
let docColor: Opt<string> = StrCast(doc?.[fieldKey + "backgroundColor"], StrCast(doc?._backgroundColor, isCaption ? "rgba(0,0,0,0.4)" : ""));
- if (MainView.Instance.LastButton === doc) return darkScheme() ? "dimgrey" : "lightgrey";
+ if (MainView.Instance.LastButton === doc) return darkScheme() ? Colors.MEDIUM_GRAY : Colors.LIGHT_GRAY;
switch (doc?.type) {
case DocumentType.PRESELEMENT: docColor = docColor || (darkScheme() ? "" : ""); break;
- case DocumentType.PRES: docColor = docColor || (darkScheme() ? "#3e3e3e" : "white"); break;
- case DocumentType.FONTICON: docColor = docColor || "black"; break;
- case DocumentType.RTF: docColor = docColor || (darkScheme() ? "#2d2d2d" : "#f1efeb"); break;
- case DocumentType.FILTER: docColor = docColor || (darkScheme() ? "#2d2d2d" : "rgba(105, 105, 105, 0.432)"); break;
+ case DocumentType.PRES: docColor = docColor || (darkScheme() ? Colors.DARK_GRAY : Colors.WHITE); break;
+ case DocumentType.FONTICON: docColor = docColor || Colors.DARK_GRAY; break;
+ case DocumentType.RTF: docColor = docColor || (darkScheme() ? Colors.DARK_GRAY : Colors.LIGHT_GRAY); break;
+ case DocumentType.FILTER: docColor = docColor || (darkScheme() ? Colors.DARK_GRAY : "rgba(105, 105, 105, 0.432)"); break;
case DocumentType.INK: docColor = doc?.isInkMask ? "rgba(0,0,0,0.7)" : undefined; break;
case DocumentType.SLIDER: break;
case DocumentType.EQUATION: docColor = docColor || "transparent"; break;
case DocumentType.LABEL: docColor = docColor || (doc.annotationOn !== undefined ? "rgba(128, 128, 128, 0.18)" : undefined); break;
- case DocumentType.BUTTON: docColor = docColor || (darkScheme() ? "#2d2d2d" : "lightgray"); break;
- case DocumentType.LINKANCHOR: docColor = isAnchor ? "lightblue" : "transparent"; break;
- case DocumentType.LINK: docColor = docColor || "transparent"; break;
+ case DocumentType.BUTTON: docColor = docColor || (darkScheme() ? Colors.DARK_GRAY : Colors.LIGHT_GRAY); break;
+ case DocumentType.LINKANCHOR: docColor = isAnchor ? Colors.LIGHT_BLUE : "transparent"; break;
+ case DocumentType.LINK: docColor = (isAnchor ? docColor : "") || "transparent"; break;
case DocumentType.IMG:
case DocumentType.WEB:
case DocumentType.PDF:
case DocumentType.SCREENSHOT:
- case DocumentType.VID: docColor = docColor || (darkScheme() ? "#2d2d2d" : "lightgray"); break;
+ case DocumentType.VID: docColor = docColor || (darkScheme() ? Colors.DARK_GRAY : Colors.LIGHT_GRAY); break;
case DocumentType.COL:
if (StrCast(Doc.LayoutField(doc)).includes("SliderBox")) break;
- docColor = docColor ? docColor :
- doc?._isGroup ? "#00000004" : // very faint highlight to show bounds of group
- (Doc.IsSystem(doc) ? (darkScheme() ? "rgb(62,62,62)" : "lightgrey") : // system docs (seen in treeView) get a grayish background
+ docColor = docColor ||
+ (doc?._isGroup ? "#00000004" : // very faint highlight to show bounds of group
+ (doc?._viewType === CollectionViewType.Pile || Doc.IsSystem(doc) ? (darkScheme() ? Colors.DARK_GRAY : Colors.LIGHT_GRAY) : // system docs (seen in treeView) get a grayish background
isBackground() ? "cyan" : // ?? is there a good default for a background collection
doc.annotationOn ? "#00000015" : // faint interior for collections on PDFs, images, etc
StrCast((props?.renderDepth || 0) > 0 ?
Doc.UserDoc().activeCollectionNestedBackground :
- Doc.UserDoc().activeCollectionBackground));
+ Doc.UserDoc().activeCollectionBackground)));
break;
//if (doc._viewType !== CollectionViewType.Freeform && doc._viewType !== CollectionViewType.Time) return "rgb(62,62,62)";
- default: docColor = docColor || (darkScheme() ? "black" : "white"); break;
+ default: docColor = docColor || (darkScheme() ? Colors.DARK_GRAY : Colors.WHITE); break;
}
if (docColor && (!doc || props?.layerProvider?.(doc) === false)) docColor = Color(docColor.toLowerCase()).fade(0.5).toString();
return docColor;
@@ -158,8 +159,9 @@ export function DefaultStyleProvider(doc: Opt<Doc>, props: Opt<DocumentViewProps
switch (doc?.type) {
case DocumentType.COL:
return StrCast(doc?.boxShadow,
- isBackground() || doc?._isGroup || docProps?.LayoutTemplateString ? undefined : // groups have no drop shadow -- they're supposed to be "invisible". LayoutString's imply collection is being rendered as something else (e.g., title of a Slide)
- `${darkScheme() ? "rgb(30, 32, 31) " : "#9c9396 "} ${StrCast(doc.boxShadow, "0.2vw 0.2vw 0.8vw")}`);
+ doc?._viewType === CollectionViewType.Pile ? "4px 4px 10px 2px" :
+ isBackground() || doc?._isGroup || docProps?.LayoutTemplateString ? undefined : // groups have no drop shadow -- they're supposed to be "invisible". LayoutString's imply collection is being rendered as something else (e.g., title of a Slide)
+ `${darkScheme() ? Colors.DARK_GRAY : Colors.MEDIUM_GRAY} ${StrCast(doc.boxShadow, "0.2vw 0.2vw 0.8vw")}`);
case DocumentType.LABEL:
if (doc?.annotationOn !== undefined) return "black 2px 2px 1px";
@@ -172,6 +174,7 @@ export function DefaultStyleProvider(doc: Opt<Doc>, props: Opt<DocumentViewProps
}
}
case StyleProp.PointerEvents:
+ if (doc?.type === DocumentType.MARKER) return "none";
if (props?.pointerEvents === "none") return "none";
const layer = doc && props?.layerProvider?.(doc);
if (opacity() === 0 || (doc?.type === DocumentType.INK && !docProps?.treeViewDoc) || doc?.isInkMask) return "none";
diff --git a/src/client/views/TemplateMenu.scss b/src/client/views/TemplateMenu.scss
index bbed8cd96..f81cbdaab 100644
--- a/src/client/views/TemplateMenu.scss
+++ b/src/client/views/TemplateMenu.scss
@@ -1,4 +1,4 @@
-@import "globalCssVariables";
+@import "global/globalCssVariables";
.templating-menu {
position: absolute;
pointer-events: auto;
@@ -24,7 +24,7 @@
cursor: pointer;
&:hover {
- background: $main-accent;
+ background: $medium-gray;
transform: scale(1.05);
}
}
@@ -32,7 +32,7 @@
.template-list {
font-family: $sans-serif;
font-size: 12px;
- background-color: $light-color-secondary;
+ background-color: $light-gray;
padding: 2px 12px;
list-style: none;
position: relative;
diff --git a/src/client/views/_nodeModuleOverrides.scss b/src/client/views/_nodeModuleOverrides.scss
index b8a7db034..fd0ac9d5c 100644
--- a/src/client/views/_nodeModuleOverrides.scss
+++ b/src/client/views/_nodeModuleOverrides.scss
@@ -1,8 +1,50 @@
+@import "./global/globalCssVariables";
// this file is for overriding all the css from installed node modules
// goldenlayout stuff
div .lm_header {
- background: $dark-color;
+ background: $dark-gray;
+ overflow: hidden;
+ height: 27px !important;
+}
+
+/* Width */
+.lm_header::-webkit-scrollbar {
+ -webkit-appearance: none;
+ display: none;
+}
+
+/* Width */
+.lm_header:hover::-webkit-scrollbar {
+ -webkit-appearance: none;
+ display: block;
+ height: 0px;
+}
+
+/* Track */
+.lm_header:hover::-webkit-scrollbar-track {
+ -webkit-appearance: none;
+ display: none;
+}
+
+/* Handle */
+.lm_header:hover::-webkit-scrollbar-thumb {
+ -webkit-appearance: none;
+ background: $dark-gray;
+}
+
+/* Handle on hover */
+.lm_header:hover::-webkit-scrollbar-thumb:hover {
+ -webkit-appearance: none;
+ background: $dark-gray;
+}
+
+.lm_tabs {
+ display: flex;
+ position: absolute;
+ width: calc(100% - 60px);
+ overflow: scroll;
+ background: $dark-gray;
}
.lm_tab {
@@ -15,7 +57,14 @@ div .lm_header {
}
.lm_header .lm_controls {
- right: 1em !important;
+ align-items: center;
+ position: absolute;
+ background-color: $dark-gray;
+ border-radius: 5px;
+ display: flex;
+ justify-content: space-evenly;
+ height: 23px;
+ width: 65px;
}
// @TODO the ril__navgiation buttons in the img gallery are a lil messed up but I can't figure out
diff --git a/src/client/views/animationtimeline/Keyframe.scss b/src/client/views/animationtimeline/Keyframe.scss
index 84c8de287..38eb103c6 100644
--- a/src/client/views/animationtimeline/Keyframe.scss
+++ b/src/client/views/animationtimeline/Keyframe.scss
@@ -1,4 +1,4 @@
-@import "./../globalCssVariables.scss";
+@import "./../global/globalCssVariables.scss";
$timelineColor: #9acedf;
@@ -15,11 +15,11 @@ $timelineDark: #77a1aa;
height: 200px;
top: 50%;
position: relative;
- background-color: $light-color;
+ background-color: $white;
.menutable {
tr:nth-child(odd) {
- background-color: $light-color-secondary;
+ background-color: $light-gray;
}
}
}
@@ -67,7 +67,7 @@ $timelineDark: #77a1aa;
height: 100%;
position: absolute;
pointer-events: none;
- background: linear-gradient(to left, $timelineColor 10%, $light-color);
+ background: linear-gradient(to left, $timelineColor 10%, $white);
}
.fadeRight {
@@ -75,7 +75,7 @@ $timelineDark: #77a1aa;
height: 100%;
position: absolute;
pointer-events: none;
- background: linear-gradient(to right, $timelineColor 10%, $light-color);
+ background: linear-gradient(to right, $timelineColor 10%, $white);
}
.divider {
diff --git a/src/client/views/animationtimeline/Keyframe.tsx b/src/client/views/animationtimeline/Keyframe.tsx
index e84022366..82b0218bf 100644
--- a/src/client/views/animationtimeline/Keyframe.tsx
+++ b/src/client/views/animationtimeline/Keyframe.tsx
@@ -1,7 +1,7 @@
import * as React from "react";
import "./Keyframe.scss";
import "./Timeline.scss";
-import "../globalCssVariables.scss";
+import "../global/globalCssVariables.scss";
import { observer } from "mobx-react";
import { observable, reaction, action, IReactionDisposer, observe, computed, runInAction, trace } from "mobx";
import { Doc, DocListCast, DocListCastAsync, Opt } from "../../../fields/Doc";
diff --git a/src/client/views/animationtimeline/Timeline.scss b/src/client/views/animationtimeline/Timeline.scss
index f90249771..48422b789 100644
--- a/src/client/views/animationtimeline/Timeline.scss
+++ b/src/client/views/animationtimeline/Timeline.scss
@@ -1,4 +1,4 @@
-@import "./../globalCssVariables.scss";
+@import "./../global/globalCssVariables.scss";
$timelineColor: #9acedf;
$timelineDark: #77a1aa;
@@ -161,7 +161,7 @@ $timelineDark: #77a1aa;
width: 100%;
height: 300px;
position: absolute;
- background-color: $light-color-secondary;
+ background-color: $light-gray;
border-bottom: 2px solid $timelineDark;
transition: transform 500ms ease;
@@ -251,7 +251,7 @@ $timelineDark: #77a1aa;
top: 0px;
width: 100px;
height: 30%;
- border: 1px solid $dark-color;
+ border: 1px solid $dark-gray;
font-size: 12px;
line-height: 11px;
background-color: $timelineDark;
diff --git a/src/client/views/animationtimeline/TimelineMenu.scss b/src/client/views/animationtimeline/TimelineMenu.scss
index 7ee0a43d5..43a89419e 100644
--- a/src/client/views/animationtimeline/TimelineMenu.scss
+++ b/src/client/views/animationtimeline/TimelineMenu.scss
@@ -1,10 +1,10 @@
-@import "./../globalCssVariables.scss";
+@import "./../global/globalCssVariables.scss";
.timeline-menu-container{
position: absolute;
display: flex;
- box-shadow: $intermediate-color 0.2vw 0.2vw 0.4vw;
+ box-shadow: $medium-gray 0.2vw 0.2vw 0.4vw;
flex-direction: column;
background: whitesmoke;
z-index: 10000;
@@ -39,7 +39,7 @@
border-top-left-radius: 15px;
border-top-right-radius: 15px;
text-transform: uppercase;
- background: $dark-color;
+ background: $dark-gray;
letter-spacing: 2px;
.timeline-menu-header-desc{
@@ -79,10 +79,10 @@
.timeline-menu-item:hover {
border-width: .11px;
border-style: none;
- border-color: $intermediate-color;
+ border-color: $medium-gray;
border-bottom-style: solid;
border-top-style: solid;
- background: $darker-alt-accent;
+ background: $medium-blue;
}
.timeline-menu-desc {
diff --git a/src/client/views/animationtimeline/TimelineOverview.scss b/src/client/views/animationtimeline/TimelineOverview.scss
index 283163ea7..c8d96c399 100644
--- a/src/client/views/animationtimeline/TimelineOverview.scss
+++ b/src/client/views/animationtimeline/TimelineOverview.scss
@@ -1,4 +1,4 @@
-@import "./../globalCssVariables.scss";
+@import "./../global/globalCssVariables.scss";
$timelineColor: #9acedf;
$timelineDark: #77a1aa;
diff --git a/src/client/views/animationtimeline/Track.scss b/src/client/views/animationtimeline/Track.scss
index aec587a79..f45e0556d 100644
--- a/src/client/views/animationtimeline/Track.scss
+++ b/src/client/views/animationtimeline/Track.scss
@@ -1,4 +1,4 @@
-@import "./../globalCssVariables.scss";
+@import "./../global/globalCssVariables.scss";
.track-container {
@@ -6,8 +6,8 @@
.inner {
top: 0px;
width: calc(100%);
- background-color: $light-color;
- border: 1px solid $dark-color;
+ background-color: $white;
+ border: 1px solid $dark-gray;
position: relative;
z-index: 100;
}
diff --git a/src/client/views/collections/CollectionDockingView.scss b/src/client/views/collections/CollectionDockingView.scss
index f4736eb29..77e7b86ea 100644
--- a/src/client/views/collections/CollectionDockingView.scss
+++ b/src/client/views/collections/CollectionDockingView.scss
@@ -1,40 +1,46 @@
-@import "../../views/globalCssVariables.scss";
+@import "../global/globalCssVariables.scss";
.lm_title {
- margin-top: 3px;
- border-radius: 5px;
- border: solid 0px dimgray;
- border-width: 2px 2px 0px;
- height: 20px;
- transform: translate(0px, -3px);
+ -webkit-appearance: none;
+ display: inline-block;
+ align-self: center;
+ align-items: center;
+ height: 100%;
+ overflow: hidden;
+ text-overflow: ellipsis;
+ background: transparent;
+ border: solid 0px transparent;
cursor: grab;
+ color: $black;
}
.lm_title.focus-visible {
+ -webkit-appearance: none;
cursor: text;
}
.lm_title_wrap {
overflow: hidden;
- height: 19px;
- margin-top: -2px;
- display: inline-block;
+ align-items: center;
+ align-self: center;
+ background: transparent;
+ width: max-content;
+ height: 100%;
+ display: flex;
}
.lm_active .lm_title {
- border: solid 1px lightgray;
-}
-
-.lm_header .lm_tab .lm_close_tab {
- position: absolute;
- text-align: center;
+ -webkit-appearance: none;
+ // font-weight: 700;
}
.lm_header .lm_tab {
- padding-right: 20px;
- margin-top: -1px;
- border-bottom: 1px black;
+ padding: 0px;
+ opacity: 0.7;
+ box-shadow: none;
+ height: 24px;
+ // border-bottom: 1px black;
.collectionDockingView-gear {
display: none;
@@ -42,9 +48,13 @@
}
.lm_header .lm_tab.lm_active {
- padding-right: 20px;
- margin-top: 1px;
- border-bottom: unset;
+ padding: 0;
+ opacity: 1;
+ margin: 0;
+ box-shadow: none;
+ height: 27px;
+ margin-right: 2px;
+ // border-bottom: unset;
.collectionDockingView-gear {
display: inline-block;
@@ -55,6 +65,41 @@
display: inline;
}
+.lm_drag_tab {
+ padding: 0;
+ width: 15px !important;
+ height: 15px !important;
+ position: relative !important;
+ display: inline-flex !important;
+ align-items: center;
+ top: 0 !important;
+ right: unset !important;
+ left: 0 !important;
+}
+
+.lm_close_tab {
+ padding: 0;
+ align-self: center;
+ margin-right: 5px;
+ background-color: black;
+ border-radius: 3px;
+ opacity: 1 !important;
+ width: 15px !important;
+ height: 15px !important;
+ position: relative !important;
+ display: inline-flex !important;
+ align-items: center;
+ top: 0 !important;
+ right: unset !important;
+ left: 0 !important;
+}
+
+.lm_tab,
+.lm_tab_active {
+ display: flex !important;
+ padding-right: 0 !important;
+}
+
.collectiondockingview-container {
width: 100%;
height: 100%;
@@ -82,16 +127,17 @@
}
.lm_content {
- background: white;
+ background: $white;
}
.lm_controls>li {
- opacity: 0.6;
- transform: scale(1.2);
+ opacity: 1;
+ transform: scale(1);
}
.lm_controls .lm_popout {
- background-image: url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAABUAAAAUCAAAAABHICnvAAAABGdBTUEAALGPC/xhBQAAACBjSFJNAAB6JgAAgIQAAPoAAACA6AAAdTAAAOpgAAA6mAAAF3CculE8AAAAAmJLR0QAAKqNIzIAAAAHdElNRQfkCBsXMgbrEyzaAAAAT0lEQVQY02NgIAcIu8tgEW3/u4IDQ5B14/8LQlhFhckVFfCJjIyIOfP/QWpEZGSQJFS05s9fIPj3/z+YmseCTxS7CZS7DI+PsYcOjpAkDAA6H0KZxzDzlgAAACV0RVh0ZGF0ZTpjcmVhdGUAMjAyMC0wOC0yN1QyMzo1MDowNi0wNDowMDvgVpQAAAAldEVYdGRhdGU6bW9kaWZ5ADIwMjAtMDgtMjdUMjM6NTA6MDYtMDQ6MDBKve4oAAAAAElFTkSuQmCC)
+ transform: rotate(45deg);
+ background-image: url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAAkAAAAJCAYAAADgkQYQAAAAQUlEQVR4nHXOQQ4AMAgCQeT/f6aXpsGK3jSTuCVJAAr7iBdoAwCKd0nwfaAdHbYERw5b44+E8JoBjEYGMBq5gAYP3usUDu2IvoUAAAAASUVORK5CYII=);
}
.lm_maximised .lm_controls .lm_maximise {
@@ -110,7 +156,7 @@
}
.flexlayout__splitter {
- background-color: black;
+ background-color: $dark-gray;
}
.flexlayout__splitter:hover {
@@ -179,7 +225,7 @@
position: absolute;
box-sizing: border-box;
background-color: #222;
- color: black;
+ color: $dark-gray;
}
.flexlayout__tab_button {
@@ -268,7 +314,7 @@
}
.flexlayout__tab_header_outer {
- background-color: black;
+ background-color: $dark-gray;
position: absolute;
left: 0;
right: 0;
@@ -311,8 +357,6 @@
background: transparent url("../../../../node_modules/flexlayout-react/images/restore.png") no-repeat center;
}
- .flexlayout__popup_menu {}
-
.flexlayout__popup_menu_item {
padding: 2px 10px 2px 10px;
color: #ddd;
@@ -332,28 +376,28 @@
}
.flexlayout__border_top {
- background-color: black;
+ background-color: $dark-gray;
border-bottom: 1px solid #ddd;
box-sizing: border-box;
overflow: hidden;
}
.flexlayout__border_bottom {
- background-color: black;
+ background-color: $dark-gray;
border-top: 1px solid #333;
box-sizing: border-box;
overflow: hidden;
}
.flexlayout__border_left {
- background-color: black;
+ background-color: $dark-gray;
border-right: 1px solid #333;
box-sizing: border-box;
overflow: hidden;
}
.flexlayout__border_right {
- background-color: black;
+ background-color: $dark-gray;
border-left: 1px solid #333;
box-sizing: border-box;
overflow: hidden;
diff --git a/src/client/views/collections/CollectionDockingView.tsx b/src/client/views/collections/CollectionDockingView.tsx
index 388f9a909..c0d39b2a2 100644
--- a/src/client/views/collections/CollectionDockingView.tsx
+++ b/src/client/views/collections/CollectionDockingView.tsx
@@ -4,7 +4,7 @@ import { action, IReactionDisposer, observable, reaction, runInAction } from "mo
import { observer } from "mobx-react";
import * as ReactDOM from 'react-dom';
import * as GoldenLayout from "../../../client/goldenLayout";
-import { Doc, DocListCast, Opt, DocListCastAsync } from "../../../fields/Doc";
+import { Doc, DocListCast, Opt, DocListCastAsync, DataSym } from "../../../fields/Doc";
import { Id } from '../../../fields/FieldSymbols';
import { InkTool } from '../../../fields/InkField';
import { List } from '../../../fields/List';
@@ -24,6 +24,7 @@ import React = require("react");
import { DocumentType } from '../../documents/DocumentTypes';
import { listSpec } from '../../../fields/Schema';
import { LightboxView } from '../LightboxView';
+import { inheritParentAcls } from '../../../fields/util';
const _global = (window /* browser */ || global /* node */) as any;
@observer
@@ -160,6 +161,18 @@ export class CollectionDockingView extends CollectionSubView(doc => doc) {
}
const instance = CollectionDockingView.Instance;
if (!instance) return false;
+ else {
+ const docList = DocListCast(instance.props.Document[DataSym]["data-all"]);
+ // adds the doc of the newly created tab to the data-all field if it doesn't already include that doc or one of its aliases
+ !docList.includes(document) && !docList.includes(document.aliasOf as Doc) && Doc.AddDocToList(instance.props.Document[DataSym], "data-all", document);
+ // adds an alias of the doc to the data-all field of the layoutdocs of the aliases
+ DocListCast(instance.props.Document[DataSym].aliases).forEach(alias => {
+ const aliasDocList = DocListCast(alias["data-all"]);
+ // if aliasDocList contains the alias, don't do anything
+ // otherwise add the original or an alias depending on whether the doc you're looking at is the current doc or a different alias
+ !DocListCast(document.aliases).some(a => aliasDocList.includes(a)) && Doc.AddDocToList(alias, "data-all", alias !== instance.props.Document ? Doc.MakeAlias(document) : document);
+ });
+ }
const docContentConfig = CollectionDockingView.makeDocumentConfig(document, panelName);
if (!pullSide && stack) {
@@ -381,15 +394,22 @@ export class CollectionDockingView extends CollectionSubView(doc => doc) {
setTimeout(async () => {
const sublists = await DocListCastAsync(this.props.Document[this.props.fieldKey]);
const tabs = sublists && Cast(sublists[0], Doc, null);
- const other = sublists && Cast(sublists[1], Doc, null);
+ // const other = sublists && Cast(sublists[1], Doc, null);
const tabdocs = await DocListCastAsync(tabs?.data);
- const otherdocs = await DocListCastAsync(other?.data);
- tabs && (Doc.GetProto(tabs).data = new List<Doc>(docs));
- const otherSet = new Set<Doc>();
- otherdocs?.filter(doc => !docs.includes(doc)).forEach(doc => otherSet.add(doc));
- tabdocs?.filter(doc => !docs.includes(doc) && doc.type !== DocumentType.KVP).forEach(doc => otherSet.add(doc));
- const vals = Array.from(otherSet.values()).filter(val => val instanceof Doc).map(d => d).filter(d => d.type !== DocumentType.KVP);
- other && (Doc.GetProto(other).data = new List<Doc>(vals));
+ // const otherdocs = await DocListCastAsync(other?.data);
+ if (tabs) {
+ tabs.data = new List<Doc>(docs);
+ // DocListCast(tabs.aliases).forEach(tab => tab !== tabs && (tab.data = new List<Doc>(docs)));
+ }
+ // const otherSet = new Set<Doc>();
+ // otherdocs?.filter(doc => !docs.includes(doc)).forEach(doc => otherSet.add(doc));
+ // tabdocs?.filter(doc => !docs.includes(doc) && doc.type !== DocumentType.KVP).forEach(doc => otherSet.add(doc));
+ // const vals = Array.from(otherSet.values()).filter(val => val instanceof Doc).map(d => d).filter(d => d.type !== DocumentType.KVP);
+ // this.props.Document[DataSym][this.props.fieldKey + "-all"] = new List<Doc>([...docs, ...vals]);
+ // if (other) {
+ // other.data = new List<Doc>(vals);
+ // // DocListCast(other.aliases).forEach(tab => tab !== other && (tab.data = new List<Doc>(vals)));
+ // }
}, 0);
}
@@ -399,7 +419,7 @@ export class CollectionDockingView extends CollectionSubView(doc => doc) {
tab.reactComponents?.forEach((ele: any) => ReactDOM.unmountComponentAtNode(ele));
}
tabCreated = (tab: any) => {
- tab.contentItem.element[0]?.firstChild?.firstChild?.InitTab?.(tab); // have to explicitly initialize tabs that reuse contents from previous abs (ie, when dragging a tab around a new tab is created for the old content)
+ tab.contentItem.element[0]?.firstChild?.firstChild?.InitTab?.(tab); // have to explicitly initialize tabs that reuse contents from previous tabs (ie, when dragging a tab around a new tab is created for the old content)
}
stackCreated = (stack: any) => {
@@ -407,9 +427,11 @@ export class CollectionDockingView extends CollectionSubView(doc => doc) {
if (e.target === stack.header?.element[0] && e.button === 2) {
const emptyPane = CurrentUserUtils.EmptyPane;
emptyPane["dragFactory-count"] = NumCast(emptyPane["dragFactory-count"]) + 1;
- CollectionDockingView.AddSplit(Docs.Create.FreeformDocument([], {
- _width: this.props.PanelWidth(), _height: this.props.PanelHeight(), _fitWidth: true, title: `Untitled Tab ${NumCast(emptyPane["dragFactory-count"])}`
- }), "", stack);
+ const docToAdd = Docs.Create.FreeformDocument([], {
+ _width: this.props.PanelWidth(), _height: this.props.PanelHeight(), _fitWidth: true, title: `Untitled Tab ${NumCast(emptyPane["dragFactory-count"])}`,
+ });
+ this.props.Document.isShared && inheritParentAcls(this.props.Document, docToAdd);
+ CollectionDockingView.AddSplit(docToAdd, "", stack);
}
});
@@ -430,9 +452,11 @@ export class CollectionDockingView extends CollectionSubView(doc => doc) {
// stack.config.fixed = !stack.config.fixed; // force the stack to have a fixed size
const emptyPane = CurrentUserUtils.EmptyPane;
emptyPane["dragFactory-count"] = NumCast(emptyPane["dragFactory-count"]) + 1;
- CollectionDockingView.AddSplit(Docs.Create.FreeformDocument([], {
+ const docToAdd = Docs.Create.FreeformDocument([], {
_width: this.props.PanelWidth(), _height: this.props.PanelHeight(), _fitWidth: true, title: `Untitled Tab ${NumCast(emptyPane["dragFactory-count"])}`
- }), "", stack);
+ });
+ this.props.Document.isShared && inheritParentAcls(this.props.Document, docToAdd);
+ CollectionDockingView.AddSplit(docToAdd, "", stack);
}));
}
@@ -445,4 +469,4 @@ Scripting.addGlobal(function openInLightbox(doc: any) { LightboxView.AddDocTab(d
"opens up document in a lightbox", "(doc: any)");
Scripting.addGlobal(function openOnRight(doc: any) { return CollectionDockingView.AddSplit(doc, "right"); },
"opens up document in tab on right side of the screen", "(doc: any)");
-Scripting.addGlobal(function useRightSplit(doc: any, shiftKey?: boolean) { CollectionDockingView.ReplaceTab(doc, "right", undefined, shiftKey); });
+Scripting.addGlobal(function useRightSplit(doc: any, shiftKey?: boolean) { CollectionDockingView.ReplaceTab(doc, "right", undefined, shiftKey); }); \ No newline at end of file
diff --git a/src/client/views/collections/CollectionLinearView.scss b/src/client/views/collections/CollectionLinearView.scss
index ca72b98a5..46e40489b 100644
--- a/src/client/views/collections/CollectionLinearView.scss
+++ b/src/client/views/collections/CollectionLinearView.scss
@@ -1,4 +1,4 @@
-@import "../globalCssVariables";
+@import "../global/globalCssVariables";
@import "../_nodeModuleOverrides";
.collectionLinearView-outer {
@@ -12,59 +12,65 @@
align-items: center;
>span {
- background: $dark-color;
- color: $light-color;
+ background: $dark-gray;
+ color: $white;
border-radius: 18px;
margin-right: 6px;
cursor: pointer;
}
.bottomPopup-background {
- padding-right: 14px;
+ background: $medium-blue;
+ display: flex;
+ border-radius: 10px;
height: 35;
- transform: translate3d(6px, 5px, 0px);
- padding-top: 6.5px;
- padding-bottom: 7px;
- padding-left: 5px;
+ transform: translate3d(6px, 0px, 0px);
+ align-content: center;
+ justify-content: center;
+ align-items: center;
}
.bottomPopup-text {
+ color: $white;
display: inline;
white-space: nowrap;
padding-left: 8px;
- padding-right: 4px;
+ padding-right: 20px;
vertical-align: middle;
font-size: 12.5px;
}
.bottomPopup-descriptions {
+ cursor:pointer;
display: inline;
white-space: nowrap;
padding-left: 8px;
padding-right: 8px;
vertical-align: middle;
- background-color: lightgrey;
- border-radius: 5.5px;
+ background-color: $light-gray;
+ border-radius: 3px;
color: black;
margin-right: 5px;
}
.bottomPopup-exit {
+ cursor:pointer;
display: inline;
white-space: nowrap;
+ margin-right: 10px;
padding-left: 8px;
padding-right: 8px;
vertical-align: middle;
- background-color: lightgrey;
- border-radius: 5.5px;
+ background-color: $close-red;
+ border-radius: 3px;
color: black;
}
>label {
margin-top: "auto";
margin-bottom: "auto";
- background: $dark-color;
- color: $light-color;
+ background: $dark-gray;
+ color: $white;
display: inline-block;
border-radius: 18px;
font-size: 12.5px;
@@ -82,7 +88,7 @@
}
label:hover {
- background: $main-accent;
+ background: $medium-gray;
transform: scale(1.15);
}
diff --git a/src/client/views/collections/CollectionLinearView.tsx b/src/client/views/collections/CollectionLinearView.tsx
index e0b90304b..52c836556 100644
--- a/src/client/views/collections/CollectionLinearView.tsx
+++ b/src/client/views/collections/CollectionLinearView.tsx
@@ -167,24 +167,22 @@ export class CollectionLinearView extends CollectionSubView(LinearDocument) {
})}
</div>
{DocumentLinksButton.StartLink ? <span className="bottomPopup-background" style={{
- background: backgroundColor === color ? "black" : backgroundColor,
pointerEvents: "all"
}}
onPointerDown={e => e.stopPropagation()} >
<span className="bottomPopup-text" >
- Creating link from: {DocumentLinksButton.AnnotationId ? "Annotation in " : " "} {StrCast(DocumentLinksButton.StartLink.title).length < 51 ? DocumentLinksButton.StartLink.title : StrCast(DocumentLinksButton.StartLink.title).slice(0, 50) + '...'}
+ Creating link from: <b>{DocumentLinksButton.AnnotationId ? "Annotation in " : " "} {StrCast(DocumentLinksButton.StartLink.title).length < 51 ? DocumentLinksButton.StartLink.title : StrCast(DocumentLinksButton.StartLink.title).slice(0, 50) + '...'}</b>
</span>
- <Tooltip title={<><div className="dash-tooltip">{LinkDescriptionPopup.showDescriptions ? "Turn off description pop-up" :
- "Turn on description pop-up"} </div></>} placement="top">
+ <Tooltip title={<><div className="dash-tooltip">{"Toggle description pop-up"} </div></>} placement="top">
<span className="bottomPopup-descriptions" onClick={this.changeDescriptionSetting}>
Labels: {LinkDescriptionPopup.showDescriptions ? LinkDescriptionPopup.showDescriptions : "ON"}
</span>
</Tooltip>
- <Tooltip title={<><div className="dash-tooltip">Exit link clicking mode </div></>} placement="top">
+ <Tooltip title={<><div className="dash-tooltip">Exit linking mode</div></>} placement="top">
<span className="bottomPopup-exit" onClick={this.exitLongLinks}>
- Clear
+ Stop
</span>
</Tooltip>
diff --git a/src/client/views/collections/CollectionMenu.scss b/src/client/views/collections/CollectionMenu.scss
index dc5231a3a..f04b19ef7 100644
--- a/src/client/views/collections/CollectionMenu.scss
+++ b/src/client/views/collections/CollectionMenu.scss
@@ -1,5 +1,4 @@
-@import "../globalCssVariables";
-
+@import "../global/globalCssVariables";
.collectionMenu-cont {
position: relative;
@@ -8,8 +7,8 @@
opacity: 0.9;
z-index: 901;
transition: top .5s;
- background: #323232;
- color: white;
+ background: $dark-gray;
+ color: $white;
transform-origin: top left;
top: 0;
width: 100%;
@@ -18,7 +17,7 @@
border-radius: 100%;
width: 18px;
height: 18px;
- border: solid 1px #f5f5f5;
+ border: solid 1px $white;
display: flex;
align-items: center;
justify-content: center;
@@ -28,7 +27,7 @@
border-radius: 100%;
width: 70%;
height: 70%;
- background: white;
+ background: $white;
}
.collectionMenu {
@@ -39,11 +38,11 @@
border: unset;
.collectionMenu-divider {
- height: 85%;
+ height: 100%;
margin-left: 3px;
margin-right: 3px;
- width: 1.5px;
- background-color: #656060;
+ width: 2px;
+ background-color: $medium-gray;
}
.collectionViewBaseChrome {
@@ -51,11 +50,11 @@
align-items: center;
.collectionViewBaseChrome-viewPicker {
- font-size: 75%;
- outline-color: black;
- color: white;
+ font-size: $small-text;
+ outline-color: $black;
+ color: $white;
border: none;
- background: #323232;
+ background: $dark-gray;
}
.collectionViewBaseChrome-viewPicker:focus {
@@ -64,16 +63,16 @@
}
.collectionViewBaseChrome-viewPicker:active {
- outline-color: black;
+ outline-color: $black;
}
.collectionViewBaseChrome-button {
- font-size: 75%;
+ font-size: $small-text;
text-transform: uppercase;
letter-spacing: 2px;
- background: rgb(238, 238, 238);
- color: purple;
- outline-color: black;
+ background: $white;
+ color: $pink;
+ outline-color: $black;
border: none;
padding: 12px 10px 11px 10px;
margin-left: 10px;
@@ -82,11 +81,11 @@
.collectionViewBaseChrome-cmdPicker {
margin-left: 3px;
margin-right: 0px;
- font-size: 75%;
+ font-size: $small-text;
text-transform: capitalize;
- color: white;
+ color: $white;
border: none;
- background: #323232;
+ background: $dark-gray;
}
.collectionViewBaseChrome-cmdPicker:focus {
@@ -105,7 +104,7 @@
overflow: hidden;
.commandEntry-drop {
- color: white;
+ color: $white;
width: 30px;
margin-top: auto;
margin-bottom: auto;
@@ -113,11 +112,11 @@
}
.commandEntry-outerDiv:hover{
- background-color: rgba(0,0,0,0.2);
+ background-color: $drop-shadow;
.collectionViewBaseChrome-viewPicker,
.collectionViewBaseChrome-cmdPicker{
- background: rgb(41,41,41);
+ background: $dark-gray;
}
}
@@ -142,7 +141,7 @@
height: 100%;
display: flex;
background: transparent;
- color: grey;
+ color: $medium-gray;
justify-content: center;
}
@@ -150,31 +149,31 @@
margin-left: 5px;
display: grid;
border: none;
- border-right: solid gray 1px;
+ border-right: solid $medium-gray 1px;
.collectionViewBaseChrome-filterIcon {
position: relative;
display: flex;
margin: auto;
- background: #323232;
- color: white;
+ background: $dark-gray;
+ color: $white;
width: 30px;
height: 30px;
align-items: center;
justify-content: center;
border: none;
- border-right: solid gray 1px;
+ border-right: solid $medium-gray 1px;
}
.collectionViewBaseChrome-viewSpecsInput {
padding: 12px 10px 11px 10px;
border: 0px;
- color: grey;
+ color: $medium-gray;
text-align: center;
letter-spacing: 2px;
- outline-color: black;
- font-size: 75%;
- background: rgb(238, 238, 238);
+ outline-color: $black;
+ font-size: $small-text;
+ background: $white;
height: 100%;
width: 75px;
}
@@ -187,8 +186,8 @@
z-index: 100;
display: flex;
flex-direction: column;
- background: rgb(238, 238, 238);
- box-shadow: grey 2px 2px 4px;
+ background: $white;
+ box-shadow: $medium-gray 2px 2px 4px;
.qs-datepicker {
left: unset;
@@ -204,13 +203,13 @@
.collectionViewBaseChrome-viewSpecsMenu-rowLeft,
.collectionViewBaseChrome-viewSpecsMenu-rowMiddle,
.collectionViewBaseChrome-viewSpecsMenu-rowRight {
- font-size: 75%;
+ font-size: $small-text;
letter-spacing: 2px;
- color: grey;
+ color: $medium-gray;
margin-left: 10px;
padding: 5px;
border: none;
- outline-color: black;
+ outline-color: $black;
}
}
@@ -236,19 +235,19 @@
margin-left: 10;
.collectionGridViewChrome-viewPicker {
- font-size: 75%;
+ font-size: $small-text;
//text-transform: uppercase;
//letter-spacing: 2px;
- background: #121721;
- color: white;
- outline-color: black;
- color: white;
+ background: $dark-gray;
+ color: $white;
+ outline-color: $black;
+ color: $white;
border: none;
- border-right: solid gray 1px;
+ border-right: solid $medium-gray 1px;
}
.collectionGridViewChrome-viewPicker:active {
- outline-color: black;
+ outline-color: $black;
}
.grid-control {
@@ -268,11 +267,11 @@
.collectionGridViewChrome-entryBox {
width: 50%;
- color: black;
+ color: $black;
}
.collectionGridViewChrome-columnButton {
- color: black;
+ color: $black;
}
}
}
@@ -302,7 +301,7 @@
align-items: center;
display: flex;
grid-auto-columns: auto;
- font-size: 75%;
+ font-size: $small-text;
letter-spacing: 2px;
.collectionStackingViewChrome-pivotField-label,
@@ -311,7 +310,7 @@
grid-column: 1;
margin-right: 7px;
user-select: none;
- font-family: 'Roboto';
+ font-family: $sans-serif;
letter-spacing: normal;
}
@@ -329,13 +328,13 @@
}
.collectionStackingViewChrome-sortIcon:hover {
- background-color: rgba(0,0,0,0.2);
+ background-color: $drop-shadow;
}
.collectionStackingViewChrome-pivotField,
.collectionTreeViewChrome-pivotField,
.collection3DCarouselViewChrome-scrollSpeed {
- color: white;
+ color: $white;
grid-column: 2;
grid-row: 1;
width: 90%;
@@ -344,7 +343,7 @@
height: 80%;
border-radius: 7px;
align-items: center;
- background: #eeeeee;
+ background: $white;
.editable-view-input,
input,
@@ -352,16 +351,16 @@
.editableView-container-editing {
margin: auto;
border: 0px;
- color: grey !important;
+ color: $light-gray !important;
text-align: center;
letter-spacing: 2px;
- outline-color: black;
+ outline-color: $black;
height: 100%;
}
.react-autosuggest__container {
margin: 0;
- color: grey;
+ color: $medium-gray;
padding: 0px;
}
}
@@ -407,11 +406,11 @@
}
.switchToText {
- color: $main-accent;
+ color: $medium-gray;
}
.switchToText:hover {
- color: $dark-color;
+ color: $dark-gray;
}
}
@@ -424,11 +423,11 @@
.collectionMenu-urlInput {
padding: 12px 10px 11px 10px;
border: 0px;
- color: black;
- font-size: 10px;
+ color: $black;
+ font-size: $small-text;
letter-spacing: 2px;
- outline-color: black;
- background: rgb(238, 238, 238);
+ outline-color: $black;
+ background: $white;
width: 100%;
min-width: 350px;
margin-right: 10px;
@@ -477,10 +476,10 @@
width: 20;
height: 30;
bottom: 0;
- background: #323232;
+ background: $dark-gray;
display: inline-flex;
align-items: center;
- color: white;
+ color: $white;
}
.backKeyframe {
@@ -502,13 +501,13 @@
margin: auto;
}
- border-right: solid gray 1px;
+ border-right: solid $medium-gray 1px;
}
}
.collectionSchemaViewChrome-cont {
display: flex;
- font-size: 10.5px;
+ font-size: $small-text;
.collectionSchemaViewChrome-toggle {
display: flex;
@@ -527,19 +526,19 @@
.collectionSchemaViewChrome-toggler {
width: 100px;
height: 35px;
- background-color: black;
+ background-color: $black;
position: relative;
}
.collectionSchemaViewChrome-togglerButton {
width: 47px;
height: 30px;
- background-color: $light-color-secondary;
+ background-color: $light-gray;
// position: absolute;
transition: all 0.5s ease;
// top: 3px;
margin-top: 3px;
- color: gray;
+ color: $medium-gray;
letter-spacing: 2px;
text-transform: uppercase;
display: flex;
@@ -579,7 +578,7 @@
}
.react-autosuggest__input {
- border: 1px solid #aaa;
+ border: 1px solid $light-gray;
border-radius: 4px;
width: 100%;
}
@@ -603,11 +602,11 @@
overflow-y: auto;
max-height: 400px;
width: 180px;
- border: 1px solid #aaa;
- background-color: #fff;
- font-family: Helvetica, sans-serif;
+ border: 1px solid $light-gray;
+ background-color: $white;
+ font-family: $sans-serif;
font-weight: 300;
- font-size: 16px;
+ font-size: $large-header;
border-bottom-left-radius: 4px;
border-bottom-right-radius: 4px;
z-index: 2;
@@ -625,5 +624,5 @@
}
.react-autosuggest__suggestion--highlighted {
- background-color: #ddd;
+ background-color: $light-gray;
} \ No newline at end of file
diff --git a/src/client/views/collections/CollectionMenu.tsx b/src/client/views/collections/CollectionMenu.tsx
index 6e6fabd0d..8f4df4a92 100644
--- a/src/client/views/collections/CollectionMenu.tsx
+++ b/src/client/views/collections/CollectionMenu.tsx
@@ -29,7 +29,7 @@ import { ActiveFillColor, ActiveInkColor, SetActiveArrowEnd, SetActiveArrowStart
import { CollectionFreeFormDocumentView } from "../nodes/CollectionFreeFormDocumentView";
import { DocumentView } from "../nodes/DocumentView";
import { RichTextMenu } from "../nodes/formattedText/RichTextMenu";
-import { PresBox } from "../nodes/PresBox";
+import { PresBox } from "../nodes/trails/PresBox";
import "./CollectionMenu.scss";
import { CollectionViewType, COLLECTION_BORDER_WIDTH } from "./CollectionView";
import { TabDocView } from "./TabDocView";
@@ -665,7 +665,7 @@ export class CollectionFreeFormViewChrome extends React.Component<CollectionMenu
}
@computed get drawButtons() {
- const func = action((i: number, keep: boolean) => {
+ const func = action((e: React.MouseEvent | React.PointerEvent, i: number, keep: boolean) => {
this._keepPrimitiveMode = keep;
if (this._selectedPrimitive !== i) {
this._selectedPrimitive = i;
@@ -683,13 +683,14 @@ export class CollectionFreeFormViewChrome extends React.Component<CollectionMenu
GestureOverlay.Instance.InkShape = "";
SetActiveBezierApprox("0");
}
+ e.stopPropagation();
});
return <div className="btn-draw" key="draw">
{this._draw.map((icon, i) =>
<Tooltip key={icon} title={<div className="dash-tooltip">{this._title[i]}</div>} placement="bottom">
<button className="antimodeMenu-button"
- onPointerDown={() => func(i, false)}
- onDoubleClick={() => func(i, true)}
+ onPointerDown={e => func(e, i, false)}
+ onDoubleClick={e => func(e, i, true)}
style={{ backgroundColor: i === this._selectedPrimitive ? "525252" : "", fontSize: "20" }}>
<FontAwesomeIcon icon={this._faName[i] as IconProp} size="sm" />
</button>
diff --git a/src/client/views/collections/CollectionPileView.tsx b/src/client/views/collections/CollectionPileView.tsx
index 6baf633dd..bc1407c53 100644
--- a/src/client/views/collections/CollectionPileView.tsx
+++ b/src/client/views/collections/CollectionPileView.tsx
@@ -1,12 +1,12 @@
-import { action, computed } from "mobx";
+import { action, computed, IReactionDisposer, reaction } from "mobx";
import { observer } from "mobx-react";
import { Doc, HeightSym, WidthSym } from "../../../fields/Doc";
import { NumCast, StrCast } from "../../../fields/Types";
-import { emptyFunction, setupMoveUpEvents, returnTrue } from "../../../Utils";
+import { emptyFunction, returnTrue, setupMoveUpEvents } from "../../../Utils";
import { DocUtils } from "../../documents/Documents";
import { SelectionManager } from "../../util/SelectionManager";
import { SnappingManager } from "../../util/SnappingManager";
-import { UndoManager, undoBatch } from "../../util/UndoManager";
+import { undoBatch, UndoManager } from "../../util/UndoManager";
import { CollectionFreeFormView } from "./collectionFreeForm/CollectionFreeFormView";
import "./CollectionPileView.scss";
import { CollectionSubView } from "./CollectionSubView";
@@ -15,6 +15,7 @@ import React = require("react");
@observer
export class CollectionPileView extends CollectionSubView(doc => doc) {
_originalChrome: any = "";
+ _disposers: { [name: string]: IReactionDisposer } = {};
componentDidMount() {
if (this.layoutEngine() !== "pass" && this.layoutEngine() !== "starburst") {
@@ -22,9 +23,14 @@ export class CollectionPileView extends CollectionSubView(doc => doc) {
}
this._originalChrome = this.layoutDoc._chromeHidden;
this.layoutDoc._chromeHidden = true;
+
+ // pileups are designed to go away when they are empty.
+ this._disposers.selected = reaction(() => this.childDocs.length,
+ (num) => !num && this.props.ContainingCollectionView?.removeDocument(this.props.Document));
}
componentWillUnmount() {
this.layoutDoc._chromeHidden = this._originalChrome;
+ Object.values(this._disposers).forEach(disposer => disposer?.());
}
layoutEngine = () => StrCast(this.Document._pileLayoutEngine);
@@ -107,9 +113,6 @@ export class CollectionPileView extends CollectionSubView(doc => doc) {
this._undoBatch?.end();
this._undoBatch = undefined;
SnappingManager.SetIsDragging(false);
- if (!this.childDocs.length) {
- this.props.ContainingCollectionView?.removeDocument(this.props.Document);
- }
}, emptyFunction, e.shiftKey && this.layoutEngine() === "pass", this.layoutEngine() === "pass" && e.shiftKey); // this sets _doubleTap
}
diff --git a/src/client/views/collections/CollectionSchemaView.tsx b/src/client/views/collections/CollectionSchemaView.tsx
index 971dd5cbf..1efea96be 100644
--- a/src/client/views/collections/CollectionSchemaView.tsx
+++ b/src/client/views/collections/CollectionSchemaView.tsx
@@ -11,12 +11,13 @@ import { listSpec } from "../../../fields/Schema";
import { PastelSchemaPalette, SchemaHeaderField } from "../../../fields/SchemaHeaderField";
import { Cast, NumCast } from "../../../fields/Types";
import { TraceMobx } from "../../../fields/util";
-import { emptyFunction, emptyPath, returnFalse, setupMoveUpEvents, returnEmptyDoclist, returnTrue } from "../../../Utils";
+import { emptyFunction, returnEmptyDoclist, returnFalse, returnTrue, setupMoveUpEvents } from "../../../Utils";
+import { DocUtils } from "../../documents/Documents";
import { SelectionManager } from "../../util/SelectionManager";
import { SnappingManager } from "../../util/SnappingManager";
import { Transform } from "../../util/Transform";
import { undoBatch } from "../../util/UndoManager";
-import { COLLECTION_BORDER_WIDTH, SCHEMA_DIVIDER_WIDTH } from '../../views/globalCssVariables.scss';
+import { COLLECTION_BORDER_WIDTH, SCHEMA_DIVIDER_WIDTH } from '../../views/global/globalCssVariables.scss';
import { ContextMenu } from "../ContextMenu";
import { ContextMenuProps } from "../ContextMenuItem";
import '../DocumentDecorations.scss';
@@ -24,8 +25,7 @@ import { DocumentView } from "../nodes/DocumentView";
import { DefaultStyleProvider } from "../StyleProvider";
import "./CollectionSchemaView.scss";
import { CollectionSubView } from "./CollectionSubView";
-import { SchemaTable } from "./SchemaTable";
-import { DocUtils } from "../../documents/Documents";
+import { SchemaTable } from "../collections/collectionSchema/SchemaTable";
// bcz: need to add drag and drop of rows and columns. This seems like it might work for rows: https://codesandbox.io/s/l94mn1q657
export enum ColumnType {
@@ -147,43 +147,43 @@ export class CollectionSchemaView extends CollectionSubView(doc => doc) {
const anyType = <div className={"columnMenu-option" + (type === ColumnType.Any ? " active" : "")} onClick={() => this.setColumnType(col, ColumnType.Any)}>
<FontAwesomeIcon icon={"align-justify"} size="sm" />
- Any
- </div>;
+ Any
+ </div>;
const numType = <div className={"columnMenu-option" + (type === ColumnType.Number ? " active" : "")} onClick={() => this.setColumnType(col, ColumnType.Number)}>
<FontAwesomeIcon icon={"hashtag"} size="sm" />
- Number
- </div>;
+ Number
+ </div>;
const textType = <div className={"columnMenu-option" + (type === ColumnType.String ? " active" : "")} onClick={() => this.setColumnType(col, ColumnType.String)}>
<FontAwesomeIcon icon={"font"} size="sm" />
Text
- </div>;
+ </div>;
const boolType = <div className={"columnMenu-option" + (type === ColumnType.Boolean ? " active" : "")} onClick={() => this.setColumnType(col, ColumnType.Boolean)}>
<FontAwesomeIcon icon={"check-square"} size="sm" />
Checkbox
- </div>;
+ </div>;
const listType = <div className={"columnMenu-option" + (type === ColumnType.List ? " active" : "")} onClick={() => this.setColumnType(col, ColumnType.List)}>
<FontAwesomeIcon icon={"list-ul"} size="sm" />
List
- </div>;
+ </div>;
const docType = <div className={"columnMenu-option" + (type === ColumnType.Doc ? " active" : "")} onClick={() => this.setColumnType(col, ColumnType.Doc)}>
<FontAwesomeIcon icon={"file"} size="sm" />
Document
- </div>;
+ </div>;
const imageType = <div className={"columnMenu-option" + (type === ColumnType.Image ? " active" : "")} onClick={() => this.setColumnType(col, ColumnType.Image)}>
<FontAwesomeIcon icon={"image"} size="sm" />
Image
- </div>;
+ </div>;
const dateType = <div className={"columnMenu-option" + (type === ColumnType.Date ? " active" : "")} onClick={() => this.setColumnType(col, ColumnType.Date)}>
<FontAwesomeIcon icon={"calendar"} size="sm" />
- Date
- </div>;
+ Date
+ </div>;
const allColumnTypes = <div className="columnMenu-types">
@@ -413,8 +413,8 @@ export class CollectionSchemaView extends CollectionSubView(doc => doc) {
isContentActive={returnTrue}
isDocumentActive={returnFalse}
ScreenToLocalTransform={this.getPreviewTransform}
- docFilters={this.docFilters}
- docRangeFilters={this.docRangeFilters}
+ docFilters={this.childDocFilters}
+ docRangeFilters={this.childDocRangeFilters}
searchFilterDocs={this.searchFilterDocs}
styleProvider={DefaultStyleProvider}
layerProvider={undefined}
diff --git a/src/client/views/collections/CollectionStackingView.scss b/src/client/views/collections/CollectionStackingView.scss
index 9f56a0c0e..4b123c8b6 100644
--- a/src/client/views/collections/CollectionStackingView.scss
+++ b/src/client/views/collections/CollectionStackingView.scss
@@ -1,4 +1,4 @@
-@import "../globalCssVariables";
+@import "../global/globalCssVariables";
.collectionMasonryView {
display: inline;
@@ -96,8 +96,8 @@
height: 2vw;
width: 100%;
font-family: $sans-serif;
- background: $dark-color;
- color: $light-color;
+ background: $dark-gray;
+ color: $white;
}
.collectionStackingView-columnDragger {
@@ -128,7 +128,7 @@
margin-left: 2px;
margin-right: 2px;
margin-top: 2px;
- background: $main-accent;
+ background: $medium-gray;
height: 5px;
&.active {
@@ -180,11 +180,11 @@
.collectionStackingView-sectionHeader {
text-align: center;
margin: auto;
- background: $main-accent;
+ background: $medium-gray;
// overflow: hidden; overflow is visible so the color menu isn't hidden -ftong
.editableView-input {
- color: black;
+ color: $dark-gray;
}
.editableView-input:hover,
@@ -205,7 +205,7 @@
display: flex;
align-items: center;
justify-content: center;
- color: black;
+ color: $dark-gray;
.editableView-container-editing-oneLine,
.editableView-container-editing {
diff --git a/src/client/views/collections/CollectionStackingView.tsx b/src/client/views/collections/CollectionStackingView.tsx
index 30f8e0112..b9bc83d49 100644
--- a/src/client/views/collections/CollectionStackingView.tsx
+++ b/src/client/views/collections/CollectionStackingView.tsx
@@ -239,10 +239,10 @@ export class CollectionStackingView extends CollectionSubView<StackingDocument,
onDoubleClick={this.onChildDoubleClickHandler}
ScreenToLocalTransform={stackedDocTransform}
focus={this.focusDocument}
- docFilters={this.docFilters}
+ docFilters={this.childDocFilters}
hideDecorationTitle={this.props.childHideDecorationTitle?.()}
hideTitle={this.props.childHideTitle?.()}
- docRangeFilters={this.docRangeFilters}
+ docRangeFilters={this.childDocRangeFilters}
searchFilterDocs={this.searchFilterDocs}
ContainingCollectionDoc={this.props.CollectionView?.props.Document}
ContainingCollectionView={this.props.CollectionView}
@@ -480,7 +480,7 @@ export class CollectionStackingView extends CollectionSubView<StackingDocument,
if (value && this.columnHeaders) {
const schemaHdrField = new SchemaHeaderField(value);
this.columnHeaders.push(schemaHdrField);
- DocUtils.addFieldEnumerations(undefined, this.pivotField, [{ title: value, _backgroundColor: schemaHdrField.color }]);
+ DocUtils.addFieldEnumerations(undefined, this.pivotField, [{ title: value, _backgroundColor: "schemaHdrField.color" }]);
return true;
}
return false;
diff --git a/src/client/views/collections/CollectionSubView.tsx b/src/client/views/collections/CollectionSubView.tsx
index 8d549bd56..a9b5ce465 100644
--- a/src/client/views/collections/CollectionSubView.tsx
+++ b/src/client/views/collections/CollectionSubView.tsx
@@ -8,7 +8,7 @@ import { ScriptField } from "../../../fields/ScriptField";
import { WebField } from "../../../fields/URLField";
import { Cast, ScriptCast, NumCast, StrCast } from "../../../fields/Types";
import { GestureUtils } from "../../../pen-gestures/GestureUtils";
-import { Utils, returnFalse } from "../../../Utils";
+import { Utils, returnFalse, returnEmptyFilter } from "../../../Utils";
import { DocServer } from "../../DocServer";
import { Networking } from "../../Network";
import { ImageUtils } from "../../util/Import & Export/ImageUtils";
@@ -22,6 +22,7 @@ import ReactLoading from 'react-loading';
export interface SubCollectionViewProps extends CollectionViewProps {
CollectionView: Opt<CollectionView>;
+ SetSubView?: (subView: any) => void;
}
export function CollectionSubView<T, X>(schemaCtor: (doc: Doc) => T, moreProps?: X) {
@@ -30,6 +31,8 @@ export function CollectionSubView<T, X>(schemaCtor: (doc: Doc) => T, moreProps?:
private gestureDisposer?: GestureUtils.GestureEventDisposer;
protected _multiTouchDisposer?: InteractionUtils.MultiTouchEventDisposer;
protected _mainCont?: HTMLDivElement;
+ @observable _focusFilters: Opt<string[]>; // docFilters that are overridden when previewing a link to an anchor which has docFilters set on it
+ @observable _focusRangeFilters: Opt<string[]>; // docRangeFilters that are overridden when previewing a link to an anchor which has docRangeFilters set on it
protected createDashEventsTarget = (ele: HTMLDivElement) => { //used for stacking and masonry view
this.dropDisposer?.();
this.gestureDisposer?.();
@@ -45,6 +48,10 @@ export function CollectionSubView<T, X>(schemaCtor: (doc: Doc) => T, moreProps?:
this.createDashEventsTarget(ele);
}
+ componentDidMount() {
+ this.props.SetSubView?.(this);
+ }
+
componentWillUnmount() {
this.gestureDisposer?.();
this._multiTouchDisposer?.();
@@ -81,15 +88,13 @@ export function CollectionSubView<T, X>(schemaCtor: (doc: Doc) => T, moreProps?:
get childDocList() {
return Cast(this.dataField, listSpec(Doc));
}
- docFilters = () => {
- return [...this.props.docFilters(), ...Cast(this.props.Document._docFilters, listSpec("string"), [])];
- }
- docRangeFilters = () => {
- return [...this.props.docRangeFilters(), ...Cast(this.props.Document._docRangeFilters, listSpec("string"), [])];
- }
- searchFilterDocs = () => {
- return [...this.props.searchFilterDocs(), ...DocListCast(this.props.Document._searchFilterDocs)];
- }
+ collectionFilters = () => this._focusFilters ?? Cast(this.props.Document._docFilters, listSpec("string"), []);
+ collectionRangeDocFilters = () => this._focusRangeFilters ?? Cast(this.props.Document._docRangeFilters, listSpec("string"), []);
+ childDocFilters = () => [...this.props.docFilters(), ...this.collectionFilters()];
+ childDocRangeFilters = () => [...(this.props.docRangeFilters?.() || []), ...this.collectionRangeDocFilters()];
+ IsFiltered = () => this.collectionFilters().length || this.collectionRangeDocFilters().length ? "hasFilter" :
+ this.props.docFilters().length || this.props.docRangeFilters().length ? "inheritsFilter" : undefined;
+ searchFilterDocs = () => this.props.searchFilterDocs?.() ?? DocListCast(this.props.Document._searchFilterDocs);
@computed.struct get childDocs() {
TraceMobx();
let rawdocs: (Doc | Promise<Doc>)[] = [];
@@ -108,8 +113,8 @@ export function CollectionSubView<T, X>(schemaCtor: (doc: Doc) => T, moreProps?:
const viewSpecScript = Cast(this.props.Document.viewSpecScript, ScriptField);
const childDocs = viewSpecScript ? docs.filter(d => viewSpecScript.script.run({ doc: d }, console.log).result) : docs;
- const docFilters = this.docFilters();
- const docRangeFilters = this.docRangeFilters();
+ const docFilters = this.childDocFilters();
+ const docRangeFilters = this.childDocRangeFilters();
const searchDocs = this.searchFilterDocs();
if (this.props.Document.dontRegisterView || (!docFilters.length && !docRangeFilters.length && !searchDocs.length)) {
return childDocs.filter(cd => !cd.cookies); // remove any documents that require a cookie if there are no filters to provide one
@@ -241,7 +246,7 @@ export function CollectionSubView<T, X>(schemaCtor: (doc: Doc) => T, moreProps?:
@undoBatch
@action
- protected async onExternalDrop(e: React.DragEvent, options: DocumentOptions, completed?: () => void) {
+ protected async onExternalDrop(e: React.DragEvent, options: DocumentOptions, completed?: (docs: Doc[]) => void) {
if (e.ctrlKey) {
e.stopPropagation(); // bcz: this is a hack to stop propagation when dropping an image on a text document with shift+ctrl
return;
@@ -303,7 +308,7 @@ export function CollectionSubView<T, X>(schemaCtor: (doc: Doc) => T, moreProps?:
} else {
const path = window.location.origin + "/doc/";
if (text.startsWith(path)) {
- const docid = text.replace(Utils.prepend("/doc/"), "").split("?")[0];
+ const docid = text.replace(Doc.globalServerPath(), "").split("?")[0];
DocServer.GetRefField(docid).then(f => {
if (f instanceof Doc) {
if (options.x || options.y) { f.x = options.x; f.y = options.y; } // should be in CollectionFreeFormView
@@ -439,7 +444,7 @@ export function CollectionSubView<T, X>(schemaCtor: (doc: Doc) => T, moreProps?:
}
this.slowLoadDocuments(files, options, generatedDocuments, text, completed, e.clientX, e.clientY, addDocument).then(batch.end);
}
- slowLoadDocuments = async (files: (File[] | string), options: DocumentOptions, generatedDocuments: Doc[], text: string, completed: (() => void) | undefined, clientX: number, clientY: number, addDocument: (doc: Doc | Doc[]) => boolean) => {
+ slowLoadDocuments = async (files: (File[] | string), options: DocumentOptions, generatedDocuments: Doc[], text: string, completed: ((doc: Doc[]) => void) | undefined, clientX: number, clientY: number, addDocument: (doc: Doc | Doc[]) => boolean) => {
const disposer = OverlayView.Instance.addElement(
<ReactLoading type={"spinningBubbles"} color={"green"} height={250} width={250} />, { x: clientX - 125, y: clientY - 125 });
if (typeof files === "string") {
@@ -448,13 +453,17 @@ export function CollectionSubView<T, X>(schemaCtor: (doc: Doc) => T, moreProps?:
generatedDocuments.push(...await DocUtils.uploadFilesToDocs(files, options));
}
if (generatedDocuments.length) {
- const set = generatedDocuments.length > 1 && generatedDocuments.map(d => DocUtils.iconify(d));
- if (set) {
- addDocument(DocUtils.pileup(generatedDocuments, options.x!, options.y!)!);
- } else {
- generatedDocuments.forEach(addDocument);
+ const isFreeformView = this.props.Document._viewType === CollectionViewType.Freeform;
+ const set = !isFreeformView ? generatedDocuments :
+ generatedDocuments.length > 1 ? generatedDocuments.map(d => { DocUtils.iconify(d); return d; }) : [];
+ if (completed) completed(set);
+ else {
+ if (isFreeformView && generatedDocuments.length > 1) {
+ addDocument(DocUtils.pileup(generatedDocuments, options.x!, options.y!));
+ } else {
+ generatedDocuments.forEach(addDocument);
+ }
}
- completed?.();
} else {
if (text && !text.includes("https://")) {
addDocument(Docs.Create.TextDocument(text, { ...options, title: text.substring(0, 20), _width: 400, _height: 315 }));
diff --git a/src/client/views/collections/CollectionTimeView.tsx b/src/client/views/collections/CollectionTimeView.tsx
index f41043179..292dfd77c 100644
--- a/src/client/views/collections/CollectionTimeView.tsx
+++ b/src/client/views/collections/CollectionTimeView.tsx
@@ -32,12 +32,10 @@ export class CollectionTimeView extends CollectionSubView(doc => doc) {
@observable _collapsed: boolean = false;
@observable _childClickedScript: Opt<ScriptField>;
@observable _viewDefDivClick: Opt<ScriptField>;
- @observable _focusDocFilters: Opt<string[]>; // fields that get overridden by a focus anchor
@observable _focusPivotField: Opt<string>;
- @observable _focusRangeFilters: Opt<string[]>;
getAnchor = () => {
- const anchor = Docs.Create.TextanchorDocument({
+ const anchor = Docs.Create.HTMLAnchorDocument([], {
title: ComputedField.MakeFunction(`"${this.pivotField}"])`) as any,
annotationOn: this.rootDoc
});
@@ -72,9 +70,9 @@ export class CollectionTimeView extends CollectionSubView(doc => doc) {
@action
setViewSpec = (anchor: Doc, preview: boolean) => {
if (preview) { // if in preview, then override document's fields with view spec
+ this._focusFilters = StrListCast(Doc.GetProto(anchor).docFilters);
+ this._focusRangeFilters = StrListCast(Doc.GetProto(anchor).docRangeFilters);
this._focusPivotField = StrCast(anchor.pivotField);
- this._focusDocFilters = StrListCast(anchor.docFilters);
- this._focusRangeFilters = StrListCast(anchor.docRangeFilters);
} else if (anchor.pivotField !== undefined) { // otherwise set document's fields based on anchor view spec
this.layoutDoc._prevFilterIndex = 1;
this.layoutDoc._pivotField = StrCast(anchor.pivotField);
@@ -84,8 +82,6 @@ export class CollectionTimeView extends CollectionSubView(doc => doc) {
return 0;
}
- pivotDocFilters = () => this._focusDocFilters || this.props.docFilters();
- pivotDocRangeFilters = () => this._focusRangeFilters || this.props.docRangeFilters();
layoutEngine = () => this._layoutEngine;
toggleVisibility = action(() => this._collapsed = !this._collapsed);
@@ -139,10 +135,8 @@ export class CollectionTimeView extends CollectionSubView(doc => doc) {
return <div className="collectionTimeView-innards" key="timeline" style={{ pointerEvents: this.props.isContentActive() ? undefined : "none" }}
onClick={this.contentsDown}>
<CollectionFreeFormView {...this.props}
- engineProps={{ pivotField: this.pivotField, docFilters: this.docFilters, docRangeFilters: this.docRangeFilters }}
+ engineProps={{ pivotField: this.pivotField, docFilters: this.childDocFilters, docRangeFilters: this.childDocRangeFilters }}
fitContentsToDoc={returnTrue}
- docFilters={this.pivotDocFilters}
- docRangeFilters={this.pivotDocRangeFilters}
childClickScript={this._childClickedScript}
viewDefDivClick={this._viewDefDivClick}
childFreezeDimensions={true}
diff --git a/src/client/views/collections/CollectionTreeView.scss b/src/client/views/collections/CollectionTreeView.scss
index 72ab51784..ec461ab94 100644
--- a/src/client/views/collections/CollectionTreeView.scss
+++ b/src/client/views/collections/CollectionTreeView.scss
@@ -1,4 +1,4 @@
-@import "../globalCssVariables";
+@import "../global/globalCssVariables";
.collectionTreeView-dropTarget {
border-width: $COLLECTION_BORDER_WIDTH;
@@ -12,7 +12,7 @@
top: 0;
padding-left: 10px;
padding-right: 10px;
- background: $light-color-secondary;
+ background: $light-gray;
font-size: 13px;
overflow: auto;
user-select: none;
@@ -40,7 +40,7 @@
}
.delete-button {
- color: $intermediate-color;
+ color: $medium-gray;
// float: right;
margin-left: 15px;
// margin-top: 3px;
@@ -71,7 +71,7 @@
.collectionTreeView-subtitle {
font-style: italic;
font-size: 8pt;
- color: $intermediate-color;
+ color: $medium-gray;
}
.docContainer {
diff --git a/src/client/views/collections/CollectionTreeView.tsx b/src/client/views/collections/CollectionTreeView.tsx
index 82c8a9114..3eece0086 100644
--- a/src/client/views/collections/CollectionTreeView.tsx
+++ b/src/client/views/collections/CollectionTreeView.tsx
@@ -154,7 +154,7 @@ export class CollectionTreeView extends CollectionSubView<Document, Partial<coll
!existingOnClick && ContextMenu.Instance.addItem({ description: "OnClick...", noexpand: true, subitems: onClicks, icon: "mouse-pointer" });
}
}
- onTreeDrop = (e: React.DragEvent) => this.onExternalDrop(e, {});
+ onTreeDrop = (e: React.DragEvent, addDocs?: (docs: Doc[]) => void) => this.onExternalDrop(e, {}, addDocs);
@undoBatch
makeTextCollection = (childDocs: Doc[]) => {
diff --git a/src/client/views/collections/CollectionView.scss b/src/client/views/collections/CollectionView.scss
index a5aef86de..5db489c0a 100644
--- a/src/client/views/collections/CollectionView.scss
+++ b/src/client/views/collections/CollectionView.scss
@@ -1,8 +1,8 @@
-@import "../globalCssVariables";
+@import "../global/globalCssVariables";
.collectionView {
border-width: 0;
- border-color: $light-color-secondary;
+ border-color: $light-gray;
border-style: solid;
border-radius: 0 0 $border-radius $border-radius;
box-sizing: border-box;
diff --git a/src/client/views/collections/CollectionView.tsx b/src/client/views/collections/CollectionView.tsx
index fb60265e3..2718cbbbf 100644
--- a/src/client/views/collections/CollectionView.tsx
+++ b/src/client/views/collections/CollectionView.tsx
@@ -1,4 +1,4 @@
-import { computed, observable, runInAction } from 'mobx';
+import { computed, observable, runInAction, action } from 'mobx';
import { observer } from "mobx-react";
import * as React from 'react';
import 'react-image-lightbox-with-rotate/style.css'; // This only needs to be imported once in your app
@@ -29,7 +29,7 @@ import CollectionMapView from './CollectionMapView';
import { CollectionMulticolumnView } from './collectionMulticolumn/CollectionMulticolumnView';
import { CollectionMultirowView } from './collectionMulticolumn/CollectionMultirowView';
import { CollectionPileView } from './CollectionPileView';
-import { CollectionSchemaView } from "./CollectionSchemaView";
+import { CollectionSchemaView } from "./collectionSchema/CollectionSchemaView";
import { CollectionStackingView } from './CollectionStackingView';
import { SubCollectionViewProps } from './CollectionSubView';
import { CollectionTimeView } from './CollectionTimeView';
@@ -236,13 +236,19 @@ export class CollectionView extends ViewBoxAnnotatableComponent<ViewBoxAnnotatab
* Shows the filter icon if it's a user-created collection which isn't a dashboard and has some docFilters applied on it or on the current dashboard.
*/
@computed get showFilterIcon() {
- return this.props.Document.viewType !== CollectionViewType.Docking && !Doc.IsSystem(this.props.Document) && ((StrListCast(this.props.Document._docFilters).length || StrListCast(this.props.Document._docRangeFilters).length || StrListCast(CurrentUserUtils.ActiveDashboard._docFilters).length || StrListCast(CurrentUserUtils.ActiveDashboard._docRangeFilters).length));
+ return this.props.Document.viewType !== CollectionViewType.Docking && !Doc.IsSystem(this.props.Document) && this._subView?.IsFiltered()
}
+ @observable _subView: any = undefined;
+
render() {
TraceMobx();
const props: SubCollectionViewProps = {
...this.props,
+ SetSubView: action((subView: any) => {
+ console.log("Setting sub", subView);
+ return this._subView = subView
+ }),
addDocument: this.addDocument,
moveDocument: this.moveDocument,
removeDocument: this.removeDocument,
@@ -260,8 +266,8 @@ export class CollectionView extends ViewBoxAnnotatableComponent<ViewBoxAnnotatab
{this.collectionViewType !== undefined ? this.SubView(this.collectionViewType, props) : (null)}
{this.showFilterIcon ?
<FontAwesomeIcon icon={"filter"} size="lg"
- style={{ position: 'absolute', top: '1%', right: '1%', cursor: "pointer", padding: 1, color: '#18c718bd', zIndex: 1 }}
- onPointerDown={e => { runInAction(() => CurrentUserUtils.propertiesWidth = 250); e.stopPropagation(); }}
+ style={{ position: 'absolute', top: '1%', right: '1%', cursor: "pointer", padding: 1, color: this.showFilterIcon === "hasFilter" ? '#18c718bd' : "orange", zIndex: 1 }}
+ onPointerDown={action(e => { this.props.select(false); CurrentUserUtils.propertiesWidth = 250; e.stopPropagation(); })}
/>
: (null)}
</div>);
diff --git a/src/client/views/collections/TabDocView.scss b/src/client/views/collections/TabDocView.scss
index 9acbc4f85..a963f1cb9 100644
--- a/src/client/views/collections/TabDocView.scss
+++ b/src/client/views/collections/TabDocView.scss
@@ -1,19 +1,62 @@
input.lm_title:focus,
-input.lm_title
-{
+input.lm_title {
max-width: unset !important;
+ outline: none;
transition-delay: unset;
- width: 100%;
+ width: max-content;
cursor: text;
}
+
input.lm_title {
transition-delay: 0.35s;
- width: 100px;
+ width: max-content;
cursor: pointer;
}
-.tabDocView-drag {
- margin: auto;
+
+.lm_iconWrap {
+ display: flex;
+ color: black;
+ width: 15px;
+ height: 15px;
+ align-items: center;
+ align-self: center;
+ justify-content: center;
+ margin: 3px;
+ border-radius: 20%;
+
+ .moreInfoDot {
+ background-color: white;
+ border-radius: 100%;
+ width: 3px;
+ height: 3px;
+ margin: 0.5px;
+ }
+}
+
+.ffMenu {
+ display: grid;
+ grid-auto-rows: 35px;
+ grid-auto-columns: auto auto auto auto auto;
+ right: 10px;
+ bottom: 50px;
+ position: absolute;
+ min-height: 35px;
+ height: max-content;
+ border: solid 2px black;
+ border-radius: 5px;
+ background-color: #bddbe6;
+ width: max-content;
+ min-width: 35px;
+
+ .ffMenuButton {
+ display: flex;
+ width: 35px;
+ height: 35px;
+ align-items: center;
+ justify-content: center;
+ }
}
+
.miniMap-hidden,
.miniMap {
position: absolute;
@@ -37,6 +80,7 @@ input.lm_title {
}
}
}
+
.miniMap-hidden {
position: absolute;
bottom: 0;
@@ -46,7 +90,8 @@ input.lm_title {
transform: translate(20px, 20px) rotate(45deg);
border-radius: 30px;
padding: 2px;
- > svg {
+
+ >svg {
margin-top: 3px;
transform: translate(0px, 7px);
}
diff --git a/src/client/views/collections/TabDocView.tsx b/src/client/views/collections/TabDocView.tsx
index 7e2f7811e..623e0f58d 100644
--- a/src/client/views/collections/TabDocView.tsx
+++ b/src/client/views/collections/TabDocView.tsx
@@ -1,3 +1,4 @@
+import { IconProp } from '@fortawesome/fontawesome-svg-core';
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome';
import { Tooltip } from '@material-ui/core';
import 'golden-layout/src/css/goldenlayout-base.css';
@@ -9,9 +10,9 @@ import * as ReactDOM from 'react-dom';
import { DataSym, Doc, DocListCast, DocListCastAsync, HeightSym, Opt, WidthSym } from "../../../fields/Doc";
import { Id } from '../../../fields/FieldSymbols';
import { FieldId } from "../../../fields/RefField";
-import { Cast, NumCast, StrCast, BoolCast } from "../../../fields/Types";
+import { BoolCast, Cast, NumCast, StrCast } from "../../../fields/Types";
import { TraceMobx } from '../../../fields/util';
-import { emptyFunction, returnEmptyDoclist, returnFalse, returnTrue, setupMoveUpEvents, Utils } from "../../../Utils";
+import { emptyFunction, lightOrDark, returnEmptyDoclist, returnFalse, returnTrue, setupMoveUpEvents, Utils } from "../../../Utils";
import { DocServer } from "../../DocServer";
import { DocUtils } from '../../documents/Documents';
import { DocumentType } from '../../documents/DocumentTypes';
@@ -24,15 +25,15 @@ import { Transform } from '../../util/Transform';
import { undoBatch, UndoManager } from "../../util/UndoManager";
import { LightboxView } from '../LightboxView';
import { DocFocusOptions, DocumentView, DocumentViewProps } from "../nodes/DocumentView";
-import { FieldViewProps } from '../nodes/FieldView';
-import { PinProps, PresBox, PresMovement } from '../nodes/PresBox';
+import { PinProps, PresBox, PresMovement } from '../nodes/trails';
import { DefaultLayerProvider, DefaultStyleProvider, StyleLayers, StyleProp } from '../StyleProvider';
import { CollectionDockingView } from './CollectionDockingView';
import { CollectionDockingViewMenu } from './CollectionDockingViewMenu';
import { CollectionFreeFormView } from './collectionFreeForm/CollectionFreeFormView';
-import { CollectionViewType, CollectionView } from './CollectionView';
+import { CollectionView, CollectionViewType } from './CollectionView';
import "./TabDocView.scss";
import React = require("react");
+import Color = require('color');
const _global = (window /* browser */ || global /* node */) as any;
interface TabDocViewProps {
@@ -52,6 +53,14 @@ export class TabDocView extends React.Component<TabDocViewProps> {
@computed get layoutDoc() { return this._document && Doc.Layout(this._document); }
@computed get tabColor() { return StrCast(this._document?._backgroundColor, StrCast(this._document?.backgroundColor, DefaultStyleProvider(this._document, undefined, StyleProp.BackgroundColor))); }
+ @computed get tabTextColor() { return this._document?.type === DocumentType.PRES ? "black" : StrCast(this._document?._color, StrCast(this._document?.color, DefaultStyleProvider(this._document, undefined, StyleProp.Color))); }
+ // @computed get renderBounds() {
+ // const bounds = this._document ? Cast(this._document._renderContentBounds, listSpec("number"), [0, 0, this.returnMiniSize(), this.returnMiniSize()]) : [0, 0, 0, 0];
+ // const xbounds = bounds[2] - bounds[0];
+ // const ybounds = bounds[3] - bounds[1];
+ // const dim = Math.max(xbounds, ybounds);
+ // return { l: bounds[0] + xbounds / 2 - dim / 2, t: bounds[1] + ybounds / 2 - dim / 2, cx: bounds[0] + xbounds / 2, cy: bounds[1] + ybounds / 2, dim };
+ // }
get stack() { return (this.props as any).glContainer.parent.parent; }
get tab() { return (this.props as any).glContainer.tab; }
@@ -65,15 +74,25 @@ export class TabDocView extends React.Component<TabDocViewProps> {
tab.contentItem.config.fixed && (tab.contentItem.parent.config.fixed = true);
tab.DashDoc = doc;
CollectionDockingView.Instance.tabMap.add(tab);
-
+ const iconType: IconProp = Doc.toIcon(doc);
// setup the title element and set its size according to the # of chars in the title. Show the full title when clicked.
const titleEle = tab.titleElement[0];
+ const iconWrap = document.createElement("div");
+ const closeWrap = document.createElement("div");
+
+
titleEle.size = StrCast(doc.title).length + 3;
titleEle.value = doc.title;
titleEle.onchange = undoBatch(action((e: any) => {
titleEle.size = e.currentTarget.value.length + 3;
Doc.GetProto(doc).title = e.currentTarget.value;
}));
+
+ const dragBtnDown = (e: React.PointerEvent) => {
+ setupMoveUpEvents(this, e, e => !e.defaultPrevented && DragManager.StartDocumentDrag([iconWrap], new DragManager.DocumentDragData([doc], doc.dropAction as dropActionType), e.clientX, e.clientY), returnFalse, emptyFunction);
+ };
+
+
if (tab.element[0].children[1].children.length === 1) {
const toggle = document.createElement("div");
toggle.style.width = "10px";
@@ -83,18 +102,42 @@ export class TabDocView extends React.Component<TabDocViewProps> {
toggle.style.borderTopRightRadius = "7px";
toggle.style.position = "relative";
toggle.style.display = "inline-block";
- toggle.style.background = "gray";
- toggle.style.borderLeft = "solid 1px black";
+ toggle.style.background = "transparent";
toggle.onclick = (e: MouseEvent) => {
if (tab.contentItem === tab.header.parent.getActiveContentItem()) {
tab.DashDoc.activeLayer = tab.DashDoc.activeLayer ? undefined : StyleLayers.Background;
}
};
- tab.element[0].style.borderTopRightRadius = "8px";
- tab.element[0].children[1].appendChild(toggle);
- tab._disposers.layerDisposer = reaction(() =>
- ({ layer: tab.DashDoc.activeLayer, color: this.tabColor }),
- ({ layer, color }) => toggle.style.background = !layer ? color : "dimgrey", { fireImmediately: true });
+ iconWrap.className = "lm_iconWrap";
+ iconWrap.id = "lm_iconWrap";
+ closeWrap.className = "lm_iconWrap";
+ closeWrap.id = "lm_closeWrap";
+ closeWrap.onclick = (e: MouseEvent) => {
+ tab.header.parent.contentItem.remove();
+ Doc.AddDocToList(CurrentUserUtils.MyRecentlyClosed, "data", tab.DashDoc, undefined, true, true);
+ };
+ const docIcon = <FontAwesomeIcon onPointerDown={dragBtnDown} icon={iconType} />;
+ const closeIcon = <FontAwesomeIcon icon={"times"} />;
+ ReactDOM.render(docIcon, iconWrap);
+ ReactDOM.render(closeIcon, closeWrap);
+ // tab.element[0].append(closeWrap);
+ tab.element[0].prepend(iconWrap);
+ tab._disposers.layerDisposer = reaction(() => ({ layer: tab.DashDoc.activeLayer, color: this.tabColor }),
+ ({ layer, color }) => {
+ const textColor = lightOrDark(this.tabColor); //not working with StyleProp.Color
+ titleEle.style.color = textColor;
+ titleEle.style.backgroundColor = "transparent";
+ iconWrap.style.color = textColor;
+ closeWrap.style.color = textColor;
+ moreInfoDrag.style.backgroundColor = textColor;
+ tab.element[0].style.background = !layer ? color : "dimgrey";
+ }, { fireImmediately: true });
+ // TODO:glr fix
+ // tab.element[0].style.borderTopRightRadius = "8px";
+ // tab.element[0].children[1].appendChild(toggle);
+ // tab._disposers.layerDisposer = reaction(() =>
+ // ({ layer: tab.DashDoc.activeLayer, color: this.tabColor }),
+ // ({ layer, color }) => toggle.style.background = !layer ? color : "dimgrey", { fireImmediately: true });
}
// shifts the focus to this tab when another tab is dragged over it
tab.element[0].onmouseenter = (e: MouseEvent) => {
@@ -103,13 +146,11 @@ export class TabDocView extends React.Component<TabDocViewProps> {
tab.setActive(true);
}
};
- const dragBtnDown = (e: React.PointerEvent) => {
- setupMoveUpEvents(this, e, e => !e.defaultPrevented && DragManager.StartDocumentDrag([dragHdl], new DragManager.DocumentDragData([doc], doc.dropAction as dropActionType), e.clientX, e.clientY), returnFalse, emptyFunction);
- };
+
// select the tab document when the tab is directly clicked and activate the tab whenver the tab document is selected
titleEle.onpointerdown = action((e: any) => {
- if (e.target.className !== "lm_close_tab") {
+ if (e.target.className !== "lm_iconWrap") {
if (this.view) SelectionManager.SelectView(this.view, false);
else this._activated = true;
if (Date.now() - titleEle.lastClick < 1000) titleEle.select();
@@ -123,25 +164,30 @@ export class TabDocView extends React.Component<TabDocViewProps> {
const toggle = tab.element[0].children[1].children[0] as HTMLInputElement;
selected && tab.contentItem !== tab.header.parent.getActiveContentItem() &&
UndoManager.RunInBatch(() => tab.header.parent.setActiveContentItem(tab.contentItem), "tab switch");
- toggle.style.fontWeight = selected ? "bold" : "";
- toggle.style.textTransform = selected ? "uppercase" : "";
+ // toggle.style.fontWeight = selected ? "bold" : "";
+ // toggle.style.textTransform = selected ? "uppercase" : "";
}));
//attach the selection doc buttons menu to the drag handle
- const stack = tab.contentItem.parent;
- const dragHdl = document.createElement("div");
- dragHdl.className = "lm_drag_tab";
+ const stack: HTMLDivElement = tab.contentItem.parent;
+ const header: HTMLDivElement = tab;
+ console.log("Stack: " + stack.id, stack.className)
+ stack.onscroll = action((e: any) => {
+ console.log('scrolling...')
+ })
+ const moreInfoDrag = document.createElement("div");
+ moreInfoDrag.className = "lm_iconWrap";
tab._disposers.buttonDisposer = reaction(() => this.view, view =>
- view && [ReactDOM.render(<span className="tabDocView-drag" onPointerDown={dragBtnDown}><CollectionDockingViewMenu views={() => [view]} Stack={stack} /></span>, dragHdl), tab._disposers.buttonDisposer?.()],
+ view && [ReactDOM.render(<span><CollectionDockingViewMenu views={() => [view]} Stack={stack} /></span>, moreInfoDrag), tab._disposers.buttonDisposer?.()],
{ fireImmediately: true });
- tab.reactComponents = [dragHdl];
- tab.closeElement.before(dragHdl);
+ // tab.reactComponents = [moreInfoDrag];
+ // tab.element[0].children[3].before(moreInfoDrag);
// highlight the tab when the tab document is brushed in any part of the UI
tab._disposers.reactionDisposer = reaction(() => ({ title: doc.title, degree: Doc.IsBrushedDegree(doc) }), ({ title, degree }) => {
titleEle.value = title;
- titleEle.style.padding = degree ? 0 : 2;
- titleEle.style.border = `${["gray", "gray", "gray"][degree]} ${["none", "dashed", "solid"][degree]} 2px`;
+ // titleEle.style.padding = degree ? 0 : 2;
+ // titleEle.style.border = `${["gray", "gray", "gray"][degree]} ${["none", "dashed", "solid"][degree]} 2px`;
}, { fireImmediately: true });
// clean up the tab when it is closed
@@ -221,9 +267,9 @@ export class TabDocView extends React.Component<TabDocViewProps> {
})).observe(this.props.glContainer._element[0]);
this.props.glContainer.layoutManager.on("activeContentItemChanged", this.onActiveContentItemChanged);
this.props.glContainer.tab?.isActive && this.onActiveContentItemChanged(undefined);
- this._tabReaction = reaction(() => ({ selected: this.active(), title: this.tab?.titleElement[0] }),
- ({ selected, title }) => title && (title.style.backgroundColor = selected ? "white" : ""),
- { fireImmediately: true });
+ // this._tabReaction = reaction(() => ({ selected: this.active(), title: this.tab?.titleElement[0] }),
+ // ({ selected, title }) => title && (title.style.backgroundColor = selected ? "white" : ""),
+ // { fireImmediately: true });
}
componentWillUnmount() {
@@ -243,10 +289,10 @@ export class TabDocView extends React.Component<TabDocViewProps> {
}
// adds a tab to the layout based on the locaiton parameter which can be:
- // close[:{left,right,top,bottom}] - e.g., "close" will close the tab, "close:left" will close the left tab,
+ // close[:{left,right,top,bottom}] - e.g., "close" will close the tab, "close:left" will close the left tab,
// add[:{left,right,top,bottom}] - e.g., "add" will add a tab to the current stack, "add:right" will add a tab on the right
- // replace[:{left,right,top,bottom,<any string>}] - e.g., "replace" will replace the current stack contents,
- // "replace:right" - will replace the stack on the right named "right" if it exists, or create a stack on the right with that name,
+ // replace[:{left,right,top,bottom,<any string>}] - e.g., "replace" will replace the current stack contents,
+ // "replace:right" - will replace the stack on the right named "right" if it exists, or create a stack on the right with that name,
// "replace:monkeys" - will replace any tab that has the label 'monkeys', or a tab with that label will be created by default on the right
// inPlace - will add the document to any collection along the path from the document to the docking view that has a field isInPlaceContainer. if none is found, inPlace adds a tab to current stack
addDocTab = (doc: Doc, location: string) => {
@@ -317,8 +363,8 @@ export class TabDocView extends React.Component<TabDocViewProps> {
PanelHeight={this.PanelHeight}
layerProvider={this.layerProvider}
styleProvider={DefaultStyleProvider}
- docFilters={CollectionDockingView.Instance.docFilters}
- docRangeFilters={CollectionDockingView.Instance.docRangeFilters}
+ docFilters={CollectionDockingView.Instance.childDocFilters}
+ docRangeFilters={CollectionDockingView.Instance.childDocRangeFilters}
searchFilterDocs={CollectionDockingView.Instance.searchFilterDocs}
addDocument={undefined}
removeDocument={undefined}
@@ -422,6 +468,7 @@ export class TabMinimapView extends React.Component<TabMinimapViewProps> {
<div className="miniMap" style={{ width: miniSize, height: miniSize, background: this.props.background() }}>
<CollectionFreeFormView
Document={this.props.document}
+ SetSubView={() => this}
CollectionView={undefined}
ContainingCollectionView={undefined}
ContainingCollectionDoc={undefined}
@@ -450,8 +497,8 @@ export class TabMinimapView extends React.Component<TabMinimapViewProps> {
layerProvider={undefined}
addDocTab={this.props.addDocTab}
pinToPres={TabDocView.PinDoc}
- docFilters={CollectionDockingView.Instance.docFilters}
- docRangeFilters={CollectionDockingView.Instance.docRangeFilters}
+ docFilters={CollectionDockingView.Instance.childDocFilters}
+ docRangeFilters={CollectionDockingView.Instance.childDocRangeFilters}
searchFilterDocs={CollectionDockingView.Instance.searchFilterDocs}
fitContentsToDoc={returnTrue}
/>
@@ -460,4 +507,4 @@ export class TabMinimapView extends React.Component<TabMinimapViewProps> {
</div>
</div>;
}
-} \ No newline at end of file
+}
diff --git a/src/client/views/collections/TreeView.scss b/src/client/views/collections/TreeView.scss
index 3f6fc8b0c..1ebc5873e 100644
--- a/src/client/views/collections/TreeView.scss
+++ b/src/client/views/collections/TreeView.scss
@@ -1,4 +1,4 @@
-@import "../globalCssVariables";
+@import "../global/globalCssVariables";
.treeView-label {
max-height: 1.5em;
@@ -14,7 +14,7 @@
.bullet-outline {
position: relative;
width: $TREE_BULLET_WIDTH;
- color: $intermediate-color;
+ color: $medium-gray;
transform: scale(0.5);
display: inline-flex;
align-items: center;
@@ -45,7 +45,7 @@
.bullet {
position: relative;
width: $TREE_BULLET_WIDTH;
- color: $intermediate-color;
+ color: $medium-gray;
margin-top: 3px;
transform: scale(1.3, 1.3);
border: #80808030 1px solid;
diff --git a/src/client/views/collections/TreeView.tsx b/src/client/views/collections/TreeView.tsx
index 2e98fb508..e33c39d20 100644
--- a/src/client/views/collections/TreeView.tsx
+++ b/src/client/views/collections/TreeView.tsx
@@ -20,7 +20,7 @@ import { SnappingManager } from '../../util/SnappingManager';
import { Transform } from '../../util/Transform';
import { undoBatch, UndoManager } from '../../util/UndoManager';
import { EditableView } from "../EditableView";
-import { TREE_BULLET_WIDTH } from '../globalCssVariables.scss';
+import { TREE_BULLET_WIDTH } from '../global/globalCssVariables.scss';
import { DocumentView, DocumentViewProps, StyleProviderFunc, DocumentViewInternal } from '../nodes/DocumentView';
import { FormattedTextBox } from '../nodes/formattedText/FormattedTextBox';
import { RichTextMenu } from '../nodes/formattedText/RichTextMenu';
@@ -151,7 +151,10 @@ export class TreeView extends React.Component<TreeViewProps> {
this.treeViewOpen = !this.treeViewOpen;
} else {
// choose an appropriate alias or make one. --- choose the first alias that (1) user owns, (2) has no context field ... otherwise make a new alias
+ // this.props.addDocTab(CurrentUserUtils.ActiveDashboard.isShared ? Doc.MakeAlias(this.props.document) : this.props.document, "add:right");
+ // choose an appropriate alias or make one -- -- choose the first alias that (1) the user owns, (2) has no context field - if I own it and someone else does not have it open,, otherwise create an alias
this.props.addDocTab(this.props.document, "add:right");
+
}
}
constructor(props: any) {
@@ -261,15 +264,19 @@ export class TreeView extends React.Component<TreeViewProps> {
if (docDragData) {
e.stopPropagation();
if (docDragData.draggedDocuments[0] === this.doc) return true;
- const parentAddDoc = (doc: Doc | Doc[]) => this.props.addDocument(doc, undefined, before);
- const canAdd = !StrCast((inside ? this.props.document : this.props.containerCollection)?.freezeChildren).includes("add") || docDragData.treeViewDoc === this.props.treeView.props.Document;
- const localAdd = (doc: Doc) => Doc.AddDocToList(this.dataDoc, this.fieldKey, doc) && ((doc.context = this.doc.context) || true) ? true : false;
- const addDoc = !inside ? parentAddDoc :
- (doc: Doc | Doc[]) => (doc instanceof Doc ? [doc] : doc).reduce((flg, doc) => flg && localAdd(doc), true as boolean);
- const move = (!docDragData.dropAction || docDragData.dropAction === "proto" || docDragData.dropAction === "move" || docDragData.dropAction === "same") && docDragData.moveDocument;
- if (canAdd) {
- UndoManager.RunInTempBatch(() => docDragData.droppedDocuments.reduce((added, d) => (move ? move(d, undefined, addDoc) || (docDragData.dropAction === "proto" ? addDoc(d) : false) : addDoc(d)) || added, false));
- }
+ this.dropDocuments(docDragData.droppedDocuments, before, inside, docDragData.dropAction, docDragData.moveDocument, docDragData.treeViewDoc === this.props.treeView.props.Document);
+ }
+ }
+
+ dropDocuments(droppedDocuments: Doc[], before: boolean, inside: number | boolean, dropAction: dropActionType, moveDocument: DragManager.MoveFunction | undefined, forceAdd: boolean) {
+ const parentAddDoc = (doc: Doc | Doc[]) => this.props.addDocument(doc, undefined, before);
+ const canAdd = !StrCast((inside ? this.props.document : this.props.containerCollection)?.freezeChildren).includes("add") || forceAdd;
+ const localAdd = (doc: Doc) => Doc.AddDocToList(this.dataDoc, this.fieldKey, doc) && ((doc.context = this.doc.context) || true) ? true : false;
+ const addDoc = !inside ? parentAddDoc :
+ (doc: Doc | Doc[]) => (doc instanceof Doc ? [doc] : doc).reduce((flg, doc) => flg && localAdd(doc), true as boolean);
+ const move = (!dropAction || dropAction === "proto" || dropAction === "move" || dropAction === "same") && moveDocument;
+ if (canAdd) {
+ UndoManager.RunInTempBatch(() => droppedDocuments.reduce((added, d) => (move ? move(d, undefined, addDoc) || (dropAction === "proto" ? addDoc(d) : false) : addDoc(d)) || added, false));
}
}
@@ -507,6 +514,7 @@ export class TreeView extends React.Component<TreeViewProps> {
[{ script: ScriptField.MakeFunction(`DocFocusOrOpen(self)`)!, label: "Focus or Open" }];
}
onChildClick = () => this.props.onChildClick?.() ?? (this._editTitleScript?.() || ScriptCast(this.doc.treeChildClick));
+
onChildDoubleClick = () => (!this.props.treeView.outlineMode && this._openScript?.()) || ScriptCast(this.doc.treeChildDoubleClick);
refocus = () => this.props.treeView.props.focus(this.props.treeView.props.Document);
@@ -727,12 +735,23 @@ export class TreeView extends React.Component<TreeViewProps> {
</div>;
}
+ onTreeDrop = (de: React.DragEvent) => {
+ const pt = [de.clientX, de.clientY];
+ const rect = this._header.current!.getBoundingClientRect();
+ const before = pt[1] < rect.top + rect.height / 2;
+ const inside = this.props.treeView.fileSysMode && !this.doc.isFolder ? false : pt[0] > Math.min(rect.left + 75, rect.left + rect.width * .75) || (!before && this.treeViewOpen && this.childDocList.length);
+
+ const docs = this.props.treeView.onTreeDrop(de, (docs: Doc[]) => this.dropDocuments(docs, before, inside, "copy", undefined, false));
+ }
+
render() {
TraceMobx();
const hideTitle = this.doc.treeViewHideHeader || this.props.treeView.outlineMode;
return this.props.renderedIds.indexOf(this.doc[Id]) !== -1 ? "<" + this.doc.title + ">" : // just print the title of documents we've previously rendered in this hierarchical path to avoid cycles
<div className={`treeView-container${this.props.isContentActive() ? "-active" : ""}`}
ref={this.createTreeDropTarget}
+
+ onDrop={this.onTreeDrop}
//onPointerDown={e => this.props.isContentActive(true) && SelectionManager.DeselectAll()} // bcz: this breaks entering a text filter in a filterBox since it deselects the filter's target document
onKeyDown={this.onKeyDown}>
<li className="collection-child">
diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormLayoutEngines.tsx b/src/client/views/collections/collectionFreeForm/CollectionFreeFormLayoutEngines.tsx
index afc1babeb..37444a9dc 100644
--- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormLayoutEngines.tsx
+++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormLayoutEngines.tsx
@@ -126,7 +126,8 @@ export function computerStarburstLayout(
replica: ""
});
});
- return normalizeResults(scaleDim, 12, docMap, poolData, viewDefsToJSX, [], 0, []);
+ const divider = { type: "div", color: "transparent", x: -burstRadius[0] / 3, y: 0, width: 15, height: 15, payload: undefined };
+ return normalizeResults(scaleDim, 12, docMap, poolData, viewDefsToJSX, [], 0, [divider]);
}
@@ -399,7 +400,7 @@ function normalizeResults(
): ViewDefResult[] {
const grpEles = groupNames.map(gn => ({ x: gn.x, y: gn.y, width: gn.width, height: gn.height }) as ViewDefBounds);
const docEles = Array.from(docMap.entries()).map(ele => ele[1]);
- const aggBounds = aggregateBounds(grpEles.concat(docEles.map(de => ({ ...de, type: "doc", payload: "" }))).filter(e => e.zIndex !== -99), 0, 0);
+ const aggBounds = aggregateBounds(extras.concat(grpEles.concat(docEles.map(de => ({ ...de, type: "doc", payload: "" })))).filter(e => e.zIndex !== -99), 0, 0);
aggBounds.r = Math.max(minWidth, aggBounds.r - aggBounds.x);
const wscale = panelDim[0] / (aggBounds.r - aggBounds.x);
let scale = wscale * (aggBounds.b - aggBounds.y) > panelDim[1] ? (panelDim[1]) / (aggBounds.b - aggBounds.y) : wscale;
diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormRemoteCursors.scss b/src/client/views/collections/collectionFreeForm/CollectionFreeFormRemoteCursors.scss
index c5b8fc5e8..5fa01b102 100644
--- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormRemoteCursors.scss
+++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormRemoteCursors.scss
@@ -1,4 +1,4 @@
-@import "globalCssVariables";
+@import "global/globalCssVariables";
.collectionFreeFormRemoteCursors-cont {
diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.scss b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.scss
index eb0538c41..79e063f7f 100644
--- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.scss
+++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.scss
@@ -1,4 +1,4 @@
-@import "../../globalCssVariables";
+@import "../../global/globalCssVariables";
.collectionfreeformview-none {
position: inherit;
@@ -226,7 +226,7 @@
// linear-gradient(to bottom, $light-color-secondary 1px, transparent 1px);
// background-size: 30px 30px;
// }
- border: 0px solid $light-color-secondary;
+ border: 0px solid $light-gray;
border-radius: inherit;
box-sizing: border-box;
position: absolute;
diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx
index accb80c5a..ba6222605 100644
--- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx
+++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx
@@ -28,7 +28,7 @@ import { SelectionManager } from "../../../util/SelectionManager";
import { SnappingManager } from "../../../util/SnappingManager";
import { Transform } from "../../../util/Transform";
import { undoBatch } from "../../../util/UndoManager";
-import { COLLECTION_BORDER_WIDTH } from "../../../views/globalCssVariables.scss";
+import { COLLECTION_BORDER_WIDTH } from "../../../views/global/globalCssVariables.scss";
import { Timeline } from "../../animationtimeline/Timeline";
import { ContextMenu } from "../../ContextMenu";
import { DocumentDecorations } from "../../DocumentDecorations";
@@ -38,7 +38,7 @@ import { CollectionFreeFormDocumentView } from "../../nodes/CollectionFreeFormDo
import { DocFocusOptions, DocumentView, DocumentViewProps, ViewAdjustment, ViewSpecPrefix } from "../../nodes/DocumentView";
import { FormattedTextBox } from "../../nodes/formattedText/FormattedTextBox";
import { pageSchema } from "../../nodes/ImageBox";
-import { PresBox } from "../../nodes/PresBox";
+import { PresBox } from "../../nodes/trails/PresBox";
import { StyleLayers, StyleProp } from "../../StyleProvider";
import { CollectionDockingView } from "../CollectionDockingView";
import { CollectionSubView } from "../CollectionSubView";
@@ -48,6 +48,7 @@ import { CollectionFreeFormRemoteCursors } from "./CollectionFreeFormRemoteCurso
import "./CollectionFreeFormView.scss";
import { MarqueeView } from "./MarqueeView";
import React = require("react");
+import { DocumentType } from "../../../documents/DocumentTypes";
export const panZoomSchema = createSchema({
_panX: "number",
@@ -109,8 +110,6 @@ export class CollectionFreeFormView extends CollectionSubView<PanZoomDocument, P
@observable _timelineRef = React.createRef<Timeline>();
@observable _marqueeRef = React.createRef<HTMLDivElement>();
@observable _keyframeEditing = false;
- @observable _focusFilters: Opt<string[]>; // docFilters that are overridden when previewing a link to an anchor which has docFilters set on it
- @observable _focusRangeFilters: Opt<string[]>; // docRangeFilters that are overridden when previewing a link to an anchor which has docRangeFilters set on it
@observable ChildDrag: DocumentView | undefined; // child document view being dragged. needed to update drop areas of groups when a group item is dragged.
@computed get views() { return this._layoutElements.filter(ele => ele.bounds && !ele.bounds.z).map(ele => ele.ele); }
@@ -158,8 +157,6 @@ export class CollectionFreeFormView extends CollectionSubView<PanZoomDocument, P
this.layoutDoc._viewScale = vals.scale;
}
freeformData = (force?: boolean) => this.fitToContent || force ? this.fitToContentVals : undefined;
- freeformDocFilters = () => this._focusFilters || this.docFilters();
- freeformRangeDocFilters = () => this._focusRangeFilters || this.docRangeFilters();
reverseNativeScaling = () => this.fitToContent ? true : false;
panX = () => this.freeformData()?.bounds.cx ?? NumCast(this.Document._panX);
panY = () => this.freeformData()?.bounds.cy ?? NumCast(this.Document._panY);
@@ -1029,8 +1026,8 @@ export class CollectionFreeFormView extends CollectionSubView<PanZoomDocument, P
ScreenToLocalTransform={childLayout.z ? this.getTransformOverlay : this.getTransform}
PanelWidth={childLayout[WidthSym]}
PanelHeight={childLayout[HeightSym]}
- docFilters={this.freeformDocFilters}
- docRangeFilters={this.freeformRangeDocFilters}
+ docFilters={this.childDocFilters}
+ docRangeFilters={this.childDocRangeFilters}
searchFilterDocs={this.searchFilterDocs}
isContentActive={this.isAnnotationOverlay ? this.props.isContentActive : returnFalse}
isDocumentActive={this.props.childDocumentsActive ? this.props.isDocumentActive : this.isContentActive}
@@ -1196,14 +1193,21 @@ export class CollectionFreeFormView extends CollectionSubView<PanZoomDocument, P
if (preview) {
this._focusFilters = StrListCast(Doc.GetProto(anchor).docFilters);
this._focusRangeFilters = StrListCast(Doc.GetProto(anchor).docRangeFilters);
- } else if (anchor.pivotField !== undefined) {
- this.layoutDoc._docFilters = new List<string>(StrListCast(anchor.docFilters));
- this.layoutDoc._docRangeFilters = new List<string>(StrListCast(anchor.docRangeFilters));
+ } else {
+ if (anchor.docFilters) {
+ this.layoutDoc._docFilters = new List<string>(StrListCast(anchor.docFilters));
+ }
+ if (anchor.docRangeFilters) {
+ this.layoutDoc._docRangeFilters = new List<string>(StrListCast(anchor.docRangeFilters));
+ }
}
return 0;
}
getAnchor = () => {
+ if (this.props.Document.annotationOn) {
+ return this.rootDoc;
+ }
const anchor = Docs.Create.TextanchorDocument({ title: StrCast(this.layoutDoc._viewType), annotationOn: this.rootDoc });
const proto = Doc.GetProto(anchor);
proto[ViewSpecPrefix + "_viewType"] = this.layoutDoc._viewType;
@@ -1486,7 +1490,8 @@ export class CollectionFreeFormView extends CollectionSubView<PanZoomDocument, P
onDragOver={e => e.preventDefault()}
onContextMenu={this.onContextMenu}
style={{
- pointerEvents: this.backgroundEvents ? "all" : this.props.pointerEvents as any,
+ pointerEvents: this.props.Document.type === DocumentType.MARKER ? "none" : // bcz: ugh.. this is here to prevent markers, which render as freeform views, from grabbing events -- need a better approach.
+ this.backgroundEvents ? "all" : this.props.pointerEvents as any,
transform: `scale(${this.contentScaling || 1})`,
width: `${100 / (this.contentScaling || 1)}%`,
height: this.isAnnotationOverlay && this.Document.scrollHeight ? this.Document.scrollHeight : `${100 / (this.contentScaling || 1)}%`// : this.isAnnotationOverlay ? (this.Document.scrollHeight ? this.Document.scrollHeight : "100%") : this.props.PanelHeight()
diff --git a/src/client/views/collections/collectionFreeForm/MarqueeView.tsx b/src/client/views/collections/collectionFreeForm/MarqueeView.tsx
index b1f2750c3..846d28214 100644
--- a/src/client/views/collections/collectionFreeForm/MarqueeView.tsx
+++ b/src/client/views/collections/collectionFreeForm/MarqueeView.tsx
@@ -19,7 +19,8 @@ import { Transform } from "../../../util/Transform";
import { undoBatch, UndoManager } from "../../../util/UndoManager";
import { ContextMenu } from "../../ContextMenu";
import { FormattedTextBox } from "../../nodes/formattedText/FormattedTextBox";
-import { PresBox, PresMovement } from "../../nodes/PresBox";
+import { PresBox } from "../../nodes/trails/PresBox";
+import { PresMovement } from "../../nodes/trails/PresEnums";
import { PreviewCursor } from "../../PreviewCursor";
import { CollectionDockingView } from "../CollectionDockingView";
import { SubCollectionViewProps } from "../CollectionSubView";
@@ -368,8 +369,8 @@ export class MarqueeView extends React.Component<SubCollectionViewProps & Marque
SelectionManager.DeselectAll();
selected.forEach(d => this.props.removeDocument?.(d));
const newCollection = DocUtils.pileup(selected, this.Bounds.left + this.Bounds.width / 2, this.Bounds.top + this.Bounds.height / 2);
- this.props.addDocument?.(newCollection!);
- this.props.selectDocuments([newCollection!]);
+ this.props.addDocument?.(newCollection);
+ this.props.selectDocuments([newCollection]);
MarqueeOptionsMenu.Instance.fadeOut(true);
this.hideMarquee();
}
diff --git a/src/client/views/collections/collectionMulticolumn/CollectionMulticolumnView.tsx b/src/client/views/collections/collectionMulticolumn/CollectionMulticolumnView.tsx
index f3a39a262..65c345547 100644
--- a/src/client/views/collections/collectionMulticolumn/CollectionMulticolumnView.tsx
+++ b/src/client/views/collections/collectionMulticolumn/CollectionMulticolumnView.tsx
@@ -237,8 +237,8 @@ export class CollectionMulticolumnView extends CollectionSubView(MulticolumnDocu
onDoubleClick={this.onChildDoubleClickHandler}
ScreenToLocalTransform={dxf}
focus={this.props.focus}
- docFilters={this.docFilters}
- docRangeFilters={this.docRangeFilters}
+ docFilters={this.childDocFilters}
+ docRangeFilters={this.childDocRangeFilters}
searchFilterDocs={this.searchFilterDocs}
ContainingCollectionDoc={this.props.CollectionView?.props.Document}
ContainingCollectionView={this.props.CollectionView}
diff --git a/src/client/views/collections/collectionMulticolumn/CollectionMultirowView.tsx b/src/client/views/collections/collectionMulticolumn/CollectionMultirowView.tsx
index 29cb3511a..30836854a 100644
--- a/src/client/views/collections/collectionMulticolumn/CollectionMultirowView.tsx
+++ b/src/client/views/collections/collectionMulticolumn/CollectionMultirowView.tsx
@@ -236,9 +236,9 @@ export class CollectionMultirowView extends CollectionSubView(MultirowDocument)
onDoubleClick={this.onChildDoubleClickHandler}
ScreenToLocalTransform={dxf}
focus={this.props.focus}
- docFilters={this.docFilters}
+ docFilters={this.childDocFilters}
isContentActive={returnFalse}
- docRangeFilters={this.docRangeFilters}
+ docRangeFilters={this.childDocRangeFilters}
searchFilterDocs={this.searchFilterDocs}
ContainingCollectionDoc={this.props.CollectionView?.props.Document}
ContainingCollectionView={this.props.CollectionView}
diff --git a/src/client/views/collections/CollectionSchemaCells.tsx b/src/client/views/collections/collectionSchema/CollectionSchemaCells.tsx
index 2e6186680..fd99abce5 100644
--- a/src/client/views/collections/CollectionSchemaCells.tsx
+++ b/src/client/views/collections/collectionSchema/CollectionSchemaCells.tsx
@@ -6,33 +6,34 @@ import DatePicker from "react-datepicker";
import "react-datepicker/dist/react-datepicker.css";
import { CellInfo } from "react-table";
import "react-table/react-table.css";
-import { DateField } from "../../../fields/DateField";
-import { Doc, DocListCast, Field, Opt } from "../../../fields/Doc";
-import { Id } from "../../../fields/FieldSymbols";
-import { List } from "../../../fields/List";
-import { SchemaHeaderField } from "../../../fields/SchemaHeaderField";
-import { ComputedField } from "../../../fields/ScriptField";
-import { BoolCast, Cast, DateCast, FieldValue, NumCast, StrCast } from "../../../fields/Types";
-import { ImageField } from "../../../fields/URLField";
-import { Utils, emptyFunction } from "../../../Utils";
-import { Docs } from "../../documents/Documents";
-import { DocumentType } from "../../documents/DocumentTypes";
-import { DocumentManager } from "../../util/DocumentManager";
-import { DragManager } from "../../util/DragManager";
-import { KeyCodes } from "../../util/KeyCodes";
-import { CompileScript } from "../../util/Scripting";
-import { SearchUtil } from "../../util/SearchUtil";
-import { SnappingManager } from "../../util/SnappingManager";
-import { undoBatch } from "../../util/UndoManager";
-import '../DocumentDecorations.scss';
-import { EditableView } from "../EditableView";
-import { MAX_ROW_HEIGHT } from '../globalCssVariables.scss';
-import { DocumentIconContainer } from "../nodes/DocumentIcon";
-import { OverlayView } from "../OverlayView";
+import { DateField } from "../../../../fields/DateField";
+import { Doc, DocListCast, Field, Opt } from "../../../../fields/Doc";
+import { Id } from "../../../../fields/FieldSymbols";
+import { List } from "../../../../fields/List";
+import { SchemaHeaderField } from "../../../../fields/SchemaHeaderField";
+import { ComputedField } from "../../../../fields/ScriptField";
+import { BoolCast, Cast, DateCast, FieldValue, NumCast, StrCast } from "../../../../fields/Types";
+import { ImageField } from "../../../../fields/URLField";
+import { Utils, emptyFunction } from "../../../../Utils";
+import { Docs } from "../../../documents/Documents";
+import { DocumentType } from "../../../documents/DocumentTypes";
+import { DocumentManager } from "../../../util/DocumentManager";
+import { DragManager } from "../../../util/DragManager";
+import { KeyCodes } from "../../../util/KeyCodes";
+import { CompileScript } from "../../../util/Scripting";
+import { SearchUtil } from "../../../util/SearchUtil";
+import { SnappingManager } from "../../../util/SnappingManager";
+import { undoBatch } from "../../../util/UndoManager";
+import '../../../views/DocumentDecorations.scss';
+import { EditableView } from "../../EditableView";
+import { MAX_ROW_HEIGHT } from '../../global/globalCssVariables.scss';
+import { DocumentIconContainer } from "../../nodes/DocumentIcon";
+import { OverlayView } from "../../OverlayView";
import "./CollectionSchemaView.scss";
-import { CollectionView } from "./CollectionView";
+import { CollectionView } from "../CollectionView";
const path = require('path');
+// intialize cell properties
export interface CellProps {
row: number;
col: number;
@@ -102,6 +103,7 @@ export class CollectionSchemaCell extends React.Component<CellProps> {
this.props.changeFocusedCellByIndex(this.props.row, this.props.col);
this.props.setPreviewDoc(this.props.rowProps.original);
+ console.log("click cell");
let url: string;
if (url = StrCast(this.props.rowProps.row.href)) {
try {
@@ -236,14 +238,69 @@ export class CollectionSchemaCell extends React.Component<CellProps> {
Field.IsField(cfield) ? Field.toScriptString(cfield) : "";
}}
SetValue={action((value: string) => {
+ // sets what is displayed after the user makes an input
let retVal = false;
if (value.startsWith(":=") || value.startsWith("=:=")) {
+ // decides how to compute a value when given either of the above strings
const script = value.substring(value.startsWith("=:=") ? 3 : 2);
retVal = this.props.setComputed(script, value.startsWith(":=") ? this._rowDataDoc : this._rowDoc, this.renderFieldKey, this.props.row, this.props.col);
} else {
- const inputscript = value.substring(value.startsWith("=") ? 1 : 0);
- const script = CompileScript(inputscript, { requiredType: type, typecheck: false, editable: true, addReturn: true, params: { this: Doc.name, $r: "number", $c: "number", $: "any" } });
- script.compiled && (retVal = this.applyToDoc(inputscript.length !== value.length ? this._rowDoc : this._rowDataDoc, this.props.row, this.props.col, script.run));
+ // check if the input is a number
+ let inputIsNum = true;
+ for (const s of value) {
+ if (isNaN(parseInt(s)) && !(s === ".") && !(s === ",")) {
+ inputIsNum = false;
+ }
+ }
+ // check if the input is a boolean
+ const inputIsBool: boolean = value === "false" || value === "true";
+ // what to do in the case
+ if (!inputIsNum && !inputIsBool && !value.startsWith("=")) {
+ // if it's not a number, it's a string, and should be processed as such
+ // strips the string of quotes when it is edited to prevent quotes form being added to the text automatically
+ // after each edit
+ let valueSansQuotes = value;
+ if (this._isEditing) {
+ const vsqLength = valueSansQuotes.length;
+ // get rid of outer quotes
+ valueSansQuotes = valueSansQuotes.substring(value.startsWith("\"") ? 1 : 0,
+ valueSansQuotes.charAt(vsqLength - 1) === "\"" ? vsqLength - 1 : vsqLength);
+ }
+ let inputAsString = '"';
+ // escape any quotes in the string
+ for (const i of valueSansQuotes) {
+ if (i === '"') {
+ inputAsString += '\\"';
+ } else {
+ inputAsString += i;
+ }
+ }
+ // add a closing quote
+ inputAsString += '"';
+ //two options here: we can strip off outer quotes or we can figure out what's going on with the script
+ const script = CompileScript(inputAsString, { requiredType: type, typecheck: false, editable: true, addReturn: true, params: { this: Doc.name, $r: "number", $c: "number", $: "any" } });
+ const changeMade = inputAsString.length !== value.length || inputAsString.length - 2 !== value.length;
+ script.compiled && (retVal = this.applyToDoc(changeMade ? this._rowDoc : this._rowDataDoc, this.props.row, this.props.col, script.run));
+ // handle numbers and expressions
+ } else if (inputIsNum || value.startsWith("=")) {
+ //TODO: make accept numbers
+ const inputscript = value.substring(value.startsWith("=") ? 1 : 0);
+ // if commas are not stripped, the parser only considers the numbers after the last comma
+ let inputSansCommas = "";
+ for (const s of inputscript) {
+ if (!(s === ",")) {
+ inputSansCommas += s;
+ }
+ }
+ const script = CompileScript(inputSansCommas, { requiredType: type, typecheck: false, editable: true, addReturn: true, params: { this: Doc.name, $r: "number", $c: "number", $: "any" } });
+ const changeMade = value.length !== value.length || value.length - 2 !== value.length;
+ script.compiled && (retVal = this.applyToDoc(changeMade ? this._rowDoc : this._rowDataDoc, this.props.row, this.props.col, script.run));
+ // handle booleans
+ } else if (inputIsBool) {
+ const script = CompileScript(value, { requiredType: type, typecheck: false, editable: true, addReturn: true, params: { this: Doc.name, $r: "number", $c: "number", $: "any" } });
+ const changeMade = value.length !== value.length || value.length - 2 !== value.length;
+ script.compiled && (retVal = this.applyToDoc(changeMade ? this._rowDoc : this._rowDataDoc, this.props.row, this.props.col, script.run));
+ }
}
if (retVal) {
this._isEditing = false; // need to set this here. otherwise, the assignment of the field will invalidate & cause render() to be called with the wrong value for 'editing'
@@ -318,7 +375,7 @@ export class CollectionSchemaDocCell extends CollectionSchemaCell {
const script = CompileScript(value, {
addReturn: true,
- typecheck: false,
+ typecheck: true,
transformer: DocumentIconContainer.getTransformer()
});
diff --git a/src/client/views/collections/CollectionSchemaHeaders.tsx b/src/client/views/collections/collectionSchema/CollectionSchemaHeaders.tsx
index 3b52e6408..b2115b22e 100644
--- a/src/client/views/collections/CollectionSchemaHeaders.tsx
+++ b/src/client/views/collections/collectionSchema/CollectionSchemaHeaders.tsx
@@ -3,16 +3,16 @@ import { IconProp, library } from "@fortawesome/fontawesome-svg-core";
import { FontAwesomeIcon } from "@fortawesome/react-fontawesome";
import { action, computed, observable, runInAction } from "mobx";
import { observer } from "mobx-react";
-import { Doc, DocListCast, Opt } from "../../../fields/Doc";
-import { listSpec } from "../../../fields/Schema";
-import { PastelSchemaPalette, SchemaHeaderField } from "../../../fields/SchemaHeaderField";
-import { ScriptField } from "../../../fields/ScriptField";
-import { Cast, StrCast } from "../../../fields/Types";
-import { undoBatch } from "../../util/UndoManager";
-import { SearchBox } from "../search/SearchBox";
+import { Doc, DocListCast, Opt } from "../../../../fields/Doc";
+import { listSpec } from "../../../../fields/Schema";
+import { PastelSchemaPalette, SchemaHeaderField } from "../../../../fields/SchemaHeaderField";
+import { ScriptField } from "../../../../fields/ScriptField";
+import { Cast, StrCast } from "../../../../fields/Types";
+import { undoBatch } from "../../../util/UndoManager";
+import { SearchBox } from "../../search/SearchBox";
import { ColumnType } from "./CollectionSchemaView";
import "./CollectionSchemaView.scss";
-import { CollectionView } from "./CollectionView";
+import { CollectionView } from "../CollectionView";
const higflyout = require("@hig/flyout");
export const { anchorPoints } = higflyout;
diff --git a/src/client/views/collections/collectionSchema/CollectionSchemaMovableColumn.tsx b/src/client/views/collections/collectionSchema/CollectionSchemaMovableColumn.tsx
new file mode 100644
index 000000000..456c38c68
--- /dev/null
+++ b/src/client/views/collections/collectionSchema/CollectionSchemaMovableColumn.tsx
@@ -0,0 +1,128 @@
+import React = require("react");
+import { FontAwesomeIcon } from "@fortawesome/react-fontawesome";
+import { action } from "mobx";
+import { ReactTableDefaults, RowInfo, TableCellRenderer } from "react-table";
+import { Doc } from "../../../../fields/Doc";
+import { SchemaHeaderField } from "../../../../fields/SchemaHeaderField";
+import { Cast, FieldValue, StrCast } from "../../../../fields/Types";
+import { DocumentManager } from "../../../util/DocumentManager";
+import { DragManager, dropActionType, SetupDrag } from "../../../util/DragManager";
+import { SnappingManager } from "../../../util/SnappingManager";
+import { Transform } from "../../../util/Transform";
+import { undoBatch } from "../../../util/UndoManager";
+import { ContextMenu } from "../../ContextMenu";
+import "./CollectionSchemaView.scss";
+
+export interface MovableColumnProps {
+ columnRenderer: TableCellRenderer;
+ columnValue: SchemaHeaderField;
+ allColumns: SchemaHeaderField[];
+ reorderColumns: (toMove: SchemaHeaderField, relativeTo: SchemaHeaderField, before: boolean, columns: SchemaHeaderField[]) => void;
+ ScreenToLocalTransform: () => Transform;
+}
+export class MovableColumn extends React.Component<MovableColumnProps> {
+ private _header?: React.RefObject<HTMLDivElement> = React.createRef();
+ private _colDropDisposer?: DragManager.DragDropDisposer;
+ private _startDragPosition: { x: number, y: number } = { x: 0, y: 0 };
+ private _sensitivity: number = 16;
+ private _dragRef: React.RefObject<HTMLDivElement> = React.createRef();
+
+ onPointerEnter = (e: React.PointerEvent): void => {
+ if (e.buttons === 1 && SnappingManager.GetIsDragging()) {
+ this._header!.current!.className = "collectionSchema-col-wrapper";
+ document.addEventListener("pointermove", this.onDragMove, true);
+ }
+ }
+ onPointerLeave = (e: React.PointerEvent): void => {
+ this._header!.current!.className = "collectionSchema-col-wrapper";
+ document.removeEventListener("pointermove", this.onDragMove, true);
+ !e.buttons && document.removeEventListener("pointermove", this.onPointerMove);
+ }
+ onDragMove = (e: PointerEvent): void => {
+ const x = this.props.ScreenToLocalTransform().transformPoint(e.clientX, e.clientY);
+ const rect = this._header!.current!.getBoundingClientRect();
+ const bounds = this.props.ScreenToLocalTransform().transformPoint(rect.left + ((rect.right - rect.left) / 2), rect.top);
+ const before = x[0] < bounds[0];
+ this._header!.current!.className = "collectionSchema-col-wrapper";
+ if (before) this._header!.current!.className += " col-before";
+ if (!before) this._header!.current!.className += " col-after";
+ e.stopPropagation();
+ }
+
+ createColDropTarget = (ele: HTMLDivElement) => {
+ this._colDropDisposer?.();
+ if (ele) {
+ this._colDropDisposer = DragManager.MakeDropTarget(ele, this.colDrop.bind(this));
+ }
+ }
+
+ colDrop = (e: Event, de: DragManager.DropEvent) => {
+ document.removeEventListener("pointermove", this.onDragMove, true);
+ const x = this.props.ScreenToLocalTransform().transformPoint(de.x, de.y);
+ const rect = this._header!.current!.getBoundingClientRect();
+ const bounds = this.props.ScreenToLocalTransform().transformPoint(rect.left + ((rect.right - rect.left) / 2), rect.top);
+ const before = x[0] < bounds[0];
+ const colDragData = de.complete.columnDragData;
+ if (colDragData) {
+ e.stopPropagation();
+ this.props.reorderColumns(colDragData.colKey, this.props.columnValue, before, this.props.allColumns);
+ return true;
+ }
+ return false;
+ }
+
+ onPointerMove = (e: PointerEvent) => {
+ const onRowMove = (e: PointerEvent) => {
+ e.stopPropagation();
+ e.preventDefault();
+
+ document.removeEventListener("pointermove", onRowMove);
+ document.removeEventListener('pointerup', onRowUp);
+ const dragData = new DragManager.ColumnDragData(this.props.columnValue);
+ DragManager.StartColumnDrag(this._dragRef.current!, dragData, e.x, e.y);
+ };
+ const onRowUp = (): void => {
+ document.removeEventListener("pointermove", onRowMove);
+ document.removeEventListener('pointerup', onRowUp);
+ };
+ if (e.buttons === 1) {
+ const [dx, dy] = this.props.ScreenToLocalTransform().transformDirection(e.clientX - this._startDragPosition.x, e.clientY - this._startDragPosition.y);
+ if (Math.abs(dx) + Math.abs(dy) > this._sensitivity) {
+ document.removeEventListener("pointermove", this.onPointerMove);
+ e.stopPropagation();
+
+ document.addEventListener("pointermove", onRowMove);
+ document.addEventListener("pointerup", onRowUp);
+ }
+ }
+ }
+
+ onPointerUp = (e: React.PointerEvent) => {
+ document.removeEventListener("pointermove", this.onPointerMove);
+ }
+
+ @action
+ onPointerDown = (e: React.PointerEvent, ref: React.RefObject<HTMLDivElement>) => {
+ this._dragRef = ref;
+ const [dx, dy] = this.props.ScreenToLocalTransform().transformDirection(e.clientX, e.clientY);
+ if (!(e.target as any)?.tagName.includes("INPUT")) {
+ this._startDragPosition = { x: dx, y: dy };
+ document.addEventListener("pointermove", this.onPointerMove);
+ }
+ }
+
+
+ render() {
+ const reference = React.createRef<HTMLDivElement>();
+
+ return (
+ <div className="collectionSchema-col" ref={this.createColDropTarget}>
+ <div className="collectionSchema-col-wrapper" ref={this._header} onPointerEnter={this.onPointerEnter} onPointerLeave={this.onPointerLeave}>
+ <div className="col-dragger" ref={reference} onPointerDown={e => this.onPointerDown(e, reference)} onPointerUp={this.onPointerUp}>
+ {this.props.columnRenderer}
+ </div>
+ </div>
+ </div>
+ );
+ }
+}
diff --git a/src/client/views/collections/CollectionSchemaMovableTableHOC.tsx b/src/client/views/collections/collectionSchema/CollectionSchemaMovableRow.tsx
index 881246bd4..f48906ba5 100644
--- a/src/client/views/collections/CollectionSchemaMovableTableHOC.tsx
+++ b/src/client/views/collections/collectionSchema/CollectionSchemaMovableRow.tsx
@@ -2,131 +2,17 @@ import React = require("react");
import { FontAwesomeIcon } from "@fortawesome/react-fontawesome";
import { action } from "mobx";
import { ReactTableDefaults, RowInfo, TableCellRenderer } from "react-table";
-import { Doc } from "../../../fields/Doc";
-import { SchemaHeaderField } from "../../../fields/SchemaHeaderField";
-import { Cast, FieldValue, StrCast } from "../../../fields/Types";
-import { DocumentManager } from "../../util/DocumentManager";
-import { DragManager, dropActionType, SetupDrag } from "../../util/DragManager";
-import { SnappingManager } from "../../util/SnappingManager";
-import { Transform } from "../../util/Transform";
-import { undoBatch } from "../../util/UndoManager";
-import { ContextMenu } from "../ContextMenu";
+import { Doc } from "../../../../fields/Doc";
+import { SchemaHeaderField } from "../../../../fields/SchemaHeaderField";
+import { Cast, FieldValue, StrCast } from "../../../../fields/Types";
+import { DocumentManager } from "../../../util/DocumentManager";
+import { DragManager, dropActionType, SetupDrag } from "../../../util/DragManager";
+import { SnappingManager } from "../../../util/SnappingManager";
+import { Transform } from "../../../util/Transform";
+import { undoBatch } from "../../../util/UndoManager";
+import { ContextMenu } from "../../ContextMenu";
import "./CollectionSchemaView.scss";
-export interface MovableColumnProps {
- columnRenderer: TableCellRenderer;
- columnValue: SchemaHeaderField;
- allColumns: SchemaHeaderField[];
- reorderColumns: (toMove: SchemaHeaderField, relativeTo: SchemaHeaderField, before: boolean, columns: SchemaHeaderField[]) => void;
- ScreenToLocalTransform: () => Transform;
-}
-export class MovableColumn extends React.Component<MovableColumnProps> {
- private _header?: React.RefObject<HTMLDivElement> = React.createRef();
- private _colDropDisposer?: DragManager.DragDropDisposer;
- private _startDragPosition: { x: number, y: number } = { x: 0, y: 0 };
- private _sensitivity: number = 16;
- private _dragRef: React.RefObject<HTMLDivElement> = React.createRef();
-
- onPointerEnter = (e: React.PointerEvent): void => {
- if (e.buttons === 1 && SnappingManager.GetIsDragging()) {
- this._header!.current!.className = "collectionSchema-col-wrapper";
- document.addEventListener("pointermove", this.onDragMove, true);
- }
- }
- onPointerLeave = (e: React.PointerEvent): void => {
- this._header!.current!.className = "collectionSchema-col-wrapper";
- document.removeEventListener("pointermove", this.onDragMove, true);
- !e.buttons && document.removeEventListener("pointermove", this.onPointerMove);
- }
- onDragMove = (e: PointerEvent): void => {
- const x = this.props.ScreenToLocalTransform().transformPoint(e.clientX, e.clientY);
- const rect = this._header!.current!.getBoundingClientRect();
- const bounds = this.props.ScreenToLocalTransform().transformPoint(rect.left + ((rect.right - rect.left) / 2), rect.top);
- const before = x[0] < bounds[0];
- this._header!.current!.className = "collectionSchema-col-wrapper";
- if (before) this._header!.current!.className += " col-before";
- if (!before) this._header!.current!.className += " col-after";
- e.stopPropagation();
- }
-
- createColDropTarget = (ele: HTMLDivElement) => {
- this._colDropDisposer?.();
- if (ele) {
- this._colDropDisposer = DragManager.MakeDropTarget(ele, this.colDrop.bind(this));
- }
- }
-
- colDrop = (e: Event, de: DragManager.DropEvent) => {
- document.removeEventListener("pointermove", this.onDragMove, true);
- const x = this.props.ScreenToLocalTransform().transformPoint(de.x, de.y);
- const rect = this._header!.current!.getBoundingClientRect();
- const bounds = this.props.ScreenToLocalTransform().transformPoint(rect.left + ((rect.right - rect.left) / 2), rect.top);
- const before = x[0] < bounds[0];
- const colDragData = de.complete.columnDragData;
- if (colDragData) {
- e.stopPropagation();
- this.props.reorderColumns(colDragData.colKey, this.props.columnValue, before, this.props.allColumns);
- return true;
- }
- return false;
- }
-
- onPointerMove = (e: PointerEvent) => {
- const onRowMove = (e: PointerEvent) => {
- e.stopPropagation();
- e.preventDefault();
-
- document.removeEventListener("pointermove", onRowMove);
- document.removeEventListener('pointerup', onRowUp);
- const dragData = new DragManager.ColumnDragData(this.props.columnValue);
- DragManager.StartColumnDrag(this._dragRef.current!, dragData, e.x, e.y);
- };
- const onRowUp = (): void => {
- document.removeEventListener("pointermove", onRowMove);
- document.removeEventListener('pointerup', onRowUp);
- };
- if (e.buttons === 1) {
- const [dx, dy] = this.props.ScreenToLocalTransform().transformDirection(e.clientX - this._startDragPosition.x, e.clientY - this._startDragPosition.y);
- if (Math.abs(dx) + Math.abs(dy) > this._sensitivity) {
- document.removeEventListener("pointermove", this.onPointerMove);
- e.stopPropagation();
-
- document.addEventListener("pointermove", onRowMove);
- document.addEventListener("pointerup", onRowUp);
- }
- }
- }
-
- onPointerUp = (e: React.PointerEvent) => {
- document.removeEventListener("pointermove", this.onPointerMove);
- }
-
- @action
- onPointerDown = (e: React.PointerEvent, ref: React.RefObject<HTMLDivElement>) => {
- this._dragRef = ref;
- const [dx, dy] = this.props.ScreenToLocalTransform().transformDirection(e.clientX, e.clientY);
- if (!(e.target as any)?.tagName.includes("INPUT")) {
- this._startDragPosition = { x: dx, y: dy };
- document.addEventListener("pointermove", this.onPointerMove);
- }
- }
-
-
- render() {
- const reference = React.createRef<HTMLDivElement>();
-
- return (
- <div className="collectionSchema-col" ref={this.createColDropTarget}>
- <div className="collectionSchema-col-wrapper" ref={this._header} onPointerEnter={this.onPointerEnter} onPointerLeave={this.onPointerLeave}>
- <div className="col-dragger" ref={reference} onPointerDown={e => this.onPointerDown(e, reference)} onPointerUp={this.onPointerUp}>
- {this.props.columnRenderer}
- </div>
- </div>
- </div>
- );
- }
-}
-
export interface MovableRowProps {
rowInfo: RowInfo;
ScreenToLocalTransform: () => Transform;
@@ -143,16 +29,20 @@ export class MovableRow extends React.Component<MovableRowProps> {
private _header?: React.RefObject<HTMLDivElement> = React.createRef();
private _rowDropDisposer?: DragManager.DragDropDisposer;
+ // Event listeners are only necessary when the user is hovering over the table
+ // Create one when the mouse starts hovering...
onPointerEnter = (e: React.PointerEvent): void => {
if (e.buttons === 1 && SnappingManager.GetIsDragging()) {
this._header!.current!.className = "collectionSchema-row-wrapper";
document.addEventListener("pointermove", this.onDragMove, true);
}
}
+ // ... and delete it when the mouse leaves
onPointerLeave = (e: React.PointerEvent): void => {
this._header!.current!.className = "collectionSchema-row-wrapper";
document.removeEventListener("pointermove", this.onDragMove, true);
}
+ // The method for the event listener, reorders columns when dragged to their new locations.
onDragMove = (e: PointerEvent): void => {
const x = this.props.ScreenToLocalTransform().transformPoint(e.clientX, e.clientY);
const rect = this._header!.current!.getBoundingClientRect();
@@ -167,14 +57,14 @@ export class MovableRow extends React.Component<MovableRowProps> {
this._rowDropDisposer?.();
}
-
+ //
createRowDropTarget = (ele: HTMLDivElement) => {
this._rowDropDisposer?.();
if (ele) {
this._rowDropDisposer = DragManager.MakeDropTarget(ele, this.rowDrop.bind(this));
}
}
-
+ // Controls what hppens when a row is dragged and dropped
rowDrop = (e: Event, de: DragManager.DropEvent) => {
this.onPointerLeave(e as any);
const rowDoc = FieldValue(Cast(this.props.rowInfo.original, Doc));
@@ -201,7 +91,6 @@ export class MovableRow extends React.Component<MovableRowProps> {
}
onRowContextMenu = (e: React.MouseEvent): void => {
- e.preventDefault();
const description = this.props.rowWrapped ? "Unwrap text on row" : "Text wrap row";
ContextMenu.Instance.addItem({ description: description, event: () => this.props.textWrapRow(this.props.rowInfo.original), icon: "file-pdf" });
}
diff --git a/src/client/views/collections/CollectionSchemaView.scss b/src/client/views/collections/collectionSchema/CollectionSchemaView.scss
index 2bdd280ec..40cdcd14b 100644
--- a/src/client/views/collections/CollectionSchemaView.scss
+++ b/src/client/views/collections/collectionSchema/CollectionSchemaView.scss
@@ -1,8 +1,7 @@
-@import "../globalCssVariables";
-
+@import "../../global/globalCssVariables.scss";
.collectionSchemaView-container {
border-width: $COLLECTION_BORDER_WIDTH;
- border-color: $intermediate-color;
+ border-color: $medium-gray;
border-style: solid;
border-radius: $border-radius;
box-sizing: border-box;
@@ -16,17 +15,13 @@
justify-content: space-between;
flex-wrap: nowrap;
touch-action: none;
-
div {
touch-action: none;
}
-
-
.collectionSchemaView-tableContainer {
width: 100%;
height: 100%;
}
-
.collectionSchemaView-dividerDragger {
position: relative;
height: 100%;
@@ -37,15 +32,14 @@
background: gray;
cursor: col-resize;
}
-
// .documentView-node:first-child {
- // background: $light-color;
+ // background: $white;
// }
}
.collectionSchemaView-searchContainer {
border-width: $COLLECTION_BORDER_WIDTH;
- border-color: $intermediate-color;
+ border-color: $medium-gray;
border-style: solid;
border-radius: $border-radius;
box-sizing: border-box;
@@ -60,17 +54,13 @@
flex-wrap: nowrap;
touch-action: none;
padding: 2px;
-
div {
touch-action: none;
}
-
-
.collectionSchemaView-tableContainer {
width: 100%;
height: 100%;
}
-
.collectionSchemaView-dividerDragger {
position: relative;
height: 100%;
@@ -81,9 +71,8 @@
background: gray;
cursor: col-resize;
}
-
// .documentView-node:first-child {
- // background: $light-color;
+ // background: $white;
// }
}
@@ -93,7 +82,6 @@
box-sizing: border-box;
border: none !important;
float: none !important;
-
.rt-table {
height: 100%;
display: -webkit-inline-box;
@@ -103,12 +91,10 @@
.rt-noData {
display: none;
}
-
.rt-thead {
width: 100%;
z-index: 100;
overflow-y: visible;
-
&.-header {
font-size: 12px;
height: 30px;
@@ -116,12 +102,10 @@
z-index: 100;
overflow-y: visible;
}
-
.rt-resizable-header-content {
height: 100%;
overflow: visible;
}
-
.rt-th {
padding: 0;
border: solid lightgray;
@@ -129,38 +113,31 @@
border-bottom: 2px solid lightgray;
}
}
-
.rt-th {
font-size: 13px;
text-align: center;
-
&:last-child {
overflow: visible;
}
}
-
.rt-tbody {
width: 100%;
direction: rtl;
overflow: visible;
-
.rt-td {
border-right: 1px solid rgba(0, 0, 0, 0.2);
}
}
-
.rt-tr-group {
direction: ltr;
flex: 0 1 auto;
min-height: 30px;
border: 0 !important;
}
-
.rt-tr {
width: 100%;
min-height: 30px;
}
-
.rt-td {
padding: 0;
font-size: 13px;
@@ -168,18 +145,15 @@
white-space: nowrap;
display: flex;
align-items: center;
-
.imageBox-cont {
position: relative;
max-height: 100%;
}
-
.imageBox-cont img {
object-fit: contain;
max-width: 100%;
height: 100%;
}
-
.videoBox-cont {
object-fit: contain;
width: auto;
@@ -191,20 +165,16 @@
align-items: center;
height: inherit;
}
-
.rt-resizer {
width: 8px;
right: -4px;
}
-
.rt-resizable-header {
padding: 0;
height: 30px;
}
-
.rt-resizable-header:last-child {
overflow: visible;
-
.rt-resizer {
width: 5px !important;
}
@@ -221,7 +191,6 @@
height: 100%;
}
-
.collectionSchema-header-menu {
height: auto;
z-index: 100;
@@ -231,7 +200,6 @@
position: fixed;
background: white;
border: black 1px solid;
-
.collectionSchema-header-toggler {
z-index: 100;
width: 100%;
@@ -239,7 +207,6 @@
padding: 4px;
letter-spacing: 2px;
text-transform: uppercase;
-
svg {
margin-right: 4px;
}
@@ -264,75 +231,62 @@ button.add-column {
color: black;
width: 180px;
text-align: left;
-
.collectionSchema-headerMenu-group {
padding: 7px 0;
border-bottom: 1px solid lightgray;
cursor: pointer;
-
&:first-child {
padding-top: 0;
}
-
&:last-child {
border: none;
text-align: center;
padding: 12px 0 0 0;
}
}
-
label {
- color: $main-accent;
+ color: $medium-gray;
font-weight: normal;
letter-spacing: 2px;
text-transform: uppercase;
}
-
input {
color: black;
width: 100%;
}
-
.columnMenu-option {
cursor: pointer;
padding: 3px;
background-color: white;
transition: background-color 0.2s;
-
&:hover {
- background-color: $light-color-secondary;
+ background-color: $light-gray;
}
-
&.active {
font-weight: bold;
- border: 2px solid $light-color-secondary;
+ border: 2px solid $light-gray;
}
-
svg {
color: gray;
margin-right: 5px;
width: 10px;
}
}
-
.keys-dropdown {
position: relative;
//width: 100%;
background-color: white;
-
input {
- border: 2px solid $light-color-secondary;
+ border: 2px solid $light-gray;
padding: 3px;
height: 28px;
font-weight: bold;
letter-spacing: "2px";
text-transform: "uppercase";
-
&:focus {
font-weight: normal;
}
}
-
.keys-options-wrapper {
width: 100%;
max-height: 150px;
@@ -341,34 +295,28 @@ button.add-column {
top: 28px;
box-shadow: 0 10px 16px rgba(0, 0, 0, 0.1);
background-color: white;
-
.key-option {
background-color: white;
border: 1px solid lightgray;
padding: 2px 3px;
-
&:not(:first-child) {
border-top: 0;
}
-
&:hover {
- background-color: $light-color-secondary;
+ background-color: $light-gray;
}
}
}
}
-
.columnMenu-colors {
display: flex;
justify-content: space-between;
flex-wrap: wrap;
-
.columnMenu-colorPicker {
cursor: pointer;
width: 20px;
height: 20px;
border-radius: 10px;
-
&.active {
border: 2px solid white;
box-shadow: 0 0 0 2px lightgray;
@@ -380,17 +328,14 @@ button.add-column {
.collectionSchema-row {
height: 100%;
background-color: white;
-
&.row-focused .rt-td {
- background-color: #bfffc0; //$light-color-secondary;
+ background-color: #bfffc0; //$light-gray;
}
-
&.row-wrapped {
.rt-td {
white-space: normal;
}
}
-
.row-dragger {
display: flex;
justify-content: space-around;
@@ -403,7 +348,6 @@ button.add-column {
color: lightgray;
background-color: white;
transition: color 0.1s ease;
-
.row-option {
// padding: 5px;
cursor: pointer;
@@ -413,27 +357,21 @@ button.add-column {
flex-direction: column;
justify-content: center;
z-index: 2;
-
&:hover {
color: gray;
}
}
}
-
.collectionSchema-row-wrapper {
-
&.row-above {
border-top: 1px solid red;
}
-
&.row-below {
border-bottom: 1px solid red;
}
-
&.row-inside {
border: 1px solid red;
}
-
.row-dragging {
background-color: blue;
}
@@ -450,16 +388,12 @@ button.add-column {
padding: 4px;
text-align: left;
padding-left: 19px;
-
position: relative;
-
&:focus {
outline: none;
}
-
&.editing {
padding: 0;
-
input {
outline: 0;
border: none;
@@ -470,50 +404,36 @@ button.add-column {
min-height: 26px;
}
}
-
&.focused {
-
&.inactive {
border: none;
}
}
-
p {
width: 100%;
height: 100%;
}
-
&:hover .collectionSchemaView-cellContents-docExpander {
display: block;
}
-
-
.collectionSchemaView-cellContents-document {
display: inline-block;
}
-
.collectionSchemaView-cellContents-docButton {
float: right;
width: "15px";
height: "15px";
}
-
.collectionSchemaView-dropdownWrapper {
-
border: grey;
border-style: solid;
border-width: 1px;
height: 30px;
-
.collectionSchemaView-dropdownButton {
-
//display: inline-block;
float: left;
height: 100%;
-
-
}
-
.collectionSchemaView-dropdownText {
display: inline-block;
//float: right;
@@ -523,14 +443,11 @@ button.add-column {
justify-content: "center";
align-items: "center";
}
-
}
-
.collectionSchemaView-dropdownContainer {
position: absolute;
border: 1px solid rgba(0, 0, 0, 0.04);
box-shadow: 0 16px 24px 2px rgba(0, 0, 0, 0.14);
-
.collectionSchemaView-dropdownOption:hover {
background-color: rgba(0, 0, 0, 0.14);
cursor: pointer;
@@ -546,7 +463,6 @@ button.add-column {
top: 0;
right: 0;
background-color: lightgray;
-
}
.doc-drag-over {
@@ -563,7 +479,6 @@ button.add-column {
justify-content: flex-end;
padding: 0 10px;
border-bottom: 2px solid gray;
-
.collectionSchemaView-toolbar-item {
display: flex;
flex-direction: column;
@@ -586,27 +501,24 @@ button.add-column {
.rt-td.rt-expandable {
overflow: visible;
position: relative;
- height:100%;
+ height: 100%;
z-index: 1;
}
+
.reactTable-sub {
background-color: rgb(252, 252, 252);
width: 100%;
-
.rt-thead {
display: none;
}
-
.row-dragger {
background-color: rgb(252, 252, 252);
}
-
.rt-table {
background-color: rgb(252, 252, 252);
}
-
.collectionSchemaView-table {
- width: 100%;
+ width: 100%;
border: solid 1px;
overflow: visible;
padding: 0px;
@@ -621,7 +533,6 @@ button.add-column {
width: 20;
height: auto;
left: 55;
-
svg {
position: absolute;
top: 50%;
diff --git a/src/client/views/collections/collectionSchema/CollectionSchemaView.tsx b/src/client/views/collections/collectionSchema/CollectionSchemaView.tsx
new file mode 100644
index 000000000..fed64b620
--- /dev/null
+++ b/src/client/views/collections/collectionSchema/CollectionSchemaView.tsx
@@ -0,0 +1,575 @@
+import React = require("react");
+import { FontAwesomeIcon } from '@fortawesome/react-fontawesome';
+import { action, computed, observable, untracked } from "mobx";
+import { observer } from "mobx-react";
+import Measure from "react-measure";
+import { Resize } from "react-table";
+import "react-table/react-table.css";
+import { Doc, Opt } from "../../../../fields/Doc";
+import { List } from "../../../../fields/List";
+import { listSpec } from "../../../../fields/Schema";
+import { PastelSchemaPalette, SchemaHeaderField } from "../../../../fields/SchemaHeaderField";
+import { Cast, NumCast } from "../../../../fields/Types";
+import { TraceMobx } from "../../../../fields/util";
+import { emptyFunction, returnEmptyDoclist, returnFalse, returnTrue, setupMoveUpEvents } from "../../../../Utils";
+import { DocUtils } from "../../../documents/Documents";
+import { SelectionManager } from "../../../util/SelectionManager";
+import { SnappingManager } from "../../../util/SnappingManager";
+import { Transform } from "../../../util/Transform";
+import { undoBatch } from "../../../util/UndoManager";
+import '../../../views/DocumentDecorations.scss';
+import { ContextMenu } from "../../ContextMenu";
+import { ContextMenuProps } from "../../ContextMenuItem";
+import { COLLECTION_BORDER_WIDTH, SCHEMA_DIVIDER_WIDTH } from '../../global/globalCssVariables.scss';
+import { DocumentView } from "../../nodes/DocumentView";
+import { DefaultStyleProvider } from "../../StyleProvider";
+import { CollectionSubView } from "../CollectionSubView";
+import "./CollectionSchemaView.scss";
+import { SchemaTable } from "./SchemaTable";
+// bcz: need to add drag and drop of rows and columns. This seems like it might work for rows: https://codesandbox.io/s/l94mn1q657
+
+export enum ColumnType {
+ Any,
+ Number,
+ String,
+ Boolean,
+ Doc,
+ Image,
+ List,
+ Date
+}
+// this map should be used for keys that should have a const type of value
+const columnTypes: Map<string, ColumnType> = new Map([
+ ["title", ColumnType.String],
+ ["x", ColumnType.Number], ["y", ColumnType.Number], ["_width", ColumnType.Number], ["_height", ColumnType.Number],
+ ["_nativeWidth", ColumnType.Number], ["_nativeHeight", ColumnType.Number], ["isPrototype", ColumnType.Boolean],
+ ["_curPage", ColumnType.Number], ["_currentTimecode", ColumnType.Number], ["zIndex", ColumnType.Number]
+]);
+
+@observer
+export class CollectionSchemaView extends CollectionSubView(doc => doc) {
+ private _previewCont?: HTMLDivElement;
+
+ @observable _previewDoc: Doc | undefined = undefined;
+ @observable _focusedTable: Doc = this.props.Document;
+ @observable _col: any = "";
+ @observable _menuWidth = 0;
+ @observable _headerOpen = false;
+ @observable _headerIsEditing = false;
+ @observable _menuHeight = 0;
+ @observable _pointerX = 0;
+ @observable _pointerY = 0;
+ @observable _openTypes: boolean = false;
+
+ @computed get previewWidth() { return () => NumCast(this.props.Document.schemaPreviewWidth); }
+ @computed get previewHeight() { return () => this.props.PanelHeight() - 2 * this.borderWidth; }
+ @computed get tableWidth() { return this.props.PanelWidth() - 2 * this.borderWidth - Number(SCHEMA_DIVIDER_WIDTH) - this.previewWidth(); }
+ @computed get borderWidth() { return Number(COLLECTION_BORDER_WIDTH); }
+ @computed get scale() { return this.props.ScreenToLocalTransform().Scale; }
+ @computed get columns() { return Cast(this.props.Document._schemaHeaders, listSpec(SchemaHeaderField), []); }
+ set columns(columns: SchemaHeaderField[]) { this.props.Document._schemaHeaders = new List<SchemaHeaderField>(columns); }
+
+ @computed get menuCoordinates() {
+ let searchx = 0;
+ let searchy = 0;
+ if (this.props.Document._searchDoc) {
+ const el = document.getElementsByClassName("collectionSchemaView-searchContainer")[0];
+ if (el !== undefined) {
+ const rect = el.getBoundingClientRect();
+ searchx = rect.x;
+ searchy = rect.y;
+ }
+ }
+ const x = Math.max(0, Math.min(document.body.clientWidth - this._menuWidth, this._pointerX)) - searchx;
+ const y = Math.max(0, Math.min(document.body.clientHeight - this._menuHeight, this._pointerY)) - searchy;
+ return this.props.ScreenToLocalTransform().transformPoint(x, y);
+ }
+
+ get documentKeys() {
+ const docs = this.childDocs;
+ const keys: { [key: string]: boolean } = {};
+ // bcz: ugh. this is untracked since otherwise a large collection of documents will blast the server for all their fields.
+ // then as each document's fields come back, we update the documents _proxies. Each time we do this, the whole schema will be
+ // invalidated and re-rendered. This workaround will inquire all of the document fields before the options button is clicked.
+ // then by the time the options button is clicked, all of the fields should be in place. If a new field is added while this menu
+ // is displayed (unlikely) it won't show up until something else changes.
+ //TODO Types
+ untracked(() => docs.map(doc => Doc.GetAllPrototypes(doc).map(proto => Object.keys(proto).forEach(key => keys[key] = false))));
+
+ this.columns.forEach(key => keys[key.heading] = true);
+ return Array.from(Object.keys(keys));
+ }
+
+ @action setHeaderIsEditing = (isEditing: boolean) => this._headerIsEditing = isEditing;
+
+ @undoBatch
+ setColumnType = action((columnField: SchemaHeaderField, type: ColumnType): void => {
+ this._openTypes = false;
+ if (columnTypes.get(columnField.heading)) return;
+
+ const columns = this.columns;
+ const index = columns.indexOf(columnField);
+ if (index > -1) {
+ columnField.setType(NumCast(type));
+ columns[index] = columnField;
+ this.columns = columns;
+ }
+ });
+
+ @undoBatch
+ setColumnColor = (columnField: SchemaHeaderField, color: string): void => {
+ const columns = this.columns;
+ const index = columns.indexOf(columnField);
+ if (index > -1) {
+ columnField.setColor(color);
+ columns[index] = columnField;
+ this.columns = columns; // need to set the columns to trigger rerender
+ }
+ }
+
+ @undoBatch
+ @action
+ setColumnSort = (columnField: SchemaHeaderField, descending: boolean | undefined) => {
+ const columns = this.columns;
+ columns.forEach(col => col.setDesc(undefined));
+
+ const index = columns.findIndex(c => c.heading === columnField.heading);
+ const column = columns[index];
+ column.setDesc(descending);
+ columns[index] = column;
+ this.columns = columns;
+ }
+
+ renderTypes = (col: any) => {
+ if (columnTypes.get(col.heading)) return (null);
+
+ const type = col.type;
+
+ const anyType = <div className={"columnMenu-option" + (type === ColumnType.Any ? " active" : "")} onClick={() => this.setColumnType(col, ColumnType.Any)}>
+ <FontAwesomeIcon icon={"align-justify"} size="sm" />
+ Any
+ </div>;
+
+ const numType = <div className={"columnMenu-option" + (type === ColumnType.Number ? " active" : "")} onClick={() => this.setColumnType(col, ColumnType.Number)}>
+ <FontAwesomeIcon icon={"hashtag"} size="sm" />
+ Number
+ </div>;
+
+ const textType = <div className={"columnMenu-option" + (type === ColumnType.String ? " active" : "")} onClick={() => this.setColumnType(col, ColumnType.String)}>
+ <FontAwesomeIcon icon={"font"} size="sm" />
+ Text
+ </div>;
+
+ const boolType = <div className={"columnMenu-option" + (type === ColumnType.Boolean ? " active" : "")} onClick={() => this.setColumnType(col, ColumnType.Boolean)}>
+ <FontAwesomeIcon icon={"check-square"} size="sm" />
+ Checkbox
+ </div>;
+
+ const listType = <div className={"columnMenu-option" + (type === ColumnType.List ? " active" : "")} onClick={() => this.setColumnType(col, ColumnType.List)}>
+ <FontAwesomeIcon icon={"list-ul"} size="sm" />
+ List
+ </div>;
+
+ const docType = <div className={"columnMenu-option" + (type === ColumnType.Doc ? " active" : "")} onClick={() => this.setColumnType(col, ColumnType.Doc)}>
+ <FontAwesomeIcon icon={"file"} size="sm" />
+ Document
+ </div>;
+
+ const imageType = <div className={"columnMenu-option" + (type === ColumnType.Image ? " active" : "")} onClick={() => this.setColumnType(col, ColumnType.Image)}>
+ <FontAwesomeIcon icon={"image"} size="sm" />
+ Image
+ </div>;
+
+ const dateType = <div className={"columnMenu-option" + (type === ColumnType.Date ? " active" : "")} onClick={() => this.setColumnType(col, ColumnType.Date)}>
+ <FontAwesomeIcon icon={"calendar"} size="sm" />
+ Date
+ </div>;
+
+
+ const allColumnTypes = <div className="columnMenu-types">
+ {anyType}
+ {numType}
+ {textType}
+ {boolType}
+ {listType}
+ {docType}
+ {imageType}
+ {dateType}
+ </div>;
+
+ const justColType = type === ColumnType.Any ? anyType : type === ColumnType.Number ? numType :
+ type === ColumnType.String ? textType : type === ColumnType.Boolean ? boolType :
+ type === ColumnType.List ? listType : type === ColumnType.Doc ? docType :
+ type === ColumnType.Date ? dateType : imageType;
+
+ return (
+ <div className="collectionSchema-headerMenu-group" onClick={action(() => this._openTypes = !this._openTypes)}>
+ <div>
+ <label style={{ cursor: "pointer" }}>Column type:</label>
+ <FontAwesomeIcon icon={"caret-down"} size="lg" style={{ float: "right", transform: `rotate(${this._openTypes ? "180deg" : 0})`, transition: "0.2s all ease" }} />
+ </div>
+ {this._openTypes ? allColumnTypes : justColType}
+ </div >
+ );
+ }
+
+ renderSorting = (col: any) => {
+ const sort = col.desc;
+ return (
+ <div className="collectionSchema-headerMenu-group">
+ <label>Sort by:</label>
+ <div className="columnMenu-sort">
+ <div className={"columnMenu-option" + (sort === true ? " active" : "")} onClick={() => this.setColumnSort(col, true)}>
+ <FontAwesomeIcon icon="sort-amount-down" size="sm" />
+ Sort descending
+ </div>
+ <div className={"columnMenu-option" + (sort === false ? " active" : "")} onClick={() => this.setColumnSort(col, false)}>
+ <FontAwesomeIcon icon="sort-amount-up" size="sm" />
+ Sort ascending
+ </div>
+ <div className="columnMenu-option" onClick={() => this.setColumnSort(col, undefined)}>
+ <FontAwesomeIcon icon="times" size="sm" />
+ Clear sorting
+ </div>
+ </div>
+ </div>
+ );
+ }
+
+ renderColors = (col: any) => {
+ const selected = col.color;
+
+ const pink = PastelSchemaPalette.get("pink2");
+ const purple = PastelSchemaPalette.get("purple2");
+ const blue = PastelSchemaPalette.get("bluegreen1");
+ const yellow = PastelSchemaPalette.get("yellow4");
+ const red = PastelSchemaPalette.get("red2");
+ const gray = "#f1efeb";
+
+ return (
+ <div className="collectionSchema-headerMenu-group">
+ <label>Color:</label>
+ <div className="columnMenu-colors">
+ <div className={"columnMenu-colorPicker" + (selected === pink ? " active" : "")} style={{ backgroundColor: pink }} onClick={() => this.setColumnColor(col, pink!)}></div>
+ <div className={"columnMenu-colorPicker" + (selected === purple ? " active" : "")} style={{ backgroundColor: purple }} onClick={() => this.setColumnColor(col, purple!)}></div>
+ <div className={"columnMenu-colorPicker" + (selected === blue ? " active" : "")} style={{ backgroundColor: blue }} onClick={() => this.setColumnColor(col, blue!)}></div>
+ <div className={"columnMenu-colorPicker" + (selected === yellow ? " active" : "")} style={{ backgroundColor: yellow }} onClick={() => this.setColumnColor(col, yellow!)}></div>
+ <div className={"columnMenu-colorPicker" + (selected === red ? " active" : "")} style={{ backgroundColor: red }} onClick={() => this.setColumnColor(col, red!)}></div>
+ <div className={"columnMenu-colorPicker" + (selected === gray ? " active" : "")} style={{ backgroundColor: gray }} onClick={() => this.setColumnColor(col, gray)}></div>
+ </div>
+ </div>
+ );
+ }
+
+ @undoBatch
+ @action
+ changeColumns = (oldKey: string, newKey: string, addNew: boolean, filter?: string) => {
+ const columns = this.columns;
+ if (columns === undefined) {
+ this.columns = new List<SchemaHeaderField>([new SchemaHeaderField(newKey, "f1efeb")]);
+ } else {
+ if (addNew) {
+ columns.push(new SchemaHeaderField(newKey, "f1efeb"));
+ this.columns = columns;
+ } else {
+ const index = columns.map(c => c.heading).indexOf(oldKey);
+ if (index > -1) {
+ const column = columns[index];
+ column.setHeading(newKey);
+ columns[index] = column;
+ this.columns = columns;
+ if (filter) {
+ Doc.setDocFilter(this.props.Document, newKey, filter, "match");
+ }
+ else {
+ this.props.Document._docFilters = undefined;
+ }
+ }
+ }
+ }
+ }
+
+ @action
+ openHeader = (col: any, screenx: number, screeny: number) => {
+ this._col = col;
+ this._headerOpen = true;
+ this._pointerX = screenx;
+ this._pointerY = screeny;
+ }
+
+ @action
+ closeHeader = () => { this._headerOpen = false; }
+
+ @undoBatch
+ @action
+ deleteColumn = (key: string) => {
+ const columns = this.columns;
+ if (columns === undefined) {
+ this.columns = new List<SchemaHeaderField>([]);
+ } else {
+ const index = columns.map(c => c.heading).indexOf(key);
+ if (index > -1) {
+ columns.splice(index, 1);
+ this.columns = columns;
+ }
+ }
+ this.closeHeader();
+ }
+
+ getPreviewTransform = (): Transform => {
+ return this.props.ScreenToLocalTransform().translate(- this.borderWidth - NumCast(COLLECTION_BORDER_WIDTH) - this.tableWidth, - this.borderWidth);
+ }
+
+ @action
+ onHeaderClick = (e: React.PointerEvent) => {
+ e.stopPropagation();
+ }
+
+ @action
+ onWheel(e: React.WheelEvent) {
+ const scale = this.props.ScreenToLocalTransform().Scale;
+ this.props.isContentActive(true) && e.stopPropagation();
+ }
+
+ @computed get renderMenuContent() {
+ TraceMobx();
+ return <div className="collectionSchema-header-menuOptions">
+ {this.renderTypes(this._col)}
+ {this.renderColors(this._col)}
+ <div className="collectionSchema-headerMenu-group">
+ <button onClick={() => { this.deleteColumn(this._col.heading); }}
+ >Delete Column</button>
+ </div>
+ </div>;
+ }
+
+ private createTarget = (ele: HTMLDivElement) => {
+ this._previewCont = ele;
+ super.CreateDropTarget(ele);
+ }
+
+ isFocused = (doc: Doc, outsideReaction: boolean): boolean => this.props.isSelected(outsideReaction) && doc === this._focusedTable;
+
+ @action setFocused = (doc: Doc) => this._focusedTable = doc;
+
+ @action setPreviewDoc = (doc: Opt<Doc>) => {
+ SelectionManager.SelectSchemaView(this, doc);
+ this._previewDoc = doc;
+ }
+
+ //toggles preview side-panel of schema
+ @action
+ toggleExpander = () => {
+ this.props.Document.schemaPreviewWidth = this.previewWidth() === 0 ? Math.min(this.tableWidth / 3, 200) : 0;
+ }
+
+ onDividerDown = (e: React.PointerEvent) => {
+ setupMoveUpEvents(this, e, this.onDividerMove, emptyFunction, this.toggleExpander);
+ }
+ @action
+ onDividerMove = (e: PointerEvent, down: number[], delta: number[]) => {
+ const nativeWidth = this._previewCont!.getBoundingClientRect();
+ const minWidth = 40;
+ const maxWidth = 1000;
+ const movedWidth = this.props.ScreenToLocalTransform().transformDirection(nativeWidth.right - e.clientX, 0)[0];
+ const width = movedWidth < minWidth ? minWidth : movedWidth > maxWidth ? maxWidth : movedWidth;
+ this.props.Document.schemaPreviewWidth = width;
+ return false;
+ }
+
+ onPointerDown = (e: React.PointerEvent): void => {
+ if (e.button === 0 && !e.altKey && !e.ctrlKey && !e.metaKey) {
+ if (this.props.isSelected(true)) e.stopPropagation();
+ else this.props.select(false);
+ }
+ }
+
+ @computed
+ get previewDocument(): Doc | undefined { return this._previewDoc; }
+
+ @computed
+ get dividerDragger() {
+ return this.previewWidth() === 0 ? (null) :
+ <div className="collectionSchemaView-dividerDragger" onPointerDown={this.onDividerDown} >
+ <div className="collectionSchemaView-dividerDragger" />
+ </div>;
+ }
+
+ @computed
+ get previewPanel() {
+ return <div ref={this.createTarget} style={{ width: `${this.previewWidth()}px` }}>
+ {!this.previewDocument ? (null) :
+ <DocumentView
+ Document={this.previewDocument}
+ DataDoc={undefined}
+ fitContentsToDoc={returnTrue}
+ freezeDimensions={true}
+ dontCenter={"y"}
+ focus={DocUtils.DefaultFocus}
+ renderDepth={this.props.renderDepth}
+ rootSelected={this.rootSelected}
+ PanelWidth={this.previewWidth}
+ PanelHeight={this.previewHeight}
+ isContentActive={returnTrue}
+ isDocumentActive={returnFalse}
+ ScreenToLocalTransform={this.getPreviewTransform}
+ docFilters={this.childDocFilters}
+ docRangeFilters={this.childDocRangeFilters}
+ searchFilterDocs={this.searchFilterDocs}
+ styleProvider={DefaultStyleProvider}
+ layerProvider={undefined}
+ docViewPath={returnEmptyDoclist}
+ ContainingCollectionDoc={this.props.CollectionView?.props.Document}
+ ContainingCollectionView={this.props.CollectionView}
+ moveDocument={this.props.moveDocument}
+ addDocument={this.props.addDocument}
+ removeDocument={this.props.removeDocument}
+ whenChildContentsActiveChanged={this.props.whenChildContentsActiveChanged}
+ addDocTab={this.props.addDocTab}
+ pinToPres={this.props.pinToPres}
+ bringToFront={returnFalse}
+ />}
+ </div>;
+ }
+
+ @computed
+ get schemaTable() {
+ return <SchemaTable
+ Document={this.props.Document}
+ PanelHeight={this.props.PanelHeight}
+ PanelWidth={this.props.PanelWidth}
+ childDocs={this.childDocs}
+ CollectionView={this.props.CollectionView}
+ ContainingCollectionView={this.props.ContainingCollectionView}
+ ContainingCollectionDoc={this.props.ContainingCollectionDoc}
+ fieldKey={this.props.fieldKey}
+ renderDepth={this.props.renderDepth}
+ moveDocument={this.props.moveDocument}
+ ScreenToLocalTransform={this.props.ScreenToLocalTransform}
+ active={this.props.isContentActive}
+ onDrop={this.onExternalDrop}
+ addDocTab={this.props.addDocTab}
+ pinToPres={this.props.pinToPres}
+ isSelected={this.props.isSelected}
+ isFocused={this.isFocused}
+ setFocused={this.setFocused}
+ setPreviewDoc={this.setPreviewDoc}
+ deleteDocument={this.props.removeDocument}
+ addDocument={this.props.addDocument}
+ dataDoc={this.props.DataDoc}
+ columns={this.columns}
+ documentKeys={this.documentKeys}
+ headerIsEditing={this._headerIsEditing}
+ openHeader={this.openHeader}
+ onClick={this.onTableClick}
+ onPointerDown={emptyFunction}
+ onResizedChange={this.onResizedChange}
+ setColumns={this.setColumns}
+ reorderColumns={this.reorderColumns}
+ changeColumns={this.changeColumns}
+ setHeaderIsEditing={this.setHeaderIsEditing}
+ changeColumnSort={this.setColumnSort}
+ />;
+ }
+
+ @computed
+ public get schemaToolbar() {
+ return <div className="collectionSchemaView-toolbar">
+ <div className="collectionSchemaView-toolbar-item">
+ <div id="preview-schema-checkbox-div">
+ <input type="checkbox" key={"Show Preview"} checked={this.previewWidth() !== 0} onChange={this.toggleExpander} />
+ Show Preview
+ </div>
+ </div>
+ </div>;
+ }
+
+ onSpecificMenu = (e: React.MouseEvent) => {
+ if ((e.target as any)?.className?.includes?.("collectionSchemaView-cell") || (e.target instanceof HTMLSpanElement)) {
+ const cm = ContextMenu.Instance;
+ const options = cm.findByDescription("Options...");
+ const optionItems: ContextMenuProps[] = options && "subitems" in options ? options.subitems : [];
+ optionItems.push({ description: "remove", event: () => this._previewDoc && this.props.removeDocument?.(this._previewDoc), icon: "trash" });
+ !options && cm.addItem({ description: "Options...", subitems: optionItems, icon: "compass" });
+ cm.displayMenu(e.clientX, e.clientY);
+ (e.nativeEvent as any).SchemaHandled = true; // not sure why this is needed, but if you right-click quickly on a cell, the Document/Collection contextMenu handlers still fire without this.
+ e.stopPropagation();
+ }
+ }
+
+ @action
+ onTableClick = (e: React.MouseEvent): void => {
+ if (!(e.target as any)?.className?.includes?.("collectionSchemaView-cell") && !(e.target instanceof HTMLSpanElement)) {
+ this.setPreviewDoc(undefined);
+ } else {
+ e.stopPropagation();
+ }
+ this.setFocused(this.props.Document);
+ this.closeHeader();
+ }
+
+ onResizedChange = (newResized: Resize[], event: any) => {
+ const columns = this.columns;
+ newResized.forEach(resized => {
+ const index = columns.findIndex(c => c.heading === resized.id);
+ const column = columns[index];
+ column.setWidth(resized.value);
+ columns[index] = column;
+ });
+ this.columns = columns;
+ }
+
+ @action
+ setColumns = (columns: SchemaHeaderField[]) => this.columns = columns
+
+ @undoBatch
+ reorderColumns = (toMove: SchemaHeaderField, relativeTo: SchemaHeaderField, before: boolean, columnsValues: SchemaHeaderField[]) => {
+ const columns = [...columnsValues];
+ const oldIndex = columns.indexOf(toMove);
+ const relIndex = columns.indexOf(relativeTo);
+ const newIndex = (oldIndex > relIndex && !before) ? relIndex + 1 : (oldIndex < relIndex && before) ? relIndex - 1 : relIndex;
+
+ if (oldIndex === newIndex) return;
+
+ columns.splice(newIndex, 0, columns.splice(oldIndex, 1)[0]);
+ this.columns = columns;
+ }
+
+ onZoomMenu = (e: React.WheelEvent) => this.props.isContentActive(true) && e.stopPropagation();
+
+ render() {
+ TraceMobx();
+ if (!this.props.isContentActive()) setTimeout(() => this.closeHeader(), 0);
+ const menuContent = this.renderMenuContent;
+ const menu = <div className="collectionSchema-header-menu"
+ onWheel={e => this.onZoomMenu(e)}
+ onPointerDown={e => this.onHeaderClick(e)}
+ style={{ transform: `translate(${(this.menuCoordinates[0])}px, ${(this.menuCoordinates[1])}px)` }}>
+ <Measure offset onResize={action((r: any) => {
+ const dim = this.props.ScreenToLocalTransform().inverse().transformDirection(r.offset.width, r.offset.height);
+ this._menuWidth = dim[0]; this._menuHeight = dim[1];
+ })}>
+ {({ measureRef }) => <div ref={measureRef}> {menuContent} </div>}
+ </Measure>
+ </div>;
+ return <div className={"collectionSchemaView" + (this.props.Document._searchDoc ? "-searchContainer" : "-container")}
+ style={{
+ overflow: this.props.scrollOverflow === true ? "scroll" : undefined, backgroundColor: "white",
+ pointerEvents: this.props.Document._searchDoc !== undefined && !this.props.isContentActive() && !SnappingManager.GetIsDragging() ? "none" : undefined,
+ width: name === "collectionSchemaView-searchContainer" ? "auto" : this.props.PanelWidth() || "100%", height: this.props.PanelHeight() || "100%", position: "relative",
+ }} >
+ <div className="collectionSchemaView-tableContainer"
+ style={{ width: `calc(100% - ${this.previewWidth()}px)` }}
+ onContextMenu={this.onSpecificMenu}
+ onPointerDown={this.onPointerDown}
+ onWheel={e => this.props.isContentActive(true) && e.stopPropagation()}
+ onDrop={e => this.onExternalDrop(e, {})}
+ ref={this.createTarget}>
+ {this.schemaTable}
+ </div>
+ {this.dividerDragger}
+ {!this.previewWidth() ? (null) : this.previewPanel}
+ {this._headerOpen && this.props.isContentActive() ? menu : null}
+ </div>;
+ }
+} \ No newline at end of file
diff --git a/src/client/views/collections/SchemaTable.tsx b/src/client/views/collections/collectionSchema/SchemaTable.tsx
index 0175b0dc2..abe549072 100644
--- a/src/client/views/collections/SchemaTable.tsx
+++ b/src/client/views/collections/collectionSchema/SchemaTable.tsx
@@ -5,32 +5,33 @@ import { action, computed, observable } from "mobx";
import { observer } from "mobx-react";
import ReactTable, { CellInfo, Column, ComponentPropsGetterR, Resize, SortingRule } from "react-table";
import "react-table/react-table.css";
-import { DateField } from "../../../fields/DateField";
-import { AclPrivate, AclReadonly, DataSym, Doc, DocListCast, Field, Opt } from "../../../fields/Doc";
-import { Id } from "../../../fields/FieldSymbols";
-import { List } from "../../../fields/List";
-import { listSpec } from "../../../fields/Schema";
-import { SchemaHeaderField } from "../../../fields/SchemaHeaderField";
-import { ComputedField } from "../../../fields/ScriptField";
-import { Cast, FieldValue, NumCast, StrCast } from "../../../fields/Types";
-import { ImageField } from "../../../fields/URLField";
-import { GetEffectiveAcl } from "../../../fields/util";
-import { emptyFunction, emptyPath, returnEmptyDoclist, returnEmptyFilter, returnFalse, returnTrue } from "../../../Utils";
-import { Docs, DocumentOptions, DocUtils } from "../../documents/Documents";
-import { DocumentType } from "../../documents/DocumentTypes";
-import { CompileScript, Transformer, ts } from "../../util/Scripting";
-import { Transform } from "../../util/Transform";
-import { undoBatch } from "../../util/UndoManager";
-import { COLLECTION_BORDER_WIDTH, SCHEMA_DIVIDER_WIDTH } from '../../views/globalCssVariables.scss';
-import { ContextMenu } from "../ContextMenu";
-import '../DocumentDecorations.scss';
-import { DocumentView } from "../nodes/DocumentView";
-import { DefaultStyleProvider } from "../StyleProvider";
+import { DateField } from "../../../../fields/DateField";
+import { AclPrivate, AclReadonly, DataSym, Doc, DocListCast, Field, Opt } from "../../../../fields/Doc";
+import { Id } from "../../../../fields/FieldSymbols";
+import { List } from "../../../../fields/List";
+import { listSpec } from "../../../../fields/Schema";
+import { SchemaHeaderField } from "../../../../fields/SchemaHeaderField";
+import { ComputedField } from "../../../../fields/ScriptField";
+import { Cast, FieldValue, NumCast, StrCast } from "../../../../fields/Types";
+import { ImageField } from "../../../../fields/URLField";
+import { GetEffectiveAcl } from "../../../../fields/util";
+import { emptyFunction, emptyPath, returnEmptyDoclist, returnEmptyFilter, returnFalse, returnTrue } from "../../../../Utils";
+import { Docs, DocumentOptions, DocUtils } from "../../../documents/Documents";
+import { DocumentType } from "../../../documents/DocumentTypes";
+import { CompileScript, Transformer, ts } from "../../../util/Scripting";
+import { Transform } from "../../../util/Transform";
+import { undoBatch } from "../../../util/UndoManager";
+import { COLLECTION_BORDER_WIDTH, SCHEMA_DIVIDER_WIDTH } from '../../global/globalCssVariables.scss';
+import { ContextMenu } from "../../ContextMenu";
+import '../../../views/DocumentDecorations.scss';
+import { DocumentView } from "../../nodes/DocumentView";
+import { DefaultStyleProvider } from "../../StyleProvider";
import { CellProps, CollectionSchemaButtons, CollectionSchemaCell, CollectionSchemaCheckboxCell, CollectionSchemaDateCell, CollectionSchemaDocCell, CollectionSchemaImageCell, CollectionSchemaListCell, CollectionSchemaNumberCell, CollectionSchemaStringCell } from "./CollectionSchemaCells";
import { CollectionSchemaAddColumnHeader, KeysDropdown } from "./CollectionSchemaHeaders";
-import { MovableColumn, MovableRow } from "./CollectionSchemaMovableTableHOC";
+import { MovableColumn } from "./CollectionSchemaMovableColumn";
+import { MovableRow } from "./CollectionSchemaMovableRow";
import "./CollectionSchemaView.scss";
-import { CollectionView } from "./CollectionView";
+import { CollectionView } from "../CollectionView";
enum ColumnType {
@@ -458,8 +459,9 @@ export class SchemaTable extends React.Component<SchemaTableProps> {
expanded={expanded}
resized={this.resized}
onResizedChange={this.props.onResizedChange}
+ // if it has a child, render another table with the children
SubComponent={!hasCollectionChild ? undefined : row => (row.original.type !== DocumentType.COL) ? (null) :
- <div className="reactTable-sub"><SchemaTable {...this.props} Document={row.original} dataDoc={undefined} childDocs={undefined} /></div>}
+ <div style={{ paddingLeft: 57 + "px" }} className="reactTable-sub"><SchemaTable {...this.props} Document={row.original} dataDoc={undefined} childDocs={undefined} /></div>}
/>;
}
diff --git a/src/client/views/globalCssVariables.scss b/src/client/views/global/globalCssVariables.scss
index ccc9306c4..7556f8b8a 100644
--- a/src/client/views/globalCssVariables.scss
+++ b/src/client/views/global/globalCssVariables.scss
@@ -1,41 +1,55 @@
-@import url("https://fonts.googleapis.com/css?family=Noto+Sans:400,700|Crimson+Text:400,400i,700");
+@import url("https://fonts.googleapis.com/css2?family=Roboto&display=swap");
// colors
-$light-color: #fcfbf7;
-$light-color-secondary:#f1efeb;
-//$main-accent: #61aaa3;
-$main-accent: #aaaaa3;
-// $alt-accent: #cdd5ec;
-// $alt-accent: #cdeceb;
-//$alt-accent: #59dff7;
-$alt-accent: #c2c2c5;
-$lighter-alt-accent: rgb(207, 220, 240);
-$darker-alt-accent: #b2cef8;
-$intermediate-color: #9c9396;
-$dark-color: #121721;
-$link-color: #add8e6;
-$antimodemenu-height: 35px;
+$white: #ffffff;
+$light-gray: #dfdfdf;
+$medium-gray: #9f9f9f;
+$dark-gray: #323232;
+$black: #000000;
+
+$light-blue: #bdddf5;
+$medium-blue: #4476f7;
+$pink: #e0217d;
+$yellow: #f5d747;
+
+$close-red: #e48282;
+
+$drop-shadow: "#32323215";
+
+//padding
+$minimum-padding: 4px;
+$medium-padding: 16px;
+$large-padding: 32px;
+
+//icon sizes
+$icon-size: 28px;
+
// fonts
-$sans-serif: "Noto Sans",
-sans-serif;
+$sans-serif: "Roboto", sans-serif;
+$large-header: 16px;
+$body-text: 12px;
+$small-text: 9px;
// $sans-serif: "Roboto Slab", sans-serif;
-$serif: "Crimson Text",
-serif;
+
// misc values
$border-radius: 0.3em;
-//
$search-thumnail-size: 130;
+$topbar-height: 32px;
+$antimodemenu-height: 36px;
// dragged items
$contextMenu-zindex: 100000; // context menu shows up over everything
$radialMenu-zindex: 100000; // context menu shows up over everything
+// borders
+$standard-border: solid 1px #9f9f9f;
+
$searchpanel-height: 32px;
$mainTextInput-zindex: 999; // then text input overlay so that it's context menu will appear over decorations, etc
$docDecorations-zindex: 998; // then doc decorations appear over everything else
$remoteCursors-zindex: 997; // ... not sure what level the remote cursors should go -- is this right?
$COLLECTION_BORDER_WIDTH: 0;
$SCHEMA_DIVIDER_WIDTH: 4;
-$MINIMIZED_ICON_SIZE:25;
+$MINIMIZED_ICON_SIZE: 24;
$MAX_ROW_HEIGHT: 44px;
$DFLT_IMAGE_NATIVE_DIM: 900px;
$MENU_PANEL_WIDTH: 60px;
@@ -53,4 +67,4 @@ $TREE_BULLET_WIDTH: 20px;
DFLT_IMAGE_NATIVE_DIM: $DFLT_IMAGE_NATIVE_DIM;
MENU_PANEL_WIDTH: $MENU_PANEL_WIDTH;
TREE_BULLET_WIDTH: $TREE_BULLET_WIDTH;
-} \ No newline at end of file
+}
diff --git a/src/client/views/globalCssVariables.scss.d.ts b/src/client/views/global/globalCssVariables.scss.d.ts
index 11e62e1eb..11e62e1eb 100644
--- a/src/client/views/globalCssVariables.scss.d.ts
+++ b/src/client/views/global/globalCssVariables.scss.d.ts
diff --git a/src/client/views/global/globalEnums.tsx b/src/client/views/global/globalEnums.tsx
new file mode 100644
index 000000000..2aeb8e338
--- /dev/null
+++ b/src/client/views/global/globalEnums.tsx
@@ -0,0 +1,38 @@
+export enum Colors {
+ BLACK = "#000000",
+ DARK_GRAY = "#323232",
+ MEDIUM_GRAY = "#9F9F9F",
+ LIGHT_GRAY = "#DFDFDF",
+ WHITE = "#FFFFFF",
+ MEDIUM_BLUE = "#4476F7",
+ LIGHT_BLUE = "#BDDDF5",
+ PINK = "#E0217D",
+ YELLOW = "#F5D747",
+ DROP_SHADOW = "#32323215",
+}
+
+export enum FontSizes {
+ //Bolded
+ LARGE_HEADER = "16px",
+
+ //Bolded or unbolded
+ BODY_TEXT = "12px",
+
+ //Bolded
+ SMALL_TEXT = "9px",
+}
+
+export enum Padding {
+ MINIMUM_PADDING = "4px",
+ SMALL_PADDING = "8px",
+ MEDIUM_PADDING = "16px",
+ LARGE_PADDING = "32px",
+}
+
+export enum IconSizes {
+ ICON_SIZE = "28px",
+}
+
+export enum Borders {
+ STANDARD = "solid 1px #9F9F9F"
+} \ No newline at end of file
diff --git a/src/client/views/linking/LinkEditor.scss b/src/client/views/linking/LinkEditor.scss
index 7e6999cdc..e45a91d57 100644
--- a/src/client/views/linking/LinkEditor.scss
+++ b/src/client/views/linking/LinkEditor.scss
@@ -1,4 +1,4 @@
-@import "../globalCssVariables";
+@import "../global/globalCssVariables";
.linkEditor {
width: 100%;
@@ -20,9 +20,9 @@
}
.linkEditor-info {
- //border-bottom: 0.5px solid $light-color-secondary;
+ //border-bottom: 0.5px solid $light-gray;
//padding-bottom: 1px;
- padding-top: 5px;
+ padding: 12px;
padding-left: 5px;
//margin-bottom: 6px;
display: flex;
@@ -61,7 +61,7 @@
}
.linkEditor-description {
- padding-left: 6.5px;
+ padding-left: 26px;
padding-right: 6.5px;
padding-bottom: 3.5px;
@@ -107,9 +107,9 @@
}
.linkEditor-followingDropdown {
- padding-left: 6.5px;
+ padding-left: 26px;
padding-right: 6.5px;
- padding-bottom: 6px;
+ padding-bottom: 15px;
&:hover {
cursor: pointer;
@@ -195,7 +195,7 @@
}
.linkEditor-group {
- background-color: $light-color-secondary;
+ background-color: $light-gray;
padding: 6px;
margin: 3px 0;
border-radius: 3px;
@@ -254,8 +254,8 @@
}
.linkEditor-option {
- background-color: $light-color-secondary;
- border: 1px solid $intermediate-color;
+ background-color: $light-gray;
+ border: 1px solid $medium-gray;
border-top: 0;
padding: 3px;
cursor: pointer;
@@ -272,7 +272,7 @@
.linkEditor-typeButton {
background-color: transparent;
- color: $dark-color;
+ color: $dark-gray;
height: 20px;
padding: 0 3px;
padding-bottom: 2px;
@@ -285,7 +285,7 @@
width: calc(100% - 40px);
&:hover {
- background-color: $light-color;
+ background-color: $white;
}
}
diff --git a/src/client/views/linking/LinkMenu.scss b/src/client/views/linking/LinkMenu.scss
index a90bf8b0a..19c6463d3 100644
--- a/src/client/views/linking/LinkMenu.scss
+++ b/src/client/views/linking/LinkMenu.scss
@@ -1,4 +1,4 @@
-@import "../globalCssVariables";
+@import "../global/globalCssVariables";
.linkMenu {
width: auto;
@@ -7,20 +7,19 @@
z-index: 2001;
.linkMenu-list,
- .linkMenu-listEditor
- {
+ .linkMenu-listEditor {
display: inline-block;
position: relative;
- border: 1px solid black;
- box-shadow: 3px 3px 1.5px grey;
+ border: 1px solid #e4e4e4;
+ box-shadow: 0 10px 20px rgba(0, 0, 0, 0.19), 0 6px 6px rgba(0, 0, 0, 0.23);
background: white;
-
min-width: 170px;
- max-height: 170px;
+ max-height: 230px;
overflow-y: scroll;
z-index: 10;
- }
- .linkMenu-list {
+ }
+
+ .linkMenu-list {
white-space: nowrap;
overflow-x: hidden;
width: 240px;
@@ -46,13 +45,13 @@
}
.linkMenu-group-name {
+ padding: 10px;
&:hover {
- p {
- background-color: lightgray;
-
- }
+ // p {
+ // background-color: lightgray;
+ // }
p.expand-one {
width: calc(100% + 20px);
@@ -65,10 +64,9 @@
p {
width: 100%;
- //padding: 4px 6px;
line-height: 12px;
border-radius: 5px;
- font-weight: bold;
+ text-transform: capitalize;
}
.linkEditor-tableButton {
diff --git a/src/client/views/linking/LinkMenu.tsx b/src/client/views/linking/LinkMenu.tsx
index c7888c5ee..6fc860447 100644
--- a/src/client/views/linking/LinkMenu.tsx
+++ b/src/client/views/linking/LinkMenu.tsx
@@ -15,6 +15,9 @@ interface Props {
changeFlyout: () => void;
}
+/**
+ * the outermost component for the link menu of a node that contains a list of its linked nodes
+ */
@observer
export class LinkMenu extends React.Component<Props> {
private _editorRef = React.createRef<HTMLDivElement>();
@@ -36,6 +39,11 @@ export class LinkMenu extends React.Component<Props> {
}
}
+ /**
+ * maps each link to a JSX element to be rendered
+ * @param groups LinkManager containing info of all of the links
+ * @returns list of link JSX elements if there at least one linked element
+ */
renderAllGroups = (groups: Map<string, Array<Doc>>): Array<JSX.Element> => {
const linkItems = Array.from(groups.entries()).map(group =>
<LinkMenuGroup
diff --git a/src/client/views/linking/LinkMenuGroup.tsx b/src/client/views/linking/LinkMenuGroup.tsx
index 74af78234..c7586a467 100644
--- a/src/client/views/linking/LinkMenuGroup.tsx
+++ b/src/client/views/linking/LinkMenuGroup.tsx
@@ -40,7 +40,7 @@ export class LinkMenuGroup extends React.Component<LinkMenuGroupProps> {
return (
<div className="linkMenu-group" ref={this._menuRef}>
<div className="linkMenu-group-name">
- <p className={this.props.groupType === "*" || this.props.groupType === "" ? "" : "expand-one"} > {this.props.groupType}:</p>
+ <p className={this.props.groupType === "*" || this.props.groupType === "" ? "" : "expand-one"}> {this.props.groupType}:</p>
</div>
<div className="linkMenu-group-wrapper">
{groupItems}
diff --git a/src/client/views/linking/LinkMenuItem.scss b/src/client/views/linking/LinkMenuItem.scss
index 4e13ef8c8..90722daf9 100644
--- a/src/client/views/linking/LinkMenuItem.scss
+++ b/src/client/views/linking/LinkMenuItem.scss
@@ -1,10 +1,10 @@
-@import "../globalCssVariables";
+@import "../global/globalCssVariables";
.linkMenu-item {
- // border-top: 0.5px solid $main-accent;
+ // border-top: 0.5px solid $medium-gray;
position: relative;
display: flex;
- border-bottom: 0.5px solid black;
+ border-top: 0.5px solid #cdcdcd;
padding-left: 6.5px;
padding-right: 2px;
@@ -55,8 +55,8 @@
.linkMenu-destination-title {
text-decoration: none;
- color: rgb(85, 120, 196);
- font-size: 14px;
+ color: #4476F7;
+ font-size: 16px;
padding-bottom: 2px;
padding-right: 4px;
margin-right: 4px;
@@ -76,7 +76,7 @@
text-decoration: none;
font-style: italic;
color: rgb(95, 97, 102);
- font-size: 10px;
+ font-size: 9px;
margin-left: 20px;
max-width: 125px;
height: auto;
@@ -102,7 +102,7 @@
.link-metadata {
padding: 0 10px 0 16px;
margin-bottom: 4px;
- color: $main-accent;
+ color: $medium-gray;
font-style: italic;
font-size: 10.5px;
}
@@ -143,8 +143,8 @@
padding-right: 6px;
border-radius: 50%;
pointer-events: auto;
- background-color: $dark-color;
- color: $light-color;
+ background-color: $dark-gray;
+ color: $white;
font-size: 65%;
transition: transform 0.2s;
text-align: center;
@@ -162,7 +162,7 @@
}
&:hover {
- background: $main-accent;
+ background: $medium-gray;
cursor: pointer;
}
}
diff --git a/src/client/views/linking/LinkPopup.scss b/src/client/views/linking/LinkPopup.scss
new file mode 100644
index 000000000..8ae65158d
--- /dev/null
+++ b/src/client/views/linking/LinkPopup.scss
@@ -0,0 +1,45 @@
+.linkPopup-container {
+ background: white;
+ box-shadow: 0 10px 20px rgba(0, 0, 0, 0.19), 0 6px 6px rgba(0, 0, 0, 0.23);
+ top: 35px;
+ height: 200px;
+ width: 200px;
+ position: absolute;
+ padding: 15px;
+ border-radius: 3px;
+
+ input {
+ border: 1px solid #b9b9b9;
+ border-radius: 20px;
+ height: 25px;
+ width: 100%;
+ padding-left: 10px;
+ }
+
+ .divider {
+ margin: 10px 0;
+ height: 20px;
+ width: 100%;
+
+ .line {
+ height: 1px;
+ background-color: #b9b9b9;
+ width: 100%;
+ position: relative;
+ top: 12px;
+ }
+
+ .divider-text {
+ width: 20px;
+ background-color: white;
+ text-align: center;
+ position: relative;
+ margin: auto;
+ }
+ }
+
+
+ .searchBox-container {
+ background: pink;
+ }
+} \ No newline at end of file
diff --git a/src/client/views/linking/LinkPopup.tsx b/src/client/views/linking/LinkPopup.tsx
new file mode 100644
index 000000000..2c4b718f4
--- /dev/null
+++ b/src/client/views/linking/LinkPopup.tsx
@@ -0,0 +1,114 @@
+import { IconProp } from '@fortawesome/fontawesome-svg-core';
+import { FontAwesomeIcon } from '@fortawesome/react-fontawesome';
+import { Tooltip } from '@material-ui/core';
+import { action, observable, runInAction } from 'mobx';
+import { observer } from "mobx-react";
+import { Doc, DocListCast } from '../../../fields/Doc';
+import { Cast, StrCast } from '../../../fields/Types';
+import { WebField } from '../../../fields/URLField';
+import { emptyFunction, setupMoveUpEvents, returnFalse, returnTrue, returnEmptyDoclist, returnEmptyFilter } from '../../../Utils';
+import { DocumentType } from '../../documents/DocumentTypes';
+import { DocumentManager } from '../../util/DocumentManager';
+import { DragManager } from '../../util/DragManager';
+import { Hypothesis } from '../../util/HypothesisUtils';
+import { LinkManager } from '../../util/LinkManager';
+import { undoBatch } from '../../util/UndoManager';
+import { DocumentLinksButton } from '../nodes/DocumentLinksButton';
+import { DocumentView, DocumentViewSharedProps } from '../nodes/DocumentView';
+import { LinkDocPreview } from '../nodes/LinkDocPreview';
+import './LinkPopup.scss';
+import React = require("react");
+import { CurrentUserUtils } from '../../util/CurrentUserUtils';
+import { DefaultStyleProvider } from '../StyleProvider';
+import { Transform } from '../../util/Transform';
+import { DocUtils } from '../../documents/Documents';
+import { SearchBox } from '../search/SearchBox';
+import { EditorView } from 'prosemirror-view';
+import { FormattedTextBox } from '../nodes/formattedText/FormattedTextBox';
+
+interface LinkPopupProps {
+ showPopup: boolean;
+ // groupType: string;
+ // linkDoc: Doc;
+ // docView: DocumentView;
+ // sourceDoc: Doc;
+}
+
+/**
+ * Popup component for creating links from text to Dash documents
+ */
+
+@observer
+export class LinkPopup extends React.Component<LinkPopupProps> {
+ @observable private linkURL: string = "";
+ @observable public view?: EditorView;
+
+
+
+ // TODO: should check for valid URL
+ @undoBatch
+ makeLinkToURL = (target: string, lcoation: string) => {
+ ((this.view as any)?.TextView as FormattedTextBox).makeLinkAnchor(undefined, "onRadd:rightight", target, target);
+ }
+
+ @action
+ onLinkChange = (e: React.ChangeEvent<HTMLInputElement>) => {
+ this.linkURL = e.target.value;
+ console.log(this.linkURL)
+ }
+
+
+ getPWidth = () => 500;
+ getPHeight = () => 500;
+
+ render() {
+ const popupVisibility = this.props.showPopup ? "block" : "none";
+ return (
+ <div className="linkPopup-container" style={{ display: popupVisibility }}>
+ <div className="linkPopup-url-container">
+ <input autoComplete="off" type="text" value={this.linkURL} placeholder="Enter URL..." onChange={this.onLinkChange} />
+ <button onPointerDown={e => this.makeLinkToURL(this.linkURL, "add:right")}
+ style={{ display: "block", margin: "10px auto", }}>Apply hyperlink</button>
+ </div>
+ <div className="divider">
+ <div className="line"></div>
+ <p className="divider-text">or</p>
+ </div>
+ <div className="linkPopup-document-search-container">
+ {/* <i></i>
+ <input defaultValue={""} autoComplete="off" type="text" placeholder="Search for Document..." id="search-input"
+ className="linkPopup-searchBox searchBox-input" /> */}
+
+ <SearchBox Document={CurrentUserUtils.MySearchPanelDoc}
+ DataDoc={CurrentUserUtils.MySearchPanelDoc}
+ fieldKey="data"
+ dropAction="move"
+ isSelected={returnTrue}
+ isContentActive={returnTrue}
+ select={returnTrue}
+ setHeight={returnFalse}
+ addDocument={undefined}
+ addDocTab={returnTrue}
+ pinToPres={emptyFunction}
+ rootSelected={returnTrue}
+ styleProvider={DefaultStyleProvider}
+ layerProvider={undefined}
+ removeDocument={undefined}
+ ScreenToLocalTransform={Transform.Identity}
+ PanelWidth={this.getPWidth}
+ PanelHeight={this.getPHeight}
+ renderDepth={0}
+ focus={DocUtils.DefaultFocus}
+ docViewPath={returnEmptyDoclist}
+ whenChildContentsActiveChanged={emptyFunction}
+ bringToFront={emptyFunction}
+ docFilters={returnEmptyFilter}
+ docRangeFilters={returnEmptyFilter}
+ searchFilterDocs={returnEmptyDoclist}
+ ContainingCollectionView={undefined}
+ ContainingCollectionDoc={undefined} />
+ </div>
+ </div>
+ );
+ }
+} \ No newline at end of file
diff --git a/src/client/views/nodes/AudioBox.tsx b/src/client/views/nodes/AudioBox.tsx
index a2e36f12e..82bad971d 100644
--- a/src/client/views/nodes/AudioBox.tsx
+++ b/src/client/views/nodes/AudioBox.tsx
@@ -196,7 +196,7 @@ export class AudioBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp
this._recorder.ondataavailable = async (e: any) => {
const [{ result }] = await Networking.UploadFilesToServer(e.data);
if (!(result instanceof Error)) {
- this.props.Document[this.props.fieldKey] = new AudioField(Utils.prepend(result.accessPaths.agnostic.client));
+ this.props.Document[this.props.fieldKey] = new AudioField(result.accessPaths.agnostic.client);
}
};
this._recordStart = new Date().getTime();
diff --git a/src/client/views/nodes/DocumentContentsView.tsx b/src/client/views/nodes/DocumentContentsView.tsx
index f0a54e4ac..3d2cdf5a4 100644
--- a/src/client/views/nodes/DocumentContentsView.tsx
+++ b/src/client/views/nodes/DocumentContentsView.tsx
@@ -8,10 +8,10 @@ import { emptyPath, OmitKeys, Without } from "../../../Utils";
import { DirectoryImportBox } from "../../util/Import & Export/DirectoryImportBox";
import { CollectionDockingView } from "../collections/CollectionDockingView";
import { CollectionFreeFormView } from "../collections/collectionFreeForm/CollectionFreeFormView";
-import { CollectionSchemaView } from "../collections/CollectionSchemaView";
+import { CollectionSchemaView } from "../collections/collectionSchema/CollectionSchemaView";
import { CollectionView } from "../collections/CollectionView";
import { InkingStroke } from "../InkingStroke";
-import { PresElementBox } from "../presentationview/PresElementBox";
+import { PresElementBox } from "../nodes/trails/PresElementBox";
import { SearchBox } from "../search/SearchBox";
import { DashWebRTCVideo } from "../webcam/DashWebRTCVideo";
import { YoutubeBox } from "./../../apis/youtube/YoutubeBox";
@@ -32,7 +32,7 @@ import { LabelBox } from "./LabelBox";
import { LinkAnchorBox } from "./LinkAnchorBox";
import { LinkBox } from "./LinkBox";
import { PDFBox } from "./PDFBox";
-import { PresBox } from "./PresBox";
+import { PresBox } from "./trails/PresBox";
import { ScreenshotBox } from "./ScreenshotBox";
import { ScriptingBox } from "./ScriptingBox";
import { SliderBox } from "./SliderBox";
@@ -64,6 +64,7 @@ interface HTMLtagProps {
htmltag: string;
onClick?: ScriptField;
onInput?: ScriptField;
+ scaling: number;
}
//"<HTMLdiv borderRadius='100px' onClick={this.bannerColor=this.bannerColor==='red'?'green':'red'} overflow='hidden' position='absolute' width='100%' height='100%' transform='rotate({2*this.x+this.y}deg)'> <ImageBox {...props} fieldKey={'data'}/> <HTMLspan width='200px' top='0' height='35px' textAlign='center' paddingTop='10px' transform='translate(-40px, 45px) rotate(-45deg)' position='absolute' color='{this.bannerColor===`green`?`light`:`dark`}blue' backgroundColor='{this.bannerColor===`green`?`dark`:`light`}blue'> {this.title}</HTMLspan></HTMLdiv>"
@@ -82,7 +83,7 @@ interface HTMLtagProps {
export class HTMLtag extends React.Component<HTMLtagProps> {
click = (e: React.MouseEvent) => {
const clickScript = (this.props as any).onClick as Opt<ScriptField>;
- clickScript?.script.run({ this: this.props.Document, self: this.props.RootDoc });
+ clickScript?.script.run({ this: this.props.Document, self: this.props.RootDoc, scale: this.props.scaling });
}
onInput = (e: React.FormEvent<HTMLDivElement>) => {
const onInputScript = (this.props as any).onInput as Opt<ScriptField>;
@@ -90,9 +91,9 @@ export class HTMLtag extends React.Component<HTMLtagProps> {
}
render() {
const style: { [key: string]: any } = {};
- const divKeys = OmitKeys(this.props, ["children", "htmltag", "RootDoc", "Document", "key", "onInput", "onClick", "__proto__"]).omit;
+ const divKeys = OmitKeys(this.props, ["children", "htmltag", "RootDoc", "scaling", "Document", "key", "onInput", "onClick", "__proto__"]).omit;
const replacer = (match: any, expr: string, offset: any, string: any) => { // bcz: this executes a script to convert a propery expression string: { script } into a value
- return ScriptField.MakeFunction(expr, { self: Doc.name, this: Doc.name })?.script.run({ self: this.props.RootDoc, this: this.props.Document }).result as string || "";
+ return ScriptField.MakeFunction(expr, { self: Doc.name, this: Doc.name, scale: "number" })?.script.run({ self: this.props.RootDoc, this: this.props.Document, scale: this.props.scaling }).result as string || "";
};
Object.keys(divKeys).map((prop: string) => {
const p = (this.props as any)[prop] as string;
@@ -180,11 +181,11 @@ export class DocumentContentsView extends React.Component<DocumentViewProps & Fo
const replacer = (match: any, prefix: string, expr: string, postfix: string, offset: any, string: any) => {
return prefix + (ScriptField.MakeFunction(expr, { self: Doc.name, this: Doc.name })?.script.run({ this: this.props.Document }).result as string || "") + postfix;
};
- layoutFrame = layoutFrame.replace(/(>[^{]*)\{([^.'][^<}]+)\}([^}]*<)/g, replacer);
+ layoutFrame = layoutFrame.replace(/(>[^{]*)[^=]\{([^.'][^<}]+)\}([^}]*<)/g, replacer);
// replace HTML<tag> with corresponding HTML tag as in: <HTMLdiv> becomes <HTMLtag Document={props.Document} htmltag='div'>
const replacer2 = (match: any, p1: string, offset: any, string: any) => {
- return `<HTMLtag RootDoc={props.RootDoc} Document={props.Document} htmltag='${p1}'`;
+ return `<HTMLtag RootDoc={props.RootDoc} Document={props.Document} scaling='${this.props.scaling?.() || 1}' htmltag='${p1}'`;
};
layoutFrame = layoutFrame.replace(/<HTML([a-zA-Z0-9_-]+)/g, replacer2);
@@ -200,7 +201,7 @@ export class DocumentContentsView extends React.Component<DocumentViewProps & Fo
if (splits.length > 1) {
const code = XRegExp.matchRecursive(splits[1], "{", "}", "", { valueNames: ["between", "left", "match", "right", "between"] });
layoutFrame = splits[0] + ` ${func}={props.${func}} ` + splits[1].substring(code[1].end + 1);
- return ScriptField.MakeScript(code[1].value, { this: Doc.name, self: Doc.name, value: "string" });
+ return ScriptField.MakeScript(code[1].value, { this: Doc.name, self: Doc.name, scale: "number", value: "string" });
}
return undefined;
// add input function to props
diff --git a/src/client/views/nodes/DocumentLinksButton.scss b/src/client/views/nodes/DocumentLinksButton.scss
index 735aa669f..b37b68249 100644
--- a/src/client/views/nodes/DocumentLinksButton.scss
+++ b/src/client/views/nodes/DocumentLinksButton.scss
@@ -1,16 +1,27 @@
-@import "../globalCssVariables.scss";
+@import "../global/globalCssVariables.scss";
+.documentLinksButton-menu {
+ width: 100%;
+ height: 100%;
+ position: relative;
+ display: flex;
+ align-content: center;
+ justify-content: center;
+ align-items: center;
+}
+
.documentLinksButton-cont {
min-width: 20;
min-height: 20;
position: absolute;
}
+
.documentLinksButton,
.documentLinksButton-endLink,
.documentLinksButton-startLink {
- height: 20px;
- width: 20px;
+ height: 25px;
+ width: 25px;
position: absolute;
border-radius: 50%;
opacity: 0.9;
@@ -33,27 +44,43 @@
}
.documentLinksButton {
- background-color: black;
+ background-color: $dark-gray;
+ color: $white;
font-weight: bold;
+ width: 80%;
+ height: 80%;
+ font-size: 100%;
+ transition: 0.2s ease all;
&:hover {
- background: $main-accent;
- transform: scale(1.05);
- cursor: pointer;
+ background-color: $black;
}
}
-.documentLinksButton-endLink {
- border: red solid 2px;
+.documentLinksButton.startLink {
+ background-color: $medium-blue;
+ color: $white;
+ font-weight: bold;
+ width: 80%;
+ height: 80%;
+ font-size: 100%;
+ transition: 0.2s ease all;
&:hover {
- background: deepskyblue;
- transform: scale(1.05);
- cursor: pointer;
+ background-color: $black;
}
}
-.documentLinksButton-startLink {
- border: red solid 2px;
- background-color: rgba(255, 192, 203, 0.5);
+.documentLinksButton-endLink {
+ border: $medium-blue 2px dashed;
+ color: $medium-blue;
+ background-color: none !important;
+ width: 80%;
+ height: 80%;
+ font-size: 100%;
+ transition: 0.2s ease all;
+
+ &:hover {
+ background-color: $light-blue;
+ }
} \ No newline at end of file
diff --git a/src/client/views/nodes/DocumentLinksButton.tsx b/src/client/views/nodes/DocumentLinksButton.tsx
index a6d07374a..b63174e54 100644
--- a/src/client/views/nodes/DocumentLinksButton.tsx
+++ b/src/client/views/nodes/DocumentLinksButton.tsx
@@ -20,6 +20,7 @@ import './DocumentLinksButton.scss';
import { DocServer } from "../../DocServer";
import { LightboxView } from "../LightboxView";
import { cat } from "shelljs";
+import { Colors } from "../global/globalEnums";
const higflyout = require("@hig/flyout");
export const { anchorPoints } = higflyout;
@@ -30,12 +31,12 @@ interface DocumentLinksButtonProps {
Offset?: (number | undefined)[];
AlwaysOn?: boolean;
InMenu?: boolean;
- StartLink?: boolean;
+ StartLink?: boolean; //whether the link HAS been started (i.e. now needs to be completed)
}
@observer
export class DocumentLinksButton extends React.Component<DocumentLinksButtonProps, {}> {
private _linkButton = React.createRef<HTMLDivElement>();
- @observable public static StartLink: Doc | undefined;
+ @observable public static StartLink: Doc | undefined; //origin's Doc, if defined
@observable public static StartLinkView: DocumentView | undefined;
@observable public static AnnotationId: string | undefined;
@observable public static AnnotationUri: string | undefined;
@@ -45,6 +46,7 @@ export class DocumentLinksButton extends React.Component<DocumentLinksButtonProp
public static invisibleWebRef = React.createRef<HTMLDivElement>();
@action public static ClearLinkEditor() { DocumentLinksButton.LinkEditorDocView = undefined; }
+
@action @undoBatch
onLinkButtonMoved = (e: PointerEvent) => {
if (this.props.InMenu && this.props.StartLink) {
@@ -66,6 +68,40 @@ export class DocumentLinksButton extends React.Component<DocumentLinksButtonProp
return false;
}
+ onLinkMenuOpen = (e: React.PointerEvent): void => {
+ setupMoveUpEvents(this, e, this.onLinkButtonMoved, emptyFunction, action((e, doubleTap) => {
+ if (doubleTap) {
+ const rootDoc = this.props.View.rootDoc;
+ const docid = Doc.CurrentUserEmail + Doc.GetProto(rootDoc)[Id] + "-pivotish";
+ DocServer.GetRefField(docid).then(async docx => {
+ const rootAlias = () => {
+ const rootAlias = Doc.MakeAlias(rootDoc);
+ rootAlias.x = rootAlias.y = 0;
+ return rootAlias;
+ };
+ let wid = rootDoc[WidthSym]();
+ const target = ((docx instanceof Doc) && docx) || Docs.Create.FreeformDocument([rootAlias()], { title: this.props.View.Document.title + "-pivot", _width: 500, _height: 500, }, docid);
+ const docs = await DocListCastAsync(Doc.GetProto(target).data);
+ if (!target.pivotFocusish) (Doc.GetProto(target).pivotFocusish = target);
+ DocListCast(rootDoc.links).forEach(link => {
+ const other = LinkManager.getOppositeAnchor(link, rootDoc);
+ const otherdoc = !other ? undefined : other.annotationOn ? Cast(other.annotationOn, Doc, null) : other;
+ if (otherdoc && !docs?.some(d => Doc.AreProtosEqual(d, otherdoc))) {
+ const alias = Doc.MakeAlias(otherdoc);
+ alias.x = wid;
+ alias.y = 0;
+ alias._lockedPosition = false;
+ wid += otherdoc[WidthSym]();
+ Doc.AddDocToList(Doc.GetProto(target), "data", alias);
+ }
+ });
+ LightboxView.SetLightboxDoc(target);
+ });
+ }
+ else DocumentLinksButton.LinkEditorDocView = this.props.View;
+ }));
+ }
+
@undoBatch
onLinkButtonDown = (e: React.PointerEvent): void => {
setupMoveUpEvents(this, e, this.onLinkButtonMoved, emptyFunction, action((e, doubleTap) => {
@@ -78,37 +114,7 @@ export class DocumentLinksButton extends React.Component<DocumentLinksButtonProp
DocumentLinksButton.StartLink = this.props.View.props.Document;
DocumentLinksButton.StartLinkView = this.props.View;
}
- } else if (!this.props.InMenu) {
- if (doubleTap) {
- const rootDoc = this.props.View.rootDoc;
- const docid = Doc.CurrentUserEmail + Doc.GetProto(rootDoc)[Id] + "-pivotish";
- DocServer.GetRefField(docid).then(async docx => {
- const rootAlias = () => {
- const rootAlias = Doc.MakeAlias(rootDoc);
- rootAlias.x = rootAlias.y = 0;
- return rootAlias;
- };
- let wid = rootDoc[WidthSym]();
- const target = ((docx instanceof Doc) && docx) || Docs.Create.FreeformDocument([rootAlias()], { title: this.props.View.Document.title + "-pivot", _width: 500, _height: 500, }, docid);
- const docs = await DocListCastAsync(Doc.GetProto(target).data);
- if (!target.pivotFocusish) (Doc.GetProto(target).pivotFocusish = target);
- DocListCast(rootDoc.links).forEach(link => {
- const other = LinkManager.getOppositeAnchor(link, rootDoc);
- const otherdoc = !other ? undefined : other.annotationOn ? Cast(other.annotationOn, Doc, null) : other;
- if (otherdoc && !docs?.some(d => Doc.AreProtosEqual(d, otherdoc))) {
- const alias = Doc.MakeAlias(otherdoc);
- alias.x = wid;
- alias.y = 0;
- alias._lockedPosition = false;
- wid += otherdoc[WidthSym]();
- Doc.AddDocToList(Doc.GetProto(target), "data", alias);
- }
- });
- LightboxView.SetLightboxDoc(target);
- });
- }
- else DocumentLinksButton.LinkEditorDocView = this.props.View;
- }
+ };
}));
}
@@ -120,17 +126,17 @@ export class DocumentLinksButton extends React.Component<DocumentLinksButtonProp
if (DocumentLinksButton.StartLink === this.props.View.props.Document) {
DocumentLinksButton.StartLink = undefined;
DocumentLinksButton.StartLinkView = undefined;
- } else {
+ } else { //if this LinkButton's Document is undefined
DocumentLinksButton.StartLink = this.props.View.props.Document;
DocumentLinksButton.StartLinkView = this.props.View;
}
-
//action(() => Doc.BrushDoc(this.props.View.Document));
} else if (!this.props.InMenu) {
DocumentLinksButton.LinkEditorDocView = this.props.View;
}
}
+
completeLink = (e: React.PointerEvent): void => {
setupMoveUpEvents(this, e, returnFalse, emptyFunction, undoBatch(action((e, doubleTap) => {
if (doubleTap && !this.props.StartLink) {
@@ -141,7 +147,7 @@ export class DocumentLinksButton extends React.Component<DocumentLinksButtonProp
} else if (DocumentLinksButton.StartLink && DocumentLinksButton.StartLink !== this.props.View.props.Document) {
const sourceDoc = DocumentLinksButton.StartLink;
const targetDoc = this.props.View.ComponentView?.getAnchor?.() || this.props.View.Document;
- const linkDoc = DocUtils.MakeLink({ doc: sourceDoc }, { doc: targetDoc }, "long drag");
+ const linkDoc = DocUtils.MakeLink({ doc: sourceDoc }, { doc: targetDoc }, "links"); //why is long drag here when this is used for completing links by clicking?
LinkManager.currentLink = linkDoc;
@@ -184,7 +190,7 @@ export class DocumentLinksButton extends React.Component<DocumentLinksButtonProp
} else if (startLink !== endLink) {
endLink = endLinkView?.docView?._componentView?.getAnchor?.() || endLink;
startLink = DocumentLinksButton.StartLinkView?.docView?._componentView?.getAnchor?.() || startLink;
- const linkDoc = DocUtils.MakeLink({ doc: startLink }, { doc: endLink }, DocumentLinksButton.AnnotationId ? "hypothes.is annotation" : "long drag", undefined, undefined, true);
+ const linkDoc = DocUtils.MakeLink({ doc: startLink }, { doc: endLink }, DocumentLinksButton.AnnotationId ? "hypothes.is annotation" : "link", undefined, undefined, true);
LinkManager.currentLink = linkDoc;
@@ -192,7 +198,7 @@ export class DocumentLinksButton extends React.Component<DocumentLinksButtonProp
Doc.GetProto(linkDoc as Doc).linksToAnnotation = true;
Doc.GetProto(linkDoc as Doc).annotationId = DocumentLinksButton.AnnotationId;
Doc.GetProto(linkDoc as Doc).annotationUri = DocumentLinksButton.AnnotationUri;
- const dashHyperlink = Utils.prepend("/doc/" + (startIsAnnotation ? endLink[Id] : startLink[Id]));
+ const dashHyperlink = Doc.globalServerPath(startIsAnnotation ? endLink : startLink);
Hypothesis.makeLink(StrCast(startIsAnnotation ? endLink.title : startLink.title), dashHyperlink, DocumentLinksButton.AnnotationId,
(startIsAnnotation ? startLink : endLink)); // edit annotation to add a Dash hyperlink to the linked doc
}
@@ -242,45 +248,50 @@ export class DocumentLinksButton extends React.Component<DocumentLinksButtonProp
return results;
}
+ /**
+ * gets the JSX of the link button (btn used to start/complete links) OR the link-view button (btn on bottom left of each linked node)
+ *
+ * todo:glr / anh seperate functionality such as onClick onPointerDown of link menu button
+ */
@computed get linkButtonInner() {
- const btnDim = this.props.InMenu ? "20px" : "30px";
+ const btnDim = "30px";
const link = <img style={{ width: "22px", height: "16px" }} src={`/assets/${"link.png"}`} />;
-
- return <div className="documentLinksButton-cont" ref={this._linkButton}
- style={{ left: this.props.Offset?.[0], top: this.props.Offset?.[1], right: this.props.Offset?.[2], bottom: this.props.Offset?.[3] }}
- >
- <div className={"documentLinksButton"}
- onPointerDown={this.onLinkButtonDown} onClick={this.onLinkClick}
- style={{
- backgroundColor: this.props.InMenu ? "" : "#add8e6",
- color: this.props.InMenu ? "white" : "black",
- width: btnDim,
- height: btnDim,
- }} >
- {this.props.InMenu ?
- this.props.StartLink ?
- <FontAwesomeIcon className="documentdecorations-icon" icon="link" size="sm" />
- : link
- : Array.from(this.filteredLinks).length}
- </div>
- {this.props.InMenu && !this.props.StartLink && DocumentLinksButton.StartLink !== this.props.View.props.Document ?
- <div className={"documentLinksButton-endLink"}
+ const isActive = (DocumentLinksButton.StartLink === this.props.View.props.Document) && this.props.StartLink;
+ return (!this.props.InMenu ?
+ <div className="documentLinksButton-cont"
+ style={{ left: this.props.Offset?.[0], top: this.props.Offset?.[1], right: this.props.Offset?.[2], bottom: this.props.Offset?.[3] }}
+ >
+ <div className={"documentLinksButton"}
+ onPointerDown={this.onLinkMenuOpen} onClick={this.onLinkClick}
style={{
- width: btnDim, height: btnDim,
- backgroundColor: DocumentLinksButton.StartLink ? "" : "grey",
- opacity: DocumentLinksButton.StartLink ? "" : "50%",
- border: DocumentLinksButton.StartLink ? "" : "none",
- cursor: DocumentLinksButton.StartLink ? "pointer" : "default"
- }}
- onPointerDown={DocumentLinksButton.StartLink && this.completeLink}
- onClick={e => DocumentLinksButton.StartLink && DocumentLinksButton.finishLinkClick(e.clientX, e.clientY, DocumentLinksButton.StartLink, this.props.View.props.Document, true, this.props.View)} />
- : (null)
- }
- {DocumentLinksButton.StartLink === this.props.View.props.Document && this.props.InMenu && this.props.StartLink ?
- <div className={"documentLinksButton-startLink"} onPointerDown={this.clearLinks} onClick={this.clearLinks} style={{ width: btnDim, height: btnDim }} />
- : (null)
- }
- </div >;
+ backgroundColor: Colors.LIGHT_BLUE,
+ color: Colors.BLACK,
+ width: btnDim,
+ height: btnDim,
+ }}>
+ {Array.from(this.filteredLinks).length}
+ </div>
+ </div>
+ :
+ <div className="documentLinksButton-menu" ref={this._linkButton}>
+ {this.props.InMenu && !this.props.StartLink && DocumentLinksButton.StartLink !== this.props.View.props.Document ? //if the origin node is not this node
+ <div className={"documentLinksButton-endLink"}
+ onPointerDown={DocumentLinksButton.StartLink && this.completeLink}
+ onClick={e => DocumentLinksButton.StartLink && DocumentLinksButton.finishLinkClick(e.clientX, e.clientY, DocumentLinksButton.StartLink, this.props.View.props.Document, true, this.props.View)}>
+ <FontAwesomeIcon className="documentdecorations-icon" icon="link" />
+ </div>
+ : (null)
+ }
+ {
+ this.props.InMenu && this.props.StartLink ? //if link has been started from current node, then set behavior of link button to deactivate linking when clicked again
+ <div className={`documentLinksButton ${isActive ? `startLink` : ``}`} onPointerDown={isActive ? undefined : this.onLinkButtonDown} onClick={isActive ? this.clearLinks : this.onLinkClick}>
+ <FontAwesomeIcon className="documentdecorations-icon" icon="link" />
+ </div>
+ :
+ (null)
+ }
+ </div>
+ )
}
render() {
@@ -290,6 +301,7 @@ export class DocumentLinksButton extends React.Component<DocumentLinksButtonProp
const buttonTitle = "Tap to view links; double tap to open link collection";
const title = this.props.InMenu ? menuTitle : buttonTitle;
+ //render circular tooltip if it isn't set to invisible and show the number of doc links the node has, and render inner-menu link button for starting/stopping links if currently in menu
return !Array.from(this.filteredLinks).length && !this.props.AlwaysOn ? (null) :
this.props.InMenu && (DocumentLinksButton.StartLink || this.props.StartLink) ?
<Tooltip title={<div className="dash-tooltip">{title}</div>}>
diff --git a/src/client/views/nodes/DocumentView.scss b/src/client/views/nodes/DocumentView.scss
index bdbece621..7f164ca48 100644
--- a/src/client/views/nodes/DocumentView.scss
+++ b/src/client/views/nodes/DocumentView.scss
@@ -1,4 +1,4 @@
-@import "../globalCssVariables";
+@import "../global/globalCssVariables";
.documentView-effectsWrapper {
border-radius: inherit;
@@ -22,7 +22,7 @@
transition: outline .3s linear;
cursor: grab;
- // background: $light-color; //overflow: hidden;
+ // background: $white; //overflow: hidden;
transform-origin: left top;
&.minimized {
@@ -147,7 +147,7 @@
.documentView-titleWrapper,
.documentView-titleWrapper-hover {
overflow: hidden;
- color: white;
+ color: $black;
transform-origin: top left;
top: 0;
width: 100%;
@@ -218,6 +218,6 @@
.documentView-node:first-child {
position: relative;
- background: "#B59B66"; //$light-color;
+ background: "#B59B66"; //$white;
}
} \ No newline at end of file
diff --git a/src/client/views/nodes/DocumentView.tsx b/src/client/views/nodes/DocumentView.tsx
index b861669f8..bea219831 100644
--- a/src/client/views/nodes/DocumentView.tsx
+++ b/src/client/views/nodes/DocumentView.tsx
@@ -13,7 +13,7 @@ import { BoolCast, Cast, NumCast, ScriptCast, StrCast } from "../../../fields/Ty
import { AudioField } from "../../../fields/URLField";
import { GetEffectiveAcl, SharingPermissions, TraceMobx } from '../../../fields/util';
import { MobileInterface } from '../../../mobile/MobileInterface';
-import { emptyFunction, hasDescendantTarget, OmitKeys, returnVal, Utils } from "../../../Utils";
+import { emptyFunction, hasDescendantTarget, OmitKeys, returnVal, Utils, returnTrue } from "../../../Utils";
import { GooglePhotos } from '../../apis/google_docs/GooglePhotosClientUtils';
import { Docs, DocUtils } from "../../documents/Documents";
import { DocumentType } from '../../documents/DocumentTypes';
@@ -43,7 +43,7 @@ import { DocumentLinksButton } from './DocumentLinksButton';
import "./DocumentView.scss";
import { LinkAnchorBox } from './LinkAnchorBox';
import { LinkDocPreview } from "./LinkDocPreview";
-import { PresBox } from './PresBox';
+import { PresBox } from './trails/PresBox';
import { RadialMenu } from './RadialMenu';
import React = require("react");
import { ScriptingBox } from "./ScriptingBox";
@@ -64,7 +64,7 @@ export enum ViewAdjustment {
doNothing = 0
}
-export const ViewSpecPrefix = "_VIEW"; // field prefix for anchor fields that are immediately copied over to the target document when link is followed. Other anchor properties will be copied over in the specific setViewSpec() method on their view (which allows for seting preview values instead of writing to the document)
+export const ViewSpecPrefix = "viewSpec"; // field prefix for anchor fields that are immediately copied over to the target document when link is followed. Other anchor properties will be copied over in the specific setViewSpec() method on their view (which allows for seting preview values instead of writing to the document)
export interface DocFocusOptions {
originalTarget?: Doc; // set in JumpToDocument, used by TabDocView to determine whether to fit contents to tab
@@ -137,7 +137,7 @@ export interface DocumentViewProps extends DocumentViewSharedProps {
hideDecorationTitle?: boolean; // forces suppression of title. e.g, treeView document labels suppress titles in case they are globally active via settings
treeViewDoc?: Doc;
isDocumentActive?: () => boolean | undefined; // whether a document should handle pointer events
- isContentActive: () => boolean | undefined; // whether a document should handle pointer events
+ isContentActive: () => boolean | undefined; // whether document contents should handle pointer events
contentPointerEvents?: string; // pointer events allowed for content of a document view. eg. set to "none" in menuSidebar for sharedDocs so that you can select a document, but not interact with its contents
radialMenu?: String[];
LayoutTemplateString?: string;
@@ -421,7 +421,9 @@ export class DocumentViewInternal extends DocComponent<DocumentViewInternalProps
focus = (anchor: Doc, options?: DocFocusOptions) => {
LightboxView.SetCookie(StrCast(anchor["cookies-set"]));
// copying over _VIEW fields immediately allows the view type to switch to create the right _componentView
- Array.from(Object.keys(Doc.GetProto(anchor))).filter(key => key.startsWith(ViewSpecPrefix)).forEach(spec => this.layoutDoc[spec.replace(ViewSpecPrefix, "")] = ((field) => field instanceof ObjectField ? ObjectField.MakeCopy(field) : field)(anchor[spec]));
+ Array.from(Object.keys(Doc.GetProto(anchor))).filter(key => key.startsWith(ViewSpecPrefix)).forEach(spec => {
+ this.layoutDoc[spec.replace(ViewSpecPrefix, "")] = ((field) => field instanceof ObjectField ? ObjectField.MakeCopy(field) : field)(anchor[spec]);
+ });
// after a timeout, the right _componentView should have been created, so call it to update its view spec values
setTimeout(() => this._componentView?.setViewSpec?.(anchor, LinkDocPreview.LinkInfo ? true : false));
const focusSpeed = this._componentView?.scrollFocus?.(anchor, !LinkDocPreview.LinkInfo); // bcz: smooth parameter should really be passed into focus() instead of inferred here
@@ -746,7 +748,7 @@ export class DocumentViewInternal extends DocComponent<DocumentViewInternalProps
moreItems.push({ description: "Tag Child Images via Google Photos", event: () => GooglePhotos.Query.TagChildImages(this.props.Document), icon: "caret-square-right" });
moreItems.push({ description: "Write Back Link to Album", event: () => GooglePhotos.Transactions.AddTextEnrichment(this.props.Document), icon: "caret-square-right" });
}
- moreItems.push({ description: "Copy ID", event: () => Utils.CopyText(Utils.prepend("/doc/" + this.props.Document[Id])), icon: "fingerprint" });
+ moreItems.push({ description: "Copy ID", event: () => Utils.CopyText(Doc.globalServerPath(this.props.Document)), icon: "fingerprint" });
}
}
@@ -754,16 +756,15 @@ export class DocumentViewInternal extends DocComponent<DocumentViewInternalProps
moreItems.push({ description: "Close", event: this.deleteClicked, icon: "times" });
}
- !more && cm.addItem({ description: "More...", subitems: moreItems, icon: "hand-point-right" });
- cm.moveAfter(cm.findByDescription("More...")!, cm.findByDescription("OnClick...")!);
-
const help = cm.findByDescription("Help...");
const helpItems: ContextMenuProps[] = help && "subitems" in help ? help.subitems : [];
!Doc.UserDoc().novice && helpItems.push({ description: "Show Fields ", event: () => this.props.addDocTab(Docs.Create.KVPDocument(this.props.Document, { _width: 300, _height: 300 }), "add:right"), icon: "layer-group" });
- helpItems.push({ description: "Text Shortcuts Ctrl+/", event: () => this.props.addDocTab(Docs.Create.PdfDocument(Utils.prepend("/assets/cheat-sheet.pdf"), { _width: 300, _height: 300 }), "add:right"), icon: "keyboard" });
+ helpItems.push({ description: "Text Shortcuts Ctrl+/", event: () => this.props.addDocTab(Docs.Create.PdfDocument("/assets/cheat-sheet.pdf", { _width: 300, _height: 300 }), "add:right"), icon: "keyboard" });
!Doc.UserDoc().novice && helpItems.push({ description: "Print Document in Console", event: () => console.log(this.props.Document), icon: "hand-point-right" });
+ !Doc.UserDoc().novice && helpItems.push({ description: "Print DataDoc in Console", event: () => console.log(this.props.Document[DataSym]), icon: "hand-point-right" });
cm.addItem({ description: "Help...", noexpand: true, subitems: helpItems, icon: "question" });
}
+
if (!this.topMost) e?.stopPropagation(); // DocumentViews should stop propagation of this event
cm.displayMenu((e?.pageX || pageX || 0) - 15, (e?.pageY || pageY || 0) - 15);
DocumentViewInternal.SelectAfterContextMenu && !this.props.isSelected(true) && setTimeout(() => SelectionManager.SelectView(this.props.DocumentView(), false), 300); // on a mac, the context menu is triggered on mouse down, but a YouTube video becaomes interactive when selected which means that the context menu won't show up. by delaying the selection until hopefully after the pointer up, the context menu will appear.
@@ -838,7 +839,7 @@ export class DocumentViewInternal extends DocComponent<DocumentViewInternalProps
if (this.props.LayoutTemplateString?.includes(LinkAnchorBox.name)) return null;
if (this.layoutDoc.presBox || this.rootDoc.type === DocumentType.LINK || this.props.dontRegisterView) return (null);
// need to use allLinks for RTF since embedded linked text anchors are not rendered with DocumentViews. All other documents render their anchors with nested DocumentViews so we just need to render the directLinks here
- const filtered = DocUtils.FilterDocs(this.rootDoc.type === DocumentType.RTF ? this.allLinks : this.directLinks, this.props.docFilters(), []).filter(d => !d.hidden);
+ const filtered = DocUtils.FilterDocs(this.rootDoc.type === DocumentType.RTF ? this.allLinks : this.directLinks, this.props.docFilters?.() ?? [], []).filter(d => !d.hidden);
return filtered.map((link, i) =>
<div className="documentView-anchorCont" key={i + 1}>
<DocumentView {...this.props}
@@ -846,6 +847,7 @@ export class DocumentViewInternal extends DocComponent<DocumentViewInternalProps
PanelWidth={this.anchorPanelWidth}
PanelHeight={this.anchorPanelHeight}
dontRegisterView={false}
+ fitWidth={returnTrue}
styleProvider={this.anchorStyleProvider}
removeDocument={this.hideLinkAnchor}
LayoutTemplate={undefined}
@@ -884,7 +886,7 @@ export class DocumentViewInternal extends DocComponent<DocumentViewInternalProps
recorder.ondataavailable = async (e: any) => {
const [{ result }] = await Networking.UploadFilesToServer(e.data);
if (!(result instanceof Error)) {
- const audioDoc = Docs.Create.AudioDocument(Utils.prepend(result.accessPaths.agnostic.client), { title: "audio test", _width: 200, _height: 32 });
+ const audioDoc = Docs.Create.AudioDocument(result.accessPaths.agnostic.client, { title: "audio test", _width: 200, _height: 32 });
audioDoc.treeViewExpandedView = "layout";
const audioAnnos = Cast(self.dataDoc[self.LayoutFieldKey + "-audioAnnotations"], listSpec(Doc));
if (audioAnnos === undefined) {
@@ -970,7 +972,7 @@ export class DocumentViewInternal extends DocComponent<DocumentViewInternalProps
const highlightIndex = this.props.LayoutTemplateString ? (Doc.IsHighlighted(this.props.Document) ? 6 : 0) : Doc.isBrushedHighlightedDegree(this.props.Document); // bcz: Argh!! need to identify a tree view doc better than a LayoutTemlatString
const highlightColor = (CurrentUserUtils.ActiveDashboard?.darkScheme ?
["transparent", "#65350c", "#65350c", "yellow", "magenta", "cyan", "orange"] :
- ["transparent", "maroon", "maroon", "yellow", "magenta", "cyan", "orange"])[highlightIndex];
+ ["transparent", "#4476F7", "#4476F7", "yellow", "magenta", "cyan", "orange"])[highlightIndex];
const highlightStyle = ["solid", "dashed", "solid", "solid", "solid", "solid", "solid"][highlightIndex];
const excludeTypes = !this.props.treeViewDoc ? [DocumentType.FONTICON, DocumentType.INK] : [DocumentType.FONTICON];
let highlighting = !this.props.disableDocBrushing && highlightIndex && !excludeTypes.includes(this.layoutDoc.type as any) && this.layoutDoc._viewType !== CollectionViewType.Linear;
@@ -978,7 +980,7 @@ export class DocumentViewInternal extends DocComponent<DocumentViewInternalProps
const borderPath = this.props.styleProvider?.(this.props.Document, this.props, StyleProp.BorderPath) || { path: undefined };
const internal = PresBox.EffectsProvider(this.layoutDoc, this.renderDoc) || this.renderDoc;
- const boxShadow = highlighting && this.borderRounding && highlightStyle !== "dashed" ? `0 0 0 ${highlightIndex}px ${highlightColor}` :
+ const boxShadow = this.props.treeViewDoc ? null : highlighting && this.borderRounding && highlightStyle !== "dashed" ? `0 0 0 ${highlightIndex}px ${highlightColor}` :
this.boxShadow || (this.props.Document.isTemplateForField ? "black 0.2vw 0.2vw 0.8vw" : undefined);
return <div className={DocumentView.ROOT_DIV} ref={this._mainCont}
onContextMenu={this.onContextMenu}
diff --git a/src/client/views/nodes/FieldView.tsx b/src/client/views/nodes/FieldView.tsx
index 86250c9d1..ebbc1138a 100644
--- a/src/client/views/nodes/FieldView.tsx
+++ b/src/client/views/nodes/FieldView.tsx
@@ -64,9 +64,9 @@ export class FieldView extends React.Component<FieldViewProps> {
// else if (field instaceof PresBox) {
// return <PresBox {...this.props} />;
// }
- else if (field instanceof VideoField) {
- return <VideoBox {...this.props} />;
- }
+ // else if (field instanceof VideoField) {
+ // return <VideoBox {...this.props} />;
+ // }
// else if (field instanceof AudioField) {
// return <AudioBox {...this.props} />;
//}
diff --git a/src/client/views/nodes/FontIconBox.scss b/src/client/views/nodes/FontIconBox.scss
index 33ac85a0e..718af2c16 100644
--- a/src/client/views/nodes/FontIconBox.scss
+++ b/src/client/views/nodes/FontIconBox.scss
@@ -1,5 +1,7 @@
+@import "../global/globalCssVariables";
+
.fontIconBox-label {
- color: white;
+ color: $white;
margin-right: 4px;
margin-top: 1px;
position: relative;
@@ -22,8 +24,8 @@
position: absolute;
top: -10px;
right: -10px;
- color: white;
- background: #f44b42;
+ color: $white;
+ background: $pink;
font-weight: 300;
border-radius: 100%;
width: 25px;
@@ -37,7 +39,7 @@
.menuButton-circle,
.menuButton-round {
border-radius: 100%;
- background-color: black;
+ background-color: $dark-gray;
padding: 0;
.fontIconBox-label {
@@ -47,13 +49,14 @@
}
&:hover {
- background-color: #aaaaa3;
+ background-color: $light-gray;
}
}
.menuButton-square {
padding-top: 3px;
padding-bottom: 3px;
+ background-color: $dark-gray;
.fontIconBox-label {
border-radius: 0px;
diff --git a/src/client/views/nodes/FontIconBox.tsx b/src/client/views/nodes/FontIconBox.tsx
index 6ae4b9726..0d415e238 100644
--- a/src/client/views/nodes/FontIconBox.tsx
+++ b/src/client/views/nodes/FontIconBox.tsx
@@ -14,6 +14,7 @@ import { DocComponent } from '../DocComponent';
import { StyleProp } from '../StyleProvider';
import { FieldView, FieldViewProps } from './FieldView';
import './FontIconBox.scss';
+import { Colors } from '../global/globalEnums';
const FontIconSchema = createSchema({
icon: "string",
});
@@ -47,7 +48,7 @@ export class FontIconBox extends DocComponent<FieldViewProps, FontIconDocument>(
const icon = StrCast(this.dataDoc.icon, "user") as any;
const presSize = shape === 'round' ? 25 : 30;
const presTrailsIcon = <img src={`/assets/${"presTrails.png"}`}
- style={{ width: presSize, height: presSize, filter: `invert(${color === "white" ? "100%" : "0%"})`, marginBottom: "5px" }} />;
+ style={{ width: presSize, height: presSize, filter: `invert(${color === Colors.DARK_GRAY ? "0%" : "100%"})`, marginBottom: "5px" }} />;
const button = <button className={`menuButton-${shape}`} onContextMenu={this.specificContextMenu}
style={{ backgroundColor: backgroundColor, }}>
<div className="menuButton-wrap">
diff --git a/src/client/views/nodes/ImageBox.tsx b/src/client/views/nodes/ImageBox.tsx
index e2e08a0e6..2c0106960 100644
--- a/src/client/views/nodes/ImageBox.tsx
+++ b/src/client/views/nodes/ImageBox.tsx
@@ -7,10 +7,10 @@ import { List } from '../../../fields/List';
import { ObjectField } from '../../../fields/ObjectField';
import { createSchema, makeInterface } from '../../../fields/Schema';
import { ComputedField } from '../../../fields/ScriptField';
-import { Cast, NumCast } from '../../../fields/Types';
+import { Cast, NumCast, StrCast } from '../../../fields/Types';
import { ImageField } from '../../../fields/URLField';
import { TraceMobx } from '../../../fields/util';
-import { emptyFunction, OmitKeys, returnOne, Utils } from '../../../Utils';
+import { emptyFunction, OmitKeys, returnOne, Utils, returnFalse } from '../../../Utils';
import { GooglePhotos } from '../../apis/google_docs/GooglePhotosClientUtils';
import { CognitiveServices, Confidence, Service, Tag } from '../../cognitive_services/CognitiveServices';
import { Networking } from '../../Network';
@@ -26,6 +26,10 @@ import { FaceRectangles } from './FaceRectangles';
import { FieldView, FieldViewProps } from './FieldView';
import "./ImageBox.scss";
import React = require("react");
+import { InkTool } from '../../../fields/InkField';
+import { CurrentUserUtils } from '../../util/CurrentUserUtils';
+import { AnchorMenu } from '../pdf/AnchorMenu';
+import { Docs } from '../../documents/Documents';
const path = require('path');
export const pageSchema = createSchema({
@@ -60,6 +64,13 @@ export class ImageBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp
} // sets viewing information for a componentview, typically when following a link. 'preview' tells the view to use the values without writing to the document
+
+ getAnchor = () => {
+ const anchor = AnchorMenu.Instance?.GetAnchor(this._savedAnnotations);
+ anchor && this.addDocument(anchor);
+ return anchor ?? this.rootDoc;
+ }
+
componentDidMount() {
this.props.setContentView?.(this); // bcz: do not remove this. without it, stepping into an image in the lightbox causes an infinite loop....
this._disposers.sizer = reaction(() => (
@@ -72,8 +83,8 @@ export class ImageBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp
{ fireImmediately: true, delay: 1000 });
this._disposers.selection = reaction(() => this.props.isSelected(),
selected => !selected && setTimeout(() => {
- Array.from(this._savedAnnotations.values()).forEach(v => v.forEach(a => a.remove()));
- this._savedAnnotations.clear();
+ // Array.from(this._savedAnnotations.values()).forEach(v => v.forEach(a => a.remove()));
+ // this._savedAnnotations.clear();
}));
this._disposers.path = reaction(() => ({ nativeSize: this.nativeSize, width: this.layoutDoc[WidthSym]() }),
({ nativeSize, width }) => {
@@ -227,7 +238,7 @@ export class ImageBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp
let succeeded = true;
let data: ImageField | undefined;
try {
- data = new ImageField(Utils.prepend(accessPaths.agnostic.client));
+ data = new ImageField(accessPaths.agnostic.client);
} catch {
succeeded = false;
}
@@ -321,12 +332,15 @@ export class ImageBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp
}
@action
marqueeDown = (e: React.PointerEvent) => {
- if (!e.altKey && e.button === 0 && this.layoutDoc._viewScale === 1 && this.isContentActive(true)) this._marqueeing = [e.clientX, e.clientY];
+ if (!e.altKey && e.button === 0 && this.layoutDoc._viewScale === 1 && this.isContentActive(true) && ![InkTool.Highlighter, InkTool.Pen].includes(CurrentUserUtils.SelectedTool)) {
+ this._marqueeing = [e.clientX, e.clientY];
+ e.stopPropagation();
+ }
}
@action
finishMarquee = () => {
this._marqueeing = undefined;
- this.props.select(true);
+ this.props.select(false);
}
render() {
@@ -342,16 +356,16 @@ export class ImageBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp
}} >
<CollectionFreeFormView {...OmitKeys(this.props, ["NativeWidth", "NativeHeight", "setContentView"]).omit}
renderDepth={this.props.renderDepth + 1}
+ isAnnotationOverlay={true}
fieldKey={this.annotationKey}
CollectionView={undefined}
- isAnnotationOverlay={true}
annotationLayerHostsContent={true}
PanelWidth={this.props.PanelWidth}
PanelHeight={this.props.PanelHeight}
ScreenToLocalTransform={this.screenToLocalTransform}
+ scaling={returnOne}
select={emptyFunction}
isContentActive={this.isContentActive}
- scaling={returnOne}
whenChildContentsActiveChanged={this.whenChildContentsActiveChanged}
removeDocument={this.removeDocument}
moveDocument={this.moveDocument}
diff --git a/src/client/views/nodes/KeyValueBox.scss b/src/client/views/nodes/KeyValueBox.scss
index eb7c2f32b..ffcba4981 100644
--- a/src/client/views/nodes/KeyValueBox.scss
+++ b/src/client/views/nodes/KeyValueBox.scss
@@ -1,10 +1,10 @@
-@import "../globalCssVariables";
+@import "../global/globalCssVariables";
.keyValueBox-cont {
overflow-y: scroll;
width:100%;
height: 100%;
- background-color: $light-color;
- border: 1px solid $intermediate-color;
+ background-color: $white;
+ border: 1px solid $medium-gray;
border-radius: $border-radius;
box-sizing: border-box;
display: inline-block;
@@ -56,8 +56,8 @@ $header-height: 30px;
width:100%;
position: relative;
display: inline-block;
- background: $intermediate-color;
- color: $light-color;
+ background: $medium-gray;
+ color: $white;
text-transform: uppercase;
letter-spacing: 2px;
font-size: 12px;
@@ -66,7 +66,7 @@ $header-height: 30px;
th {
font-weight: normal;
&:first-child {
- border-right: 1px solid $light-color;
+ border-right: 1px solid $white;
}
}
}
@@ -76,9 +76,9 @@ $header-height: 30px;
display: flex;
width:100%;
height:$header-height;
- background: $light-color;
+ background: $white;
.formattedTextBox-cont {
- background: $light-color;
+ background: $white;
}
}
.keyValueBox-cont {
@@ -116,8 +116,8 @@ $header-height: 30px;
display: flex;
width:100%;
height:30px;
- background: $light-color-secondary;
+ background: $light-gray;
.formattedTextBox-cont {
- background: $light-color-secondary;
+ background: $light-gray;
}
} \ No newline at end of file
diff --git a/src/client/views/nodes/KeyValuePair.scss b/src/client/views/nodes/KeyValuePair.scss
index f78767234..5b660e582 100644
--- a/src/client/views/nodes/KeyValuePair.scss
+++ b/src/client/views/nodes/KeyValuePair.scss
@@ -1,4 +1,4 @@
-@import "../globalCssVariables";
+@import "../global/globalCssVariables";
.keyValuePair-td-key {
diff --git a/src/client/views/nodes/LinkDescriptionPopup.scss b/src/client/views/nodes/LinkDescriptionPopup.scss
index d92823ccc..a8db5d360 100644
--- a/src/client/views/nodes/LinkDescriptionPopup.scss
+++ b/src/client/views/nodes/LinkDescriptionPopup.scss
@@ -1,9 +1,13 @@
+@import "../global/globalCssVariables.scss";
+
.linkDescriptionPopup {
display: flex;
-
- border: 1px solid rgb(170, 26, 26);
-
+ flex-direction: row;
+ justify-content: center;
+ align-items: center;
+ border: 2px solid $medium-blue;
+ background-color: $white;
width: auto;
position: absolute;
@@ -11,17 +15,11 @@
z-index: 10000;
border-radius: 10px;
font-size: 12px;
- //white-space: nowrap;
-
- background-color: rgba(250, 250, 250, 0.95);
- padding-top: 9px;
- padding-bottom: 9px;
- padding-left: 9px;
- padding-right: 9px;
+ gap: 5px;
+ padding: 9px;
.linkDescriptionPopup-input {
float: left;
- background-color: rgba(250, 250, 250, 0.95);
color: rgb(100, 100, 100);
border: none;
min-width: 160px;
@@ -30,46 +28,29 @@
.linkDescriptionPopup-btn {
float: right;
-
justify-content: center;
vertical-align: middle;
-
.linkDescriptionPopup-btn-dismiss {
- background-color: white;
- color: black;
+ cursor: pointer;
display: inline;
- right: 0;
- border-radius: 10px;
- border: 1px solid black;
- padding: 3px;
- font-size: 9px;
- text-align: center;
- position: relative;
- margin-right: 4px;
- justify-content: center;
-
- &:hover{
- cursor: pointer;
- }
+ white-space: nowrap;
+ padding: 5px;
+ vertical-align: middle;
+ background-color: $close-red;
+ border-radius: 3px;
+ color: black;
}
.linkDescriptionPopup-btn-add {
- background-color: black;
- color: white;
+ cursor: pointer;
display: inline;
- right: 0;
- border-radius: 10px;
- border: 1px solid black;
- padding: 3px;
- font-size: 9px;
- text-align: center;
- position: relative;
- justify-content: center;
-
- &:hover{
- cursor: pointer;
- }
+ white-space: nowrap;
+ padding: 5px;
+ vertical-align: middle;
+ background-color: $light-blue;
+ border-radius: 3px;
+ color: black;
}
}
diff --git a/src/client/views/nodes/LinkDocPreview.tsx b/src/client/views/nodes/LinkDocPreview.tsx
index b73fb10df..126a37eb8 100644
--- a/src/client/views/nodes/LinkDocPreview.tsx
+++ b/src/client/views/nodes/LinkDocPreview.tsx
@@ -72,14 +72,14 @@ export class LinkDocPreview extends React.Component<LinkDocPreviewProps> {
@computed get href() {
if (this.props.hrefs?.length) {
const href = this.props.hrefs[this._hrefInd];
- if (href.indexOf(Utils.prepend("/doc/")) !== 0) { // link to a web page URL -- try to show a preview
+ if (href.indexOf(Doc.localServerPath()) !== 0) { // link to a web page URL -- try to show a preview
if (href.startsWith("https://en.wikipedia.org/wiki/")) {
wiki().page(href.replace("https://en.wikipedia.org/wiki/", "")).then(page => page.summary().then(action(summary => this._toolTipText = summary.substring(0, 500))));
} else {
setTimeout(action(() => this._toolTipText = "url => " + href));
}
} else { // hyperlink to a document .. decode doc id and retrieve from the server. this will trigger vals() being invalidated
- const anchorDoc = href.replace(Utils.prepend("/doc/"), "").split("?")[0];
+ const anchorDoc = href.replace(Doc.localServerPath(), "").split("?")[0];
anchorDoc && DocServer.GetRefField(anchorDoc).then(action(anchor => {
if (anchor instanceof Doc && DocListCast(anchor.links).length) {
this._linkDoc = DocListCast(anchor.links)[0];
diff --git a/src/client/views/nodes/PDFBox.scss b/src/client/views/nodes/PDFBox.scss
index 0f46da294..72dec6e4c 100644
--- a/src/client/views/nodes/PDFBox.scss
+++ b/src/client/views/nodes/PDFBox.scss
@@ -7,7 +7,7 @@
overflow: hidden;
cursor: auto;
transform-origin: top left;
- z-index: 0;
+ //z-index: 0;
.pdfBox-ui {
position: absolute;
@@ -30,6 +30,7 @@
justify-content: center;
border-radius: 3px;
pointer-events: all;
+ z-index: 1; // so it appears on top of the document's title, if shown
}
.pdfBox-pageNums {
@@ -223,7 +224,7 @@
.pdfBox {
width: 100%;
height: 100%;
- pointer-events: none;
+ //pointer-events: none;
.pdfViewerDash-text {
.textLayer {
display: none;
diff --git a/src/client/views/nodes/PDFBox.tsx b/src/client/views/nodes/PDFBox.tsx
index feaeb9e21..fc8fa4eef 100644
--- a/src/client/views/nodes/PDFBox.tsx
+++ b/src/client/views/nodes/PDFBox.tsx
@@ -3,10 +3,10 @@ import { action, computed, IReactionDisposer, observable, reaction, runInAction
import { observer } from "mobx-react";
import * as Pdfjs from "pdfjs-dist";
import "pdfjs-dist/web/pdf_viewer.css";
-import { Doc, Opt, WidthSym } from "../../../fields/Doc";
+import { Doc, Opt, WidthSym, DocListCast } from "../../../fields/Doc";
import { documentSchema } from '../../../fields/documentSchemas';
import { makeInterface } from "../../../fields/Schema";
-import { Cast, NumCast, StrCast } from '../../../fields/Types';
+import { Cast, NumCast, StrCast, BoolCast } from '../../../fields/Types';
import { PdfField } from "../../../fields/URLField";
import { TraceMobx } from '../../../fields/util';
import { Utils, setupMoveUpEvents, emptyFunction } from '../../../Utils';
@@ -23,6 +23,7 @@ import { FieldView, FieldViewProps } from './FieldView';
import { pageSchema } from "./ImageBox";
import "./PDFBox.scss";
import React = require("react");
+import { AnchorMenu } from '../pdf/AnchorMenu';
type PdfDocument = makeInterface<[typeof documentSchema, typeof panZoomSchema, typeof pageSchema]>;
const PdfDocument = makeInterface(documentSchema, panZoomSchema, pageSchema);
@@ -52,30 +53,6 @@ export class PDFBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps
if (PDFBox.pdfcache.get(this.pdfUrl.url.href)) runInAction(() => this._pdf = PDFBox.pdfcache.get(this.pdfUrl!.url.href));
else if (PDFBox.pdfpromise.get(this.pdfUrl.url.href)) PDFBox.pdfpromise.get(this.pdfUrl.url.href)?.then(action(pdf => this._pdf = pdf));
}
-
- const backup = "oldPath";
- const href = this.pdfUrl?.url.href;
- if (href) {
- const pathCorrectionTest = /upload\_[a-z0-9]{32}.(.*)/g;
- const matches = pathCorrectionTest.exec(href);
- // console.log("\nHere's the { url } being fed into the outer regex:");
- // console.log(href);
- // console.log("And here's the 'properPath' build from the captured filename:\n");
- if (matches !== null && href.startsWith(window.location.origin)) {
- const properPath = Utils.prepend(`/files/pdfs/${matches[0]}`);
- //console.log(properPath);
- if (!properPath.includes(href)) {
- console.log(`The two (url and proper path) were not equal`);
- const proto = Doc.GetProto(this.props.Document);
- proto[this.props.fieldKey] = new PdfField(properPath);
- proto[backup] = href;
- } else {
- //console.log(`The two (url and proper path) were equal`);
- }
- } else {
- console.log("Outer matches was null!");
- }
- }
}
componentWillUnmount() { this._selectReactionDisposer?.(); }
@@ -89,16 +66,21 @@ export class PDFBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps
}
scrollFocus = (doc: Doc, smooth: boolean) => {
+ if (DocListCast(this.props.Document[this.fieldKey + "-sidebar"]).includes(doc) && !this.SidebarShown) {
+ this.toggleSidebar(!smooth);
+ }
if (this._sidebarRef?.current?.makeDocUnfiltered(doc)) return 1;
this._initialScrollTarget = doc;
return this._pdfViewer?.scrollFocus(doc, smooth);
}
getAnchor = () => {
- const anchor = Docs.Create.TextanchorDocument({
- title: StrCast(this.rootDoc.title + " " + this.layoutDoc._scrollTop),
- annotationOn: this.rootDoc,
- y: NumCast(this.layoutDoc._scrollTop),
- });
+ const anchor =
+ AnchorMenu.Instance?.GetAnchor() ??
+ Docs.Create.TextanchorDocument({
+ title: StrCast(this.rootDoc.title + " " + this.layoutDoc._scrollTop),
+ annotationOn: this.rootDoc,
+ y: NumCast(this.layoutDoc._scrollTop),
+ });
this.addDocument(anchor);
return anchor;
}
@@ -162,15 +144,18 @@ export class PDFBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps
this.layoutDoc._showSidebar = nativeWidth !== this.layoutDoc._nativeWidth;
}
return false;
- }, emptyFunction, this.toggleSidebar);
+ }, emptyFunction, () => this.toggleSidebar());
}
- toggleSidebar = action(() => {
+ toggleSidebar = action((preview: boolean = false) => {
const nativeWidth = NumCast(this.layoutDoc[this.fieldKey + "-nativeWidth"]);
const ratio = ((!this.layoutDoc.nativeWidth || this.layoutDoc.nativeWidth === nativeWidth ? 250 : 0) + nativeWidth) / nativeWidth;
const curNativeWidth = NumCast(this.layoutDoc.nativeWidth, nativeWidth);
- this.layoutDoc.nativeWidth = nativeWidth * ratio;
- this.layoutDoc._width = this.layoutDoc[WidthSym]() * nativeWidth * ratio / curNativeWidth;
- this.layoutDoc._showSidebar = nativeWidth !== this.layoutDoc._nativeWidth;
+ if (preview) this._showSidebar = true;
+ else {
+ this.layoutDoc.nativeWidth = nativeWidth * ratio;
+ this.layoutDoc._width = this.layoutDoc[WidthSym]() * nativeWidth * ratio / curNativeWidth;
+ this.layoutDoc._showSidebar = nativeWidth !== this.layoutDoc._nativeWidth;
+ }
});
settingsPanel() {
const pageBtns = <>
@@ -223,7 +208,7 @@ export class PDFBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps
</button>
</div>;
}
- sidebarWidth = () => !this.layoutDoc._showSidebar ? 0 : (NumCast(this.layoutDoc.nativeWidth) - Doc.NativeWidth(this.dataDoc)) * this.props.PanelWidth() / NumCast(this.layoutDoc.nativeWidth);
+ sidebarWidth = () => !this.SidebarShown ? 0 : (NumCast(this.layoutDoc.nativeWidth) - Doc.NativeWidth(this.dataDoc)) * this.props.PanelWidth() / NumCast(this.layoutDoc.nativeWidth);
specificContextMenu = (e: React.MouseEvent): void => {
const funcs: ContextMenuProps[] = [];
@@ -244,6 +229,9 @@ export class PDFBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps
}
anchorMenuClick = () => this._sidebarRef.current?.anchorMenuClick;
+ @observable _showSidebar = false;
+ @computed get SidebarShown() { return this._showSidebar || this.layoutDoc._showSidebar ? true : false; }
+
@computed get renderPdfView() {
TraceMobx();
@@ -276,6 +264,7 @@ export class PDFBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps
rootDoc={this.rootDoc}
layoutDoc={this.layoutDoc}
dataDoc={this.dataDoc}
+ showSidebar={this.SidebarShown}
whenChildContentsActiveChanged={this.whenChildContentsActiveChanged}
sidebarAddDocument={this.sidebarAddDocument}
moveDocument={this.moveDocument}
diff --git a/src/client/views/nodes/RadialMenu.scss b/src/client/views/nodes/RadialMenu.scss
index daa620d12..312b51013 100644
--- a/src/client/views/nodes/RadialMenu.scss
+++ b/src/client/views/nodes/RadialMenu.scss
@@ -1,4 +1,4 @@
-@import "../globalCssVariables";
+@import "../global/globalCssVariables";
.radialMenu-cont {
position: absolute;
@@ -53,7 +53,7 @@ s
transition: all .1s;
border-width: .11px;
border-style: none;
- border-color: $intermediate-color; // rgb(187, 186, 186);
+ border-color: $medium-gray; // rgb(187, 186, 186);
// padding: 10px 0px 10px 0px;
white-space: nowrap;
font-size: 13px;
diff --git a/src/client/views/nodes/ScreenshotBox.tsx b/src/client/views/nodes/ScreenshotBox.tsx
index 252c029e4..0e235a62d 100644
--- a/src/client/views/nodes/ScreenshotBox.tsx
+++ b/src/client/views/nodes/ScreenshotBox.tsx
@@ -227,7 +227,7 @@ export class ScreenshotBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatabl
this._audioRec.onstop = async (e: any) => {
const [{ result }] = await Networking.UploadFilesToServer(aud_chunks);
if (!(result instanceof Error)) {
- this.dataDoc[this.props.fieldKey + "-audio"] = new AudioField(Utils.prepend(result.accessPaths.agnostic.client));
+ this.dataDoc[this.props.fieldKey + "-audio"] = new AudioField(result.accessPaths.agnostic.client);
}
};
this._videoRef!.srcObject = await (navigator.mediaDevices as any).getDisplayMedia({ video: true });
@@ -244,7 +244,7 @@ export class ScreenshotBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatabl
this.layoutDoc.layout = VideoBox.LayoutString(this.fieldKey);
this.dataDoc.nativeWidth = this.dataDoc.nativeHeight = undefined;
this.layoutDoc._fitWidth = undefined;
- this.dataDoc[this.props.fieldKey] = new VideoField(Utils.prepend(result.accessPaths.agnostic.client));
+ this.dataDoc[this.props.fieldKey] = new VideoField(result.accessPaths.agnostic.client);
} else alert("video conversion failed");
};
this._audioRec.start();
@@ -252,8 +252,8 @@ export class ScreenshotBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatabl
this.dataDoc.mediaState = "recording";
DocUtils.ActiveRecordings.push(this);
} else {
- this._audioRec.stop();
- this._videoRec.stop();
+ this._audioRec?.stop();
+ this._videoRec?.stop();
this.dataDoc.mediaState = "paused";
const ind = DocUtils.ActiveRecordings.indexOf(this);
ind !== -1 && (DocUtils.ActiveRecordings.splice(ind, 1));
diff --git a/src/client/views/nodes/VideoBox.tsx b/src/client/views/nodes/VideoBox.tsx
index 263fd5a19..ce45c01e6 100644
--- a/src/client/views/nodes/VideoBox.tsx
+++ b/src/client/views/nodes/VideoBox.tsx
@@ -75,10 +75,6 @@ export class VideoBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp
return CollectionStackedTimeline.createAnchor(this.rootDoc, this.dataDoc, this.annotationKey, "_timecodeToShow"/* videoStart */, "_timecodeToHide" /* videoEnd */, timecode ? timecode : undefined) || this.rootDoc;
}
- choosePath(url: string) {
- return url.indexOf(window.location.origin) === -1 ? Utils.CorsProxy(url) : url;
- }
-
videoLoad = () => {
const aspect = this.player!.videoWidth / this.player!.videoHeight;
Doc.SetNativeWidth(this.dataDoc, this.player!.videoWidth);
@@ -182,8 +178,8 @@ export class VideoBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp
}
}
- private createRealSummaryLink = (relative: string, downX?: number, downY?: number) => {
- const url = this.choosePath(Utils.prepend(relative));
+ private createRealSummaryLink = (imagePath: string, downX?: number, downY?: number) => {
+ const url = !imagePath.startsWith("/") ? Utils.CorsProxy(imagePath) : imagePath;
const width = this.layoutDoc._width || 1;
const height = this.layoutDoc._height || 0;
const imageSummary = Docs.Create.ImageDocument(url, {
@@ -543,7 +539,7 @@ export class VideoBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp
}
marqueeDown = action((e: React.PointerEvent) => {
- if (!e.altKey && e.button === 0 && this.layoutDoc._viewScale === 1 && this.isContentActive(true)) this._marqueeing = [e.clientX, e.clientY];
+ if (!e.altKey && e.button === 0 && this.layoutDoc._viewScale === 1 && this.isContentActive(true) && ![InkTool.Highlighter, InkTool.Pen].includes(CurrentUserUtils.SelectedTool)) this._marqueeing = [e.clientX, e.clientY];
});
finishMarquee = action(() => {
diff --git a/src/client/views/nodes/WebBox.scss b/src/client/views/nodes/WebBox.scss
index ca82c049c..19b69ff5a 100644
--- a/src/client/views/nodes/WebBox.scss
+++ b/src/client/views/nodes/WebBox.scss
@@ -1,4 +1,4 @@
-@import "../globalCssVariables.scss";
+@import "../global/globalCssVariables.scss";
.webBox {
@@ -17,6 +17,7 @@
justify-content: center;
border-radius: 3px;
pointer-events: all;
+ z-index: 1; // so it appears on top of the document's title, if shown
}
.pdfViewerDash-dragAnnotationBox {
diff --git a/src/client/views/nodes/WebBox.tsx b/src/client/views/nodes/WebBox.tsx
index cb7e58559..bb2c09fdf 100644
--- a/src/client/views/nodes/WebBox.tsx
+++ b/src/client/views/nodes/WebBox.tsx
@@ -88,9 +88,10 @@ export class WebBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps
this._disposers.selection = reaction(() => this.props.isSelected(),
selected => !selected && setTimeout(() => {
- Array.from(this._savedAnnotations.values()).forEach(v => v.forEach(a => a.remove()));
- this._savedAnnotations.clear();
- }));
+ // Array.from(this._savedAnnotations.values()).forEach(v => v.forEach(a => a.remove()));
+ // this._savedAnnotations.clear();
+ })
+ );
if (this.webField?.href.indexOf("youtube") !== -1) {
const youtubeaspect = 400 / 315;
@@ -159,9 +160,13 @@ export class WebBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps
menuControls = () => this.urlEditor; // controls to be added to the top bar when a document of this type is selected
scrollFocus = (doc: Doc, smooth: boolean) => {
+ if (DocListCast(this.props.Document[this.fieldKey + "-sidebar"]).includes(doc) && !this.SidebarShown) {
+ this.toggleSidebar(!smooth);
+ }
if (this._sidebarRef?.current?.makeDocUnfiltered(doc)) return 1;
if (doc !== this.rootDoc && this._outerRef.current) {
- const scrollTo = doc.type === DocumentType.TEXTANCHOR ? NumCast(doc.y) : Utils.scrollIntoView(NumCast(doc.y), doc[HeightSym](), NumCast(this.layoutDoc._scrollTop), this.props.PanelHeight() / (this.props.scaling?.() || 1));
+ const windowHeight = this.props.PanelHeight() / (this.props.scaling?.() || 1);
+ const scrollTo = Utils.scrollIntoView(NumCast(doc.y), doc[HeightSym](), NumCast(this.layoutDoc._scrollTop), windowHeight, windowHeight * .1);
if (scrollTo !== undefined) {
const focusSpeed = smooth ? 500 : 0;
this._initialScroll !== undefined && (this._initialScroll = scrollTo);
@@ -174,11 +179,13 @@ export class WebBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps
}
getAnchor = () => {
- const anchor = Docs.Create.TextanchorDocument({
- title: StrCast(this.rootDoc.title + " " + this.layoutDoc._scrollTop),
- annotationOn: this.rootDoc,
- y: NumCast(this.layoutDoc._scrollTop),
- });
+ const anchor =
+ AnchorMenu.Instance?.GetAnchor(this._savedAnnotations) ??
+ Docs.Create.TextanchorDocument({
+ title: StrCast(this.rootDoc.title + " " + this.layoutDoc._scrollTop),
+ annotationOn: this.rootDoc,
+ y: NumCast(this.layoutDoc._scrollTop),
+ });
this.addDocument(anchor);
return anchor;
}
@@ -395,7 +402,7 @@ export class WebBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps
@action
onMarqueeDown = (e: React.PointerEvent) => {
- if (!e.altKey && e.button === 0 && this.isContentActive(true)) {
+ if (!e.altKey && e.button === 0 && this.isContentActive(true) && ![InkTool.Highlighter, InkTool.Pen].includes(CurrentUserUtils.SelectedTool)) {
this._marqueeing = [e.clientX, e.clientY];
this.props.select(false);
}
@@ -445,17 +452,20 @@ export class WebBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps
this.layoutDoc._showSidebar = nativeWidth !== this.layoutDoc._nativeWidth;
}
return false;
- }, emptyFunction, this.toggleSidebar);
+ }, emptyFunction, () => this.toggleSidebar());
}
- toggleSidebar = action(() => {
+ toggleSidebar = action((preview: boolean = false) => {
const nativeWidth = NumCast(this.layoutDoc[this.fieldKey + "-nativeWidth"]);
const ratio = ((!this.layoutDoc.nativeWidth || this.layoutDoc.nativeWidth === nativeWidth ? 250 : 0) + nativeWidth) / nativeWidth;
const curNativeWidth = NumCast(this.layoutDoc.nativeWidth, nativeWidth);
- this.layoutDoc.nativeWidth = nativeWidth * ratio;
- this.layoutDoc._width = this.layoutDoc[WidthSym]() * nativeWidth * ratio / curNativeWidth;
- this.layoutDoc._showSidebar = nativeWidth !== this.layoutDoc._nativeWidth;
+ if (preview) this._showSidebar;
+ else {
+ this.layoutDoc.nativeWidth = nativeWidth * ratio;
+ this.layoutDoc._width = this.layoutDoc[WidthSym]() * nativeWidth * ratio / curNativeWidth;
+ this.layoutDoc._showSidebar = nativeWidth !== this.layoutDoc._nativeWidth;
+ }
});
- sidebarWidth = () => !this.layoutDoc._showSidebar ? 0 : (NumCast(this.layoutDoc.nativeWidth) - Doc.NativeWidth(this.dataDoc)) * this.props.PanelWidth() / NumCast(this.layoutDoc.nativeWidth);
+ sidebarWidth = () => !this.SidebarShown ? 0 : (NumCast(this.layoutDoc.nativeWidth) - Doc.NativeWidth(this.dataDoc)) * this.props.PanelWidth() / NumCast(this.layoutDoc.nativeWidth);
@computed get content() {
return <div className={"webBox-cont" + (!this.props.docViewPath().lastElement()?.docView?._pendingDoubleClick && this.isContentActive() && CurrentUserUtils.SelectedTool === InkTool.None && !DocumentDecorations.Instance?.Interacting ? "-interactive" : "")}
@@ -471,7 +481,10 @@ export class WebBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps
<Annotation {...this.props} fieldKey={this.annotationKey} showInfo={this.showInfo} dataDoc={this.dataDoc} anno={anno} key={`${anno[Id]}-annotation`} />)
}
</div>;
+
}
+ @observable _showSidebar = false;
+ @computed get SidebarShown() { return this._showSidebar || this.layoutDoc._showSidebar ? true : false; }
showInfo = action((anno: Opt<Doc>) => this._overlayAnnoInfo = anno);
setPreviewCursor = (func?: (x: number, y: number, drag: boolean) => void) => this._setPreviewCursor = func;
@@ -505,11 +518,15 @@ export class WebBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps
}}>
{this.content}
<CollectionFreeFormView {...OmitKeys(this.props, ["NativeWidth", "NativeHeight", "setContentView"]).omit}
+ renderDepth={this.props.renderDepth + 1}
isAnnotationOverlay={true}
fieldKey={this.annotationKey}
+ CollectionView={undefined}
setPreviewCursor={this.setPreviewCursor}
PanelWidth={this.panelWidth}
PanelHeight={this.panelHeight}
+ ScreenToLocalTransform={this.scrollXf}
+ scaling={returnOne}
dropAction={"alias"}
select={emptyFunction}
isContentActive={returnFalse}
@@ -519,10 +536,6 @@ export class WebBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps
removeDocument={this.removeDocument}
moveDocument={this.moveDocument}
addDocument={this.sidebarAddDocument}
- CollectionView={undefined}
- ScreenToLocalTransform={this.scrollXf}
- renderDepth={this.props.renderDepth + 1}
- scaling={returnOne}
childPointerEvents={true}
pointerEvents={this._isAnnotating || SnappingManager.GetIsDragging() ? "all" : "none"} />
{this.annotationLayer}
@@ -544,10 +557,11 @@ export class WebBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps
</div >
<SidebarAnnos ref={this._sidebarRef}
{...this.props}
- fieldKey={this.annotationKey}
+ fieldKey={this.fieldKey}
rootDoc={this.rootDoc}
layoutDoc={this.layoutDoc}
dataDoc={this.dataDoc}
+ showSidebar={this.SidebarShown}
sidebarAddDocument={this.sidebarAddDocument}
moveDocument={this.moveDocument}
removeDocument={this.removeDocument}
diff --git a/src/client/views/nodes/formattedText/DashFieldView.scss b/src/client/views/nodes/formattedText/DashFieldView.scss
index e16036000..e7dd286a5 100644
--- a/src/client/views/nodes/formattedText/DashFieldView.scss
+++ b/src/client/views/nodes/formattedText/DashFieldView.scss
@@ -1,6 +1,7 @@
.dashFieldView {
position: relative;
- display: inline-block;
+ display: inline-flex;
+ align-items: center;
.dashFieldView-enumerables {
width: 10px;
@@ -13,6 +14,8 @@
min-width: 12px;
position: relative;
display: inline-block;
+ margin: 0;
+ transform: scale(0.7);
background-color: rgba(155, 155, 155, 0.24);
}
.dashFieldView-labelSpan {
@@ -22,11 +25,11 @@
background: rgba(0,0,0,0.1);
}
.dashFieldView-fieldSpan {
- min-width: 20px;
+ min-width: 8px;
margin-left: 2px;
margin-right: 5px;
- position: relative;
- display: inline;
+ padding-left: 2px;
+ display: inline-block;
background-color: rgba(155, 155, 155, 0.24);
font-weight: bold;
span {
diff --git a/src/client/views/nodes/formattedText/FormattedTextBox.scss b/src/client/views/nodes/formattedText/FormattedTextBox.scss
index 53aceb533..3cedab1a4 100644
--- a/src/client/views/nodes/formattedText/FormattedTextBox.scss
+++ b/src/client/views/nodes/formattedText/FormattedTextBox.scss
@@ -1,4 +1,4 @@
-@import "../../globalCssVariables";
+@import "../../global/globalCssVariables";
.ProseMirror {
width: 100%;
@@ -31,7 +31,7 @@ audiotag:hover {
padding: 0;
border-width: 0px;
border-radius: inherit;
- border-color: $intermediate-color;
+ border-color: $medium-gray;
box-sizing: border-box;
background-color: inherit;
border-style: solid;
@@ -363,7 +363,7 @@ footnote::after {
@media only screen and (max-width: 1000px) {
- @import "../../globalCssVariables";
+ @import "../../global/globalCssVariables";
.ProseMirror {
width: 100%;
@@ -381,7 +381,7 @@ footnote::after {
padding: 0;
border-width: 0px;
border-radius: inherit;
- border-color: $intermediate-color;
+ border-color: $medium-gray;
box-sizing: border-box;
background-color: inherit;
border-style: solid;
diff --git a/src/client/views/nodes/formattedText/FormattedTextBox.tsx b/src/client/views/nodes/formattedText/FormattedTextBox.tsx
index 911ec1560..d308345ec 100644
--- a/src/client/views/nodes/formattedText/FormattedTextBox.tsx
+++ b/src/client/views/nodes/formattedText/FormattedTextBox.tsx
@@ -71,7 +71,8 @@ export interface FormattedTextBoxProps {
xPadding?: number; // used to override document's settings for xMargin --- see CollectionCarouselView
yPadding?: number;
noSidebar?: boolean;
- dontSelectOnLoad?: boolean; // suppress selecting the text box when loaded
+ dontScale?: boolean;
+ dontSelectOnLoad?: boolean; // suppress selecting the text box when loaded (and mark as not being associated with scrollTop document field)
}
export const GoogleRef = "googleDocId";
@@ -119,13 +120,14 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
public get EditorView() { return this._editorView; }
public get SidebarKey() { return this.fieldKey + "-sidebar"; }
- @computed get sidebarWidthPercent() { return StrCast(this.layoutDoc._sidebarWidthPercent, "0%"); }
+ @computed get sidebarWidthPercent() { return this._showSidebar ? "20%" : StrCast(this.layoutDoc._sidebarWidthPercent, "0%"); }
@computed get sidebarColor() { return StrCast(this.layoutDoc.sidebarColor, StrCast(this.layoutDoc[this.props.fieldKey + "-backgroundColor"], "#e4e4e4")); }
@computed get autoHeight() { return this.layoutDoc._autoHeight && !this.props.ignoreAutoHeight; }
@computed get textHeight() { return NumCast(this.rootDoc[this.fieldKey + "-height"]); }
@computed get scrollHeight() { return NumCast(this.rootDoc[this.fieldKey + "-scrollHeight"]); }
- @computed get sidebarHeight() { return NumCast(this.rootDoc[this.SidebarKey + "-height"]); }
+ @computed get sidebarHeight() { return !this.sidebarWidth() ? 0 : NumCast(this.rootDoc[this.SidebarKey + "-height"]); }
@computed get titleHeight() { return this.props.styleProvider?.(this.layoutDoc, this.props, StyleProp.HeaderMargin) || 0; }
+ @computed get autoHeightMargins() { return this.titleHeight + NumCast(this.layoutDoc._autoHeightMargins); }
@computed get _recording() { return this.dataDoc?.mediaState === "recording"; }
set _recording(value) {
!this.dataDoc.recordingSource && (this.dataDoc.mediaState = value ? "recording" : undefined);
@@ -213,6 +215,7 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
AnchorMenu.Instance.Status = "marquee";
AnchorMenu.Instance.Highlight = action((color: string, isLinkButton: boolean) => {
this._editorView?.state && RichTextMenu.Instance.insertHighlight(color, this._editorView.state, this._editorView?.dispatch);
+ console.log("highlight")
return undefined;
});
/**
@@ -368,7 +371,7 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
this._searchIndex = ++this._searchIndex > flattened.length - 1 ? 0 : this._searchIndex;
const anchor = Docs.Create.TextanchorDocument();
const alink = DocUtils.MakeLink({ doc: anchor }, { doc: target }, "automatic")!;
- const allAnchors = [{ href: Utils.prepend("/doc/" + anchor[Id]), title: "a link", anchorId: anchor[Id] }];
+ const allAnchors = [{ href: Doc.localServerPath(anchor), title: "a link", anchorId: anchor[Id] }];
const link = this._editorView!.state.schema.marks.linkAnchor.create({ allAnchors, title: "auto link", location });
tr = tr.addMark(flattened[i].from, flattened[i].to, link);
});
@@ -541,11 +544,16 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
}
}
+ @observable _showSidebar = false;
+ @computed get SidebarShown() { return this._showSidebar || this.layoutDoc._showSidebar ? true : false; }
+
@action
- toggleSidebar = () => {
+ toggleSidebar = (preview: boolean = false) => {
const prevWidth = this.sidebarWidth();
- this.layoutDoc._showSidebar = ((this.layoutDoc._sidebarWidthPercent = StrCast(this.layoutDoc._sidebarWidthPercent, "0%") === "0%" ? "50%" : "0%")) !== "0%";
- this.layoutDoc._width = this.layoutDoc._showSidebar ? NumCast(this.layoutDoc._width) * 2 : Math.max(20, NumCast(this.layoutDoc._width) - prevWidth);
+ if (preview) this._showSidebar = true;
+ else this.layoutDoc._showSidebar = ((this.layoutDoc._sidebarWidthPercent = StrCast(this.layoutDoc._sidebarWidthPercent, "0%") === "0%" ? "50%" : "0%")) !== "0%";
+
+ this.layoutDoc._width = !preview && this.SidebarShown ? NumCast(this.layoutDoc._width) * 2 : Math.max(20, NumCast(this.layoutDoc._width) - prevWidth);
}
sidebarDown = (e: React.PointerEvent) => {
setupMoveUpEvents(this, e, this.sidebarMove, emptyFunction, () => setTimeout(this.toggleSidebar), false);
@@ -702,7 +710,7 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
let tr = state.tr.addMark(sel.from, sel.to, splitter);
if (sel.from !== sel.to) {
const anchor = anchorDoc ?? Docs.Create.TextanchorDocument({ title: this._editorView?.state.doc.textBetween(sel.from, sel.to) });
- const href = targetHref ?? Utils.prepend("/doc/" + anchor[Id]);
+ const href = targetHref ?? Doc.localServerPath(anchor);
if (anchor !== anchorDoc) this.addDocument(anchor);
tr.doc.nodesBetween(sel.from, sel.to, (node: any, pos: number, parent: any) => {
if (node.firstChild === null && node.marks.find((m: Mark) => m.type.name === schema.marks.splitter.name)) {
@@ -723,6 +731,9 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
}
scrollFocus = (textAnchor: Doc, smooth: boolean) => {
+ if (DocListCast(this.Document[this.fieldKey + "-sidebar"]).includes(textAnchor) && !this.SidebarShown) {
+ this.toggleSidebar(!smooth);
+ }
const textAnchorId = textAnchor[Id];
const findAnchorFrag = (frag: Fragment, editor: EditorView) => {
const nodes: Node[] = [];
@@ -780,12 +791,12 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
// Since we also monitor all component height changes, this will update the document's height.
resetNativeHeight = (scrollHeight: number) => {
const nh = this.layoutDoc.isTemplateForField ? 0 : NumCast(this.layoutDoc._nativeHeight);
- this.rootDoc[this.fieldKey + "-height"] = scrollHeight + this.titleHeight;
+ this.rootDoc[this.fieldKey + "-height"] = scrollHeight;
if (nh) this.layoutDoc._nativeHeight = scrollHeight;
}
componentDidMount() {
- this.props.setContentView?.(this); // this tells the DocumentView that this AudioBox is the "content" of the document. this allows the DocumentView to indirectly call getAnchor() on the AudioBox when making a link.
+ !this.props.dontSelectOnLoad && this.props.setContentView?.(this); // this tells the DocumentView that this AudioBox is the "content" of the document. this allows the DocumentView to indirectly call getAnchor() on the AudioBox when making a link.
this._cachedLinks = DocListCast(this.Document.links);
this._disposers.breakupDictation = reaction(() => DocumentManager.Instance.RecordingEvent, this.breakupDictation);
this._disposers.autoHeight = reaction(() => this.autoHeight, autoHeight => autoHeight && this.tryUpdateScrollHeight());
@@ -793,8 +804,8 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
({ width, scrollHeight, autoHeight }) => width && autoHeight && this.resetNativeHeight(scrollHeight)
);
this._disposers.componentHeights = reaction( // set the document height when one of the component heights changes and autoHeight is on
- () => ({ sidebarHeight: this.sidebarHeight, textHeight: this.textHeight, autoHeight: this.autoHeight }),
- ({ sidebarHeight, textHeight, autoHeight }) => autoHeight && this.props.setHeight(Math.max(sidebarHeight, textHeight)));
+ () => ({ sidebarHeight: this.sidebarHeight, textHeight: this.textHeight, autoHeight: this.autoHeight, marginsHeight: this.autoHeightMargins }),
+ ({ sidebarHeight, textHeight, autoHeight, marginsHeight }) => autoHeight && this.props.setHeight(marginsHeight + Math.max(sidebarHeight, textHeight)));
this._disposers.links = reaction(() => DocListCast(this.Document.links), // if a link is deleted, then remove all hyperlinks that reference it from the text's marks
newLinks => {
this._cachedLinks.forEach(l => !newLinks.includes(l) && this.RemoveLinkFromDoc(l));
@@ -876,7 +887,7 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
var quickScroll: string | undefined = "";
this._disposers.scroll = reaction(() => NumCast(this.layoutDoc._scrollTop),
pos => {
- if (!this._ignoreScroll && this._scrollRef.current) {
+ if (!this._ignoreScroll && this._scrollRef.current && !this.props.dontSelectOnLoad) {
const viewTrans = quickScroll ?? StrCast(this.Document._viewTransition);
const durationMiliStr = viewTrans.match(/([0-9]*)ms/);
const durationSecStr = viewTrans.match(/([0-9.]*)s/);
@@ -1039,7 +1050,7 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
}
const marks = [...node.marks];
const linkIndex = marks.findIndex(mark => mark.type.name === "link");
- const allLinks = [{ href: Utils.prepend(`/doc/${linkId}`), title, linkId }];
+ const allLinks = [{ href: Doc.globalServerPath(linkId), title, linkId }];
const link = view.state.schema.mark(view.state.schema.marks.linkAnchor, { allLinks, location: "add:right", title, docref: true });
marks.splice(linkIndex === -1 ? 0 : linkIndex, 1, link);
return node.mark(marks);
@@ -1413,23 +1424,24 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
}
onScroll = (e: React.UIEvent) => {
if (!LinkDocPreview.LinkInfo && this._scrollRef.current) {
- this._ignoreScroll = true;
- this.layoutDoc._scrollTop = this._scrollRef.current.scrollTop;
- this._ignoreScroll = false;
+ if (!this.props.dontSelectOnLoad) {
+ this._ignoreScroll = true;
+ this.layoutDoc._scrollTop = this._scrollRef.current.scrollTop;
+ this._ignoreScroll = false;
+ }
}
}
tryUpdateScrollHeight() {
if (!LightboxView.LightboxDoc || LightboxView.IsLightboxDocView(this.props.docViewPath())) {
- setTimeout(() => { // bcz: don't know why this is needed, but without it, the size of the textbox is too big as it includes the size of the title header. after the timeout, the size seems to get computed correctly.
- const proseHeight = this.ProseRef?.scrollHeight || 0;
- const scrollHeight = this.ProseRef && Math.min(NumCast(this.layoutDoc.docMaxAutoHeight, proseHeight), proseHeight);
- if (scrollHeight && this.props.renderDepth && !this.props.dontRegisterView) { // if top === 0, then the text box is growing upward (as the overlay caption) which doesn't contribute to the height computation
- const setScrollHeight = () => this.rootDoc[this.fieldKey + "-scrollHeight"] = scrollHeight;
- if (this.rootDoc === this.layoutDoc.doc || this.layoutDoc.resolvedDataDoc) {
- setScrollHeight();
- } else setTimeout(setScrollHeight, 10); // if we have a template that hasn't been resolved yet, we can't set the height or we'd be setting it on the unresolved template. So set a timeout and hope its arrived...
- }
- });
+ const margins = 2 * NumCast(this.layoutDoc._yMargin, this.props.yPadding || 0);
+ const proseHeight = !this.ProseRef ? 0 : Array.from(this.ProseRef.children[0].children).reduce((p, child) => p + Number(getComputedStyle(child).height.replace("px", "")), margins);
+ const scrollHeight = this.ProseRef && Math.min(NumCast(this.layoutDoc.docMaxAutoHeight, proseHeight), proseHeight);
+ if (scrollHeight && this.props.renderDepth && !this.props.dontRegisterView) { // if top === 0, then the text box is growing upward (as the overlay caption) which doesn't contribute to the height computation
+ const setScrollHeight = () => this.rootDoc[this.fieldKey + "-scrollHeight"] = scrollHeight;
+ if (this.rootDoc === this.layoutDoc.doc || this.layoutDoc.resolvedDataDoc) {
+ setScrollHeight();
+ } else setTimeout(setScrollHeight, 10); // if we have a template that hasn't been resolved yet, we can't set the height or we'd be setting it on the unresolved template. So set a timeout and hope its arrived...
+ }
}
}
fitToBox = () => this.props.Document._fitToBox;
@@ -1464,11 +1476,13 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
return ComponentTag === CollectionStackingView ?
<SidebarAnnos ref={this._sidebarRef}
{...this.props}
- fieldKey={this.annotationKey}
+ fieldKey={this.fieldKey}
rootDoc={this.rootDoc}
layoutDoc={this.layoutDoc}
dataDoc={this.dataDoc}
+ showSidebar={this.SidebarShown}
PanelWidth={this.sidebarWidth}
+ setHeight={this.setSidebarHeight}
sidebarAddDocument={this.sidebarAddDocument}
moveDocument={this.moveDocument}
removeDocument={this.removeDocument}
@@ -1517,16 +1531,14 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
const selPad = Math.min(margins, 10);
const padding = Math.max(margins + ((selected && !this.layoutDoc._singleLine) || minimal ? -selPad : 0), 0);
const selPaddingClass = selected && !this.layoutDoc._singleLine && margins >= 10 ? "-selected" : "";
- const col = this.props.color ? this.props.color : this.props.styleProvider?.(this.layoutDoc, this.props, StyleProp.Color);
- const back = this.props.background ? this.props.background : this.props.styleProvider?.(this.layoutDoc, this.props, StyleProp.BackgroundColor);
return (
<div className="formattedTextBox-cont"
onWheel={e => this.isContentActive() && e.stopPropagation()}
style={{
- transform: `scale(${scale})`,
- transformOrigin: "top left",
- width: `${100 / scale}%`,
- height: `${100 / scale}%`,
+ transform: this.props.dontScale ? undefined : `scale(${scale})`,
+ transformOrigin: this.props.dontScale ? undefined : "top left",
+ width: this.props.dontScale ? undefined : `${100 / scale}%`,
+ height: this.props.dontScale ? undefined : `${100 / scale}%`,
// overflowY: this.layoutDoc._autoHeight ? "hidden" : undefined,
...this.styleFromLayoutString(scale) // this converts any expressions in the format string to style props. e.g., <FormattedTextBox height='{this._headerHeight}px' >
}}>
@@ -1554,7 +1566,7 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
>
<div className={`formattedTextBox-outer${selected ? "-selected" : ""}`} ref={this._scrollRef}
style={{
- width: `calc(100% - ${this.sidebarWidthPercent})`,
+ width: this.props.dontSelectOnLoad ? "100%" : `calc(100% - ${this.sidebarWidthPercent})`,
pointerEvents: !active && !SnappingManager.GetIsDragging() ? "none" : undefined,
overflow: this.layoutDoc._singleLine ? "hidden" : undefined,
}}
@@ -1566,8 +1578,8 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
}}
/>
</div>
- {(this.props.noSidebar || this.Document._noSidebar) || !this.layoutDoc._showSidebar || this.sidebarWidthPercent === "0%" ? (null) : this.sidebarCollection}
- {(this.props.noSidebar || this.Document._noSidebar) || this.Document._singleLine ? (null) : this.sidebarHandle}
+ {(this.props.noSidebar || this.Document._noSidebar) || this.props.dontSelectOnLoad || !this.SidebarShown || this.sidebarWidthPercent === "0%" ? (null) : this.sidebarCollection}
+ {(this.props.noSidebar || this.Document._noSidebar) || this.props.dontSelectOnLoad || this.Document._singleLine ? (null) : this.sidebarHandle}
{!this.layoutDoc._showAudio ? (null) : this.audioHandle}
</div>
</div >
diff --git a/src/client/views/nodes/formattedText/RichTextMenu.scss b/src/client/views/nodes/formattedText/RichTextMenu.scss
index 1d24d6833..c94e93541 100644
--- a/src/client/views/nodes/formattedText/RichTextMenu.scss
+++ b/src/client/views/nodes/formattedText/RichTextMenu.scss
@@ -1,4 +1,4 @@
-@import "../../globalCssVariables";
+@import "../../global/globalCssVariables";
.button-dropdown-wrapper {
position: relative;
@@ -24,7 +24,7 @@
top: 35px;
left: 0;
background-color: #323232;
- color: $light-color-secondary;
+ color: $light-gray;
border: 1px solid #4d4d4d;
border-radius: 0 6px 6px 6px;
box-shadow: 3px 3px 3px rgba(0, 0, 0, 0.25);
diff --git a/src/client/views/nodes/formattedText/RichTextMenu.tsx b/src/client/views/nodes/formattedText/RichTextMenu.tsx
index 071491463..82ad2b7db 100644
--- a/src/client/views/nodes/formattedText/RichTextMenu.tsx
+++ b/src/client/views/nodes/formattedText/RichTextMenu.tsx
@@ -352,7 +352,7 @@ export class RichTextMenu extends AntimodeMenu<AntimodeMenuProps> {
function onClick(e: React.PointerEvent) {
e.preventDefault();
e.stopPropagation();
- self.TextView.endUndoTypingBatch();
+ self.TextView?.endUndoTypingBatch();
UndoManager.RunInBatch(() => {
self.view && command && command(self.view.state, self.view.dispatch, self.view);
self.view && onclick && onclick(self.view.state, self.view.dispatch, self.view);
@@ -821,8 +821,8 @@ export class RichTextMenu extends AntimodeMenu<AntimodeMenuProps> {
if (link) {
const href = link.attrs.allAnchors.length > 0 ? link.attrs.allAnchors[0].href : undefined;
if (href) {
- if (href.indexOf(Utils.prepend("/doc/")) === 0) {
- const linkclicked = href.replace(Utils.prepend("/doc/"), "").split("?")[0];
+ if (href.indexOf(Doc.localServerPath()) === 0) {
+ const linkclicked = href.replace(Doc.localServerPath(), "").split("?")[0];
if (linkclicked) {
const linkDoc = await DocServer.GetRefField(linkclicked);
if (linkDoc instanceof Doc) {
@@ -852,6 +852,7 @@ export class RichTextMenu extends AntimodeMenu<AntimodeMenuProps> {
@undoBatch
makeLinkToURL = (target: string, lcoation: string) => {
((this.view as any)?.TextView as FormattedTextBox).makeLinkAnchor(undefined, "onRadd:rightight", target, target);
+ console.log((this.view as any)?.TextView);
}
@undoBatch
@@ -863,8 +864,8 @@ export class RichTextMenu extends AntimodeMenu<AntimodeMenuProps> {
const allAnchors = linkAnchor.attrs.allAnchors.slice();
this.TextView.RemoveAnchorFromSelection(allAnchors);
// bcz: Argh ... this will remove the link from the document even it's anchored somewhere else in the text which happens if only part of the anchor text was selected.
- allAnchors.filter((aref: any) => aref?.href.indexOf(Utils.prepend("/doc/")) === 0).forEach((aref: any) => {
- const anchorId = aref.href.replace(Utils.prepend("/doc/"), "").split("?")[0];
+ allAnchors.filter((aref: any) => aref?.href.indexOf(Doc.localServerPath()) === 0).forEach((aref: any) => {
+ const anchorId = aref.href.replace(Doc.localServerPath(), "").split("?")[0];
anchorId && DocServer.GetRefField(anchorId).then(linkDoc => LinkManager.Instance.deleteLink(linkDoc as Doc));
});
}
@@ -963,7 +964,7 @@ export class RichTextMenu extends AntimodeMenu<AntimodeMenuProps> {
this.createHighlighterButton(),
this.createLinkButton(),
this.createBrushButton(),
- <div className="richTextMenu-divider" key="divider 2" />,
+ <div className="collectionMenu-divider" key="divider 2" />,
this.createButton("align-left", "Align Left", this.activeAlignment === "left", this.alignLeft),
this.createButton("align-center", "Align Center", this.activeAlignment === "center", this.alignCenter),
this.createButton("align-right", "Align Right", this.activeAlignment === "right", this.alignRight),
@@ -976,7 +977,7 @@ export class RichTextMenu extends AntimodeMenu<AntimodeMenuProps> {
const row2 = <div className="antimodeMenu-row row-2" key="row2">
{this.collapsed ? this.getDragger() : (null)}
<div key="row 2" style={{ display: this.collapsed ? "none" : undefined }}>
- <div className="richTextMenu-divider" key="divider 3" />
+ <div className="collectionMenu-divider" key="divider 3" />
{[this.createMarksDropdown(this.activeFontSize, this.fontSizeOptions, "font size", action((val: string) => {
this.activeFontSize = val;
SelectionManager.Views().map(dv => dv.props.Document._fontSize = val);
@@ -985,12 +986,12 @@ export class RichTextMenu extends AntimodeMenu<AntimodeMenuProps> {
this.activeFontFamily = val;
SelectionManager.Views().map(dv => dv.props.Document._fontFamily = val);
})),
- <div className="richTextMenu-divider" key="divider 4" />,
+ <div className="collectionMenu-divider" key="divider 4" />,
this.createNodesDropdown(this.activeListType, this.listTypeOptions, "list type", () => ({})),
this.createButton("sort-amount-down", "Summarize", undefined, this.insertSummarizer),
this.createButton("quote-left", "Blockquote", undefined, this.insertBlockquote),
- this.createButton("minus", "Horizontal Rule", undefined, this.insertHorizontalRule),
- <div className="richTextMenu-divider" key="divider 5" />,]}
+ this.createButton("minus", "Horizontal Rule", undefined, this.insertHorizontalRule)
+ ]}
</div>
{/* <div key="collapser">
{<div key="collapser">
diff --git a/src/client/views/nodes/formattedText/TooltipTextMenu.scss b/src/client/views/nodes/formattedText/TooltipTextMenu.scss
index 0e4b752ac..8c4d77da9 100644
--- a/src/client/views/nodes/formattedText/TooltipTextMenu.scss
+++ b/src/client/views/nodes/formattedText/TooltipTextMenu.scss
@@ -1,4 +1,4 @@
-@import "../views/globalCssVariables";
+@import "../views/global/globalCssVariables";
.ProseMirror-menu-dropdown-wrap {
display: inline-block;
position: relative;
@@ -50,7 +50,7 @@
padding: 3px;
&:hover {
- background-color: $light-color-secondary;
+ background-color: $light-gray;
}
}
}
@@ -294,9 +294,9 @@
top: 31px;
background-color: #323232;
border: 1px solid #4d4d4d;
- color: $light-color-secondary;
+ color: $light-gray;
// border: none;
- // border: 1px solid $light-color-secondary;
+ // border: 1px solid $light-gray;
border-radius: 0 6px 6px 6px;
padding: 3px;
box-shadow: 3px 3px 3px rgba(0, 0, 0, 0.25);
@@ -323,7 +323,7 @@
}
.separated-button {
- border-top: 1px solid $light-color-secondary;
+ border-top: 1px solid $light-gray;
padding-top: 6px;
}
diff --git a/src/client/views/nodes/PresBox.scss b/src/client/views/nodes/trails/PresBox.scss
index 1ba86232b..06932d145 100644
--- a/src/client/views/nodes/PresBox.scss
+++ b/src/client/views/nodes/trails/PresBox.scss
@@ -1,7 +1,4 @@
-$light-blue: #AEDDF8;
-$dark-blue: #5B9FDD;
-$light-background: #ececec;
-$dark-grey: #656565;
+@import "../../global/globalCssVariables";
.presBox-cont {
cursor: auto;
@@ -10,7 +7,6 @@ $dark-grey: #656565;
pointer-events: inherit;
z-index: 2;
font-family: Roboto;
- box-shadow: #AAAAAA .2vw .2vw .4vw;
width: 100%;
min-width: 20px;
height: 100%;
@@ -47,8 +43,8 @@ $dark-grey: #656565;
align-items: center;
height: 30px;
width: 100%;
- color: white;
- background-color: #323232;
+ color: $white;
+ background-color: $dark-gray;
.toolbar-button {
cursor: pointer;
@@ -110,7 +106,7 @@ $dark-grey: #656565;
}
.toolbar-divider {
- border-left: solid #ffffff70 0.5px;
+ border-left: solid $medium-gray 0.5px;
height: 20px;
}
}
@@ -118,7 +114,7 @@ $dark-grey: #656565;
.dropdown {
font-size: 10;
margin-left: 5px;
- color: darkgrey;
+ color: $medium-gray;
transition: 0.5s ease;
}
@@ -174,7 +170,7 @@ $dark-grey: #656565;
.ribbon-colorBox {
cursor: pointer;
- border: solid 1px black;
+ border: solid 1px $black;
display: flex;
margin-left: 5px;
margin-top: 5px;
@@ -191,9 +187,9 @@ $dark-grey: #656565;
font-size: 11;
font-weight: 200;
height: 20;
- background-color: #ececec;
- color: black;
- border: solid 1px black;
+ background-color: $white;
+ color: $black;
+ border: solid 1px $black;
display: flex;
margin-left: 5px;
margin-top: 5px;
@@ -220,11 +216,11 @@ $dark-grey: #656565;
align-items: center;
height: 100%;
width: 100%;
- background: black;
+ background: $black;
}
.ribbon-propertyUpDownItem:hover {
- background: darkgrey;
+ background: $medium-gray;
transform: scale(1.05);
}
}
@@ -239,7 +235,7 @@ $dark-grey: #656565;
.multiThumb-slider {
display: grid;
- background-color: $light-background;
+ background-color: $white;
height: 10px;
border-radius: 10px;
overflow: hidden;
@@ -257,8 +253,8 @@ $dark-grey: #656565;
-webkit-appearance: none;
height: 10px;
cursor: ew-resize;
- background: $dark-blue;
- box-shadow: -100vw 0 0 100vw $light-background;
+ background: $medium-blue;
+ box-shadow: -100vw 0 0 100vw $white;
}
.toolbar-slider.end::-webkit-slider-thumb {
@@ -267,7 +263,7 @@ $dark-grey: #656565;
-webkit-appearance: none;
height: 10px;
cursor: ew-resize;
- background: $dark-blue;
+ background: $medium-blue;
box-shadow: -100vw 0 0 100vw $light-blue;
}
}
@@ -282,7 +278,7 @@ $dark-grey: #656565;
height: 10px;
border-radius: 10px;
-webkit-appearance: none;
- background-color: $light-background;
+ background-color: $white;
}
.toolbar-slider:focus {
@@ -301,7 +297,7 @@ $dark-grey: #656565;
-webkit-appearance: none;
height: 10px;
cursor: ew-resize;
- background: $dark-blue;
+ background: $medium-blue;
box-shadow: -100vw 0 0 100vw $light-blue;
}
@@ -318,7 +314,7 @@ $dark-grey: #656565;
width: 15px;
min-width: 15px;
cursor: pointer;
- background: $light-background;
+ background: $white;
}
.presBox-checkbox:focus {
@@ -326,7 +322,7 @@ $dark-grey: #656565;
}
.presBox-checkbox:hover {
- background: #c0c0c0;
+ background: $light-gray;
}
.presBox-checkbox:checked {
@@ -381,9 +377,9 @@ $dark-grey: #656565;
text-align: center;
font-size: 16;
width: 90%;
- color: black;
+ color: $black;
transform: translate(5%, 0px);
- border-bottom: solid 2px darkgrey;
+ border-bottom: solid 2px $medium-gray;
}
@@ -396,8 +392,8 @@ $dark-grey: #656565;
justify-self: left;
margin-top: 5px;
padding-left: 10px;
- background-color: $light-background;
- border: solid 1px black;
+ background-color: $white;
+ border: solid 1px $black;
min-width: 80px;
max-width: 200px;
width: 100%;
@@ -416,7 +412,7 @@ $dark-grey: #656565;
}
.ribbon-frameSelector {
- border: black solid 1px;
+ border: $black solid 1px;
width: 60px;
height: 20px;
margin-top: 5px;
@@ -433,12 +429,12 @@ $dark-grey: #656565;
cursor: pointer;
position: relative;
height: 100%;
- background: $light-background;
+ background: $white;
display: flex;
align-items: center;
justify-content: center;
text-align: center;
- color: black;
+ color: $black;
}
.numKeyframe {
@@ -446,7 +442,7 @@ $dark-grey: #656565;
font-size: 10;
font-weight: 600;
position: relative;
- color: black;
+ color: $black;
display: flex;
width: 100%;
height: 100%;
@@ -489,7 +485,7 @@ $dark-grey: #656565;
padding-left: 10;
padding-right: 10;
border-radius: 10px;
- background-color: #979797;
+ background-color: $medium-gray;
}
.ribbon-final-button:hover {
@@ -508,13 +504,13 @@ $dark-grey: #656565;
align-items: center;
margin-bottom: 5px;
height: 25px;
- color: lightgrey;
+ color: $light-gray;
width: 100%;
max-width: 120;
padding-left: 10;
padding-right: 10;
border-radius: 10px;
- background-color: black;
+ background-color: $black;
}
.ribbon-final-button-hidden:hover {
@@ -525,15 +521,15 @@ $dark-grey: #656565;
.ribbon-frameList {
width: calc(100% - 5px);
height: 50px;
- background-color: #ececec;
- border: 1px solid #9f9f9f;
+ background-color: $white;
+ border: 1px solid $medium-gray;
grid-template-rows: max-content;
.frameList-header {
display: grid;
width: 100%;
height: 20px;
- background-color: #9f9f9f;
+ background-color: $medium-gray;
.frameList-headerButtons {
display: flex;
@@ -588,7 +584,7 @@ $dark-grey: #656565;
font-size: 10.5;
font-weight: 300;
height: 20;
- background-color: #979797;
+ background-color: $medium-gray;
color: white;
display: flex;
margin-top: 5px;
@@ -607,8 +603,8 @@ $dark-grey: #656565;
transition: all 0.4s;
font-weight: 400;
opacity: 1;
- color: white;
- background-color: black;
+ color: $white;
+ background-color: $black;
}
.ribbon-toggle {
@@ -616,10 +612,10 @@ $dark-grey: #656565;
font-size: 10.5;
font-weight: 200;
height: 20;
- background-color: $light-background;
+ background-color: $white;
border: solid 1px rgba(0, 0, 0, 0.5);
display: flex;
- color: black;
+ color: $black;
margin-top: 5px;
margin-bottom: 5px;
border-radius: 5px;
@@ -660,13 +656,13 @@ $dark-grey: #656565;
position: relative;
font-size: 13;
padding-bottom: 10px;
- border-bottom: solid 1px $dark-grey;
+ border-bottom: solid 1px $dark-gray;
.presBox-dropdown:hover {
- border: solid 1px $dark-blue;
+ border: solid 1px $medium-blue;
.presBox-dropdownIcon {
- color: $dark-blue;
+ color: $medium-blue;
}
}
@@ -675,12 +671,12 @@ $dark-grey: #656565;
display: grid;
grid-template-columns: auto 20%;
position: relative;
- border: solid 1px black;
- background-color: $light-background;
+ border: solid 1px $black;
+ background-color: $light-gray;
border-radius: 5px;
font-size: 10;
height: 25;
- color: black;
+ color: $black;
padding-left: 5px;
align-items: center;
margin-top: 5px;
@@ -744,7 +740,7 @@ $dark-grey: #656565;
height: 100px;
padding-top: 5px;
padding-bottom: 5px;
- border: solid 1px black;
+ border: solid 1px $black;
// overflow: auto;
::-webkit-scrollbar {
@@ -794,7 +790,7 @@ $dark-grey: #656565;
cursor: pointer;
position: relative;
text-align: center;
- border-left: solid 1px darkgrey;
+ border-left: solid 1px $medium-gray;
width: 20%;
height: 100%;
display: flex;
@@ -825,7 +821,7 @@ $dark-grey: #656565;
box-shadow: 0px 4px 10px rgba(0, 0, 0, 0.8);
z-index: 200;
background-color: white;
- color: black;
+ color: $black;
position: absolute;
overflow: hidden;
}
@@ -841,12 +837,12 @@ $dark-grey: #656565;
align-items: center;
justify-content: center;
transform: translate(0px, -1px);
- background-color: $light-background;
+ background-color: $white;
width: 40px;
height: 15px;
align-self: center;
justify-self: center;
- border: solid 1px black;
+ border: solid 1px $black;
border-top: 0px;
border-bottom-right-radius: 7px;
border-bottom-left-radius: 7px;
@@ -855,15 +851,15 @@ $dark-grey: #656565;
.layout-container {
padding: 5px;
display: grid;
- background-color: $light-background;
+ background-color: $white;
grid-template-columns: repeat(auto-fit, minmax(90px, 100px));
width: 100%;
- border: solid 1px black;
+ border: solid 1px $black;
min-width: 100px;
overflow: hidden;
.layout:hover {
- border: solid 2px #5c9edd;
+ border: solid 2px $medium-blue;
}
.layout {
@@ -878,7 +874,7 @@ $dark-grey: #656565;
width: 90px;
overflow: hidden;
background-color: white;
- border: solid darkgrey 1px;
+ border: solid $medium-gray 1px;
display: grid;
grid-template-rows: auto;
align-items: center;
@@ -893,7 +889,7 @@ $dark-grey: #656565;
height: 13;
font-size: 12;
display: flex;
- background-color: #f1efec;
+ background-color: $white;
}
.subtitle {
@@ -906,7 +902,7 @@ $dark-grey: #656565;
height: 13;
font-size: 9;
display: flex;
- background-color: #f1efec;
+ background-color: $white;
}
.content {
@@ -919,7 +915,7 @@ $dark-grey: #656565;
height: 13;
font-size: 10;
display: flex;
- background-color: #f1efec;
+ background-color: $white;
height: 33;
text-align: left;
font-size: 8px;
@@ -930,7 +926,7 @@ $dark-grey: #656565;
.presBox-buttons {
position: relative;
width: 100%;
- background: gray;
+ background: $medium-gray;
min-height: 35px;
padding-top: 5px;
padding-bottom: 5px;
@@ -960,8 +956,8 @@ $dark-grey: #656565;
select {
- background: #323232;
- color: white;
+ background: $dark-gray;
+ color: $white;
}
.presBox-button {
@@ -975,8 +971,8 @@ $dark-grey: #656565;
text-align: center;
letter-spacing: normal;
width: inherit;
- background: #323232;
- color: white;
+ background: $dark-gray;
+ color: $white;
}
.presBox-button.active {
@@ -984,7 +980,7 @@ $dark-grey: #656565;
}
.presBox-button.active:hover {
- background-color: #233163;
+ background-color: $medium-blue;
}
.presBox-button.edit {
@@ -1053,8 +1049,8 @@ $dark-grey: #656565;
font-size: 100;
display: flex;
align-items: center;
- background: #323232;
- color: white;
+ background: $dark-gray;
+ color: $white;
}
.presBox-viewPicker {
@@ -1086,7 +1082,7 @@ $dark-grey: #656565;
top: 10;
opacity: 0.1;
transition: all 0.4s;
- color: white;
+ color: $white;
}
.miniPres:hover {
@@ -1094,8 +1090,8 @@ $dark-grey: #656565;
}
.presPanelOverlay {
- background-color: #323232;
- color: white;
+ background-color: $dark-gray;
+ color: $white;
border-radius: 5px;
grid-template-rows: 100%;
height: 25;
@@ -1129,7 +1125,7 @@ $dark-grey: #656565;
.presPanel-divider {
width: 0.5px;
height: 80%;
- border-right: solid 1px #5a5a5a;
+ border-right: solid 1px $medium-gray;
}
.presPanel-button-frame {
@@ -1161,12 +1157,12 @@ $dark-grey: #656565;
}
.presPanel-button:hover {
- background-color: #5a5a5a;
+ background-color: $medium-gray;
transform: scale(1.2);
}
.presPanel-button-text:hover {
- background-color: #5a5a5a;
+ background-color: $medium-gray;
}
diff --git a/src/client/views/nodes/PresBox.tsx b/src/client/views/nodes/trails/PresBox.tsx
index f3fb6ff17..5cb9866f8 100644
--- a/src/client/views/nodes/PresBox.tsx
+++ b/src/client/views/nodes/trails/PresBox.tsx
@@ -5,67 +5,33 @@ import { action, computed, IReactionDisposer, observable, ObservableMap, reactio
import { observer } from "mobx-react";
import { ColorState, SketchPicker } from "react-color";
import { Bounce, Fade, Flip, LightSpeed, Roll, Rotate, Zoom } from 'react-reveal';
-import { Doc, DocListCast, DocListCastAsync, FieldResult } from "../../../fields/Doc";
-import { documentSchema } from "../../../fields/documentSchemas";
-import { InkTool } from "../../../fields/InkField";
-import { List } from "../../../fields/List";
-import { PrefetchProxy } from "../../../fields/Proxy";
-import { listSpec, makeInterface } from "../../../fields/Schema";
-import { ScriptField } from "../../../fields/ScriptField";
-import { BoolCast, Cast, NumCast, StrCast } from "../../../fields/Types";
-import { returnFalse, returnOne, returnTrue, emptyFunction } from '../../../Utils';
-import { Docs } from "../../documents/Documents";
-import { DocumentType } from "../../documents/DocumentTypes";
-import { CurrentUserUtils } from "../../util/CurrentUserUtils";
-import { DocumentManager } from "../../util/DocumentManager";
-import { Scripting } from "../../util/Scripting";
-import { SelectionManager } from "../../util/SelectionManager";
-import { undoBatch, UndoManager } from "../../util/UndoManager";
-import { CollectionDockingView } from "../collections/CollectionDockingView";
-import { CollectionView, CollectionViewType } from "../collections/CollectionView";
-import { TabDocView } from "../collections/TabDocView";
-import { ViewBoxBaseComponent } from "../DocComponent";
-import { CollectionFreeFormDocumentView } from "./CollectionFreeFormDocumentView";
-import { FieldView, FieldViewProps } from './FieldView';
+import { Doc, DocListCast, DocListCastAsync, FieldResult } from "../../../../fields/Doc";
+import { documentSchema } from "../../../../fields/documentSchemas";
+import { InkTool } from "../../../../fields/InkField";
+import { List } from "../../../../fields/List";
+import { PrefetchProxy } from "../../../../fields/Proxy";
+import { listSpec, makeInterface } from "../../../../fields/Schema";
+import { ScriptField } from "../../../../fields/ScriptField";
+import { BoolCast, Cast, NumCast, StrCast } from "../../../../fields/Types";
+import { emptyFunction, returnFalse, returnOne, returnTrue } from '../../../../Utils';
+import { Docs } from "../../../documents/Documents";
+import { DocumentType } from "../../../documents/DocumentTypes";
+import { CurrentUserUtils } from "../../../util/CurrentUserUtils";
+import { DocumentManager } from "../../../util/DocumentManager";
+import { Scripting } from "../../../util/Scripting";
+import { SelectionManager } from "../../../util/SelectionManager";
+import { undoBatch, UndoManager } from "../../../util/UndoManager";
+import { CollectionDockingView } from "../../collections/CollectionDockingView";
+import { CollectionView, CollectionViewType } from "../../collections/CollectionView";
+import { TabDocView } from "../../collections/TabDocView";
+import { ViewBoxBaseComponent } from "../../DocComponent";
+import { Colors } from "../../global/globalEnums";
+import { LightboxView } from "../../LightboxView";
+import { CollectionFreeFormDocumentView } from "../CollectionFreeFormDocumentView";
+import { FieldView, FieldViewProps } from '../FieldView';
import "./PresBox.scss";
import Color = require("color");
-import { LightboxView } from "../LightboxView";
-
-export enum PresMovement {
- Zoom = "zoom",
- Pan = "pan",
- Jump = "jump",
- None = "none",
-}
-
-export enum PresEffect {
- Zoom = "Zoom",
- Lightspeed = "Lightspeed",
- Fade = "Fade in",
- Flip = "Flip",
- Rotate = "Rotate",
- Bounce = "Bounce",
- Roll = "Roll",
- None = "None",
- Left = "left",
- Right = "right",
- Center = "center",
- Top = "top",
- Bottom = "bottom"
-}
-
-enum PresStatus {
- Autoplay = "auto",
- Manual = "manual",
- Edit = "edit"
-}
-
-export enum PresColor {
- LightBlue = "#AEDDF8",
- DarkBlue = "#5B9FDD",
- LightBackground = "#ececec",
- SlideBackground = "#d5dce2",
-}
+import { PresEffect, PresStatus, PresMovement } from "./PresEnums";
export class PinProps {
audioRange?: boolean;
@@ -1198,9 +1164,9 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
{this.scrollable ? "Scroll to pinned view" : !isPinWithView ? "No movement" : "Pan & Zoom to pinned view"}
</div>
:
- <div className="presBox-dropdown" onClick={action(e => { e.stopPropagation(); this.openMovementDropdown = !this.openMovementDropdown; })} style={{ borderBottomLeftRadius: this.openMovementDropdown ? 0 : 5, border: this.openMovementDropdown ? `solid 2px ${PresColor.DarkBlue}` : 'solid 1px black' }}>
+ <div className="presBox-dropdown" onClick={action(e => { e.stopPropagation(); this.openMovementDropdown = !this.openMovementDropdown; })} style={{ borderBottomLeftRadius: this.openMovementDropdown ? 0 : 5, border: this.openMovementDropdown ? `solid 2px ${Colors.MEDIUM_BLUE}` : 'solid 1px black' }}>
{this.setMovementName(activeItem.presMovement, activeItem)}
- <FontAwesomeIcon className='presBox-dropdownIcon' style={{ gridColumn: 2, color: this.openMovementDropdown ? PresColor.DarkBlue : 'black' }} icon={"angle-down"} />
+ <FontAwesomeIcon className='presBox-dropdownIcon' style={{ gridColumn: 2, color: this.openMovementDropdown ? Colors.MEDIUM_BLUE : 'black' }} icon={"angle-down"} />
<div className={'presBox-dropdownOptions'} id={'presBoxMovementDropdown'} onPointerDown={e => e.stopPropagation()} style={{ display: this.openMovementDropdown ? "grid" : "none" }}>
<div className={`presBox-dropdownOption ${activeItem.presMovement === PresMovement.None ? "active" : ""}`} onPointerDown={e => e.stopPropagation()} onClick={() => this.updateMovement(PresMovement.None)}>None</div>
<div className={`presBox-dropdownOption ${activeItem.presMovement === PresMovement.Zoom ? "active" : ""}`} onPointerDown={e => e.stopPropagation()} onClick={() => this.updateMovement(PresMovement.Zoom)}>Pan {"&"} Zoom</div>
@@ -1245,7 +1211,7 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
<div className="ribbon-doubleButton">
{isPresCollection ? (null) : <Tooltip title={<><div className="dash-tooltip">{"Hide before presented"}</div></>}><div className={`ribbon-toggle ${activeItem.presHideBefore ? "active" : ""}`} onClick={() => this.updateHideBefore(activeItem)}>Hide before</div></Tooltip>}
{isPresCollection ? (null) : <Tooltip title={<><div className="dash-tooltip">{"Hide after presented"}</div></>}><div className={`ribbon-toggle ${activeItem.presHideAfter ? "active" : ""}`} onClick={() => this.updateHideAfter(activeItem)}>Hide after</div></Tooltip>}
- <Tooltip title={<><div className="dash-tooltip">{"Open in lightbox view"}</div></>}><div className="ribbon-toggle" style={{ backgroundColor: activeItem.openDocument ? PresColor.LightBlue : "" }} onClick={() => this.updateOpenDoc(activeItem)}>Lightbox</div></Tooltip>
+ <Tooltip title={<><div className="dash-tooltip">{"Open in lightbox view"}</div></>}><div className="ribbon-toggle" style={{ backgroundColor: activeItem.openDocument ? Colors.LIGHT_BLUE : "" }} onClick={() => this.updateOpenDoc(activeItem)}>Lightbox</div></Tooltip>
</div>
{(type === DocumentType.AUDIO || type === DocumentType.VID) ? (null) : <>
<div className="ribbon-doubleButton" >
@@ -1280,9 +1246,9 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
</div>
{isPresCollection ? (null) : <div className="ribbon-box">
Effects
- <div className="presBox-dropdown" onClick={action(e => { e.stopPropagation(); this.openEffectDropdown = !this.openEffectDropdown; })} style={{ borderBottomLeftRadius: this.openEffectDropdown ? 0 : 5, border: this.openEffectDropdown ? `solid 2px ${PresColor.DarkBlue}` : 'solid 1px black' }}>
+ <div className="presBox-dropdown" onClick={action(e => { e.stopPropagation(); this.openEffectDropdown = !this.openEffectDropdown; })} style={{ borderBottomLeftRadius: this.openEffectDropdown ? 0 : 5, border: this.openEffectDropdown ? `solid 2px ${Colors.MEDIUM_BLUE}` : 'solid 1px black' }}>
{effect}
- <FontAwesomeIcon className='presBox-dropdownIcon' style={{ gridColumn: 2, color: this.openEffectDropdown ? PresColor.DarkBlue : 'black' }} icon={"angle-down"} />
+ <FontAwesomeIcon className='presBox-dropdownIcon' style={{ gridColumn: 2, color: this.openEffectDropdown ? Colors.MEDIUM_BLUE : 'black' }} icon={"angle-down"} />
<div className={'presBox-dropdownOptions'} id={'presBoxMovementDropdown'} style={{ display: this.openEffectDropdown ? "grid" : "none" }} onPointerDown={e => e.stopPropagation()}>
<div className={`presBox-dropdownOption ${targetDoc.presEffect === PresEffect.None || !targetDoc.presEffect ? "active" : ""}`} onPointerDown={e => e.stopPropagation()} onClick={() => this.updateEffect(PresEffect.None)}>None</div>
<div className={`presBox-dropdownOption ${targetDoc.presEffect === PresEffect.Fade ? "active" : ""}`} onPointerDown={e => e.stopPropagation()} onClick={() => this.updateEffect(PresEffect.Fade)}>Fade In</div>
@@ -1299,11 +1265,11 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
</div>
</div>
<div className="effectDirection" style={{ display: effect === 'None' ? "none" : "grid", width: 40 }}>
- <Tooltip title={<><div className="dash-tooltip">{"Enter from left"}</div></>}><div style={{ gridColumn: 1, gridRow: 2, justifySelf: 'center', color: targetDoc.presEffectDirection === PresEffect.Left ? PresColor.LightBlue : "black", cursor: "pointer" }} onClick={() => this.updateEffectDirection(PresEffect.Left)}><FontAwesomeIcon icon={"angle-right"} /></div></Tooltip>
- <Tooltip title={<><div className="dash-tooltip">{"Enter from right"}</div></>}><div style={{ gridColumn: 3, gridRow: 2, justifySelf: 'center', color: targetDoc.presEffectDirection === PresEffect.Right ? PresColor.LightBlue : "black", cursor: "pointer" }} onClick={() => this.updateEffectDirection(PresEffect.Right)}><FontAwesomeIcon icon={"angle-left"} /></div></Tooltip>
- <Tooltip title={<><div className="dash-tooltip">{"Enter from top"}</div></>}><div style={{ gridColumn: 2, gridRow: 1, justifySelf: 'center', color: targetDoc.presEffectDirection === PresEffect.Top ? PresColor.LightBlue : "black", cursor: "pointer" }} onClick={() => this.updateEffectDirection(PresEffect.Top)}><FontAwesomeIcon icon={"angle-down"} /></div></Tooltip>
- <Tooltip title={<><div className="dash-tooltip">{"Enter from bottom"}</div></>}><div style={{ gridColumn: 2, gridRow: 3, justifySelf: 'center', color: targetDoc.presEffectDirection === PresEffect.Bottom ? PresColor.LightBlue : "black", cursor: "pointer" }} onClick={() => this.updateEffectDirection(PresEffect.Bottom)}><FontAwesomeIcon icon={"angle-up"} /></div></Tooltip>
- <Tooltip title={<><div className="dash-tooltip">{"Enter from center"}</div></>}><div style={{ gridColumn: 2, gridRow: 2, width: 10, height: 10, alignSelf: 'center', justifySelf: 'center', border: targetDoc.presEffectDirection === PresEffect.Center || !targetDoc.presEffectDirection ? `solid 2px ${PresColor.LightBlue}` : "solid 2px black", borderRadius: "100%", cursor: "pointer" }} onClick={() => this.updateEffectDirection(PresEffect.Center)}></div></Tooltip>
+ <Tooltip title={<><div className="dash-tooltip">{"Enter from left"}</div></>}><div style={{ gridColumn: 1, gridRow: 2, justifySelf: 'center', color: targetDoc.presEffectDirection === PresEffect.Left ? Colors.LIGHT_BLUE : "black", cursor: "pointer" }} onClick={() => this.updateEffectDirection(PresEffect.Left)}><FontAwesomeIcon icon={"angle-right"} /></div></Tooltip>
+ <Tooltip title={<><div className="dash-tooltip">{"Enter from right"}</div></>}><div style={{ gridColumn: 3, gridRow: 2, justifySelf: 'center', color: targetDoc.presEffectDirection === PresEffect.Right ? Colors.LIGHT_BLUE : "black", cursor: "pointer" }} onClick={() => this.updateEffectDirection(PresEffect.Right)}><FontAwesomeIcon icon={"angle-left"} /></div></Tooltip>
+ <Tooltip title={<><div className="dash-tooltip">{"Enter from top"}</div></>}><div style={{ gridColumn: 2, gridRow: 1, justifySelf: 'center', color: targetDoc.presEffectDirection === PresEffect.Top ? Colors.LIGHT_BLUE : "black", cursor: "pointer" }} onClick={() => this.updateEffectDirection(PresEffect.Top)}><FontAwesomeIcon icon={"angle-down"} /></div></Tooltip>
+ <Tooltip title={<><div className="dash-tooltip">{"Enter from bottom"}</div></>}><div style={{ gridColumn: 2, gridRow: 3, justifySelf: 'center', color: targetDoc.presEffectDirection === PresEffect.Bottom ? Colors.LIGHT_BLUE : "black", cursor: "pointer" }} onClick={() => this.updateEffectDirection(PresEffect.Bottom)}><FontAwesomeIcon icon={"angle-up"} /></div></Tooltip>
+ <Tooltip title={<><div className="dash-tooltip">{"Enter from center"}</div></>}><div style={{ gridColumn: 2, gridRow: 2, width: 10, height: 10, alignSelf: 'center', justifySelf: 'center', border: targetDoc.presEffectDirection === PresEffect.Center || !targetDoc.presEffectDirection ? `solid 2px ${Colors.LIGHT_BLUE}` : "solid 2px black", borderRadius: "100%", cursor: "pointer" }} onClick={() => this.updateEffectDirection(PresEffect.Center)}></div></Tooltip>
</div>
</div>}
<div className="ribbon-final-box">
@@ -1356,7 +1322,7 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
<>
{this.panable || this.scrollable || this.targetDoc.type === DocumentType.COMPARISON ? 'Pinned view' : (null)}
<div className="ribbon-doubleButton">
- <Tooltip title={<><div className="dash-tooltip">{activeItem.presPinView ? "Turn off pin with view" : "Turn on pin with view"}</div></>}><div className="ribbon-toggle" style={{ width: 20, padding: 0, backgroundColor: activeItem.presPinView ? PresColor.LightBlue : "" }}
+ <Tooltip title={<><div className="dash-tooltip">{activeItem.presPinView ? "Turn off pin with view" : "Turn on pin with view"}</div></>}><div className="ribbon-toggle" style={{ width: 20, padding: 0, backgroundColor: activeItem.presPinView ? Colors.LIGHT_BLUE : "" }}
onClick={() => {
activeItem.presPinView = !activeItem.presPinView;
targetDoc.presPinView = activeItem.presPinView;
@@ -1496,7 +1462,7 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
<div className="slider-text" style={{ fontWeight: 500 }}>
Start time (s)
</div>
- <div id={"startTime"} className="slider-number" style={{ backgroundColor: PresColor.LightBackground }}>
+ <div id={"startTime"} className="slider-number" style={{ backgroundColor: Colors.LIGHT_GRAY }}>
<input className="presBox-input"
style={{ textAlign: 'center', width: 30, height: 15, fontSize: 10 }}
type="number" value={NumCast(activeItem.presStartTime)}
@@ -1508,7 +1474,7 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
<div className="slider-text" style={{ fontWeight: 500 }}>
Duration (s)
</div>
- <div className="slider-number" style={{ backgroundColor: PresColor.LightBlue }}>
+ <div className="slider-number" style={{ backgroundColor: Colors.LIGHT_BLUE }}>
{Math.round((NumCast(activeItem.presEndTime) - NumCast(activeItem.presStartTime)) * 10) / 10}
</div>
</div>
@@ -1516,7 +1482,7 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
<div className="slider-text" style={{ fontWeight: 500 }}>
End time (s)
</div>
- <div id={"endTime"} className="slider-number" style={{ backgroundColor: PresColor.LightBackground }}>
+ <div id={"endTime"} className="slider-number" style={{ backgroundColor: Colors.LIGHT_GRAY }}>
<input className="presBox-input"
style={{ textAlign: 'center', width: 30, height: 15, fontSize: 10 }}
type="number" value={NumCast(activeItem.presEndTime)}
@@ -1534,16 +1500,16 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
this._batch = UndoManager.StartBatch("presEndTime");
const endBlock = document.getElementById("endTime");
if (endBlock) {
- endBlock.style.color = PresColor.LightBackground;
- endBlock.style.backgroundColor = PresColor.DarkBlue;
+ endBlock.style.color = Colors.LIGHT_GRAY;
+ endBlock.style.backgroundColor = Colors.MEDIUM_BLUE;
}
}}
onPointerUp={() => {
this._batch?.end();
const endBlock = document.getElementById("endTime");
if (endBlock) {
- endBlock.style.color = "black";
- endBlock.style.backgroundColor = PresColor.LightBackground;
+ endBlock.style.color = Colors.BLACK;
+ endBlock.style.backgroundColor = Colors.LIGHT_GRAY;
}
}}
onChange={(e: React.ChangeEvent<HTMLInputElement>) => {
@@ -1558,16 +1524,16 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
this._batch = UndoManager.StartBatch("presStartTime");
const startBlock = document.getElementById("startTime");
if (startBlock) {
- startBlock.style.color = PresColor.LightBackground;
- startBlock.style.backgroundColor = PresColor.DarkBlue;
+ startBlock.style.color = Colors.LIGHT_GRAY;
+ startBlock.style.backgroundColor = Colors.MEDIUM_BLUE;
}
}}
onPointerUp={() => {
this._batch?.end();
const startBlock = document.getElementById("startTime");
if (startBlock) {
- startBlock.style.color = "black";
- startBlock.style.backgroundColor = PresColor.LightBackground;
+ startBlock.style.color = Colors.BLACK;
+ startBlock.style.backgroundColor = Colors.LIGHT_GRAY;
}
}}
onChange={(e: React.ChangeEvent<HTMLInputElement>) => {
@@ -1651,15 +1617,15 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
<div>
<div className={'presBox-toolbar-dropdown'} style={{ display: this.newDocumentTools && this.layoutDoc.presStatus === "edit" ? "inline-flex" : "none" }} onClick={e => e.stopPropagation()} onPointerUp={e => e.stopPropagation()} onPointerDown={e => e.stopPropagation()}>
<div className="layout-container" style={{ height: 'max-content' }}>
- <div className="layout" style={{ border: this.layout === 'blank' ? `solid 2px ${PresColor.DarkBlue}` : '' }} onClick={action(() => { this.layout = 'blank'; this.createNewSlide(this.layout); })} />
- <div className="layout" style={{ border: this.layout === 'title' ? `solid 2px ${PresColor.DarkBlue}` : '' }} onClick={action(() => { this.layout = 'title'; this.createNewSlide(this.layout); })}>
+ <div className="layout" style={{ border: this.layout === 'blank' ? `solid 2px ${Colors.MEDIUM_BLUE}` : '' }} onClick={action(() => { this.layout = 'blank'; this.createNewSlide(this.layout); })} />
+ <div className="layout" style={{ border: this.layout === 'title' ? `solid 2px ${Colors.MEDIUM_BLUE}` : '' }} onClick={action(() => { this.layout = 'title'; this.createNewSlide(this.layout); })}>
<div className="title">Title</div>
<div className="subtitle">Subtitle</div>
</div>
- <div className="layout" style={{ border: this.layout === 'header' ? `solid 2px ${PresColor.DarkBlue}` : '' }} onClick={action(() => { this.layout = 'header'; this.createNewSlide(this.layout); })}>
+ <div className="layout" style={{ border: this.layout === 'header' ? `solid 2px ${Colors.MEDIUM_BLUE}` : '' }} onClick={action(() => { this.layout = 'header'; this.createNewSlide(this.layout); })}>
<div className="title" style={{ alignSelf: 'center', fontSize: 10 }}>Section header</div>
</div>
- <div className="layout" style={{ border: this.layout === 'content' ? `solid 2px ${PresColor.DarkBlue}` : '' }} onClick={action(() => { this.layout = 'content'; this.createNewSlide(this.layout); })}>
+ <div className="layout" style={{ border: this.layout === 'content' ? `solid 2px ${Colors.MEDIUM_BLUE}` : '' }} onClick={action(() => { this.layout = 'content'; this.createNewSlide(this.layout); })}>
<div className="title" style={{ alignSelf: 'center' }}>Title</div>
<div className="content">Text goes here</div>
</div>
@@ -1691,26 +1657,26 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
<div className="ribbon-box">
Choose type:
<div className="ribbon-doubleButton">
- <div title="Text" className={'ribbon-toggle'} style={{ background: this.addFreeform ? "" : PresColor.LightBlue }} onClick={action(() => this.addFreeform = !this.addFreeform)}>Text</div>
- <div title="Freeform" className={'ribbon-toggle'} style={{ background: this.addFreeform ? PresColor.LightBlue : "" }} onClick={action(() => this.addFreeform = !this.addFreeform)}>Freeform</div>
+ <div title="Text" className={'ribbon-toggle'} style={{ background: this.addFreeform ? "" : Colors.LIGHT_BLUE }} onClick={action(() => this.addFreeform = !this.addFreeform)}>Text</div>
+ <div title="Freeform" className={'ribbon-toggle'} style={{ background: this.addFreeform ? Colors.LIGHT_BLUE : "" }} onClick={action(() => this.addFreeform = !this.addFreeform)}>Freeform</div>
</div>
</div>
<div className="ribbon-box" style={{ display: this.addFreeform ? "grid" : "none" }}>
Preset layouts:
<div className="layout-container" style={{ height: this.openLayouts ? 'max-content' : '75px' }}>
- <div className="layout" style={{ border: this.layout === 'blank' ? `solid 2px ${PresColor.DarkBlue}` : '' }} onClick={action(() => this.layout = 'blank')} />
- <div className="layout" style={{ border: this.layout === 'title' ? `solid 2px ${PresColor.DarkBlue}` : '' }} onClick={action(() => this.layout = 'title')}>
+ <div className="layout" style={{ border: this.layout === 'blank' ? `solid 2px ${Colors.MEDIUM_BLUE}` : '' }} onClick={action(() => this.layout = 'blank')} />
+ <div className="layout" style={{ border: this.layout === 'title' ? `solid 2px ${Colors.MEDIUM_BLUE}` : '' }} onClick={action(() => this.layout = 'title')}>
<div className="title">Title</div>
<div className="subtitle">Subtitle</div>
</div>
- <div className="layout" style={{ border: this.layout === 'header' ? `solid 2px ${PresColor.DarkBlue}` : '' }} onClick={action(() => this.layout = 'header')}>
+ <div className="layout" style={{ border: this.layout === 'header' ? `solid 2px ${Colors.MEDIUM_BLUE}` : '' }} onClick={action(() => this.layout = 'header')}>
<div className="title" style={{ alignSelf: 'center', fontSize: 10 }}>Section header</div>
</div>
- <div className="layout" style={{ border: this.layout === 'content' ? `solid 2px ${PresColor.DarkBlue}` : '' }} onClick={action(() => this.layout = 'content')}>
+ <div className="layout" style={{ border: this.layout === 'content' ? `solid 2px ${Colors.MEDIUM_BLUE}` : '' }} onClick={action(() => this.layout = 'content')}>
<div className="title" style={{ alignSelf: 'center' }}>Title</div>
<div className="content">Text goes here</div>
</div>
- <div className="layout" style={{ border: this.layout === 'twoColumns' ? `solid 2px ${PresColor.DarkBlue}` : '' }} onClick={action(() => this.layout = 'twoColumns')}>
+ <div className="layout" style={{ border: this.layout === 'twoColumns' ? `solid 2px ${Colors.MEDIUM_BLUE}` : '' }} onClick={action(() => this.layout = 'twoColumns')}>
<div className="title" style={{ alignSelf: 'center', gridColumn: '1/3' }}>Title</div>
<div className="content" style={{ gridColumn: 1, gridRow: 2 }}>Column one text</div>
<div className="content" style={{ gridColumn: 2, gridRow: 2 }}>Column two text</div>
@@ -1869,8 +1835,8 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
<div className="ribbon-box">
{this.stringType} selected
<div className="ribbon-doubleButton" style={{ borderTop: 'solid 1px darkgrey', display: (targetDoc.type === DocumentType.COL && targetDoc._viewType === 'freeform') || targetDoc.type === DocumentType.IMG || targetDoc.type === DocumentType.RTF ? "inline-flex" : "none" }}>
- <div className="ribbon-toggle" style={{ backgroundColor: activeItem.presProgressivize ? PresColor.LightBlue : "" }} onClick={this.progressivizeChild}>Contents</div>
- <div className="ribbon-toggle" style={{ opacity: activeItem.presProgressivize ? 1 : 0.4, backgroundColor: targetDoc.editProgressivize ? PresColor.LightBlue : "" }} onClick={this.editProgressivize}>Edit</div>
+ <div className="ribbon-toggle" style={{ backgroundColor: activeItem.presProgressivize ? Colors.LIGHT_BLUE : "" }} onClick={this.progressivizeChild}>Contents</div>
+ <div className="ribbon-toggle" style={{ opacity: activeItem.presProgressivize ? 1 : 0.4, backgroundColor: targetDoc.editProgressivize ? Colors.LIGHT_BLUE : "" }} onClick={this.editProgressivize}>Edit</div>
</div>
<div className="ribbon-doubleButton" style={{ display: activeItem.presProgressivize ? "inline-flex" : "none" }}>
<div className="presBox-subheading">Active text color</div>
@@ -1885,12 +1851,12 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
</div>
{this.viewedColorPicker}
<div className="ribbon-doubleButton" style={{ borderTop: 'solid 1px darkgrey', display: (targetDoc.type === DocumentType.COL && targetDoc._viewType === 'freeform') || targetDoc.type === DocumentType.IMG ? "inline-flex" : "none" }}>
- <div className="ribbon-toggle" style={{ backgroundColor: activeItem.zoomProgressivize ? PresColor.LightBlue : "" }} onClick={this.progressivizeZoom}>Zoom</div>
- <div className="ribbon-toggle" style={{ opacity: activeItem.zoomProgressivize ? 1 : 0.4, backgroundColor: activeItem.editZoomProgressivize ? PresColor.LightBlue : "" }} onClick={this.editZoomProgressivize}>Edit</div>
+ <div className="ribbon-toggle" style={{ backgroundColor: activeItem.zoomProgressivize ? Colors.LIGHT_BLUE : "" }} onClick={this.progressivizeZoom}>Zoom</div>
+ <div className="ribbon-toggle" style={{ opacity: activeItem.zoomProgressivize ? 1 : 0.4, backgroundColor: activeItem.editZoomProgressivize ? Colors.LIGHT_BLUE : "" }} onClick={this.editZoomProgressivize}>Edit</div>
</div>
<div className="ribbon-doubleButton" style={{ borderTop: 'solid 1px darkgrey', display: targetDoc._viewType === "stacking" || targetDoc.type === DocumentType.PDF || targetDoc.type === DocumentType.WEB || targetDoc.type === DocumentType.RTF ? "inline-flex" : "none" }}>
- <div className="ribbon-toggle" style={{ backgroundColor: activeItem.scrollProgressivize ? PresColor.LightBlue : "" }} onClick={this.progressivizeScroll}>Scroll</div>
- <div className="ribbon-toggle" style={{ opacity: activeItem.scrollProgressivize ? 1 : 0.4, backgroundColor: targetDoc.editScrollProgressivize ? PresColor.LightBlue : "" }} onClick={this.editScrollProgressivize}>Edit</div>
+ <div className="ribbon-toggle" style={{ backgroundColor: activeItem.scrollProgressivize ? Colors.LIGHT_BLUE : "" }} onClick={this.progressivizeScroll}>Scroll</div>
+ <div className="ribbon-toggle" style={{ opacity: activeItem.scrollProgressivize ? 1 : 0.4, backgroundColor: targetDoc.editScrollProgressivize ? Colors.LIGHT_BLUE : "" }} onClick={this.editScrollProgressivize}>Edit</div>
</div>
</div>
<div className="ribbon-final-box">
@@ -1900,7 +1866,7 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
<div key="back" title="back frame" className="backKeyframe" onClick={e => { e.stopPropagation(); this.prevKeyframe(targetDoc, activeItem); }}>
<FontAwesomeIcon icon={"caret-left"} size={"lg"} />
</div>
- <div key="num" title="toggle view all" className="numKeyframe" style={{ color: targetDoc.keyFrameEditing ? "white" : "black", backgroundColor: targetDoc.keyFrameEditing ? PresColor.DarkBlue : PresColor.LightBlue }}
+ <div key="num" title="toggle view all" className="numKeyframe" style={{ color: targetDoc.keyFrameEditing ? "white" : "black", backgroundColor: targetDoc.keyFrameEditing ? Colors.MEDIUM_BLUE : Colors.LIGHT_BLUE }}
onClick={action(() => targetDoc.keyFrameEditing = !targetDoc.keyFrameEditing)} >
{NumCast(targetDoc._currentFrame)}
</div>
@@ -1914,7 +1880,7 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
{this.frameListHeader}
{this.frameList}
</div>
- <div className="ribbon-toggle" style={{ height: 20, backgroundColor: PresColor.LightBlue }} onClick={() => console.log(" TODO: play frames")}>Play</div>
+ <div className="ribbon-toggle" style={{ height: 20, backgroundColor: Colors.LIGHT_BLUE }} onClick={() => console.log(" TODO: play frames")}>Play</div>
</div>
</div>
</div>
@@ -2130,7 +2096,7 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
tags.push(<div style={{ position: 'absolute', display: doc.displayMovement ? "block" : "none" }}>{this.checkMovementLists(doc, doc["x-indexed"], doc["y-indexed"])}</div>);
}
tags.push(
- <div className="progressivizeButton" key={index} onPointerLeave={() => { if (NumCast(targetDoc._currentFrame) < NumCast(doc.appearFrame)) doc.opacity = 0; }} onPointerOver={() => { if (NumCast(targetDoc._currentFrame) < NumCast(doc.appearFrame)) doc.opacity = 0.5; }} onClick={e => { this.toggleDisplayMovement(doc); e.stopPropagation(); }} style={{ backgroundColor: doc.displayMovement ? PresColor.LightBlue : "#c8c8c8", top: NumCast(doc.y), left: NumCast(doc.x) }}>
+ <div className="progressivizeButton" key={index} onPointerLeave={() => { if (NumCast(targetDoc._currentFrame) < NumCast(doc.appearFrame)) doc.opacity = 0; }} onPointerOver={() => { if (NumCast(targetDoc._currentFrame) < NumCast(doc.appearFrame)) doc.opacity = 0.5; }} onClick={e => { this.toggleDisplayMovement(doc); e.stopPropagation(); }} style={{ backgroundColor: doc.displayMovement ? Colors.LIGHT_BLUE : "#c8c8c8", top: NumCast(doc.y), left: NumCast(doc.x) }}>
<div className="progressivizeButton-prev"><FontAwesomeIcon icon={"caret-left"} size={"lg"} onClick={e => { e.stopPropagation(); this.prevAppearFrame(doc, index); }} /></div>
<div className="progressivizeButton-frame">{doc.appearFrame}</div>
<div className="progressivizeButton-next"><FontAwesomeIcon icon={"caret-right"} size={"lg"} onClick={e => { e.stopPropagation(); this.nextAppearFrame(doc, index); }} /></div>
@@ -2213,6 +2179,8 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
const mode = StrCast(this.rootDoc._viewType) as CollectionViewType;
const isMini: boolean = this.toolbarWidth <= 100;
const presKeyEvents: boolean = (this.isPres && this._presKeyEventsActive && this.rootDoc === Doc.UserDoc().activePresentation);
+ const activeColor = Colors.LIGHT_BLUE;
+ const inactiveColor = Colors.WHITE;
return (mode === CollectionViewType.Carousel3D) ? (null) : (
<div id="toolbarContainer" className={'presBox-toolbar'}>
{/* <Tooltip title={<><div className="dash-tooltip">{"Add new slide"}</div></>}><div className={`toolbar-button ${this.newDocumentTools ? "active" : ""}`} onClick={action(() => this.newDocumentTools = !this.newDocumentTools)}>
@@ -2220,7 +2188,7 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
<FontAwesomeIcon className={`dropdown ${this.newDocumentTools ? "active" : ""}`} icon={"angle-down"} />
</div></Tooltip> */}
<Tooltip title={<><div className="dash-tooltip">{"View paths"}</div></>}>
- <div style={{ opacity: this.childDocs.length > 1 && this.layoutDoc.presCollection ? 1 : 0.3, color: this._pathBoolean ? PresColor.DarkBlue : 'white', width: isMini ? "100%" : undefined }} className={"toolbar-button"} onClick={this.childDocs.length > 1 && this.layoutDoc.presCollection ? this.viewPaths : undefined}>
+ <div style={{ opacity: this.childDocs.length > 1 && this.layoutDoc.presCollection ? 1 : 0.3, color: this._pathBoolean ? Colors.MEDIUM_BLUE : 'white', width: isMini ? "100%" : undefined }} className={"toolbar-button"} onClick={this.childDocs.length > 1 && this.layoutDoc.presCollection ? this.viewPaths : undefined}>
<FontAwesomeIcon icon={"exchange-alt"} />
</div>
</Tooltip>
@@ -2229,7 +2197,7 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
<div className="toolbar-divider" />
{/* <Tooltip title={<><div className="dash-tooltip">{this._expandBoolean ? "Minimize all" : "Expand all"}</div></>}>
<div className={"toolbar-button"}
- style={{ color: this._expandBoolean ? PresColors.DarkBlue : 'white' }}
+ style={{ color: this._expandBoolean ? Colors.MEDIUM_BLUE : 'white' }}
onClick={this.toggleExpandMode}>
<FontAwesomeIcon icon={"eye"} />
</div>
@@ -2237,12 +2205,12 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
<div className="toolbar-divider" /> */}
<Tooltip title={<><div className="dash-tooltip">{presKeyEvents ? "Keys are active" : "Keys are not active - click anywhere on the presentation trail to activate keys"}</div></>}>
<div className="toolbar-button" style={{ cursor: presKeyEvents ? 'default' : 'pointer', position: 'absolute', right: 30, fontSize: 16 }}>
- <FontAwesomeIcon className={"toolbar-thumbtack"} icon={"keyboard"} style={{ color: presKeyEvents ? PresColor.DarkBlue : 'white' }} />
+ <FontAwesomeIcon className={"toolbar-thumbtack"} icon={"keyboard"} style={{ color: presKeyEvents ? activeColor : inactiveColor }} />
</div>
</Tooltip>
<Tooltip title={<><div className="dash-tooltip">{propTitle}</div></>}>
<div className="toolbar-button" style={{ position: 'absolute', right: 4, fontSize: 16 }} onClick={this.toggleProperties}>
- <FontAwesomeIcon className={"toolbar-thumbtack"} icon={propIcon} style={{ color: CurrentUserUtils.propertiesWidth > 0 ? PresColor.DarkBlue : 'white' }} />
+ <FontAwesomeIcon className={"toolbar-thumbtack"} icon={propIcon} style={{ color: CurrentUserUtils.propertiesWidth > 0 ? activeColor : inactiveColor }} />
</div>
</Tooltip>
</>
@@ -2379,7 +2347,7 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
const presStart: boolean = !this.layoutDoc.presLoop && (this.itemIndex === 0);
// Case 1: There are still other frames and should go through all frames before going to next slide
return (<div className="presPanelOverlay" style={{ display: this.layoutDoc.presStatus !== "edit" ? "inline-flex" : "none" }}>
- <Tooltip title={<><div className="dash-tooltip">{"Loop"}</div></>}><div className="presPanel-button" style={{ color: this.layoutDoc.presLoop ? PresColor.DarkBlue : 'white' }} onClick={() => this.layoutDoc.presLoop = !this.layoutDoc.presLoop}><FontAwesomeIcon icon={"redo-alt"} /></div></Tooltip>
+ <Tooltip title={<><div className="dash-tooltip">{"Loop"}</div></>}><div className="presPanel-button" style={{ color: this.layoutDoc.presLoop ? Colors.MEDIUM_BLUE : 'white' }} onClick={() => this.layoutDoc.presLoop = !this.layoutDoc.presLoop}><FontAwesomeIcon icon={"redo-alt"} /></div></Tooltip>
<div className="presPanel-divider"></div>
<div className="presPanel-button" style={{ opacity: presStart ? 0.4 : 1 }} onClick={() => { this.back(); if (this._presTimer) { clearTimeout(this._presTimer); this.layoutDoc.presStatus = PresStatus.Manual; } }}><FontAwesomeIcon icon={"arrow-left"} /></div>
<Tooltip title={<><div className="dash-tooltip">{this.layoutDoc.presStatus === PresStatus.Autoplay ? "Pause" : "Autoplay"}</div></>}><div className="presPanel-button" onClick={this.startOrPause}><FontAwesomeIcon icon={this.layoutDoc.presStatus === PresStatus.Autoplay ? "pause" : "play"} /></div></Tooltip>
@@ -2418,8 +2386,8 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
const presStart: boolean = !this.layoutDoc.presLoop && (this.itemIndex === 0);
return CurrentUserUtils.OverlayDocs.includes(this.rootDoc) ?
<div className="miniPres">
- <div className="presPanelOverlay" style={{ display: "inline-flex", height: 30, background: '#323232', top: 0, zIndex: 3000000, boxShadow: presKeyEvents ? '0 0 0px 3px ' + PresColor.DarkBlue : undefined }}>
- <Tooltip title={<><div className="dash-tooltip">{"Loop"}</div></>}><div className="presPanel-button" style={{ color: this.layoutDoc.presLoop ? PresColor.DarkBlue : undefined }} onClick={() => this.layoutDoc.presLoop = !this.layoutDoc.presLoop}><FontAwesomeIcon icon={"redo-alt"} /></div></Tooltip>
+ <div className="presPanelOverlay" style={{ display: "inline-flex", height: 30, background: '#323232', top: 0, zIndex: 3000000, boxShadow: presKeyEvents ? '0 0 0px 3px ' + Colors.MEDIUM_BLUE : undefined }}>
+ <Tooltip title={<><div className="dash-tooltip">{"Loop"}</div></>}><div className="presPanel-button" style={{ color: this.layoutDoc.presLoop ? Colors.MEDIUM_BLUE : undefined }} onClick={() => this.layoutDoc.presLoop = !this.layoutDoc.presLoop}><FontAwesomeIcon icon={"redo-alt"} /></div></Tooltip>
<div className="presPanel-divider"></div>
<div className="presPanel-button" style={{ opacity: presStart ? 0.4 : 1 }} onClick={() => { this.back(); if (this._presTimer) { clearTimeout(this._presTimer); this.layoutDoc.presStatus = PresStatus.Manual; } }}><FontAwesomeIcon icon={"arrow-left"} /></div>
<Tooltip title={<><div className="dash-tooltip">{this.layoutDoc.presStatus === PresStatus.Autoplay ? "Pause" : "Autoplay"}</div></>}><div className="presPanel-button" onClick={this.startOrPause}><FontAwesomeIcon icon={this.layoutDoc.presStatus === "auto" ? "pause" : "play"} /></div></Tooltip>
diff --git a/src/client/views/presentationview/PresElementBox.scss b/src/client/views/nodes/trails/PresElementBox.scss
index 1ad4b820e..1ad4b820e 100644
--- a/src/client/views/presentationview/PresElementBox.scss
+++ b/src/client/views/nodes/trails/PresElementBox.scss
diff --git a/src/client/views/presentationview/PresElementBox.tsx b/src/client/views/nodes/trails/PresElementBox.tsx
index f15d51764..5e713c3cf 100644
--- a/src/client/views/presentationview/PresElementBox.tsx
+++ b/src/client/views/nodes/trails/PresElementBox.tsx
@@ -2,27 +2,29 @@ import { FontAwesomeIcon } from "@fortawesome/react-fontawesome";
import { Tooltip } from "@material-ui/core";
import { action, computed, IReactionDisposer, observable, reaction } from "mobx";
import { observer } from "mobx-react";
-import { DataSym, Doc, Opt } from "../../../fields/Doc";
-import { documentSchema } from '../../../fields/documentSchemas';
-import { Id } from "../../../fields/FieldSymbols";
-import { createSchema, makeInterface } from '../../../fields/Schema';
-import { Cast, NumCast, StrCast } from "../../../fields/Types";
-import { emptyFunction, returnFalse, returnTrue, setupMoveUpEvents, emptyPath, returnEmptyDoclist } from "../../../Utils";
-import { DocumentType } from "../../documents/DocumentTypes";
-import { CurrentUserUtils } from "../../util/CurrentUserUtils";
-import { DocumentManager } from "../../util/DocumentManager";
-import { DragManager } from "../../util/DragManager";
-import { Transform } from "../../util/Transform";
-import { undoBatch } from "../../util/UndoManager";
-import { ViewBoxBaseComponent } from '../DocComponent';
-import { EditableView } from "../EditableView";
-import { DocumentView, DocumentViewProps } from "../nodes/DocumentView";
-import { FieldView, FieldViewProps } from '../nodes/FieldView';
-import { PresBox, PresColor, PresMovement } from "../nodes/PresBox";
-import { StyleProp } from "../StyleProvider";
+import { DataSym, Doc, Opt } from "../../../../fields/Doc";
+import { documentSchema } from '../../../../fields/documentSchemas';
+import { Id } from "../../../../fields/FieldSymbols";
+import { createSchema, makeInterface } from '../../../../fields/Schema';
+import { Cast, NumCast, StrCast } from "../../../../fields/Types";
+import { emptyFunction, returnFalse, returnTrue, setupMoveUpEvents, emptyPath, returnEmptyDoclist } from "../../../../Utils";
+import { DocumentType } from "../../../documents/DocumentTypes";
+import { CurrentUserUtils } from "../../../util/CurrentUserUtils";
+import { DocumentManager } from "../../../util/DocumentManager";
+import { DragManager } from "../../../util/DragManager";
+import { Transform } from "../../../util/Transform";
+import { undoBatch } from "../../../util/UndoManager";
+import { ViewBoxBaseComponent } from '../../DocComponent';
+import { EditableView } from "../../EditableView";
+import { DocumentView, DocumentViewProps } from "../../nodes/DocumentView";
+import { FieldView, FieldViewProps } from '../../nodes/FieldView';
+import { PresBox } from "./PresBox";
+import { Colors } from "../../global/globalEnums";
+import { StyleProp } from "../../StyleProvider";
import "./PresElementBox.scss";
import React = require("react");
-import { DocUtils } from "../../documents/Documents";
+import { DocUtils } from "../../../documents/Documents";
+import { PresMovement } from "./PresEnums";
export const presSchema = createSchema({
presentationTargetDoc: Doc,
@@ -210,11 +212,11 @@ export class PresElementBox extends ViewBoxBaseComponent<FieldViewProps, PresDoc
const height = slide.clientHeight;
const halfLine = height / 2;
if (y <= halfLine) {
- slide.style.borderTop = "solid 2px #5B9FDD";
+ slide.style.borderTop = `solid 2px ${Colors.MEDIUM_BLUE}`;
slide.style.borderBottom = "0px";
} else if (y > halfLine) {
slide.style.borderTop = "0px";
- slide.style.borderBottom = "solid 2px #5B9FDD";
+ slide.style.borderBottom = `solid 2px ${Colors.MEDIUM_BLUE}`;
}
}
document.removeEventListener("pointermove", this.onPointerMove);
@@ -292,7 +294,7 @@ export class PresElementBox extends ViewBoxBaseComponent<FieldViewProps, PresDoc
const miniView: boolean = this.toolbarWidth <= 110;
const presBox: Doc = this.presBox; //presBox
const presBoxColor: string = StrCast(presBox._backgroundColor);
- const presColorBool: boolean = presBoxColor ? (presBoxColor !== "white" && presBoxColor !== "transparent") : false;
+ const presColorBool: boolean = presBoxColor ? (presBoxColor !== Colors.WHITE && presBoxColor !== "transparent") : false;
const targetDoc: Doc = this.targetDoc;
const activeItem: Doc = this.rootDoc;
return (
@@ -300,7 +302,7 @@ export class PresElementBox extends ViewBoxBaseComponent<FieldViewProps, PresDoc
key={this.props.Document[Id] + this.indexInPres}
ref={this._itemRef}
style={{
- backgroundColor: presColorBool ? isSelected ? "rgba(250,250,250,0.3)" : "transparent" : isSelected ? "#AEDDF8" : "transparent",
+ backgroundColor: presColorBool ? isSelected ? "rgba(250,250,250,0.3)" : "transparent" : isSelected ? Colors.LIGHT_BLUE : "transparent",
opacity: this._dragging ? 0.3 : 1
}}
onClick={e => {
@@ -356,7 +358,7 @@ export class PresElementBox extends ViewBoxBaseComponent<FieldViewProps, PresDoc
style={{
zIndex: 1000 - this.indexInPres,
fontWeight: 700,
- backgroundColor: activeItem.groupWithUp ? presColorBool ? presBoxColor : PresColor.DarkBlue : undefined,
+ backgroundColor: activeItem.groupWithUp ? presColorBool ? presBoxColor : Colors.MEDIUM_BLUE : undefined,
height: activeItem.groupWithUp ? 53 : 18,
transform: activeItem.groupWithUp ? "translate(0, -17px)" : undefined
}}>
diff --git a/src/client/views/nodes/trails/PresEnums.ts b/src/client/views/nodes/trails/PresEnums.ts
new file mode 100644
index 000000000..93ab323fb
--- /dev/null
+++ b/src/client/views/nodes/trails/PresEnums.ts
@@ -0,0 +1,28 @@
+export enum PresMovement {
+ Zoom = "zoom",
+ Pan = "pan",
+ Jump = "jump",
+ None = "none",
+}
+
+export enum PresEffect {
+ Zoom = "Zoom",
+ Lightspeed = "Lightspeed",
+ Fade = "Fade in",
+ Flip = "Flip",
+ Rotate = "Rotate",
+ Bounce = "Bounce",
+ Roll = "Roll",
+ None = "None",
+ Left = "left",
+ Right = "right",
+ Center = "center",
+ Top = "top",
+ Bottom = "bottom"
+}
+
+export enum PresStatus {
+ Autoplay = "auto",
+ Manual = "manual",
+ Edit = "edit"
+} \ No newline at end of file
diff --git a/src/client/views/nodes/trails/index.ts b/src/client/views/nodes/trails/index.ts
new file mode 100644
index 000000000..8f3f7b03a
--- /dev/null
+++ b/src/client/views/nodes/trails/index.ts
@@ -0,0 +1,3 @@
+export * from "./PresBox";
+export * from "./PresElementBox";
+export * from "./PresEnums"; \ No newline at end of file
diff --git a/src/client/views/pdf/AnchorMenu.tsx b/src/client/views/pdf/AnchorMenu.tsx
index 1e2d72254..55816ed52 100644
--- a/src/client/views/pdf/AnchorMenu.tsx
+++ b/src/client/views/pdf/AnchorMenu.tsx
@@ -1,7 +1,7 @@
import React = require("react");
import { FontAwesomeIcon } from "@fortawesome/react-fontawesome";
import { Tooltip } from "@material-ui/core";
-import { action, computed, observable, IReactionDisposer, reaction } from "mobx";
+import { action, computed, observable, IReactionDisposer, reaction, ObservableMap } from "mobx";
import { observer } from "mobx-react";
import { ColorState } from "react-color";
import { Doc, Opt } from "../../../fields/Doc";
@@ -10,6 +10,7 @@ import { AntimodeMenu, AntimodeMenuProps } from "../AntimodeMenu";
import { ButtonDropdown } from "../nodes/formattedText/RichTextMenu";
import "./AnchorMenu.scss";
import { SelectionManager } from "../../util/SelectionManager";
+import { LinkPopup } from "../linking/LinkPopup";
@observer
export class AnchorMenu extends AntimodeMenu<AntimodeMenuProps> {
@@ -38,6 +39,7 @@ export class AnchorMenu extends AntimodeMenu<AntimodeMenuProps> {
@observable private _valueValue: string = "";
@observable private _added: boolean = false;
@observable private highlightColor: string = "rgba(245, 230, 95, 0.616)";
+ @observable private _showLinkPopup: boolean = false;
@observable public _colorBtn = false;
@observable public Highlighting: boolean = false;
@@ -46,6 +48,7 @@ export class AnchorMenu extends AntimodeMenu<AntimodeMenuProps> {
public OnClick: (e: PointerEvent) => void = unimplementedFunction;
public StartDrag: (e: PointerEvent, ele: HTMLElement) => void = unimplementedFunction;
public Highlight: (color: string, isPushpin: boolean) => Opt<Doc> = (color: string, isPushpin: boolean) => undefined;
+ public GetAnchor: (savedAnnotations?: ObservableMap<number, HTMLDivElement[]>) => Opt<Doc> = () => undefined;
public Delete: () => void = unimplementedFunction;
public AddTag: (key: string, value: string) => boolean = returnFalse;
public PinToPres: () => void = unimplementedFunction;
@@ -79,6 +82,13 @@ export class AnchorMenu extends AntimodeMenu<AntimodeMenuProps> {
}
}
+ @action
+ toggleLinkPopup = (e: React.MouseEvent) => {
+ //ignore the potential null type error because this method cannot be called unless the user selects text and clicks the link button
+ //change popup visibility field to visible
+ this._showLinkPopup = !this._showLinkPopup;
+ }
+
@computed get highlighter() {
const button =
<button className="antimodeMenu-button color-preview-button" title="" key="highlighter-button" onClick={this.highlightClicked}>
@@ -135,6 +145,14 @@ export class AnchorMenu extends AntimodeMenu<AntimodeMenuProps> {
<FontAwesomeIcon icon="comment-alt" size="lg" />
</button>
</Tooltip>,
+
+ //NOTE: link popup is currently incomplete
+ // <Tooltip key="link" title={<div className="dash-tooltip">{"Link selected text to document or URL"}</div>}>
+ // <button className="antimodeMenu-button link" onPointerDown={this.toggleLinkPopup} style={{}}>
+ // <FontAwesomeIcon icon="link" size="lg" />
+ // </button>
+ // </Tooltip>,
+ // <LinkPopup showPopup={this._showLinkPopup} />
] : [
<Tooltip key="trash" title={<div className="dash-tooltip">{"Remove Link Anchor"}</div>}>
<button className="antimodeMenu-button" onPointerDown={this.Delete}>
diff --git a/src/client/views/pdf/PDFViewer.tsx b/src/client/views/pdf/PDFViewer.tsx
index 85cf5abd7..e8c7a4ab0 100644
--- a/src/client/views/pdf/PDFViewer.tsx
+++ b/src/client/views/pdf/PDFViewer.tsx
@@ -133,10 +133,10 @@ export class PDFViewer extends React.Component<IViewerProps> {
this._disposers.selected = reaction(() => this.props.isSelected(),
selected => {
- if (!selected) {
- Array.from(this._savedAnnotations.values()).forEach(v => v.forEach(a => a.remove()));
- Array.from(this._savedAnnotations.keys()).forEach(k => this._savedAnnotations.set(k, []));
- }
+ // if (!selected) {
+ // Array.from(this._savedAnnotations.values()).forEach(v => v.forEach(a => a.remove()));
+ // Array.from(this._savedAnnotations.keys()).forEach(k => this._savedAnnotations.set(k, []));
+ // }
(SelectionManager.Views().length === 1) && this.setupPdfJsViewer();
},
{ fireImmediately: true });
@@ -184,7 +184,8 @@ export class PDFViewer extends React.Component<IViewerProps> {
const mainCont = this._mainCont.current;
let focusSpeed: Opt<number>;
if (doc !== this.props.rootDoc && mainCont && this._pdfViewer) {
- const scrollTo = Utils.scrollIntoView(NumCast(doc.y), doc[HeightSym](), NumCast(this.props.layoutDoc._scrollTop), this.props.PanelHeight() / (this.props.scaling?.() || 1));
+ const windowHeight = this.props.PanelHeight() / (this.props.scaling?.() || 1);
+ const scrollTo = Utils.scrollIntoView(NumCast(doc.y), doc[HeightSym](), NumCast(this.props.layoutDoc._scrollTop), windowHeight, .1 * windowHeight);
if (scrollTo !== undefined) {
focusSpeed = 500;
@@ -372,7 +373,7 @@ export class PDFViewer extends React.Component<IViewerProps> {
if ((e.button !== 0 || e.altKey) && this.props.isContentActive(true)) {
this._setPreviewCursor?.(e.clientX, e.clientY, true);
}
- if (!e.altKey && e.button === 0 && this.props.isContentActive(true)) {
+ if (!e.altKey && e.button === 0 && this.props.isContentActive(true) && ![InkTool.Highlighter, InkTool.Pen].includes(CurrentUserUtils.SelectedTool)) {
this.props.select(false);
this._marqueeing = [e.clientX, e.clientY];
if (e.target && ((e.target as any).className.includes("endOfContent") || ((e.target as any).parentElement.className !== "textLayer"))) {
diff --git a/src/client/views/search/CheckBox.scss b/src/client/views/search/CheckBox.scss
index cc858bec6..2a0085ade 100644
--- a/src/client/views/search/CheckBox.scss
+++ b/src/client/views/search/CheckBox.scss
@@ -1,4 +1,4 @@
-@import "../globalCssVariables";
+@import "../global/globalCssVariables";
.checkboxfilter {
display: flex;
@@ -13,7 +13,7 @@
margin-top: 0px;
.check-container:hover~.check-box {
- background-color: $darker-alt-accent;
+ background-color: $medium-blue;
}
.check-container {
@@ -40,7 +40,7 @@
overflow: visible;
background-color: transparent;
border-style: solid;
- border-color: $alt-accent;
+ border-color: $medium-gray;
border-width: 2px;
-webkit-transition: all 0.2s ease-in-out;
-moz-transition: all 0.2s ease-in-out;
diff --git a/src/client/views/search/CollectionFilters.scss b/src/client/views/search/CollectionFilters.scss
index b54cdcbd1..845b16f67 100644
--- a/src/client/views/search/CollectionFilters.scss
+++ b/src/client/views/search/CollectionFilters.scss
@@ -1,4 +1,4 @@
-@import "../globalCssVariables";
+@import "../global/globalCssVariables";
.collection-filters {
display: flex;
diff --git a/src/client/views/search/IconBar.scss b/src/client/views/search/IconBar.scss
index 013dcd57e..6aaf7918d 100644
--- a/src/client/views/search/IconBar.scss
+++ b/src/client/views/search/IconBar.scss
@@ -1,4 +1,4 @@
-@import "../globalCssVariables";
+@import "../global/globalCssVariables";
.icon-bar {
display: flex;
diff --git a/src/client/views/search/IconButton.scss b/src/client/views/search/IconButton.scss
index 4ec03c7c9..3cb08d756 100644
--- a/src/client/views/search/IconButton.scss
+++ b/src/client/views/search/IconButton.scss
@@ -1,4 +1,4 @@
-@import "../globalCssVariables";
+@import "../global/globalCssVariables";
.type-outer {
display: flex;
@@ -9,7 +9,7 @@
.type-icon {
height: 30px;
width: 30px;
- color: $light-color;
+ color: $white;
// background-color: rgb(194, 194, 197);
background-color: gray;
border-radius: 50%;
@@ -43,7 +43,7 @@
.type-icon:hover {
transform: scale(1.1);
- background-color: $darker-alt-accent;
+ background-color: $medium-blue;
opacity: 1;
+.filter-description {
diff --git a/src/client/views/search/IconButton.tsx b/src/client/views/search/IconButton.tsx
index 349690b20..2dd6b1b79 100644
--- a/src/client/views/search/IconButton.tsx
+++ b/src/client/views/search/IconButton.tsx
@@ -4,7 +4,7 @@ import { action, IReactionDisposer, observable, reaction, runInAction } from 'mo
import { observer } from 'mobx-react';
import * as React from 'react';
import { DocumentType } from "../../documents/DocumentTypes";
-import '../globalCssVariables.scss';
+import '../global/globalCssVariables.scss';
import { IconBar } from './IconBar';
import "./IconButton.scss";
import "./SearchBox.scss";
@@ -104,7 +104,7 @@ export class IconButton extends React.Component<IconButtonProps>{
hoverStyle = {
opacity: 1,
backgroundColor: "rgb(128, 128, 128)"
- //backgroundColor: "rgb(178, 206, 248)" //$darker-alt-accent
+ //backgroundColor: "rgb(178, 206, 248)" //$medium-blue
};
render() {
diff --git a/src/client/views/search/NaviconButton.scss b/src/client/views/search/NaviconButton.scss
index c23bab461..8a70b29de 100644
--- a/src/client/views/search/NaviconButton.scss
+++ b/src/client/views/search/NaviconButton.scss
@@ -1,4 +1,4 @@
-@import "../globalCssVariables";
+@import "../global/globalCssVariables";
$height-icon: 15px;
$width-line: 30px;
@@ -20,7 +20,7 @@ $translateX: 0;
.line {
display: block;
- background: $alt-accent;
+ background: $medium-gray;
width: $width-line;
height: $height-line;
position: absolute;
diff --git a/src/client/views/search/SearchBox.scss b/src/client/views/search/SearchBox.scss
index e4d1ac6a3..3d173f115 100644
--- a/src/client/views/search/SearchBox.scss
+++ b/src/client/views/search/SearchBox.scss
@@ -1,4 +1,4 @@
-@import "../globalCssVariables";
+@import "../global/globalCssVariables";
@import "./NaviconButton.scss";
.searchBox-container {
diff --git a/src/client/views/search/SearchBox.tsx b/src/client/views/search/SearchBox.tsx
index 3cbb4b3b1..51b1319d4 100644
--- a/src/client/views/search/SearchBox.tsx
+++ b/src/client/views/search/SearchBox.tsx
@@ -1,34 +1,17 @@
-import { FontAwesomeIcon } from "@fortawesome/react-fontawesome";
-import { Tooltip } from '@material-ui/core';
-import { action, computed, IReactionDisposer, observable, reaction, runInAction } from 'mobx';
+import { action, observable } from 'mobx';
import { observer } from 'mobx-react';
import * as React from 'react';
-import { Doc, DocListCast, Field, Opt, DocListCastAsync, DataSym, HeightSym, FieldsSym } from '../../../fields/Doc';
+import { Doc, DocListCast, Field } from '../../../fields/Doc';
import { documentSchema } from "../../../fields/documentSchemas";
-import { Copy, Id, ToString } from '../../../fields/FieldSymbols';
-import { List } from '../../../fields/List';
-import { createSchema, listSpec, makeInterface } from '../../../fields/Schema';
-import { SchemaHeaderField } from '../../../fields/SchemaHeaderField';
-import { Cast, NumCast, StrCast } from '../../../fields/Types';
-import { emptyFunction, returnFalse, returnZero, setupMoveUpEvents, Utils } from '../../../Utils';
-import { Docs } from '../../documents/Documents';
+import { Id } from '../../../fields/FieldSymbols';
+import { createSchema, makeInterface } from '../../../fields/Schema';
+import { StrCast } from '../../../fields/Types';
import { DocumentType } from "../../documents/DocumentTypes";
-import { CurrentUserUtils } from "../../util/CurrentUserUtils";
-import { SetupDrag } from '../../util/DragManager';
-import { SearchUtil } from '../../util/SearchUtil';
-import { Transform } from '../../util/Transform';
+import { DocumentManager } from "../../util/DocumentManager";
import { CollectionDockingView } from "../collections/CollectionDockingView";
-import { CollectionSchemaView, ColumnType } from "../collections/CollectionSchemaView";
-import { CollectionViewType } from '../collections/CollectionView';
import { ViewBoxBaseComponent } from "../DocComponent";
import { FieldView, FieldViewProps } from '../nodes/FieldView';
import "./SearchBox.scss";
-import { undoBatch } from "../../util/UndoManager";
-import { DocServer } from "../../DocServer";
-import { MainView } from "../MainView";
-import { DocumentManager } from "../../util/DocumentManager";
-import { CollectionSchemaBooleanCell } from "../collections/CollectionSchemaCells";
-import { transpileModule } from "typescript";
export const searchSchema = createSchema({ Document: Doc });
diff --git a/src/client/views/search/SelectorContextMenu.scss b/src/client/views/search/SelectorContextMenu.scss
index 48cacc608..a114f679c 100644
--- a/src/client/views/search/SelectorContextMenu.scss
+++ b/src/client/views/search/SelectorContextMenu.scss
@@ -1,7 +1,7 @@
-@import "../globalCssVariables";
+@import "../global/globalCssVariables";
.parents {
- background: $lighter-alt-accent;
+ background: $light-blue;
padding: 10px;
// width: 300px;
@@ -10,7 +10,7 @@
}
.collection {
- border-color: $darker-alt-accent;
+ border-color: $medium-blue;
border-bottom-style: solid;
}
} \ No newline at end of file
diff --git a/src/client/views/search/ToggleBar.scss b/src/client/views/search/ToggleBar.scss
index 79f866acb..3a164f133 100644
--- a/src/client/views/search/ToggleBar.scss
+++ b/src/client/views/search/ToggleBar.scss
@@ -1,9 +1,9 @@
-@import "../globalCssVariables";
+@import "../global/globalCssVariables";
.toggle-title {
display: flex;
align-items: center;
- color: $light-color;
+ color: $white;
text-transform: uppercase;
flex-direction: row;
justify-content: space-around;
@@ -25,7 +25,7 @@
// height: 50px;
height: 30px;
width: 100px;
- background-color: $alt-accent;
+ background-color: $medium-gray;
border-radius: 10px;
padding: 5px;
display: flex;
@@ -36,6 +36,6 @@
width: 40px;
height: 100%;
border-radius: 10px;
- background-color: $light-color;
+ background-color: $white;
}
} \ No newline at end of file
diff --git a/src/client/views/topbar/TopBar.scss b/src/client/views/topbar/TopBar.scss
new file mode 100644
index 000000000..164cc29cd
--- /dev/null
+++ b/src/client/views/topbar/TopBar.scss
@@ -0,0 +1,217 @@
+@import "../global/globalCssVariables";
+
+.topbar-container {
+ display: flex;
+ flex-direction: column;
+ width: 100%;
+ position: relative;
+ font-size: 10px;
+ line-height: 1;
+ overflow-y: auto;
+ overflow-x: visible;
+ background: $dark-gray;
+ overflow: visible;
+ z-index: 1000;
+
+ .topbar-bar {
+ height: $topbar-height;
+ display: grid;
+ grid-auto-columns: 33.3% 33.3% 33.3%;
+ align-items: center;
+ background-color: $dark-gray;
+
+ .topBar-icon {
+ cursor: pointer;
+ font-size: 12px;
+ font-family: 'Roboto';
+ width: fit-content;
+ display: flex;
+ justify-content: center;
+ gap: 4px;
+ align-items: center;
+ justify-self: center;
+ align-self: center;
+ border-radius: 5px;
+ padding: 5px;
+ transition: linear 0.1s;
+ color: $black;
+ background-color: $light-gray;
+ }
+
+ .topBar-icon:hover {
+ background-color: $light-blue;
+ }
+
+
+ .topbar-center {
+ grid-column: 2;
+ display: inline-flex;
+ justify-content: center;
+ align-items: center;
+ gap: 5px;
+
+ .topbar-dashboards {
+ display: flex;
+ flex-direction: row;
+ }
+
+ .topbar-lozenge-dashboard {
+ display: flex;
+
+
+
+ .topbar-dashSelect {
+ border: none;
+ background-color: $dark-gray;
+ color: $white;
+ font-family: 'Roboto';
+ font-size: 17;
+ font-weight: 500;
+
+ &:hover {
+ cursor: pointer;
+ }
+ }
+ }
+ }
+
+
+ .topbar-right {
+ grid-column: 3;
+ position: relative;
+ display: flex;
+ justify-content: flex-end;
+ gap: 5px;
+ margin-right: 5px;
+ }
+
+ .topbar-left {
+ grid-column: 1;
+ color: black;
+ font-family: 'Roboto';
+ position: relative;
+ display: flex;
+ width: 450;
+ gap: 5px;
+
+ .topBar-icon:hover {
+ background-color: $close-red;
+ }
+
+ .topbar-lozenge-user,
+ .topbar-lozenge {
+ height: 23;
+ font-size: 12;
+ color: white;
+ font-family: 'Roboto';
+ font-weight: 400;
+ padding: 4px;
+ align-self: center;
+ margin-left: 7px;
+ display: flex;
+ align-items: center;
+
+ .topbar-dashSelect {
+ border: none;
+ background-color: transparent;
+ color: black;
+ font-family: 'Roboto';
+ font-size: 17;
+ font-weight: 500;
+
+ &:hover {
+ cursor: pointer;
+ }
+ }
+ }
+
+ .topbar-logoff {
+ border-radius: 3px;
+ background: olivedrab;
+ color: white;
+ display: none;
+ margin-left: 5px;
+ padding: 1px 2px 1px 2px;
+ cursor: pointer;
+ }
+
+ .topbar-logoff {
+ background: red;
+ }
+
+ .topbar-lozenge-user:hover {
+ .topbar-logoff {
+ display: inline-block;
+ }
+ }
+ }
+
+ .topbar-barChild {
+
+ &.topbar-collection {
+ flex: 0 1 auto;
+ margin-left: 2px;
+ margin-right: 2px
+ }
+
+ &.topbar-input {
+ margin:5px;
+ border-radius:20px;
+ border:$dark-gray;
+ display: block;
+ width: 130px;
+ -webkit-transition: width 0.4s;
+ transition: width 0.4s;
+ /* align-self: stretch; */
+ outline: none;
+
+ &:focus {
+ width: 500px;
+ outline: none;
+ }
+ }
+
+ &.topbar-filter {
+ align-self: stretch;
+
+ button {
+ transform: none;
+
+ &:hover {
+ transform: none;
+ }
+ }
+ }
+
+ &.topbar-submit {
+ margin-left: 2px;
+ margin-right: 2px
+ }
+
+ &.topbar-close {
+ color: $white;
+ max-height: $topbar-height;
+ }
+ }
+ }
+}
+
+.topbar-results {
+ display: flex;
+ flex-direction: column;
+ top: 300px;
+ display: flex;
+ flex-direction: column;
+ height: 100%;
+ overflow: visible;
+
+ .no-result {
+ width: 500px;
+ background: $light-gray;
+ padding: 10px;
+ height: 50px;
+ text-transform: uppercase;
+ text-align: left;
+ font-weight: bold;
+ }
+} \ No newline at end of file
diff --git a/src/client/views/topbar/TopBar.tsx b/src/client/views/topbar/TopBar.tsx
new file mode 100644
index 000000000..05edb975c
--- /dev/null
+++ b/src/client/views/topbar/TopBar.tsx
@@ -0,0 +1,66 @@
+import { FontAwesomeIcon } from "@fortawesome/react-fontawesome";
+import { observer } from "mobx-react";
+import * as React from 'react';
+import { Doc, DocListCast } from '../../../fields/Doc';
+import { Id } from '../../../fields/FieldSymbols';
+import { StrCast } from '../../../fields/Types';
+import { Utils } from '../../../Utils';
+import { CurrentUserUtils } from "../../util/CurrentUserUtils";
+import { SettingsManager } from "../../util/SettingsManager";
+import { undoBatch } from "../../util/UndoManager";
+import { Borders, Colors } from "../global/globalEnums";
+import "./TopBar.scss";
+
+/**
+ * ABOUT: This is the topbar in Dash, which included the current Dashboard as well as access to information on the user
+ * and settings and help buttons. Future scope for this bar is to include the collaborators that are on the same Dashboard.
+ */
+@observer
+export class TopBar extends React.Component {
+ render() {
+ const myDashboards = DocListCast(CurrentUserUtils.MyDashboards.data);
+ return (
+ //TODO:glr Add support for light / dark mode
+ <div style={{ pointerEvents: "all" }} className="topbar-container">
+ <div className="topbar-bar" style={{ background: Colors.DARK_GRAY, borderBottom: Borders.STANDARD }}>
+ <div className="topbar-left">
+ <div className="topbar-lozenge-user">
+ {`${Doc.CurrentUserEmail}`}
+ </div>
+ <div className="topbar-icon" onClick={() => window.location.assign(Utils.prepend("/logout"))}>
+ {"Sign out"}
+ </div>
+ </div>
+ <div className="topbar-center" >
+ <div className="topbar-lozenge-dashboard">
+ <select className="topbar-dashSelect" onChange={e => CurrentUserUtils.openDashboard(Doc.UserDoc(), myDashboards[Number(e.target.value)])}
+ value={myDashboards.indexOf(CurrentUserUtils.ActiveDashboard)}
+ style={{ color: Colors.WHITE }}>
+ {myDashboards.map((dash, i) => <option key={dash[Id]} value={i}> {StrCast(dash.title)} </option>)}
+ </select>
+ </div>
+ <div className="topbar-dashboards">
+ <div className="topbar-icon" onClick={undoBatch(() => CurrentUserUtils.createNewDashboard(Doc.UserDoc()))}
+ >
+ {"New"}<FontAwesomeIcon icon="plus"></FontAwesomeIcon>
+ </div>
+ {Doc.UserDoc().noviceMode ? (null) : <div className="topbar-icon" onClick={undoBatch(() => CurrentUserUtils.snapshotDashboard(Doc.UserDoc()))}
+ >
+ {"Snapshot"}<FontAwesomeIcon icon="camera"></FontAwesomeIcon>
+ </div>}
+ </div>
+ </div>
+ <div className="topbar-right" >
+ <div className="topbar-icon">
+ {"Help"}<FontAwesomeIcon icon="question-circle"></FontAwesomeIcon>
+ </div>
+ <div className="topbar-icon" onClick={() => SettingsManager.Instance.open()}>
+ {"Settings"}<FontAwesomeIcon icon="cog"></FontAwesomeIcon>
+ </div>
+
+ </div>
+ </div>
+ </div >
+ );
+ }
+} \ No newline at end of file
diff --git a/src/client/views/webcam/DashWebRTCVideo.scss b/src/client/views/webcam/DashWebRTCVideo.scss
index 41307a808..249aee9d6 100644
--- a/src/client/views/webcam/DashWebRTCVideo.scss
+++ b/src/client/views/webcam/DashWebRTCVideo.scss
@@ -1,4 +1,4 @@
-@import "../globalCssVariables";
+@import "../global/globalCssVariables";
.webcam-cont {
background: whitesmoke;