2 files changed, 76 insertions, 8 deletions

diff --git a/src/documents/Documents.ts b/src/documents/Documents.ts
index bba678bbd..beee44bee 100644
--- a/src/documents/Documents.ts
+++ b/src/documents/Documents.ts
@@ -44,7 +44,7 @@ export namespace Documents {
     export function TextDocument(text: string, options:DocumentOptions = {}): Document {
         let doc = GetTextPrototype().MakeDelegate();
         setupOptions(doc, options);
-        doc.SetField(KeyStore.Data, new TextField(text));
+        // doc.SetField(KeyStore.Data, new TextField(text));
         return doc;
     }
 
diff --git a/src/views/nodes/FieldTextBox.tsx b/src/views/nodes/FieldTextBox.tsx
index 5df3e6012..dbac3906a 100644
--- a/src/views/nodes/FieldTextBox.tsx
+++ b/src/views/nodes/FieldTextBox.tsx
@@ -1,14 +1,21 @@
-import { Key } from "../../fields/Key";
+import { Key, KeyStore } from "../../fields/Key";
 import { Document } from "../../fields/Document";
 import { observer } from "mobx-react";
 import { TextField } from "../../fields/TextField";
 import React = require("react")
-import { action, observable } from "mobx";
+import { action, observable, reaction, IReactionDisposer } from "mobx";
+
+import {schema} from "prosemirror-schema-basic";
+import {EditorState, Transaction} from "prosemirror-state"
+import {EditorView} from "prosemirror-view"
+import {keymap} from "prosemirror-keymap"
+import {baseKeymap} from "prosemirror-commands"
+import {undo, redo, history} from "prosemirror-history"
+import { Opt } from "../../fields/Field";
 
 interface IProps {
     fieldKey:Key;
     doc:Document;
-    test:string;
 }
 
 // FieldTextBox: Displays an editable plain text node that maps to a specified Key of a Document
@@ -28,13 +35,76 @@ interface IProps {
 //  this will edit the document and assign the new value to that field.
 //
 @observer
-export class FieldTextBox extends React.Component<IProps, IProps> {
+export class FieldTextBox extends React.Component<IProps> {
+    private _ref: React.RefObject<HTMLDivElement>;
+    private _editorView: Opt<EditorView>;
+    private _reactionDisposer: Opt<IReactionDisposer>;
 
     constructor(props:IProps) {
         super(props);
+
+        this._ref = React.createRef();
+
         this.onChange = this.onChange.bind(this);
     }
 
+    dispatchTransaction = (tx: Transaction) => {
+        if(this._editorView) {
+            const state = this._editorView.state.apply(tx);
+            this._editorView.updateState(state);
+            const {doc, fieldKey} = this.props;
+            doc.SetFieldValue(fieldKey, JSON.stringify(state.toJSON()), TextField);
+        }
+    }
+
+    componentDidMount() {
+        let state:EditorState;
+        const {doc, fieldKey} = this.props;
+        const config = {
+            schema,
+            plugins: [
+                history(),
+                keymap({"Mod-z": undo, "Mod-y": redo}),
+                keymap(baseKeymap)
+            ]
+        };
+
+        let field = doc.GetFieldT(fieldKey, TextField);
+        if(field) {
+            state = EditorState.fromJSON(config, JSON.parse(field.Data));
+        } else {
+            state = EditorState.create(config);
+        }
+        if(this._ref.current) {
+            this._editorView = new EditorView(this._ref.current, {
+                state,
+                dispatchTransaction: this.dispatchTransaction
+            });
+        }
+
+        this._reactionDisposer = reaction(() => {
+            const field = this.props.doc.GetFieldT(this.props.fieldKey, TextField);
+            return field ? field.Data : undefined;
+        }, (field) => {
+            if(field && this._editorView) {
+                this._editorView.updateState(EditorState.fromJSON(config, JSON.parse(field)));
+            }
+        })
+    }
+
+    componentWillUnmount() {
+        if(this._editorView) {
+            this._editorView.destroy();
+        }
+        if(this._reactionDisposer) {
+            this._reactionDisposer();
+        }
+    }
+
+    shouldComponentUpdate() {
+        return false;
+    }
+
     @action
     onChange(e: React.ChangeEvent<HTMLInputElement>) {
         const {fieldKey, doc} = this.props;
@@ -42,8 +112,6 @@ export class FieldTextBox extends React.Component<IProps, IProps> {
     }
 
     render() {
-        const {fieldKey, doc} = this.props;
-        const value = doc.GetFieldValue(fieldKey, TextField, String(""));
-        return (<input value={value} onChange={this.onChange} />)
+        return (<div ref={this._ref} />)
     }
 }
\ No newline at end of file