From 96001ff5b299326de8742a6540acd5017d0f751a Mon Sep 17 00:00:00 2001 From: anika-ahluwalia Date: Thu, 2 Jul 2020 10:40:17 -0500 Subject: started link created popup, tried hihglighting source --- src/client/documents/Documents.ts | 9 ++++++++- 1 file changed, 8 insertions(+), 1 deletion(-) (limited to 'src/client/documents') diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts index 85da621e0..2e0323ede 100644 --- a/src/client/documents/Documents.ts +++ b/src/client/documents/Documents.ts @@ -1,4 +1,4 @@ -import { runInAction } from "mobx"; +import { runInAction, action } from "mobx"; import { extname, basename } from "path"; import { DateField } from "../../fields/DateField"; import { Doc, DocListCast, DocListCastAsync, Field, HeightSym, Opt, WidthSym } from "../../fields/Doc"; @@ -50,6 +50,7 @@ import { DashWebRTCVideo } from "../views/webcam/DashWebRTCVideo"; import { DocumentType } from "./DocumentTypes"; import { Networking } from "../Network"; import { Upload } from "../../server/SharedMediaTypes"; +import { MainView } from "../views/MainView"; const path = require('path'); export interface DocumentOptions { @@ -866,6 +867,7 @@ export namespace DocUtils { export function MakeLinkToActiveAudio(doc: Doc) { DocUtils.ActiveRecordings.map(d => DocUtils.MakeLink({ doc: doc }, { doc: d }, "audio link", "audio timeline")); } + export function MakeLink(source: { doc: Doc }, target: { doc: Doc }, linkRelationship: string = "", id?: string) { const sv = DocumentManager.Instance.getDocumentView(source.doc); if (sv && sv.props.ContainingCollectionDoc === target.doc) return; @@ -877,6 +879,11 @@ export namespace DocUtils { Doc.GetProto(source.doc).links = ComputedField.MakeFunction("links(self)"); Doc.GetProto(target.doc).links = ComputedField.MakeFunction("links(self)"); + + runInAction(() => { MainView.linkCreated = true; }); + console.log("link created"); + runInAction(() => { setTimeout("MainView.changeLinkCreated()", 2000); }); + return linkDoc; } -- cgit v1.2.3-70-g09d2 From 37392f606d29547bed46ffcd0f0190ad38f51148 Mon Sep 17 00:00:00 2001 From: anika-ahluwalia Date: Fri, 3 Jul 2020 01:06:18 -0500 Subject: link created popup --- src/client/documents/Documents.ts | 8 ++++---- src/client/views/MainView.tsx | 23 +++++++++++++--------- .../collectionFreeForm/CollectionFreeFormView.tsx | 5 +++++ src/client/views/linking/LinkMenu.scss | 9 ++++----- src/client/views/linking/LinkMenu.tsx | 4 ++++ src/client/views/linking/LinkMenuItem.tsx | 11 ++++++++--- src/client/views/nodes/DocumentLinksButton.tsx | 14 +++++++++++-- src/fields/Doc.ts | 4 ++-- 8 files changed, 53 insertions(+), 25 deletions(-) (limited to 'src/client/documents') diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts index 2e0323ede..0f434d616 100644 --- a/src/client/documents/Documents.ts +++ b/src/client/documents/Documents.ts @@ -868,6 +868,10 @@ export namespace DocUtils { DocUtils.ActiveRecordings.map(d => DocUtils.MakeLink({ doc: doc }, { doc: d }, "audio link", "audio timeline")); } + function stopLinkCreated() { + MainView.linkCreated = false; + } + export function MakeLink(source: { doc: Doc }, target: { doc: Doc }, linkRelationship: string = "", id?: string) { const sv = DocumentManager.Instance.getDocumentView(source.doc); if (sv && sv.props.ContainingCollectionDoc === target.doc) return; @@ -880,10 +884,6 @@ export namespace DocUtils { Doc.GetProto(source.doc).links = ComputedField.MakeFunction("links(self)"); Doc.GetProto(target.doc).links = ComputedField.MakeFunction("links(self)"); - runInAction(() => { MainView.linkCreated = true; }); - console.log("link created"); - runInAction(() => { setTimeout("MainView.changeLinkCreated()", 2000); }); - return linkDoc; } diff --git a/src/client/views/MainView.tsx b/src/client/views/MainView.tsx index 4898e114a..617cc19b1 100644 --- a/src/client/views/MainView.tsx +++ b/src/client/views/MainView.tsx @@ -84,6 +84,8 @@ export class MainView extends React.Component { public isPointerDown = false; @observable public static linkCreated: boolean = false; + @observable public static popupX: number = 600; + @observable public static popupY: number = 250; componentDidMount() { @@ -614,15 +616,18 @@ export class MainView extends React.Component { {this.mainContent} - {MainView.linkCreated ?
- {/* */} - link created! - {/* */} -
: null} + + +
Link Created
+
+ {DocumentLinksButton.EditLink ? : (null)} {LinkDocPreview.LinkInfo ? { MainView.linkCreated = true; }); + runInAction(() => { setTimeout(function () { runInAction(() => MainView.linkCreated = false); }, 2500); }); linkDragData.linkDocument = DocUtils.MakeLink({ doc: source }, { doc: linkDragData.linkSourceDocument }, "doc annotation"); // TODODO this is where in text links get passed e.stopPropagation(); return true; diff --git a/src/client/views/linking/LinkMenu.scss b/src/client/views/linking/LinkMenu.scss index c372e7098..6468ccd3d 100644 --- a/src/client/views/linking/LinkMenu.scss +++ b/src/client/views/linking/LinkMenu.scss @@ -15,7 +15,7 @@ } .linkMenu-group { - border-bottom: 0.5px solid lightgray; + border-bottom: 0.5px solid lightgray; padding: 5px 0; @@ -30,9 +30,11 @@ p { background-color: lightgray; } + p.expand-one { width: calc(100% - 26px); } + .linkEditor-tableButton { display: block; } @@ -50,7 +52,4 @@ display: none; } } -} - - - +} \ No newline at end of file diff --git a/src/client/views/linking/LinkMenu.tsx b/src/client/views/linking/LinkMenu.tsx index c36e7b67c..c672511ac 100644 --- a/src/client/views/linking/LinkMenu.tsx +++ b/src/client/views/linking/LinkMenu.tsx @@ -10,6 +10,7 @@ import { LinkMenuGroup } from "./LinkMenuGroup"; import { faTrash } from '@fortawesome/free-solid-svg-icons'; import { library } from "@fortawesome/fontawesome-svg-core"; import { DocumentLinksButton } from "../nodes/DocumentLinksButton"; +import { LinkDocPreview } from "../nodes/LinkDocPreview"; library.add(faTrash); @@ -28,6 +29,9 @@ export class LinkMenu extends React.Component { @action onClick = (e: PointerEvent) => { + + LinkDocPreview.LinkInfo = undefined; + if (this._linkMenuRef?.contains(e.target as any)) { DocumentLinksButton.EditLink = undefined; } diff --git a/src/client/views/linking/LinkMenuItem.tsx b/src/client/views/linking/LinkMenuItem.tsx index 54dca261d..b11a173f3 100644 --- a/src/client/views/linking/LinkMenuItem.tsx +++ b/src/client/views/linking/LinkMenuItem.tsx @@ -97,6 +97,7 @@ export class LinkMenuItem extends React.Component { return (
{mdRows}
); } + @action onLinkButtonDown = (e: React.PointerEvent): void => { this._downX = e.clientX; this._downY = e.clientY; @@ -106,6 +107,10 @@ export class LinkMenuItem extends React.Component { document.addEventListener("pointermove", this.onLinkButtonMoved); document.removeEventListener("pointerup", this.onLinkButtonUp); document.addEventListener("pointerup", this.onLinkButtonUp); + + //if (this._editRef && this._editRef.current?.contains(e.target as any)) { + LinkDocPreview.LinkInfo = undefined; + //} } onLinkButtonUp = (e: PointerEvent): void => { @@ -168,14 +173,14 @@ export class LinkMenuItem extends React.Component { }))} onPointerDown={this.onLinkButtonDown}>

{StrCast(this.props.destinationDoc.title)}

-
+
{canExpand ?
this.toggleShowMore(e)}>
: <>} {/*
*/} -
+
-
this.followDefault()} onContextMenu={this.onContextMenu}> +
diff --git a/src/client/views/nodes/DocumentLinksButton.tsx b/src/client/views/nodes/DocumentLinksButton.tsx index d67a01d8b..95c2988da 100644 --- a/src/client/views/nodes/DocumentLinksButton.tsx +++ b/src/client/views/nodes/DocumentLinksButton.tsx @@ -77,6 +77,7 @@ export class DocumentLinksButton extends React.Component { setupMoveUpEvents(this, e, returnFalse, emptyFunction, action((e, doubleTap) => { if (doubleTap) { @@ -88,12 +89,17 @@ export class DocumentLinksButton extends React.Component { MainView.linkCreated = true; }); + runInAction(() => { setTimeout(function () { runInAction(() => MainView.linkCreated = false); }, 2500); }); + MainView.popupX = e.screenX; + MainView.popupY = e.screenY; } } })); } - finishLinkClick = () => { + @action + finishLinkClick = (e: React.MouseEvent) => { if (DocumentLinksButton.StartLink === this.props.View) { DocumentLinksButton.StartLink = undefined; // action((e: React.PointerEvent) => { @@ -102,6 +108,10 @@ export class DocumentLinksButton extends React.Component { MainView.linkCreated = true; }); + runInAction(() => { setTimeout(function () { runInAction(() => MainView.linkCreated = false); }, 2500); }); + MainView.popupX = e.screenX; + MainView.popupY = e.screenY; } } @@ -131,7 +141,7 @@ export class DocumentLinksButton extends React.Component {DocumentLinksButton.StartLink && DocumentLinksButton.StartLink !== this.props.View ?
: (null)} + onPointerDown={this.completeLink} onClick={e => this.finishLinkClick(e)} /> : (null)} {DocumentLinksButton.StartLink === this.props.View ?
: (null)}
; diff --git a/src/fields/Doc.ts b/src/fields/Doc.ts index b4bb556c7..7aa1d528d 100644 --- a/src/fields/Doc.ts +++ b/src/fields/Doc.ts @@ -832,14 +832,14 @@ export namespace Doc { })(doc); } export function BrushDoc(doc: Doc) { - console.log("brushed"); + if (!doc || doc[AclSym] === AclPrivate || Doc.GetProto(doc)[AclSym] === AclPrivate) return doc; brushManager.BrushedDoc.set(doc, true); brushManager.BrushedDoc.set(Doc.GetProto(doc), true); return doc; } export function UnBrushDoc(doc: Doc) { - console.log("unbrushed"); + if (!doc || doc[AclSym] === AclPrivate || Doc.GetProto(doc)[AclSym] === AclPrivate) return doc; brushManager.BrushedDoc.delete(doc); brushManager.BrushedDoc.delete(Doc.GetProto(doc)); -- cgit v1.2.3-70-g09d2 From ed74b8b6d6c65a24803c4e0e68aa192a750d60fa Mon Sep 17 00:00:00 2001 From: anika-ahluwalia Date: Fri, 3 Jul 2020 18:47:48 -0500 Subject: restructure --- src/client/documents/Documents.ts | 5 ---- src/client/views/MainView.tsx | 27 ++--------------- .../views/collections/CollectionLinearView.scss | 34 ++++++++++++++++++---- .../views/collections/CollectionLinearView.tsx | 32 ++++---------------- src/client/views/linking/LinkMenuItem.scss | 34 ++++++++++++---------- src/client/views/nodes/DocumentLinksButton.tsx | 24 +++++++++------ src/client/views/nodes/DocumentView.tsx | 22 ++++++++------ src/client/views/nodes/LinkCreatedBox.scss | 21 +++++++++++++ src/client/views/nodes/LinkCreatedBox.tsx | 31 ++++++++++++++++++++ 9 files changed, 134 insertions(+), 96 deletions(-) create mode 100644 src/client/views/nodes/LinkCreatedBox.scss create mode 100644 src/client/views/nodes/LinkCreatedBox.tsx (limited to 'src/client/documents') diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts index 0f434d616..f81c25bab 100644 --- a/src/client/documents/Documents.ts +++ b/src/client/documents/Documents.ts @@ -50,7 +50,6 @@ import { DashWebRTCVideo } from "../views/webcam/DashWebRTCVideo"; import { DocumentType } from "./DocumentTypes"; import { Networking } from "../Network"; import { Upload } from "../../server/SharedMediaTypes"; -import { MainView } from "../views/MainView"; const path = require('path'); export interface DocumentOptions { @@ -868,10 +867,6 @@ export namespace DocUtils { DocUtils.ActiveRecordings.map(d => DocUtils.MakeLink({ doc: doc }, { doc: d }, "audio link", "audio timeline")); } - function stopLinkCreated() { - MainView.linkCreated = false; - } - export function MakeLink(source: { doc: Doc }, target: { doc: Doc }, linkRelationship: string = "", id?: string) { const sv = DocumentManager.Instance.getDocumentView(source.doc); if (sv && sv.props.ContainingCollectionDoc === target.doc) return; diff --git a/src/client/views/MainView.tsx b/src/client/views/MainView.tsx index 3d47d09c8..15f818d1f 100644 --- a/src/client/views/MainView.tsx +++ b/src/client/views/MainView.tsx @@ -60,6 +60,7 @@ import { DocumentLinksButton } from './nodes/DocumentLinksButton'; import { LinkMenu } from './linking/LinkMenu'; import { LinkDocPreview } from './nodes/LinkDocPreview'; import { Fade } from '@material-ui/core'; +import { LinkCreatedBox } from './nodes/LinkCreatedBox'; @observer export class MainView extends React.Component { @@ -83,11 +84,6 @@ export class MainView extends React.Component { public isPointerDown = false; - @observable public static linkCreated: boolean = false; - @observable public static popupX: number = 600; - @observable public static popupY: number = 250; - - componentDidMount() { DocServer.setPlaygroundFields(["dataTransition", "_viewTransition", "_panX", "_panY", "_viewScale", "_viewType"]); // can play with these fields on someone else's @@ -367,11 +363,6 @@ export class MainView extends React.Component { } } - @action - public static changeLinkCreated = () => { - MainView.linkCreated = !MainView.linkCreated; - } - @action onPointerMove = (e: PointerEvent) => { this.flyoutWidth = Math.max(e.clientX, 0); @@ -616,21 +607,7 @@ export class MainView extends React.Component { {this.mainContent} - - -
Link Created
-
- + {DocumentLinksButton.EditLink ? : (null)} {LinkDocPreview.LinkInfo ? span { - //margin-top: 8px; - //margin-left: 4px; - //margin-bottom: 2px; background: $dark-color; color: $light-color; - //display: inline-block; border-radius: 18px; margin-right: 6px; - //height: 100%; cursor: pointer; } + .bottomPopup-background { + padding-right: 14px; + height: 35; + transform: translate3d(6px, 5px, 0px); + padding-top: 6.5px; + padding-bottom: 7px; + padding-left: 5px; + } + + .bottomPopup-text { + display: inline; + white-space: nowrap; + padding-left: 8px; + padding-right: 4px; + vertical-align: middle; + font-size: 12.5px; + } + + .bottomPopup-exit { + display: inline; + white-space: nowrap; + padding-left: 8px; + padding-right: 8px; + vertical-align: middle; + background-color: lightgrey; + border-radius: 5.5px; + color: black; + } + >label { margin-top: "auto"; margin-bottom: "auto"; diff --git a/src/client/views/collections/CollectionLinearView.tsx b/src/client/views/collections/CollectionLinearView.tsx index 7635dac24..7cbe5c19d 100644 --- a/src/client/views/collections/CollectionLinearView.tsx +++ b/src/client/views/collections/CollectionLinearView.tsx @@ -149,36 +149,14 @@ export class CollectionLinearView extends CollectionSubView(LinearDocument) {
; })}
- {DocumentLinksButton.StartLink ? e.stopPropagation()} > - + Creating link from: {DocumentLinksButton.StartLink.title} - Exit + Exit {/* */} diff --git a/src/client/views/linking/LinkMenuItem.scss b/src/client/views/linking/LinkMenuItem.scss index c5becae7d..e3ce69cd7 100644 --- a/src/client/views/linking/LinkMenuItem.scss +++ b/src/client/views/linking/LinkMenuItem.scss @@ -31,21 +31,23 @@ font-size: 10.5px; } - // &:hover { - // .linkMenu-item-buttons { - // display: flex; - // } - // .linkMenu-item-content { - // &.expand-two p { - // width: calc(100% - 52px); - // background-color: lightgray; - // } - // &.expand-three p { - // width: calc(100% - 84px); - // background-color: lightgray; - // } - // } - // } + &:hover { + .linkMenu-item-buttons { + display: flex; + } + + .linkMenu-item-content { + &.expand-two p { + width: calc(100% - 52px); + background-color: lightgray; + } + + &.expand-three p { + width: calc(100% - 84px); + background-color: lightgray; + } + } + } } .linkMenu-item-buttons { @@ -53,7 +55,7 @@ top: 50%; right: 0; transform: translateY(-50%); - display: flex; + display: none; .button { width: 20px; diff --git a/src/client/views/nodes/DocumentLinksButton.tsx b/src/client/views/nodes/DocumentLinksButton.tsx index 6a6624aa0..bfd860f65 100644 --- a/src/client/views/nodes/DocumentLinksButton.tsx +++ b/src/client/views/nodes/DocumentLinksButton.tsx @@ -10,7 +10,7 @@ import React = require("react"); import { DocUtils } from "../../documents/Documents"; import { FontAwesomeIcon } from "@fortawesome/react-fontawesome"; import { LinkDocPreview } from "./LinkDocPreview"; -import { MainView } from "../MainView"; +import { LinkCreatedBox } from "./LinkCreatedBox"; const higflyout = require("@hig/flyout"); export const { anchorPoints } = higflyout; export const Flyout = higflyout.default; @@ -89,10 +89,13 @@ export class DocumentLinksButton extends React.Component { MainView.linkCreated = true; }); - runInAction(() => { setTimeout(function () { runInAction(() => MainView.linkCreated = false); }, 2500); }); - MainView.popupX = e.screenX; - MainView.popupY = e.screenY; + + runInAction(() => { + LinkCreatedBox.popupX = e.screenX; + LinkCreatedBox.popupY = e.screenY - 120; + LinkCreatedBox.linkCreated = true; + setTimeout(action(() => { LinkCreatedBox.linkCreated = false; }), 2500); + }); } } })); @@ -108,10 +111,13 @@ export class DocumentLinksButton extends React.Component { MainView.linkCreated = true; }); - runInAction(() => { setTimeout(function () { runInAction(() => MainView.linkCreated = false); }, 2000); }); - MainView.popupX = e.screenX - 25; - MainView.popupY = e.screenY - 140; + + runInAction(() => { + LinkCreatedBox.popupX = e.screenX; + LinkCreatedBox.popupY = e.screenY - 120; + LinkCreatedBox.linkCreated = true; + setTimeout(action(() => { LinkCreatedBox.linkCreated = false; }), 2500); + }); } } diff --git a/src/client/views/nodes/DocumentView.tsx b/src/client/views/nodes/DocumentView.tsx index 3a9e4fcf0..b38db9a1e 100644 --- a/src/client/views/nodes/DocumentView.tsx +++ b/src/client/views/nodes/DocumentView.tsx @@ -42,7 +42,7 @@ import { RadialMenu } from './RadialMenu'; import React = require("react"); import { DocumentLinksButton } from './DocumentLinksButton'; import { MobileInterface } from '../../../mobile/MobileInterface'; -import { MainView } from '../MainView'; +import { LinkCreatedBox } from './LinkCreatedBox'; library.add(fa.faEdit, fa.faTrash, fa.faShare, fa.faDownload, fa.faExpandArrowsAlt, fa.faCompressArrowsAlt, fa.faLayerGroup, fa.faExternalLinkAlt, fa.faAlignCenter, fa.faCaretSquareRight, fa.faSquare, fa.faConciergeBell, fa.faWindowRestore, fa.faFolder, fa.faMapPin, fa.faLink, fa.faFingerprint, fa.faCrosshairs, fa.faDesktop, fa.faUnlock, fa.faLock, fa.faLaptopCode, fa.faMale, @@ -642,10 +642,12 @@ export class DocumentView extends DocComponent(Docu e.stopPropagation(); de.complete.annoDragData.linkedToDoc = true; - runInAction(() => MainView.popupX = de.x); - runInAction(() => MainView.popupY = de.y); - runInAction(() => { MainView.linkCreated = true; }); - runInAction(() => { setTimeout(function () { runInAction(() => MainView.linkCreated = false); }, 2500); }); + runInAction(() => { + LinkCreatedBox.popupX = de.x; + LinkCreatedBox.popupY = de.y; + LinkCreatedBox.linkCreated = true; + setTimeout(action(() => { LinkCreatedBox.linkCreated = false; }), 2500); + }); DocUtils.MakeLink({ doc: de.complete.annoDragData.annotationDocument }, { doc: this.props.Document }, "link"); } @@ -653,11 +655,13 @@ export class DocumentView extends DocComponent(Docu e.stopPropagation(); // const docs = await SearchUtil.Search(`data_l:"${destDoc[Id]}"`, true); // const views = docs.map(d => DocumentManager.Instance.getDocumentView(d)).filter(d => d).map(d => d as DocumentView); - runInAction(() => MainView.popupX = de.x); - runInAction(() => MainView.popupY = de.y); - runInAction(() => { MainView.linkCreated = true; }); - runInAction(() => { setTimeout(function () { runInAction(() => MainView.linkCreated = false); }, 2000); }); + runInAction(() => { + LinkCreatedBox.popupX = de.x; + LinkCreatedBox.popupY = de.y; + LinkCreatedBox.linkCreated = true; + setTimeout(action(() => { LinkCreatedBox.linkCreated = false; }), 2500); + }); de.complete.linkDragData.linkSourceDocument !== this.props.Document && (de.complete.linkDragData.linkDocument = DocUtils.MakeLink({ doc: de.complete.linkDragData.linkSourceDocument }, diff --git a/src/client/views/nodes/LinkCreatedBox.scss b/src/client/views/nodes/LinkCreatedBox.scss new file mode 100644 index 000000000..3cbd38b55 --- /dev/null +++ b/src/client/views/nodes/LinkCreatedBox.scss @@ -0,0 +1,21 @@ +.linkCreatedBox-fade { + border: 1px solid rgb(100, 100, 100); + + + width: auto; + position: absolute; + + height: auto; + z-index: 10000; + border-radius: 13px; + font-size: 13px; + white-space: nowrap; + + color: rgb(100, 100, 100); + background-color: rgba(250, 250, 250, 0.85); + padding-top: 6.5px; + padding-bottom: 6.5px; + font-weight: bold; + padding-left: 9px; + padding-right: 9px; +} \ No newline at end of file diff --git a/src/client/views/nodes/LinkCreatedBox.tsx b/src/client/views/nodes/LinkCreatedBox.tsx new file mode 100644 index 000000000..d157d3fca --- /dev/null +++ b/src/client/views/nodes/LinkCreatedBox.tsx @@ -0,0 +1,31 @@ +import React = require("react"); +import { observer } from "mobx-react"; +import { documentSchema } from "../../../fields/documentSchemas"; +import { makeInterface } from "../../../fields/Schema"; +import "./LinkCreatedBox.scss"; +import { observable, action } from "mobx"; +import { Fade } from "@material-ui/core"; + + +@observer +export class LinkCreatedBox extends React.Component<{}> { + + @observable public static linkCreated: boolean = false; + @observable public static popupX: number = 600; + @observable public static popupY: number = 250; + + @action + public static changeLinkCreated = () => { + LinkCreatedBox.linkCreated = !LinkCreatedBox.linkCreated; + } + + render() { + return +
Link Created
+
; + } +} \ No newline at end of file -- cgit v1.2.3-70-g09d2 From 8264ac5484c0c7b5d47cb78ce60f5d6568e736d9 Mon Sep 17 00:00:00 2001 From: anika-ahluwalia Date: Sat, 4 Jul 2020 17:25:10 -0500 Subject: redesigned editing menu, added link descriptions and popup on created --- src/client/documents/Documents.ts | 9 +-- src/client/util/LinkManager.ts | 6 +- src/client/views/EditableView.tsx | 6 +- src/client/views/GestureOverlay.tsx | 2 +- src/client/views/MainView.tsx | 2 + src/client/views/RecommendationsBox.tsx | 2 +- .../views/collections/CollectionTreeView.tsx | 2 +- src/client/views/collections/CollectionView.tsx | 2 +- .../collectionFreeForm/CollectionFreeFormView.tsx | 2 +- .../collections/collectionFreeForm/MarqueeView.tsx | 2 +- src/client/views/linking/LinkEditor.scss | 48 ++++++++++++--- src/client/views/linking/LinkEditor.tsx | 59 +++++++++++++++--- src/client/views/linking/LinkMenu.scss | 13 +++- src/client/views/linking/LinkMenu.tsx | 15 +++-- src/client/views/linking/LinkMenuGroup.tsx | 6 +- src/client/views/linking/LinkMenuItem.scss | 48 ++++++++++++--- src/client/views/linking/LinkMenuItem.tsx | 23 ++++--- src/client/views/nodes/DocumentLinksButton.tsx | 52 ++++++++++------ src/client/views/nodes/DocumentView.tsx | 42 +++++++++---- src/client/views/nodes/LinkCreatedBox.tsx | 8 +-- src/client/views/nodes/LinkDescriptionPopup.scss | 62 +++++++++++++++++++ src/client/views/nodes/LinkDescriptionPopup.tsx | 70 ++++++++++++++++++++++ 22 files changed, 393 insertions(+), 88 deletions(-) create mode 100644 src/client/views/nodes/LinkDescriptionPopup.scss create mode 100644 src/client/views/nodes/LinkDescriptionPopup.tsx (limited to 'src/client/documents') diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts index f81c25bab..11b80aef9 100644 --- a/src/client/documents/Documents.ts +++ b/src/client/documents/Documents.ts @@ -94,6 +94,7 @@ export interface DocumentOptions { label?: string; // short form of title for use as an icon label style?: string; page?: number; + description?: string; // added for links _viewScale?: number; isDisplayPanel?: boolean; // whether the panel functions as GoldenLayout "stack" used to display documents forceActive?: boolean; @@ -259,7 +260,7 @@ export namespace Docs { }], [DocumentType.LINK, { layout: { view: LinkBox, dataField: defaultDataKey }, - options: { _height: 150 } + options: { _height: 150, description: "" } }], [DocumentType.LINKDB, { data: new List(), @@ -864,15 +865,15 @@ export namespace DocUtils { export let ActiveRecordings: Doc[] = []; export function MakeLinkToActiveAudio(doc: Doc) { - DocUtils.ActiveRecordings.map(d => DocUtils.MakeLink({ doc: doc }, { doc: d }, "audio link", "audio timeline")); + DocUtils.ActiveRecordings.map(d => DocUtils.MakeLink({ doc: doc }, { doc: d }, "audio link", "", "audio timeline")); } - export function MakeLink(source: { doc: Doc }, target: { doc: Doc }, linkRelationship: string = "", id?: string) { + export function MakeLink(source: { doc: Doc }, target: { doc: Doc }, linkRelationship: string = "", description: string = "", id?: string) { const sv = DocumentManager.Instance.getDocumentView(source.doc); if (sv && sv.props.ContainingCollectionDoc === target.doc) return; if (target.doc === Doc.UserDoc()) return undefined; - const linkDoc = Docs.Create.LinkDocument(source, target, { linkRelationship, layoutKey: "layout_linkView" }, id); + const linkDoc = Docs.Create.LinkDocument(source, target, { linkRelationship, layoutKey: "layout_linkView", description }, id); linkDoc.layout_linkView = Cast(Cast(Doc.UserDoc()["template-button-link"], Doc, null).dragFactory, Doc, null); Doc.GetProto(linkDoc).title = ComputedField.MakeFunction('self.anchor1?.title +" (" + (self.linkRelationship||"to") +") " + self.anchor2?.title'); diff --git a/src/client/util/LinkManager.ts b/src/client/util/LinkManager.ts index 749fabfcc..6da581f35 100644 --- a/src/client/util/LinkManager.ts +++ b/src/client/util/LinkManager.ts @@ -1,4 +1,4 @@ -import { Doc, DocListCast } from "../../fields/Doc"; +import { Doc, DocListCast, Opt } from "../../fields/Doc"; import { List } from "../../fields/List"; import { listSpec } from "../../fields/Schema"; import { Cast, StrCast } from "../../fields/Types"; @@ -23,6 +23,10 @@ import { Scripting } from "./Scripting"; export class LinkManager { private static _instance: LinkManager; + + + public static currentLink: Opt; + public static get Instance(): LinkManager { return this._instance || (this._instance = new this()); } diff --git a/src/client/views/EditableView.tsx b/src/client/views/EditableView.tsx index 628db366f..25a87ab56 100644 --- a/src/client/views/EditableView.tsx +++ b/src/client/views/EditableView.tsx @@ -194,7 +194,11 @@ export class EditableView extends React.Component { ref={this._ref} style={{ display: this.props.display, minHeight: "20px", height: `${this.props.height ? this.props.height : "auto"}`, maxHeight: `${this.props.maxHeight}` }} onClick={this.onClick} placeholder={this.props.placeholder}> - {this.props.contents ? this.props.contents?.valueOf() : this.props.placeholder?.valueOf()} + + {this.props.contents ? this.props.contents?.valueOf() : this.props.placeholder?.valueOf()}
); } diff --git a/src/client/views/GestureOverlay.tsx b/src/client/views/GestureOverlay.tsx index 487467b2b..cdc468066 100644 --- a/src/client/views/GestureOverlay.tsx +++ b/src/client/views/GestureOverlay.tsx @@ -551,7 +551,7 @@ export default class GestureOverlay extends Touchable { else if (this._d1 !== doc && !LinkManager.Instance.doesLinkExist(this._d1, doc)) { // we don't want to create a link between ink strokes (doing so makes drawing a t very hard) if (this._d1.type !== "ink" && doc.type !== "ink") { - DocUtils.MakeLink({ doc: this._d1 }, { doc: doc }, "gestural link"); + DocUtils.MakeLink({ doc: this._d1 }, { doc: doc }, "gestural link", ""); actionPerformed = true; } } diff --git a/src/client/views/MainView.tsx b/src/client/views/MainView.tsx index 15f818d1f..68ea51456 100644 --- a/src/client/views/MainView.tsx +++ b/src/client/views/MainView.tsx @@ -61,6 +61,7 @@ import { LinkMenu } from './linking/LinkMenu'; import { LinkDocPreview } from './nodes/LinkDocPreview'; import { Fade } from '@material-ui/core'; import { LinkCreatedBox } from './nodes/LinkCreatedBox'; +import { LinkDescriptionPopup } from './nodes/LinkDescriptionPopup'; @observer export class MainView extends React.Component { @@ -608,6 +609,7 @@ export class MainView extends React.Component { + {LinkDescriptionPopup.descriptionPopup ? : null} {DocumentLinksButton.EditLink ? : (null)} {LinkDocPreview.LinkInfo ? {
DocumentManager.Instance.jumpToDocument(doc, false)}>
-
DocUtils.MakeLink({ doc: this.props.Document.sourceDoc as Doc }, { doc: doc }, "Recommender", undefined)}> +
DocUtils.MakeLink({ doc: this.props.Document.sourceDoc as Doc }, { doc: doc }, "Recommender", "", undefined)}>
diff --git a/src/client/views/collections/CollectionTreeView.tsx b/src/client/views/collections/CollectionTreeView.tsx index 620b977fa..26c41f524 100644 --- a/src/client/views/collections/CollectionTreeView.tsx +++ b/src/client/views/collections/CollectionTreeView.tsx @@ -207,7 +207,7 @@ class TreeView extends React.Component { if (complete.linkDragData) { const sourceDoc = complete.linkDragData.linkSourceDocument; const destDoc = this.doc; - DocUtils.MakeLink({ doc: sourceDoc }, { doc: destDoc }, "tree link"); + DocUtils.MakeLink({ doc: sourceDoc }, { doc: destDoc }, "tree link", ""); e.stopPropagation(); } const docDragData = complete.docDragData; diff --git a/src/client/views/collections/CollectionView.tsx b/src/client/views/collections/CollectionView.tsx index 26abd2529..df21d6a28 100644 --- a/src/client/views/collections/CollectionView.tsx +++ b/src/client/views/collections/CollectionView.tsx @@ -147,7 +147,7 @@ export class CollectionView extends Touchable d instanceof Doc); first && (first.hidden = true); pushpinLink && (Doc.GetProto(pushpinLink).isPushpin = true); diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx index b81e400b3..9bf425db2 100644 --- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx +++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx @@ -246,7 +246,7 @@ export class CollectionFreeFormView extends CollectionSubView { + + @observable description = StrCast(LinkManager.currentLink?.description); + + //@observable description = this.props.linkDoc.description ? StrCast(this.props.linkDoc.description) : "DESCRIPTION"; + @action deleteLink = (): void => { LinkManager.Instance.deleteLink(this.props.linkDoc); this.props.showLinks(); } + @action + setDescripValue = (value: string) => { + if (LinkManager.currentLink) { + LinkManager.currentLink.description = value; + return true; + } + } + + @computed + get editDescription() { + return
+
+ Link Description:
+
+ StrCast(LinkManager.currentLink?.description)} + SetValue={value => { this.setDescripValue(value); return false; }} + contents={LinkManager.currentLink?.description} + placeholder={"(optional) enter link description"} + color={"rgb(88, 88, 88)"} + >
; + } + + @computed + get followingDropdown() { + return "choose follow behavior"; + } + render() { const destination = LinkManager.Instance.getOppositeAnchor(this.props.linkDoc, this.props.sourceDoc); const groups = [this.props.linkDoc].map(groupDoc => { - return ; + return ; }); return !destination ? (null) : (
- {this.props.hideback ? (null) : }
-

editing link to: {destination.proto?.title ?? destination.title ?? "untitled"}

- + {this.props.hideback ? (null) : } +

editing link to: { + destination.proto?.title ?? destination.title ?? "untitled"}

+
- {groups.length > 0 ? groups :
There are currently no relationships associated with this link.
} + +
{this.editDescription}
+
{this.followingDropdown}
+ + {/* {groups.length > 0 ? groups :
There are currently no relationships associated with this link.
} */}
); diff --git a/src/client/views/linking/LinkMenu.scss b/src/client/views/linking/LinkMenu.scss index 6468ccd3d..f827f25c2 100644 --- a/src/client/views/linking/LinkMenu.scss +++ b/src/client/views/linking/LinkMenu.scss @@ -11,12 +11,17 @@ position: absolute; z-index: 10; background: $link-color; - min-width: 150px + min-width: 150px; + border-radius: 5px; + padding-top: 6.5px; + padding-bottom: 6.5px; + padding-left: 6.5px; + padding-right: 2px; } .linkMenu-group { - border-bottom: 0.5px solid lightgray; - padding: 5px 0; + //border-bottom: 0.5px solid lightgray; + //@extend: 5px 0; &:last-child { @@ -26,9 +31,11 @@ .linkMenu-group-name { display: flex; + &:hover { p { background-color: lightgray; + } p.expand-one { diff --git a/src/client/views/linking/LinkMenu.tsx b/src/client/views/linking/LinkMenu.tsx index c672511ac..8721b9f3d 100644 --- a/src/client/views/linking/LinkMenu.tsx +++ b/src/client/views/linking/LinkMenu.tsx @@ -11,6 +11,7 @@ import { faTrash } from '@fortawesome/free-solid-svg-icons'; import { library } from "@fortawesome/fontawesome-svg-core"; import { DocumentLinksButton } from "../nodes/DocumentLinksButton"; import { LinkDocPreview } from "../nodes/LinkDocPreview"; +import { isUndefined } from "util"; library.add(faTrash); @@ -26,18 +27,19 @@ export class LinkMenu extends React.Component { @observable private _editingLink?: Doc; @observable private _linkMenuRef: Opt; + private _editorRef = React.createRef(); @action onClick = (e: PointerEvent) => { LinkDocPreview.LinkInfo = undefined; - if (this._linkMenuRef?.contains(e.target as any)) { - DocumentLinksButton.EditLink = undefined; - } - if (this._linkMenuRef && !this._linkMenuRef.contains(e.target as any)) { - DocumentLinksButton.EditLink = undefined; + if (this._linkMenuRef && !!!this._linkMenuRef.contains(e.target as any)) { + if (this._editorRef && !!!this._editorRef.current?.contains(e.target as any)) { + console.log("outside click"); + DocumentLinksButton.EditLink = undefined; + } } } @action @@ -82,7 +84,8 @@ export class LinkMenu extends React.Component { ref={(r) => this._linkMenuRef = r} style={{ left: this.props.location[0], top: this.props.location[1] }}> {!this._editingLink ? this.renderAllGroups(groups) : - this._editingLink = undefined)} /> + this._editingLink = undefined)} /> }
; } diff --git a/src/client/views/linking/LinkMenuGroup.tsx b/src/client/views/linking/LinkMenuGroup.tsx index 7892d381b..ec17776e3 100644 --- a/src/client/views/linking/LinkMenuGroup.tsx +++ b/src/client/views/linking/LinkMenuGroup.tsx @@ -26,6 +26,7 @@ export class LinkMenuGroup extends React.Component { private _drag = React.createRef(); private _table = React.createRef(); + private _menuRef = React.createRef(); onLinkButtonDown = (e: React.PointerEvent): void => { e.stopPropagation(); @@ -74,12 +75,13 @@ export class LinkMenuGroup extends React.Component { linkDoc={linkDoc} sourceDoc={this.props.sourceDoc} destinationDoc={destination} - showEditor={this.props.showEditor} />; + showEditor={this.props.showEditor} + menuRef={this._menuRef} />; } }); return ( -
+
{/*

{this.props.groupType}:

diff --git a/src/client/views/linking/LinkMenuItem.scss b/src/client/views/linking/LinkMenuItem.scss index e3ce69cd7..a71b2dbba 100644 --- a/src/client/views/linking/LinkMenuItem.scss +++ b/src/client/views/linking/LinkMenuItem.scss @@ -4,19 +4,38 @@ // border-top: 0.5px solid $main-accent; position: relative; display: flex; - font-size: 12px; .linkMenu-name { position: relative; - p { - padding: 4px 6px; - line-height: 12px; - border-radius: 5px; - overflow-wrap: break-word; - user-select: none; + .linkMenu-text { + + padding: 4px 2px; + + .linkMenu-destination-title { + text-decoration: none; + color: rgb(46, 82, 160); + font-size: 14px; + padding-bottom: 2px; + } + + .linkMenu-description { + text-decoration: none; + font-style: italic; + color: rgb(95, 97, 102); + font-size: 10px; + } + + p { + //padding: 4px 2px; + line-height: 12px; + border-radius: 5px; + overflow-wrap: break-word; + user-select: none; + } } + } .linkMenu-item-content { @@ -32,19 +51,30 @@ } &:hover { + .linkMenu-item-buttons { display: flex; } .linkMenu-item-content { + + .linkMenu-destination-title { + text-decoration: underline; + color: rgb(15, 57, 148); + } + &.expand-two p { width: calc(100% - 52px); - background-color: lightgray; + //text-decoration: underline; + //color: rgb(15, 57, 148); + //background-color: lightgray; } &.expand-three p { width: calc(100% - 84px); - background-color: lightgray; + //text-decoration: underline; + //color: rgb(15, 57, 148); + //background-color: lightgray; } } } diff --git a/src/client/views/linking/LinkMenuItem.tsx b/src/client/views/linking/LinkMenuItem.tsx index 04cd83ee0..891c6d263 100644 --- a/src/client/views/linking/LinkMenuItem.tsx +++ b/src/client/views/linking/LinkMenuItem.tsx @@ -26,6 +26,7 @@ interface LinkMenuItemProps { destinationDoc: Doc; showEditor: (linkDoc: Doc) => void; addDocTab: (document: Doc, where: string) => boolean; + menuRef: React.Ref; } // drag links and drop link targets (aliasing them if needed) @@ -77,6 +78,7 @@ export class LinkMenuItem extends React.Component { @action toggleShowMore(e: React.PointerEvent) { e.stopPropagation(); this._showMore = !this._showMore; } onEdit = (e: React.PointerEvent): void => { + LinkManager.currentLink = this.props.linkDoc; setupMoveUpEvents(this, e, this.editMoved, emptyFunction, () => this.props.showEditor(this.props.linkDoc)); } @@ -110,7 +112,8 @@ export class LinkMenuItem extends React.Component { document.removeEventListener("pointerup", this.onLinkButtonUp); document.addEventListener("pointerup", this.onLinkButtonUp); - if (this._buttonRef && this._buttonRef.current?.contains(e.target as any)) { + if (this._buttonRef && !!!this._buttonRef.current?.contains(e.target as any)) { + console.log("outside click"); LinkDocPreview.LinkInfo = undefined; } } @@ -174,18 +177,24 @@ export class LinkMenuItem extends React.Component { Location: [e.clientX, e.clientY + 20] }))} onPointerDown={this.onLinkButtonDown}> -

{StrCast(this.props.destinationDoc.title)}

+ +
+

+ {StrCast(this.props.destinationDoc.title)}

+ {this.props.linkDoc.description !== "" ?

+ {StrCast(this.props.linkDoc.description)}

: null}
+
{canExpand ?
this.toggleShowMore(e)}>
: <>} - {/*
-
*/} +
+
-
- -
+ {/*
+
*/}
{this._showMore ? this.renderMetadata() : <>} diff --git a/src/client/views/nodes/DocumentLinksButton.tsx b/src/client/views/nodes/DocumentLinksButton.tsx index bfd860f65..5d1a68af5 100644 --- a/src/client/views/nodes/DocumentLinksButton.tsx +++ b/src/client/views/nodes/DocumentLinksButton.tsx @@ -11,6 +11,8 @@ import { DocUtils } from "../../documents/Documents"; import { FontAwesomeIcon } from "@fortawesome/react-fontawesome"; import { LinkDocPreview } from "./LinkDocPreview"; import { LinkCreatedBox } from "./LinkCreatedBox"; +import { LinkDescriptionPopup } from "./LinkDescriptionPopup"; +import { LinkManager } from "../../util/LinkManager"; const higflyout = require("@hig/flyout"); export const { anchorPoints } = higflyout; export const Flyout = higflyout.default; @@ -54,6 +56,7 @@ export class DocumentLinksButton extends React.Component { setupMoveUpEvents(this, e, this.onLinkButtonMoved, emptyFunction, action((e, doubleTap) => { if (doubleTap && this.props.InMenu) { @@ -87,15 +90,22 @@ export class DocumentLinksButton extends React.Component { - LinkCreatedBox.popupX = e.screenX; - LinkCreatedBox.popupY = e.screenY - 120; - LinkCreatedBox.linkCreated = true; - setTimeout(action(() => { LinkCreatedBox.linkCreated = false; }), 2500); - }); + + if (DocumentLinksButton.StartLink && DocumentLinksButton.StartLink !== this.props.View) { + const linkDoc = DocUtils.MakeLink({ doc: DocumentLinksButton.StartLink.props.Document }, { doc: this.props.View.props.Document }, "long drag"); + LinkManager.currentLink = linkDoc; + runInAction(() => { + LinkCreatedBox.popupX = e.screenX; + LinkCreatedBox.popupY = e.screenY - 33; + LinkCreatedBox.linkCreated = true; + + LinkDescriptionPopup.popupX = e.screenX; + LinkDescriptionPopup.popupY = e.screenY; + LinkDescriptionPopup.descriptionPopup = true; + + setTimeout(action(() => { LinkCreatedBox.linkCreated = false; }), 2500); + }); + } } } })); @@ -109,15 +119,21 @@ export class DocumentLinksButton extends React.Component { - LinkCreatedBox.popupX = e.screenX; - LinkCreatedBox.popupY = e.screenY - 120; - LinkCreatedBox.linkCreated = true; - setTimeout(action(() => { LinkCreatedBox.linkCreated = false; }), 2500); - }); + if (DocumentLinksButton.StartLink && DocumentLinksButton.StartLink !== this.props.View) { + const linkDoc = DocUtils.MakeLink({ doc: DocumentLinksButton.StartLink.props.Document }, { doc: this.props.View.props.Document }, "long drag"); + LinkManager.currentLink = linkDoc; + runInAction(() => { + LinkCreatedBox.popupX = e.screenX; + LinkCreatedBox.popupY = e.screenY - 33; + LinkCreatedBox.linkCreated = true; + + LinkDescriptionPopup.popupX = e.screenX; + LinkDescriptionPopup.popupY = e.screenY; + LinkDescriptionPopup.descriptionPopup = true; + + setTimeout(action(() => { LinkCreatedBox.linkCreated = false; }), 2500); + }); + } } } diff --git a/src/client/views/nodes/DocumentView.tsx b/src/client/views/nodes/DocumentView.tsx index b38db9a1e..9a4d9ac53 100644 --- a/src/client/views/nodes/DocumentView.tsx +++ b/src/client/views/nodes/DocumentView.tsx @@ -43,6 +43,8 @@ import React = require("react"); import { DocumentLinksButton } from './DocumentLinksButton'; import { MobileInterface } from '../../../mobile/MobileInterface'; import { LinkCreatedBox } from './LinkCreatedBox'; +import { LinkDescriptionPopup } from './LinkDescriptionPopup'; +import { LinkManager } from '../../util/LinkManager'; library.add(fa.faEdit, fa.faTrash, fa.faShare, fa.faDownload, fa.faExpandArrowsAlt, fa.faCompressArrowsAlt, fa.faLayerGroup, fa.faExternalLinkAlt, fa.faAlignCenter, fa.faCaretSquareRight, fa.faSquare, fa.faConciergeBell, fa.faWindowRestore, fa.faFolder, fa.faMapPin, fa.faLink, fa.faFingerprint, fa.faCrosshairs, fa.faDesktop, fa.faUnlock, fa.faLock, fa.faLaptopCode, fa.faMale, @@ -642,30 +644,46 @@ export class DocumentView extends DocComponent(Docu e.stopPropagation(); de.complete.annoDragData.linkedToDoc = true; + const linkDoc = DocUtils.MakeLink({ doc: de.complete.annoDragData.annotationDocument }, { doc: this.props.Document }, "link"); + LinkManager.currentLink = linkDoc; + runInAction(() => { LinkCreatedBox.popupX = de.x; - LinkCreatedBox.popupY = de.y; + LinkCreatedBox.popupY = de.y - 33; LinkCreatedBox.linkCreated = true; + + LinkDescriptionPopup.popupX = de.x; + LinkDescriptionPopup.popupY = de.y; + LinkDescriptionPopup.descriptionPopup = true; + setTimeout(action(() => { LinkCreatedBox.linkCreated = false; }), 2500); }); - - DocUtils.MakeLink({ doc: de.complete.annoDragData.annotationDocument }, { doc: this.props.Document }, "link"); } if (de.complete.linkDragData) { e.stopPropagation(); // const docs = await SearchUtil.Search(`data_l:"${destDoc[Id]}"`, true); // const views = docs.map(d => DocumentManager.Instance.getDocumentView(d)).filter(d => d).map(d => d as DocumentView); - runInAction(() => { - LinkCreatedBox.popupX = de.x; - LinkCreatedBox.popupY = de.y; - LinkCreatedBox.linkCreated = true; - setTimeout(action(() => { LinkCreatedBox.linkCreated = false; }), 2500); - }); + if (de.complete.linkDragData.linkSourceDocument !== this.props.Document) { + const linkDoc = DocUtils.MakeLink({ doc: de.complete.linkDragData.linkSourceDocument }, + { doc: this.props.Document }, `link`); + LinkManager.currentLink = linkDoc; + + de.complete.linkDragData.linkSourceDocument !== this.props.Document && + (de.complete.linkDragData.linkDocument = linkDoc); // TODODO this is where in text links get passed + runInAction(() => { + LinkCreatedBox.popupX = de.x; + LinkCreatedBox.popupY = de.y - 33; + LinkCreatedBox.linkCreated = true; + + LinkDescriptionPopup.popupX = de.x; + LinkDescriptionPopup.popupY = de.y; + LinkDescriptionPopup.descriptionPopup = true; + + setTimeout(action(() => { LinkCreatedBox.linkCreated = false; }), 2500); + }); + } - de.complete.linkDragData.linkSourceDocument !== this.props.Document && - (de.complete.linkDragData.linkDocument = DocUtils.MakeLink({ doc: de.complete.linkDragData.linkSourceDocument }, - { doc: this.props.Document }, `link`)); // TODODO this is where in text links get passed } } diff --git a/src/client/views/nodes/LinkCreatedBox.tsx b/src/client/views/nodes/LinkCreatedBox.tsx index d157d3fca..648ae23c8 100644 --- a/src/client/views/nodes/LinkCreatedBox.tsx +++ b/src/client/views/nodes/LinkCreatedBox.tsx @@ -11,8 +11,8 @@ import { Fade } from "@material-ui/core"; export class LinkCreatedBox extends React.Component<{}> { @observable public static linkCreated: boolean = false; - @observable public static popupX: number = 600; - @observable public static popupY: number = 250; + @observable public static popupX: number = 500; + @observable public static popupY: number = 150; @action public static changeLinkCreated = () => { @@ -23,8 +23,8 @@ export class LinkCreatedBox extends React.Component<{}> { return
Link Created
; } diff --git a/src/client/views/nodes/LinkDescriptionPopup.scss b/src/client/views/nodes/LinkDescriptionPopup.scss new file mode 100644 index 000000000..474bd919b --- /dev/null +++ b/src/client/views/nodes/LinkDescriptionPopup.scss @@ -0,0 +1,62 @@ +.linkDescriptionPopup { + + display: flex; + + border: 1px solid rgb(100, 100, 100); + + width: auto; + position: absolute; + + height: auto; + z-index: 10000; + border-radius: 10px; + font-size: 12px; + //white-space: nowrap; + + background-color: rgba(250, 250, 250, 0.95); + padding-top: 9px; + padding-bottom: 9px; + padding-left: 9px; + padding-right: 9px; + + .linkDescriptionPopup-input { + float: left; + color: rgb(100, 100, 100); + } + + .linkDescriptionPopup-btn { + + float: right; + + + .linkDescriptionPopup-btn-dismiss { + background-color: white; + color: black; + display: inline; + right: 0; + border-radius: 10px; + border: 1px solid black; + padding: 3px; + font-size: 9px; + text-align: center; + position: relative; + transform: translateY(5px); + } + + .linkDescriptionPopup-btn-add { + background-color: black; + color: white; + display: inline; + right: 0; + border-radius: 10px; + border: 1px solid black; + padding: 3px; + font-size: 9px; + text-align: center; + position: relative; + transform: translateY(5px); + } + } + + +} \ No newline at end of file diff --git a/src/client/views/nodes/LinkDescriptionPopup.tsx b/src/client/views/nodes/LinkDescriptionPopup.tsx new file mode 100644 index 000000000..078a738e7 --- /dev/null +++ b/src/client/views/nodes/LinkDescriptionPopup.tsx @@ -0,0 +1,70 @@ +import React = require("react"); +import { observer } from "mobx-react"; +import "./LinkDescriptionPopup.scss"; +import { observable, action } from "mobx"; +import { EditableView } from "../EditableView"; +import { LinkManager } from "../../util/LinkManager"; + + +@observer +export class LinkDescriptionPopup extends React.Component<{}> { + + @observable public static descriptionPopup: boolean = false; + @observable public static popupX: number = 700; + @observable public static popupY: number = 350; + @observable description: string = ""; + @observable popupRef = React.createRef(); + + @action + descriptionChanged = (e: React.ChangeEvent) => { + this.description = e.currentTarget.value; + } + + @action + setDescription = () => { + if (LinkManager.currentLink) { + LinkManager.currentLink.description = this.description; + } + LinkDescriptionPopup.descriptionPopup = false; + } + + @action + onDismiss = () => { + LinkDescriptionPopup.descriptionPopup = false; + } + + @action + onClick = (e: PointerEvent) => { + if (this.popupRef && !!!this.popupRef.current?.contains(e.target as any)) { + LinkDescriptionPopup.descriptionPopup = false; + } + } + + @action + componentDidMount() { + document.addEventListener("pointerdown", this.onClick); + } + + componentWillUnmount() { + document.removeEventListener("pointerdown", this.onClick); + } + + render() { + return
+ this.descriptionChanged(e)}> + +
+
Dismiss
+
Add
+
+
; + } +} \ No newline at end of file -- cgit v1.2.3-70-g09d2 From 0438137cd435c47ce334b15a4ad00cbd70d80662 Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Tue, 7 Jul 2020 00:23:24 -0400 Subject: made docFilters apply to links. added hypothesis api token input --- .../apis/HypothesisAuthenticationManager.scss | 26 ++++ .../apis/HypothesisAuthenticationManager.tsx | 158 +++++++++++++++++++++ src/client/documents/Documents.ts | 41 ++++++ src/client/util/CurrentUserUtils.ts | 1 + src/client/views/GlobalKeyHandler.ts | 2 + src/client/views/MainView.tsx | 2 + src/client/views/collections/CollectionSubView.tsx | 43 +----- src/client/views/nodes/DocumentView.tsx | 2 +- src/server/ApiManagers/HypothesisManager.ts | 44 ++++++ src/server/ApiManagers/UploadManager.ts | 3 +- src/server/apis/google/GoogleApiServerUtils.ts | 3 +- src/server/index.ts | 3 +- 12 files changed, 285 insertions(+), 43 deletions(-) create mode 100644 src/client/apis/HypothesisAuthenticationManager.scss create mode 100644 src/client/apis/HypothesisAuthenticationManager.tsx create mode 100644 src/server/ApiManagers/HypothesisManager.ts (limited to 'src/client/documents') diff --git a/src/client/apis/HypothesisAuthenticationManager.scss b/src/client/apis/HypothesisAuthenticationManager.scss new file mode 100644 index 000000000..bd30dd94f --- /dev/null +++ b/src/client/apis/HypothesisAuthenticationManager.scss @@ -0,0 +1,26 @@ +.authorize-container { + display: flex; + flex-direction: column; + align-items: center; + + .paste-target { + padding: 5px; + width: 100%; + } + + .avatar { + border-radius: 50%; + } + + .welcome { + font-style: italic; + margin-top: 15px; + } + + .disconnect { + font-size: 10px; + margin-top: 20px; + color: red; + cursor: grab; + } +} \ No newline at end of file diff --git a/src/client/apis/HypothesisAuthenticationManager.tsx b/src/client/apis/HypothesisAuthenticationManager.tsx new file mode 100644 index 000000000..cffb87227 --- /dev/null +++ b/src/client/apis/HypothesisAuthenticationManager.tsx @@ -0,0 +1,158 @@ +import { observable, action, reaction, runInAction, IReactionDisposer } from "mobx"; +import { observer } from "mobx-react"; +import * as React from "react"; +import MainViewModal from "../views/MainViewModal"; +import { Opt } from "../../fields/Doc"; +import { Networking } from "../Network"; +import "./HypothesisAuthenticationManager.scss"; +import { Scripting } from "../util/Scripting"; + +const prompt = "Paste authorization code here..."; + +@observer +export default class HypothesisAuthenticationManager extends React.Component<{}> { + public static Instance: HypothesisAuthenticationManager; + private authenticationLink: Opt = undefined; + @observable private openState = false; + @observable private authenticationCode: Opt = undefined; + @observable private showPasteTargetState = false; + @observable private success: Opt = undefined; + @observable private displayLauncher = true; + @observable private credentials: string; + private disposer: Opt; + + private set isOpen(value: boolean) { + runInAction(() => this.openState = value); + } + + private set shouldShowPasteTarget(value: boolean) { + runInAction(() => this.showPasteTargetState = value); + } + + public cancel() { + this.openState && this.resetState(0, 0); + } + + public fetchAccessToken = async (displayIfFound = false) => { + let response: any = await Networking.FetchFromServer("/readHypothesisAccessToken"); + // if this is an authentication url, activate the UI to register the new access token + if (!response) { // new RegExp(AuthenticationUrl).test(response)) { + this.isOpen = true; + this.authenticationLink = response; + return new Promise(async resolve => { + this.disposer?.(); + this.disposer = reaction( + () => this.authenticationCode, + async authenticationCode => { + if (authenticationCode) { + this.disposer?.(); + Networking.PostToServer("/writeHypothesisAccessToken", { authenticationCode }); + runInAction(() => { + this.success = true; + this.credentials = response; + }); + this.resetState(); + resolve(authenticationCode); + } + } + ); + }); + } + + if (displayIfFound) { + runInAction(() => { + this.success = true; + this.credentials = response; + }); + this.resetState(-1, -1); + this.isOpen = true; + } + return response.access_token; + } + + resetState = action((visibleForMS: number = 3000, fadesOutInMS: number = 500) => { + if (!visibleForMS && !fadesOutInMS) { + runInAction(() => { + this.isOpen = false; + this.success = undefined; + this.displayLauncher = true; + this.credentials = ""; + this.shouldShowPasteTarget = false; + this.authenticationCode = undefined; + }); + return; + } + this.authenticationCode = undefined; + this.displayLauncher = false; + this.shouldShowPasteTarget = false; + if (visibleForMS > 0 && fadesOutInMS > 0) { + setTimeout(action(() => { + this.isOpen = false; + setTimeout(action(() => { + this.success = undefined; + this.displayLauncher = true; + this.credentials = ""; + }), fadesOutInMS); + }), visibleForMS); + } + }); + + constructor(props: {}) { + super(props); + HypothesisAuthenticationManager.Instance = this; + } + + private get renderPrompt() { + return ( +
+ + {this.displayLauncher ? : (null)} + {this.showPasteTargetState ? this.authenticationCode = e.currentTarget.value)} + placeholder={prompt} + /> : (null)} + {this.credentials ? + <> + Welcome to Dash, {this.credentials} + +
{ + await Networking.FetchFromServer("/revokeHypothesisAccessToken"); + this.resetState(0, 0); + }} + >Disconnect Account
+ : (null)} +
+ ); + } + + private get dialogueBoxStyle() { + const borderColor = this.success === undefined ? "black" : this.success ? "green" : "red"; + return { borderColor, transition: "0.2s borderColor ease" }; + } + + render() { + return ( + + ); + } + +} + +Scripting.addGlobal("HypothesisAuthenticationManager", HypothesisAuthenticationManager); \ No newline at end of file diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts index f81c25bab..3355c0091 100644 --- a/src/client/documents/Documents.ts +++ b/src/client/documents/Documents.ts @@ -829,6 +829,47 @@ export namespace Docs { } export namespace DocUtils { + export function FilterDocs(docs: Doc[], docFilters: string[], docRangeFilters: string[], viewSpecScript?: ScriptField) { + const childDocs = viewSpecScript ? docs.filter(d => viewSpecScript.script.run({ doc: d }, console.log).result) : docs; + + const filterFacets: { [key: string]: { [value: string]: string } } = {}; // maps each filter key to an object with value=>modifier fields + for (let i = 0; i < docFilters.length; i += 3) { + const [key, value, modifiers] = docFilters.slice(i, i + 3); + if (!filterFacets[key]) { + filterFacets[key] = {}; + } + filterFacets[key][value] = modifiers; + } + + const filteredDocs = docFilters.length ? childDocs.filter(d => { + for (const facetKey of Object.keys(filterFacets)) { + const facet = filterFacets[facetKey]; + const satisfiesFacet = Object.keys(facet).some(value => { + if (facet[value] === "match") { + return d[facetKey] === undefined || Field.toString(d[facetKey] as Field).includes(value); + } + return (facet[value] === "x") !== Doc.matchFieldValue(d, facetKey, value); + }); + if (!satisfiesFacet) { + return false; + } + } + return true; + }) : childDocs; + const rangeFilteredDocs = filteredDocs.filter(d => { + for (let i = 0; i < docRangeFilters.length; i += 3) { + const key = docRangeFilters[i]; + const min = Number(docRangeFilters[i + 1]); + const max = Number(docRangeFilters[i + 2]); + const val = Cast(d[key], "number", null); + if (val !== undefined && (val < min || val > max)) { + return false; + } + } + return true; + }); + return rangeFilteredDocs; + } export function Publish(promoteDoc: Doc, targetID: string, addDoc: any, remDoc: any) { targetID = targetID.replace(/^-/, "").replace(/\([0-9]*\)$/, ""); diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts index 4276e04e4..9f04aab04 100644 --- a/src/client/util/CurrentUserUtils.ts +++ b/src/client/util/CurrentUserUtils.ts @@ -424,6 +424,7 @@ export class CurrentUserUtils { { title: "Drag a document previewer", label: "Prev", icon: "expand", click: 'openOnRight(getCopy(this.dragFactory, true))', drag: 'getCopy(this.dragFactory,true)', dragFactory: doc.emptyDocHolder as Doc }, { title: "Toggle a Calculator REPL", label: "repl", icon: "calculator", click: 'addOverlayWindow("ScriptingRepl", { x: 300, y: 100, width: 200, height: 200, title: "Scripting REPL" })' }, { title: "Connect a Google Account", label: "Google Account", icon: "external-link-alt", click: 'GoogleAuthenticationManager.Instance.fetchOrGenerateAccessToken(true)' }, + { title: "Connect a Hypothesis Account", label: "Hypothesis Account", icon: "houzz", click: 'HypothesisAuthenticationManager.Instance.fetchOrGenerateAccessToken(true)' }, ]; } diff --git a/src/client/views/GlobalKeyHandler.ts b/src/client/views/GlobalKeyHandler.ts index 34f666f62..a3a023164 100644 --- a/src/client/views/GlobalKeyHandler.ts +++ b/src/client/views/GlobalKeyHandler.ts @@ -7,6 +7,7 @@ import { List } from "../../fields/List"; import { ScriptField } from "../../fields/ScriptField"; import { Cast, PromiseValue } from "../../fields/Types"; import GoogleAuthenticationManager from "../apis/GoogleAuthenticationManager"; +import HypothesisAuthenticationManager from "../apis/HypothesisAuthenticationManager"; import { DocServer } from "../DocServer"; import { DocumentType } from "../documents/DocumentTypes"; import { DictationManager } from "../util/DictationManager"; @@ -104,6 +105,7 @@ export default class KeyManager { DictationManager.Controls.stop(); // RecommendationsBox.Instance.closeMenu(); GoogleAuthenticationManager.Instance.cancel(); + HypothesisAuthenticationManager.Instance.cancel(); SharingManager.Instance.close(); break; case "delete": diff --git a/src/client/views/MainView.tsx b/src/client/views/MainView.tsx index 15f818d1f..eba9bb344 100644 --- a/src/client/views/MainView.tsx +++ b/src/client/views/MainView.tsx @@ -61,6 +61,7 @@ import { LinkMenu } from './linking/LinkMenu'; import { LinkDocPreview } from './nodes/LinkDocPreview'; import { Fade } from '@material-ui/core'; import { LinkCreatedBox } from './nodes/LinkCreatedBox'; +import HypothesisAuthenticationManager from '../apis/HypothesisAuthenticationManager'; @observer export class MainView extends React.Component { @@ -601,6 +602,7 @@ export class MainView extends React.Component { + diff --git a/src/client/views/collections/CollectionSubView.tsx b/src/client/views/collections/CollectionSubView.tsx index ed8535ecb..ce6872695 100644 --- a/src/client/views/collections/CollectionSubView.tsx +++ b/src/client/views/collections/CollectionSubView.tsx @@ -106,16 +106,6 @@ export function CollectionSubView(schemaCtor: (doc: Doc) => T, moreProps?: [...this.props.docFilters(), ...Cast(this.props.Document._docFilters, listSpec("string"), [])]; } @computed get childDocs() { - const docFilters = this.docFilters(); - const docRangeFilters = this.props.ignoreFields?.includes("_docRangeFilters") ? [] : Cast(this.props.Document._docRangeFilters, listSpec("string"), []); - const filterFacets: { [key: string]: { [value: string]: string } } = {}; // maps each filter key to an object with value=>modifier fields - for (let i = 0; i < docFilters.length; i += 3) { - const [key, value, modifiers] = docFilters.slice(i, i + 3); - if (!filterFacets[key]) { - filterFacets[key] = {}; - } - filterFacets[key][value] = modifiers; - } let rawdocs: (Doc | Promise)[] = []; if (this.dataField instanceof Doc) { // if collection data is just a document, then promote it to a singleton list; @@ -128,38 +118,13 @@ export function CollectionSubView(schemaCtor: (doc: Doc) => T, moreProps?: const rootDoc = Cast(this.props.Document.rootDocument, Doc, null); rawdocs = rootDoc && !this.props.annotationsKey ? [Doc.GetProto(rootDoc)] : []; } + const docs = rawdocs.filter(d => !(d instanceof Promise)).map(d => d as Doc); + const docFilters = this.docFilters(); const viewSpecScript = Cast(this.props.Document.viewSpecScript, ScriptField); - const childDocs = viewSpecScript ? docs.filter(d => viewSpecScript.script.run({ doc: d }, console.log).result) : docs; + const docRangeFilters = this.props.ignoreFields?.includes("_docRangeFilters") ? [] : Cast(this.props.Document._docRangeFilters, listSpec("string"), []); - const filteredDocs = docFilters.length && !this.props.dontRegisterView ? childDocs.filter(d => { - for (const facetKey of Object.keys(filterFacets)) { - const facet = filterFacets[facetKey]; - const satisfiesFacet = Object.keys(facet).some(value => { - if (facet[value] === "match") { - return d[facetKey] === undefined || Field.toString(d[facetKey] as Field).includes(value); - } - return (facet[value] === "x") !== Doc.matchFieldValue(d, facetKey, value); - }); - if (!satisfiesFacet) { - return false; - } - } - return true; - }) : childDocs; - const rangeFilteredDocs = filteredDocs.filter(d => { - for (let i = 0; i < docRangeFilters.length; i += 3) { - const key = docRangeFilters[i]; - const min = Number(docRangeFilters[i + 1]); - const max = Number(docRangeFilters[i + 2]); - const val = Cast(d[key], "number", null); - if (val !== undefined && (val < min || val > max)) { - return false; - } - } - return true; - }); - return rangeFilteredDocs; + return this.props.Document.dontRegisterView ? docs : DocUtils.FilterDocs(docs, docFilters, docRangeFilters, viewSpecScript); } @action diff --git a/src/client/views/nodes/DocumentView.tsx b/src/client/views/nodes/DocumentView.tsx index b38db9a1e..3311bfa33 100644 --- a/src/client/views/nodes/DocumentView.tsx +++ b/src/client/views/nodes/DocumentView.tsx @@ -1094,7 +1094,7 @@ export class DocumentView extends DocComponent(Docu return (this.props.treeViewDoc && this.props.LayoutTemplateString) || // render nothing for: tree view anchor dots this.layoutDoc.presBox || // presentationbox nodes this.props.dontRegisterView ? (null) : // view that are not registered - DocListCast(this.Document.links).filter(d => !d.hidden && this.isNonTemporalLink).map((d, i) => + DocUtils.FilterDocs(DocListCast(this.Document.links), this.props.docFilters(), []).filter(d => !d.hidden && this.isNonTemporalLink).map((d, i) => { + if (existsSync(serverPathToFile(Directory.hypothesis, user.id))) { + const read = readFileSync(serverPathToFile(Directory.hypothesis, user.id), "base64") || ""; + console.log("READ = " + read); + res.send(read); + } else res.send(""); + } + }); + + register({ + method: Method.POST, + subscription: "/writeHypothesisAccessToken", + secureHandler: async ({ user, req, res }) => { + const write = req.body.authenticationCode; + console.log("WRITE = " + write); + res.send(await writeFile(serverPathToFile(Directory.hypothesis, user.id), write, "base64", () => { })); + } + }); + + register({ + method: Method.GET, + subscription: "/revokeHypothesisAccessToken", + secureHandler: async ({ user, res }) => { + await Database.Auxiliary.GoogleAccessToken.Revoke("dash-hyp-" + user.id); + res.send(); + } + }); + + } +} \ No newline at end of file diff --git a/src/server/ApiManagers/UploadManager.ts b/src/server/ApiManagers/UploadManager.ts index fe39b84e6..55ceab9fb 100644 --- a/src/server/ApiManagers/UploadManager.ts +++ b/src/server/ApiManagers/UploadManager.ts @@ -24,7 +24,8 @@ export enum Directory { pdfs = "pdfs", text = "text", pdf_thumbnails = "pdf_thumbnails", - audio = "audio" + audio = "audio", + hypothesis = "hypothesis" } export function serverPathToFile(directory: Directory, filename: string) { diff --git a/src/server/apis/google/GoogleApiServerUtils.ts b/src/server/apis/google/GoogleApiServerUtils.ts index 20f96f432..b0157a85f 100644 --- a/src/server/apis/google/GoogleApiServerUtils.ts +++ b/src/server/apis/google/GoogleApiServerUtils.ts @@ -39,7 +39,8 @@ export namespace GoogleApiServerUtils { */ export enum Service { Documents = "Documents", - Slides = "Slides" + Slides = "Slides", + Hypothesis = "Hypothesis" } /** diff --git a/src/server/index.ts b/src/server/index.ts index 083173bb5..9af4b00bc 100644 --- a/src/server/index.ts +++ b/src/server/index.ts @@ -18,10 +18,10 @@ import PDFManager from "./ApiManagers/PDFManager"; import UploadManager from "./ApiManagers/UploadManager"; import { log_execution } from "./ActionUtilities"; import GeneralGoogleManager from "./ApiManagers/GeneralGoogleManager"; +import HypothesisManager from "./ApiManagers/HypothesisManager"; import GooglePhotosManager from "./ApiManagers/GooglePhotosManager"; import { Logger } from "./ProcessFactory"; import { yellow } from "colors"; -import { DashSessionAgent } from "./DashSession/DashSessionAgent"; import SessionManager from "./ApiManagers/SessionManager"; import { AppliedSessionAgent } from "./DashSession/Session/agents/applied_session_agent"; @@ -72,6 +72,7 @@ function routeSetter({ isRelease, addSupervisedRoute, logRegistrationOutcome }: new DeleteManager(), new UtilManager(), new GeneralGoogleManager(), + new HypothesisManager(), new GooglePhotosManager(), ]; -- cgit v1.2.3-70-g09d2 From 3f704ee2941fef77dd0eafebeb0a6ffb0a946a8b Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Tue, 7 Jul 2020 12:04:21 -0400 Subject: fixes for audio document linkiing --- src/client/documents/Documents.ts | 2 +- src/client/views/nodes/AudioBox.scss | 1 + src/client/views/nodes/AudioBox.tsx | 1 + 3 files changed, 3 insertions(+), 1 deletion(-) (limited to 'src/client/documents') diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts index ad62169ab..fa85d58f0 100644 --- a/src/client/documents/Documents.ts +++ b/src/client/documents/Documents.ts @@ -906,7 +906,7 @@ export namespace DocUtils { export let ActiveRecordings: Doc[] = []; export function MakeLinkToActiveAudio(doc: Doc) { - DocUtils.ActiveRecordings.map(d => DocUtils.MakeLink({ doc: doc }, { doc: d }, "audio link", "", "audio timeline")); + DocUtils.ActiveRecordings.map(d => DocUtils.MakeLink({ doc: doc }, { doc: d }, "audio link", "audio timeline")); } export function MakeLink(source: { doc: Doc }, target: { doc: Doc }, linkRelationship: string = "", description: string = "", id?: string) { diff --git a/src/client/views/nodes/AudioBox.scss b/src/client/views/nodes/AudioBox.scss index c959b79f5..e9420a072 100644 --- a/src/client/views/nodes/AudioBox.scss +++ b/src/client/views/nodes/AudioBox.scss @@ -5,6 +5,7 @@ position: inherit; display: flex; pointer-events: all; + position: relative; cursor: default; .audiobox-buttons { diff --git a/src/client/views/nodes/AudioBox.tsx b/src/client/views/nodes/AudioBox.tsx index d5288fff6..5c921cea4 100644 --- a/src/client/views/nodes/AudioBox.tsx +++ b/src/client/views/nodes/AudioBox.tsx @@ -268,6 +268,7 @@ export class AudioBox extends ViewBoxBaseComponent -- cgit v1.2.3-70-g09d2 From 065a29e87c771b5cd9301b0468fb036e070cad17 Mon Sep 17 00:00:00 2001 From: yunahi <60233430+yunahi@users.noreply.github.com> Date: Fri, 10 Jul 2020 05:08:53 +0900 Subject: added format shape --- src/client/documents/Documents.ts | 3 +- src/client/util/InteractionUtils.tsx | 8 + src/client/util/SelectionManager.ts | 5 + src/client/views/AntimodeMenu.tsx | 18 + src/client/views/ContextMenu.tsx | 1 + src/client/views/DocumentDecorations.tsx | 2 + src/client/views/GestureOverlay.tsx | 17 +- src/client/views/InkingStroke.tsx | 15 +- src/client/views/MainView.tsx | 13 +- .../collectionFreeForm/FormatShapePane.scss | 53 ++ .../collectionFreeForm/FormatShapePane.tsx | 996 +++++++++++++++++++++ .../collectionFreeForm/InkOptionsMenu.scss | 2 +- .../collectionFreeForm/InkOptionsMenu.tsx | 40 +- 13 files changed, 1152 insertions(+), 21 deletions(-) create mode 100644 src/client/views/collections/collectionFreeForm/FormatShapePane.scss create mode 100644 src/client/views/collections/collectionFreeForm/FormatShapePane.tsx (limited to 'src/client/documents') diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts index b70971c2d..eb8e04317 100644 --- a/src/client/documents/Documents.ts +++ b/src/client/documents/Documents.ts @@ -653,7 +653,7 @@ export namespace Docs { I.type = DocumentType.INK; I.layout = InkingStroke.LayoutString("data"); I.color = color; - I.strokeWidth = strokeWidth; + I.strokeWidth = Number(strokeWidth); I.strokeBezier = strokeBezier; I.fillColor = fillColor; I.arrowStart = arrowStart; @@ -667,6 +667,7 @@ export namespace Docs { I._width = options._width; I._height = options._height; I.author = Doc.CurrentUserEmail; + I.rotation = 0; I.data = new InkField(points); return I; // return I; diff --git a/src/client/util/InteractionUtils.tsx b/src/client/util/InteractionUtils.tsx index edeb461e0..2883e2056 100644 --- a/src/client/util/InteractionUtils.tsx +++ b/src/client/util/InteractionUtils.tsx @@ -3,6 +3,7 @@ import * as beziercurve from 'bezier-curve'; import * as fitCurve from 'fit-curve'; import "./InteractionUtils.scss"; import { Utils } from "../../Utils"; +import InkOptionsMenu from "../views/collections/collectionFreeForm/InkOptionsMenu"; export namespace InteractionUtils { export const MOUSETYPE = "mouse"; @@ -94,6 +95,13 @@ export namespace InteractionUtils { export function CreatePolyline(points: { X: number, Y: number }[], left: number, top: number, color: string, width: number, strokeWidth: number, bezier: string, fill: string, arrowStart: string, arrowEnd: string, dash: string, scalex: number, scaley: number, shape: string, pevents: string, drawHalo: boolean, nodefs: boolean) { + + // if (InkOptionsMenu.Instance.Pinned) { + // for (var i = 0; i < points.length; i++) { + // points[i].Y -= 35; + // } + // } + let pts: { X: number; Y: number; }[] = []; if (shape) { //if any of the shape are true pts = makePolygon(shape, points); diff --git a/src/client/util/SelectionManager.ts b/src/client/util/SelectionManager.ts index 024532f90..aea2c542b 100644 --- a/src/client/util/SelectionManager.ts +++ b/src/client/util/SelectionManager.ts @@ -5,6 +5,7 @@ import { computedFn } from "mobx-utils"; import { List } from "../../fields/List"; import { Scripting } from "./Scripting"; import { DocumentManager } from "./DocumentManager"; +import FormatShapePane from "../views/collections/collectionFreeForm/FormatShapePane"; export namespace SelectionManager { @@ -14,6 +15,8 @@ export namespace SelectionManager { SelectedDocuments: ObservableMap = new ObservableMap(); @action SelectDoc(docView: DocumentView, ctrlPressed: boolean): void { + console.log("select" + ); // if doc is not in SelectedDocuments, add it if (!manager.SelectedDocuments.get(docView)) { if (!ctrlPressed) { @@ -29,6 +32,8 @@ export namespace SelectionManager { manager.SelectedDocuments.set(docView, true); } Doc.UserDoc().activeSelection = new List(SelectionManager.SelectedDocuments().map(dv => dv.props.Document)); + FormatShapePane.Instance.selected(); + } @action DeselectDoc(docView: DocumentView): void { diff --git a/src/client/views/AntimodeMenu.tsx b/src/client/views/AntimodeMenu.tsx index d83ac434c..cb6de1785 100644 --- a/src/client/views/AntimodeMenu.tsx +++ b/src/client/views/AntimodeMenu.tsx @@ -1,6 +1,7 @@ import React = require("react"); import { observable, action } from "mobx"; import "./AntimodeMenu.scss"; +import { inherits } from "util"; /** * This is an abstract class that serves as the base for a PDF-style or Marquee-style @@ -147,6 +148,23 @@ export default abstract class AntimodeMenu extends React.Component { ); } + protected getElementVert(buttons: JSX.Element[]) { + return ( +
+ {buttons} +
+ ); + } + protected getElementWithRows(rows: JSX.Element[], numRows: number, hasDragger: boolean = true) { diff --git a/src/client/views/ContextMenu.tsx b/src/client/views/ContextMenu.tsx index 941d7b44a..1a6b7ab90 100644 --- a/src/client/views/ContextMenu.tsx +++ b/src/client/views/ContextMenu.tsx @@ -224,6 +224,7 @@ export class ContextMenu extends React.Component { } render() { + console.log("context"); if (!this._display) { return null; } diff --git a/src/client/views/DocumentDecorations.tsx b/src/client/views/DocumentDecorations.tsx index 4fda10926..8edd4c4a9 100644 --- a/src/client/views/DocumentDecorations.tsx +++ b/src/client/views/DocumentDecorations.tsx @@ -293,6 +293,8 @@ export class DocumentDecorations extends React.Component<{}, { value: string }> SelectionManager.SelectedDocuments().forEach(action((element: DocumentView) => { const doc = Document(element.rootDoc); if (doc.type === DocumentType.INK && doc.x && doc.y && doc._width && doc._height && doc.data) { + doc.rotation = Number(doc.rotation) + Number(angle); + console.log(doc.rotation); const ink = Cast(doc.data, InkField)?.inkData; if (ink) { diff --git a/src/client/views/GestureOverlay.tsx b/src/client/views/GestureOverlay.tsx index bfd659207..26a06090b 100644 --- a/src/client/views/GestureOverlay.tsx +++ b/src/client/views/GestureOverlay.tsx @@ -633,7 +633,8 @@ export default class GestureOverlay extends Touchable { this.makePolygon(this.InkShape, false); this.dispatchGesture(GestureUtils.Gestures.Stroke); this._points = []; - if (this.InkShape !== "noRec") { + if (InkOptionsMenu.Instance._double === "") { + this.InkShape = ""; } } @@ -687,12 +688,14 @@ export default class GestureOverlay extends Touchable { } //get out of ink mode after each stroke= console.log("now"); - Doc.SetSelectedTool(InkTool.None); - InkOptionsMenu.Instance._selected = InkOptionsMenu.Instance._shapesNum; - SetActiveArrowStart("none"); - GestureOverlay.Instance.SavedArrowStart = ActiveArrowStart(); - SetActiveArrowEnd("none"); - GestureOverlay.Instance.SavedArrowEnd = ActiveArrowEnd(); + if (InkOptionsMenu.Instance._double === "") { + Doc.SetSelectedTool(InkTool.None); + InkOptionsMenu.Instance._selected = InkOptionsMenu.Instance._shapesNum; + SetActiveArrowStart("none"); + GestureOverlay.Instance.SavedArrowStart = ActiveArrowStart(); + SetActiveArrowEnd("none"); + GestureOverlay.Instance.SavedArrowEnd = ActiveArrowEnd(); + } document.removeEventListener("pointermove", this.onPointerMove); document.removeEventListener("pointerup", this.onPointerUp); diff --git a/src/client/views/InkingStroke.tsx b/src/client/views/InkingStroke.tsx index c32e76cec..4a7ec40be 100644 --- a/src/client/views/InkingStroke.tsx +++ b/src/client/views/InkingStroke.tsx @@ -15,6 +15,8 @@ import { FieldView, FieldViewProps } from "./nodes/FieldView"; import React = require("react"); import { Scripting } from "../util/Scripting"; import { Doc } from "../../fields/Doc"; +import FormatShapePane from "./collections/collectionFreeForm/FormatShapePane"; +import { action } from "mobx"; library.add(faPaintBrush); @@ -38,10 +40,19 @@ export class InkingStroke extends ViewBoxBaseComponent { + console.log("Clicked"); + FormatShapePane.Instance.Pinned = true; + FormatShapePane.Instance.selected(); + + } + render() { TraceMobx(); const data: InkData = Cast(this.dataDoc[this.fieldKey], InkField)?.inkData ?? []; - const strokeWidth = Number(StrCast(this.layoutDoc.strokeWidth, ActiveInkWidth())); + // const strokeWidth = Number(StrCast(this.layoutDoc.strokeWidth, ActiveInkWidth())); + const strokeWidth = Number(this.layoutDoc.strokeWidth); const xs = data.map(p => p.X); const ys = data.map(p => p.Y); const left = Math.min(...xs) - strokeWidth / 2; @@ -74,6 +85,8 @@ export class InkingStroke extends ViewBoxBaseComponent { ContextMenu.Instance.addItem({ description: "Analyze Stroke", event: this.analyzeStrokes, icon: "paint-brush" }); ContextMenu.Instance.addItem({ description: "Make Mask", event: this.makeMask, icon: "paint-brush" }); + ContextMenu.Instance.addItem({ description: "Format Shape", event: this.formatShape, icon: "paint-brush" }); + }} > diff --git a/src/client/views/MainView.tsx b/src/client/views/MainView.tsx index afdff4ed8..3eed44654 100644 --- a/src/client/views/MainView.tsx +++ b/src/client/views/MainView.tsx @@ -58,7 +58,7 @@ import { DocumentManager } from '../util/DocumentManager'; import { DocumentLinksButton } from './nodes/DocumentLinksButton'; import { LinkMenu } from './linking/LinkMenu'; import { LinkDocPreview } from './nodes/LinkDocPreview'; - +import FormatShapePane from "./collections/collectionFreeForm/FormatShapePane"; @observer export class MainView extends React.Component { public static Instance: MainView; @@ -453,12 +453,13 @@ export class MainView extends React.Component { @computed get mainContent() { const sidebar = this.userDoc?.["tabs-panelContainer"]; - console.log(InkOptionsMenu.Instance?.Pinned); + console.log('${ ANTIMODEMENU_HEIGHT }'); return !this.userDoc || !(sidebar instanceof Doc) ? (null) : (
@@ -597,7 +598,10 @@ export class MainView extends React.Component { + + + {this.mainContent} @@ -608,6 +612,7 @@ export class MainView extends React.Component { linkDoc={LinkDocPreview.LinkInfo.linkDoc} linkSrc={LinkDocPreview.LinkInfo.linkSrc} href={LinkDocPreview.LinkInfo.href} addDocTab={LinkDocPreview.LinkInfo.addDocTab} /> : (null)} + diff --git a/src/client/views/collections/collectionFreeForm/FormatShapePane.scss b/src/client/views/collections/collectionFreeForm/FormatShapePane.scss new file mode 100644 index 000000000..5789c6c75 --- /dev/null +++ b/src/client/views/collections/collectionFreeForm/FormatShapePane.scss @@ -0,0 +1,53 @@ +.antimodeMenu-button { + width: 200px; + + .color-previewI { + width: 100%; + height: 40%; + } + + .color-previewII { + width: 100%; + height: 100%; + } + + +} + +.sketch-picker { + background: #323232; + + .flexbox-fit { + background: #323232; + } +} + +.btn-group { + display: grid; + grid-template-columns: auto auto auto auto; + /* Make the buttons appear below each other */ +} + +.btn-group-palette { + display: block; + /* Make the buttons appear below each other */ +} + +.btn-draw { + display: inline; + /* Make the buttons appear below each other */ +} + +.btn2-group { + display: block; + background: #323232; + grid-template-columns: auto; + + /* Make the buttons appear below each other */ + .antimodeMenu-button { + background: #323232; + display: block; + + + } +} \ No newline at end of file diff --git a/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx b/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx new file mode 100644 index 000000000..7b47b7ca4 --- /dev/null +++ b/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx @@ -0,0 +1,996 @@ +import React = require("react"); +import AntimodeMenu from "../../AntimodeMenu"; +import { observer } from "mobx-react"; +import { observable, action, computed } from "mobx"; +import "./FormatShapePane.scss"; +import { ActiveInkColor, ActiveInkBezierApprox, ActiveFillColor, ActiveArrowStart, ActiveArrowEnd, SetActiveInkWidth, SetActiveInkColor, SetActiveBezierApprox, SetActiveFillColor, SetActiveArrowStart, SetActiveArrowEnd, ActiveDash, SetActiveDash } from "../../InkingStroke"; +import { Scripting } from "../../../util/Scripting"; +import { InkTool, InkField } from "../../../../fields/InkField"; +import { ColorState } from "react-color"; +import { Utils } from "../../../../Utils"; +import GestureOverlay from "../../GestureOverlay"; +import { Doc } from "../../../../fields/Doc"; +import { SelectionManager } from "../../../util/SelectionManager"; +import { DocumentView } from "../../../views/nodes/DocumentView"; +import { Document } from "../../../../fields/documentSchemas"; +import { DocumentType } from "../../../documents/DocumentTypes"; +import { FontAwesomeIcon } from "@fortawesome/react-fontawesome"; +import { IconProp, library } from '@fortawesome/fontawesome-svg-core'; +import { faRulerCombined, faFillDrip, faPenNib } from "@fortawesome/free-solid-svg-icons"; +import { Cast, StrCast, BoolCast, NumCast } from "../../../../fields/Types"; +import e = require("express"); +import { ChangeEvent } from "mongodb"; +import { black } from "colors"; + + +library.add(faRulerCombined, faFillDrip, faPenNib); + +@observer +export default class FormatShapePane extends AntimodeMenu { + static Instance: FormatShapePane; + + private _palette = ["#D0021B", "#F5A623", "#F8E71C", "#8B572A", "#7ED321", "#417505", "#9013FE", "#4A90E2", "#50E3C2", "#B8E986", "#000000", "#4A4A4A", "#9B9B9B", "#FFFFFF"]; + private _width = ["1", "5", "10", "100"]; + private _mode = ["fill-drip", "ruler-combined"]; + private _subMenu = ["fill", "line", "size", "position"]; + private _headIcon = ["⎯", "←"]; + private _endIcon = ["⎯", "→"]; + private _head = ["none", "arrowHead"]; + private _end = ["none", "arrowEnd"]; + + @observable private _subOpen = [false, false, false, false]; + + @observable private collapsed: boolean = false; + @observable private currMode: string = "fill-drip"; + @observable _fillBtn = false; + @observable _lineBtn = false; + + @observable _selectDoc: DocumentView[] = []; + + @observable _noFill = false; + @observable _solidFill = false; + @observable _noLine = false; + @observable _solidLine = false; + @observable _dashLine = false; + @observable _lock = false; + + @observable _multiple = false; + + @observable _widthBtn = false; + + @observable _currWidth = "10"; + + @observable _single = false; + @observable _currFill = "#D0021B"; + @observable _currColor = "#D0021B"; + + @observable _arrowHead = false; + @observable _arrowEnd = false; + + + @observable _currSizeHeight = "10"; + @observable _currSizeWidth = "10"; + @observable _currRotation = "10"; + + @observable _currPositionHorizontal = "10"; + @observable _currPositionVertical = "10"; + + + constructor(props: Readonly<{}>) { + super(props); + FormatShapePane.Instance = this; + this._canFade = false; // don't let the inking menu fade away + this.Pinned = BoolCast(Doc.UserDoc()["formatShapePane-pinned"]); + + } + + @action + toggleMenuPin = (e: React.MouseEvent) => { + Doc.UserDoc()["formatShapePane-pinned"] = this.Pinned = !this.Pinned; + if (!this.Pinned) { + // this.fadeOut(true); + } + } + + @action + protected toggleCollapse = (e: React.MouseEvent) => { + this.collapsed = !this.collapsed; + setTimeout(() => { + const x = Math.min(this._left, window.innerWidth - FormatShapePane.Instance.width); + FormatShapePane.Instance.jumpTo(x, this._top, true); + }, 0); + } + + @action + closePane = () => { + this.jumpTo(-300, -300); + this.Pinned = false; + + } + + @action + checkSame = () => { + const docs = SelectionManager.SelectedDocuments(); + const inks: DocumentView[] = []; + for (var i = 0; i < docs.length; i++) { + if (Document(docs[i].rootDoc).type === DocumentType.INK) { + inks.push(docs[i]); + } + } + const firstWidth = Document(inks[0].rootDoc).strokeWidth; + const firstColor = Document(inks[0].rootDoc).color; + const firstFill = Document(inks[0].rootDoc).fillColor; + // const firstBezier + const firstRotation = Document(inks[0].rootDoc).rotation; + const firstArrowStart = Document(inks[0].rootDoc).arrowStart; + const firstArrowEnd = Document(inks[0].rootDoc).arrowEnd; + const firstDash = Document(inks[0].rootDoc).dash; + const firstWidthSize = Document(inks[0].rootDoc)._width; + const firstHeightSize = Document(inks[0].rootDoc)._height; + const firstHorizontal = Document(inks[0].rootDoc).x; + const firstVertical = Document(inks[0].rootDoc).y; + this._noFill = Document(inks[0].rootDoc).fillColor === "none" ? true : false; + this._solidFill = Document(inks[0].rootDoc).fillColor === "none" ? false : true; + this._noLine = Document(inks[0].rootDoc).color === "none" ? true : false; + if (Document(inks[0].rootDoc).color !== "none") { + this._solidLine = true; + this._dashLine = true; + if (Document(inks[0].rootDoc).dash === "0") { + this._dashLine = false; + } else { + this._solidLine = false; + + } + } + // this._solidLine = (Document(inks[0].rootDoc).color === "none") ? false : Document(inks[0].rootDoc).dash === 0 ? true : false; + // this._dashLine = (Document(inks[0].rootDoc).color === "none") ? false : Document(inks[0].rootDoc).dash !== 0 ? true : false; + // // this._widthBtn = false; + this._currWidth = String(Document(inks[0].rootDoc).strokeWidth); + // this._single = false; + this._currFill = String(Document(inks[0].rootDoc).fillColor); + this._currColor = String(Document(inks[0].rootDoc).color); + this._arrowHead = Document(inks[0].rootDoc).arrowStart === "none" ? false : true; + this._arrowEnd = Document(inks[0].rootDoc).arrowEnd === "none" ? false : true; + this._currSizeHeight = String(Document(inks[0].rootDoc)._height); + this._currSizeWidth = String(Document(inks[0].rootDoc)._width); + this._currRotation = String(Document(inks[0].rootDoc).rotation); + this._currPositionHorizontal = String(Document(inks[0].rootDoc).x); + this._currPositionVertical = String(Document(inks[0].rootDoc).y); + for (var i = 0; i < inks.length; i++) { + if (Document(inks[i].rootDoc).strokeWidth !== firstWidth) { + this._currWidth = ""; + } + if (Document(inks[i].rootDoc).color !== firstColor) { + this._noLine = false; + this._solidLine = false; + this._dashLine = false; + } + if (Document(inks[i].rootDoc).fillColor !== firstFill) { + this._solidFill = false; + this._noFill = false; + } + if (Document(inks[i].rootDoc).arrowStart !== firstArrowStart) { + this._arrowHead = false; + } + if (Document(inks[i].rootDoc).arrowEnd !== firstArrowEnd) { + this._arrowEnd = false; + } + if (Document(inks[i].rootDoc).x !== firstHorizontal) { + this._currPositionHorizontal = ""; + } + if (Document(inks[i].rootDoc).y !== firstVertical) { + this._currPositionVertical = ""; + } + if (Document(inks[i].rootDoc)._width !== firstWidthSize) { + this._currSizeWidth = ""; + } + if (Document(inks[i].rootDoc)._height !== firstHeightSize) { + this._currSizeHeight = ""; + } + if (Document(inks[i].rootDoc).rotation !== firstRotation) { + this._currRotation = ""; + } + } + + + + } + + @action + upDownButtons = (dirs: string, field: string) => { + SelectionManager.SelectedDocuments().forEach(action((element: DocumentView) => { + const doc = Document(element.rootDoc); + if (doc.type === DocumentType.INK) { + switch (field) { + case "width": + if (doc.strokeWidth) { + doc.strokeWidth = dirs === "up" ? doc.strokeWidth + 1 : doc.strokeWidth - 1; + SetActiveInkWidth(String(doc.strokeWidth)); + + } + break; + case "sizeWidth": + if (doc._width && doc._height) { + const oldWidth = doc._width; + const oldHeight = doc._height; + + doc._width = dirs === "up" ? doc._width + 10 : doc._width - 10; + if (this._lock) { + doc._height = (doc._width * oldHeight) / oldWidth; + } + } + break; + case "sizeHeight": + if (doc._width && doc._height) { + const oldWidth = doc._width; + const oldHeight = doc._height; + doc._height = dirs === "up" ? doc._height + 10 : doc._height - 10; + if (this._lock) { + doc._width = (doc._height * oldWidth) / oldHeight; + } + } + break; + case "horizontal": + if (doc.x) { + doc.x = dirs === "up" ? doc.x + 10 : doc.x - 10; + } + break; + case "vertical": + if (doc.y) { + doc.y = dirs === "up" ? doc.y + 10 : doc.y - 10; + } + case "rotation": + + this.rotate(dirs === "up" ? Number(doc.rotation) + Number(0.1) : Number(doc.rotation) - Number(0.1)); + + break; + default: + break; + } + this.selected(); + + } + })); + } + + @action + editProperties = (value: any, field: string) => { + SelectionManager.SelectedDocuments().forEach(action((element: DocumentView) => { + const doc = Document(element.rootDoc); + if (doc.type === DocumentType.INK) { + switch (field) { + case "width": + SetActiveInkWidth(value); + doc.strokeWidth = Number(value); + break; + case "color": + doc.color = String(value); + break; + case "fill": + doc.fillColor = String(value); + break; + case "bezier": + // doc.strokeBezier === 300 ? doc.strokeBezier = 0 : doc.strokeBezier = 300; + break; + case "arrowStart": + doc.arrowStart = String(value); + break; + case "arrowEnd": + doc.arrowEnd = String(value); + break; + case "dash": + doc.dash = String(value); + break; + case "widthSize": + if (doc._width && doc._height) { + const oldWidth = doc._width; + const oldHeight = doc._height; + + doc._width = Number(value); + if (this._lock) { + doc._height = (doc._width * oldHeight) / oldWidth; + } + } + break; + case "heightSize": + if (doc._width && doc._height) { + const oldWidth = doc._width; + const oldHeight = doc._height; + + doc._height = Number(value); + if (this._lock) { + doc._width = (doc._height * oldWidth) / oldHeight; + } + } + break; + case "horizontal": + doc.x = Number(value); + break; + case "vertical": + doc.y = Number(value); + + break; + default: + break; + } + } + this.selected(); + })); + this.checkSame(); + + } + + @computed get close() { + const close = ; + return close; + } + + @computed get modes() { + const modes =
+ {this._mode.map(mode => { + return ; + }) + }
; + return modes; + } + + @action + selected = () => { + this._selectDoc = SelectionManager.SelectedDocuments(); + if (this._selectDoc.length === 1 && Document(this._selectDoc[0].rootDoc).type === DocumentType.INK) { + this._single = true; + const doc = Document(this._selectDoc[0].rootDoc); + if (doc.type === DocumentType.INK) { + console.log(doc.fillColor); + if (doc.fillColor === "none") { + this._noFill = true; + this._solidFill = false; + } else { + this._solidFill = true; + this._noFill = false; + this._currFill = String(doc.fillColor); + } + if (doc.color === "none") { + this._noLine = true; + this._solidLine = false; + this._dashLine = false; + } else { + console.log(doc.strokeWidth); + this._currWidth = String(doc.strokeWidth); + this._currColor = String(doc.color); + if (doc.dash === "0") { + this._solidLine = true; + this._noLine = false; + this._dashLine = false; + } else { + this._dashLine = true; + this._noLine = false; + this._solidLine = false; + } + + this._arrowHead = doc.arrowStart === "none" ? false : true; + this._arrowEnd = doc.arrowEnd === "none" ? false : true; + + + this._currPositionHorizontal = String(doc.x); + this._currPositionVertical = String(doc.y); + console.log(doc.rotation); + this._currRotation = String(doc.rotation); + this._currSizeHeight = String(doc._height); + this._currSizeWidth = String(doc._width); + } + + } + } else { + this._noFill = false; + this._solidFill = false; + this._single = false; + this._currFill = "#D0021B"; + this._noLine = false; + this._solidLine = false; + this._dashLine = false; + this._currColor = "#D0021B"; + this._arrowHead = false; + this._arrowEnd = false; + this._currPositionHorizontal = ""; + this._currPositionVertical = ""; + this._currRotation = ""; + this._currSizeHeight = ""; + this._currSizeWidth = ""; + } + this.checkSame(); + } + + @action + rotate = (degrees: number) => { + SelectionManager.SelectedDocuments().forEach(action((element: DocumentView) => { + const doc = Document(element.rootDoc); + if (doc.type === DocumentType.INK && doc.x && doc.y && doc._width && doc._height && doc.data) { + // doc.rotation = (Number(doc.rotation) + (Number(angle) * 180 / Math.PI)); + // console.log(doc.rotation); + const angle = Number(degrees) - Number(doc.rotation); + doc.rotation = Number(degrees); + const ink = Cast(doc.data, InkField)?.inkData; + if (ink) { + const xs = ink.map(p => p.X); + const ys = ink.map(p => p.Y); + const left = Math.min(...xs); + const top = Math.min(...ys); + const right = Math.max(...xs); + const bottom = Math.max(...ys); + const _centerPoints: { X: number, Y: number }[] = []; + _centerPoints.push({ X: left, Y: top }); + + const newPoints: { X: number, Y: number }[] = []; + for (var i = 0; i < ink.length; i++) { + const newX = Math.cos(angle) * (ink[i].X - _centerPoints[0].X) - Math.sin(angle) * (ink[i].Y - _centerPoints[0].Y) + _centerPoints[0].X; + const newY = Math.sin(angle) * (ink[i].X - _centerPoints[0].X) + Math.cos(angle) * (ink[i].Y - _centerPoints[0].Y) + _centerPoints[0].Y; + newPoints.push({ X: newX, Y: newY }); + } + doc.data = new InkField(newPoints); + const xs2 = newPoints.map(p => p.X); + const ys2 = newPoints.map(p => p.Y); + const left2 = Math.min(...xs2); + const top2 = Math.min(...ys2); + const right2 = Math.max(...xs2); + const bottom2 = Math.max(...ys2); + + doc._height = (bottom2 - top2) * element.props.ScreenToLocalTransform().Scale; + doc._width = (right2 - left2) * element.props.ScreenToLocalTransform().Scale; + + } + } + })); + } + + @action + toggle = (check: string) => { + switch (check) { + case "noFill": + if (!this._noFill) { + this._noFill = true; + this._solidFill = false; + } + break; + case "solidFill": + if (!this._solidFill) { + this._solidFill = true; + this._noFill = false; + if (this._currFill === "none") { + this._currFill = "#D0021B"; + } + } + break; + case "noLine": + if (!this._noLine) { + this._noLine = true; + this._solidLine = false; + this._dashLine = false; + } + break; + case "solidLine": + if (!this._solidLine) { + this._solidLine = true; + this._noLine = false; + this._dashLine = false; + if (this._currColor === "none") { + this._currColor = "#D0021B"; + } + } + break; + case "dashLine": + if (!this._dashLine) { + this._dashLine = true; + this._solidLine = false; + this._noLine = false; + if (this._currColor === "none") { + this._currColor = "#D0021B"; + } + } + break; + case "lock": + if (this._lock) { + this._lock = false; + } else { + this._lock = true; + } + break; + case "arrowHead": + this._arrowHead = this._arrowHead ? false : true; + break; + case "arrowEnd": + this._arrowEnd = this._arrowEnd ? false : true; + break; + default: + break; + } + } + + @computed get subMenu() { + const fillCheck =
+ { this.toggle("noFill"); this.editProperties("none", "fill"); })} /> + No Fill +

+ { this.toggle("solidFill"); this.editProperties(this._currFill, "fill"); })} /> + Solid Fill +

+

+ {this._solidFill ? "Color" : ""} + {this._solidFill ? this.fillButton : ""} + {this._fillBtn && this._solidFill ? this.fillPicker : ""} + +
; + const arrows = <> { this.toggle("arrowHead"); this.editProperties(this._arrowHead ? "arrowHead" : "none", "arrowStart"); })} /> + Arrow Head +

+ + { this.toggle("arrowEnd"); this.editProperties(this._arrowEnd ? "arrowEnd" : "none", "arrowEnd"); })} /> + Arrow End +

; + const lineCheck =
+ { this.toggle("noLine"); this.editProperties("none", "color"); })} /> + No Line +

+ { this.toggle("solidLine"); this.editProperties(this._currColor, "color"); this.editProperties("0", "dash"); })} /> + Solid Line +

+ { this.toggle("dashLine"); this.editProperties(this._currColor, "color"); this.editProperties("2", "dash"); })} /> + Dash Line +

+

+ {(this._solidLine || this._dashLine) ? "Color" : ""} + {(this._solidLine || this._dashLine) ? this.lineButton : ""} + {this._lineBtn && (this._solidLine || this._dashLine) ? this.linePicker : ""} +

+ {(this._solidLine || this._dashLine) ? "Width" : ""} + {(this._solidLine || this._dashLine) ? this.widthInput : ""} +

+

+ {(this._solidLine || this._dashLine) ? arrows : ""} + +
; + + const sizeCheck =
+ Height {this.sizeHeightInput} +

+

+ + + Width {this.sizeWidthInput} +

+

+ + { this.toggle("lock"); })} /> + Lock Ratio +

+

+ + + Rotation {this.rotationInput} +

+

+ + +
; + const positionCheck =
+ Horizontal {this.positionHorizontalInput} +

+

+ + Vertical {this.positionVerticalInput} +

+

+ + +
; + + const subMenu =
+ {this._subMenu.map((subMenu, i) => { + if (subMenu === "fill" || subMenu === "line") { + return
+ {this.currMode === "fill-drip" && subMenu === "fill" && this._subOpen[0] ? fillCheck : ""} + {this.currMode === "fill-drip" && subMenu === "line" && this._subOpen[1] ? lineCheck : ""} + +
; + } + else if (subMenu === "size" || subMenu === "position") { + return
+ {this.currMode === "ruler-combined" && subMenu === "size" && this._subOpen[2] ? sizeCheck : ""} + {this.currMode === "ruler-combined" && subMenu === "position" && this._subOpen[3] ? positionCheck : ""} + +
+ ; + + } + }) + }
; + return subMenu; + } + + @computed get fillButton() { + const fillButton = <> +

+

; + return fillButton; + } + @computed get fillPicker() { + const fillPicker =
+ {this._palette.map(color => { + return ; + })} + +
; + return fillPicker; + } + + @computed get lineButton() { + const lineButton = <> +

+

; + return lineButton; + } + @computed get linePicker() { + const linePicker =
+ {this._palette.map(color => { + return ; + })} + +
; + return linePicker; + } + @computed get widthInput() { + const widthInput = <> + this.onChange(e.target.value, "width")} + autoFocus> +
+ ; + return widthInput; + } + @computed get sizeHeightInput() { + const sizeHeightInput = <> + this.onChange(e.target.value, "sizeHeight")} + autoFocus> + +
+ + ; + return sizeHeightInput; + } + + @computed get sizeWidthInput() { + const sizeWidthInput = <> + this.onChange(e.target.value, "sizeWidth")} + autoFocus> + +

+ ; + return sizeWidthInput; + } + + @computed get rotationInput() { + const rotationInput = + <> + this.onChange(e.target.value, "rotation")} + autoFocus> + +

+ ; + return rotationInput; + } + + @computed get positionHorizontalInput() { + const positionHorizontalInput = + <> this.onChange(e.target.value, "positionHorizontal")} + autoFocus> + +

+ ; + return positionHorizontalInput; + } + + @computed get positionVerticalInput() { + const positionVerticalInput = + <> this.onChange(e.target.value, "positionVertical")} + autoFocus> + +

+ ; + return positionVerticalInput; + } + + + @action + onChange = (val: string, property: string): void => { + if (!Number.isNaN(Number(val)) && Number(val) !== null && val !== " ") { + + // if (val === "") { + // val = "0"; + // } + switch (property) { + case "width": + this._currWidth = val; + if (val !== "") { + this.editProperties(this._currWidth, "width"); + } + break; + case "sizeHeight": + this._currSizeHeight = val; + if (val !== "") { + this.editProperties(this._currSizeHeight, "heightSize"); + } + break; + case "sizeWidth": + this._currSizeWidth = val; + if (val !== "") { + + this.editProperties(this._currSizeWidth, "widthSize"); + } + break; + case "rotation": + + this._currRotation = val; + if (val !== "") { + + this.rotate(Number(val)); + } + break; + case "positionHorizontal": + this._currPositionHorizontal = val; if (val !== "") { + + this.editProperties(this._currPositionHorizontal, "horizontal"); + } + + break; + case "positionVertical": + this._currPositionVertical = val; + if (val !== "") { + + this.editProperties(this._currPositionVertical, "vertical"); + } + + break; + default: + break; + } + } + } + + + + + // @action + // changeWidth = (event: React.ChangeEvent) => { + // console.log(event.target.value); + // this._currWidth = NumCast(event.target.value); + + // } + + @computed get upDown() { + const upDown =
+ +

+ +
; + return upDown; + } + + + @computed get widthPicker() { + var widthPicker = ; + if (this._widthBtn) { + widthPicker =
+ {widthPicker} + {this._width.map(wid => { + return ; + })} +
; + } + return widthPicker; + } + + + + render() { + const buttons = [ + + this.close, + this.modes, + this.subMenu + + ]; + + return this.getElementVert(buttons); + } +} +Scripting.addGlobal(function activatePen2(penBtn: any) { + if (penBtn) { + //no longer changes to inkmode + // Doc.SetSelectedTool(InkTool.Pen); + FormatShapePane.Instance.jumpTo(300, 300); + FormatShapePane.Instance.Pinned = true; + + } else { + // Doc.SetSelectedTool(InkTool.None); + FormatShapePane.Instance.Pinned = false; + FormatShapePane.Instance.fadeOut(true); + + } +}); \ No newline at end of file diff --git a/src/client/views/collections/collectionFreeForm/InkOptionsMenu.scss b/src/client/views/collections/collectionFreeForm/InkOptionsMenu.scss index 7329f4fc1..f739fcc8c 100644 --- a/src/client/views/collections/collectionFreeForm/InkOptionsMenu.scss +++ b/src/client/views/collections/collectionFreeForm/InkOptionsMenu.scss @@ -32,7 +32,7 @@ } .btn2-group { - display: block; + display: grid; background: #323232; grid-template-columns: auto; diff --git a/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx b/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx index 7de70b8cd..e4f3248d0 100644 --- a/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx +++ b/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx @@ -36,14 +36,15 @@ export default class InkOptionsMenu extends AntimodeMenu { // private _arrowEnd = ["none", "arrowEnd", "none", "dot", "none"]; // private _arrowIcons = ["→", "↔︎", "•", "••", " "]; private _draw = ["⎯", "→", "↔︎", "∿", "↝", "↭", "ロ", "O", "∆"]; - private _head = ["none", "arrowHead", "arrowHead", "none", "arrowHead", "arrowHead", "none", "none", "none"]; - private _end = ["none", "none", "arrowEnd", "none", "none", "arrowEnd", "none", "none", "none"]; + private _head = ["none", "none", "arrowHead", "none", "none", "arrowHead", "none", "none", "none"]; + private _end = ["none", "arrowEnd", "arrowEnd", "none", "arrowEnd", "arrowEnd", "none", "none", "none"]; private _shape = ["", "", "", "", "", "", "rectangle", "circle", "triangle"]; @observable _shapesNum = this._shape.length; @observable _selected = this._shapesNum; @observable private collapsed: boolean = false; + @observable _double = ""; @observable _colorBtn = false; @observable _widthBtn = false; @@ -155,7 +156,7 @@ export default class InkOptionsMenu extends AntimodeMenu { className="antimodeMenu-button" key={icon} onPointerDown={action(() => { - console.log(this._selected); + this._double = ""; if (this._selected !== i) { this._selected = i; @@ -177,6 +178,31 @@ export default class InkOptionsMenu extends AntimodeMenu { } console.log(this._selected); + })} + onDoubleClick={action(() => { + console.log("double"); + this._double = this._draw[i]; + if (this._selected !== i) { + this._selected = i; + Doc.SetSelectedTool(InkTool.Pen); + SetActiveArrowStart(this._head[i]); + SetActiveArrowEnd(this._end[i]); + SetActiveBezierApprox("300"); + + // this.editProperties(this._head[i], "arrowStart"), this.editProperties(this._end[i], "arrowEnd"); + GestureOverlay.Instance.InkShape = this._shape[i]; + } else { + this._selected = this._shapesNum; + Doc.SetSelectedTool(InkTool.None); + SetActiveArrowStart("none"); + SetActiveArrowEnd("none"); + GestureOverlay.Instance.InkShape = ""; + SetActiveBezierApprox("0"); + + } + + + })} style={{ backgroundColor: i === this._selected ? "121212" : "", fontSize: "20" }}> {this._draw[i]} @@ -235,7 +261,7 @@ export default class InkOptionsMenu extends AntimodeMenu { className="antimodeMenu-button" key={wid} onPointerDown={action(() => { SetActiveInkWidth(wid); this._widthBtn = false; this.editProperties(wid, "width"); })} - style={{ backgroundColor: this._widthBtn ? "121212" : "" }}> + style={{ backgroundColor: this._widthBtn ? "121212" : "", zIndex: 1001 }}> {wid} ; })} @@ -265,7 +291,7 @@ export default class InkOptionsMenu extends AntimodeMenu { className="antimodeMenu-button" key={color} onPointerDown={action(() => { this.changeColor(color, "color"); this._colorBtn = false; this.editProperties(color, "color"); })} - style={{ backgroundColor: this._colorBtn ? "121212" : "" }}> + style={{ backgroundColor: this._colorBtn ? "121212" : "", zIndex: 1001 }}> {/* */}
; @@ -286,14 +312,14 @@ export default class InkOptionsMenu extends AntimodeMenu {
; if (this._fillBtn) { - fillPicker =
+ fillPicker =
{fillPicker} {this._palette.map(color => { return ; })} -- cgit v1.2.3-70-g09d2 From 3439640aad338bb8ff0e12df637e1b4509684001 Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Sun, 12 Jul 2020 13:05:42 -0400 Subject: fixed stroke alignment with docked menus. fixed initializing InkingStrokes --- src/client/documents/Documents.ts | 14 ++--- src/client/views/GestureOverlay.tsx | 103 +++++++++++------------------------- src/client/views/MainView.tsx | 8 +-- src/fields/documentSchemas.ts | 3 ++ 4 files changed, 40 insertions(+), 88 deletions(-) (limited to 'src/client/documents') diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts index 26abd4c3c..72b716492 100644 --- a/src/client/documents/Documents.ts +++ b/src/client/documents/Documents.ts @@ -671,12 +671,12 @@ export namespace Docs { I.type = DocumentType.INK; I.layout = InkingStroke.LayoutString("data"); I.color = color; + I.fillColor = fillColor; I.strokeWidth = Number(strokeWidth); I.strokeBezier = strokeBezier; - I.fillColor = fillColor; - I.arrowStart = arrowStart; - I.arrowEnd = arrowEnd; - I.dash = dash; + I.strokeStartMarker = arrowStart; + I.strokeEndMarker = arrowEnd; + I.strokeDash = dash; I.tool = tool; I.title = "ink"; I.x = options.x; @@ -688,12 +688,6 @@ export namespace Docs { I.rotation = 0; I.data = new InkField(points); return I; - // return I; - // const doc = InstanceFromProto(Prototypes.get(DocumentType.INK), new InkField(points), options); - // doc.color = color; - // doc.strokeWidth = strokeWidth; - // doc.tool = tool; - // return doc; } export function PdfDocument(url: string, options: DocumentOptions = {}) { diff --git a/src/client/views/GestureOverlay.tsx b/src/client/views/GestureOverlay.tsx index fc8530811..768057c22 100644 --- a/src/client/views/GestureOverlay.tsx +++ b/src/client/views/GestureOverlay.tsx @@ -7,9 +7,8 @@ import { Cast, FieldValue, NumCast } from "../../fields/Types"; import MobileInkOverlay from "../../mobile/MobileInkOverlay"; import { GestureUtils } from "../../pen-gestures/GestureUtils"; import { MobileInkOverlayContent } from "../../server/Message"; -import { emptyFunction, emptyPath, returnEmptyString, returnFalse, returnOne, returnTrue, returnZero, returnEmptyFilter } from "../../Utils"; +import { emptyFunction, emptyPath, returnEmptyString, returnFalse, returnOne, returnTrue, returnZero, returnEmptyFilter, setupMoveUpEvents } from "../../Utils"; import { CognitiveServices } from "../cognitive_services/CognitiveServices"; -import { DocServer } from "../DocServer"; import { DocUtils } from "../documents/Documents"; import { CurrentUserUtils } from "../util/CurrentUserUtils"; import { InteractionUtils } from "../util/InteractionUtils"; @@ -23,7 +22,6 @@ import { RadialMenu } from "./nodes/RadialMenu"; import HorizontalPalette from "./Palette"; import { Touchable } from "./Touchable"; import TouchScrollableMenu, { TouchScrollableMenuItem } from "./TouchScrollableMenu"; -import HeightLabel from "./collections/collectionMulticolumn/MultirowHeightLabel"; import InkOptionsMenu from "./collections/collectionFreeForm/InkOptionsMenu"; @observer @@ -56,6 +54,7 @@ export default class GestureOverlay extends Touchable { @observable private showMobileInkOverlay: boolean = false; + private _overlayRef = React.createRef(); private _d1: Doc | undefined; private _inkToTextDoc: Doc | undefined; private _thumbDoc: Doc | undefined; @@ -498,39 +497,26 @@ export default class GestureOverlay extends Touchable { onPointerDown = (e: React.PointerEvent) => { if (InteractionUtils.IsType(e, InteractionUtils.PENTYPE) || (Doc.GetSelectedTool() === InkTool.Highlighter || Doc.GetSelectedTool() === InkTool.Pen)) { this._points.push({ X: e.clientX, Y: e.clientY }); - e.stopPropagation(); - e.preventDefault(); - - document.removeEventListener("pointermove", this.onPointerMove); - document.removeEventListener("pointerup", this.onPointerUp); - document.addEventListener("pointermove", this.onPointerMove); - document.addEventListener("pointerup", this.onPointerUp); + setupMoveUpEvents(this, e, this.onPointerMove, this.onPointerUp, emptyFunction); } } @action onPointerMove = (e: PointerEvent) => { - if (InteractionUtils.IsType(e, InteractionUtils.PENTYPE) || (Doc.GetSelectedTool() === InkTool.Highlighter || Doc.GetSelectedTool() === InkTool.Pen)) { - this._points.push({ X: e.clientX, Y: e.clientY }); - e.stopPropagation(); - e.preventDefault(); - - - if (this._points.length > 1) { - const B = this.svgBounds; - const initialPoint = this._points[0.]; - const xInGlass = initialPoint.X > (this._thumbX ?? Number.MAX_SAFE_INTEGER) && initialPoint.X < (this._thumbX ?? Number.MAX_SAFE_INTEGER) + this.height; - const yInGlass = initialPoint.Y > (this._thumbY ?? Number.MAX_SAFE_INTEGER) - this.height && initialPoint.Y < (this._thumbY ?? Number.MAX_SAFE_INTEGER); - if (this.Tool !== ToolglassTools.None && xInGlass && yInGlass) { - switch (this.Tool) { - case ToolglassTools.RadialMenu: - document.removeEventListener("pointermove", this.onPointerMove); - document.removeEventListener("pointerup", this.onPointerUp); - //this.handle1PointerHoldStart(e); - } + this._points.push({ X: e.clientX, Y: e.clientY }); + + if (this._points.length > 1) { + const B = this.svgBounds; + const initialPoint = this._points[0.]; + const xInGlass = initialPoint.X > (this._thumbX ?? Number.MAX_SAFE_INTEGER) && initialPoint.X < (this._thumbX ?? Number.MAX_SAFE_INTEGER) + this.height; + const yInGlass = initialPoint.Y > (this._thumbY ?? Number.MAX_SAFE_INTEGER) - this.height && initialPoint.Y < (this._thumbY ?? Number.MAX_SAFE_INTEGER); + if (this.Tool !== ToolglassTools.None && xInGlass && yInGlass) { + switch (this.Tool) { + case ToolglassTools.RadialMenu: return true; } } } + return false; } handleLineGesture = (): boolean => { @@ -589,8 +575,6 @@ export default class GestureOverlay extends Touchable { if (this.Tool !== ToolglassTools.None && xInGlass && yInGlass) { switch (this.Tool) { case ToolglassTools.InkToText: - document.removeEventListener("pointermove", this.onPointerMove); - document.removeEventListener("pointerup", this.onPointerUp); this._strokes.push(new Array(...this._points)); this._points = []; CognitiveServices.Inking.Appliers.InterpretStrokes(this._strokes).then((results) => { @@ -635,50 +619,27 @@ export default class GestureOverlay extends Touchable { let actionPerformed = false; if (result && result.Score > 0.7) { switch (result.Name) { - case GestureUtils.Gestures.Box: - this.dispatchGesture(GestureUtils.Gestures.Box); - actionPerformed = true; - break; - case GestureUtils.Gestures.StartBracket: - this.dispatchGesture(GestureUtils.Gestures.StartBracket); - actionPerformed = true; - break; - case GestureUtils.Gestures.EndBracket: - this.dispatchGesture("endbracket"); - actionPerformed = true; - break; - case GestureUtils.Gestures.Line: - actionPerformed = this.handleLineGesture(); - break; - case GestureUtils.Gestures.Triangle: - this.makePolygon("triangle", true); - break; - case GestureUtils.Gestures.Circle: - this.makePolygon("circle", true); - break; - case GestureUtils.Gestures.Rectangle: - this.makePolygon("rectangle", true); - break; - case GestureUtils.Gestures.Scribble: - console.log("scribble"); - break; - } - if (actionPerformed) { - this._points = []; + case GestureUtils.Gestures.Box: actionPerformed = this.dispatchGesture(GestureUtils.Gestures.Box); break; + case GestureUtils.Gestures.StartBracket: actionPerformed = this.dispatchGesture(GestureUtils.Gestures.StartBracket); break; + case GestureUtils.Gestures.EndBracket: actionPerformed = this.dispatchGesture("endbracket"); break; + case GestureUtils.Gestures.Line: actionPerformed = this.handleLineGesture(); break; + case GestureUtils.Gestures.Triangle: actionPerformed = this.makePolygon("triangle", true); break; + case GestureUtils.Gestures.Circle: actionPerformed = this.makePolygon("circle", true); break; + case GestureUtils.Gestures.Rectangle: actionPerformed = this.makePolygon("rectangle", true); break; + case GestureUtils.Gestures.Scribble: console.log("scribble"); break; } } // if no gesture (or if the gesture was unsuccessful), "dry" the stroke into an ink document if (!actionPerformed) { this.dispatchGesture(GestureUtils.Gestures.Stroke); - this._points = []; } + this._points = []; } } else { this._points = []; } //get out of ink mode after each stroke= - console.log("now"); if (InkOptionsMenu.Instance._double === "") { Doc.SetSelectedTool(InkTool.None); InkOptionsMenu.Instance._selected = InkOptionsMenu.Instance._shapesNum; @@ -687,9 +648,6 @@ export default class GestureOverlay extends Touchable { SetActiveArrowEnd("none"); GestureOverlay.Instance.SavedArrowEnd = ActiveArrowEnd(); } - document.removeEventListener("pointermove", this.onPointerMove); - document.removeEventListener("pointerup", this.onPointerUp); - } makePolygon = (shape: string, gesture: boolean) => { @@ -700,7 +658,7 @@ export default class GestureOverlay extends Touchable { var bottom = Math.max(...ys); var top = Math.min(...ys); if (shape === "noRec") { - return; + return false; } if (!gesture) { //if shape options is activated in inkOptionMenu @@ -781,11 +739,12 @@ export default class GestureOverlay extends Touchable { this._points.push({ X: x2, Y: y2 }); // this._points.push({ X: x1, Y: y1 - 1 }); } + return true; } dispatchGesture = (gesture: "box" | "line" | "startbracket" | "endbracket" | "stroke" | "scribble" | "text", stroke?: InkData, data?: any) => { const target = document.elementFromPoint((stroke ?? this._points)[0].X, (stroke ?? this._points)[0].Y); - target?.dispatchEvent( + return target?.dispatchEvent( new CustomEvent("dashOnGesture", { bubbles: true, @@ -797,7 +756,7 @@ export default class GestureOverlay extends Touchable { } } ) - ); + ) || false; } getBounds = (stroke: InkData) => { @@ -816,10 +775,11 @@ export default class GestureOverlay extends Touchable { @computed get elements() { const width = Number(ActiveInkWidth()); + const rect = this._overlayRef.current?.getBoundingClientRect(); const B = this.svgBounds; B.left = B.left - width / 2; B.right = B.right + width / 2; - B.top = B.top - width / 2; + B.top = B.top - width / 2 - (rect?.y || 0); B.bottom = B.bottom + width / 2; B.width += width; B.height += width; @@ -836,7 +796,7 @@ export default class GestureOverlay extends Touchable { }), this._points.length <= 1 ? (null) : - {InteractionUtils.CreatePolyline(this._points, B.left, B.top, ActiveInkColor(), width, width, ActiveInkBezierApprox(), ActiveFillColor(), ActiveArrowStart(), ActiveArrowEnd(), ActiveDash(), 1, 1, this.InkShape, "none", false, false)} + {InteractionUtils.CreatePolyline(this._points.map(p => ({ X: p.X, Y: p.Y - (rect?.y || 0) })), B.left, B.top, ActiveInkColor(), width, width, ActiveInkBezierApprox(), ActiveFillColor(), ActiveArrowStart(), ActiveArrowEnd(), ActiveDash(), 1, 1, this.InkShape, "none", false, false)} ] ]; } @@ -885,8 +845,7 @@ export default class GestureOverlay extends Touchable { render() { return ( - -
{this.showMobileInkOverlay ? : <>} {this.elements} diff --git a/src/client/views/MainView.tsx b/src/client/views/MainView.tsx index ab23a6ee9..b9ee58d5d 100644 --- a/src/client/views/MainView.tsx +++ b/src/client/views/MainView.tsx @@ -610,13 +610,9 @@ export class MainView extends React.Component { - - + + - - - - {this.mainContent} diff --git a/src/fields/documentSchemas.ts b/src/fields/documentSchemas.ts index 97f62c9d4..c1659d4d5 100644 --- a/src/fields/documentSchemas.ts +++ b/src/fields/documentSchemas.ts @@ -73,6 +73,9 @@ export const documentSchema = createSchema({ opacity: "number", // opacity of document strokeWidth: "number", strokeBezier: "number", + strokeStartMarker: "string", + strokeEndMarker: "string", + strokeDash: "string", textTransform: "string", treeViewOpen: "boolean", // flag denoting whether the documents sub-tree (contents) is visible or hidden treeViewExpandedView: "string", // name of field whose contents are being displayed as the document's subtree -- cgit v1.2.3-70-g09d2 From 0b0183de3a13649819983203e2aba1dc6b84fdb1 Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Sun, 12 Jul 2020 23:34:34 -0400 Subject: fixed updating RichTextMenu with proper values for fontFamily, size, bullet, and alignment --- src/client/documents/Documents.ts | 2 +- src/client/util/CurrentUserUtils.ts | 15 +-- src/client/util/DragManager.ts | 2 +- src/client/views/animationtimeline/Timeline.tsx | 4 +- .../collectionFreeForm/CollectionFreeFormView.tsx | 2 +- .../collections/collectionFreeForm/MarqueeView.tsx | 2 +- src/client/views/nodes/DocumentView.tsx | 2 +- src/client/views/nodes/LabelBox.tsx | 2 +- src/client/views/nodes/SliderBox.tsx | 2 +- .../views/nodes/formattedText/FormattedTextBox.tsx | 7 +- .../views/nodes/formattedText/RichTextMenu.tsx | 111 ++++++++++++--------- .../views/nodes/formattedText/RichTextRules.ts | 2 +- src/fields/documentSchemas.ts | 2 +- 13 files changed, 88 insertions(+), 67 deletions(-) (limited to 'src/client/documents') diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts index 72b716492..a415e17c8 100644 --- a/src/client/documents/Documents.ts +++ b/src/client/documents/Documents.ts @@ -123,7 +123,7 @@ export interface DocumentOptions { isBackground?: boolean; isLinkButton?: boolean; _columnWidth?: number; - _fontSize?: number; + _fontSize?: string; _fontFamily?: string; curPage?: number; currentTimecode?: number; // the current timecode of a time-based document (e.g., current time of a video) value is in seconds diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts index ce910c062..39781a5ce 100644 --- a/src/client/util/CurrentUserUtils.ts +++ b/src/client/util/CurrentUserUtils.ts @@ -211,7 +211,7 @@ export class CurrentUserUtils { details.text = new RichTextField(JSON.stringify(detailedTemplate), buxtonFieldKeys.join(" ")); const shared = { _chromeStatus: "disabled", _autoHeight: true, _xMargin: 0 }; - const detailViewOpts = { title: "detailView", _width: 300, _fontFamily: "Arial", _fontSize: 12 }; + const detailViewOpts = { title: "detailView", _width: 300, _fontFamily: "Arial", _fontSize: "12pt" }; const descriptionWrapperOpts = { title: "descriptions", _height: 300, _columnWidth: -1, treeViewHideTitle: true, _pivotField: "title" }; const descriptionWrapper = MasonryDocument([details, short, long], { ...shared, ...descriptionWrapperOpts }); @@ -525,13 +525,13 @@ export class CurrentUserUtils { // Sets up the title of the button static mobileButtonText = (opts: DocumentOptions, buttonTitle: string) => Docs.Create.TextDocument(buttonTitle, { ...opts, - dropAction: undefined, title: buttonTitle, _fontSize: 37, _xMargin: 0, _yMargin: 0, ignoreClick: true, _chromeStatus: "disabled", backgroundColor: "rgba(0,0,0,0)" + dropAction: undefined, title: buttonTitle, _fontSize: "37pt", _xMargin: 0, _yMargin: 0, ignoreClick: true, _chromeStatus: "disabled", backgroundColor: "rgba(0,0,0,0)" }) as any as Doc // Sets up the description of the button static mobileButtonInfo = (opts: DocumentOptions, buttonInfo: string) => Docs.Create.TextDocument(buttonInfo, { ...opts, - dropAction: undefined, title: "info", _fontSize: 25, _xMargin: 0, _yMargin: 0, ignoreClick: true, _chromeStatus: "disabled", backgroundColor: "rgba(0,0,0,0)", _dimMagnitude: 2, + dropAction: undefined, title: "info", _fontSize: "25pt", _xMargin: 0, _yMargin: 0, ignoreClick: true, _chromeStatus: "disabled", backgroundColor: "rgba(0,0,0,0)", _dimMagnitude: 2, }) as any as Doc @@ -598,7 +598,7 @@ export class CurrentUserUtils { _width: 500, lockedPosition: true, _chromeStatus: "disabled", title: "tools stack", forceActive: true })) as any as Doc; doc["tabs-button-tools"] = new PrefetchProxy(Docs.Create.ButtonDocument({ - _width: 35, _height: 25, title: "Tools", _fontSize: 10, + _width: 35, _height: 25, title: "Tools", _fontSize: "10pt", letterSpacing: "0px", textTransform: "unset", borderRounding: "5px 5px 0px 0px", boxShadow: "3px 3px 0px rgb(34, 34, 34)", sourcePanel: toolsStack, onDragStart: ScriptField.MakeFunction('getAlias(this.dragFactory, true)'), @@ -663,7 +663,7 @@ export class CurrentUserUtils { lockedPosition: true, boxShadow: "0 0", dontRegisterChildViews: true, targetDropAction: "same" })) as any as Doc; doc["tabs-button-library"] = new PrefetchProxy(Docs.Create.ButtonDocument({ - _width: 50, _height: 25, title: "Library", _fontSize: 10, targetDropAction: "same", + _width: 50, _height: 25, title: "Library", _fontSize: "10pt", targetDropAction: "same", letterSpacing: "0px", textTransform: "unset", borderRounding: "5px 5px 0px 0px", boxShadow: "3px 3px 0px rgb(34, 34, 34)", sourcePanel: libraryStack, onDragStart: ScriptField.MakeFunction('getAlias(this.dragFactory, true)'), @@ -681,7 +681,7 @@ export class CurrentUserUtils { static setupSearchBtnPanel(doc: Doc, sidebarContainer: Doc) { if (doc["tabs-button-search"] === undefined) { doc["tabs-button-search"] = new PrefetchProxy(Docs.Create.ButtonDocument({ - _width: 50, _height: 25, title: "Search", _fontSize: 10, + _width: 50, _height: 25, title: "Search", _fontSize: "10pt", letterSpacing: "0px", textTransform: "unset", borderRounding: "5px 5px 0px 0px", boxShadow: "3px 3px 0px rgb(34, 34, 34)", sourcePanel: new PrefetchProxy(Docs.Create.QueryDocument({ title: "search stack", })) as any as Doc, searchFileTypes: new List([DocumentType.RTF, DocumentType.IMG, DocumentType.PDF, DocumentType.VID, DocumentType.WEB, DocumentType.SCRIPTING]), @@ -824,7 +824,8 @@ export class CurrentUserUtils { doc.activeArrowStart = StrCast(doc.activeArrowStart, ""); doc.activeArrowEnd = StrCast(doc.activeArrowEnd, ""); doc.activeDash = StrCast(doc.activeDash, "0"); - doc.fontSize = NumCast(doc.fontSize, 12); + doc.fontSize = StrCast(doc.fontSize, "12pt"); + doc.fontFamily = StrCast(doc.fontFamily, "Arial"); doc["constants-snapThreshold"] = NumCast(doc["constants-snapThreshold"], 10); // doc["constants-dragThreshold"] = NumCast(doc["constants-dragThreshold"], 4); // Utils.DRAG_THRESHOLD = NumCast(doc["constants-dragThreshold"]); diff --git a/src/client/util/DragManager.ts b/src/client/util/DragManager.ts index 64c3d8458..5f34509a1 100644 --- a/src/client/util/DragManager.ts +++ b/src/client/util/DragManager.ts @@ -323,7 +323,7 @@ export namespace DragManager { dragLabel = document.createElement("div"); dragLabel.className = "dragManager-dragLabel"; dragLabel.style.zIndex = "100001"; - dragLabel.style.fontSize = "10"; + dragLabel.style.fontSize = "10pt"; dragLabel.style.position = "absolute"; // dragLabel.innerText = "press 'a' to embed on drop"; // bcz: need to move this to a status bar dragDiv.appendChild(dragLabel); diff --git a/src/client/views/animationtimeline/Timeline.tsx b/src/client/views/animationtimeline/Timeline.tsx index f54bd3aff..eac30ca75 100644 --- a/src/client/views/animationtimeline/Timeline.tsx +++ b/src/client/views/animationtimeline/Timeline.tsx @@ -385,10 +385,10 @@ export class Timeline extends React.Component { const ttime = `Total: ${this.toReadTime(this._time)}`; return (
-
+
{ctime}
-
+
{ttime}
diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx index 2191021d2..ef6ea8f99 100644 --- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx +++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx @@ -1034,7 +1034,7 @@ export class CollectionFreeFormView extends CollectionSubView val === undefined) ? undefined : { ele:
diff --git a/src/client/views/collections/collectionFreeForm/MarqueeView.tsx b/src/client/views/collections/collectionFreeForm/MarqueeView.tsx index b47236bea..2db665337 100644 --- a/src/client/views/collections/collectionFreeForm/MarqueeView.tsx +++ b/src/client/views/collections/collectionFreeForm/MarqueeView.tsx @@ -129,7 +129,7 @@ export class MarqueeView extends React.Component(Docu background: finalColor, opacity: finalOpacity, fontFamily: StrCast(this.Document._fontFamily, "inherit"), - fontSize: Cast(this.Document._fontSize, "number", null) + fontSize: Cast(this.Document._fontSize, "string", null) }}> {this.onClickHandler && this.props.ContainingCollectionView?.props.Document._viewType === CollectionViewType.Time ? <> {this.innards} diff --git a/src/client/views/nodes/LabelBox.tsx b/src/client/views/nodes/LabelBox.tsx index 360ead18e..836ef4149 100644 --- a/src/client/views/nodes/LabelBox.tsx +++ b/src/client/views/nodes/LabelBox.tsx @@ -67,7 +67,7 @@ export class LabelBox extends ViewBoxBaseComponent
this._editorView && RichTextMenu.Instance.updateFromDash(this._editorView, undefined, this.props), 0); - } else if (FormattedTextBoxComment.textBox === this) { + setTimeout(() => this._editorView && RichTextMenu.Instance.updateFromDash(this._editorView, undefined, this.props), this.props.isSelected() ? 10 : 0); // need to make sure that we update a text box that is selected after updating the one that was deselected + if (!this.props.isSelected() && FormattedTextBoxComment.textBox === this) { setTimeout(() => FormattedTextBoxComment.Hide(), 0); } const selPad = this.props.isSelected() ? -10 : 0; @@ -1376,7 +1375,7 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp opacity: this.props.hideOnLeave ? (this._entered ? 1 : 0.1) : 1, color: this.props.color ? this.props.color : StrCast(this.layoutDoc[this.props.fieldKey + "-color"], this.props.hideOnLeave ? "white" : "inherit"), pointerEvents: interactive ? undefined : "none", - fontSize: Cast(this.layoutDoc._fontSize, "number", null), + fontSize: Cast(this.layoutDoc._fontSize, "string", null), fontFamily: StrCast(this.layoutDoc._fontFamily, "inherit"), transition: "opacity 1s" }} diff --git a/src/client/views/nodes/formattedText/RichTextMenu.tsx b/src/client/views/nodes/formattedText/RichTextMenu.tsx index 1a8a4ceb7..a70f879ff 100644 --- a/src/client/views/nodes/formattedText/RichTextMenu.tsx +++ b/src/client/views/nodes/formattedText/RichTextMenu.tsx @@ -11,7 +11,7 @@ import { EditorState, NodeSelection, TextSelection } from "prosemirror-state"; import { EditorView } from "prosemirror-view"; import { Doc } from "../../../../fields/Doc"; import { DarkPastelSchemaPalette, PastelSchemaPalette } from '../../../../fields/SchemaHeaderField'; -import { Cast, StrCast, BoolCast } from "../../../../fields/Types"; +import { Cast, StrCast, BoolCast, NumCast } from "../../../../fields/Types"; import { unimplementedFunction, Utils } from "../../../../Utils"; import { DocServer } from "../../../DocServer"; import { LinkManager } from "../../../util/LinkManager"; @@ -112,6 +112,7 @@ export default class RichTextMenu extends AntimodeMenu { { node: schema.nodes.ordered_list.create({ mapStyle: "bullet" }), title: "Set list type", label: ":", command: this.changeListType }, { node: schema.nodes.ordered_list.create({ mapStyle: "decimal" }), title: "Set list type", label: "1.1", command: this.changeListType }, { node: schema.nodes.ordered_list.create({ mapStyle: "multi" }), title: "Set list type", label: "A.1", command: this.changeListType }, + { node: schema.nodes.ordered_list.create({ mapStyle: "" }), title: "Set list type", label: "", command: this.changeListType }, //{ node: undefined, title: "Set list type", label: "Remove", command: this.changeListType }, ]; @@ -217,7 +218,7 @@ export default class RichTextMenu extends AntimodeMenu { // finds font sizes and families in selection getActiveAlignment() { - if (this.view) { + if (this.view && this.TextView.props.isSelected()) { const path = (this.view.state.selection.$from as any).path; for (let i = path.length - 3; i < path.length && i >= 0; i -= 3) { if (path[i]?.type === this.view.state.schema.nodes.paragraph) { @@ -230,15 +231,18 @@ export default class RichTextMenu extends AntimodeMenu { // finds font sizes and families in selection getActiveListStyle() { - if (this.view) { + if (this.view && this.TextView.props.isSelected()) { const path = (this.view.state.selection.$from as any).path; for (let i = 0; i < path.length; i += 3) { if (path[i].type === this.view.state.schema.nodes.ordered_list) { return path[i].attrs.mapStyle; } } + if (this.view.state.selection.$from.nodeAfter?.type === this.view.state.schema.nodes.ordered_list) { + return this.view.state.selection.$from.nodeAfter?.attrs.mapStyle; + } } - return "decimal"; + return ""; } // finds font sizes and families in selection @@ -247,16 +251,21 @@ export default class RichTextMenu extends AntimodeMenu { const activeFamilies: string[] = []; const activeSizes: string[] = []; - const state = this.view.state; - const pos = this.view.state.selection.$from; - const ref_node = this.reference_node(pos); - if (ref_node && ref_node !== this.view.state.doc && ref_node.isText) { - ref_node.marks.forEach(m => { - m.type === state.schema.marks.pFontFamily && activeFamilies.push(m.attrs.family); - m.type === state.schema.marks.pFontSize && activeSizes.push(String(m.attrs.fontSize) + "pt"); - }); + if (this.TextView.props.isSelected()) { + const state = this.view.state; + const pos = this.view.state.selection.$from; + const ref_node = this.reference_node(pos); + if (ref_node && ref_node !== this.view.state.doc && ref_node.isText) { + ref_node.marks.forEach(m => { + m.type === state.schema.marks.pFontFamily && activeFamilies.push(m.attrs.family); + m.type === state.schema.marks.pFontSize && activeSizes.push(String(m.attrs.fontSize) + "pt"); + }); + } + !activeFamilies.length && (activeFamilies.push(StrCast(this.TextView.layoutDoc._fontFamily, StrCast(Doc.UserDoc().fontFamily)))); + !activeSizes.length && (activeSizes.push(StrCast(this.TextView.layoutDoc._fontSize, StrCast(Doc.UserDoc().fontSize)))); } - + !activeFamilies.length && (activeFamilies.push(StrCast(Doc.UserDoc().fontFamily))); + !activeSizes.length && (activeSizes.push(StrCast(Doc.UserDoc().fontSize))); return { activeFamilies, activeSizes }; } @@ -269,14 +278,14 @@ export default class RichTextMenu extends AntimodeMenu { //finds all active marks on selection in given group getActiveMarksOnSelection() { - if (!this.view) return; + let activeMarks: MarkType[] = []; + if (!this.view || !this.TextView.props.isSelected()) return activeMarks; const markGroup = [schema.marks.strong, schema.marks.em, schema.marks.underline, schema.marks.strikethrough, schema.marks.superscript, schema.marks.subscript]; if (this.view.state.storedMarks) return this.view.state.storedMarks.map(mark => mark.type); //current selection const { empty, ranges, $to } = this.view.state.selection as TextSelection; const state = this.view.state; - let activeMarks: MarkType[] = []; if (!empty) { activeMarks = markGroup.filter(mark => { const has = false; @@ -357,13 +366,9 @@ export default class RichTextMenu extends AntimodeMenu { createMarksDropdown(activeOption: string, options: { mark: Mark | null, title: string, label: string, command: (mark: Mark, view: EditorView) => void, hidden?: boolean, style?: {} }[], key: string): JSX.Element { const items = options.map(({ title, label, hidden, style }) => { if (hidden) { - return label === activeOption ? - : - ; + return ; } - return label === activeOption ? - : - ; + return ; }); const self = this; @@ -372,37 +377,42 @@ export default class RichTextMenu extends AntimodeMenu { e.preventDefault(); self.TextView.endUndoTypingBatch(); options.forEach(({ label, mark, command }) => { - if (e.target.value === label) { - UndoManager.RunInBatch(() => self.view && mark && command(mark, self.view), "text mark dropdown"); + if (e.target.value === label && mark) { + if (!self.TextView.props.isSelected()) { + switch (mark.type) { + case schema.marks.pFontFamily: Doc.UserDoc().fontFamily = mark.attrs.family; break; + case schema.marks.pFontSize: Doc.UserDoc().fontSize = mark.attrs.fontSize.toString() + "pt"; break; + } + } + else UndoManager.RunInBatch(() => self.view && mark && command(mark, self.view), "text mark dropdown"); } }); } - return ; + return ; } - createNodesDropdown(activeMap: string, options: { node: NodeType | any | null, title: string, label: string, command: (node: NodeType | any) => void, hidden?: boolean, style?: {} }[], key: string): JSX.Element { - const activeOption = activeMap === "bullet" ? ":" : activeMap === "decimal" ? "1.1" : "A.1"; + createNodesDropdown(activeMap: string, options: { node: NodeType | any | null, title: string, label: string, command: (node: NodeType | any) => void, hidden?: boolean, style?: {} }[], key: string, setter: (val: string) => {}): JSX.Element { + const activeOption = activeMap === "bullet" ? ":" : activeMap === "decimal" ? "1.1" : activeMap === "multi" ? "A.1" : ""; const items = options.map(({ title, label, hidden, style }) => { if (hidden) { - return label === activeOption ? - : - ; + return ; } - return label === activeOption ? - : - ; + return ; }); const self = this; function onChange(val: string) { self.TextView.endUndoTypingBatch(); options.forEach(({ label, node, command }) => { - if (val === label) { - UndoManager.RunInBatch(() => self.view && node && command(node), "nodes dropdown"); + if (val === label && node) { + if (self.TextView.props.isSelected()) { + UndoManager.RunInBatch(() => self.view && node && command(node), "nodes dropdown"); + setter(val); + } } }); } - return ; + return ; } changeFontSize = (mark: Mark, view: EditorView) => { @@ -416,10 +426,21 @@ export default class RichTextMenu extends AntimodeMenu { // TODO: remove doesn't work //remove all node type and apply the passed-in one to the selected text changeListType = (nodeType: Node | undefined) => { - if (!this.view) return; + if (!this.view || (nodeType as any)?.attrs.mapStyle === "") return; + + const nextIsOL = this.view.state.selection.$from.nodeAfter?.type === schema.nodes.ordered_list; + let inList: any = undefined; + let fromList = -1; + let path: any = Array.from((this.view.state.selection.$from as any).path); + for (let i = 0; i < path.length; i++) { + if (path[i]?.type === schema.nodes.ordered_list) { + inList = path[i]; + fromList = path[i - 1]; + } + } const marks = this.view.state.storedMarks || (this.view.state.selection.$to.parentOffset && this.view.state.selection.$from.marks()); - if (!wrapInList(schema.nodes.ordered_list)(this.view.state, (tx2: any) => { + if (inList || !wrapInList(schema.nodes.ordered_list)(this.view.state, (tx2: any) => { const tx3 = updateBullets(tx2, schema, nodeType && (nodeType as any).attrs.mapStyle, this.view!.state.selection.from - 1, this.view!.state.selection.to + 1); marks && tx3.ensureMarks([...marks]); marks && tx3.setStoredMarks([...marks]); @@ -427,12 +448,12 @@ export default class RichTextMenu extends AntimodeMenu { this.view!.dispatch(tx2); })) { const tx2 = this.view.state.tr; - if (nodeType && this.view.state.selection.$from.nodeAfter?.type === schema.nodes.ordered_list) { - const tx3 = updateBullets(tx2, schema, nodeType && (nodeType as any).attrs.mapStyle, this.view.state.selection.from, this.view.state.selection.to); + if (nodeType && (inList || nextIsOL)) { + const tx3 = updateBullets(tx2, schema, nodeType && (nodeType as any).attrs.mapStyle, inList ? fromList : this.view.state.selection.from, + inList ? fromList + inList.nodeSize : this.view.state.selection.to); marks && tx3.ensureMarks([...marks]); marks && tx3.setStoredMarks([...marks]); - - this.view.dispatch(tx3.setSelection(new NodeSelection(tx3.doc.resolve(this.view.state.selection.$from.pos)))); + this.view.dispatch(tx3); } } } @@ -448,13 +469,13 @@ export default class RichTextMenu extends AntimodeMenu { return true; } alignCenter = (state: EditorState, dispatch: any) => { - return this.alignParagraphs(state, "center", dispatch); + return this.TextView.props.isSelected() && this.alignParagraphs(state, "center", dispatch); } alignLeft = (state: EditorState, dispatch: any) => { - return this.alignParagraphs(state, "left", dispatch); + return this.TextView.props.isSelected() && this.alignParagraphs(state, "left", dispatch); } alignRight = (state: EditorState, dispatch: any) => { - return this.alignParagraphs(state, "right", dispatch); + return this.TextView.props.isSelected() && this.alignParagraphs(state, "right", dispatch); } alignParagraphs(state: EditorState, align: "left" | "right" | "center", dispatch: any) { @@ -914,7 +935,7 @@ export default class RichTextMenu extends AntimodeMenu { {[this.createMarksDropdown(this.activeFontSize, this.fontSizeOptions, "font size"), this.createMarksDropdown(this.activeFontFamily, this.fontFamilyOptions, "font family"),
, - this.createNodesDropdown(this.activeListType, this.listTypeOptions, "nodes"), + this.createNodesDropdown(this.activeListType, this.listTypeOptions, "nodes", action((val: string) => this.activeListType = val)), this.createButton("sort-amount-down", "Summarize", undefined, this.insertSummarizer), this.createButton("quote-left", "Blockquote", undefined, this.insertBlockquote), this.createButton("minus", "Horizontal Rule", undefined, this.insertHorizontalRule), diff --git a/src/client/views/nodes/formattedText/RichTextRules.ts b/src/client/views/nodes/formattedText/RichTextRules.ts index ca30dde9d..ef0fead4a 100644 --- a/src/client/views/nodes/formattedText/RichTextRules.ts +++ b/src/client/views/nodes/formattedText/RichTextRules.ts @@ -90,7 +90,7 @@ export class RichTextRules { textDoc.inlineTextCount = numInlines + 1; const inlineFieldKey = "inline" + numInlines; // which field on the text document this annotation will write to const inlineLayoutKey = "layout_" + inlineFieldKey; // the field holding the layout string that will render the inline annotation - const textDocInline = Docs.Create.TextDocument("", { layoutKey: inlineLayoutKey, _width: 75, _height: 35, annotationOn: textDoc, _autoHeight: true, _fontSize: 9, title: "inline comment" }); + const textDocInline = Docs.Create.TextDocument("", { layoutKey: inlineLayoutKey, _width: 75, _height: 35, annotationOn: textDoc, _autoHeight: true, _fontSize: "9pt", title: "inline comment" }); textDocInline.title = inlineFieldKey; // give the annotation its own title textDocInline.customTitle = true; // And make sure that it's 'custom' so that editing text doesn't change the title of the containing doc textDocInline.isTemplateForField = inlineFieldKey; // this is needed in case the containing text doc is converted to a template at some point diff --git a/src/fields/documentSchemas.ts b/src/fields/documentSchemas.ts index c1659d4d5..61a37ef8a 100644 --- a/src/fields/documentSchemas.ts +++ b/src/fields/documentSchemas.ts @@ -55,7 +55,7 @@ export const documentSchema = createSchema({ _columnsHideIfEmpty: "boolean", // whether empty stacking view column headings should be hidden _columnHeaders: listSpec(SchemaHeaderField), // header descriptions for stacking/masonry _schemaHeaders: listSpec(SchemaHeaderField), // header descriptions for schema views - _fontSize: "number", + _fontSize: "string", _fontFamily: "string", _sidebarWidthPercent: "string", // percent of text window width taken up by sidebar -- cgit v1.2.3-70-g09d2 From f6db7693e18e06c467a7136c591bd12a2cc96c7f Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Tue, 14 Jul 2020 14:20:53 -0400 Subject: fixed issues with creating & using scripting boxes by making scriptFields be a function, not value, prop --- src/client/documents/Documents.ts | 2 ++ src/client/util/CurrentUserUtils.ts | 26 ++++++++++++------ src/client/views/OverlayView.scss | 2 ++ src/client/views/TemplateMenu.tsx | 7 +++-- .../views/collections/CollectionCarousel3DView.tsx | 10 +++---- .../views/collections/CollectionCarouselView.tsx | 7 +++-- .../views/collections/CollectionStackingView.tsx | 4 +-- .../views/collections/CollectionTreeView.tsx | 30 +++++++++++--------- src/client/views/collections/CollectionView.tsx | 11 +++++--- .../collectionFreeForm/CollectionFreeFormView.tsx | 9 +++--- .../collectionGrid/CollectionGridView.tsx | 2 +- .../CollectionMulticolumnView.tsx | 4 +-- .../CollectionMultirowView.tsx | 4 +-- src/client/views/nodes/DocumentView.tsx | 32 +++++++++++----------- src/fields/documentSchemas.ts | 1 - 15 files changed, 87 insertions(+), 64 deletions(-) (limited to 'src/client/documents') diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts index a415e17c8..90cef31d9 100644 --- a/src/client/documents/Documents.ts +++ b/src/client/documents/Documents.ts @@ -136,6 +136,8 @@ export interface DocumentOptions { dontRegisterChildViews?: boolean; lookupField?: ScriptField; // script that returns the value of a field. This script is passed the rootDoc, layoutDoc, field, and container of the document. see PresBox. "onDoubleClick-rawScript"?: string; // onDoubleClick script in raw text form + "onChildDoubleClick-rawScript"?: string; // onChildDoubleClick script in raw text form + "onChildClick-rawScript"?: string // on ChildClick script in raw text form "onClick-rawScript"?: string; // onClick script in raw text form "onCheckedClick-rawScript"?: string; // onChecked script in raw text form "onCheckedClick-params"?: List; // parameter list for onChecked treeview functions diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts index 7a06e1bc1..ad8336e8a 100644 --- a/src/client/util/CurrentUserUtils.ts +++ b/src/client/util/CurrentUserUtils.ts @@ -413,7 +413,7 @@ export class CurrentUserUtils { { title: "Drag a presentation view", label: "Prezi", icon: "tv", click: 'openOnRight(Doc.UserDoc().activePresentation = getCopy(this.dragFactory, true))', drag: `Doc.UserDoc().activePresentation = getCopy(this.dragFactory,true)`, dragFactory: doc.emptyPresentation as Doc }, { title: "Drag a search box", label: "Query", icon: "search", ignoreClick: true, drag: 'Docs.Create.QueryDocument({ _width: 200, title: "an image of a cat" })' }, { title: "Drag a scripting box", label: "Script", icon: "terminal", click: 'openOnRight(getCopy(this.dragFactory, true))', drag: 'getCopy(this.dragFactory, true)', dragFactory: doc.emptyScript as Doc }, - // { title: "Drag an import folder", label: "Load", icon: "cloud-upload-alt", ignoreClick: true, drag: 'Docs.Create.DirectoryImportDocument({ title: "Directory Import", _width: 400, _height: 400 })' }, + { title: "Drag an import folder", label: "Load", icon: "cloud-upload-alt", ignoreClick: true, drag: 'Docs.Create.DirectoryImportDocument({ title: "Directory Import", _width: 400, _height: 400 })' }, { title: "Drag a mobile view", label: "Phone", icon: "mobile", click: 'openOnRight(Doc.UserDoc().activeMobileMenu)', drag: 'this.dragFactory', dragFactory: doc.activeMobileMenu as Doc }, // { title: "Drag an instance of the device collection", label: "Buxton", icon: "globe-asia", ignoreClick: true, drag: 'Docs.Create.Buxton()' }, // { title: "use pen", icon: "pen-nib", click: 'activatePen(this.activeInkPen = sameDocs(this.activeInkPen, this) ? undefined : this)', backgroundColor: "blue", ischecked: `sameDocs(this.activeInkPen, this)`, activeInkPen: doc }, @@ -775,17 +775,17 @@ export class CurrentUserUtils { static setupClickEditorTemplates(doc: Doc) { if (doc["clickFuncs-child"] === undefined) { + // to use this function, select it from the context menu of a collection. then edit the onChildClick script. Add two Doc variables: 'target' and 'thisContainer', then assign 'target' to some target collection. After that, clicking on any document in the initial collection will open it in the target const openInTarget = Docs.Create.ScriptingDocument(ScriptField.MakeScript( - "docCast(thisContainer.target).then((target) => {" + - " target && docCast(this.source).then((source) => { " + - " target.proto.data = new List([source || this]); " + - " }); " + - "})", - { target: Doc.name }), { title: "Click to open in target", _width: 300, _height: 200, targetScriptKey: "onChildClick" }); + "docCast(thisContainer.target).then((target) => target && (target.proto.data = new List([self]))) ", + { thisContainer: Doc.name }), { + title: "Click to open in target", _width: 300, _height: 200, + targetScriptKey: "onChildClick", + }); const openDetail = Docs.Create.ScriptingDocument(ScriptField.MakeScript( "openOnRight(self.doubleClickView)", - { target: Doc.name }), { title: "Double click to open doubleClickView", _width: 300, _height: 200, targetScriptKey: "onChildDoubleClick" }); + {}), { title: "Double click to open doubleClickView", _width: 300, _height: 200, targetScriptKey: "onChildDoubleClick" }); doc["clickFuncs-child"] = Docs.Create.TreeDocument([openInTarget, openDetail], { title: "on Child Click function templates" }); } @@ -797,14 +797,22 @@ export class CurrentUserUtils { title: "onClick", "onClick-rawScript": "console.log('click')", isTemplateDoc: true, isTemplateForField: "onClick", _width: 300, _height: 200 }, "onClick"); + const onChildClick = Docs.Create.ScriptingDocument(undefined, { + title: "onChildClick", "onChildClick-rawScript": "console.log('child click')", + isTemplateDoc: true, isTemplateForField: "onChildClick", _width: 300, _height: 200 + }, "onChildClick"); const onDoubleClick = Docs.Create.ScriptingDocument(undefined, { title: "onDoubleClick", "onDoubleClick-rawScript": "console.log('double click')", isTemplateDoc: true, isTemplateForField: "onDoubleClick", _width: 300, _height: 200 }, "onDoubleClick"); + const onChildDoubleClick = Docs.Create.ScriptingDocument(undefined, { + title: "onChildDoubleClick", "onChildDoubleClick-rawScript": "console.log('child double click')", + isTemplateDoc: true, isTemplateForField: "onChildDoubleClick", _width: 300, _height: 200 + }, "onChildDoubleClick"); const onCheckedClick = Docs.Create.ScriptingDocument(undefined, { title: "onCheckedClick", "onCheckedClick-rawScript": "console.log(heading + checked + containingTreeView)", "onCheckedClick-params": new List(["heading", "checked", "containingTreeView"]), isTemplateDoc: true, isTemplateForField: "onCheckedClick", _width: 300, _height: 200 }, "onCheckedClick"); - doc.clickFuncs = Docs.Create.TreeDocument([onClick, onDoubleClick, onCheckedClick], { title: "onClick funcs" }); + doc.clickFuncs = Docs.Create.TreeDocument([onClick, onChildClick, onDoubleClick, onCheckedClick], { title: "onClick funcs" }); } PromiseValue(Cast(doc.clickFuncs, Doc)).then(func => func && PromiseValue(func.data).then(DocListCast)); diff --git a/src/client/views/OverlayView.scss b/src/client/views/OverlayView.scss index 26c2e0e1e..09a349012 100644 --- a/src/client/views/OverlayView.scss +++ b/src/client/views/OverlayView.scss @@ -3,6 +3,8 @@ overflow: hidden; display: flex; flex-direction: column; + top: 0; + left: 0; } .overlayWindow-outerDiv, diff --git a/src/client/views/TemplateMenu.tsx b/src/client/views/TemplateMenu.tsx index 916e631d0..9fb8a227e 100644 --- a/src/client/views/TemplateMenu.tsx +++ b/src/client/views/TemplateMenu.tsx @@ -108,8 +108,9 @@ export class TemplateMenu extends React.Component { return100 = () => 100; @computed get scriptField() { - return ScriptField.MakeScript("docs.map(d => switchView(d, this))", { this: Doc.name, heading: "string", checked: "string", containingTreeView: Doc.name, firstDoc: Doc.name }, + const script = ScriptField.MakeScript("docs.map(d => switchView(d, this))", { this: Doc.name, heading: "string", checked: "string", containingTreeView: Doc.name, firstDoc: Doc.name }, { docs: new List(this.props.docViews.map(dv => dv.props.Document)) }); + return script ? () => script : undefined; } templateIsUsed = (selDoc: Doc, templateDoc: Doc) => { const template = StrCast(templateDoc.dragFactory ? Cast(templateDoc.dragFactory, Doc, null)?.title : templateDoc.title); @@ -142,8 +143,8 @@ export class TemplateMenu extends React.Component { ContainingCollectionView={undefined} docFilters={returnEmptyFilter} rootSelected={returnFalse} - onCheckedClick={this.scriptField!} - onChildClick={this.scriptField!} + onCheckedClick={this.scriptField} + onChildClick={this.scriptField} LibraryPath={emptyPath} dropAction={undefined} active={returnTrue} diff --git a/src/client/views/collections/CollectionCarousel3DView.tsx b/src/client/views/collections/CollectionCarousel3DView.tsx index 8f1cd5311..8e9970ada 100644 --- a/src/client/views/collections/CollectionCarousel3DView.tsx +++ b/src/client/views/collections/CollectionCarousel3DView.tsx @@ -38,15 +38,15 @@ export class CollectionCarousel3DView extends CollectionSubView(Carousel3DDocume panelWidth = () => this.props.PanelWidth() / 3; panelHeight = () => this.props.PanelHeight() * 0.6; + onChildDoubleClick = () => ScriptCast(this.layoutDoc.onChildDoubleClick); @computed get content() { const currentIndex = NumCast(this.layoutDoc._itemIndex); const displayDoc = (childPair: { layout: Doc, data: Doc }) => { + const script = ScriptField.MakeScript("child._showCaption = 'caption'", { child: Doc.name }, { child: childPair.layout }); + const onChildClick = script && (() => script); return ; const CarouselDocument = makeInterface(documentSchema, collectionSchema); @@ -40,14 +41,16 @@ export class CollectionCarouselView extends CollectionSubView(CarouselDocument) this.layoutDoc._itemIndex = (NumCast(this.layoutDoc._itemIndex) - 1 + this.childLayoutPairs.length) % this.childLayoutPairs.length; } panelHeight = () => this.props.PanelHeight() - 50; + onContentDoubleClick = () => ScriptCast(this.layoutDoc.onChildDoubleClick); + onContentClick = () => ScriptCast(this.layoutDoc.onChildClick); @computed get content() { const index = NumCast(this.layoutDoc._itemIndex); return !(this.childLayoutPairs?.[index]?.layout instanceof Doc) ? (null) : <>
this.props.childClickScript || ScriptCast(this.Document.onChildClick); } + @computed get onChildDoubleClickHandler() { return () => this.props.childDoubleClickScript || ScriptCast(this.Document.onChildDoubleClick); } addDocTab = (doc: Doc, where: string) => { if (where === "inPlace" && this.layoutDoc.isInPlaceContainer) { diff --git a/src/client/views/collections/CollectionTreeView.tsx b/src/client/views/collections/CollectionTreeView.tsx index dbd39d8df..8438248ad 100644 --- a/src/client/views/collections/CollectionTreeView.tsx +++ b/src/client/views/collections/CollectionTreeView.tsx @@ -61,8 +61,8 @@ export interface TreeViewProps { treeViewHideHeaderFields: () => boolean; treeViewPreventOpen: boolean; renderedIds: string[]; // list of document ids rendered used to avoid unending expansion of items in a cycle - onCheckedClick?: ScriptField; - onChildClick?: ScriptField; + onCheckedClick?: () => ScriptField; + onChildClick?: () => ScriptField; ignoreFields?: string[]; } @@ -76,7 +76,7 @@ export interface TreeViewProps { * treeViewExpandedView : name of field whose contents are being displayed as the document's subtree */ class TreeView extends React.Component { - private _editTitleScript: ScriptField | undefined; + private _editTitleScript: (() => ScriptField) | undefined; private _header?: React.RefObject = React.createRef(); private _treedropDisposer?: DragManager.DragDropDisposer; private _dref = React.createRef(); @@ -124,7 +124,8 @@ class TreeView extends React.Component { constructor(props: any) { super(props); - this._editTitleScript = ScriptField.MakeScript(`{setInPlace(self, 'editTitle', '${this._uniqueId}'); selectDoc(self);} `); + const script = ScriptField.MakeScript(`{setInPlace(self, 'editTitle', '${this._uniqueId}'); selectDoc(self);} `); + this._editTitleScript = script && (() => script); if (Doc.GetT(this.doc, "editTitle", "string", true) === "*") Doc.SetInPlace(this.doc, "editTitle", this._uniqueId, false); } @@ -368,13 +369,13 @@ class TreeView extends React.Component { } } - get onCheckedClick() { return this.props.onCheckedClick || ScriptCast(this.doc.onCheckedClick); } + get onCheckedClick() { return this.props.onCheckedClick || (() => ScriptCast(this.doc.onCheckedClick)); } @action bulletClick = (e: React.MouseEvent) => { - if (this.onCheckedClick && this.doc.type !== DocumentType.COL) { + if (this.onCheckedClick() && this.doc.type !== DocumentType.COL) { // this.props.document.treeViewChecked = this.props.document.treeViewChecked === "check" ? "x" : this.props.document.treeViewChecked === "x" ? undefined : "check"; - this.onCheckedClick.script.run({ + this.onCheckedClick()?.script.run({ this: this.doc.isTemplateForField && this.props.dataDoc ? this.props.dataDoc : this.doc, heading: this.props.containingCollection.title, checked: this.doc.treeViewChecked === "check" ? "x" : this.doc.treeViewChecked === "x" ? undefined : "check", @@ -388,7 +389,7 @@ class TreeView extends React.Component { @computed get renderBullet() { TraceMobx(); - const checked = this.doc.type === DocumentType.COL ? undefined : this.onCheckedClick ? (this.doc.treeViewChecked ?? "unchecked") : undefined; + const checked = this.doc.type === DocumentType.COL ? undefined : this.onCheckedClick() ? (this.doc.treeViewChecked ?? "unchecked") : undefined; return
{ treeViewPreventOpen: boolean, renderedIds: string[], libraryPath: Doc[] | undefined, - onCheckedClick: ScriptField | undefined, - onChildClick: ScriptField | undefined, + onCheckedClick?: () => ScriptField, + onChildClick?: () => ScriptField, ignoreFields: string[] | undefined ) { const viewSpecScript = Cast(containingCollection.viewSpecScript, ScriptField); @@ -658,8 +659,8 @@ class TreeView extends React.Component { export type collectionTreeViewProps = { treeViewHideTitle?: boolean; treeViewHideHeaderFields?: boolean; - onCheckedClick?: ScriptField; - onChildClick?: ScriptField; + onCheckedClick?: () => ScriptField; + onChildClick?: () => ScriptField; }; @observer @@ -797,6 +798,9 @@ export class CollectionTreeView extends CollectionSubView { console.log(e); } + onChildClick = () => { + return this.props.onChildClick?.() || ScriptCast(this.doc.onChildClick); + } render() { TraceMobx(); if (!(this.doc instanceof Doc)) return (null); @@ -839,7 +843,7 @@ export class CollectionTreeView extends CollectionSubView this.props.treeViewHideHeaderFields || BoolCast(this.doc.treeViewHideHeaderFields), BoolCast(this.doc.treeViewPreventOpen), [], this.props.LibraryPath, this.props.onCheckedClick, - this.props.onChildClick || ScriptCast(this.doc.onChildClick), this.props.ignoreFields) + this.onChildClick, this.props.ignoreFields) }
diff --git a/src/client/views/collections/CollectionView.tsx b/src/client/views/collections/CollectionView.tsx index cbd1ac9af..5165a8f11 100644 --- a/src/client/views/collections/CollectionView.tsx +++ b/src/client/views/collections/CollectionView.tsx @@ -305,14 +305,16 @@ export class CollectionView extends Touchable onClicks.push({ description: `Edit ${func.name} script`, icon: "edit", event: (obj: any) => { - ScriptBox.EditButtonScript(func.name + "...", this.props.Document, func.key, obj.x, obj.y, { thisContainer: Doc.name }); + const alias = Doc.MakeAlias(this.props.Document); + DocUtils.makeCustomViewClicked(alias, undefined, func.key); + this.props.addDocTab(alias, "onRight"); } })); DocListCast(Cast(Doc.UserDoc()["clickFuncs-child"], Doc, null).data).forEach(childClick => onClicks.push({ description: `Set child ${childClick.title}`, icon: "edit", - event: () => this.props.Document[StrCast(childClick.targetScriptKey)] = ObjectField.MakeCopy(ScriptCast(childClick.data)), + event: () => Doc.GetProto(this.props.Document)[StrCast(childClick.targetScriptKey)] = ObjectField.MakeCopy(ScriptCast(childClick.data)), })); !existingOnClick && cm.addItem({ description: "OnClick...", noexpand: true, subitems: onClicks, icon: "hand-point-right" }); @@ -470,7 +472,8 @@ export class CollectionView extends Touchable script : undefined; } @computed get filterView() { TraceMobx(); @@ -523,7 +526,7 @@ export class CollectionView extends Touchable (this.props.childClickScript || ScriptCast(this.Document.onChildClick)); } + @computed get onChildDoubleClickHandler() { return () => (this.props.childDoubleClickScript || ScriptCast(this.Document.onChildDoubleClick)); } @computed get backgroundActive() { return this.layoutDoc.isBackground && (this.props.ContainingCollectionView?.active() || this.props.active()); } backgroundHalo = () => BoolCast(this.Document.useClusters); parentActive = (outsideReaction: boolean) => this.props.active(outsideReaction) || this.backgroundActive ? true : false; @@ -1151,7 +1152,7 @@ export class CollectionFreeFormView extends CollectionSubView this._layoutElements = elements || [], { fireImmediately: true, name: "doLayout" }); - const handler = (e: Event) => this.handleDragging(e, (e as CustomEvent).detail); + const handler = (e: any) => this.handleDragging(e, (e as CustomEvent).detail); document.addEventListener("dashDragging", handler); } @@ -1159,7 +1160,7 @@ export class CollectionFreeFormView extends CollectionSubView this.handleDragging(e, (e as CustomEvent).detail); + const handler = (e: any) => this.handleDragging(e, (e as CustomEvent).detail); document.removeEventListener("dashDragging", handler); } diff --git a/src/client/views/collections/collectionGrid/CollectionGridView.tsx b/src/client/views/collections/collectionGrid/CollectionGridView.tsx index 188b88c41..b2e506dfa 100644 --- a/src/client/views/collections/collectionGrid/CollectionGridView.tsx +++ b/src/client/views/collections/collectionGrid/CollectionGridView.tsx @@ -31,7 +31,7 @@ export class CollectionGridView extends CollectionSubView(GridSchema) { @observable private _rowHeight: Opt; // temporary store of row height to make change undoable @observable private _scroll: number = 0; // required to make sure the decorations box container updates on scroll - @computed get onChildClickHandler() { return ScriptCast(this.Document.onChildClick); } + @computed get onChildClickHandler() { return () => ScriptCast(this.Document.onChildClick); } @computed get numCols() { return NumCast(this.props.Document.gridNumCols, 10); } @computed get rowHeight() { return this._rowHeight === undefined ? NumCast(this.props.Document.gridRowHeight, 100) : this._rowHeight; } diff --git a/src/client/views/collections/collectionMulticolumn/CollectionMulticolumnView.tsx b/src/client/views/collections/collectionMulticolumn/CollectionMulticolumnView.tsx index cd25c21b4..402e7563d 100644 --- a/src/client/views/collections/collectionMulticolumn/CollectionMulticolumnView.tsx +++ b/src/client/views/collections/collectionMulticolumn/CollectionMulticolumnView.tsx @@ -202,8 +202,8 @@ export class CollectionMulticolumnView extends CollectionSubView(MulticolumnDocu } - @computed get onChildClickHandler() { return ScriptCast(this.Document.onChildClick); } - @computed get onChildDoubleClickHandler() { return ScriptCast(this.Document.onChildDoubleClick); } + @computed get onChildClickHandler() { return () => ScriptCast(this.Document.onChildClick); } + @computed get onChildDoubleClickHandler() { return () => ScriptCast(this.Document.onChildDoubleClick); } addDocTab = (doc: Doc, where: string) => { diff --git a/src/client/views/collections/collectionMulticolumn/CollectionMultirowView.tsx b/src/client/views/collections/collectionMulticolumn/CollectionMultirowView.tsx index 51dcdcfe6..e4ef9b436 100644 --- a/src/client/views/collections/collectionMulticolumn/CollectionMultirowView.tsx +++ b/src/client/views/collections/collectionMulticolumn/CollectionMultirowView.tsx @@ -202,8 +202,8 @@ export class CollectionMultirowView extends CollectionSubView(MultirowDocument) } - @computed get onChildClickHandler() { return ScriptCast(this.Document.onChildClick); } - @computed get onChildDoubleClickHandler() { return ScriptCast(this.Document.onChildDoubleClick); } + @computed get onChildClickHandler() { return () => ScriptCast(this.Document.onChildClick); } + @computed get onChildDoubleClickHandler() { return () => ScriptCast(this.Document.onChildDoubleClick); } addDocTab = (doc: Doc, where: string) => { if (where === "inPlace" && this.layoutDoc.isInPlaceContainer) { diff --git a/src/client/views/nodes/DocumentView.tsx b/src/client/views/nodes/DocumentView.tsx index 11be4c2e7..e338d5203 100644 --- a/src/client/views/nodes/DocumentView.tsx +++ b/src/client/views/nodes/DocumentView.tsx @@ -11,7 +11,7 @@ import { InkTool } from '../../../fields/InkField'; import { listSpec } from "../../../fields/Schema"; import { SchemaHeaderField } from '../../../fields/SchemaHeaderField'; import { ScriptField } from '../../../fields/ScriptField'; -import { BoolCast, Cast, NumCast, StrCast } from "../../../fields/Types"; +import { BoolCast, Cast, NumCast, StrCast, ScriptCast } from "../../../fields/Types"; import { TraceMobx } from '../../../fields/util'; import { GestureUtils } from '../../../pen-gestures/GestureUtils'; import { emptyFunction, OmitKeys, returnOne, returnTransparent, Utils, emptyPath } from "../../../Utils"; @@ -68,10 +68,10 @@ export interface DocumentViewProps { ignoreAutoHeight?: boolean; contextMenuItems?: () => { script: ScriptField, label: string }[]; rootSelected: (outsideReaction?: boolean) => boolean; // whether the root of a template has been selected - onClick?: ScriptField; - onDoubleClick?: ScriptField; - onPointerDown?: ScriptField; - onPointerUp?: ScriptField; + onClick?: () => ScriptField; + onDoubleClick?: () => ScriptField; + onPointerDown?: () => ScriptField; + onPointerUp?: () => ScriptField; treeViewDoc?: Doc; dropAction?: dropActionType; dragDivName?: string; @@ -127,10 +127,10 @@ export class DocumentView extends DocComponent(Docu @computed get freezeDimensions() { return this.props.FreezeDimensions; } @computed get nativeWidth() { return NumCast(this.layoutDoc._nativeWidth, this.props.NativeWidth() || (this.freezeDimensions ? this.layoutDoc[WidthSym]() : 0)); } @computed get nativeHeight() { return NumCast(this.layoutDoc._nativeHeight, this.props.NativeHeight() || (this.freezeDimensions ? this.layoutDoc[HeightSym]() : 0)); } - @computed get onClickHandler() { return this.props.onClick || Cast(this.Document.onClick, ScriptField, Cast(this.layoutDoc.onClick, ScriptField, null)); } - @computed get onDoubleClickHandler() { return this.props.onDoubleClick || Cast(this.layoutDoc.onDoubleClick, ScriptField, null) || this.Document.onDoubleClick; } - @computed get onPointerDownHandler() { return this.props.onPointerDown ? this.props.onPointerDown : this.Document.onPointerDown; } - @computed get onPointerUpHandler() { return this.props.onPointerUp ? this.props.onPointerUp : this.Document.onPointerUp; } + @computed get onClickHandler() { return this.props.onClick?.() ? this.props.onClick : (() => Cast(this.Document.onClick, ScriptField, Cast(this.layoutDoc.onClick, ScriptField, null))); } + @computed get onDoubleClickHandler() { return this.props.onDoubleClick?.() ? this.props.onDoubleClick : () => (Cast(this.layoutDoc.onDoubleClick, ScriptField, null) || this.Document.onDoubleClick); } + @computed get onPointerDownHandler() { return this.props.onPointerDown?.() ? this.props.onPointerDown : () => ScriptCast(this.Document.onPointerDown) } + @computed get onPointerUpHandler() { return this.props.onPointerUp ?? (() => ScriptCast(this.Document.onPointerUp)); } NativeWidth = () => this.nativeWidth; NativeHeight = () => this.nativeHeight; @@ -293,10 +293,10 @@ export class DocumentView extends DocComponent(Docu let stopPropagate = true; let preventDefault = true; !this.props.Document.isBackground && this.props.bringToFront(this.props.Document); - if (this._doubleTap && this.props.renderDepth && !this.onClickHandler?.script) { // disable double-click to show full screen for things that have an on click behavior since clicking them twice can be misinterpreted as a double click + if (this._doubleTap && this.props.renderDepth && !this.onClickHandler()?.script) { // disable double-click to show full screen for things that have an on click behavior since clicking them twice can be misinterpreted as a double click if (!(e.nativeEvent as any).formattedHandled) { - if (this.onDoubleClickHandler?.script && !StrCast(Doc.LayoutField(this.layoutDoc))?.includes("ScriptingBox")) { // bcz: hack? don't execute script if you're clicking on a scripting box itself - const func = () => this.onDoubleClickHandler.script.run({ + if (this.onDoubleClickHandler()?.script && !StrCast(Doc.LayoutField(this.layoutDoc))?.includes("ScriptingBox")) { // bcz: hack? don't execute script if you're clicking on a scripting box itself + const func = () => this.onDoubleClickHandler()?.script.run({ this: this.layoutDoc, self: this.rootDoc, thisContainer: this.props.ContainingCollectionDoc, shiftKey: e.shiftKey @@ -316,9 +316,9 @@ export class DocumentView extends DocComponent(Docu Doc.UnBrushDoc(this.props.Document); } } - } else if (this.onClickHandler?.script && !StrCast(Doc.LayoutField(this.layoutDoc))?.includes("ScriptingBox")) { // bcz: hack? don't execute script if you're clicking on a scripting box itself + } else if (this.onClickHandler()?.script && !StrCast(Doc.LayoutField(this.layoutDoc))?.includes("ScriptingBox")) { // bcz: hack? don't execute script if you're clicking on a scripting box itself //SelectionManager.DeselectAll(); - const func = () => this.onClickHandler.script.run({ + const func = () => this.onClickHandler()?.script.run({ this: this.layoutDoc, self: this.rootDoc, thisContainer: this.props.ContainingCollectionDoc, shiftKey: e.shiftKey @@ -553,8 +553,8 @@ export class DocumentView extends DocComponent(Docu onPointerUp = (e: PointerEvent): void => { this.cleanUpInteractions(); - if (this.onPointerUpHandler?.script && !InteractionUtils.IsType(e, InteractionUtils.PENTYPE)) { - this.onPointerUpHandler.script.run({ self: this.rootDoc, this: this.layoutDoc }, console.log); + if (this.onPointerUpHandler()?.script && !InteractionUtils.IsType(e, InteractionUtils.PENTYPE)) { + this.onPointerUpHandler()?.script.run({ self: this.rootDoc, this: this.layoutDoc }, console.log); document.removeEventListener("pointerup", this.onPointerUp); return; } diff --git a/src/fields/documentSchemas.ts b/src/fields/documentSchemas.ts index 61a37ef8a..9dda644f3 100644 --- a/src/fields/documentSchemas.ts +++ b/src/fields/documentSchemas.ts @@ -3,7 +3,6 @@ import { ScriptField } from "./ScriptField"; import { Doc } from "./Doc"; import { DateField } from "./DateField"; import { SchemaHeaderField } from "./SchemaHeaderField"; -import { Schema } from "prosemirror-model"; export const documentSchema = createSchema({ // content properties -- cgit v1.2.3-70-g09d2 From 866561aa20aff0f570d31edf64eae36cd2d35279 Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Tue, 14 Jul 2020 17:27:19 -0400 Subject: fixed onClickHandler stuff to use functions properly. fixed several linking to annotations/pushpins problems. --- src/client/documents/Documents.ts | 8 +- src/client/util/DocumentManager.ts | 4 +- src/client/util/LinkManager.ts | 11 ++- src/client/util/SettingsManager.tsx | 4 +- src/client/views/DocumentButtonBar.tsx | 2 +- src/client/views/MetadataEntryMenu.tsx | 96 ++++++---------------- src/client/views/collections/CollectionView.tsx | 7 +- .../collectionFreeForm/CollectionFreeFormView.tsx | 10 +-- .../collectionFreeForm/FormatShapePane.tsx | 2 +- .../collectionFreeForm/InkOptionsMenu.tsx | 2 +- .../collectionGrid/CollectionGridView.tsx | 2 +- .../CollectionMulticolumnView.tsx | 5 +- .../CollectionMultirowView.tsx | 4 +- src/client/views/linking/LinkMenuGroup.tsx | 4 +- src/client/views/linking/LinkMenuItem.tsx | 5 +- src/client/views/nodes/DocumentLinksButton.tsx | 3 - src/client/views/nodes/DocumentView.tsx | 17 ++-- src/client/views/nodes/FieldView.tsx | 2 +- .../views/nodes/formattedText/RichTextMenu.tsx | 2 +- src/fields/documentSchemas.ts | 3 + 20 files changed, 78 insertions(+), 115 deletions(-) (limited to 'src/client/documents') diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts index 90cef31d9..1fd533b62 100644 --- a/src/client/documents/Documents.ts +++ b/src/client/documents/Documents.ts @@ -102,6 +102,8 @@ export interface DocumentOptions { childLayoutTemplate?: Doc; // template for collection to use to render its children (see PresBox or Buxton layout in tree view) childLayoutString?: string; // template string for collection to use to render its children hideFilterView?: boolean; // whether to hide the filter popout on collections + hideLinkButton?: boolean; // whether the blue link counter button should be hidden + hideAllLinks?: boolean; // whether all individual blue anchor dots should be hidden _columnsHideIfEmpty?: boolean; // whether stacking view column headings should be hidden isTemplateForField?: string; // the field key for which the containing document is a rendering template isTemplateDoc?: boolean; @@ -137,7 +139,7 @@ export interface DocumentOptions { lookupField?: ScriptField; // script that returns the value of a field. This script is passed the rootDoc, layoutDoc, field, and container of the document. see PresBox. "onDoubleClick-rawScript"?: string; // onDoubleClick script in raw text form "onChildDoubleClick-rawScript"?: string; // onChildDoubleClick script in raw text form - "onChildClick-rawScript"?: string // on ChildClick script in raw text form + "onChildClick-rawScript"?: string; // on ChildClick script in raw text form "onClick-rawScript"?: string; // onClick script in raw text form "onCheckedClick-rawScript"?: string; // onChecked script in raw text form "onCheckedClick-params"?: List; // parameter list for onChecked treeview functions @@ -779,7 +781,7 @@ export namespace Docs { export function FontIconDocument(options?: DocumentOptions) { - return InstanceFromProto(Prototypes.get(DocumentType.FONTICON), undefined, { ...(options || {}) }); + return InstanceFromProto(Prototypes.get(DocumentType.FONTICON), undefined, { hideLinkButton: true, ...(options || {}) }); } export function PresElementBoxDocument(options?: DocumentOptions) { @@ -912,6 +914,8 @@ export namespace DocUtils { if (target.doc === Doc.UserDoc()) return undefined; const linkDoc = Docs.Create.LinkDocument(source, target, { linkRelationship, layoutKey: "layout_linkView", description }, id); + linkDoc.linkDisplay = true; + linkDoc.hideAnhors = true; linkDoc.layout_linkView = Cast(Cast(Doc.UserDoc()["template-button-link"], Doc, null).dragFactory, Doc, null); Doc.GetProto(linkDoc).title = ComputedField.MakeFunction('self.anchor1?.title +" (" + (self.linkRelationship||"to") +") " + self.anchor2?.title'); diff --git a/src/client/util/DocumentManager.ts b/src/client/util/DocumentManager.ts index 1fa5faeb3..b66e7fdc4 100644 --- a/src/client/util/DocumentManager.ts +++ b/src/client/util/DocumentManager.ts @@ -146,7 +146,7 @@ export class DocumentManager { }; const docView = getFirstDocView(targetDoc, originatingDoc); let annotatedDoc = await Cast(targetDoc.annotationOn, Doc); - if (annotatedDoc && !linkDoc?.isPushpin) { + if (annotatedDoc && !targetDoc?.isPushpin) { const first = getFirstDocView(annotatedDoc); if (first) { annotatedDoc = first.props.Document; @@ -156,7 +156,7 @@ export class DocumentManager { } } if (docView) { // we have a docView already and aren't forced to create a new one ... just focus on the document. TODO move into view if necessary otherwise just highlight? - if (linkDoc?.isPushpin) docView.props.Document.hidden = !docView.props.Document.hidden; + if (originatingDoc?.isPushpin) docView.props.Document.hidden = !docView.props.Document.hidden; else { docView.props.Document.hidden && (docView.props.Document.hidden = undefined); docView.props.focus(docView.props.Document, willZoom, undefined, focusAndFinish); diff --git a/src/client/util/LinkManager.ts b/src/client/util/LinkManager.ts index 50f3fc1d6..974744344 100644 --- a/src/client/util/LinkManager.ts +++ b/src/client/util/LinkManager.ts @@ -63,12 +63,17 @@ export class LinkManager { } // finds all links that contain the given anchor - public getAllRelatedLinks(anchor: Doc): Doc[] { + public getAllDirectLinks(anchor: Doc): Doc[] { const related = LinkManager.Instance.getAllLinks().filter(link => { const protomatch1 = Doc.AreProtosEqual(anchor, Cast(link.anchor1, Doc, null)); const protomatch2 = Doc.AreProtosEqual(anchor, Cast(link.anchor2, Doc, null)); return protomatch1 || protomatch2 || Doc.AreProtosEqual(link, anchor); }); + return related; + } + // finds all links that contain the given anchor + public getAllRelatedLinks(anchor: Doc): Doc[] { + const related = LinkManager.Instance.getAllDirectLinks(anchor); DocListCast(anchor[Doc.LayoutFieldKey(anchor) + "-annotations"]).map(anno => { related.push(...LinkManager.Instance.getAllRelatedLinks(anno)); }); @@ -208,4 +213,6 @@ export class LinkManager { } Scripting.addGlobal(function links(doc: any) { return new List(LinkManager.Instance.getAllRelatedLinks(doc)); }, - "creates a link to inputted document", "(doc: any)"); \ No newline at end of file + "returns all the links to the document or its annotations", "(doc: any)"); +Scripting.addGlobal(function directLinks(doc: any) { return new List(LinkManager.Instance.getAllDirectLinks(doc)); }, + "returns all the links directly to the document", "(doc: any)"); \ No newline at end of file diff --git a/src/client/util/SettingsManager.tsx b/src/client/util/SettingsManager.tsx index f7ca3942b..981ee698d 100644 --- a/src/client/util/SettingsManager.tsx +++ b/src/client/util/SettingsManager.tsx @@ -87,11 +87,11 @@ export default class SettingsManager extends React.Component<{}> { } @action googleAuthorize = (event: any) => { - GoogleAuthenticationManager.Instance.fetchOrGenerateAccessToken(true) + GoogleAuthenticationManager.Instance.fetchOrGenerateAccessToken(true); } @action hypothesisAuthorize = (event: any) => { - HypothesisAuthenticationManager.Instance.fetchAccessToken(true) + HypothesisAuthenticationManager.Instance.fetchAccessToken(true); } private get settingsInterface() { diff --git a/src/client/views/DocumentButtonBar.tsx b/src/client/views/DocumentButtonBar.tsx index c188618f4..927c192cd 100644 --- a/src/client/views/DocumentButtonBar.tsx +++ b/src/client/views/DocumentButtonBar.tsx @@ -208,7 +208,7 @@ export class DocumentButtonBar extends React.Component<{ views: () => (DocumentV const view0 = this.view0; return !view0 ? (null) :
this.props.views().filter(dv => dv).map(dv => dv!.props.Document)} suggestWithFunction /> /* tfs: @bcz This might need to be the data document? */}> + content={ dv).map(dv => dv!.props.Document)} suggestWithFunction /> /* tfs: @bcz This might need to be the data document? */}>
e.stopPropagation()} > {}
diff --git a/src/client/views/MetadataEntryMenu.tsx b/src/client/views/MetadataEntryMenu.tsx index b0752ffb2..ca8a6e1d7 100644 --- a/src/client/views/MetadataEntryMenu.tsx +++ b/src/client/views/MetadataEntryMenu.tsx @@ -3,14 +3,14 @@ import "./MetadataEntryMenu.scss"; import { observer } from 'mobx-react'; import { observable, action, runInAction, trace, computed, IReactionDisposer, reaction } from 'mobx'; import { KeyValueBox } from './nodes/KeyValueBox'; -import { Doc, Field, DocListCastAsync } from '../../fields/Doc'; +import { Doc, Field, DocListCastAsync, DocListCast } from '../../fields/Doc'; import * as Autosuggest from 'react-autosuggest'; -import { undoBatch } from '../util/UndoManager'; +import { undoBatch, UndoManager } from '../util/UndoManager'; import { emptyFunction, emptyPath } from '../../Utils'; export type DocLike = Doc | Doc[] | Promise | Promise; export interface MetadataEntryProps { - docs: DocLike | (() => DocLike); + docs: Doc[]; onError?: () => boolean; suggestWithFunction?: boolean; } @@ -39,26 +39,13 @@ export class MetadataEntryMenu extends React.Component{ let onProto: boolean = false; let value: string | undefined = undefined; let docs = this.props.docs; - if (typeof docs === "function") { - if (this.props.suggestWithFunction) { - docs = docs(); - } else { - return; - } - } - docs = await docs; - if (docs instanceof Doc) { - await docs[this._currentKey]; - value = Field.toKeyValueString(docs, this._currentKey); - } else { - for (const doc of docs) { - const v = await doc[this._currentKey]; - onProto = onProto || !Object.keys(doc).includes(this._currentKey); - if (field === null) { - field = v; - } else if (v !== field) { - value = "multiple values"; - } + for (const doc of docs) { + const v = await doc[this._currentKey]; + onProto = onProto || !Object.keys(doc).includes(this._currentKey); + if (field === null) { + field = v; + } else if (v !== field) { + value = "multiple values"; } } if (value === undefined) { @@ -86,27 +73,16 @@ export class MetadataEntryMenu extends React.Component{ const script = KeyValueBox.CompileKVPScript(this._currentValue); if (!script) return; - let doc = this.props.docs; - if (typeof doc === "function") { - doc = doc(); - } - doc = await doc; - - let success: boolean; - if (doc instanceof Doc) { - success = KeyValueBox.ApplyKVPScript(doc, this._currentKey, script); - } else { - let childSuccess = true; - if (this._addChildren) { - for (const document of doc) { - const collectionChildren = await DocListCastAsync(document.data); - if (collectionChildren) { - childSuccess = collectionChildren.every(c => KeyValueBox.ApplyKVPScript(c, this._currentKey, script)); - } + let childSuccess = true; + if (this._addChildren) { + for (const document of this.props.docs) { + const collectionChildren = DocListCast(document.data); + if (collectionChildren) { + childSuccess = collectionChildren.every(c => KeyValueBox.ApplyKVPScript(c, this._currentKey, script)); } } - success = doc.every(d => KeyValueBox.ApplyKVPScript(d, this._currentKey, script)) && childSuccess; } + const success = this.props.docs.every(d => KeyValueBox.ApplyKVPScript(d, this._currentKey, script)) && childSuccess; if (!success) { if (this.props.onError) { if (this.props.onError()) { @@ -132,24 +108,12 @@ export class MetadataEntryMenu extends React.Component{ } } - getKeySuggestions = async (value: string): Promise => { + getKeySuggestions = (value: string) => { value = value.toLowerCase(); let docs = this.props.docs; - if (typeof docs === "function") { - if (this.props.suggestWithFunction) { - docs = docs(); - } else { - return []; - } - } - docs = await docs; - if (docs instanceof Doc) { - return Object.keys(docs).filter(key => key.toLowerCase().startsWith(value)); - } else { - const keys = new Set(); - docs.forEach(doc => Doc.allKeys(doc).forEach(key => keys.add(key))); - return Array.from(keys).filter(key => key.toLowerCase().startsWith(value)); - } + const keys = new Set(); + docs.forEach(doc => Doc.allKeys(doc).forEach(key => keys.add(key))); + return Array.from(keys).filter(key => key.toLowerCase().startsWith(value)); } getSuggestionValue = (suggestion: string) => suggestion; @@ -157,9 +121,8 @@ export class MetadataEntryMenu extends React.Component{ return (null); } componentDidMount() { - this._suggestionDispser = reaction(() => this._currentKey, - () => this.getKeySuggestions(this._currentKey).then(action((s: string[]) => this._allSuggestions = s)), + () => this._allSuggestions = this.getKeySuggestions(this._currentKey), { fireImmediately: true }); } componentWillUnmount() { @@ -171,19 +134,8 @@ export class MetadataEntryMenu extends React.Component{ } private get considerChildOptions() { - let docSource = this.props.docs; - if (typeof docSource === "function") { - docSource = docSource(); - } - docSource = docSource as Doc[] | Doc; - if (docSource instanceof Doc) { - if (docSource._viewType === undefined) { - return (null); - } - } else if (Array.isArray(docSource)) { - if (!docSource.every(doc => doc._viewType !== undefined)) { - return null; - } + if (!this.props.docs.every(doc => doc._viewType !== undefined)) { + return null; } return (
diff --git a/src/client/views/collections/CollectionView.tsx b/src/client/views/collections/CollectionView.tsx index 5165a8f11..6ab4645ea 100644 --- a/src/client/views/collections/CollectionView.tsx +++ b/src/client/views/collections/CollectionView.tsx @@ -140,17 +140,18 @@ export class CollectionView extends Touchable { const context = Cast(doc.context, Doc, null); - if (context && (context.type === DocumentType.VID || context.type === DocumentType.WEB || context.type === DocumentType.PDF || context.type === DocumentType.IMG) && - !DocListCast(doc.links).some(d => d.isPushpin)) { + if (context && (context.type === DocumentType.VID || context.type === DocumentType.WEB || context.type === DocumentType.PDF || context.type === DocumentType.IMG)) { const pushpin = Docs.Create.FontIconDocument({ icon: "map-pin", x: Cast(doc.x, "number", null), y: Cast(doc.y, "number", null), _backgroundColor: "#0000003d", color: "#ACCEF7", _width: 15, _height: 15, _xPadding: 0, isLinkButton: true, displayTimecode: Cast(doc.displayTimecode, "number", null) }); + pushpin.isPushpin = true; + Doc.GetProto(pushpin).annotationOn = doc.annotationOn; + Doc.SetInPlace(doc, "annotationOn", undefined, true); Doc.AddDocToList(context, Doc.LayoutFieldKey(context) + "-annotations", pushpin); const pushpinLink = DocUtils.MakeLink({ doc: pushpin }, { doc: doc }, "pushpin", ""); const first = DocListCast(pushpin.links).find(d => d instanceof Doc); first && (first.hidden = true); - pushpinLink && (Doc.GetProto(pushpinLink).isPushpin = true); doc.displayTimecode = undefined; } doc.context = this.props.Document; diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx index f33b5371f..994f4ce6e 100644 --- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx +++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx @@ -939,9 +939,9 @@ export class CollectionFreeFormView extends CollectionSubView (this.props.childClickScript || ScriptCast(this.Document.onChildClick)); } - @computed get onChildDoubleClickHandler() { return () => (this.props.childDoubleClickScript || ScriptCast(this.Document.onChildDoubleClick)); } @computed get backgroundActive() { return this.layoutDoc.isBackground && (this.props.ContainingCollectionView?.active() || this.props.active()); } + onChildClickHandler = () => this.props.childClickScript || ScriptCast(this.Document.onChildClick); + onChildDoubleClickHandler = () => this.props.childDoubleClickScript || ScriptCast(this.Document.onChildDoubleClick); backgroundHalo = () => BoolCast(this.Document.useClusters); parentActive = (outsideReaction: boolean) => this.props.active(outsideReaction) || this.backgroundActive ? true : false; getChildDocumentViewProps(childLayout: Doc, childData?: Doc): DocumentViewProps { @@ -1186,8 +1186,8 @@ export class CollectionFreeFormView extends CollectionSubView - (p === undefined || (p && p === i.rootDoc[key])) && i.rootDoc[key] !== "0" ? Field.toString(i.rootDoc[key] as Field) : "", undefined as Opt) + (p === undefined || (p && p === i.rootDoc[key])) && i.rootDoc[key] !== "0" ? Field.toString(i.rootDoc[key] as Field) : "", undefined as Opt); } @computed get selectedInk() { diff --git a/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx b/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx index 15707ad9e..5d115df69 100644 --- a/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx +++ b/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx @@ -128,7 +128,7 @@ export default class InkOptionsMenu extends AntimodeMenu { // doc.strokeBezier === 300 ? doc.strokeBezier = 0 : doc.strokeBezier = 300; break; case "dash": - doc.strokeDash = Number(value); + doc.strokeDash = value; default: break; } diff --git a/src/client/views/collections/collectionGrid/CollectionGridView.tsx b/src/client/views/collections/collectionGrid/CollectionGridView.tsx index b2e506dfa..73d0ae374 100644 --- a/src/client/views/collections/collectionGrid/CollectionGridView.tsx +++ b/src/client/views/collections/collectionGrid/CollectionGridView.tsx @@ -31,7 +31,7 @@ export class CollectionGridView extends CollectionSubView(GridSchema) { @observable private _rowHeight: Opt; // temporary store of row height to make change undoable @observable private _scroll: number = 0; // required to make sure the decorations box container updates on scroll - @computed get onChildClickHandler() { return () => ScriptCast(this.Document.onChildClick); } + onChildClickHandler = () => ScriptCast(this.Document.onChildClick); @computed get numCols() { return NumCast(this.props.Document.gridNumCols, 10); } @computed get rowHeight() { return this._rowHeight === undefined ? NumCast(this.props.Document.gridRowHeight, 100) : this._rowHeight; } diff --git a/src/client/views/collections/collectionMulticolumn/CollectionMulticolumnView.tsx b/src/client/views/collections/collectionMulticolumn/CollectionMulticolumnView.tsx index 402e7563d..21d283547 100644 --- a/src/client/views/collections/collectionMulticolumn/CollectionMulticolumnView.tsx +++ b/src/client/views/collections/collectionMulticolumn/CollectionMulticolumnView.tsx @@ -202,9 +202,8 @@ export class CollectionMulticolumnView extends CollectionSubView(MulticolumnDocu } - @computed get onChildClickHandler() { return () => ScriptCast(this.Document.onChildClick); } - @computed get onChildDoubleClickHandler() { return () => ScriptCast(this.Document.onChildDoubleClick); } - + onChildClickHandler = () => ScriptCast(this.Document.onChildClick); + onChildDoubleClickHandler = () => ScriptCast(this.Document.onChildDoubleClick); addDocTab = (doc: Doc, where: string) => { if (where === "inPlace" && this.layoutDoc.isInPlaceContainer) { diff --git a/src/client/views/collections/collectionMulticolumn/CollectionMultirowView.tsx b/src/client/views/collections/collectionMulticolumn/CollectionMultirowView.tsx index e4ef9b436..d02088a6c 100644 --- a/src/client/views/collections/collectionMulticolumn/CollectionMultirowView.tsx +++ b/src/client/views/collections/collectionMulticolumn/CollectionMultirowView.tsx @@ -202,8 +202,8 @@ export class CollectionMultirowView extends CollectionSubView(MultirowDocument) } - @computed get onChildClickHandler() { return () => ScriptCast(this.Document.onChildClick); } - @computed get onChildDoubleClickHandler() { return () => ScriptCast(this.Document.onChildDoubleClick); } + onChildClickHandler = () => ScriptCast(this.Document.onChildClick); + onChildDoubleClickHandler = () => ScriptCast(this.Document.onChildDoubleClick); addDocTab = (doc: Doc, where: string) => { if (where === "inPlace" && this.layoutDoc.isInPlaceContainer) { diff --git a/src/client/views/linking/LinkMenuGroup.tsx b/src/client/views/linking/LinkMenuGroup.tsx index 2f6b75437..2ae87ac13 100644 --- a/src/client/views/linking/LinkMenuGroup.tsx +++ b/src/client/views/linking/LinkMenuGroup.tsx @@ -11,6 +11,7 @@ import { DocumentView } from "../nodes/DocumentView"; import './LinkMenu.scss'; import { LinkMenuItem, StartLinkTargetsDrag } from "./LinkMenuItem"; import React = require("react"); +import { Cast } from "../../../fields/Types"; interface LinkMenuGroupProps { sourceDoc: Doc; @@ -66,7 +67,8 @@ export class LinkMenuGroup extends React.Component { render() { const groupItems = this.props.group.map(linkDoc => { - const destination = LinkManager.Instance.getOppositeAnchor(linkDoc, this.props.sourceDoc); + const destination = LinkManager.Instance.getOppositeAnchor(linkDoc, this.props.sourceDoc) || + LinkManager.Instance.getOppositeAnchor(linkDoc, Cast(linkDoc.anchor2, Doc, null).annotationOn === this.props.sourceDoc ? Cast(linkDoc.anchor2, Doc, null) : Cast(linkDoc.anchor1, Doc, null)); if (destination && this.props.sourceDoc) { return { const eyeIcon = this.props.linkDoc.hidden ? "eye-slash" : "eye"; - let destinationIcon: string = "";; + let destinationIcon: FontAwesomeIconProps["icon"] = "question"; switch (this.props.destinationDoc.type) { case DocumentType.IMG: destinationIcon = "image"; break; case DocumentType.COMPARISON: destinationIcon = "columns"; break; @@ -205,7 +205,6 @@ export class LinkMenuItem extends React.Component { case DocumentType.SCRIPTING: destinationIcon = "terminal"; break; case DocumentType.IMPORT: destinationIcon = "cloud-upload-alt"; break; case DocumentType.DOCHOLDER: destinationIcon = "expand"; break; - default: "question"; } const title = StrCast(this.props.destinationDoc.title).length > 18 ? diff --git a/src/client/views/nodes/DocumentLinksButton.tsx b/src/client/views/nodes/DocumentLinksButton.tsx index 83710cfbf..823e25471 100644 --- a/src/client/views/nodes/DocumentLinksButton.tsx +++ b/src/client/views/nodes/DocumentLinksButton.tsx @@ -101,8 +101,6 @@ export class DocumentLinksButton extends React.Component { if (linkDoc) { @@ -137,7 +135,6 @@ export class DocumentLinksButton extends React.Component { if (linkDoc) { diff --git a/src/client/views/nodes/DocumentView.tsx b/src/client/views/nodes/DocumentView.tsx index 7d9c4da87..a6771443a 100644 --- a/src/client/views/nodes/DocumentView.tsx +++ b/src/client/views/nodes/DocumentView.tsx @@ -128,9 +128,9 @@ export class DocumentView extends DocComponent(Docu @computed get nativeWidth() { return NumCast(this.layoutDoc._nativeWidth, this.props.NativeWidth() || (this.freezeDimensions ? this.layoutDoc[WidthSym]() : 0)); } @computed get nativeHeight() { return NumCast(this.layoutDoc._nativeHeight, this.props.NativeHeight() || (this.freezeDimensions ? this.layoutDoc[HeightSym]() : 0)); } @computed get onClickHandler() { return this.props.onClick?.() ?? Cast(this.Document.onClick, ScriptField, Cast(this.layoutDoc.onClick, ScriptField, null)); } - @computed get onDoubleClickHandler() { return this.props.onDoubleClick?.() || (Cast(this.layoutDoc.onDoubleClick, ScriptField, null) || this.Document.onDoubleClick); } - @computed get onPointerDownHandler() { return this.props.onPointerDown?.() || ScriptCast(this.Document.onPointerDown) } - @computed get onPointerUpHandler() { return this.props.onPointerUp?.() || ScriptCast(this.Document.onPointerUp); } + @computed get onDoubleClickHandler() { return this.props.onDoubleClick?.() ?? (Cast(this.layoutDoc.onDoubleClick, ScriptField, null) ?? this.Document.onDoubleClick); } + @computed get onPointerDownHandler() { return this.props.onPointerDown?.() ?? ScriptCast(this.Document.onPointerDown); } + @computed get onPointerUpHandler() { return this.props.onPointerUp?.() ?? ScriptCast(this.Document.onPointerUp); } NativeWidth = () => this.nativeWidth; NativeHeight = () => this.nativeHeight; onClickFunc = () => this.onClickHandler; @@ -298,7 +298,7 @@ export class DocumentView extends DocComponent(Docu if (this._doubleTap && this.props.renderDepth && !this.onClickHandler?.script) { // disable double-click to show full screen for things that have an on click behavior since clicking them twice can be misinterpreted as a double click if (!(e.nativeEvent as any).formattedHandled) { if (this.onDoubleClickHandler?.script && !StrCast(Doc.LayoutField(this.layoutDoc))?.includes("ScriptingBox")) { // bcz: hack? don't execute script if you're clicking on a scripting box itself - const func = () => this.onDoubleClickHandler?.script.run({ + const func = () => this.onDoubleClickHandler.script.run({ this: this.layoutDoc, self: this.rootDoc, thisContainer: this.props.ContainingCollectionDoc, shiftKey: e.shiftKey @@ -320,7 +320,7 @@ export class DocumentView extends DocComponent(Docu } } else if (this.onClickHandler?.script && !StrCast(Doc.LayoutField(this.layoutDoc))?.includes("ScriptingBox")) { // bcz: hack? don't execute script if you're clicking on a scripting box itself //SelectionManager.DeselectAll(); - const func = () => this.onClickHandler?.script.run({ + const func = () => this.onClickHandler.script.run({ this: this.layoutDoc, self: this.rootDoc, thisContainer: this.props.ContainingCollectionDoc, shiftKey: e.shiftKey @@ -556,7 +556,7 @@ export class DocumentView extends DocComponent(Docu this.cleanUpInteractions(); if (this.onPointerUpHandler?.script && !InteractionUtils.IsType(e, InteractionUtils.PENTYPE)) { - this.onPointerUpHandler?.script.run({ self: this.rootDoc, this: this.layoutDoc }, console.log); + this.onPointerUpHandler.script.run({ self: this.rootDoc, this: this.layoutDoc }, console.log); document.removeEventListener("pointerup", this.onPointerUp); return; } @@ -644,7 +644,6 @@ export class DocumentView extends DocComponent(Docu const makeLink = action((linkDoc: Doc) => { LinkManager.currentLink = linkDoc; linkDoc.hidden = true; - linkDoc.linkDisplay = true; LinkCreatedBox.popupX = de.x; LinkCreatedBox.popupY = de.y - 33; @@ -1076,7 +1075,7 @@ export class DocumentView extends DocComponent(Docu layoutKey={this.finalLayoutKey} /> {this.layoutDoc.hideAllLinks ? (null) : this.allAnchors} {/* {this.allAnchors} */} - {this.props.forcedBackgroundColor?.(this.Document) === "transparent" || this.props.dontRegisterView ? (null) : } + {this.props.forcedBackgroundColor?.(this.Document) === "transparent" || this.layoutDoc.hideLinkButton || this.props.dontRegisterView ? (null) : }
); } @@ -1105,7 +1104,7 @@ export class DocumentView extends DocComponent(Docu return (this.props.treeViewDoc && this.props.LayoutTemplateString) || // render nothing for: tree view anchor dots this.layoutDoc.presBox || // presentationbox nodes this.props.dontRegisterView ? (null) : // view that are not registered - DocUtils.FilterDocs(DocListCast(this.Document.links), this.props.docFilters(), []).filter(d => !d.hidden && this.isNonTemporalLink).map((d, i) => + DocUtils.FilterDocs(LinkManager.Instance.getAllDirectLinks(this.Document), this.props.docFilters(), []).filter(d => !d.hidden && this.isNonTemporalLink).map((d, i) => ScriptField; dropAction: dropActionType; backgroundHalo?: () => boolean; docFilters: () => string[]; diff --git a/src/client/views/nodes/formattedText/RichTextMenu.tsx b/src/client/views/nodes/formattedText/RichTextMenu.tsx index 8da1f99b5..c8798d757 100644 --- a/src/client/views/nodes/formattedText/RichTextMenu.tsx +++ b/src/client/views/nodes/formattedText/RichTextMenu.tsx @@ -431,7 +431,7 @@ export default class RichTextMenu extends AntimodeMenu { const nextIsOL = this.view.state.selection.$from.nodeAfter?.type === schema.nodes.ordered_list; let inList: any = undefined; let fromList = -1; - let path: any = Array.from((this.view.state.selection.$from as any).path); + const path: any = Array.from((this.view.state.selection.$from as any).path); for (let i = 0; i < path.length; i++) { if (path[i]?.type === schema.nodes.ordered_list) { inList = path[i]; diff --git a/src/fields/documentSchemas.ts b/src/fields/documentSchemas.ts index 9dda644f3..ddffb56c3 100644 --- a/src/fields/documentSchemas.ts +++ b/src/fields/documentSchemas.ts @@ -65,6 +65,7 @@ export const documentSchema = createSchema({ color: "string", // foreground color of document fitToBox: "boolean", // whether freeform view contents should be zoomed/panned to fill the area of the document view fontSize: "string", + hidden: "boolean", // whether a document should not be displayed isInkMask: "boolean", // is the document a mask (ie, sits on top of other documents, has an unbounded width/height that is dark, and content uses 'hard-light' mix-blend-mode to let other documents pop through) layout: "string", // this is the native layout string for the document. templates can be added using other fields and setting layoutKey below layoutKey: "string", // holds the field key for the field that actually holds the current lyoat @@ -87,6 +88,8 @@ export const documentSchema = createSchema({ onPointerUp: ScriptField, // script to run when document is clicked (can be overriden by an onClick prop) onDragStart: ScriptField, // script to run when document is dragged (without being selected). the script should return the Doc to be dropped. followLinkLocation: "string",// flag for where to place content when following a click interaction (e.g., onRight, inPlace, inTab, ) + hideLinkButton: "boolean", // whether the blue link counter button should be hidden + hideAllLinks: "boolean", // whether all individual blue anchor dots should be hidden isInPlaceContainer: "boolean",// whether the marked object will display addDocTab() calls that target "inPlace" destinations isLinkButton: "boolean", // whether document functions as a link follow button to follow the first link on the document when clicked isBackground: "boolean", // whether document is a background element and ignores input events (can only select with marquee) -- cgit v1.2.3-70-g09d2 From 3fdee81100954e66f54c73661cb11967993ff467 Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Wed, 15 Jul 2020 15:24:53 -0400 Subject: fixed tooltips to share a csss style. added tooltips for richtext. --- src/client/documents/Documents.ts | 2 +- src/client/views/DocumentButtonBar.tsx | 10 ++--- src/client/views/DocumentDecorations.tsx | 15 +++---- src/client/views/MainView.scss | 4 ++ .../views/collections/CollectionLinearView.tsx | 20 +++++---- src/client/views/collections/CollectionMenu.tsx | 13 +++--- src/client/views/collections/CollectionView.tsx | 3 +- .../CollectionFreeFormLinkView.tsx | 12 +++--- src/client/views/linking/LinkEditor.tsx | 14 +++---- src/client/views/linking/LinkMenuItem.tsx | 19 +++------ src/client/views/nodes/DocumentLinksButton.tsx | 5 +-- src/client/views/nodes/DocumentView.tsx | 25 +++-------- .../formattedText/FormattedTextBoxComment.tsx | 4 +- .../views/nodes/formattedText/RichTextMenu.tsx | 49 +++++++++++++--------- src/client/views/pdf/PDFViewer.tsx | 2 +- 15 files changed, 94 insertions(+), 103 deletions(-) (limited to 'src/client/documents') diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts index 1fd533b62..b57f4c6c7 100644 --- a/src/client/documents/Documents.ts +++ b/src/client/documents/Documents.ts @@ -915,7 +915,7 @@ export namespace DocUtils { const linkDoc = Docs.Create.LinkDocument(source, target, { linkRelationship, layoutKey: "layout_linkView", description }, id); linkDoc.linkDisplay = true; - linkDoc.hideAnhors = true; + linkDoc.hidden = true; linkDoc.layout_linkView = Cast(Cast(Doc.UserDoc()["template-button-link"], Doc, null).dragFactory, Doc, null); Doc.GetProto(linkDoc).title = ComputedField.MakeFunction('self.anchor1?.title +" (" + (self.linkRelationship||"to") +") " + self.anchor2?.title'); diff --git a/src/client/views/DocumentButtonBar.tsx b/src/client/views/DocumentButtonBar.tsx index 05538a28e..45f4c7393 100644 --- a/src/client/views/DocumentButtonBar.tsx +++ b/src/client/views/DocumentButtonBar.tsx @@ -118,7 +118,7 @@ export class DocumentButtonBar extends React.Component<{ views: () => (DocumentV const targetDoc = this.view0?.props.Document; const published = targetDoc && Doc.GetProto(targetDoc)[GoogleRef] !== undefined; const animation = this.isAnimatingPulse ? "shadow-pulse 1s linear infinite" : "none"; - return !targetDoc ? (null) :
{`${published ? "Push" : "Publish"} to Google Docs`}
}> + return !targetDoc ? (null) :
{`${published ? "Push" : "Publish"} to Google Docs`}
}>
(DocumentV })(); return !targetDoc || !dataDoc || !dataDoc[GoogleRef] ? (null) :
{title}
}> + title={<>
{title}
}>
{ @@ -197,7 +197,7 @@ export class DocumentButtonBar extends React.Component<{ views: () => (DocumentV get pinButton() { const targetDoc = this.view0?.props.Document; const isPinned = targetDoc && Doc.isDocPinned(targetDoc); - return !targetDoc ? (null) :
{Doc.isDocPinned(targetDoc) ? "Unpin from presentation" : "Pin to presentation"}
}> + return !targetDoc ? (null) :
{Doc.isDocPinned(targetDoc) ? "Unpin from presentation" : "Pin to presentation"}
}>
DockedFrameRenderer.PinDoc(targetDoc, isPinned)}> @@ -209,7 +209,7 @@ export class DocumentButtonBar extends React.Component<{ views: () => (DocumentV @computed get metadataButton() { const view0 = this.view0; - return !view0 ? (null) :
Show metadata panel
}> + return !view0 ? (null) :
Show metadata panel
}>
dv).map(dv => dv!.props.Document)} suggestWithFunction /> /* tfs: @bcz This might need to be the data document? */}> @@ -258,7 +258,7 @@ export class DocumentButtonBar extends React.Component<{ views: () => (DocumentV Array.from(Object.values(Templates.TemplateList)).map(template => templates.set(template, views.reduce((checked, doc) => checked || doc?.props.Document["_show" + template.Name] ? true : false, false as boolean))); return !view0 ? (null) : -
Tap: Customize layout. Drag: Create alias
}> +
Tap: Customize layout. Drag: Create alias
}>
this._aliasDown = true)} onClose={action(() => this._aliasDown = false)} content={!this._aliasDown ? (null) : v).map(v => v as DocumentView)} templates={templates} />}> diff --git a/src/client/views/DocumentDecorations.tsx b/src/client/views/DocumentDecorations.tsx index 2fd017f7b..376b1d46b 100644 --- a/src/client/views/DocumentDecorations.tsx +++ b/src/client/views/DocumentDecorations.tsx @@ -81,6 +81,7 @@ export class DocumentDecorations extends React.Component<{}, { value: string }> return SelectionManager.SelectedDocuments().reduce((bounds, documentView) => { if (documentView.props.renderDepth === 0 || documentView.props.treeViewDoc || + !documentView.ContentDiv || Doc.AreProtosEqual(documentView.props.Document, Doc.UserDoc())) { return bounds; } @@ -88,7 +89,7 @@ export class DocumentDecorations extends React.Component<{}, { value: string }> var [sptX, sptY] = transform.transformPoint(0, 0); let [bptX, bptY] = transform.transformPoint(documentView.props.PanelWidth(), documentView.props.PanelHeight()); if (documentView.props.Document.type === DocumentType.LINK) { - const docuBox = documentView.ContentDiv!.getElementsByClassName("linkAnchorBox-cont"); + const docuBox = documentView.ContentDiv.getElementsByClassName("linkAnchorBox-cont"); if (docuBox.length) { const rect = docuBox[0].getBoundingClientRect(); sptX = rect.left; @@ -544,11 +545,11 @@ export class DocumentDecorations extends React.Component<{}, { value: string }> } const minimal = bounds.r - bounds.x < 100 ? true : false; const maximizeIcon = minimal ? ( -
Show context menu
} placement="top"> +
Show context menu
} placement="top">
) : ( -
Iconify
} placement="top"> +
Iconify
} placement="top">
{/* Currently, this is set to be enabled if there is no ink selected. It might be interesting to think about minimizing ink if it's useful? -syip2*/} @@ -572,7 +573,7 @@ export class DocumentDecorations extends React.Component<{}, { value: string }>
} : <> - {minimal ? (null) :
Show context menu
} placement="top">
+ {minimal ? (null) :
Show context menu
} placement="top">
}
@@ -611,11 +612,11 @@ export class DocumentDecorations extends React.Component<{}, { value: string }> {maximizeIcon} {titleArea} {SelectionManager.SelectedDocuments().length !== 1 || seldoc.Document.type === DocumentType.INK ? (null) : -
{`${seldoc.finalLayoutKey.includes("icon") ? "De" : ""}Iconify Document`}
} placement="top"> +
{`${seldoc.finalLayoutKey.includes("icon") ? "De" : ""}Iconify Document`}
} placement="top">
{"_"}
} -
Open Document In Tab
} placement="top">
+
Open Document In Tab
} placement="top">
{SelectionManager.SelectedDocuments().length === 1 ? DocumentDecorations.DocumentIcon(StrCast(seldoc.props.Document.layout, "...")) : "..."}
e.preventDefault()}>
{seldoc.props.renderDepth <= 1 || !seldoc.props.ContainingCollectionView ? (null) : -
tap to select containing document
} placement="top"> +
tap to select containing document
} placement="top">
e.preventDefault()}> diff --git a/src/client/views/MainView.scss b/src/client/views/MainView.scss index 5b142ffda..e1ddbc533 100644 --- a/src/client/views/MainView.scss +++ b/src/client/views/MainView.scss @@ -1,6 +1,10 @@ @import "globalCssVariables"; @import "nodeModuleOverrides"; +.dash-tooltip { + font-size: 11px; + padding: 2px; +} .mainView-tabButtons { position: relative; diff --git a/src/client/views/collections/CollectionLinearView.tsx b/src/client/views/collections/CollectionLinearView.tsx index 319cca70f..407524353 100644 --- a/src/client/views/collections/CollectionLinearView.tsx +++ b/src/client/views/collections/CollectionLinearView.tsx @@ -124,7 +124,7 @@ export class CollectionLinearView extends CollectionSubView(LinearDocument) { return
-
{BoolCast(this.props.Document.linearViewIsExpanded) ? "Close menu" : "Open menu"}
} placement="top"> +
{BoolCast(this.props.Document.linearViewIsExpanded) ? "Close menu" : "Open menu"}
} placement="top"> {menuOpener}
e.stopPropagation()} > - Creating link from: {DocumentLinksButton.StartLink.title} + Creating link from: {DocumentLinksButton.StartLink.title} + -
{LinkDescriptionPopup.showDescriptions ? "Turn off description pop-up" : - "Turn on description pop-up"}
} placement="top"> - Labels: {LinkDescriptionPopup.showDescriptions ? LinkDescriptionPopup.showDescriptions : "ON"} +
{LinkDescriptionPopup.showDescriptions ? "Turn off description pop-up" : + "Turn on description pop-up"}
} placement="top"> + + Labels: {LinkDescriptionPopup.showDescriptions ? LinkDescriptionPopup.showDescriptions : "ON"}
-
Exit link clicking mode
} placement="top"> - Clear +
Exit link clicking mode
} placement="top"> + + Clear +
{/* : , - - ]); + const button = ; + + return this.getElement(!this.SelectedCollection ? [button] : + [, + button]); } } diff --git a/src/client/views/collections/CollectionView.tsx b/src/client/views/collections/CollectionView.tsx index c1a6b5b0d..c1da23470 100644 --- a/src/client/views/collections/CollectionView.tsx +++ b/src/client/views/collections/CollectionView.tsx @@ -142,6 +142,7 @@ export class CollectionView extends Touchable d instanceof Doc); - first && (first.hidden = true); doc.displayTimecode = undefined; } doc.context = this.props.Document; diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormLinkView.tsx b/src/client/views/collections/collectionFreeForm/CollectionFreeFormLinkView.tsx index dea936113..0933d525a 100644 --- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormLinkView.tsx +++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormLinkView.tsx @@ -29,13 +29,13 @@ export class CollectionFreeFormLinkView extends React.Component [this.props.A.props.ScreenToLocalTransform(), this.props.B.props.ScreenToLocalTransform(), this.props.A.isSelected() || Doc.IsBrushed(this.props.A.props.Document), this.props.A.isSelected() || Doc.IsBrushed(this.props.A.props.Document)], action(() => { - if (SnappingManager.GetIsDragging()) return; + if (SnappingManager.GetIsDragging() || !this.props.A.ContentDiv || !this.props.B.ContentDiv) return; setTimeout(action(() => this._opacity = 1), 0); // since the render code depends on querying the Dom through getBoudndingClientRect, we need to delay triggering render() setTimeout(action(() => (!this.props.LinkDocs.length || !this.props.LinkDocs[0].linkDisplay) && (this._opacity = 0.05)), 750); // this will unhighlight the link line. - const acont = this.props.A.props.Document.type === DocumentType.LINK ? this.props.A.ContentDiv!.getElementsByClassName("linkAnchorBox-cont") : []; - const bcont = this.props.B.props.Document.type === DocumentType.LINK ? this.props.B.ContentDiv!.getElementsByClassName("linkAnchorBox-cont") : []; - const adiv = (acont.length ? acont[0] : this.props.A.ContentDiv!); - const bdiv = (bcont.length ? bcont[0] : this.props.B.ContentDiv!); + const acont = this.props.A.props.Document.type === DocumentType.LINK ? this.props.A.ContentDiv.getElementsByClassName("linkAnchorBox-cont") : []; + const bcont = this.props.B.props.Document.type === DocumentType.LINK ? this.props.B.ContentDiv.getElementsByClassName("linkAnchorBox-cont") : []; + const adiv = (acont.length ? acont[0] : this.props.A.ContentDiv); + const bdiv = (bcont.length ? bcont[0] : this.props.B.ContentDiv); const a = adiv.getBoundingClientRect(); const b = bdiv.getBoundingClientRect(); const abounds = adiv.parentElement!.getBoundingClientRect(); @@ -103,7 +103,7 @@ export class CollectionFreeFormLinkView extends React.Component { @observable description = StrCast(LinkManager.currentLink?.description); @observable openDropdown: boolean = false; - @observable followBehavior = this.props.linkDoc.follow ? this.props.linkDoc.follow : "Default"; @observable showInfo: boolean = false; @computed get infoIcon() { if (this.showInfo) { return "chevron-up"; } return "chevron-down"; } @observable private buttonColor: string = "black"; @@ -364,8 +363,7 @@ export class LinkEditor extends React.Component { @action changeFollowBehavior = (follow: string) => { this.openDropdown = false; - this.followBehavior = follow; - this.props.linkDoc.follow = follow; + Doc.GetProto(this.props.linkDoc).followLinkLocation = follow; } @computed @@ -376,7 +374,7 @@ export class LinkEditor extends React.Component {
- {this.followBehavior} + {StrCast(this.props.linkDoc.followLinkLocation, "Default")} @@ -388,11 +386,11 @@ export class LinkEditor extends React.Component { Default
this.changeFollowBehavior("Always open in right tab")}> + onPointerDown={() => this.changeFollowBehavior("onRight")}> Always open in right tab
this.changeFollowBehavior("Always open in new tab")}> + onPointerDown={() => this.changeFollowBehavior("inTab")}> Always open in new tab
@@ -416,7 +414,7 @@ export class LinkEditor extends React.Component { return !destination ? (null) : (
-
Return to link menu
} placement="top"> +
Return to link menu
} placement="top"> */} -
Show more link information
} placement="top"> +
Show more link information
} placement="top">
diff --git a/src/client/views/linking/LinkMenuItem.tsx b/src/client/views/linking/LinkMenuItem.tsx index 6782f625b..0e847632b 100644 --- a/src/client/views/linking/LinkMenuItem.tsx +++ b/src/client/views/linking/LinkMenuItem.tsx @@ -16,7 +16,6 @@ import { DocumentView } from '../nodes/DocumentView'; import { DocumentLinksButton } from '../nodes/DocumentLinksButton'; import { LinkDocPreview } from '../nodes/LinkDocPreview'; import { Tooltip } from '@material-ui/core'; -import { RichTextField } from '../../../fields/RichTextField'; import { DocumentType } from '../../documents/DocumentTypes'; library.add(faEye, faEdit, faTimes, faArrowRight, faChevronDown, faChevronUp, faPencilAlt, faEyeSlash); @@ -157,14 +156,8 @@ export class LinkMenuItem extends React.Component { DocumentLinksButton.EditLink = undefined; LinkDocPreview.LinkInfo = undefined; - if (this.props.linkDoc.follow) { - if (this.props.linkDoc.follow === "Default") { - DocumentManager.Instance.FollowLink(this.props.linkDoc, this.props.sourceDoc, doc => this.props.addDocTab(doc, "onRight"), false); - } else if (this.props.linkDoc.follow === "Always open in right tab") { - this.props.addDocTab(this.props.destinationDoc, "onRight"); - } else if (this.props.linkDoc.follow === "Always open in new tab") { - this.props.addDocTab(this.props.destinationDoc, "inTab"); - } + if (this.props.linkDoc.followLinkLocation && this.props.linkDoc.followLinkLocation !== "Default") { + this.props.addDocTab(this.props.destinationDoc, StrCast(this.props.linkDoc.followLinkLocation)); } else { DocumentManager.Instance.FollowLink(this.props.linkDoc, this.props.sourceDoc, doc => this.props.addDocTab(doc, "onRight"), false); } @@ -221,8 +214,6 @@ export class LinkMenuItem extends React.Component { StrCast(this.props.linkDoc.storedText).substr(0, 18) : this.props.linkDoc.storedText : undefined : undefined; - const showTitle = this.props.linkDoc.hidden ? "Show link" : "Hide link"; - return (
@@ -255,16 +246,16 @@ export class LinkMenuItem extends React.Component { {canExpand ?
this.toggleShowMore(e)}>
: <>} -
{showTitle}
}> +
{this.props.linkDoc.hidden ? "Show link" : "Hide link"}
}>
-
Edit Link
}> +
Edit Link
}>
-
Delete Link
}> +
Delete Link
}>
diff --git a/src/client/views/nodes/DocumentLinksButton.tsx b/src/client/views/nodes/DocumentLinksButton.tsx index 01c068966..bbef48e44 100644 --- a/src/client/views/nodes/DocumentLinksButton.tsx +++ b/src/client/views/nodes/DocumentLinksButton.tsx @@ -134,7 +134,6 @@ export class DocumentLinksButton extends React.Component { if (linkDoc) { @@ -213,10 +212,10 @@ export class DocumentLinksButton extends React.Component
{title}
}> +
{title}
}> {linkButton}
: !!!DocumentLinksButton.EditLink ? -
{title}
}> +
{title}
}> {linkButton}
: linkButton; diff --git a/src/client/views/nodes/DocumentView.tsx b/src/client/views/nodes/DocumentView.tsx index a6771443a..c0a8b3a59 100644 --- a/src/client/views/nodes/DocumentView.tsx +++ b/src/client/views/nodes/DocumentView.tsx @@ -589,16 +589,12 @@ export class DocumentView extends DocComponent(Docu @undoBatch toggleLinkButtonBehavior = (): void => { + this.Document.ignoreClick = false; if (this.Document.isLinkButton || this.onClickHandler || this.Document.ignoreClick) { this.Document.isLinkButton = false; - const first = DocListCast(this.Document.links).find(d => d instanceof Doc); - first && (first.hidden = false); - this.Document.ignoreClick = false; this.Document.onClick = this.layoutDoc.onClick = undefined; } else { this.Document.isLinkButton = true; - const first = DocListCast(this.Document.links).find(d => d instanceof Doc); - first && (first.hidden = true); this.Document.followLinkZoom = false; this.Document.followLinkLocation = undefined; } @@ -606,14 +602,9 @@ export class DocumentView extends DocComponent(Docu @undoBatch toggleFollowInPlace = (): void => { + this.Document.ignoreClick = false; + this.Document.isLinkButton = !this.Document.isLinkButton; if (this.Document.isLinkButton) { - this.Document.isLinkButton = false; - const first = DocListCast(this.Document.links).find(d => d instanceof Doc); - first && (first.hidden = false); - } else { - this.Document.isLinkButton = true; - const first = DocListCast(this.Document.links).find(d => d instanceof Doc); - first && (first.hidden = true); this.Document.followLinkZoom = true; this.Document.followLinkLocation = "inPlace"; } @@ -621,15 +612,10 @@ export class DocumentView extends DocComponent(Docu @undoBatch toggleFollowOnRight = (): void => { + this.Document.ignoreClick = false; + this.Document.isLinkButton = !this.Document.isLinkButton; if (this.Document.isLinkButton) { - this.Document.isLinkButton = false; - const first = DocListCast(this.Document.links).find(d => d instanceof Doc); - first && (first.hidden = false); - } else { - this.Document.isLinkButton = true; this.Document.followLinkZoom = false; - const first = DocListCast(this.Document.links).find(d => d instanceof Doc); - first && (first.hidden = true); this.Document.followLinkLocation = "onRight"; } } @@ -643,7 +629,6 @@ export class DocumentView extends DocComponent(Docu } const makeLink = action((linkDoc: Doc) => { LinkManager.currentLink = linkDoc; - linkDoc.hidden = true; LinkCreatedBox.popupX = de.x; LinkCreatedBox.popupY = de.y - 33; diff --git a/src/client/views/nodes/formattedText/FormattedTextBoxComment.tsx b/src/client/views/nodes/formattedText/FormattedTextBoxComment.tsx index c98b5eac1..3687d5513 100644 --- a/src/client/views/nodes/formattedText/FormattedTextBoxComment.tsx +++ b/src/client/views/nodes/formattedText/FormattedTextBoxComment.tsx @@ -270,14 +270,14 @@ export class FormattedTextBoxComment {
-
Delete Link
} placement="top"> +
Delete Link
} placement="top">
this._deleteRef = r}>
-
Follow Link
} placement="top"> +
Follow Link
} placement="top">
this._followRef = r}> - - + {title}
} key={title} placement="bottom"> + +
); } @@ -388,7 +391,9 @@ export default class RichTextMenu extends AntimodeMenu { } }); } - return ; + return {key}
} placement="bottom"> + + ; } createNodesDropdown(activeMap: string, options: { node: NodeType | any | null, title: string, label: string, command: (node: NodeType | any) => void, hidden?: boolean, style?: {} }[], key: string, setter: (val: string) => {}): JSX.Element { @@ -412,7 +417,10 @@ export default class RichTextMenu extends AntimodeMenu { } }); } - return ; + + return {key}
} placement="bottom"> + + ; } changeFontSize = (mark: Mark, view: EditorView) => { @@ -595,10 +603,11 @@ export default class RichTextMenu extends AntimodeMenu { label = "No marks are currently stored"; } - const button = -
} placement="bottom"> + ; + +
; const dropdownContent =
@@ -667,11 +676,12 @@ export default class RichTextMenu extends AntimodeMenu { self.TextView.EditorView!.focus(); } - const button = -
} placement="bottom"> + ; + +
; const dropdownContent =
@@ -720,11 +730,12 @@ export default class RichTextMenu extends AntimodeMenu { UndoManager.RunInBatch(() => self.view && self.insertHighlight(self.activeHighlightColor, self.view.state, self.view.dispatch), "rt highlighter"); } - const button = -
} placement="bottom"> + ; + +
; const dropdownContent =
@@ -763,7 +774,9 @@ export default class RichTextMenu extends AntimodeMenu { const link = this.currentLink ? this.currentLink : ""; - const button = ; + const button = set hyperlink
} placement="bottom"> +
+ ; const dropdownContent =
@@ -774,9 +787,7 @@ export default class RichTextMenu extends AntimodeMenu {
; - return ( - - ); + return ; } async getTextLinkTargetTitle() { @@ -935,7 +946,7 @@ export default class RichTextMenu extends AntimodeMenu { {[this.createMarksDropdown(this.activeFontSize, this.fontSizeOptions, "font size", action((val: string) => this.activeFontSize = val)), this.createMarksDropdown(this.activeFontFamily, this.fontFamilyOptions, "font family", action((val: string) => this.activeFontFamily = val)),
, - this.createNodesDropdown(this.activeListType, this.listTypeOptions, "nodes", action((val: string) => this.activeListType = val)), + this.createNodesDropdown(this.activeListType, this.listTypeOptions, "list type", action((val: string) => this.activeListType = val)), this.createButton("sort-amount-down", "Summarize", undefined, this.insertSummarizer), this.createButton("quote-left", "Blockquote", undefined, this.insertBlockquote), this.createButton("minus", "Horizontal Rule", undefined, this.insertHorizontalRule), diff --git a/src/client/views/pdf/PDFViewer.tsx b/src/client/views/pdf/PDFViewer.tsx index 4e5fdbfbb..56212a773 100644 --- a/src/client/views/pdf/PDFViewer.tsx +++ b/src/client/views/pdf/PDFViewer.tsx @@ -637,7 +637,7 @@ export class PDFViewer extends ViewBoxAnnotatableComponent { - if (this.active()) { + if (this.active(true)) { e.stopPropagation(); if (e.ctrlKey) { const curScale = Number(this._pdfViewer.currentScaleValue); -- cgit v1.2.3-70-g09d2 From 2f22e7006b663f7014d0ae1336ec0f81faa6cd14 Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Thu, 16 Jul 2020 11:24:57 -0400 Subject: made fitWidth the default for PDFs --- src/client/documents/Documents.ts | 1 + src/client/views/nodes/formattedText/ProsemirrorExampleTransfer.ts | 2 +- src/mobile/ImageUpload.tsx | 2 +- 3 files changed, 3 insertions(+), 2 deletions(-) (limited to 'src/client/documents') diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts index b57f4c6c7..5b58aa2e3 100644 --- a/src/client/documents/Documents.ts +++ b/src/client/documents/Documents.ts @@ -979,6 +979,7 @@ export namespace DocUtils { } if (type.indexOf("pdf") !== -1) { ctor = Docs.Create.PdfDocument; + if (!options._fitWidth) options._fitWidth = true; if (!options._width) options._width = 400; if (!options._height) options._height = options._width * 1200 / 927; } diff --git a/src/client/views/nodes/formattedText/ProsemirrorExampleTransfer.ts b/src/client/views/nodes/formattedText/ProsemirrorExampleTransfer.ts index 172cde3e0..8faf752b4 100644 --- a/src/client/views/nodes/formattedText/ProsemirrorExampleTransfer.ts +++ b/src/client/views/nodes/formattedText/ProsemirrorExampleTransfer.ts @@ -103,7 +103,7 @@ export default function buildKeymap>(schema: S, props: any //Command to create a new Tab with a PDF of all the command shortcuts bind("Mod-/", (state: EditorState, dispatch: (tx: Transaction) => void) => { - const newDoc = Docs.Create.PdfDocument(Utils.prepend("/assets/cheat-sheet.pdf"), { _width: 300, _height: 300 }); + const newDoc = Docs.Create.PdfDocument(Utils.prepend("/assets/cheat-sheet.pdf"), { _fitWidth: true, _width: 300, _height: 300 }); props.addDocTab(newDoc, "onRight"); }); diff --git a/src/mobile/ImageUpload.tsx b/src/mobile/ImageUpload.tsx index 5ea626d52..e13c91db9 100644 --- a/src/mobile/ImageUpload.tsx +++ b/src/mobile/ImageUpload.tsx @@ -55,7 +55,7 @@ export class Uploader extends React.Component { doc = Docs.Create.VideoDocument(path, { _nativeWidth: 400, _width: 400, title: name }); // Case 2: File is a PDF document } else if (file.type === "application/pdf") { - doc = Docs.Create.PdfDocument(path, { _nativeWidth: 400, _width: 400, title: name }); + doc = Docs.Create.PdfDocument(path, { _nativeWidth: 400, _width: 400, _fitWidth: true, title: name }); // Case 3: File is another document type (most likely Image) } else { doc = Docs.Create.ImageDocument(path, { _nativeWidth: 400, _width: 400, title: name }); -- cgit v1.2.3-70-g09d2 From 934fd41b249533ced87b5869c116f628f4a013b9 Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Fri, 17 Jul 2020 11:19:03 -0400 Subject: changed dropping menu items from collectionMenu to create fonticonbuttons if all parameters are filled in. . and buttons are placed in overlay layer. added labels to all fonticons usin title + added a tooltip field. turned off autoscroll of freeform view when dragign buttons (which will be in the overlay) --- src/client/documents/Documents.ts | 2 +- src/client/util/CurrentUserUtils.ts | 44 +++++++++++----------- src/client/util/DragManager.ts | 8 +++- src/client/views/collections/CollectionMenu.tsx | 22 +++++------ .../collectionFreeForm/CollectionFreeFormView.tsx | 4 +- src/client/views/nodes/FontIconBox.tsx | 21 ++++++----- .../views/nodes/formattedText/RichTextMenu.tsx | 4 +- src/fields/Doc.ts | 9 +++-- 8 files changed, 62 insertions(+), 52 deletions(-) (limited to 'src/client/documents') diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts index 5b58aa2e3..8e7d125b0 100644 --- a/src/client/documents/Documents.ts +++ b/src/client/documents/Documents.ts @@ -91,7 +91,7 @@ export interface DocumentOptions { layoutKey?: string; type?: string; title?: string; - label?: string; // short form of title for use as an icon label + toolTip?: string; // tooltip to display on hover style?: string; page?: number; description?: string; // added for links diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts index e0cb90b46..892d0ca1d 100644 --- a/src/client/util/CurrentUserUtils.ts +++ b/src/client/util/CurrentUserUtils.ts @@ -373,7 +373,7 @@ export class CurrentUserUtils { } static creatorBtnDescriptors(doc: Doc): { - title: string, label: string, icon: string, drag?: string, ignoreClick?: boolean, + title: string, toolTip: string, icon: string, drag?: string, ignoreClick?: boolean, click?: string, ischecked?: string, activeInkPen?: Doc, backgroundColor?: string, dragFactory?: Doc }[] { if (doc.emptyPresentation === undefined) { @@ -402,27 +402,27 @@ export class CurrentUserUtils { this.setupActiveMobileMenu(doc); } return [ - { title: "Drag a collection", label: "Col", icon: "folder", click: 'openOnRight(getCopy(this.dragFactory, true))', drag: 'getCopy(this.dragFactory, true)', dragFactory: doc.emptyCollection as Doc }, - { title: "Drag a web page", label: "Web", icon: "globe-asia", click: 'openOnRight(getCopy(this.dragFactory, true))', drag: 'getCopy(this.dragFactory, true)', dragFactory: doc.emptyWebpage as Doc }, - { title: "Drag a cat image", label: "Image", icon: "cat", ignoreClick: true, drag: 'Docs.Create.ImageDocument("https://upload.wikimedia.org/wikipedia/commons/thumb/3/3a/Cat03.jpg/1200px-Cat03.jpg", { _width: 250, _nativeWidth:250, title: "an image of a cat" })' }, - { title: "Drag a comparison box", label: "Comp", icon: "columns", click: 'openOnRight(getCopy(this.dragFactory, true))', drag: 'getCopy(this.dragFactory, true)', dragFactory: doc.emptyComparison as Doc }, - { title: "Drag a screengrabber", label: "Grab", icon: "photo-video", ignoreClick: true, drag: 'Docs.Create.ScreenshotDocument("", { _width: 400, _height: 200, title: "screen snapshot" })' }, - // { title: "Drag a webcam", label: "Cam", icon: "video", ignoreClick: true, drag: 'Docs.Create.WebCamDocument("", { _width: 400, _height: 400, title: "a test cam" })' }, - { title: "Drag a audio recorder", label: "Audio", icon: "microphone", ignoreClick: true, drag: `Docs.Create.AudioDocument("${nullAudio}", { _width: 200, title: "ready to record audio" })` }, - { title: "Drag a button", label: "Button", icon: "bolt", ignoreClick: true, drag: 'Docs.Create.ButtonDocument({ _width: 150, _height: 50, _xPadding:10, _yPadding: 10, title: "Button" })' }, - { title: "Drag a presentation view", label: "Prezi", icon: "tv", click: 'openOnRight(Doc.UserDoc().activePresentation = getCopy(this.dragFactory, true))', drag: `Doc.UserDoc().activePresentation = getCopy(this.dragFactory,true)`, dragFactory: doc.emptyPresentation as Doc }, - { title: "Drag a search box", label: "Query", icon: "search", ignoreClick: true, drag: 'Docs.Create.QueryDocument({ _width: 200, title: "an image of a cat" })' }, - { title: "Drag a scripting box", label: "Script", icon: "terminal", click: 'openOnRight(getCopy(this.dragFactory, true))', drag: 'getCopy(this.dragFactory, true)', dragFactory: doc.emptyScript as Doc }, - // { title: "Drag an import folder", label: "Load", icon: "cloud-upload-alt", ignoreClick: true, drag: 'Docs.Create.DirectoryImportDocument({ title: "Directory Import", _width: 400, _height: 400 })' }, - { title: "Drag a mobile view", label: "Phone", icon: "mobile", click: 'openOnRight(Doc.UserDoc().activeMobileMenu)', drag: 'this.dragFactory', dragFactory: doc.activeMobileMenu as Doc }, - // { title: "Drag an instance of the device collection", label: "Buxton", icon: "globe-asia", ignoreClick: true, drag: 'Docs.Create.Buxton()' }, + { toolTip: "Drag a collection", title: "Col", icon: "folder", click: 'openOnRight(getCopy(this.dragFactory, true))', drag: 'getCopy(this.dragFactory, true)', dragFactory: doc.emptyCollection as Doc }, + { toolTip: "Drag a web page", title: "Web", icon: "globe-asia", click: 'openOnRight(getCopy(this.dragFactory, true))', drag: 'getCopy(this.dragFactory, true)', dragFactory: doc.emptyWebpage as Doc }, + { toolTip: "Drag a cat image", title: "Image", icon: "cat", ignoreClick: true, drag: 'Docs.Create.ImageDocument("https://upload.wikimedia.org/wikipedia/commons/thumb/3/3a/Cat03.jpg/1200px-Cat03.jpg", { _width: 250, _nativeWidth:250, title: "an image of a cat" })' }, + { toolTip: "Drag a comparison box", title: "Comp", icon: "columns", click: 'openOnRight(getCopy(this.dragFactory, true))', drag: 'getCopy(this.dragFactory, true)', dragFactory: doc.emptyComparison as Doc }, + { toolTip: "Drag a screengrabber", title: "Grab", icon: "photo-video", ignoreClick: true, drag: 'Docs.Create.ScreenshotDocument("", { _width: 400, _height: 200, title: "screen snapshot" })' }, + // { title: "Drag a webcam", title: "Cam", icon: "video", ignoreClick: true, drag: 'Docs.Create.WebCamDocument("", { _width: 400, _height: 400, title: "a test cam" })' }, + { toolTip: "Drag a audio recorder", title: "Audio", icon: "microphone", ignoreClick: true, drag: `Docs.Create.AudioDocument("${nullAudio}", { _width: 200, title: "ready to record audio" })` }, + { toolTip: "Drag a button", title: "Button", icon: "bolt", ignoreClick: true, drag: 'Docs.Create.ButtonDocument({ _width: 150, _height: 50, _xPadding:10, _yPadding: 10, title: "Button" })' }, + { toolTip: "Drag a presentation view", title: "Prezi", icon: "tv", click: 'openOnRight(Doc.UserDoc().activePresentation = getCopy(this.dragFactory, true))', drag: `Doc.UserDoc().activePresentation = getCopy(this.dragFactory,true)`, dragFactory: doc.emptyPresentation as Doc }, + { toolTip: "Drag a search box", title: "Query", icon: "search", ignoreClick: true, drag: 'Docs.Create.QueryDocument({ _width: 200, title: "an image of a cat" })' }, + { toolTip: "Drag a scripting box", title: "Script", icon: "terminal", click: 'openOnRight(getCopy(this.dragFactory, true))', drag: 'getCopy(this.dragFactory, true)', dragFactory: doc.emptyScript as Doc }, + // { title: "Drag an import folder", title: "Load", icon: "cloud-upload-alt", ignoreClick: true, drag: 'Docs.Create.DirectoryImportDocument({ title: "Directory Import", _width: 400, _height: 400 })' }, + { toolTip: "Drag a mobile view", title: "Phone", icon: "mobile", click: 'openOnRight(Doc.UserDoc().activeMobileMenu)', drag: 'this.dragFactory', dragFactory: doc.activeMobileMenu as Doc }, + // { title: "Drag an instance of the device collection", title: "Buxton", icon: "globe-asia", ignoreClick: true, drag: 'Docs.Create.Buxton()' }, // { title: "use pen", icon: "pen-nib", click: 'activatePen(this.activeInkPen = sameDocs(this.activeInkPen, this) ? undefined : this)', backgroundColor: "blue", ischecked: `sameDocs(this.activeInkPen, this)`, activeInkPen: doc }, // { title: "use highlighter", icon: "highlighter", click: 'activateBrush(this.activeInkPen = sameDocs(this.activeInkPen, this) ? undefined : this,20,this.backgroundColor)', backgroundColor: "yellow", ischecked: `sameDocs(this.activeInkPen, this)`, activeInkPen: doc }, // { title: "use stamp", icon: "stamp", click: 'activateStamp(this.activeInkPen = sameDocs(this.activeInkPen, this) ? undefined : this)', backgroundColor: "orange", ischecked: `sameDocs(this.activeInkPen, this)`, activeInkPen: doc }, // { title: "use eraser", icon: "eraser", click: 'activateEraser(this.activeInkPen = sameDocs(this.activeInkPen, this) ? undefined : this);', ischecked: `sameDocs(this.activeInkPen, this)`, backgroundColor: "pink", activeInkPen: doc }, // { title: "use drag", icon: "mouse-pointer", click: 'deactivateInk();this.activeInkPen = this;', ischecked: `sameDocs(this.activeInkPen, this)`, backgroundColor: "white", activeInkPen: doc }, - { title: "Drag a document previewer", label: "Prev", icon: "expand", click: 'openOnRight(getCopy(this.dragFactory, true))', drag: 'getCopy(this.dragFactory,true)', dragFactory: doc.emptyDocHolder as Doc }, - { title: "Toggle a Calculator REPL", label: "repl", icon: "calculator", click: 'addOverlayWindow("ScriptingRepl", { x: 300, y: 100, width: 200, height: 200, title: "Scripting REPL" })' }, + { toolTip: "Drag a document previewer", title: "Prev", icon: "expand", click: 'openOnRight(getCopy(this.dragFactory, true))', drag: 'getCopy(this.dragFactory,true)', dragFactory: doc.emptyDocHolder as Doc }, + { toolTip: "Toggle a Calculator REPL", title: "repl", icon: "calculator", click: 'addOverlayWindow("ScriptingRepl", { x: 300, y: 100, width: 200, height: 200, title: "Scripting REPL" })' }, ]; } @@ -439,11 +439,11 @@ export class CurrentUserUtils { } } const buttons = CurrentUserUtils.creatorBtnDescriptors(doc).filter(d => !alreadyCreatedButtons?.includes(d.title)); - const creatorBtns = buttons.map(({ title, label, icon, ignoreClick, drag, click, ischecked, activeInkPen, backgroundColor, dragFactory }) => Docs.Create.FontIconDocument({ + const creatorBtns = buttons.map(({ title, toolTip, icon, ignoreClick, drag, click, ischecked, activeInkPen, backgroundColor, dragFactory }) => Docs.Create.FontIconDocument({ _nativeWidth: 100, _nativeHeight: 100, _width: 100, _height: 100, icon, title, - label, + toolTip, ignoreClick, dropAction: "copy", onDragStart: drag ? ScriptField.MakeFunction(drag) : undefined, @@ -735,14 +735,14 @@ export class CurrentUserUtils { if (doc["dockedBtn-pen"] === undefined) { doc["dockedBtn-pen"] = CurrentUserUtils.ficon({ onClick: ScriptField.MakeScript("activatePen(this.activeInkPen = sameDocs(this.activeInkPen, this) ? undefined : this)"), - author: "systemTemplates", title: "ink mode", icon: "pen-nib", ischecked: ComputedField.MakeFunction(`sameDocs(this.activeInkPen, this)`), activeInkPen: doc + author: "systemTemplates", toolTip: "open drawing tools", title: "draw", icon: "pen-nib", ischecked: ComputedField.MakeFunction(`sameDocs(this.activeInkPen, this)`), activeInkPen: doc }); } if (doc["dockedBtn-undo"] === undefined) { - doc["dockedBtn-undo"] = CurrentUserUtils.ficon({ onClick: ScriptField.MakeScript("undo()"), title: "undo button", icon: "undo-alt" }); + doc["dockedBtn-undo"] = CurrentUserUtils.ficon({ onClick: ScriptField.MakeScript("undo()"), toolTip: "click to undo", title: "undo", icon: "undo-alt" }); } if (doc["dockedBtn-redo"] === undefined) { - doc["dockedBtn-redo"] = CurrentUserUtils.ficon({ onClick: ScriptField.MakeScript("redo()"), title: "redo button", icon: "redo-alt" }); + doc["dockedBtn-redo"] = CurrentUserUtils.ficon({ onClick: ScriptField.MakeScript("redo()"), toolTip: "click to redo", title: "redo", icon: "redo-alt" }); } if (doc.dockedBtns === undefined) { doc.dockedBtns = CurrentUserUtils.blist({ title: "docked buttons", ignoreClick: true }, [doc["dockedBtn-undo"] as Doc, doc["dockedBtn-redo"] as Doc, doc["dockedBtn-pen"] as Doc]); diff --git a/src/client/util/DragManager.ts b/src/client/util/DragManager.ts index 5f34509a1..6a3108157 100644 --- a/src/client/util/DragManager.ts +++ b/src/client/util/DragManager.ts @@ -83,6 +83,7 @@ export namespace DragManager { hideSource?: boolean; // hide source document during drag offsetX?: number; // offset of top left of source drag visual from cursor offsetY?: number; + noAutoscroll?: boolean; } // event called when the drag operation results in a drop action @@ -225,13 +226,16 @@ export namespace DragManager { // drag a button template and drop a new button export function StartButtonDrag(eles: HTMLElement[], script: string, title: string, vars: { [name: string]: Field }, params: string[], initialize: (button: Doc) => void, downX: number, downY: number, options?: DragOptions) { const finishDrag = (e: DragCompleteEvent) => { - const bd = Docs.Create.ButtonDocument({ _width: 150, _height: 50, title, onClick: ScriptField.MakeScript(script) }); + const bd = params.length > Object.keys(vars).length ? + Docs.Create.ButtonDocument({ toolTip: title, z: 1, _width: 150, _height: 50, title, onClick: ScriptField.MakeScript(script) }) : + Docs.Create.FontIconDocument({ toolTip: title, z: 1, _nativeWidth: 30, _nativeHeight: 30, _width: 30, _height: 30, title, onClick: ScriptField.MakeScript(script) }); params.map(p => Object.keys(vars).indexOf(p) !== -1 && (Doc.GetProto(bd)[p] = new PrefetchProxy(vars[p] as Doc))); // copy all "captured" arguments into document parameterfields initialize?.(bd); Doc.GetProto(bd)["onClick-paramFieldKeys"] = new List(params); e.docDragData && (e.docDragData.droppedDocuments = [bd]); return e; }; + options && (options.noAutoscroll = true); StartDrag(eles, new DragManager.DocumentDragData([]), downX, downY, options, finishDrag); } @@ -431,7 +435,7 @@ export namespace DragManager { const complete = new DragCompleteEvent(false, dragData); - if (target) { + if (target && !options?.noAutoscroll) { target.dispatchEvent( new CustomEvent("dashDragging", { bubbles: true, diff --git a/src/client/views/collections/CollectionMenu.tsx b/src/client/views/collections/CollectionMenu.tsx index cdd653823..84e5d56cb 100644 --- a/src/client/views/collections/CollectionMenu.tsx +++ b/src/client/views/collections/CollectionMenu.tsx @@ -62,37 +62,37 @@ export class CollectionViewBaseChrome extends React.Component item view", - script: "this.target.childLayout = getDocTemplate(this.source?.[0])", - immediate: undoBatch((source: Doc[]) => source.length && (this.target.childLayout = Doc.getDocTemplate(source?.[0]))), + params: ["target", "source"], title: "item view", + script: "this.target.childLayoutTemplate = getDocTemplate(this.source?.[0])", + immediate: undoBatch((source: Doc[]) => source.length && (this.target.childLayoutTemplate = Doc.getDocTemplate(source?.[0]))), initialize: emptyFunction, }; _narrativeCommand = { - params: ["target", "source"], title: "=> child click view", + params: ["target", "source"], title: "child click view", script: "this.target.childClickedOpenTemplateView = getDocTemplate(this.source?.[0])", immediate: undoBatch((source: Doc[]) => source.length && (this.target.childClickedOpenTemplateView = Doc.getDocTemplate(source?.[0]))), initialize: emptyFunction, }; _contentCommand = { - params: ["target", "source"], title: "=> clear content", + params: ["target", "source"], title: "clear content", script: "getProto(this.target).data = copyField(this.source);", immediate: undoBatch((source: Doc[]) => Doc.GetProto(this.target).data = new List(source)), // Doc.aliasDocs(source), initialize: emptyFunction, }; _viewCommand = { - params: ["target"], title: "=> reset view", - script: "this.target._panX = this.restoredPanX; this.target._panY = this.restoredPanY; this.target.scale = this.restoredScale;", - immediate: undoBatch((source: Doc[]) => { this.target._panX = 0; this.target._panY = 0; this.target.scale = 1; }), - initialize: (button: Doc) => { button.restoredPanX = this.target._panX; button.restoredPanY = this.target._panY; button.restoredScale = this.target.scale; }, + params: ["target"], title: "bookmark view", + script: "this.target._panX = this['target-panX']; this.target._panY = this['target-panY']; this.target._viewScale = this['target-viewScale'];", + immediate: undoBatch((source: Doc[]) => { this.target._panX = 0; this.target._panY = 0; this.target._viewScale = 1; }), + initialize: (button: Doc) => { button['target-panX'] = this.target._panX; button['target-panY'] = this.target._panY; button['target-viewScale'] = this.target._viewScale; }, }; _clusterCommand = { - params: ["target"], title: "=> fit content", + params: ["target"], title: "fit content", script: "this.target._fitToBox = !this.target._fitToBox;", immediate: undoBatch((source: Doc[]) => this.target._fitToBox = !this.target._fitToBox), initialize: emptyFunction }; _fitContentCommand = { - params: ["target"], title: "=> toggle clusters", + params: ["target"], title: "toggle clusters", script: "this.target.useClusters = !this.target.useClusters;", immediate: undoBatch((source: Doc[]) => this.target.useClusters = !this.target.useClusters), initialize: emptyFunction diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx index 922cb17fe..e119910bd 100644 --- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx +++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx @@ -953,8 +953,8 @@ export class CollectionFreeFormView extends CollectionSubView( render() { const referenceDoc = (this.layoutDoc.dragFactory instanceof Doc ? this.layoutDoc.dragFactory : this.layoutDoc); const refLayout = Doc.Layout(referenceDoc); - return ; + return {StrCast(this.layoutDoc.toolTip)}
}> + + ; } } \ No newline at end of file diff --git a/src/client/views/nodes/formattedText/RichTextMenu.tsx b/src/client/views/nodes/formattedText/RichTextMenu.tsx index 9890ef2c1..3c7c58126 100644 --- a/src/client/views/nodes/formattedText/RichTextMenu.tsx +++ b/src/client/views/nodes/formattedText/RichTextMenu.tsx @@ -319,7 +319,7 @@ export default class RichTextMenu extends AntimodeMenu { } destroy() { - !this.TextView.props.isSelected(false) && this.fadeOut(true); + !this.TextView?.props.isSelected(false) && this.fadeOut(true); } @action @@ -657,7 +657,7 @@ export default class RichTextMenu extends AntimodeMenu { @action toggleColorDropdown() { this.showColorDropdown = !this.showColorDropdown; } @action setActiveColor(color: string) { this.activeFontColor = color; } - get TextView() { return (this.view as any).TextView as FormattedTextBox; } + get TextView() { return (this.view as any)?.TextView as FormattedTextBox; } createColorButton() { const self = this; diff --git a/src/fields/Doc.ts b/src/fields/Doc.ts index 7aa1d528d..3ad9f4e41 100644 --- a/src/fields/Doc.ts +++ b/src/fields/Doc.ts @@ -899,9 +899,12 @@ export namespace Doc { } export function getDocTemplate(doc?: Doc) { - return doc?.isTemplateDoc ? doc : - Cast(doc?.dragFactory, Doc, null)?.isTemplateDoc ? doc?.dragFactory : - Cast(doc?.layout, Doc, null)?.isTemplateDoc ? doc?.layout : undefined; + return !doc ? undefined : + doc.isTemplateDoc ? doc : + Cast(doc.dragFactory, Doc, null)?.isTemplateDoc ? doc.dragFactory : + Cast(Doc.Layout(doc), Doc, null)?.isTemplateDoc ? + (Cast(Doc.Layout(doc), Doc, null).resolvedDataDoc ? Doc.Layout(doc).proto : Doc.Layout(doc)) : + undefined; } export function matchFieldValue(doc: Doc, key: string, value: any): boolean { -- cgit v1.2.3-70-g09d2 From e613f4ebc268bb9d8a0bd1ea2f07fef73a870199 Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Mon, 20 Jul 2020 17:01:39 -0400 Subject: fixed noAutoscroll functionality for creator icons --- src/client/documents/Documents.ts | 1 + src/client/util/CurrentUserUtils.ts | 7 +++---- src/client/util/DragManager.ts | 2 +- src/client/views/nodes/FontIconBox.scss | 3 ++- src/fields/ScriptField.ts | 2 +- 5 files changed, 8 insertions(+), 7 deletions(-) (limited to 'src/client/documents') diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts index 8e7d125b0..2d74c462d 100644 --- a/src/client/documents/Documents.ts +++ b/src/client/documents/Documents.ts @@ -69,6 +69,7 @@ export interface DocumentOptions { _showTitle?: string; // which field to display in the title area. leave empty to have no title _showCaption?: string; // which field to display in the caption area. leave empty to have no caption _scrollTop?: number; // scroll location for pdfs + _noAutoscroll?: boolean;// whether collectoins autoscroll when this item is dragged _chromeStatus?: string; _viewType?: string; // sub type of a collection _gridGap?: number; // gap between items in masonry view diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts index 4b8c342f1..d53a6fcdb 100644 --- a/src/client/util/CurrentUserUtils.ts +++ b/src/client/util/CurrentUserUtils.ts @@ -466,6 +466,7 @@ export class CurrentUserUtils { onClick: click ? ScriptField.MakeScript(click) : undefined, ischecked: ischecked ? ComputedField.MakeFunction(ischecked) : undefined, activeInkPen, + _noAutoscroll: true, backgroundColor, removeDropProperties: new List(["dropAction"]), dragFactory, @@ -735,15 +736,13 @@ export class CurrentUserUtils { } static blist = (opts: DocumentOptions, docs: Doc[]) => new PrefetchProxy(Docs.Create.LinearDocument(docs, { - ...opts, - _gridGap: 5, _xMargin: 5, _yMargin: 5, _height: 42, _width: 100, boxShadow: "0 0", forceActive: true, + ...opts, _noAutoscroll: true, _gridGap: 5, _xMargin: 5, _yMargin: 5, _height: 42, _width: 100, boxShadow: "0 0", forceActive: true, dropConverter: ScriptField.MakeScript("convertToButtons(dragData)", { dragData: DragManager.DocumentDragData.name }), backgroundColor: "black", treeViewPreventOpen: true, lockedPosition: true, _chromeStatus: "disabled", linearViewIsExpanded: true })) as any as Doc static ficon = (opts: DocumentOptions) => new PrefetchProxy(Docs.Create.FontIconDocument({ - ...opts, - dropAction: "alias", removeDropProperties: new List(["dropAction"]), _nativeWidth: 100, _nativeHeight: 100, _width: 100, _height: 100 + ...opts, _noAutoscroll: true, dropAction: "alias", removeDropProperties: new List(["dropAction"]), _nativeWidth: 100, _nativeHeight: 100, _width: 100, _height: 100 })) as any as Doc /// sets up the default list of buttons to be shown in the expanding button menu at the bottom of the Dash window diff --git a/src/client/util/DragManager.ts b/src/client/util/DragManager.ts index 6a3108157..007336190 100644 --- a/src/client/util/DragManager.ts +++ b/src/client/util/DragManager.ts @@ -435,7 +435,7 @@ export namespace DragManager { const complete = new DragCompleteEvent(false, dragData); - if (target && !options?.noAutoscroll) { + if (target && !options?.noAutoscroll && !dragData.draggedDocuments?.some((d: any) => d._noAutoscroll)) { target.dispatchEvent( new CustomEvent("dashDragging", { bubbles: true, diff --git a/src/client/views/nodes/FontIconBox.scss b/src/client/views/nodes/FontIconBox.scss index fe0f067ad..5b85d8b0b 100644 --- a/src/client/views/nodes/FontIconBox.scss +++ b/src/client/views/nodes/FontIconBox.scss @@ -11,7 +11,6 @@ .fontIconBox-label { background: gray; color:white; - margin-left: -10px; border-radius: 8px; width:100%; position: absolute; @@ -19,6 +18,8 @@ font-size: 8px; margin-top:4px; letter-spacing: normal; + left: 0; + overflow: hidden; } svg { diff --git a/src/fields/ScriptField.ts b/src/fields/ScriptField.ts index ebca19430..4604a2132 100644 --- a/src/fields/ScriptField.ts +++ b/src/fields/ScriptField.ts @@ -51,7 +51,7 @@ async function deserializeScript(script: ScriptField) { return (script as any).script = (ScriptField.DeiconifyView ?? (ScriptField.DeiconifyView = ComputedField.MakeFunction('deiconifyView(self)')))?.script; } if (script.script.originalScript === 'convertToButtons(dragData)') { - return (script as any).script = (ScriptField.ConvertToButtons ?? (ScriptField.ConvertToButtons = ComputedField.MakeFunction('convertToButtons(dragData)')))?.script; + return (script as any).script = (ScriptField.ConvertToButtons ?? (ScriptField.ConvertToButtons = ComputedField.MakeFunction('convertToButtons(dragData)', { dragData: "DocumentDragData" })))?.script; } console.log(script.script.originalScript); const captures: ProxyField = (script as any).captures; -- cgit v1.2.3-70-g09d2 From fa68e59c31c9ad4b4458933a246440807529794b Mon Sep 17 00:00:00 2001 From: usodhi <61431818+usodhi@users.noreply.github.com> Date: Tue, 21 Jul 2020 12:15:39 +0530 Subject: more addonly fixes --- src/client/documents/Documents.ts | 3 +++ src/client/views/DocComponent.tsx | 10 ++++++---- src/client/views/MainView.tsx | 2 +- src/client/views/collections/CollectionSubView.tsx | 6 ++++++ 4 files changed, 16 insertions(+), 5 deletions(-) (limited to 'src/client/documents') diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts index 8e7d125b0..c783a761a 100644 --- a/src/client/documents/Documents.ts +++ b/src/client/documents/Documents.ts @@ -549,6 +549,9 @@ export namespace Docs { const dataDoc = MakeDataDelegate(proto, protoProps, data, fieldKey); const viewDoc = Doc.MakeDelegate(dataDoc, delegId); + // so that the list of annotations is already initialised, prevents issues in addonly + dataDoc[fieldKey + "-annotations"] = new List(); + proto.links = ComputedField.MakeFunction("links(self)"); viewDoc.author = Doc.CurrentUserEmail; diff --git a/src/client/views/DocComponent.tsx b/src/client/views/DocComponent.tsx index 8740d17c2..2519360da 100644 --- a/src/client/views/DocComponent.tsx +++ b/src/client/views/DocComponent.tsx @@ -1,4 +1,4 @@ -import { Doc, Opt, DataSym, DocListCast, AclReadonly, AclAddonly, AclPrivate, AclEdit, AclSym } from '../../fields/Doc'; +import { Doc, Opt, DataSym, AclReadonly, AclAddonly, AclPrivate, AclEdit, AclSym, DocListCastAsync, DocListCast } from '../../fields/Doc'; import { Touchable } from './Touchable'; import { computed, action, observable } from 'mobx'; import { Cast, BoolCast, ScriptCast } from '../../fields/Types'; @@ -126,11 +126,13 @@ export function ViewBoxAnnotatableComponent

doc.annotationOn = undefined); const targetDataDoc = this.dataDoc; const value = DocListCast(targetDataDoc[this.annotationKey]); - const result = value.filter(v => !docs.includes(v)); - if (result.length !== value.length) { - targetDataDoc[this.annotationKey] = new List(result); + const toRemove = value.filter(v => docs.includes(v)); + // can't assign new List(result) to this because you can't assign new values in addonly + if (toRemove.length !== 0) { + toRemove.forEach(doc => Doc.RemoveDocFromList(targetDataDoc, this.annotationKey, doc)); return true; } + return false; } // if the moved document is already in this overlay collection nothing needs to be done. diff --git a/src/client/views/MainView.tsx b/src/client/views/MainView.tsx index 7184e8225..aadfdef21 100644 --- a/src/client/views/MainView.tsx +++ b/src/client/views/MainView.tsx @@ -90,7 +90,7 @@ export class MainView extends React.Component { public isPointerDown = false; componentDidMount() { - DocServer.setPlaygroundFields(["dataTransition", "_viewTransition", "_panX", "_panY", "_viewScale", "_viewType", "_chromeStatus", "data-annotations"]); // can play with these fields on someone else's + DocServer.setPlaygroundFields(["dataTransition", "_viewTransition", "_panX", "_panY", "_viewScale", "_viewType", "_chromeStatus"]); // can play with these fields on someone else's const tag = document.createElement('script'); diff --git a/src/client/views/collections/CollectionSubView.tsx b/src/client/views/collections/CollectionSubView.tsx index 3794088d4..8a3c2144e 100644 --- a/src/client/views/collections/CollectionSubView.tsx +++ b/src/client/views/collections/CollectionSubView.tsx @@ -91,6 +91,11 @@ export function CollectionSubView(schemaCtor: (doc: Doc) => T, moreProps?: // to its children which may be templates. // If 'annotationField' is specified, then all children exist on that field of the extension document, otherwise, they exist directly on the data document under 'fieldKey' @computed get dataField() { + // sets the dataDoc's data field to an empty list if the data field is undefined - prevents issues with addonly + // setTimeout changes it outside of the @computed section + setTimeout(() => { + if (!this.dataDoc[this.props.annotationsKey || this.props.fieldKey]) this.dataDoc[this.props.annotationsKey || this.props.fieldKey] = new List(); + }, 1000); return this.dataDoc[this.props.annotationsKey || this.props.fieldKey]; } @@ -418,4 +423,5 @@ import { FormattedTextBox, GoogleRef } from "../nodes/formattedText/FormattedTex import { CollectionView } from "./CollectionView"; import { SelectionManager } from "../../util/SelectionManager"; import { OverlayView } from "../OverlayView"; +import { setTimeout } from "timers"; -- cgit v1.2.3-70-g09d2 From 2d0741800ed626ac3db2a8ac551904cbc0f7848e Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Tue, 21 Jul 2020 09:38:29 -0400 Subject: fixed up autoscrollin a bit. scrolls the correct collection and waits 250ms to start scrolling. --- src/client/documents/Documents.ts | 2 +- src/client/util/CurrentUserUtils.ts | 5 +- src/client/util/DragManager.ts | 96 ++++++++++++---------- .../collectionFreeForm/CollectionFreeFormView.tsx | 41 +++------ 4 files changed, 65 insertions(+), 79 deletions(-) (limited to 'src/client/documents') diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts index 2d74c462d..36c8a0d3b 100644 --- a/src/client/documents/Documents.ts +++ b/src/client/documents/Documents.ts @@ -69,7 +69,7 @@ export interface DocumentOptions { _showTitle?: string; // which field to display in the title area. leave empty to have no title _showCaption?: string; // which field to display in the caption area. leave empty to have no caption _scrollTop?: number; // scroll location for pdfs - _noAutoscroll?: boolean;// whether collectoins autoscroll when this item is dragged + _noAutoscroll?: boolean;// whether collections autoscroll when this item is dragged _chromeStatus?: string; _viewType?: string; // sub type of a collection _gridGap?: number; // gap between items in masonry view diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts index d53a6fcdb..03a75381a 100644 --- a/src/client/util/CurrentUserUtils.ts +++ b/src/client/util/CurrentUserUtils.ts @@ -466,7 +466,6 @@ export class CurrentUserUtils { onClick: click ? ScriptField.MakeScript(click) : undefined, ischecked: ischecked ? ComputedField.MakeFunction(ischecked) : undefined, activeInkPen, - _noAutoscroll: true, backgroundColor, removeDropProperties: new List(["dropAction"]), dragFactory, @@ -736,13 +735,13 @@ export class CurrentUserUtils { } static blist = (opts: DocumentOptions, docs: Doc[]) => new PrefetchProxy(Docs.Create.LinearDocument(docs, { - ...opts, _noAutoscroll: true, _gridGap: 5, _xMargin: 5, _yMargin: 5, _height: 42, _width: 100, boxShadow: "0 0", forceActive: true, + ...opts, _gridGap: 5, _xMargin: 5, _yMargin: 5, _height: 42, _width: 100, boxShadow: "0 0", forceActive: true, dropConverter: ScriptField.MakeScript("convertToButtons(dragData)", { dragData: DragManager.DocumentDragData.name }), backgroundColor: "black", treeViewPreventOpen: true, lockedPosition: true, _chromeStatus: "disabled", linearViewIsExpanded: true })) as any as Doc static ficon = (opts: DocumentOptions) => new PrefetchProxy(Docs.Create.FontIconDocument({ - ...opts, _noAutoscroll: true, dropAction: "alias", removeDropProperties: new List(["dropAction"]), _nativeWidth: 100, _nativeHeight: 100, _width: 100, _height: 100 + ...opts, dropAction: "alias", removeDropProperties: new List(["dropAction"]), _nativeWidth: 100, _nativeHeight: 100, _width: 100, _height: 100 })) as any as Doc /// sets up the default list of buttons to be shown in the expanding button menu at the bottom of the Dash window diff --git a/src/client/util/DragManager.ts b/src/client/util/DragManager.ts index 007336190..4291eee9c 100644 --- a/src/client/util/DragManager.ts +++ b/src/client/util/DragManager.ts @@ -7,7 +7,7 @@ import { listSpec } from "../../fields/Schema"; import { SchemaHeaderField } from "../../fields/SchemaHeaderField"; import { ScriptField } from "../../fields/ScriptField"; import { Cast, NumCast, ScriptCast, StrCast } from "../../fields/Types"; -import { emptyFunction } from "../../Utils"; +import { emptyFunction, returnTrue } from "../../Utils"; import { Docs, DocUtils } from "../documents/Documents"; import * as globalCssVariables from "../views/globalCssVariables.scss"; import { UndoManager } from "./UndoManager"; @@ -235,7 +235,8 @@ export namespace DragManager { e.docDragData && (e.docDragData.droppedDocuments = [bd]); return e; }; - options && (options.noAutoscroll = true); + options = options ?? {}; + options.noAutoscroll = true; // these buttons are being dragged on the overlay layer, so scrollin the underlay is not appropriate StartDrag(eles, new DragManager.DocumentDragData([]), downX, downY, options, finishDrag); } @@ -411,6 +412,8 @@ export namespace DragManager { const yFromTop = downY - elesCont.top; const xFromRight = elesCont.right - downX; const yFromBottom = elesCont.bottom - downY; + let paused = false; + let scrollAwaiter: Opt; const moveHandler = (e: PointerEvent) => { e.preventDefault(); // required or dragging text menu link item ends up dragging the link button as native drag/drop if (dragData instanceof DocumentDragData) { @@ -433,50 +436,55 @@ export namespace DragManager { const target = document.elementFromPoint(e.x, e.y); - const complete = new DragCompleteEvent(false, dragData); - if (target && !options?.noAutoscroll && !dragData.draggedDocuments?.some((d: any) => d._noAutoscroll)) { - target.dispatchEvent( - new CustomEvent("dashDragging", { - bubbles: true, - detail: { - shiftKey: e.shiftKey, - altKey: e.altKey, - metaKey: e.metaKey, - ctrlKey: e.ctrlKey, - clientX: e.clientX, - clientY: e.clientY, - dataTransfer: new DataTransfer, - button: e.button, - buttons: e.buttons, - getModifierState: e.getModifierState, - movementX: e.movementX, - movementY: e.movementY, - pageX: e.pageX, - pageY: e.pageY, - relatedTarget: e.relatedTarget, - screenX: e.screenX, - screenY: e.screenY, - detail: e.detail, - view: e.view ? e.view : new Window, - nativeEvent: new DragEvent("dashDragging"), - currentTarget: target, - target: target, + scrollAwaiter && clearTimeout(scrollAwaiter); + scrollAwaiter = setTimeout(() => autoScrollHandler(), 250); + const autoScrollHandler = () => { + target.dispatchEvent( + new CustomEvent("dashDragAutoScroll", { bubbles: true, - cancelable: true, - defaultPrevented: true, - eventPhase: e.eventPhase, - isTrusted: true, - preventDefault: e.preventDefault, - isDefaultPrevented: () => true, - stopPropagation: e.stopPropagation, - isPropagationStopped: () => true, - persist: emptyFunction, - timeStamp: e.timeStamp, - type: "dashDragging" - } - }) - ); + detail: { + shiftKey: e.shiftKey, + altKey: e.altKey, + metaKey: e.metaKey, + ctrlKey: e.ctrlKey, + clientX: e.clientX, + clientY: e.clientY, + dataTransfer: new DataTransfer, + button: e.button, + buttons: e.buttons, + getModifierState: e.getModifierState, + movementX: e.movementX, + movementY: e.movementY, + pageX: e.pageX, + pageY: e.pageY, + relatedTarget: e.relatedTarget, + screenX: e.screenX, + screenY: e.screenY, + detail: e.detail, + view: e.view ? e.view : new Window, + nativeEvent: new DragEvent("dashDragAutoScroll"), + currentTarget: target, + target: target, + bubbles: true, + cancelable: true, + defaultPrevented: true, + eventPhase: e.eventPhase, + isTrusted: true, + preventDefault: () => "not implemented for this event" ? false : false, + isDefaultPrevented: () => "not implemented for this event" ? false : false, + stopPropagation: () => "not implemented for this event" ? false : false, + isPropagationStopped: () => "not implemented for this event" ? false : false, + persist: emptyFunction, + timeStamp: e.timeStamp, + type: "dashDragAutoScroll" + } + }) + ); + + scrollAwaiter && clearTimeout(scrollAwaiter); + SnappingManager.GetIsDragging() && (scrollAwaiter = setTimeout(() => autoScrollHandler(), 25)); + } } const { thisX, thisY } = snapDrag(e, xFromLeft, yFromTop, xFromRight, yFromBottom); diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx index 01b0c81d8..412f91417 100644 --- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx +++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx @@ -85,8 +85,6 @@ export class CollectionFreeFormView extends CollectionSubView = new Map(); @@ -582,7 +580,6 @@ export class CollectionFreeFormView extends CollectionSubView { - this._lastClientY = this._lastClientX = undefined; if (InteractionUtils.IsType(e, InteractionUtils.TOUCHTYPE)) return; document.removeEventListener("pointermove", this.onPointerMove); @@ -1152,16 +1149,12 @@ export class CollectionFreeFormView extends CollectionSubView this._layoutElements = elements || [], { fireImmediately: true, name: "doLayout" }); - const handler = (e: any) => this.handleDragging(e, (e as CustomEvent).detail); - - document.addEventListener("dashDragging", handler); + this._marqueeRef.current?.addEventListener("dashDragAutoScroll", this.onDragAutoScroll as any); } componentWillUnmount() { this._layoutComputeReaction?.(); - - const handler = (e: any) => this.handleDragging(e, (e as CustomEvent).detail); - document.removeEventListener("dashDragging", handler); + this._marqueeRef.current?.removeEventListener("dashDragAutoScroll", this.onDragAutoScroll as any); } @computed get views() { return this._layoutElements.filter(ele => ele.bounds && !ele.bounds.z).map(ele => ele.ele); } @@ -1176,39 +1169,25 @@ export class CollectionFreeFormView extends CollectionSubView @action - handleDragging = (e: CustomEvent, de: DragEvent) => { - if ((e as any).handlePan) return; + onDragAutoScroll = (e: CustomEvent) => { + if ((e as any).handlePan || this.props.isAnnotationOverlay) return; (e as any).handlePan = true; - this._lastClientY = e.detail.clientY; - this._lastClientX = e.detail.clientX; if (this._marqueeRef?.current) { const dragX = e.detail.clientX; const dragY = e.detail.clientY; const bounds = this._marqueeRef.current?.getBoundingClientRect(); - const deltaX = dragX - bounds.left < 25 ? -2 : bounds.right - dragX < 25 ? 2 : 0; - const deltaY = dragY - bounds.top < 25 ? -2 : bounds.bottom - dragY < 25 ? 2 : 0; - (deltaX !== 0 || deltaY !== 0) && this.continuePan(deltaX, deltaY); + const deltaX = dragX - bounds.left < 25 ? -(25 + (bounds.left - dragX)) : bounds.right - dragX < 25 ? 25 - (bounds.right - dragX) : 0; + const deltaY = dragY - bounds.top < 25 ? -(25 + (bounds.top - dragY)) : bounds.bottom - dragY < 25 ? 25 - (bounds.bottom - dragY) : 0; + if (deltaX !== 0 || deltaY !== 0) { + this.Document._panY = NumCast(this.Document._panY) + deltaY / 2; + this.Document._panX = NumCast(this.Document._panX) + deltaX / 2; + } } e.stopPropagation(); } - continuePan = (deltaX: number, deltaY: number) => { - setTimeout(action(() => { - const dragY = this._lastClientY; - const dragX = this._lastClientX; - if (dragY !== undefined && dragX !== undefined && this._marqueeRef.current) { - const bounds = this._marqueeRef.current.getBoundingClientRect(); - this.Document._panY = NumCast(this.Document._panY) + deltaY; - this.Document._panX = NumCast(this.Document._panX) + deltaX; - if (dragY - bounds.top < 25 || bounds.bottom - dragY < 25 || dragX - bounds.left < 25 || bounds.right - dragX < 25) { - this.continuePan(deltaX, deltaY); - } - } else this._lastClientY !== undefined && this._lastClientX !== undefined && this.continuePan(deltaX, deltaY); - }), 50); - } - promoteCollection = undoBatch(action(() => { const childDocs = this.childDocs.slice(); childDocs.forEach(doc => { -- cgit v1.2.3-70-g09d2 From 12dd45618c0dc595b8e6663bf8d3635dd7161306 Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Tue, 21 Jul 2020 16:02:53 -0400 Subject: fixed compile warnings --- src/client/documents/Documents.ts | 4 +++- src/client/util/DragManager.ts | 9 ++++----- src/client/views/DocumentDecorations.tsx | 11 +++++------ src/client/views/MetadataEntryMenu.tsx | 4 ++-- src/client/views/collections/CollectionMenu.tsx | 6 +++--- .../collectionFreeForm/CollectionFreeFormLinkView.tsx | 10 +++++----- 6 files changed, 22 insertions(+), 22 deletions(-) (limited to 'src/client/documents') diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts index 657ba521b..e2569ec70 100644 --- a/src/client/documents/Documents.ts +++ b/src/client/documents/Documents.ts @@ -550,7 +550,9 @@ export namespace Docs { const dataDoc = MakeDataDelegate(proto, protoProps, data, fieldKey); const viewDoc = Doc.MakeDelegate(dataDoc, delegId); - // so that the list of annotations is already initialised, prevents issues in addonly + // so that the list of annotations is already initialised, prevents issues in addonly. + // without this, if a doc has no annotations but the user has AddOnly privileges, they won't be able to add an annotation because they would have needed to create the field's list which they don't have permissions to do. + dataDoc[fieldKey + "-annotations"] = new List(); proto.links = ComputedField.MakeFunction("links(self)"); diff --git a/src/client/util/DragManager.ts b/src/client/util/DragManager.ts index 4291eee9c..837f0b1db 100644 --- a/src/client/util/DragManager.ts +++ b/src/client/util/DragManager.ts @@ -412,7 +412,6 @@ export namespace DragManager { const yFromTop = downY - elesCont.top; const xFromRight = elesCont.right - downX; const yFromBottom = elesCont.bottom - downY; - let paused = false; let scrollAwaiter: Opt; const moveHandler = (e: PointerEvent) => { e.preventDefault(); // required or dragging text menu link item ends up dragging the link button as native drag/drop @@ -437,8 +436,6 @@ export namespace DragManager { const target = document.elementFromPoint(e.x, e.y); if (target && !options?.noAutoscroll && !dragData.draggedDocuments?.some((d: any) => d._noAutoscroll)) { - scrollAwaiter && clearTimeout(scrollAwaiter); - scrollAwaiter = setTimeout(() => autoScrollHandler(), 250); const autoScrollHandler = () => { target.dispatchEvent( new CustomEvent("dashDragAutoScroll", { @@ -483,8 +480,10 @@ export namespace DragManager { ); scrollAwaiter && clearTimeout(scrollAwaiter); - SnappingManager.GetIsDragging() && (scrollAwaiter = setTimeout(() => autoScrollHandler(), 25)); - } + SnappingManager.GetIsDragging() && (scrollAwaiter = setTimeout(autoScrollHandler, 25)); + }; + scrollAwaiter && clearTimeout(scrollAwaiter); + scrollAwaiter = setTimeout(autoScrollHandler, 250); } const { thisX, thisY } = snapDrag(e, xFromLeft, yFromTop, xFromRight, yFromBottom); diff --git a/src/client/views/DocumentDecorations.tsx b/src/client/views/DocumentDecorations.tsx index 35c040f86..fec4ad9e0 100644 --- a/src/client/views/DocumentDecorations.tsx +++ b/src/client/views/DocumentDecorations.tsx @@ -293,13 +293,12 @@ export class DocumentDecorations extends React.Component<{}, { value: string }> const doc = Document(element.rootDoc); if (doc.type === DocumentType.INK && doc.x && doc.y && doc._width && doc._height && doc.data) { doc.rotation = Number(doc.rotation) + Number(angle); - const ink = Cast(doc.data, InkField)?.inkData; - if (ink) { - + const inks = Cast(doc.data, InkField)?.inkData; + if (inks) { const newPoints: { X: number, Y: number }[] = []; - for (var i = 0; i < ink.length; i++) { - const newX = Math.cos(angle) * (ink[i].X - this._centerPoints[index].X) - Math.sin(angle) * (ink[i].Y - this._centerPoints[index].Y) + this._centerPoints[index].X; - const newY = Math.sin(angle) * (ink[i].X - this._centerPoints[index].X) + Math.cos(angle) * (ink[i].Y - this._centerPoints[index].Y) + this._centerPoints[index].Y; + for (const ink of inks) { + const newX = Math.cos(angle) * (ink.X - this._centerPoints[index].X) - Math.sin(angle) * (ink.Y - this._centerPoints[index].Y) + this._centerPoints[index].X; + const newY = Math.sin(angle) * (ink.X - this._centerPoints[index].X) + Math.cos(angle) * (ink.Y - this._centerPoints[index].Y) + this._centerPoints[index].Y; newPoints.push({ X: newX, Y: newY }); } doc.data = new InkField(newPoints); diff --git a/src/client/views/MetadataEntryMenu.tsx b/src/client/views/MetadataEntryMenu.tsx index ca8a6e1d7..82ec5a5b3 100644 --- a/src/client/views/MetadataEntryMenu.tsx +++ b/src/client/views/MetadataEntryMenu.tsx @@ -38,7 +38,7 @@ export class MetadataEntryMenu extends React.Component{ let field: Field | undefined | null = null; let onProto: boolean = false; let value: string | undefined = undefined; - let docs = this.props.docs; + const docs = this.props.docs; for (const doc of docs) { const v = await doc[this._currentKey]; onProto = onProto || !Object.keys(doc).includes(this._currentKey); @@ -110,7 +110,7 @@ export class MetadataEntryMenu extends React.Component{ getKeySuggestions = (value: string) => { value = value.toLowerCase(); - let docs = this.props.docs; + const docs = this.props.docs; const keys = new Set(); docs.forEach(doc => Doc.allKeys(doc).forEach(key => keys.add(key))); return Array.from(keys).filter(key => key.toLowerCase().startsWith(value)); diff --git a/src/client/views/collections/CollectionMenu.tsx b/src/client/views/collections/CollectionMenu.tsx index 2be57b6d2..e7c5ca86b 100644 --- a/src/client/views/collections/CollectionMenu.tsx +++ b/src/client/views/collections/CollectionMenu.tsx @@ -402,7 +402,7 @@ export class CollectionFreeFormViewChrome extends React.Component this._widthBtn = !this._widthBtn, "bars", null); + const widthPicker = this.toggleButton("stroke width", this._widthBtn, () => this._widthBtn = !this._widthBtn, "bars", null); return !this._widthBtn ? widthPicker :

{widthPicker} @@ -416,7 +416,7 @@ export class CollectionFreeFormViewChrome extends React.Component this._colorBtn = !this._colorBtn, "pen-nib", + const colorPicker = this.toggleButton("stroke color", this._colorBtn, () => this._colorBtn = !this._colorBtn, "pen-nib",
); return !this._colorBtn ? colorPicker :
@@ -431,7 +431,7 @@ export class CollectionFreeFormViewChrome extends React.Component; } @computed get fillPicker() { - var fillPicker = this.toggleButton("shape fill color", this._fillBtn, () => this._fillBtn = !this._fillBtn, "fill-drip", + const fillPicker = this.toggleButton("shape fill color", this._fillBtn, () => this._fillBtn = !this._fillBtn, "fill-drip",
); return !this._fillBtn ? fillPicker :
diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormLinkView.tsx b/src/client/views/collections/collectionFreeForm/CollectionFreeFormLinkView.tsx index 6d44ac967..bfe569853 100644 --- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormLinkView.tsx +++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormLinkView.tsx @@ -26,7 +26,7 @@ export class CollectionFreeFormLinkView extends React.Component (Date.now() < this._start++ + 1000) && setTimeout(this.timeout, 25); + timeout = () => (Date.now() < this._start++ + 1000) && setTimeout(this.timeout, 25) componentDidMount() { this._anchorDisposer = reaction(() => [this.props.A.props.ScreenToLocalTransform(), this.props.B.props.ScreenToLocalTransform(), this.props.A.isSelected() || Doc.IsBrushed(this.props.A.props.Document), this.props.A.isSelected() || Doc.IsBrushed(this.props.A.props.Document)], action(() => { @@ -111,10 +111,10 @@ export class CollectionFreeFormLinkView extends React.Component Date: Thu, 23 Jul 2020 11:56:05 -0400 Subject: got rid of lots of console.logs(). fixed fonticon box to show a 'label' if defined otherwise 'title'. if neither, then it shows no tooltip. --- src/client/ClientRecommender.tsx | 2 -- src/client/apis/IBM_Recommender.ts | 2 -- .../apis/google_docs/GooglePhotosClientUtils.ts | 2 -- src/client/cognitive_services/CognitiveServices.ts | 2 -- src/client/documents/Documents.ts | 3 ++- src/client/util/CurrentUserUtils.ts | 1 - src/client/util/DictationManager.ts | 2 +- src/client/util/InteractionUtils.tsx | 2 -- src/client/util/ScriptManager.ts | 10 --------- src/client/util/SearchUtil.ts | 1 - src/client/util/SelectionManager.ts | 1 - src/client/views/EditableView.tsx | 1 - src/client/views/GestureOverlay.tsx | 1 - src/client/views/KeyphraseQueryView.tsx | 1 - src/client/views/ScriptBox.tsx | 2 +- src/client/views/SearchDocBox.tsx | 9 -------- src/client/views/Touchable.tsx | 3 --- src/client/views/animationtimeline/Keyframe.tsx | 4 ---- src/client/views/animationtimeline/Timeline.tsx | 1 - src/client/views/animationtimeline/Track.tsx | 4 ---- .../views/collections/CollectionCarousel3DView.tsx | 3 --- .../views/collections/CollectionCarouselView.tsx | 2 -- .../collections/CollectionMasonryViewFieldRow.tsx | 1 - src/client/views/collections/CollectionMenu.tsx | 2 +- .../views/collections/CollectionSchemaCells.tsx | 12 ----------- .../views/collections/CollectionSchemaView.tsx | 1 - src/client/views/collections/CollectionSubView.tsx | 2 -- .../views/collections/CollectionTreeView.tsx | 4 ---- src/client/views/collections/CollectionView.tsx | 2 +- src/client/views/collections/SchemaTable.tsx | 3 +-- .../collectionFreeForm/CollectionFreeFormView.tsx | 2 -- .../collections/collectionFreeForm/MarqueeView.tsx | 3 --- src/client/views/linking/LinkMenu.tsx | 1 - src/client/views/linking/LinkMenuItem.tsx | 5 ----- src/client/views/nodes/DocumentContentsView.tsx | 2 +- src/client/views/nodes/DocumentLinksButton.tsx | 2 -- src/client/views/nodes/DocumentView.tsx | 1 - src/client/views/nodes/FontIconBox.tsx | 24 ++++++++++++---------- src/client/views/nodes/PresBox.tsx | 1 - src/client/views/nodes/RadialMenu.tsx | 1 - src/client/views/nodes/ScreenshotBox.tsx | 2 +- src/client/views/nodes/ScriptingBox.tsx | 1 - src/client/views/nodes/VideoBox.tsx | 2 +- src/client/views/nodes/WebBox.tsx | 2 +- .../views/nodes/formattedText/DashDocView.tsx | 2 +- .../views/nodes/formattedText/RichTextSchema.tsx | 2 +- src/client/views/search/FilterBox.tsx | 1 - src/client/views/search/SearchBox.tsx | 5 +---- src/client/views/search/ToggleBar.tsx | 1 - src/fields/Doc.ts | 1 - src/fields/ScriptField.ts | 1 - src/fields/util.ts | 1 - src/server/Recommender.ts | 4 ---- src/server/downsize.ts | 2 +- 54 files changed, 28 insertions(+), 127 deletions(-) (limited to 'src/client/documents') diff --git a/src/client/ClientRecommender.tsx b/src/client/ClientRecommender.tsx index d18669b02..3f875057e 100644 --- a/src/client/ClientRecommender.tsx +++ b/src/client/ClientRecommender.tsx @@ -50,7 +50,6 @@ export class ClientRecommender extends React.Component { @observable private corr_matrix = [[0, 0], [0, 0]]; // for testing constructor(props: RecommenderProps) { - //console.log("creating client recommender..."); super(props); if (!ClientRecommender.Instance) ClientRecommender.Instance = this; ClientRecommender.Instance.docVectors = new Set(); @@ -383,7 +382,6 @@ export class ClientRecommender extends React.Component { case 200: const title_vals: string[] = []; const url_vals: string[] = []; - //console.log(result); if (xml) { const titles = xml.getElementsByTagName("title"); let counter = 1; diff --git a/src/client/apis/IBM_Recommender.ts b/src/client/apis/IBM_Recommender.ts index 480b9cb1c..e6265fcb5 100644 --- a/src/client/apis/IBM_Recommender.ts +++ b/src/client/apis/IBM_Recommender.ts @@ -29,10 +29,8 @@ // export const analyze = async (_parameters: any): Promise> => { // try { // const response = await naturalLanguageUnderstanding.analyze(_parameters); -// console.log(response); // return (JSON.stringify(response, null, 2)); // } catch (err) { -// console.log('error: ', err); // return undefined; // } // }; diff --git a/src/client/apis/google_docs/GooglePhotosClientUtils.ts b/src/client/apis/google_docs/GooglePhotosClientUtils.ts index 13bfb3a91..92eaf2e73 100644 --- a/src/client/apis/google_docs/GooglePhotosClientUtils.ts +++ b/src/client/apis/google_docs/GooglePhotosClientUtils.ts @@ -156,8 +156,6 @@ export namespace GooglePhotos { const values = Object.values(ContentCategories).filter(value => value !== ContentCategories.NONE); for (const value of values) { const searched = (await ContentSearch({ included: [value] }))?.mediaItems?.map(({ id }) => id); - console.log("Searching " + value); - console.log(searched); searched?.forEach(async id => { const image = await Cast(idMapping[id], Doc); if (image) { diff --git a/src/client/cognitive_services/CognitiveServices.ts b/src/client/cognitive_services/CognitiveServices.ts index 6b0b3e029..80961af14 100644 --- a/src/client/cognitive_services/CognitiveServices.ts +++ b/src/client/cognitive_services/CognitiveServices.ts @@ -377,7 +377,6 @@ export namespace CognitiveServices { console.log("successful vectorization!"); const vectorValues = new List(); indices.forEach((ind: any) => { - //console.log(wordvec.word); vectorValues.push(wordvecs[ind]); }); ClientRecommender.Instance.processVector(vectorValues, dataDoc, mainDoc); @@ -385,7 +384,6 @@ export namespace CognitiveServices { else { console.log("unsuccessful :( word(s) not in vocabulary"); } - //console.log(vectorValues.size); } ); } diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts index e2569ec70..cd2792226 100644 --- a/src/client/documents/Documents.ts +++ b/src/client/documents/Documents.ts @@ -92,6 +92,7 @@ export interface DocumentOptions { layoutKey?: string; type?: string; title?: string; + label?: string; toolTip?: string; // tooltip to display on hover style?: string; page?: number; @@ -494,7 +495,7 @@ export namespace Docs { Doc.Get.FromJson({ data: device, appendToExisting: { targetDoc: Doc.GetProto(doc) } }); Doc.AddDocToList(parentProto, "data", doc); } else if (errors) { - console.log(errors); + console.log("Documents:" + errors); } else { alert("A Buxton document import was completely empty (??)"); } diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts index 23b8f09de..b47cfb33a 100644 --- a/src/client/util/CurrentUserUtils.ts +++ b/src/client/util/CurrentUserUtils.ts @@ -487,7 +487,6 @@ export class CurrentUserUtils { // Sets up mobile menu if it is undefined creates a new one, otherwise returns existing menu static setupActiveMobileMenu(doc: Doc) { if (doc.activeMobileMenu === undefined) { - console.log("undefined"); doc.activeMobileMenu = this.setupMobileMenu(); } return doc.activeMobileMenu as Doc; diff --git a/src/client/util/DictationManager.ts b/src/client/util/DictationManager.ts index 28b1ca6cf..540540642 100644 --- a/src/client/util/DictationManager.ts +++ b/src/client/util/DictationManager.ts @@ -121,7 +121,7 @@ export namespace DictationManager { const listenImpl = (options?: Partial) => { if (!recognizer) { - console.log(unsupported); + console.log("DictationManager:" + unsupported); return unsupported; } if (isListening) { diff --git a/src/client/util/InteractionUtils.tsx b/src/client/util/InteractionUtils.tsx index 473d4a263..8b3614ea7 100644 --- a/src/client/util/InteractionUtils.tsx +++ b/src/client/util/InteractionUtils.tsx @@ -161,7 +161,6 @@ export namespace InteractionUtils { // return ( // InkOptionsMenu.Instance.getColors().map(color => { // const id1 = "arrowStartTest" + color; - // console.log(color); // // // ; @@ -383,7 +382,6 @@ export namespace InteractionUtils { // let dist12 = TwoPointEuclidist(pt1, pt2); // let dist23 = TwoPointEuclidist(pt2, pt3); // let dist13 = TwoPointEuclidist(pt1, pt3); - // console.log(`distances: ${dist12}, ${dist23}, ${dist13}`); // let dist12close = dist12 < leniency; // let dist23close = dist23 < leniency; // let dist13close = dist13 < leniency; diff --git a/src/client/util/ScriptManager.ts b/src/client/util/ScriptManager.ts index 785e63d9a..94806a7ba 100644 --- a/src/client/util/ScriptManager.ts +++ b/src/client/util/ScriptManager.ts @@ -32,24 +32,17 @@ export class ScriptManager { } public addScript(scriptDoc: Doc): boolean { - - console.log("in add script method"); - const scriptList = this.getAllScripts(); scriptList.push(scriptDoc); if (ScriptManager.Instance.ScriptManagerDoc) { ScriptManager.Instance.ScriptManagerDoc.data = new List(scriptList); ScriptManager.addScriptToGlobals(scriptDoc); - console.log("script added"); return true; } return false; } public deleteScript(scriptDoc: Doc): boolean { - - console.log("in delete script method"); - if (scriptDoc.name) { Scripting.removeGlobal(StrCast(scriptDoc.name)); } @@ -70,7 +63,6 @@ export class ScriptManager { Scripting.removeGlobal(StrCast(scriptDoc.name)); const params = Cast(scriptDoc["data-params"], listSpec("string"), []); - console.log(params); const paramNames = params.reduce((o: string, p: string) => { if (params.indexOf(p) === params.length - 1) { o = o + p.split(":")[0].trim(); @@ -82,8 +74,6 @@ export class ScriptManager { const f = new Function(paramNames, StrCast(scriptDoc.script)); - console.log(scriptDoc.script); - Object.defineProperty(f, 'name', { value: StrCast(scriptDoc.name), writable: false }); let parameters = "("; diff --git a/src/client/util/SearchUtil.ts b/src/client/util/SearchUtil.ts index 1ac68480e..0a01d8ac7 100644 --- a/src/client/util/SearchUtil.ts +++ b/src/client/util/SearchUtil.ts @@ -128,7 +128,6 @@ export namespace SearchUtil { }); const result: IdSearchResult = JSON.parse(response); const { ids, numFound, highlighting } = result; - //console.log(ids.length); const docMap = await DocServer.GetRefFields(ids); const docs: Doc[] = []; for (const id of ids) { diff --git a/src/client/util/SelectionManager.ts b/src/client/util/SelectionManager.ts index 9a968aeda..20d881961 100644 --- a/src/client/util/SelectionManager.ts +++ b/src/client/util/SelectionManager.ts @@ -22,7 +22,6 @@ export namespace SelectionManager { } manager.SelectedDocuments.set(docView, true); - // console.log(manager.SelectedDocuments); docView.props.whenActiveChanged(true); } else if (!ctrlPressed && Array.from(manager.SelectedDocuments.entries()).length > 1) { Array.from(manager.SelectedDocuments.keys()).map(dv => dv !== docView && dv.props.whenActiveChanged(false)); diff --git a/src/client/views/EditableView.tsx b/src/client/views/EditableView.tsx index 25a87ab56..ad61d3f91 100644 --- a/src/client/views/EditableView.tsx +++ b/src/client/views/EditableView.tsx @@ -73,7 +73,6 @@ export class EditableView extends React.Component { // // this is done because when autosuggest is turned on, the suggestions are passed in as a prop, // // so when the suggestions are passed in, and no editing prop is passed in, it used to set it // // to false. this will no longer do so -syip - // console.log("props editing = " + nextProps.editing); // if (nextProps.editing && nextProps.editing !== this._editing) { // this._editing = nextProps.editing; // EditableView.loadId = ""; diff --git a/src/client/views/GestureOverlay.tsx b/src/client/views/GestureOverlay.tsx index b0b0d72b1..2e588ceb5 100644 --- a/src/client/views/GestureOverlay.tsx +++ b/src/client/views/GestureOverlay.tsx @@ -160,7 +160,6 @@ export default class GestureOverlay extends Touchable { if (nts.nt.length === 1) { // -- radial menu code -- this._holdTimer = setTimeout(() => { - console.log("hold"); const target = document.elementFromPoint(te.changedTouches?.item(0).clientX, te.changedTouches?.item(0).clientY); const pt: any = te.touches[te.touches?.length - 1]; if (nts.nt.length === 1 && pt.radiusX > 1 && pt.radiusY > 1) { diff --git a/src/client/views/KeyphraseQueryView.tsx b/src/client/views/KeyphraseQueryView.tsx index 1dc156968..13d52db88 100644 --- a/src/client/views/KeyphraseQueryView.tsx +++ b/src/client/views/KeyphraseQueryView.tsx @@ -11,7 +11,6 @@ export interface KP_Props { export class KeyphraseQueryView extends React.Component{ constructor(props: KP_Props) { super(props); - console.log("FIRST KEY PHRASE: ", props.keyphrases[0]); } render() { diff --git a/src/client/views/ScriptBox.tsx b/src/client/views/ScriptBox.tsx index 888f84dfa..2c185be86 100644 --- a/src/client/views/ScriptBox.tsx +++ b/src/client/views/ScriptBox.tsx @@ -39,7 +39,7 @@ export class ScriptBox extends React.Component { @action onError = (error: string) => { - console.log(error); + console.log("ScriptBox: " + error); } overlayDisposer?: () => void; diff --git a/src/client/views/SearchDocBox.tsx b/src/client/views/SearchDocBox.tsx index e038d8213..084f952a3 100644 --- a/src/client/views/SearchDocBox.tsx +++ b/src/client/views/SearchDocBox.tsx @@ -60,8 +60,6 @@ export class SearchDocBox extends React.Component { componentDidMount() { runInAction(() => { - console.log("didit" - ); this.query = StrCast(this.props.Document.searchText); this.content = (Docs.Create.TreeDocument(DocListCast(Doc.GetProto(this.props.Document).data), { _width: 200, _height: 400, _chromeStatus: "disabled", title: `Search Docs:` + this.query })); @@ -83,12 +81,9 @@ export class SearchDocBox extends React.Component { if (newKey.length > 1) { const newdocs = await this.getAllResults(this.query); const things = newdocs.docs; - console.log(things); - console.log(this.content); runInAction(() => { this.content = Docs.Create.TreeDocument(things, { _width: 200, _height: 400, _chromeStatus: "disabled", title: `Search Docs:` + this.query }); }); - console.log(this.content); } @@ -150,12 +145,9 @@ export class SearchDocBox extends React.Component { } enter = async (e: React.KeyboardEvent) => { - console.log(e.key); if (e.key === "Enter") { const newdocs = await this.getAllResults(this.query); - console.log(newdocs.docs); this.content = Docs.Create.TreeDocument(newdocs.docs, { _width: 200, _height: 400, _chromeStatus: "disabled", title: `Search Docs: "Results"` }); - } } @@ -256,7 +248,6 @@ export class SearchDocBox extends React.Component { startDragCollection = async () => { const res = await this.getAllResults(FilterBox.Instance.getFinalQuery(this._searchString)); const filtered = FilterBox.Instance.filterDocsByType(res.docs); - // console.log(this._results) const docs = filtered.map(doc => { const isProto = Doc.GetT(doc, "isPrototype", "boolean", true); if (isProto) { diff --git a/src/client/views/Touchable.tsx b/src/client/views/Touchable.tsx index 5e48d5ffb..c4cae7e8d 100644 --- a/src/client/views/Touchable.tsx +++ b/src/client/views/Touchable.tsx @@ -54,7 +54,6 @@ export abstract class Touchable extends React.Component { } }); - // console.log(ptsToDelete.length); ptsToDelete.forEach(pt => this.prevPoints.delete(pt)); if (this.prevPoints.size) { @@ -86,7 +85,6 @@ export abstract class Touchable extends React.Component { // if we're not actually moving a lot, don't consider it as dragging yet if (!InteractionUtils.IsDragging(this.prevPoints, myTouches, 5) && !this._touchDrag) return; this._touchDrag = true; - // console.log(myTouches.length); switch (myTouches.length) { case 1: this.handle1PointerMove(te, me); @@ -107,7 +105,6 @@ export abstract class Touchable extends React.Component { @action protected onTouchEnd = (e: Event, me: InteractionUtils.MultiTouchEvent): void => { - // console.log(InteractionUtils.GetMyTargetTouches(e, this.prevPoints).length + " up"); // remove all the touches associated with the event const te = me.touchEvent; for (const pt of me.changedTouches) { diff --git a/src/client/views/animationtimeline/Keyframe.tsx b/src/client/views/animationtimeline/Keyframe.tsx index 3a7182a94..1b81c544a 100644 --- a/src/client/views/animationtimeline/Keyframe.tsx +++ b/src/client/views/animationtimeline/Keyframe.tsx @@ -527,10 +527,6 @@ export class Keyframe extends React.Component { */ //154, 206, 223 render() { - trace(); - console.log(this.props.RegionData.position); - console.log(this.regiondata.position); - console.log(this.pixelPosition); return (
{ //TODO: remove undefineds and duplicates } }); - // console.log(longestTime); return longestTime; } diff --git a/src/client/views/animationtimeline/Track.tsx b/src/client/views/animationtimeline/Track.tsx index 4987006e7..25c2e68e7 100644 --- a/src/client/views/animationtimeline/Track.tsx +++ b/src/client/views/animationtimeline/Track.tsx @@ -134,7 +134,6 @@ export class Track extends React.Component { autoCreateKeyframe = () => { const objects = this.objectWhitelist.map(key => this.props.node[key]); intercept(this.props.node, change => { - console.log(change); return change; }); return reaction(() => { @@ -174,7 +173,6 @@ export class Track extends React.Component { if (regiondata) { this.props.node.hidden = false; // if (!this._autoKfReaction) { - // // console.log("creating another reaction"); // // this._autoKfReaction = this.autoCreateKeyframe(); // } this.timeChange(); @@ -204,7 +202,6 @@ export class Track extends React.Component { } }); } else { - console.log("reverting state"); //this.revertState(); } }); @@ -229,7 +226,6 @@ export class Track extends React.Component { const rightkf: (Doc | undefined) = await KeyframeFunc.calcMinRight(regiondata, this.time); //right keyframe, if it exists const currentkf: (Doc | undefined) = await this.calcCurrent(regiondata); //if the scrubber is on top of the keyframe if (currentkf) { - console.log("is current"); await this.applyKeys(currentkf); this.saveStateKf = currentkf; this.saveStateRegion = regiondata; diff --git a/src/client/views/collections/CollectionCarousel3DView.tsx b/src/client/views/collections/CollectionCarousel3DView.tsx index 8e9970ada..0f3b6f212 100644 --- a/src/client/views/collections/CollectionCarousel3DView.tsx +++ b/src/client/views/collections/CollectionCarousel3DView.tsx @@ -86,7 +86,6 @@ export class CollectionCarousel3DView extends CollectionSubView(Carousel3DDocume interval?: number; startAutoScroll = (direction: number) => { this.interval = window.setInterval(() => { - console.log(this.interval, this.scrollSpeed); this.changeSlide(direction); }, this.scrollSpeed); } @@ -113,13 +112,11 @@ export class CollectionCarousel3DView extends CollectionSubView(Carousel3DDocume onPointerDown = (e: React.PointerEvent) => { this._downX = e.clientX; this._downY = e.clientY; - console.log("CAROUSEL down"); document.addEventListener("pointerup", this.onpointerup); } private _lastTap: number = 0; private _doubleTap = false; onpointerup = (e: PointerEvent) => { - console.log("CAROUSEL up"); this._doubleTap = (Date.now() - this._lastTap < 300 && e.button === 0 && Math.abs(e.clientX - this._downX) < 2 && Math.abs(e.clientY - this._downY) < 2); this._lastTap = Date.now(); } diff --git a/src/client/views/collections/CollectionCarouselView.tsx b/src/client/views/collections/CollectionCarouselView.tsx index 404dc0daa..27aea4b99 100644 --- a/src/client/views/collections/CollectionCarouselView.tsx +++ b/src/client/views/collections/CollectionCarouselView.tsx @@ -91,13 +91,11 @@ export class CollectionCarouselView extends CollectionSubView(CarouselDocument) onPointerDown = (e: React.PointerEvent) => { this._downX = e.clientX; this._downY = e.clientY; - console.log("CAROUSEL down"); document.addEventListener("pointerup", this.onpointerup); } private _lastTap: number = 0; private _doubleTap = false; onpointerup = (e: PointerEvent) => { - console.log("CAROUSEL up"); this._doubleTap = (Date.now() - this._lastTap < 300 && e.button === 0 && Math.abs(e.clientX - this._downX) < 2 && Math.abs(e.clientY - this._downY) < 2); this._lastTap = Date.now(); } diff --git a/src/client/views/collections/CollectionMasonryViewFieldRow.tsx b/src/client/views/collections/CollectionMasonryViewFieldRow.tsx index 627b22417..9a7ea2c93 100644 --- a/src/client/views/collections/CollectionMasonryViewFieldRow.tsx +++ b/src/client/views/collections/CollectionMasonryViewFieldRow.tsx @@ -84,7 +84,6 @@ export class CollectionMasonryViewFieldRow extends React.Component { - console.log("masronry row drop"); this._createAliasSelected = false; if (de.complete.docDragData) { (this.props.parent.Document.dropConverter instanceof ScriptField) && diff --git a/src/client/views/collections/CollectionMenu.tsx b/src/client/views/collections/CollectionMenu.tsx index 5d95b214a..992c1f600 100644 --- a/src/client/views/collections/CollectionMenu.tsx +++ b/src/client/views/collections/CollectionMenu.tsx @@ -462,7 +462,7 @@ export class CollectionFreeFormViewChrome extends React.Component -
+
diff --git a/src/client/views/collections/CollectionSchemaCells.tsx b/src/client/views/collections/CollectionSchemaCells.tsx index d76b6d204..eecaf7672 100644 --- a/src/client/views/collections/CollectionSchemaCells.tsx +++ b/src/client/views/collections/CollectionSchemaCells.tsx @@ -151,7 +151,6 @@ export class CollectionSchemaCell extends React.Component { // let field = this.props.rowProps.original[this.props.rowProps.column.id as string]; // let doc = FieldValue(Cast(field, Doc)); - // console.log("Expanding doc", StrCast(doc!.title)); // this.props.setPreviewDoc(doc!); // // this.props.changeFocusedCellByIndex(this.props.row, this.props.col); @@ -265,7 +264,6 @@ export class CollectionSchemaCell extends React.Component { return "0"; } else { const cfield = ComputedField.WithoutComputed(() => FieldValue(props.Document[props.fieldKey])); - console.log(cfield); if (type === "number") { return StrCast(cfield); } @@ -286,7 +284,6 @@ export class CollectionSchemaCell extends React.Component { const script = CompileScript(value, { requiredType: type, typecheck: false, editable: true, addReturn: true, params: { this: Doc.name, $r: "number", $c: "number", $: "any" } }); if (script.compiled) { retVal = this.applyToDoc(props.Document, this.props.row, this.props.col, script.run); - console.log("compiled"); } } @@ -350,17 +347,13 @@ export class CollectionSchemaDateCell extends CollectionSchemaCell { @action handleChange = (date: any) => { - console.log(date); this._date = date; // const script = CompileScript(date.toString(), { requiredType: "Date", addReturn: true, params: { this: Doc.name } }); // if (script.compiled) { - // console.log("scripting"); // this.applyToDoc(this._document, this.props.row, this.props.col, script.run); // } else { - console.log(DateCast(date)); // ^ DateCast is always undefined for some reason, but that is what the field should be set to this._document[this.props.rowProps.column.id as string] = date as Date; - console.log(this._document[this.props.rowProps.column.id as string]); //} } @@ -425,8 +418,6 @@ export class CollectionSchemaDocCell extends CollectionSchemaCell { const results = script.compiled && script.run(); if (results && results.success) { - - console.log(results.result); this._doc = results.result; this._document[this.prop.fieldKey] = results.result; this._docTitle = this._doc?.title; @@ -457,10 +448,8 @@ export class CollectionSchemaDocCell extends CollectionSchemaCell { this._preview = false; } else { if (bool) { - console.log("show doc"); this.props.showDoc(this._doc, this.prop.DataDoc, e.clientX, e.clientY); } else { - console.log("no doc"); this.props.showDoc(undefined); } } @@ -675,7 +664,6 @@ export class CollectionSchemaListCell extends CollectionSchemaCell { @action toggleOpened(open: boolean) { - console.log("open: " + open); this._opened = open; } diff --git a/src/client/views/collections/CollectionSchemaView.tsx b/src/client/views/collections/CollectionSchemaView.tsx index 3c42a2f1c..5553bbbb7 100644 --- a/src/client/views/collections/CollectionSchemaView.tsx +++ b/src/client/views/collections/CollectionSchemaView.tsx @@ -332,7 +332,6 @@ export class CollectionSchemaView extends CollectionSubView(doc => doc) { @action openHeader = (col: any, screenx: number, screeny: number) => { - console.log("header opening"); this._col = col; this._headerOpen = !this._headerOpen; this._pointerX = screenx; diff --git a/src/client/views/collections/CollectionSubView.tsx b/src/client/views/collections/CollectionSubView.tsx index a147b06a3..8480a56cc 100644 --- a/src/client/views/collections/CollectionSubView.tsx +++ b/src/client/views/collections/CollectionSubView.tsx @@ -340,7 +340,6 @@ export function CollectionSubView(schemaCtor: (doc: Doc) => T, moreProps?: // if ((matches = /(https:\/\/)?photos\.google\.com\/(u\/3\/)?album\/([^\\]+)/g.exec(text)) !== null) { // const albumId = matches[3]; // const mediaItems = await GooglePhotos.Query.AlbumSearch(albumId); - // console.log(mediaItems); // return; // } } @@ -381,7 +380,6 @@ export function CollectionSubView(schemaCtor: (doc: Doc) => T, moreProps?: file?.type && files.push(file); file?.type === "application/json" && Utils.readUploadedFileAsText(file).then(result => { - console.log(result); const json = JSON.parse(result as string); this.addDocument(Docs.Create.TreeDocument( json["rectangular-puzzle"].crossword.clues[0].clue.map((c: any) => { diff --git a/src/client/views/collections/CollectionTreeView.tsx b/src/client/views/collections/CollectionTreeView.tsx index 96a2e23c9..651357e5d 100644 --- a/src/client/views/collections/CollectionTreeView.tsx +++ b/src/client/views/collections/CollectionTreeView.tsx @@ -796,9 +796,6 @@ export class CollectionTreeView extends CollectionSubView; } - onKeyPress = (e: React.KeyboardEvent) => { - console.log(e); - } onChildClick = () => { return this.props.onChildClick?.() || ScriptCast(this.doc.onChildClick); } @@ -819,7 +816,6 @@ export class CollectionTreeView extends CollectionSubView this._mainEle && this._mainEle.scrollHeight > this._mainEle.clientHeight && e.stopPropagation()} onDrop={this.onTreeDrop} ref={this.createTreeDropTarget}> diff --git a/src/client/views/collections/CollectionView.tsx b/src/client/views/collections/CollectionView.tsx index 53fd83f26..e2f78d6f9 100644 --- a/src/client/views/collections/CollectionView.tsx +++ b/src/client/views/collections/CollectionView.tsx @@ -167,7 +167,7 @@ export class CollectionView extends Touchable { @action changeSorting = (col: any) => { - console.log(col.heading); if (col.desc === undefined) { // no sorting this.props.changeColumnSort(col, true); @@ -149,7 +148,7 @@ export class SchemaTable extends React.Component { } @action - changeTitleMode = () => { console.log("header clicked"); this._showTitleDropdown = !this._showTitleDropdown; } + changeTitleMode = () => this._showTitleDropdown = !this._showTitleDropdown; @computed get borderWidth() { return Number(COLLECTION_BORDER_WIDTH); } @computed get tableColumns(): Column[] { diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx index 3b19a2ab8..979b21321 100644 --- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx +++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx @@ -497,10 +497,8 @@ export class CollectionFreeFormView extends CollectionSubView p.X)), Math.min(...ge.points.map(p => p.Y))); this._inkToTextStartX = start[0]; this._inkToTextStartY = start[1]; - console.log("start"); break; case GestureUtils.Gestures.EndBracket: - console.log("end"); if (this._inkToTextStartX && this._inkToTextStartY) { const end = this.getTransform().transformPoint(Math.max(...ge.points.map(p => p.X)), Math.max(...ge.points.map(p => p.Y))); const setDocs = this.getActiveDocuments().filter(s => s.proto?.type === "rtf" && s.color); diff --git a/src/client/views/collections/collectionFreeForm/MarqueeView.tsx b/src/client/views/collections/collectionFreeForm/MarqueeView.tsx index 84719b2c9..aa9a3b4ae 100644 --- a/src/client/views/collections/collectionFreeForm/MarqueeView.tsx +++ b/src/client/views/collections/collectionFreeForm/MarqueeView.tsx @@ -434,8 +434,6 @@ export class MarqueeView extends React.Component { // const wordResults = results.filter((r: any) => r.category === "inkWord"); - // console.log(wordResults); - // console.log(results); // for (const word of wordResults) { // const indices: number[] = word.strokeIds; // indices.forEach(i => { @@ -476,7 +474,6 @@ export class MarqueeView extends React.Component r.category === "line"); - console.log(lines); const text = lines.map((l: any) => l.recognizedText).join("\r\n"); this.props.addDocument(Docs.Create.TextDocument(text, { _width: this.Bounds.width, _height: this.Bounds.height, x: this.Bounds.left + this.Bounds.width, y: this.Bounds.top, title: text })); }); diff --git a/src/client/views/linking/LinkMenu.tsx b/src/client/views/linking/LinkMenu.tsx index 2d151e9bc..7b5fb0127 100644 --- a/src/client/views/linking/LinkMenu.tsx +++ b/src/client/views/linking/LinkMenu.tsx @@ -46,7 +46,6 @@ export class LinkMenu extends React.Component { if (this._linkMenuRef && !this._linkMenuRef.current?.contains(e.target as any)) { if (this._editorRef && !this._editorRef.current?.contains(e.target as any)) { - console.log("outside click"); DocumentLinksButton.EditLink = undefined; } } diff --git a/src/client/views/linking/LinkMenuItem.tsx b/src/client/views/linking/LinkMenuItem.tsx index d8ba39f09..d1c839c3b 100644 --- a/src/client/views/linking/LinkMenuItem.tsx +++ b/src/client/views/linking/LinkMenuItem.tsx @@ -81,10 +81,7 @@ export class LinkMenuItem extends React.Component { @action toggleShowMore(e: React.PointerEvent) { e.stopPropagation(); this._showMore = !this._showMore; } onEdit = (e: React.PointerEvent): void => { - - console.log("Edit"); LinkManager.currentLink = this.props.linkDoc; - console.log(this.props.linkDoc); setupMoveUpEvents(this, e, this.editMoved, emptyFunction, () => this.props.showEditor(this.props.linkDoc)); } @@ -119,7 +116,6 @@ export class LinkMenuItem extends React.Component { document.addEventListener("pointerup", this.onLinkButtonUp); if (this._buttonRef && !!!this._buttonRef.current?.contains(e.target as any)) { - console.log("outside click"); LinkDocPreview.LinkInfo = undefined; } } @@ -153,7 +149,6 @@ export class LinkMenuItem extends React.Component { @action.bound async followDefault() { - console.log("FOLLOWWW"); DocumentLinksButton.EditLink = undefined; LinkDocPreview.LinkInfo = undefined; diff --git a/src/client/views/nodes/DocumentContentsView.tsx b/src/client/views/nodes/DocumentContentsView.tsx index f2f8ada68..47dc0a773 100644 --- a/src/client/views/nodes/DocumentContentsView.tsx +++ b/src/client/views/nodes/DocumentContentsView.tsx @@ -200,7 +200,7 @@ export class DocumentContentsView extends React.Component { console.log(test); }} + onError={(test: any) => { console.log("DocumentContentsView:" + test); }} />; } } \ No newline at end of file diff --git a/src/client/views/nodes/DocumentLinksButton.tsx b/src/client/views/nodes/DocumentLinksButton.tsx index 13bec5d7f..b17accfd6 100644 --- a/src/client/views/nodes/DocumentLinksButton.tsx +++ b/src/client/views/nodes/DocumentLinksButton.tsx @@ -68,8 +68,6 @@ export class DocumentLinksButton extends React.Component Doc.BrushDoc(this.props.View.Document)); DocumentLinksButton.StartLink = this.props.View; } else if (!this.props.InMenu) { - console.log("editing"); - this.props.View ? console.log("view") : null; DocumentLinksButton.EditLink = this.props.View; DocumentLinksButton.EditLinkLoc = [e.clientX + 10, e.clientY]; } diff --git a/src/client/views/nodes/DocumentView.tsx b/src/client/views/nodes/DocumentView.tsx index 9e492650b..998c6798e 100644 --- a/src/client/views/nodes/DocumentView.tsx +++ b/src/client/views/nodes/DocumentView.tsx @@ -910,7 +910,6 @@ export class DocumentView extends DocComponent(Docu if (!ClientRecommender.Instance) new ClientRecommender({ title: "Client Recommender" }); const documents: Doc[] = []; const allDocs = await SearchUtil.GetAllDocs(); - // allDocs.forEach(doc => console.log(doc.title)); // clears internal representation of documents as vectors ClientRecommender.Instance.reset_docs(); //ClientRecommender.Instance.arxivrequest("electrons"); diff --git a/src/client/views/nodes/FontIconBox.tsx b/src/client/views/nodes/FontIconBox.tsx index a4d16fe0e..ab34e13b0 100644 --- a/src/client/views/nodes/FontIconBox.tsx +++ b/src/client/views/nodes/FontIconBox.tsx @@ -61,16 +61,18 @@ export class FontIconBox extends DocComponent( render() { const referenceDoc = (this.layoutDoc.dragFactory instanceof Doc ? this.layoutDoc.dragFactory : this.layoutDoc); const refLayout = Doc.Layout(referenceDoc); - return {StrCast(this.layoutDoc.toolTip)}
}> - - ; + const button = ; + return !this.layoutDoc.toolTip ? button : + {StrCast(this.layoutDoc.toolTip)}
}> + {button} + ; } } \ No newline at end of file diff --git a/src/client/views/nodes/PresBox.tsx b/src/client/views/nodes/PresBox.tsx index 8818d375e..a304ced18 100644 --- a/src/client/views/nodes/PresBox.tsx +++ b/src/client/views/nodes/PresBox.tsx @@ -297,7 +297,6 @@ export class PresBox extends ViewBoxBaseComponent (this.layoutDoc.forceActive || this.props.isSelected(outsideReaction) || this._isChildActive || this.props.renderDepth === 0) ? true : false) render() { - // console.log("render = " + this.layoutDoc.title + " " + this.layoutDoc.presStatus); // const presOrderedDocs = DocListCast(this.rootDoc.presOrderedDocs); // if (presOrderedDocs.length != this.childDocs.length || presOrderedDocs.some((pd, i) => pd !== this.childDocs[i])) { // this.rootDoc.presOrderedDocs = new List(this.childDocs.slice()); diff --git a/src/client/views/nodes/RadialMenu.tsx b/src/client/views/nodes/RadialMenu.tsx index a3ac09a11..7f0956e51 100644 --- a/src/client/views/nodes/RadialMenu.tsx +++ b/src/client/views/nodes/RadialMenu.tsx @@ -89,7 +89,6 @@ export class RadialMenu extends React.Component { @action componentDidMount = () => { - console.log(this._pageX); document.addEventListener("pointerdown", this.onPointerDown); document.addEventListener("pointerup", this.onPointerUp); this.previewcircle(); diff --git a/src/client/views/nodes/ScreenshotBox.tsx b/src/client/views/nodes/ScreenshotBox.tsx index f7dee0896..1cd29d795 100644 --- a/src/client/views/nodes/ScreenshotBox.tsx +++ b/src/client/views/nodes/ScreenshotBox.tsx @@ -112,7 +112,7 @@ export class ScreenshotBox extends ViewBoxBaseComponent([]); } catch (e) { - console.log("Error in URL :" + this._url); + console.log("WebBox URL error:" + this._url); } } diff --git a/src/client/views/nodes/formattedText/DashDocView.tsx b/src/client/views/nodes/formattedText/DashDocView.tsx index 5c3f3dcc9..212da3f3d 100644 --- a/src/client/views/nodes/formattedText/DashDocView.tsx +++ b/src/client/views/nodes/formattedText/DashDocView.tsx @@ -209,7 +209,7 @@ export class DashDocView extends React.Component { try { // bcz: an exception will be thrown if two aliases are open at the same time when a doc view comment is made view.dispatch(view.state.tr.setNodeMarkup(getPos(), null, { ...node.attrs, width: dashDoc._width + "px", height: dashDoc._height + "px" })); } catch (e) { - console.log(e); + console.log("DashDocView:" + e); } } diff --git a/src/client/views/nodes/formattedText/RichTextSchema.tsx b/src/client/views/nodes/formattedText/RichTextSchema.tsx index 7a50ec3af..33a080fe4 100644 --- a/src/client/views/nodes/formattedText/RichTextSchema.tsx +++ b/src/client/views/nodes/formattedText/RichTextSchema.tsx @@ -170,7 +170,7 @@ export class DashDocView { } } } catch (e) { - console.log(e); + console.log("RichTextSchema: " + e); } } }; diff --git a/src/client/views/search/FilterBox.tsx b/src/client/views/search/FilterBox.tsx index 4b53963a5..eb61f9a14 100644 --- a/src/client/views/search/FilterBox.tsx +++ b/src/client/views/search/FilterBox.tsx @@ -352,7 +352,6 @@ export class FilterBox extends React.Component { getDataStatus() { return this._deletedDocsStatus; } getActiveFilters() { - console.log(this._authorFieldStatus, this._titleFieldStatus, this._dataFieldStatus); return (
{!this._basicWordStatus ?
diff --git a/src/client/views/search/SearchBox.tsx b/src/client/views/search/SearchBox.tsx index c9d29e485..99fa6da21 100644 --- a/src/client/views/search/SearchBox.tsx +++ b/src/client/views/search/SearchBox.tsx @@ -125,7 +125,7 @@ export class SearchBox extends React.Component { return returnedUri; } catch (e) { - console.log(e); + console.log("SearchBox:" + e); } } @@ -582,7 +582,6 @@ export class SearchBox extends React.Component { } expandSection(thing: string) { - console.log("expand"); const element = document.getElementById(thing)!; // get the height of the element's inner content, regardless of its actual size const sectionHeight = element.scrollHeight; @@ -593,7 +592,6 @@ export class SearchBox extends React.Component { // when the next css transition finishes (which should be the one we just triggered) element.addEventListener('transitionend', function handler(e) { // remove this event listener so it only gets triggered once - console.log("autoset"); element.removeEventListener('transitionend', handler); // remove "height" from the element's inline styles, so it can return to its initial value @@ -608,7 +606,6 @@ export class SearchBox extends React.Component { autoset(thing: string) { const element = document.getElementById(thing)!; - console.log("autoset"); element.removeEventListener('transitionend', function (e) { }); // remove "height" from the element's inline styles, so it can return to its initial value diff --git a/src/client/views/search/ToggleBar.tsx b/src/client/views/search/ToggleBar.tsx index e4d7f2fd5..466822eba 100644 --- a/src/client/views/search/ToggleBar.tsx +++ b/src/client/views/search/ToggleBar.tsx @@ -58,7 +58,6 @@ export class ToggleBar extends React.Component{ this._forwardTimeline.play(); this._forwardTimeline.reverse(); this.props.handleChange(); - console.log(this.props.getStatus()); } @action.bound diff --git a/src/fields/Doc.ts b/src/fields/Doc.ts index 917a6853c..7e91a7761 100644 --- a/src/fields/Doc.ts +++ b/src/fields/Doc.ts @@ -566,7 +566,6 @@ export namespace Doc { export async function Zip(doc: Doc) { const { clone, map } = await Doc.MakeClone(doc, true); function replacer(key: any, value: any) { - console.log("Checkin: " + key); if (["cloneOf", "context", "cursors"].includes(key)) return undefined; else if (value instanceof Doc) { if (key !== "field" && Number.isNaN(Number(key))) { diff --git a/src/fields/ScriptField.ts b/src/fields/ScriptField.ts index 4604a2132..bd08b2f32 100644 --- a/src/fields/ScriptField.ts +++ b/src/fields/ScriptField.ts @@ -53,7 +53,6 @@ async function deserializeScript(script: ScriptField) { if (script.script.originalScript === 'convertToButtons(dragData)') { return (script as any).script = (ScriptField.ConvertToButtons ?? (ScriptField.ConvertToButtons = ComputedField.MakeFunction('convertToButtons(dragData)', { dragData: "DocumentDragData" })))?.script; } - console.log(script.script.originalScript); const captures: ProxyField = (script as any).captures; if (captures) { const doc = (await captures.value())!; diff --git a/src/fields/util.ts b/src/fields/util.ts index 20b072786..ef66d9633 100644 --- a/src/fields/util.ts +++ b/src/fields/util.ts @@ -35,7 +35,6 @@ export namespace Plugins { } const _setterImpl = action(function (target: any, prop: string | symbol | number, value: any, receiver: any): boolean { - //console.log("-set " + target[SelfProxy].title + "(" + target[SelfProxy][prop] + ")." + prop.toString() + " = " + value); if (SerializationHelper.IsSerializing()) { target[prop] = value; return true; diff --git a/src/server/Recommender.ts b/src/server/Recommender.ts index 423ce9b46..935ec3871 100644 --- a/src/server/Recommender.ts +++ b/src/server/Recommender.ts @@ -21,7 +21,6 @@ // private choice: string = ""; // Tensorflow or Word2Vec // constructor() { -// console.log("creating recommender..."); // Recommender.Instance = this; // } @@ -70,7 +69,6 @@ // if (this._model) { // if (this.choice === "WV") { // let similarity = this._model.similarity('father', 'mother'); -// console.log(similarity); // } // else if (this.choice === "TF") { // const model = this._model as use.UniversalSentenceEncoder; @@ -119,7 +117,6 @@ // } // // public async trainModel() { -// // console.log("phrasing..."); // // w2v.word2vec("./node_modules/word2vec/examples/eng_news-typical_2016_1M-sentences.txt", './node_modules/word2vec/examples/my_phrases.txt', { // // cbow: 1, // // size: 200, @@ -131,7 +128,6 @@ // // iter: 200, // // minCount: 2 // // }); -// // console.log("phrased!!!"); // // } // } diff --git a/src/server/downsize.ts b/src/server/downsize.ts index cd0d83812..5cd709fa3 100644 --- a/src/server/downsize.ts +++ b/src/server/downsize.ts @@ -7,7 +7,7 @@ const jpgTypes = ["jpg", "JPG", "jpeg", "JPEG"]; const smallResizer = sharp().resize(100); fs.readdir(folder, async (err, files) => { if (err) { - console.log(err); + console.log("readdir:" + err); return; } // files.forEach(file => { -- cgit v1.2.3-70-g09d2 From ec3a3adb0f9c6706e963432170d59bf54f95702c Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Tue, 28 Jul 2020 01:05:19 -0400 Subject: chaned # text syntax to create a field startin with #. chaned pivot views to aggreate #keys as if the value were the key after the # --- src/client/documents/Documents.ts | 3 --- .../CollectionFreeFormLayoutEngines.tsx | 16 ++++++++-------- src/client/views/nodes/formattedText/DashFieldView.tsx | 4 +--- .../views/nodes/formattedText/FormattedTextBox.tsx | 2 +- src/client/views/nodes/formattedText/RichTextRules.ts | 7 +++---- 5 files changed, 13 insertions(+), 19 deletions(-) (limited to 'src/client/documents') diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts index cd2792226..a1c66c2fe 100644 --- a/src/client/documents/Documents.ts +++ b/src/client/documents/Documents.ts @@ -926,9 +926,6 @@ export namespace DocUtils { linkDoc.layout_linkView = Cast(Cast(Doc.UserDoc()["template-button-link"], Doc, null).dragFactory, Doc, null); Doc.GetProto(linkDoc).title = ComputedField.MakeFunction('self.anchor1?.title +" (" + (self.linkRelationship||"to") +") " + self.anchor2?.title'); - Doc.GetProto(source.doc).links = ComputedField.MakeFunction("links(self)"); - Doc.GetProto(target.doc).links = ComputedField.MakeFunction("links(self)"); - return linkDoc; } diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormLayoutEngines.tsx b/src/client/views/collections/collectionFreeForm/CollectionFreeFormLayoutEngines.tsx index a4fd5384f..183ed3119 100644 --- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormLayoutEngines.tsx +++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormLayoutEngines.tsx @@ -142,9 +142,16 @@ export function computePivotLayout( const fieldKey = "data"; const pivotColumnGroups = new Map, PivotColumn>(); + let nonNumbers = 0; const pivotFieldKey = toLabel(pivotDoc._pivotField); childPairs.map(pair => { - const lval = Cast(pair.layout[pivotFieldKey], listSpec("string"), null); + const lval = pivotFieldKey === "#" ? Array.from(Object.keys(Doc.GetProto(pair.layout))).filter(k => k.startsWith("#")).map(k => k.substring(1)) : + Cast(pair.layout[pivotFieldKey], listSpec("string"), null); + + const num = toNumber(pair.layout[pivotFieldKey]); + if (num === undefined || Number.isNaN(num)) { + nonNumbers++; + } const val = Field.toString(pair.layout[pivotFieldKey] as Field); if (lval) { lval.forEach((val, i) => { @@ -168,13 +175,6 @@ export function computePivotLayout( }); } }); - let nonNumbers = 0; - childPairs.map(pair => { - const num = toNumber(pair.layout[pivotFieldKey]); - if (num === undefined || Number.isNaN(num)) { - nonNumbers++; - } - }); const pivotNumbers = nonNumbers / childPairs.length < .1; if (pivotColumnGroups.size > 10) { const arrayofKeys = Array.from(pivotColumnGroups.keys()); diff --git a/src/client/views/nodes/formattedText/DashFieldView.tsx b/src/client/views/nodes/formattedText/DashFieldView.tsx index 8718bf329..958a37568 100644 --- a/src/client/views/nodes/formattedText/DashFieldView.tsx +++ b/src/client/views/nodes/formattedText/DashFieldView.tsx @@ -205,9 +205,7 @@ export class DashFieldViewInternal extends React.Component} - {/*
*/} - {this.fieldValueContent} - {/*
*/} + {this.props.fieldKey.startsWith("#") ? (null) : this.fieldValueContent} {!this._showEnumerables ? (null) :
} diff --git a/src/client/views/nodes/formattedText/FormattedTextBox.tsx b/src/client/views/nodes/formattedText/FormattedTextBox.tsx index 6b6fc5da2..c1a50268a 100644 --- a/src/client/views/nodes/formattedText/FormattedTextBox.tsx +++ b/src/client/views/nodes/formattedText/FormattedTextBox.tsx @@ -994,7 +994,7 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp clipboardTextSerializer: this.clipboardTextSerializer, handlePaste: this.handlePaste, }); - !Doc.UserDoc().noviceMode && applyDevTools.applyDevTools(this._editorView); + // !Doc.UserDoc().noviceMode && applyDevTools.applyDevTools(this._editorView); const startupText = !rtfField && this._editorView && Field.toString(this.dataDoc[fieldKey] as Field); if (startupText) { const { state: { tr }, dispatch } = this._editorView; diff --git a/src/client/views/nodes/formattedText/RichTextRules.ts b/src/client/views/nodes/formattedText/RichTextRules.ts index ef0fead4a..dc1d8a2c8 100644 --- a/src/client/views/nodes/formattedText/RichTextRules.ts +++ b/src/client/views/nodes/formattedText/RichTextRules.ts @@ -317,13 +317,12 @@ export class RichTextRules { // create an inline view of a tag stored under the '#' field new InputRule( - new RegExp(/#([a-zA-Z_\-]+[a-zA-Z_;\-0-9]*)\s$/), + new RegExp(/#([a-zA-Z_\-]+[a-zA-Z_\-0-9]*)\s$/), (state, match, start, end) => { const tag = match[1]; if (!tag) return state.tr; - const multiple = tag.split(";"); - this.Document[DataSym]["#"] = multiple.length > 1 ? new List(multiple) : tag; - const fieldView = state.schema.nodes.dashField.create({ fieldKey: "#" }); + this.Document[DataSym]["#" + tag] = "."; + const fieldView = state.schema.nodes.dashField.create({ fieldKey: "#" + tag }); return state.tr.deleteRange(start, end).insert(start, fieldView); }), -- cgit v1.2.3-70-g09d2 From 7693ca298392cb0551032b83b688366b1956bdd6 Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Tue, 28 Jul 2020 10:52:02 -0400 Subject: cleaned up some font stuff. cleaned up DocumentView a bit --- src/client/documents/Documents.ts | 1 + src/client/util/SharingManager.tsx | 5 +- src/client/views/DocComponent.tsx | 6 +- src/client/views/GestureOverlay.tsx | 2 +- src/client/views/MainView.tsx | 38 +- src/client/views/Touchable.tsx | 2 +- .../views/collections/CollectionLinearView.tsx | 2 +- src/client/views/collections/CollectionSubView.tsx | 8 +- src/client/views/collections/CollectionView.tsx | 7 +- .../CollectionFreeFormLayoutEngines.tsx | 24 -- .../collectionFreeForm/CollectionFreeFormView.tsx | 5 - src/client/views/nodes/ComparisonBox.tsx | 2 +- src/client/views/nodes/DocumentView.tsx | 409 ++++----------------- src/client/views/nodes/ImageBox.tsx | 2 +- src/client/views/nodes/ScriptingBox.tsx | 2 +- src/fields/Doc.ts | 5 + 16 files changed, 110 insertions(+), 410 deletions(-) (limited to 'src/client/documents') diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts index a1c66c2fe..2cd781a53 100644 --- a/src/client/documents/Documents.ts +++ b/src/client/documents/Documents.ts @@ -1053,6 +1053,7 @@ export namespace DocUtils { } }); batch.end(); + return doc; } export function findTemplate(templateName: string, type: string, signature: string) { let docLayoutTemplate: Opt; diff --git a/src/client/util/SharingManager.tsx b/src/client/util/SharingManager.tsx index 452a58d21..0d8b33fbe 100644 --- a/src/client/util/SharingManager.tsx +++ b/src/client/util/SharingManager.tsx @@ -8,7 +8,6 @@ import * as RequestPromise from "request-promise"; import { Utils } from "../../Utils"; import "./SharingManager.scss"; import { observer } from "mobx-react"; -import { library } from '@fortawesome/fontawesome-svg-core'; import * as fa from '@fortawesome/free-solid-svg-icons'; import { DocumentView } from "../views/nodes/DocumentView"; import { SelectionManager } from "./SelectionManager"; @@ -23,8 +22,6 @@ import { List } from "../../fields/List"; import { distributeAcls, SharingPermissions } from "../../fields/util"; import { TaskCompletionBox } from "../views/nodes/TaskCompletedBox"; -library.add(fa.faCopy, fa.faTimes); - export interface User { email: string; userDocumentId: string; @@ -447,7 +444,7 @@ export default class SharingManager extends React.Component<{}> {

Share {this.focusOn(StrCast(this.targetDoc?.title, "this document"))}

- +
{this.targetDoc?.author !== Doc.CurrentUserEmail ? null : diff --git a/src/client/views/DocComponent.tsx b/src/client/views/DocComponent.tsx index 9fd406407..4c82149e2 100644 --- a/src/client/views/DocComponent.tsx +++ b/src/client/views/DocComponent.tsx @@ -26,7 +26,7 @@ export function DocComponent

(schemaCtor: (doc: D // This is the data part of a document -- ie, the data that is constant across all views of the document @computed get dataDoc() { return this.props.Document[DataSym] as Doc; } - protected multiTouchDisposer?: InteractionUtils.MultiTouchEventDisposer; + protected _multiTouchDisposer?: InteractionUtils.MultiTouchEventDisposer; } return Component; } @@ -59,7 +59,7 @@ export function ViewBoxBaseComponent

(schemaCtor: lookupField = (field: string) => ScriptCast(this.layoutDoc.lookupField)?.script.run({ self: this.layoutDoc, data: this.rootDoc, field: field, container: this.props.ContainingCollectionDoc }).result; active = (outsideReaction?: boolean) => !this.props.Document.isBackground && (this.props.rootSelected(outsideReaction) || this.props.isSelected(outsideReaction) || this.props.renderDepth === 0 || this.layoutDoc.forceActive);// && !Doc.SelectedTool(); // bcz: inking state shouldn't affect static tools - protected multiTouchDisposer?: InteractionUtils.MultiTouchEventDisposer; + protected _multiTouchDisposer?: InteractionUtils.MultiTouchEventDisposer; } return Component; } @@ -114,7 +114,7 @@ export function ViewBoxAnnotatableComponent

= new Map(); private _holdTimer: NodeJS.Timeout | undefined; - protected multiTouchDisposer?: InteractionUtils.MultiTouchEventDisposer; + protected _multiTouchDisposer?: InteractionUtils.MultiTouchEventDisposer; constructor(props: Readonly<{}>) { super(props); diff --git a/src/client/views/MainView.tsx b/src/client/views/MainView.tsx index 9fad612ee..33cd43678 100644 --- a/src/client/views/MainView.tsx +++ b/src/client/views/MainView.tsx @@ -1,18 +1,6 @@ import { library } from '@fortawesome/fontawesome-svg-core'; - -import { - faHireAHelper -} from '@fortawesome/free-brands-svg-icons'; -import { - faTasks, faEdit, faTrashAlt, faPalette, faAngleRight, faBell, faTrash, faCamera, faExpand, faCaretDown, faCaretLeft, faCaretRight, faCaretSquareDown, faCaretSquareRight, faArrowsAltH, faPlus, faMinus, - faTerminal, faToggleOn, faFile as fileSolid, faExternalLinkAlt, faLocationArrow, faSearch, faFileDownload, faStop, faCalculator, faWindowMaximize, faAddressCard, - faQuestionCircle, faArrowLeft, faArrowRight, faArrowDown, faArrowUp, faBolt, faBullseye, faCaretUp, faCat, faCheck, faChevronRight, faClipboard, faClone, faCloudUploadAlt, - faCommentAlt, faCompressArrowsAlt, faCut, faEllipsisV, faEraser, faExclamation, faFileAlt, faFileAudio, faFilePdf, faFilm, faFilter, faFont, faGlobeAsia, faHighlighter, - faLongArrowAltRight, faMicrophone, faMousePointer, faMusic, faObjectGroup, faPause, faPen, faPenNib, faPhone, faPlay, faPortrait, faRedoAlt, faStamp, faStickyNote, faTimesCircle, - faThumbtack, faTree, faTv, faUndoAlt, faVideo, faAsterisk, faBrain, faImage, faPaintBrush, faTimes, faEye, faArrowsAlt, faQuoteLeft, faSortAmountDown, faAlignLeft, faAlignCenter, faAlignRight, - faHeading, faRulerCombined, faFillDrip, faLink, faUnlink, faBold, faItalic, faChevronLeft, faUnderline, faStrikethrough, faSuperscript, faSubscript, faIndent, faEyeDropper, - faPaintRoller, faBars, faBrush, faShapes, faEllipsisH, faHandPaper, faMap, faUser -} from '@fortawesome/free-solid-svg-icons'; +import { faHireAHelper } from '@fortawesome/free-brands-svg-icons'; +import * as fa from '@fortawesome/free-solid-svg-icons'; import { ANTIMODEMENU_HEIGHT } from './globalCssVariables.scss'; import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'; import { action, computed, configure, observable, reaction, runInAction } from 'mobx'; @@ -146,14 +134,20 @@ export class MainView extends React.Component { } } - library.add(faTasks, faEdit, faTrashAlt, faPalette, faAngleRight, faBell, faTrash, faCamera, faExpand, faCaretDown, faCaretLeft, faCaretRight, faCaretSquareDown, faCaretSquareRight, faArrowsAltH, faPlus, faMinus, - faTerminal, faToggleOn, faExternalLinkAlt, faLocationArrow, faSearch, faFileDownload, faStop, faCalculator, faTimesCircle, faWindowMaximize, faAddressCard, fileSolid, - faQuestionCircle, faArrowLeft, faArrowRight, faArrowDown, faArrowUp, faBolt, faBullseye, faCaretUp, faCat, faCheck, faChevronRight, faClipboard, faClone, faCloudUploadAlt, - faCommentAlt, faCompressArrowsAlt, faCut, faEllipsisV, faEraser, faExclamation, faFileAlt, faFileAudio, faFilePdf, faFilm, faFilter, faFont, faGlobeAsia, faHighlighter, - faLongArrowAltRight, faMicrophone, faMousePointer, faMusic, faObjectGroup, faPause, faPen, faPenNib, faPhone, faPlay, faPortrait, faRedoAlt, faStamp, faStickyNote, faTrashAlt, faAngleRight, faBell, - faThumbtack, faTree, faTv, faUndoAlt, faVideo, faAsterisk, faBrain, faImage, faPaintBrush, faTimes, faEye, faArrowsAlt, faQuoteLeft, faSortAmountDown, faAlignLeft, faAlignCenter, faAlignRight, - faHeading, faRulerCombined, faFillDrip, faLink, faUnlink, faBold, faItalic, faChevronLeft, faUnderline, faStrikethrough, faSuperscript, faSubscript, faIndent, faEyeDropper, - faPaintRoller, faBars, faBrush, faShapes, faEllipsisH, faHandPaper, faMap, faUser, faHireAHelper); + library.add(fa.faEdit, fa.faTrash, fa.faTrashAlt, fa.faShare, fa.faDownload, fa.faExpandArrowsAlt, fa.faLayerGroup, fa.faExternalLinkAlt, + fa.faSquare, fa.faConciergeBell, fa.faWindowRestore, fa.faFolder, fa.faMapPin, fa.faFingerprint, fa.faCrosshairs, fa.faDesktop, fa.faUnlock, + fa.faLock, fa.faLaptopCode, fa.faMale, fa.faCopy, fa.faHandPointRight, fa.faCompass, fa.faSnowflake, fa.faMicrophone, fa.faKeyboard, + fa.faQuestion, fa.faTasks, fa.faPalette, fa.faAngleRight, fa.faBell, fa.faCamera, fa.faExpand, fa.faCaretDown, fa.faCaretLeft, fa.faCaretRight, + fa.faCaretSquareDown, fa.faCaretSquareRight, fa.faArrowsAltH, fa.faPlus, fa.faMinus, fa.faTerminal, fa.faToggleOn, fa.faFile, fa.faLocationArrow, + fa.faSearch, fa.faFileDownload, fa.faStop, fa.faCalculator, fa.faWindowMaximize, fa.faAddressCard, fa.faQuestionCircle, fa.faArrowLeft, + fa.faArrowRight, fa.faArrowDown, fa.faArrowUp, fa.faBolt, fa.faBullseye, fa.faCaretUp, fa.faCat, fa.faCheck, fa.faChevronRight, fa.faClipboard, + fa.faClone, fa.faCloudUploadAlt, fa.faCommentAlt, fa.faCompressArrowsAlt, fa.faCut, fa.faEllipsisV, fa.faEraser, fa.faExclamation, fa.faFileAlt, + fa.faFileAudio, fa.faFilePdf, fa.faFilm, fa.faFilter, fa.faFont, fa.faGlobeAsia, fa.faHighlighter, fa.faLongArrowAltRight, fa.faMousePointer, + fa.faMusic, fa.faObjectGroup, fa.faPause, fa.faPen, fa.faPenNib, fa.faPhone, fa.faPlay, fa.faPortrait, fa.faRedoAlt, fa.faStamp, fa.faStickyNote, + fa.faTimesCircle, fa.faThumbtack, fa.faTree, fa.faTv, fa.faUndoAlt, fa.faVideo, fa.faAsterisk, fa.faBrain, fa.faImage, fa.faPaintBrush, fa.faTimes, + fa.faEye, fa.faArrowsAlt, fa.faQuoteLeft, fa.faSortAmountDown, fa.faAlignLeft, fa.faAlignCenter, fa.faAlignRight, fa.faHeading, fa.faRulerCombined, + fa.faFillDrip, fa.faLink, fa.faUnlink, fa.faBold, fa.faItalic, fa.faChevronLeft, fa.faUnderline, fa.faStrikethrough, fa.faSuperscript, fa.faSubscript, + fa.faIndent, fa.faEyeDropper, fa.faPaintRoller, fa.faBars, fa.faBrush, fa.faShapes, fa.faEllipsisH, fa.faHandPaper, fa.faMap, fa.faUser, faHireAHelper); this.initEventListeners(); this.initAuthenticationRouters(); } diff --git a/src/client/views/Touchable.tsx b/src/client/views/Touchable.tsx index c4cae7e8d..bb9e108cb 100644 --- a/src/client/views/Touchable.tsx +++ b/src/client/views/Touchable.tsx @@ -12,7 +12,7 @@ export abstract class Touchable extends React.Component { private holdEndDisposer?: InteractionUtils.MultiTouchEventDisposer; - protected abstract multiTouchDisposer?: InteractionUtils.MultiTouchEventDisposer; + protected abstract _multiTouchDisposer?: InteractionUtils.MultiTouchEventDisposer; protected _touchDrag: boolean = false; protected prevPoints: Map = new Map(); diff --git a/src/client/views/collections/CollectionLinearView.tsx b/src/client/views/collections/CollectionLinearView.tsx index 407524353..3b31947f7 100644 --- a/src/client/views/collections/CollectionLinearView.tsx +++ b/src/client/views/collections/CollectionLinearView.tsx @@ -176,7 +176,7 @@ export class CollectionLinearView extends CollectionSubView(LinearDocument) { }} onPointerDown={e => e.stopPropagation()} > - Creating link from: {DocumentLinksButton.StartLink.title} + Creating link from: {DocumentLinksButton.StartLink.props.Document.title}

{LinkDescriptionPopup.showDescriptions ? "Turn off description pop-up" : diff --git a/src/client/views/collections/CollectionSubView.tsx b/src/client/views/collections/CollectionSubView.tsx index d9d9c0eb8..99acfdcc2 100644 --- a/src/client/views/collections/CollectionSubView.tsx +++ b/src/client/views/collections/CollectionSubView.tsx @@ -55,17 +55,17 @@ export function CollectionSubView(schemaCtor: (doc: Doc) => T, moreProps?: class CollectionSubView extends DocComponent(schemaCtor) { private dropDisposer?: DragManager.DragDropDisposer; private gestureDisposer?: GestureUtils.GestureEventDisposer; - protected multiTouchDisposer?: InteractionUtils.MultiTouchEventDisposer; + protected _multiTouchDisposer?: InteractionUtils.MultiTouchEventDisposer; protected _mainCont?: HTMLDivElement; protected createDashEventsTarget = (ele: HTMLDivElement) => { //used for stacking and masonry view this.dropDisposer?.(); this.gestureDisposer?.(); - this.multiTouchDisposer?.(); + this._multiTouchDisposer?.(); if (ele) { this._mainCont = ele; this.dropDisposer = DragManager.MakeDropTarget(ele, this.onInternalDrop.bind(this), this.layoutDoc, this.onInternalPreDrop.bind(this)); this.gestureDisposer = GestureUtils.MakeGestureTarget(ele, this.onGesture.bind(this)); - this.multiTouchDisposer = InteractionUtils.MakeMultiTouchTarget(ele, this.onTouchStart.bind(this)); + this._multiTouchDisposer = InteractionUtils.MakeMultiTouchTarget(ele, this.onTouchStart.bind(this)); } } protected CreateDropTarget(ele: HTMLDivElement) { //used in schema view @@ -74,7 +74,7 @@ export function CollectionSubView(schemaCtor: (doc: Doc) => T, moreProps?: componentWillUnmount() { this.gestureDisposer?.(); - this.multiTouchDisposer?.(); + this._multiTouchDisposer?.(); } @computed get dataDoc() { diff --git a/src/client/views/collections/CollectionView.tsx b/src/client/views/collections/CollectionView.tsx index 2c17254ed..e7a504e61 100644 --- a/src/client/views/collections/CollectionView.tsx +++ b/src/client/views/collections/CollectionView.tsx @@ -27,12 +27,10 @@ import { InteractionUtils } from '../../util/InteractionUtils'; import { UndoManager } from '../../util/UndoManager'; import { ContextMenu } from "../ContextMenu"; import { FieldView, FieldViewProps } from '../nodes/FieldView'; -import { ScriptBox } from '../ScriptBox'; import { Touchable } from '../Touchable'; import { CollectionCarousel3DView } from './CollectionCarousel3DView'; import { CollectionCarouselView } from './CollectionCarouselView'; import { CollectionDockingView } from "./CollectionDockingView"; -import { AddCustomFreeFormLayout } from './collectionFreeForm/CollectionFreeFormLayoutEngines'; import { CollectionFreeFormView } from './collectionFreeForm/CollectionFreeFormView'; import { CollectionGridView } from './collectionGrid/CollectionGridView'; import { CollectionLinearView } from './CollectionLinearView'; @@ -105,7 +103,7 @@ export class CollectionView extends Touchable([ [AclPrivate, SharingPermissions.None], @@ -289,9 +287,6 @@ export class CollectionView extends Touchable func(CollectionViewType.Time), icon: "columns" }); subItems.push({ description: "Map", event: () => func(CollectionViewType.Map), icon: "globe-americas" }); subItems.push({ description: "Grid", event: () => func(CollectionViewType.Grid), icon: "th-list" }); - if (addExtras && this.props.Document._viewType === CollectionViewType.Freeform) { - subItems.push({ description: "Custom", icon: "fingerprint", event: AddCustomFreeFormLayout(this.props.Document, this.props.fieldKey) }); - } addExtras && subItems.push({ description: "lightbox", event: action(() => this._isLightboxOpen = true), icon: "eye" }); const existingVm = ContextMenu.Instance.findByDescription(category); diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormLayoutEngines.tsx b/src/client/views/collections/collectionFreeForm/CollectionFreeFormLayoutEngines.tsx index 183ed3119..b00074cc6 100644 --- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormLayoutEngines.tsx +++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormLayoutEngines.tsx @@ -434,27 +434,3 @@ function normalizeResults( payload: gname.payload }))); } - -export function AddCustomFreeFormLayout(doc: Doc, dataKey: string): () => void { - return () => { - const addOverlay = (key: "arrangeScript" | "arrangeInit", options: OverlayElementOptions, params?: Record, requiredType?: string) => { - let overlayDisposer: () => void = emptyFunction; // filled in below after we have a reference to the scriptingBox - const scriptField = Cast(doc[key], ScriptField); - const scriptingBox = overlayDisposer()} // don't get rid of the function wrapper-- we don't want to use the current value of overlayDiposer, but the one set below - onSave={(text, onError) => { - const script = CompileScript(text, { params, requiredType, typecheck: false }); - if (!script.compiled) { - onError(script.errors.map(error => error.messageText).join("\n")); - } else { - doc[key] = new ScriptField(script); - overlayDisposer(); - } - }} />; - overlayDisposer = OverlayView.Instance.addWindow(scriptingBox, options); - }; - addOverlay("arrangeInit", { x: 400, y: 100, width: 400, height: 300, title: "Layout Initialization" }, { collection: "Doc", docs: "Doc[]" }, undefined); - addOverlay("arrangeScript", { x: 400, y: 500, width: 400, height: 300, title: "Layout Script" }, { doc: "Doc", index: "number", collection: "Doc", state: "any", docs: "Doc[]" }, "{x: number, y: number, width?: number, height?: number}"); - }; -} diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx index 792f3af5f..57336131a 100644 --- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx +++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx @@ -57,7 +57,6 @@ export const panZoomSchema = createSchema({ currentTimecode: "number", displayTimecode: "number", currentFrame: "number", - arrangeScript: ScriptField, arrangeInit: ScriptField, useClusters: "boolean", fitToBox: "boolean", @@ -1005,10 +1004,6 @@ export class CollectionFreeFormView extends CollectionSubView(ComparisonDocument) { public static LayoutString(fieldKey: string) { return FieldView.LayoutString(ComparisonBox, fieldKey); } - protected multiTouchDisposer?: import("../../util/InteractionUtils").InteractionUtils.MultiTouchEventDisposer | undefined; + protected _multiTouchDisposer?: import("../../util/InteractionUtils").InteractionUtils.MultiTouchEventDisposer | undefined; private _disposers: (DragManager.DragDropDisposer | undefined)[] = [undefined, undefined]; @observable _animating = ""; diff --git a/src/client/views/nodes/DocumentView.tsx b/src/client/views/nodes/DocumentView.tsx index 3b4dc3741..c47edefd6 100644 --- a/src/client/views/nodes/DocumentView.tsx +++ b/src/client/views/nodes/DocumentView.tsx @@ -1,31 +1,31 @@ -import { library } from '@fortawesome/fontawesome-svg-core'; -import * as fa from '@fortawesome/free-solid-svg-icons'; import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'; import { action, computed, observable, runInAction } from "mobx"; import { observer } from "mobx-react"; -import { Doc, DocListCast, HeightSym, Opt, WidthSym, DataSym, AclPrivate, AclEdit, AclAdmin } from "../../../fields/Doc"; +import { AclAdmin, AclEdit, AclPrivate, DataSym, Doc, DocListCast, HeightSym, Opt, WidthSym } from "../../../fields/Doc"; import { Document } from '../../../fields/documentSchemas'; import { Id } from '../../../fields/FieldSymbols'; import { InkTool } from '../../../fields/InkField'; import { listSpec } from "../../../fields/Schema"; import { SchemaHeaderField } from '../../../fields/SchemaHeaderField'; import { ScriptField } from '../../../fields/ScriptField'; -import { BoolCast, Cast, NumCast, StrCast, ScriptCast } from "../../../fields/Types"; -import { TraceMobx, GetEffectiveAcl, SharingPermissions } from '../../../fields/util'; +import { BoolCast, Cast, NumCast, ScriptCast, StrCast } from "../../../fields/Types"; +import { GetEffectiveAcl, SharingPermissions, TraceMobx } from '../../../fields/util'; +import { MobileInterface } from '../../../mobile/MobileInterface'; import { GestureUtils } from '../../../pen-gestures/GestureUtils'; -import { emptyFunction, OmitKeys, returnOne, returnTransparent, Utils, emptyPath } from "../../../Utils"; +import { emptyFunction, emptyPath, OmitKeys, returnOne, returnTransparent, Utils } from "../../../Utils"; import { GooglePhotos } from '../../apis/google_docs/GooglePhotosClientUtils'; import { ClientRecommender } from '../../ClientRecommender'; import { Docs, DocUtils } from "../../documents/Documents"; import { DocumentType } from '../../documents/DocumentTypes'; import { DocumentManager } from "../../util/DocumentManager"; -import { SnappingManager } from '../../util/SnappingManager'; import { DragManager, dropActionType } from "../../util/DragManager"; import { InteractionUtils } from '../../util/InteractionUtils'; +import { LinkManager } from '../../util/LinkManager'; import { Scripting } from '../../util/Scripting'; import { SearchUtil } from '../../util/SearchUtil'; import { SelectionManager } from "../../util/SelectionManager"; import SharingManager from '../../util/SharingManager'; +import { SnappingManager } from '../../util/SnappingManager'; import { Transform } from "../../util/Transform"; import { undoBatch, UndoManager } from "../../util/UndoManager"; import { CollectionView, CollectionViewType } from '../collections/CollectionView'; @@ -35,20 +35,13 @@ import { DocComponent } from "../DocComponent"; import { EditableView } from '../EditableView'; import { KeyphraseQueryView } from '../KeyphraseQueryView'; import { DocumentContentsView } from "./DocumentContentsView"; +import { DocumentLinksButton } from './DocumentLinksButton'; import "./DocumentView.scss"; import { LinkAnchorBox } from './LinkAnchorBox'; +import { LinkDescriptionPopup } from './LinkDescriptionPopup'; import { RadialMenu } from './RadialMenu'; -import React = require("react"); -import { DocumentLinksButton } from './DocumentLinksButton'; -import { MobileInterface } from '../../../mobile/MobileInterface'; import { TaskCompletionBox } from './TaskCompletedBox'; -import { LinkDescriptionPopup } from './LinkDescriptionPopup'; -import { LinkManager } from '../../util/LinkManager'; -import CollectionMenu from '../collections/CollectionMenu'; - -library.add(fa.faEdit, fa.faTrash, fa.faShare, fa.faDownload, fa.faExpandArrowsAlt, fa.faCompressArrowsAlt, fa.faLayerGroup, fa.faExternalLinkAlt, fa.faAlignCenter, fa.faCaretSquareRight, - fa.faSquare, fa.faConciergeBell, fa.faWindowRestore, fa.faFolder, fa.faMapPin, fa.faLink, fa.faFingerprint, fa.faCrosshairs, fa.faDesktop, fa.faUnlock, fa.faLock, fa.faLaptopCode, fa.faMale, - fa.faCopy, fa.faHandPointRight, fa.faCompass, fa.faSnowflake, fa.faMicrophone, fa.faKeyboard, fa.faQuestion); +import React = require("react"); export type DocFocusFunc = () => boolean; @@ -105,24 +98,25 @@ export interface DocumentViewProps { @observer export class DocumentView extends DocComponent(Document) { + @observable _animateScalingTo = 0; private _downX: number = 0; private _downY: number = 0; + private _firstX: number = -1; + private _firstY: number = -1; private _lastTap: number = 0; private _doubleTap = false; private _mainCont = React.createRef(); private _dropDisposer?: DragManager.DragDropDisposer; private _showKPQuery: boolean = false; private _queries: string = ""; - private _gestureEventDisposer?: GestureUtils.GestureEventDisposer; private _titleRef = React.createRef(); + private _gestureEventDisposer?: GestureUtils.GestureEventDisposer; + private _holdDisposer?: InteractionUtils.MultiTouchEventDisposer; + protected _multiTouchDisposer?: InteractionUtils.MultiTouchEventDisposer; - protected multiTouchDisposer?: InteractionUtils.MultiTouchEventDisposer; - private holdDisposer?: InteractionUtils.MultiTouchEventDisposer; - - public get title() { return this.props.Document.title; } public get displayName() { return "DocumentView(" + this.props.Document.title + ")"; } // this makes mobx trace() statements more descriptive public get ContentDiv() { return this._mainCont.current; } - get active() { return SelectionManager.IsSelected(this, true) || this.props.parentActive(true); } + private get active() { return SelectionManager.IsSelected(this, true) || this.props.parentActive(true); } @computed get topMost() { return this.props.renderDepth === 0; } @computed get freezeDimensions() { return this.props.FreezeDimensions; } @computed get nativeWidth() { return NumCast(this.layoutDoc._nativeWidth, this.props.NativeWidth() || (this.freezeDimensions ? this.layoutDoc[WidthSym]() : 0)); } @@ -136,9 +130,6 @@ export class DocumentView extends DocComponent(Docu onClickFunc = () => this.onClickHandler; onDoubleClickFunc = () => this.onDoubleClickHandler; - private _firstX: number = -1; - private _firstY: number = -1; - handle1PointerHoldStart = (e: Event, me: InteractionUtils.MultiTouchEvent): any => { this.removeMoveListeners(); this.removeEndListeners(); @@ -152,11 +143,9 @@ export class DocumentView extends DocComponent(Docu this._firstX = pt.pageX; this._firstY = pt.pageY; } - } handle1PointerHoldMove = (e: Event, me: InteractionUtils.MultiTouchEvent): void => { - const pt = me.touchEvent.touches[me.touchEvent.touches.length - 1]; if (this._firstX === -1 || this._firstY === -1) { @@ -200,7 +189,7 @@ export class DocumentView extends DocComponent(Docu componentDidMount() { this._mainCont.current && (this._dropDisposer = DragManager.MakeDropTarget(this._mainCont.current, this.drop.bind(this), this.props.Document)); this._mainCont.current && (this._gestureEventDisposer = GestureUtils.MakeGestureTarget(this._mainCont.current, this.onGesture.bind(this))); - this._mainCont.current && (this.multiTouchDisposer = InteractionUtils.MakeMultiTouchTarget(this._mainCont.current, this.onTouchStart.bind(this))); + this._mainCont.current && (this._multiTouchDisposer = InteractionUtils.MakeMultiTouchTarget(this._mainCont.current, this.onTouchStart.bind(this))); // this._mainCont.current && (this.holdDisposer = InteractionUtils.MakeHoldTouchTarget(this._mainCont.current, this.handle1PointerHoldStart.bind(this))); if (!this.props.dontRegisterView) { @@ -212,13 +201,13 @@ export class DocumentView extends DocComponent(Docu componentDidUpdate() { this._dropDisposer?.(); this._gestureEventDisposer?.(); - this.multiTouchDisposer?.(); - this.holdDisposer?.(); + this._multiTouchDisposer?.(); + this._holdDisposer?.(); if (this._mainCont.current) { this._dropDisposer = DragManager.MakeDropTarget(this._mainCont.current, this.drop.bind(this), this.props.Document); this._gestureEventDisposer = GestureUtils.MakeGestureTarget(this._mainCont.current, this.onGesture.bind(this)); - this.multiTouchDisposer = InteractionUtils.MakeMultiTouchTarget(this._mainCont.current, this.onTouchStart.bind(this)); - this.holdDisposer = InteractionUtils.MakeHoldTouchTarget(this._mainCont.current, this.handle1PointerHoldStart.bind(this)); + this._multiTouchDisposer = InteractionUtils.MakeMultiTouchTarget(this._mainCont.current, this.onTouchStart.bind(this)); + this._holdDisposer = InteractionUtils.MakeHoldTouchTarget(this._mainCont.current, this.handle1PointerHoldStart.bind(this)); } } @@ -226,8 +215,8 @@ export class DocumentView extends DocComponent(Docu componentWillUnmount() { this._dropDisposer?.(); this._gestureEventDisposer?.(); - this.multiTouchDisposer?.(); - this.holdDisposer?.(); + this._multiTouchDisposer?.(); + this._holdDisposer?.(); Doc.UnBrushDoc(this.props.Document); if (!this.props.dontRegisterView) { const index = DocumentManager.Instance.DocumentViews.indexOf(this); @@ -242,7 +231,7 @@ export class DocumentView extends DocComponent(Docu dragData.offset = this.props.ScreenToLocalTransform().scale(this.props.ContentScaling()).transformDirection(x - left, y - top); dragData.dropAction = dropAction; dragData.removeDocument = this.props.removeDocument; - dragData.moveDocument = this.props.moveDocument;// this.layoutDoc.onDragStart ? undefined : this.props.moveDocument; + dragData.moveDocument = this.props.moveDocument; dragData.dragDivName = this.props.dragDivName; dragData.treeViewDoc = this.props.treeViewDoc; DragManager.StartDocumentDrag([this._mainCont.current], dragData, x, y, { hideSource: !dropAction && !this.layoutDoc.onDragStart }); @@ -254,7 +243,6 @@ export class DocumentView extends DocComponent(Docu const de = new DragManager.DocumentDragData([topDoc]); de.dragDivName = topDocView.props.dragDivName; de.moveDocument = topDocView.props.moveDocument; - undoBatch(action(() => topDoc.z = topDoc.z ? 0 : 1))(); setTimeout(() => { const newDocView = DocumentManager.Instance.getDocumentView(topDoc); if (newDocView) { @@ -263,6 +251,7 @@ export class DocumentView extends DocComponent(Docu DragManager.StartDocumentDrag([contentDiv], de, x, y, { offsetX: x - xf.left, offsetY: y - xf.top, hideSource: true }); } }, 0); + UndoManager.RunInBatch(action(() => topDoc.z = topDoc.z ? 0 : 1), "float"); } onKeyDown = (e: React.KeyboardEvent) => { @@ -301,41 +290,39 @@ export class DocumentView extends DocComponent(Docu const func = () => this.onDoubleClickHandler.script.run({ this: this.layoutDoc, self: this.rootDoc, - thisContainer: this.props.ContainingCollectionDoc, shiftKey: e.shiftKey + thisContainer: this.props.ContainingCollectionDoc, + shiftKey: e.shiftKey }, console.log); func(); } else { UndoManager.RunInBatch(() => { + let fullScreenDoc = this.props.Document; if (StrCast(this.props.Document.layoutKey) !== "layout_fullScreen" && this.props.Document.layout_fullScreen) { - const fullScreenAlias = Doc.MakeAlias(this.props.Document); - fullScreenAlias.layoutKey = "layout_fullScreen"; - this.props.addDocTab(fullScreenAlias, "inTab"); - } else { - this.props.addDocTab(this.props.Document, "inTab"); + fullScreenDoc = Doc.MakeAlias(this.props.Document); + fullScreenDoc.layoutKey = "layout_fullScreen"; } + this.props.addDocTab(fullScreenDoc, "inTab"); }, "double tap"); SelectionManager.DeselectAll(); Doc.UnBrushDoc(this.props.Document); } } } else if (this.onClickHandler?.script && !StrCast(Doc.LayoutField(this.layoutDoc))?.includes("ScriptingBox")) { // bcz: hack? don't execute script if you're clicking on a scripting box itself - //SelectionManager.DeselectAll(); const func = () => this.onClickHandler.script.run({ this: this.layoutDoc, self: this.rootDoc, - thisContainer: this.props.ContainingCollectionDoc, shiftKey: e.shiftKey + thisContainer: this.props.ContainingCollectionDoc, + shiftKey: e.shiftKey }, console.log); if (this.props.Document !== Doc.UserDoc()["dockedBtn-undo"] && this.props.Document !== Doc.UserDoc()["dockedBtn-redo"]) { UndoManager.RunInBatch(func, "on click"); } else func(); } else if (this.Document["onClick-rawScript"] && !StrCast(Doc.LayoutField(this.layoutDoc))?.includes("ScriptingBox")) {// bcz: hack? don't edit a script if you're clicking on a scripting box itself - const alias = Doc.MakeAlias(this.props.Document); - DocUtils.makeCustomViewClicked(alias, undefined, "onClick"); - this.props.addDocTab(alias, "onRight"); + this.props.addDocTab(DocUtils.makeCustomViewClicked(Doc.MakeAlias(this.props.Document), undefined, "onClick"), "onRight"); } else if (this.allLinks && this.Document.isLinkButton && !e.shiftKey && !e.ctrlKey) { this.allLinks.length && this.followLinkClick(e.altKey, e.ctrlKey, e.shiftKey); } else { - if ((this.layoutDoc.onDragStart || (this.props.Document.rootDocument)) && !(e.ctrlKey || e.button > 0)) { // onDragStart implies a button doc that we don't want to select when clicking. RootDocument & isTEmplaetForField implies we're clicking on part of a template instance and we want to select the whole template, not the part + if ((this.layoutDoc.onDragStart || this.props.Document.rootDocument) && !(e.ctrlKey || e.button > 0)) { // onDragStart implies a button doc that we don't want to select when clicking. RootDocument & isTemplaetForField implies we're clicking on part of a template instance and we want to select the whole template, not the part stopPropagate = false; // don't stop propagation for field templates -- want the selection to propagate up to the root document of the template } else { SelectionManager.SelectDoc(this, e.ctrlKey || e.shiftKey); @@ -407,7 +394,6 @@ export class DocumentView extends DocComponent(Docu } e.stopPropagation(); // doesn't actually stop propagation since all our listeners are listening to events on 'document' however it does mark the event as cancelBubble=true which we test for in the move event handlers e.preventDefault(); - } } @@ -445,12 +431,6 @@ export class DocumentView extends DocComponent(Docu const oldPoint2 = this.prevPoints.get(pt2.identifier); const pinching = InteractionUtils.Pinning(pt1, pt2, oldPoint1!, oldPoint2!); if (pinching !== 0 && oldPoint1 && oldPoint2) { - // let dX = (Math.min(pt1.clientX, pt2.clientX) - Math.min(oldPoint1.clientX, oldPoint2.clientX)); - // let dY = (Math.min(pt1.clientY, pt2.clientY) - Math.min(oldPoint1.clientY, oldPoint2.clientY)); - // let dX = Math.sign(Math.abs(pt1.clientX - oldPoint1.clientX) - Math.abs(pt2.clientX - oldPoint2.clientX)); - // let dY = Math.sign(Math.abs(pt1.clientY - oldPoint1.clientY) - Math.abs(pt2.clientY - oldPoint2.clientY)); - // let dW = -dX; - // let dH = -dY; const dW = (Math.abs(pt1.clientX - pt2.clientX) - Math.abs(oldPoint1.clientX - oldPoint2.clientX)); const dH = (Math.abs(pt1.clientY - pt2.clientY) - Math.abs(oldPoint1.clientY - oldPoint2.clientY)); const dX = -1 * Math.sign(dW); @@ -533,7 +513,6 @@ export class DocumentView extends DocComponent(Docu } onPointerMove = (e: PointerEvent): void => { - if ((e as any).formattedHandled) { e.stopPropagation(); return; } if ((InteractionUtils.IsType(e, InteractionUtils.PENTYPE) || Doc.GetSelectedTool() === InkTool.Highlighter || Doc.GetSelectedTool() === InkTool.Pen)) return; if (e.cancelBubble && this.active) { @@ -554,17 +533,15 @@ export class DocumentView extends DocComponent(Docu onPointerUp = (e: PointerEvent): void => { this.cleanUpInteractions(); + document.removeEventListener("pointermove", this.onPointerMove); + document.removeEventListener("pointerup", this.onPointerUp); if (this.onPointerUpHandler?.script && !InteractionUtils.IsType(e, InteractionUtils.PENTYPE)) { this.onPointerUpHandler.script.run({ self: this.rootDoc, this: this.layoutDoc }, console.log); - document.removeEventListener("pointerup", this.onPointerUp); - return; + } else { + this._doubleTap = (Date.now() - this._lastTap < 300 && e.button === 0 && Math.abs(e.clientX - this._downX) < 2 && Math.abs(e.clientY - this._downY) < 2); + this._lastTap = Date.now(); } - - document.removeEventListener("pointermove", this.onPointerMove); - document.removeEventListener("pointerup", this.onPointerUp); - this._doubleTap = (Date.now() - this._lastTap < 300 && e.button === 0 && Math.abs(e.clientX - this._downX) < 2 && Math.abs(e.clientY - this._downY) < 2); - this._lastTap = Date.now(); } onGesture = (e: Event, ge: GestureUtils.GestureEvent) => { @@ -586,54 +563,20 @@ export class DocumentView extends DocComponent(Docu } } - @undoBatch - togglePushpin = () => { + @undoBatch @action + toggleFollowLink = (location: Opt, zoom: boolean, setPushpin: boolean): void => { this.Document.ignoreClick = false; - if (this.Document.isLinkButton || this.Document.isPushpin || this.onClickHandler || this.Document.ignoreClick) { - this.Document.isPushpin = this.Document.isLinkButton = false; - this.Document.onClick = this.layoutDoc.onClick = undefined; + this.Document.isLinkButton = !this.Document.isLinkButton; + setPushpin && (this.Document.isPushpin = this.Document.isLinkButton); + if (this.Document.isLinkButton && !this.onClickHandler) { + this.Document.followLinkZoom = zoom; + this.Document.followLinkLocation = location; } else { - this.Document.isPushpin = this.Document.isLinkButton = true; - this.Document.followLinkZoom = false; - this.Document.followLinkLocation = undefined; - } - } - - @undoBatch - toggleLinkButtonBehavior = (): void => { - this.Document.ignoreClick = false; - if (this.Document.isLinkButton || this.onClickHandler || this.Document.ignoreClick) { - this.Document.isLinkButton = false; this.Document.onClick = this.layoutDoc.onClick = undefined; - } else { - this.Document.isLinkButton = true; - this.Document.followLinkZoom = false; - this.Document.followLinkLocation = undefined; - } - } - - @undoBatch - toggleFollowInPlace = (): void => { - this.Document.ignoreClick = false; - this.Document.isLinkButton = !this.Document.isLinkButton; - if (this.Document.isLinkButton) { - this.Document.followLinkZoom = true; - this.Document.followLinkLocation = "inPlace"; } } - @undoBatch - toggleFollowOnRight = (): void => { - this.Document.ignoreClick = false; - this.Document.isLinkButton = !this.Document.isLinkButton; - if (this.Document.isLinkButton) { - this.Document.followLinkZoom = false; - this.Document.followLinkLocation = "onRight"; - } - } - - @undoBatch - @action + @undoBatch @action drop = async (e: Event, de: DragManager.DropEvent) => { if (this.props.Document === Doc.UserDoc().activeWorkspace) { alert("linking to document tabs not yet supported. Drop link on document content."); @@ -663,11 +606,10 @@ export class DocumentView extends DocComponent(Docu } if (de.complete.linkDragData) { e.stopPropagation(); - if (de.complete.linkDragData.linkSourceDocument !== this.props.Document) { - const linkDoc = DocUtils.MakeLink({ doc: de.complete.linkDragData.linkSourceDocument }, - { doc: this.props.Document }, `link`); - de.complete.linkDragData.linkSourceDocument !== this.props.Document && - (de.complete.linkDragData.linkDocument = linkDoc); // TODODO this is where in text links get passed + const linkSource = de.complete.linkDragData.linkSourceDocument; + if (linkSource !== this.props.Document) { + const linkDoc = DocUtils.MakeLink({ doc: linkSource }, { doc: this.props.Document }, `link`); + linkSource !== this.props.Document && (de.complete.linkDragData.linkDocument = linkDoc); // TODODO this is where in text links get passed linkDoc && makeLink(linkDoc); } @@ -680,6 +622,12 @@ export class DocumentView extends DocComponent(Docu Doc.toggleNativeDimensions(this.layoutDoc, this.props.ContentScaling(), this.props.PanelWidth(), this.props.PanelHeight()); } + @undoBatch + @action + toggleLockPosition = (): void => { + this.Document.lockedPosition = this.Document.lockedPosition ? undefined : true; + } + @undoBatch @action makeIntoPortal = async () => { @@ -694,9 +642,9 @@ export class DocumentView extends DocComponent(Docu @undoBatch @action - toggleBackground = (temporary: boolean): void => { - this.Document._overflow = temporary ? "visible" : "hidden"; - this.Document.isBackground = !temporary ? !this.Document.isBackground : (this.Document.isBackground ? undefined : true); + toggleBackground = () => { + this.Document.isBackground = (this.Document.isBackground ? undefined : true); + this.Document._overflow = this.Document.isBackground ? "visible" : undefined; if (this.Document.isBackground) { this.props.bringToFront(this.props.Document, true); this.props.Document[DataSym][Doc.LayoutFieldKey(this.Document) + "-nativeWidth"] = this.Document[WidthSym](); @@ -704,41 +652,6 @@ export class DocumentView extends DocComponent(Docu } } - @undoBatch - @action - toggleLockPosition = (): void => { - this.Document.lockedPosition = this.Document.lockedPosition ? undefined : true; - } - - @undoBatch - @action - setAcl = (acl: SharingPermissions) => { - this.dataDoc.ACL = this.props.Document.ACL = acl; - DocListCast(this.dataDoc[Doc.LayoutFieldKey(this.dataDoc)]).map(d => { - if (d.author === Doc.CurrentUserEmail) d.ACL = acl; - const data = d[DataSym]; - if (data && data.author === Doc.CurrentUserEmail) data.ACL = acl; - }); - } - - @undoBatch - @action - testAcl = (acl: SharingPermissions) => { - this.dataDoc.author = this.props.Document.author = "ADMIN"; - this.dataDoc.ACL = this.props.Document.ACL = acl; - DocListCast(this.dataDoc[Doc.LayoutFieldKey(this.dataDoc)]).map(d => { - if (d.author === Doc.CurrentUserEmail) { - d.author = "ADMIN"; - d.ACL = acl; - } - const data = d[DataSym]; - if (data && data.author === Doc.CurrentUserEmail) { - data.author = "ADMIN"; - data.ACL = acl; - } - }); - } - @action onContextMenu = async (e: React.MouseEvent | Touch): Promise => { // the touch onContextMenu is button 0, the pointer onContextMenu is button 2 @@ -785,10 +698,10 @@ export class DocumentView extends DocComponent(Docu onClicks.push({ description: "Enter Portal", event: this.makeIntoPortal, icon: "window-restore" }); onClicks.push({ description: "Toggle Detail", event: () => this.Document.onClick = ScriptField.MakeScript(`toggleDetail(self, "${this.Document.layoutKey}")`), icon: "window-restore" }); onClicks.push({ description: this.Document.ignoreClick ? "Select" : "Do Nothing", event: () => this.Document.ignoreClick = !this.Document.ignoreClick, icon: this.Document.ignoreClick ? "unlock" : "lock" }); - onClicks.push({ description: this.Document.isLinkButton ? "Remove Follow Behavior" : "Follow Link in Place", event: this.toggleFollowInPlace, icon: "concierge-bell" }); - onClicks.push({ description: this.Document.isLinkButton ? "Remove Follow Behavior" : "Follow Link on Right", event: this.toggleFollowOnRight, icon: "concierge-bell" }); - onClicks.push({ description: this.Document.isLinkButton || this.onClickHandler ? "Remove Click Behavior" : "Follow Link", event: this.toggleLinkButtonBehavior, icon: "concierge-bell" }); - onClicks.push({ description: (this.Document.isPushpin ? "Remove" : "Make") + " Pushpin", event: this.togglePushpin, icon: "snowflake" }); + onClicks.push({ description: this.Document.isLinkButton ? "Remove Follow Behavior" : "Follow Link in Place", event: () => this.toggleFollowLink("inPlace", true, false), icon: "concierge-bell" }); + !this.Document.isLinkButton && onClicks.push({ description: "Follow Link on Right", event: () => this.toggleFollowLink("onRight", false, false), icon: "concierge-bell" }); + onClicks.push({ description: this.Document.isLinkButton || this.onClickHandler ? "Remove Click Behavior" : "Follow Link", event: () => this.toggleFollowLink(undefined, false, false), icon: "concierge-bell" }); + onClicks.push({ description: (this.Document.isPushpin ? "Remove" : "Make") + " Pushpin", event: () => this.toggleFollowLink(undefined, false, true), icon: "snowflake" }); onClicks.push({ description: "Edit onClick Script", event: () => UndoManager.RunInBatch(() => DocUtils.makeCustomViewClicked(this.props.Document, undefined, "onClick"), "edit onClick"), icon: "edit" }); !existingOnClick && cm.addItem({ description: "OnClick...", noexpand: true, addDivider: true, subitems: onClicks, icon: "hand-point-right" }); @@ -802,16 +715,7 @@ export class DocumentView extends DocComponent(Docu const more = cm.findByDescription("More..."); const moreItems = more && "subitems" in more ? more.subitems : []; - moreItems.push({ - description: "Download document", icon: "download", event: async () => { - Doc.Zip(this.props.Document); - // const a = document.createElement("a"); - // const url = Utils.prepend(`/downloadId/${this.props.Document[Id]}`); - // a.href = url; - // a.download = `DocExport-${this.props.Document[Id]}.zip`; - // a.click(); - } - }); + moreItems.push({ description: "Download document", icon: "download", event: async () => Doc.Zip(this.props.Document) }); if (!Doc.UserDoc().noviceMode) { moreItems.push({ description: "Make View of Metadata Field", event: () => Doc.MakeMetadataFieldTemplate(this.props.Document, this.props.DataDoc), icon: "concierge-bell" }); moreItems.push({ description: `${this.Document._chromeStatus !== "disabled" ? "Hide" : "Show"} Chrome`, event: () => this.Document._chromeStatus = (this.Document._chromeStatus !== "disabled" ? "disabled" : "enabled"), icon: "project-diagram" }); @@ -836,179 +740,13 @@ export class DocumentView extends DocComponent(Docu helpItems.push({ description: "Print Document in Console", event: () => console.log(this.props.Document), icon: "hand-point-right" }); cm.addItem({ description: "Help...", noexpand: true, subitems: helpItems, icon: "question" }); - // const existingAcls = cm.findByDescription("Privacy..."); - // const aclItems: ContextMenuProps[] = existingAcls && "subitems" in existingAcls ? existingAcls.subitems : []; - // aclItems.push({ description: "Make Add Only", event: () => this.setAcl(SharingPermissions.Add), icon: "concierge-bell" }); - // aclItems.push({ description: "Make Read Only", event: () => this.setAcl(SharingPermissions.View), icon: "concierge-bell" }); - // aclItems.push({ description: "Make Private", event: () => this.setAcl(SharingPermissions.None), icon: "concierge-bell" }); - // aclItems.push({ description: "Make Editable", event: () => this.setAcl(SharingPermissions.Edit), icon: "concierge-bell" }); - // aclItems.push({ description: "Test Private", event: () => this.testAcl(SharingPermissions.None), icon: "concierge-bell" }); - // aclItems.push({ description: "Test Readonly", event: () => this.testAcl(SharingPermissions.View), icon: "concierge-bell" }); - // !existingAcls && cm.addItem({ description: "Privacy...", subitems: aclItems, icon: "question" }); - - // cm.addItem({ description: `${getPlaygroundMode() ? "Disable" : "Enable"} playground mode`, event: togglePlaygroundMode, icon: "concierge-bell" }); - - // const recommender_subitems: ContextMenuProps[] = []; - - // recommender_subitems.push({ - // description: "Internal recommendations", - // event: () => this.recommender(), - // icon: "brain" - // }); - - // const ext_recommender_subitems: ContextMenuProps[] = []; - - // ext_recommender_subitems.push({ - // description: "arXiv", - // event: () => this.externalRecommendation("arxiv"), - // icon: "brain" - // }); - // ext_recommender_subitems.push({ - // description: "Bing", - // event: () => this.externalRecommendation("bing"), - // icon: "brain" - // }); - - // recommender_subitems.push({ - // description: "External recommendations", - // subitems: ext_recommender_subitems, - // icon: "brain" - // }); - - - //moreItems.push({ description: "Recommender System", subitems: recommender_subitems, icon: "brain" }); - //moreItems.push({ description: "Publish", event: () => DocUtils.Publish(this.props.Document, this.Document.title || "", this.props.addDocument, this.props.removeDocument), icon: "file" }); - //moreItems.push({ description: "Undo Debug Test", event: () => UndoManager.TraceOpenBatches(), icon: "exclamation" }); - - // runInAction(() => { - // const setWriteMode = (mode: DocServer.WriteMode) => { - // DocServer.AclsMode = mode; - // const mode1 = mode; - // const mode2 = mode === DocServer.WriteMode.Default ? mode : DocServer.WriteMode.Playground; - // DocServer.setFieldWriteMode("x", mode1); - // DocServer.setFieldWriteMode("y", mode1); - // DocServer.setFieldWriteMode("_width", mode1); - // DocServer.setFieldWriteMode("_height", mode1); - - // DocServer.setFieldWriteMode("_panX", mode2); - // DocServer.setFieldWriteMode("_panY", mode2); - // DocServer.setFieldWriteMode("scale", mode2); - // DocServer.setFieldWriteMode("_viewType", mode2); - // }; - // const aclsMenu: ContextMenuProps[] = []; - // aclsMenu.push({ description: "Default (write/read all)", event: () => setWriteMode(DocServer.WriteMode.Default), icon: DocServer.AclsMode === DocServer.WriteMode.Default ? "check" : "exclamation" }); - // aclsMenu.push({ description: "Playground (write own/no read)", event: () => setWriteMode(DocServer.WriteMode.Playground), icon: DocServer.AclsMode === DocServer.WriteMode.Playground ? "check" : "exclamation" }); - // aclsMenu.push({ description: "Live Playground (write own/read others)", event: () => setWriteMode(DocServer.WriteMode.LivePlayground), icon: DocServer.AclsMode === DocServer.WriteMode.LivePlayground ? "check" : "exclamation" }); - // aclsMenu.push({ description: "Live Readonly (no write/read others)", event: () => setWriteMode(DocServer.WriteMode.LiveReadonly), icon: DocServer.AclsMode === DocServer.WriteMode.LiveReadonly ? "check" : "exclamation" }); - // cm.addItem({ description: "Collaboration ...", subitems: aclsMenu, icon: "share" }); - // }); runInAction(() => { if (!this.topMost && !(e instanceof Touch)) { - // DocumentViews should stop propagation of this event - e.stopPropagation(); + e.stopPropagation(); // DocumentViews should stop propagation of this event } cm.displayMenu(e.pageX - 15, e.pageY - 15); !SelectionManager.IsSelected(this, true) && SelectionManager.SelectDoc(this, false); }); - const path = this.props.LibraryPath.reduce((p: string, d: Doc) => p + "/" + (Doc.AreProtosEqual(d, (Doc.UserDoc()["tabs-button-library"] as Doc).sourcePanel as Doc) ? "" : d.title), ""); - const item = ({ - description: `path: ${path}`, event: () => { - if (this.props.LibraryPath !== emptyPath) { - this.props.LibraryPath.map(lp => Doc.GetProto(lp).treeViewOpen = lp.treeViewOpen = true); - Doc.linkFollowHighlight(this.props.Document); - } else { - Doc.AddDocToList(Doc.GetProto(Doc.UserDoc().myCatalog as Doc), "data", this.props.Document[DataSym]); - } - }, icon: "check" - }); - //cm.addItem(item); - } - - recommender = async () => { - if (!ClientRecommender.Instance) new ClientRecommender({ title: "Client Recommender" }); - const documents: Doc[] = []; - const allDocs = await SearchUtil.GetAllDocs(); - // clears internal representation of documents as vectors - ClientRecommender.Instance.reset_docs(); - //ClientRecommender.Instance.arxivrequest("electrons"); - await Promise.all(allDocs.map((doc: Doc) => { - let isMainDoc: boolean = false; - const dataDoc = Doc.GetProto(doc); - if (doc.type === DocumentType.RTF) { - if (dataDoc === Doc.GetProto(this.props.Document)) { - isMainDoc = true; - } - if (!documents.includes(dataDoc)) { - documents.push(dataDoc); - const extdoc = doc.data_ext as Doc; - return ClientRecommender.Instance.extractText(doc, extdoc ? extdoc : doc, true, "", isMainDoc); - } - } - if (doc.type === DocumentType.IMG) { - if (dataDoc === Doc.GetProto(this.props.Document)) { - isMainDoc = true; - } - if (!documents.includes(dataDoc)) { - documents.push(dataDoc); - const extdoc = doc.data_ext as Doc; - return ClientRecommender.Instance.extractText(doc, extdoc ? extdoc : doc, true, "", isMainDoc, true); - } - } - })); - const doclist = ClientRecommender.Instance.computeSimilarities("cosine"); - const recDocs: { preview: Doc, score: number }[] = []; - // tslint:disable-next-line: prefer-for-of - for (let i = 0; i < doclist.length; i++) { - recDocs.push({ preview: doclist[i].actualDoc, score: doclist[i].score }); - } - - const data = recDocs.map(unit => { - unit.preview.score = unit.score; - return unit.preview; - }); - - console.log(recDocs.map(doc => doc.score)); - - const title = `Showing ${data.length} recommendations for "${StrCast(this.props.Document.title)}"`; - const recommendations = Docs.Create.RecommendationsDocument(data, { title }); - recommendations.documentIconHeight = 150; - recommendations.sourceDoc = this.props.Document; - recommendations.sourceDocContext = this.props.ContainingCollectionView!.props.Document; - this.props.addDocTab(recommendations, "onRight"); - - // RecommendationsBox.Instance.displayRecommendations(e.pageX + 100, e.pageY); - } - - @action - externalRecommendation = async (api: string) => { - if (!ClientRecommender.Instance) new ClientRecommender({ title: "Client Recommender" }); - ClientRecommender.Instance.reset_docs(); - const doc = Doc.GetDataDoc(this.props.Document); - const extdoc = doc.data_ext as Doc; - const recs_and_kps = await ClientRecommender.Instance.extractText(doc, extdoc ? extdoc : doc, false, api); - let recs: any; - let kps: any; - if (recs_and_kps) { - recs = recs_and_kps.recs; - kps = recs_and_kps.keyterms; - } - else { - console.log("recommender system failed :("); - return; - } - console.log("ibm keyterms: ", kps.toString()); - const headers = [new SchemaHeaderField("title"), new SchemaHeaderField("href")]; - const bodies: Doc[] = []; - const titles = recs.title_vals; - const urls = recs.url_vals; - for (let i = 0; i < 5; i++) { - const body = Docs.Create.FreeformDocument([], { title: titles[i] }); - body.href = urls[i]; - bodies.push(body); - } - this.props.addDocTab(Docs.Create.SchemaDocument(headers, bodies, { title: `Showing External Recommendations for "${StrCast(doc.title)}"` }), "onRight"); - this._showKPQuery = true; - this._queries = kps.toString(); } // does Document set a layout prop @@ -1088,7 +826,7 @@ export class DocumentView extends DocComponent(Docu } // used to decide whether a link anchor view should be created or not. - // if it's a tempoarl link (currently just for Audio), then the audioBox will display the anchor and we don't want to display it here. + // if it's a temporal link (currently just for Audio), then the audioBox will display the anchor and we don't want to display it here. // would be good to generalize this some way. isNonTemporalLink = (linkDoc: Doc) => { const anchor = Cast(Doc.AreProtosEqual(this.props.Document, Cast(linkDoc.anchor1, Doc) as Doc) ? linkDoc.anchor1 : linkDoc.anchor2, Doc) as Doc; @@ -1096,7 +834,6 @@ export class DocumentView extends DocComponent(Docu return anchor.type === DocumentType.AUDIO && NumCast(ept) ? false : true; } - @observable _link: Opt; // see DocumentButtonBar for explanation of how this works makeLink = () => this._link; // pass the link placeholde to child views so they can react to make a specialized anchor. This is essentially a function call to the descendants since the value of the _link variable will immediately get set back to undefined. @@ -1186,7 +923,7 @@ export class DocumentView extends DocComponent(Docu DocUtils.makeCustomViewClicked(this.props.Document, Docs.Create.StackingDocument, layout, undefined); } } - @observable _animateScalingTo = 0; + switchViews = action((custom: boolean, view: string) => { this._animateScalingTo = 0.1; // shrink doc setTimeout(action(() => { @@ -1200,7 +937,7 @@ export class DocumentView extends DocComponent(Docu return (this.Document.isBackground !== undefined || this.isSelected(false)) && ((this.Document.type === DocumentType.COL && this.Document._viewType !== CollectionViewType.Pile) || this.Document.type === DocumentType.IMG) && this.props.renderDepth > 0 && !this.props.treeViewDoc ? -
this.toggleBackground(true)}> +
: (null); @@ -1224,7 +961,8 @@ export class DocumentView extends DocComponent(Docu const highlightStyles = ["solid", "dashed", "solid", "solid", "solid", "solid", "solid"]; let highlighting = fullDegree && this.layoutDoc.type !== DocumentType.FONTICON && this.layoutDoc._viewType !== CollectionViewType.Linear && this.props.Document.type !== DocumentType.INK; highlighting = highlighting && this.props.focus !== emptyFunction; // bcz: hack to turn off highlighting onsidebar panel documents. need to flag a document as not highlightable in a more direct way - return
(Docu this.innards} {this.renderLock()}
; - { this._showKPQuery ? : undefined; } } } diff --git a/src/client/views/nodes/ImageBox.tsx b/src/client/views/nodes/ImageBox.tsx index 5f689624c..d668d332b 100644 --- a/src/client/views/nodes/ImageBox.tsx +++ b/src/client/views/nodes/ImageBox.tsx @@ -66,7 +66,7 @@ const uploadIcons = { @observer export class ImageBox extends ViewBoxAnnotatableComponent(ImageDocument) { - protected multiTouchDisposer?: import("../../util/InteractionUtils").InteractionUtils.MultiTouchEventDisposer | undefined; + protected _multiTouchDisposer?: import("../../util/InteractionUtils").InteractionUtils.MultiTouchEventDisposer | undefined; public static LayoutString(fieldKey: string) { return FieldView.LayoutString(ImageBox, fieldKey); } private _imgRef: React.RefObject = React.createRef(); private _dropDisposer?: DragManager.DragDropDisposer; diff --git a/src/client/views/nodes/ScriptingBox.tsx b/src/client/views/nodes/ScriptingBox.tsx index bc43cd473..1a5edc1d9 100644 --- a/src/client/views/nodes/ScriptingBox.tsx +++ b/src/client/views/nodes/ScriptingBox.tsx @@ -32,7 +32,7 @@ const ScriptingDocument = makeInterface(ScriptingSchema, documentSchema); export class ScriptingBox extends ViewBoxAnnotatableComponent(ScriptingDocument) { private dropDisposer?: DragManager.DragDropDisposer; - protected multiTouchDisposer?: InteractionUtils.MultiTouchEventDisposer | undefined; + protected _multiTouchDisposer?: InteractionUtils.MultiTouchEventDisposer | undefined; public static LayoutString(fieldStr: string) { return FieldView.LayoutString(ScriptingBox, fieldStr); } private _overlayDisposer?: () => void; private _caretPos = 0; diff --git a/src/fields/Doc.ts b/src/fields/Doc.ts index 87acb2ea7..267defa4b 100644 --- a/src/fields/Doc.ts +++ b/src/fields/Doc.ts @@ -587,6 +587,11 @@ export namespace Doc { } export async function Zip(doc: Doc) { + // const a = document.createElement("a"); + // const url = Utils.prepend(`/downloadId/${this.props.Document[Id]}`); + // a.href = url; + // a.download = `DocExport-${this.props.Document[Id]}.zip`; + // a.click(); const { clone, map } = await Doc.MakeClone(doc, true); function replacer(key: any, value: any) { if (["cloneOf", "context", "cursors"].includes(key)) return undefined; -- cgit v1.2.3-70-g09d2 From 1064d32921a9d4a5b61c3337aee37968a5bf124b Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Wed, 29 Jul 2020 16:30:00 -0400 Subject: stackinviews and tree views --- src/client/documents/Documents.ts | 8 ++++---- src/client/views/collections/CollectionStackingView.tsx | 2 +- 2 files changed, 5 insertions(+), 5 deletions(-) (limited to 'src/client/documents') diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts index 2cd781a53..ad19ea7b2 100644 --- a/src/client/documents/Documents.ts +++ b/src/client/documents/Documents.ts @@ -722,7 +722,7 @@ export namespace Docs { } export function FreeformDocument(documents: Array, options: DocumentOptions, id?: string) { - return InstanceFromProto(Prototypes.get(DocumentType.COL), new List(documents), { _chromeStatus: "collapsed", ...options, _viewType: CollectionViewType.Freeform }, id); + return InstanceFromProto(Prototypes.get(DocumentType.COL), new List(documents), { _chromeStatus: "collapsed", dontRegisterChildViews: true, ...options, _viewType: CollectionViewType.Freeform }, id); } export function PileDocument(documents: Array, options: DocumentOptions, id?: string) { @@ -750,11 +750,11 @@ export namespace Docs { } export function TreeDocument(documents: Array, options: DocumentOptions, id?: string) { - return InstanceFromProto(Prototypes.get(DocumentType.COL), new List(documents), { _chromeStatus: "collapsed", ...options, _viewType: CollectionViewType.Tree }, id); + return InstanceFromProto(Prototypes.get(DocumentType.COL), new List(documents), { _chromeStatus: "collapsed", dontRegisterChildViews: true, ...options, _viewType: CollectionViewType.Tree }, id); } export function StackingDocument(documents: Array, options: DocumentOptions, id?: string) { - return InstanceFromProto(Prototypes.get(DocumentType.COL), new List(documents), { _chromeStatus: "collapsed", ...options, _viewType: CollectionViewType.Stacking }, id); + return InstanceFromProto(Prototypes.get(DocumentType.COL), new List(documents), { _chromeStatus: "collapsed", dontRegisterChildViews: true, ...options, _viewType: CollectionViewType.Stacking }, id); } export function MulticolumnDocument(documents: Array, options: DocumentOptions) { @@ -766,7 +766,7 @@ export namespace Docs { export function MasonryDocument(documents: Array, options: DocumentOptions) { - return InstanceFromProto(Prototypes.get(DocumentType.COL), new List(documents), { _chromeStatus: "collapsed", ...options, _viewType: CollectionViewType.Masonry }); + return InstanceFromProto(Prototypes.get(DocumentType.COL), new List(documents), { _chromeStatus: "collapsed", dontRegisterChildViews: true, ...options, _viewType: CollectionViewType.Masonry }); } export function LabelDocument(options?: DocumentOptions) { diff --git a/src/client/views/collections/CollectionStackingView.tsx b/src/client/views/collections/CollectionStackingView.tsx index dd4c34885..0332b4bf2 100644 --- a/src/client/views/collections/CollectionStackingView.tsx +++ b/src/client/views/collections/CollectionStackingView.tsx @@ -208,7 +208,7 @@ export class CollectionStackingView extends CollectionSubView(StackingDocument) NativeHeight={returnZero} NativeWidth={returnZero} fitToBox={false} - dontRegisterView={this.props.dontRegisterView} + dontRegisterView={BoolCast(this.layoutDoc.dontRegisterChildViews, this.props.dontRegisterView)} rootSelected={this.rootSelected} dropAction={StrCast(this.layoutDoc.childDropAction) as dropActionType} onClick={this.onChildClickHandler} -- cgit v1.2.3-70-g09d2 From c40feda5e8799831e77639b24db2789d5ff8cdc3 Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Wed, 29 Jul 2020 22:09:07 -0400 Subject: fixed Pileup interactions - no double tap. shift to dra out items. --- src/client/documents/Documents.ts | 2 +- .../views/collections/CollectionPileView.tsx | 28 ++++++++++------------ src/client/views/collections/CollectionSubView.tsx | 8 +++++-- src/client/views/collections/CollectionView.tsx | 3 +-- .../collectionFreeForm/FormatShapePane.tsx | 12 +++++----- 5 files changed, 26 insertions(+), 27 deletions(-) (limited to 'src/client/documents') diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts index ad19ea7b2..7e094089f 100644 --- a/src/client/documents/Documents.ts +++ b/src/client/documents/Documents.ts @@ -726,7 +726,7 @@ export namespace Docs { } export function PileDocument(documents: Array, options: DocumentOptions, id?: string) { - return InstanceFromProto(Prototypes.get(DocumentType.COL), new List(documents), { _chromeStatus: "collapsed", backgroundColor: "black", ...options, _viewType: CollectionViewType.Pile }, id); + return InstanceFromProto(Prototypes.get(DocumentType.COL), new List(documents), { _chromeStatus: "collapsed", backgroundColor: "black", hideFilterView: true, forceActive: true, ...options, _viewType: CollectionViewType.Pile }, id); } export function LinearDocument(documents: Array, options: DocumentOptions, id?: string) { diff --git a/src/client/views/collections/CollectionPileView.tsx b/src/client/views/collections/CollectionPileView.tsx index 22a3877ab..2e4055256 100644 --- a/src/client/views/collections/CollectionPileView.tsx +++ b/src/client/views/collections/CollectionPileView.tsx @@ -39,7 +39,15 @@ export class CollectionPileView extends CollectionSubView(doc => doc) { @computed get contents() { return
- + { + (doc instanceof Doc ? [doc] : doc).map((d) => DocUtils.iconify(d)); + return this.props.addDocument(doc); + }} + moveDocument={(doc: Doc | Doc[], targetCollection: Doc | undefined, addDoc: (doc: Doc | Doc[]) => boolean) => { + (doc instanceof Doc ? [doc] : doc).map((d) => Doc.deiconifyView(d)); + return this.props.moveDocument(doc, targetCollection, addDoc); + }} />
; } toggleStarburst = action(() => { @@ -72,24 +80,13 @@ export class CollectionPileView extends CollectionSubView(doc => doc) { } }); - @undoBatch - @action - onInternalDrop = (e: Event, de: DragManager.DropEvent) => { - if (super.onInternalDrop(e, de)) { - if (de.complete.docDragData) { - DocUtils.pileup(this.childDocs); - } - } - return true; - } - _undoBatch: UndoManager.Batch | undefined; pointerDown = (e: React.PointerEvent) => { let dist = 0; SnappingManager.SetIsDragging(true); // this._lastTap should be set to 0, and this._doubleTap should be set to false in the class header setupMoveUpEvents(this, e, (e: PointerEvent, down: number[], delta: number[]) => { - if (this.layoutEngine() === "pass" && this.childDocs.length && this.props.isSelected(true)) { + if (this.layoutEngine() === "pass" && this.childDocs.length && e.shiftKey) { dist += Math.sqrt(delta[0] * delta[0] + delta[1] * delta[1]); if (dist > 100) { if (!this._undoBatch) { @@ -110,11 +107,11 @@ export class CollectionPileView extends CollectionSubView(doc => doc) { if (!this.childDocs.length) { this.props.ContainingCollectionView?.removeDocument(this.props.Document); } - }, emptyFunction, false, this.layoutEngine() === "pass" && this.props.isSelected(true)); // this sets _doubleTap + }, emptyFunction, e.shiftKey && this.layoutEngine() === "pass", this.layoutEngine() === "pass" && e.shiftKey); // this sets _doubleTap } onClick = (e: React.MouseEvent) => { - if (e.button === 0 && this._doubleTap) { + if (e.button === 0) {//} && this._doubleTap) { SelectionManager.DeselectAll(); this.toggleStarburst(); e.stopPropagation(); @@ -124,7 +121,6 @@ export class CollectionPileView extends CollectionSubView(doc => doc) { render() { return
{this.contents}
; diff --git a/src/client/views/collections/CollectionSubView.tsx b/src/client/views/collections/CollectionSubView.tsx index 99acfdcc2..a89fcc703 100644 --- a/src/client/views/collections/CollectionSubView.tsx +++ b/src/client/views/collections/CollectionSubView.tsx @@ -195,7 +195,11 @@ export function CollectionSubView(schemaCtor: (doc: Doc) => T, moreProps?: const movedDocs = docDragData.droppedDocuments.filter((d, i) => docDragData.draggedDocuments[i] === d); const addedDocs = docDragData.droppedDocuments.filter((d, i) => docDragData.draggedDocuments[i] !== d); const res = addedDocs.length ? this.addDocument(addedDocs) : true; - added = movedDocs.length ? docDragData.moveDocument(movedDocs, this.props.Document, Doc.AreProtosEqual(Cast(movedDocs[0].annotationOn, Doc, null), this.props.Document) || de.embedKey || !this.props.isAnnotationOverlay ? this.addDocument : returnFalse) : res; + if (movedDocs.length) { + const canAdd = this.props.Document._viewType === CollectionViewType.Pile || de.embedKey || !this.props.isAnnotationOverlay || + Doc.AreProtosEqual(Cast(movedDocs[0].annotationOn, Doc, null), this.props.Document); + added = docDragData.moveDocument(movedDocs, this.props.Document, canAdd ? this.addDocument : returnFalse); + } else added = res; } else { added = this.addDocument(docDragData.droppedDocuments); } @@ -430,7 +434,7 @@ import { Docs, DocumentOptions, DocUtils } from "../../documents/Documents"; import { CurrentUserUtils } from "../../util/CurrentUserUtils"; import { DocumentType } from "../../documents/DocumentTypes"; import { FormattedTextBox, GoogleRef } from "../nodes/formattedText/FormattedTextBox"; -import { CollectionView } from "./CollectionView"; +import { CollectionView, CollectionViewType } from "./CollectionView"; import { SelectionManager } from "../../util/SelectionManager"; import { OverlayView } from "../OverlayView"; import { setTimeout } from "timers"; diff --git a/src/client/views/collections/CollectionView.tsx b/src/client/views/collections/CollectionView.tsx index 5a3396b68..42d320308 100644 --- a/src/client/views/collections/CollectionView.tsx +++ b/src/client/views/collections/CollectionView.tsx @@ -45,7 +45,6 @@ import { SubCollectionViewProps } from './CollectionSubView'; import { CollectionTimeView } from './CollectionTimeView'; import { CollectionTreeView } from "./CollectionTreeView"; import './CollectionView.scss'; -import CollectionMenu from './CollectionMenu'; import { ContextMenuProps } from '../ContextMenuItem'; const higflyout = require("@hig/flyout"); export const { anchorPoints } = higflyout; @@ -586,7 +585,7 @@ export class CollectionView extends Touchable } diff --git a/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx b/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx index cd5ca7fd4..ddc282e57 100644 --- a/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx +++ b/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx @@ -338,7 +338,7 @@ export default class FormatShapePane extends AntimodeMenu { colorButton(value: string, setter: () => {}) { return <> - @@ -347,14 +347,14 @@ export default class FormatShapePane extends AntimodeMenu { controlPointsButton() { return <> - - -

@@ -363,7 +363,7 @@ export default class FormatShapePane extends AntimodeMenu { lockRatioButton() { return <> -