From 48dbde117728e4b36bae11f0f16a796059ecf7ee Mon Sep 17 00:00:00 2001 From: dg314 Date: Sat, 17 Jul 2021 15:13:39 -0400 Subject: initial search panel --- src/client/util/CurrentUserUtils.ts | 27 ++++++++++++++++++++++++--- 1 file changed, 24 insertions(+), 3 deletions(-) (limited to 'src/client/util/CurrentUserUtils.ts') diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts index 12733e815..596ccd9a6 100644 --- a/src/client/util/CurrentUserUtils.ts +++ b/src/client/util/CurrentUserUtils.ts @@ -35,6 +35,8 @@ import { UndoManager } from "./UndoManager"; import { SnappingManager } from "./SnappingManager"; import { InkTool } from "../../fields/InkField"; import { computedFn } from "mobx-utils"; +import { CollectionSchemaBooleanCell } from "../views/collections/CollectionSchemaCells"; +import { Console } from "console"; export let resolvedPorts: { server: number, socket: number }; @@ -53,6 +55,7 @@ export class CurrentUserUtils { @observable public static GuestDashboard: Doc | undefined; @observable public static GuestMobile: Doc | undefined; @observable public static propertiesWidth: number = 0; + @observable public static searchPanelWidth: number = 0; // sets up the default User Templates - slideView, headerView static setupUserTemplateButtons(doc: Doc) { @@ -516,6 +519,7 @@ export class CurrentUserUtils { static async menuBtnDescriptions(doc: Doc) { return [ { title: "Dashboards", target: Cast(doc.myDashboards, Doc, null), icon: "desktop", click: 'selectMainMenu(self)' }, + { title: "Search", target: Cast(doc.mySearchPanel, Doc, null), icon: "search", click: 'selectMainMenu(self)' }, { title: "My Files", target: Cast(doc.myFilesystem, Doc, null), icon: "file", click: 'selectMainMenu(self)' }, { title: "Tools", target: Cast(doc.myTools, Doc, null), icon: "wrench", click: 'selectMainMenu(self)' }, { title: "Import", target: Cast(doc.myImportPanel, Doc, null), icon: "upload", click: 'selectMainMenu(self)' }, @@ -529,14 +533,15 @@ export class CurrentUserUtils { ]; } - static setupSearchPanel(doc: Doc) { + /*static setupSearchPanel(doc: Doc) { if (doc.mySearchPanelDoc === undefined) { doc.mySearchPanelDoc = new PrefetchProxy(Docs.Create.SearchDocument({ _width: 500, _height: 300, backgroundColor: "dimGray", ignoreClick: true, _searchDoc: true, childDropAction: "alias", _lockedPosition: true, _viewType: CollectionViewType.Schema, title: "sidebar search stack", system: true })) as any as Doc; } - } + }*/ + static async setupMenuPanel(doc: Doc, sharingDocumentId: string, linkDatabaseId: string) { if (doc.menuStack === undefined) { await this.setupSharingSidebar(doc, sharingDocumentId, linkDatabaseId); // sets up the right sidebar collection for mobile upload documents and sharing @@ -807,6 +812,7 @@ export class CurrentUserUtils { (doc.myRecentlyClosedDocs as any as Doc).contextMenuLabels = new List(["Clear All"]); } } + static setupFilterDocs(doc: Doc) { // setup Filter item if (doc.currentFilter === undefined) { @@ -939,6 +945,21 @@ export class CurrentUserUtils { } } + // Search sidebar is where searches within the document are performed + static setupSearchSidebar(doc: Doc) { + if (doc.mySearchPanelDoc === undefined) { + doc.mySearchPanelDoc = new PrefetchProxy(Docs.Create.SearchDocument({ + _width: 500, _height: 300, backgroundColor: "dimGray", ignoreClick: true, _searchDoc: true, + childDropAction: "alias", _lockedPosition: true, _viewType: CollectionViewType.Schema, title: "sidebar search stack", system: true + })) as any as Doc; + } + if (doc.mySearchPanel === undefined) { + const searchPanelDoc = Cast(doc.mySearchPanelDoc, Doc, null); + //const newUpload = CurrentUserUtils.ficon({ onClick: ScriptField.MakeScript("importDocument()"), toolTip: "Import External document", _stayInCollection: true, _hideContextMenu: true, title: "Import", icon: "upload", system: true }); + doc.mySearchPanel = new PrefetchProxy(Docs.Create.StackingDocument([searchPanelDoc], { title: "Search", _yMargin: 20, ignoreClick: true, _chromeHidden: true, _stayInCollection: true, _hideContextMenu: true, _lockedPosition: true, system: true })); + } + } + static setupClickEditorTemplates(doc: Doc) { if (doc["clickFuncs-child"] === undefined) { // to use this function, select it from the context menu of a collection. then edit the onChildClick script. Add two Doc variables: 'target' and 'thisContainer', then assign 'target' to some target collection. After that, clicking on any document in the initial collection will open it in the target @@ -1023,8 +1044,8 @@ export class CurrentUserUtils { this.setupDefaultIconTemplates(doc); // creates a set of icon templates triggered by the document deoration icon this.setupDocTemplates(doc); // sets up the template menu of templates this.setupImportSidebar(doc); + this.setupSearchSidebar(doc); // sets up the search sidebar this.setupActiveMobileMenu(doc); // sets up the current mobile menu for Dash Mobile - this.setupSearchPanel(doc); this.setupOverlays(doc); // documents in overlay layer this.setupDockedButtons(doc); // the bottom bar of font icons await this.setupSidebarButtons(doc); // the pop-out left sidebar of tools/panels -- cgit v1.2.3-70-g09d2 From fc1559fd74bde212f418b27806b68a76748153ad Mon Sep 17 00:00:00 2001 From: dg314 Date: Thu, 29 Jul 2021 15:12:03 -0400 Subject: search panel updates --- src/client/util/CurrentUserUtils.ts | 11 +- src/client/views/MainView.tsx | 6 +- src/client/views/search/SearchBox.scss | 173 ++++-------- src/client/views/search/SearchBox.tsx | 491 +++++++++++++++------------------ 4 files changed, 291 insertions(+), 390 deletions(-) (limited to 'src/client/util/CurrentUserUtils.ts') diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts index 596ccd9a6..31384da3b 100644 --- a/src/client/util/CurrentUserUtils.ts +++ b/src/client/util/CurrentUserUtils.ts @@ -947,17 +947,12 @@ export class CurrentUserUtils { // Search sidebar is where searches within the document are performed static setupSearchSidebar(doc: Doc) { - if (doc.mySearchPanelDoc === undefined) { - doc.mySearchPanelDoc = new PrefetchProxy(Docs.Create.SearchDocument({ - _width: 500, _height: 300, backgroundColor: "dimGray", ignoreClick: true, _searchDoc: true, + if (doc.mySearchPanel === undefined) { + doc.mySearchPanel = new PrefetchProxy(Docs.Create.SearchDocument({ + backgroundColor: "dimGray", ignoreClick: true, _searchDoc: true, childDropAction: "alias", _lockedPosition: true, _viewType: CollectionViewType.Schema, title: "sidebar search stack", system: true })) as any as Doc; } - if (doc.mySearchPanel === undefined) { - const searchPanelDoc = Cast(doc.mySearchPanelDoc, Doc, null); - //const newUpload = CurrentUserUtils.ficon({ onClick: ScriptField.MakeScript("importDocument()"), toolTip: "Import External document", _stayInCollection: true, _hideContextMenu: true, title: "Import", icon: "upload", system: true }); - doc.mySearchPanel = new PrefetchProxy(Docs.Create.StackingDocument([searchPanelDoc], { title: "Search", _yMargin: 20, ignoreClick: true, _chromeHidden: true, _stayInCollection: true, _hideContextMenu: true, _lockedPosition: true, system: true })); - } } static setupClickEditorTemplates(doc: Doc) { diff --git a/src/client/views/MainView.tsx b/src/client/views/MainView.tsx index bc9c6f4d2..0d957518b 100644 --- a/src/client/views/MainView.tsx +++ b/src/client/views/MainView.tsx @@ -178,12 +178,12 @@ export class MainView extends React.Component { const targets = document.elementsFromPoint(e.x, e.y); if (targets.length) { const targClass = targets[0].className.toString(); - if (SearchBox.Instance._searchbarOpen || SearchBox.Instance.open) { + /*if (SearchBox.Instance._resultsOpen) { const check = targets.some((thing) => (thing.className === "collectionSchemaView-searchContainer" || (thing as any)?.dataset.icon === "filter" || thing.className === "collectionSchema-header-menuOptions")); !check && SearchBox.Instance.resetSearch(true); - } + }*/ !targClass.includes("contextMenu") && ContextMenu.Instance.closeMenu(); !["timeline-menu-desc", "timeline-menu-item", "timeline-menu-input"].includes(targClass) && TimelineMenu.Instance.closeMenu(); } @@ -192,7 +192,7 @@ export class MainView extends React.Component { initEventListeners = () => { window.addEventListener("drop", e => e.preventDefault(), false); // prevent default behavior of navigating to a new web page window.addEventListener("dragover", e => e.preventDefault(), false); - document.addEventListener("pointermove", action(e => SearchBox.Instance._undoBackground = UndoManager.batchCounter ? "#000000a8" : undefined)); + //document.addEventListener("pointermove", action(e => SearchBox.Instance._undoBackground = UndoManager.batchCounter ? "#000000a8" : undefined)); document.addEventListener("pointerdown", this.globalPointerDown); document.addEventListener("click", (e: MouseEvent) => { if (!e.cancelBubble) { diff --git a/src/client/views/search/SearchBox.scss b/src/client/views/search/SearchBox.scss index 4f5b7e41a..f8e994da7 100644 --- a/src/client/views/search/SearchBox.scss +++ b/src/client/views/search/SearchBox.scss @@ -2,141 +2,84 @@ @import "./NaviconButton.scss"; .searchBox-container { - display: flex; - flex-direction: column; width: 100%; height: 100%; - position: relative; font-size: 10px; line-height: 1; - overflow-y: auto; - overflow-x: visible; - background: lightgrey; - overflow: visible; + background: none; z-index: 1000; + padding: 0px; + cursor: default; .searchBox-bar { - height: $searchpanel-height; + width: 100%; + height: 35px; display: flex; justify-content: center; align-items: center; - background-color: black; + background-color: none; + padding: 5px; - .searchBox-lozenges { - position: absolute; - left: 15; - display: flex; - - .searchBox-lozenge-user, - .searchBox-lozenge-dashboard, - .searchBox-lozenge { - height: 18px; - padding: 4px; - margin-right: 5px; - display: flex; - align-items: center; - border: grey 1px solid; - .searchBox-logoff, - .searchBox-dashboards { - border-radius: 3px; - background: olivedrab; - color: white; - display: none; - margin-left: 5px; - padding: 1px 2px 1px 2px; - cursor: pointer; - } - .searchBox-logoff { - background: red; - } - - .searchBox-dashSelect{ - border: none; - background-color: transparent; + .searchBox-type { + display: block; + width: 50px; + outline: none; + padding: 1px 5px 1px 5px; + color: black; + height: 25px; + border: 1px solid black; + } - &:hover { - cursor: pointer; - } - } - } - .searchBox-lozenge-user:hover { - .searchBox-logoff { - display:inline-block; - } - } - .searchBox-lozenge-dashboard:hover { - .searchBox-dashboards { - display:inline-block; - } - } + .searchBox-input { + display: block; + width: calc(100% - 50px); + outline: none; + padding: 1px 5px 1px 5px; + color: black; + height: 25px; + border: 1px solid black; } - .searchBox-query { - position: relative; + } + + .searchBox-results-container { + display: flex; + flex-direction: column; + width: 100%; + height: 100%; + justify-content: "center"; + + .searchBox-results-count { display: flex; - width: 450; + color: gray; + margin-left: 5px; } - .searchBox-barChild { + + .searchBox-results-scroll-view { + margin-top: 10px; + display: inline-block; + width: 100%; + height: calc(100% - 55px); + overflow-y: scroll; - &.searchBox-collection { - flex: 0 1 auto; - margin-left: 2px; - margin-right: 2px - } + .searchBox-results-scroll-view-result { + display: inline-block; + vertical-align: middle; + width: 100%; + height: 40px; + cursor: pointer; + font-size: 15px; + padding: 10px; - &.searchBox-input { - margin:5px; - border-radius:20px; - border:black; - display: block; - width: 130px; - -webkit-transition: width 0.4s; - transition: width 0.4s; - align-self: stretch; - outline:none; - &:focus { - width: 500px; - outline:none; + &.searchBox-results-scroll-view-result-selected { + background: gray; } - } - &.searchBox-filter { - align-self: stretch; - button{ - transform:none; - &:hover { - transform: none; - } - } - } - &.searchBox-submit { - margin-left: 2px; - margin-right: 2px - } - - &.searchBox-close { - color: $light-color; - max-height: $searchpanel-height; + .titletitle { + display: relative; + float: left; + left: 50px; + } } } - } -} - -.searchBox-results { - display: flex; - flex-direction: column; - top: 300px; - display: flex; - flex-direction: column; - height: 100%; - overflow: visible; - - .no-result { - width: 500px; - background: $light-color-secondary; - padding: 10px; - height: 50px; - text-transform: uppercase; - text-align: left; - font-weight: bold; } } \ No newline at end of file diff --git a/src/client/views/search/SearchBox.tsx b/src/client/views/search/SearchBox.tsx index cc4590969..374a754bf 100644 --- a/src/client/views/search/SearchBox.tsx +++ b/src/client/views/search/SearchBox.tsx @@ -3,7 +3,7 @@ import { Tooltip } from '@material-ui/core'; import { action, computed, IReactionDisposer, observable, reaction, runInAction } from 'mobx'; import { observer } from 'mobx-react'; import * as React from 'react'; -import { Doc, DocListCast, Field, Opt, DocListCastAsync, DataSym, HeightSym } from '../../../fields/Doc'; +import { Doc, DocListCast, Field, Opt, DocListCastAsync, DataSym, HeightSym, FieldsSym } from '../../../fields/Doc'; import { documentSchema } from "../../../fields/documentSchemas"; import { Copy, Id, ToString } from '../../../fields/FieldSymbols'; import { List } from '../../../fields/List'; @@ -26,6 +26,9 @@ import "./SearchBox.scss"; import { undoBatch } from "../../util/UndoManager"; import { DocServer } from "../../DocServer"; import { MainView } from "../MainView"; +import { DocumentManager } from "../../util/DocumentManager"; +import { CollectionSchemaBooleanCell } from "../collections/CollectionSchemaCells"; +import { transpileModule } from "typescript"; export const searchSchema = createSchema({ Document: Doc }); @@ -38,33 +41,18 @@ export class SearchBox extends ViewBoxBaseComponent; private _resultsSet = new Map(); private _inputRef = React.createRef(); - private _maxSearchIndex: number = 0; - private _curRequest?: Promise = undefined; private _disposers: { [name: string]: IReactionDisposer } = {}; private _blockedTypes = [DocumentType.PRESELEMENT, DocumentType.KVP, DocumentType.FILTER, DocumentType.SEARCH, DocumentType.SEARCHITEM, DocumentType.FONTICON, DocumentType.BUTTON, DocumentType.SCRIPTING]; - private docsforfilter: Doc[] | undefined = []; - private realTotalResults: number = 0; - private newsearchstring = ""; - - @observable _undoBackground: string | undefined = ""; + @observable _searchString = ""; + @observable _docTypeString = "all"; @observable _icons: string[] = this._allIcons; @observable _results: [Doc, string[], string[]][] = []; - @observable _visibleElements: JSX.Element[] = []; - @observable _visibleDocuments: Doc[] = []; + @observable _selectedResult: Doc | undefined = undefined; @observable _deletedDocsStatus: boolean = false; @observable _onlyAliases: boolean = true; - @observable _searchbarOpen = false; - @observable _noResults = ""; - @observable _pageStart = 0; - @observable open = false; - @observable children = 0; @computed get filter() { return this._results?.length && (this.currentSelectedCollection?.props.Document._searchFilterDocs || this.currentSelectedCollection?.props.Document._docFilters); } constructor(props: any) { @@ -76,8 +64,6 @@ export class SearchBox extends ViewBoxBaseComponent this.props.Document._docFilters, - (filters: any) => this.setSearchFilter(this.currentSelectedCollection, !this.filter ? undefined : this.docsforfilter)); }); componentWillUnmount() { @@ -86,32 +72,25 @@ export class SearchBox extends ViewBoxBaseComponent) => { - this.newsearchstring = e.target.value; - if (e.target.value === "") { - console.log("Reset start"); - this.docsforfilter = undefined; - this.setSearchFilter(this.currentSelectedCollection, undefined); - this.resetSearch(false); - - this.open = false; - this._results = []; - this._resultsSet.clear(); - this._visibleElements = []; - this._numTotalResults = -1; - this._endIndex = -1; - this._curRequest = undefined; - this._maxSearchIndex = 0; - } + onInputChange = action((e: React.ChangeEvent) => { + this._searchString = e.target.value; + this.submitSearch(); }); - enter = action((e: React.KeyboardEvent | undefined) => { + onSelectChange = action((e: React.ChangeEvent) => { + this._docTypeString = e.target.value; + this.submitSearch(); + }); + + /*enter = action((e: React.KeyboardEvent | undefined) => { if (!e || e.key === "Enter") { - this.layoutDoc._searchString = this.newsearchstring; - this._pageStart = 0; - this.open = true; this.submitSearch(); } + });*/ + + onResultClick = action((doc: Doc) => { + this.selectElement(doc); + this._selectedResult = doc; }); @action @@ -126,21 +105,6 @@ export class SearchBox extends ViewBoxBaseComponent void) { - let newarray: Doc[] = []; - while (docs.length > 0) { - newarray = []; - await Promise.all(docs.filter(d => d).map(async d => { - const fieldKey = Doc.LayoutFieldKey(d); - const annos = !Field.toString(Doc.LayoutField(d) as Field).includes("CollectionView"); - const data = d[annos ? fieldKey + "-annotations" : fieldKey]; - const docs = await DocListCastAsync(data); - docs && newarray.push(...docs); - func(d); - })); - docs = newarray; - } - } static foreachRecursiveDoc(docs: Doc[], func: (doc: Doc) => void) { let newarray: Doc[] = []; while (docs.length > 0) { @@ -172,15 +136,7 @@ export class SearchBox extends ViewBoxBaseComponent r[0]); - this.setSearchFilter(selectedCollection, this.filter && found.length ? this.docsforfilter : undefined); - this._numTotalResults = found.length; - this.realTotalResults = found.length; } - else { - this._noResults = "No collection selected :("; - } - } static documentKeys(doc: Doc) { @@ -197,246 +153,253 @@ export class SearchBox extends ViewBoxBaseComponent { - this.resetSearch(false); - - //this.props.Document._docFilters = new List(); - this._noResults = ""; + this.resetSearch(); this.dataDoc[this.fieldKey] = new List([]); - this.children = 0; - let query = StrCast(this.layoutDoc._searchString); + let query = StrCast(this._searchString); Doc.SetSearchQuery(query); this._results = []; this._resultsSet.clear(); - this._visibleElements = []; - this._visibleDocuments = []; if (query) { - this._endIndex = 12; - this._maxSearchIndex = 0; - this._numTotalResults = -1; this.searchCollection(query); - runInAction(() => { - this.open = this._searchbarOpen = true; - this.resultsScrolled(); - }); } } - getAllResults = async (query: string) => { - return SearchUtil.Search(query, true, { fq: this.filterQuery, start: 0, rows: 10000000 }); - } + resetSearch = action(() => { + this._results.forEach(result => { + Doc.UnBrushDoc(result[0]); + Doc.ClearSearchMatches(); + }); + }); - private get filterQuery() { - const baseExpr = "NOT system_b:true"; - const authorExpr = undefined; - const includeDeleted = this._deletedDocsStatus ? "" : " NOT deleted_b:true"; - const typeExpr = this._onlyAliases ? "NOT {!join from=id to=proto_i}type_t:*" : `(type_t:* OR {!join from=id to=proto_i}type_t:*) ${this._blockedTypes.map(type => `NOT ({!join from=id to=proto_i}type_t:${type}) AND NOT type_t:${type}`).join(" AND ")}`; - // fq: type_t:collection OR {!join from=id to=proto_i}type_t:collection q:text_t:hello - return [baseExpr, authorExpr, includeDeleted, typeExpr].filter(q => q).join(" AND ").replace(/AND $/, ""); + selectElement = async (doc: Doc) => { + await DocumentManager.Instance.jumpToDocument(doc, true); // documents open in new tab instead of on right } - @computed get primarySort() { - const suffixMap = (type: ColumnType) => { - switch (type) { - case ColumnType.Date: return "_d"; - case ColumnType.String: return "_t"; - case ColumnType.Boolean: return "_b"; - case ColumnType.Number: return "_n"; + render() { + const results = this._results.map(result => { + var className = "searchBox-results-scroll-view-result"; + + if (this._selectedResult == result[0]) { + className += " searchBox-results-scroll-view-result-selected" } - }; - const headers = Cast(this.props.Document._schemaHeaders, listSpec(SchemaHeaderField), []); - return headers.reduce((p: Opt, header: SchemaHeaderField) => p || (header.desc !== undefined && suffixMap(header.type) ? (header.heading + suffixMap(header.type) + (header.desc ? " desc" : " asc")) : undefined), undefined); - } - searchDatabase = async (query: string) => { - this._lockPromise && (await this._lockPromise); - this._lockPromise = new Promise(async res => { - while (this._results.length <= this._endIndex && (this._numTotalResults === -1 || this._maxSearchIndex < this._numTotalResults)) { - this._curRequest = SearchUtil.Search(query, true, { onlyAliases: true, allowAliases: true, /*sort: this.primarySort,*/ fq: this.filterQuery, start: 0, rows: this._numResultsPerPage, hl: "on", "hl.fl": "*", }).then(action(async (res: SearchUtil.DocSearchResult) => { - // happens at the beginning - this.realTotalResults = res.numFound <= 0 ? 0 : res.numFound; - if (res.numFound !== this._numTotalResults && this._numTotalResults === -1) { - this._numTotalResults = res.numFound; - } - const highlighting = res.highlighting || {}; - const highlightList = res.docs.map(doc => highlighting[doc[Id]]); - const lines = new Map(); - res.docs.map((doc, i) => lines.set(doc[Id], res.lines[i])); - const docs = res.docs; - const highlights: typeof res.highlighting = {}; - docs.forEach((doc, index) => highlights[doc[Id]] = highlightList[index]); - const filteredDocs = this.filterDocsByType(docs); - - runInAction(() => filteredDocs.forEach((doc, i) => { - const index = this._resultsSet.get(doc); - const highlight = highlights[doc[Id]]; - const line = lines.get(doc[Id]) || []; - const hlights = highlight ? Object.keys(highlight).map(key => key.substring(0, key.length - 2)).filter(k => k) : []; - // if (this.findCommonElements(hlights)) { - // } - if (index === undefined) { - this._resultsSet.set(doc, this._results.length); - this._results.push([doc, hlights, line]); - } else { - this._results[index][1].push(...hlights); - this._results[index][2].push(...line); - } - })); - - this._curRequest = undefined; - })); - this._maxSearchIndex += this._numResultsPerPage; - - await this._curRequest; + if (this._docTypeString == "all" || this._docTypeString == result[0].type) { + return (
this.onResultClick(result[0])} className={className}>
{result[0].title}
) } - this.resultsScrolled(); + return null; + }) - const selectedCollection = this.currentSelectedCollection;//SelectionManager.SelectedDocuments()[0]; - this.docsforfilter = this._results.map(r => r[0]); - this.setSearchFilter(selectedCollection, this.filter ? this.docsforfilter : undefined); - res(); - }); - return this._lockPromise; + results.filter(result => result) + + return ( +
+
+ + +
+
+
+ {`${results.length}` + " result" + (results.length == 1 ? "" : "s")} +
+
+ {results} +
+
+
+ ); } +} + + + +/* +import { FontAwesomeIcon } from "@fortawesome/react-fontawesome"; +import { Tooltip } from '@material-ui/core'; +import { action, computed, IReactionDisposer, observable, reaction, runInAction } from 'mobx'; +import { observer } from 'mobx-react'; +import * as React from 'react'; +import { Doc, DocListCast, Field, Opt, DocListCastAsync, DataSym, HeightSym, FieldsSym } from '../../../fields/Doc'; +import { documentSchema } from "../../../fields/documentSchemas"; +import { Copy, Id, ToString } from '../../../fields/FieldSymbols'; +import { List } from '../../../fields/List'; +import { createSchema, listSpec, makeInterface } from '../../../fields/Schema'; +import { SchemaHeaderField } from '../../../fields/SchemaHeaderField'; +import { Cast, NumCast, StrCast } from '../../../fields/Types'; +import { emptyFunction, returnFalse, returnZero, setupMoveUpEvents, Utils } from '../../../Utils'; +import { Docs } from '../../documents/Documents'; +import { DocumentType } from "../../documents/DocumentTypes"; +import { CurrentUserUtils } from "../../util/CurrentUserUtils"; +import { SetupDrag } from '../../util/DragManager'; +import { SearchUtil } from '../../util/SearchUtil'; +import { Transform } from '../../util/Transform'; +import { CollectionDockingView } from "../collections/CollectionDockingView"; +import { CollectionSchemaView, ColumnType } from "../collections/CollectionSchemaView"; +import { CollectionViewType } from '../collections/CollectionView'; +import { ViewBoxBaseComponent } from "../DocComponent"; +import { FieldView, FieldViewProps } from '../nodes/FieldView'; +import "./SearchBox.scss"; +import { undoBatch } from "../../util/UndoManager"; +import { DocServer } from "../../DocServer"; +import { MainView } from "../MainView"; +import { SelectionManager } from "../../util/SelectionManager"; +import { CollectionSchemaBooleanCell } from "../collections/CollectionSchemaCells"; +import { transpileModule } from "typescript"; +import { DocumentManager } from "../../util/DocumentManager"; + +export const searchSchema = createSchema({ Document: Doc }); + +type SearchBoxDocument = makeInterface<[typeof documentSchema, typeof searchSchema]>; +const SearchBoxDocument = makeInterface(documentSchema, searchSchema); + +@observer +export class SearchBox extends ViewBoxBaseComponent(SearchBoxDocument) { + public static LayoutString(fieldKey: string) { return FieldView.LayoutString(SearchBox, fieldKey); } + public static Instance: SearchBox; + + @observable _searchString = ""; + @observable _docTypeString = "all"; + @observable _results: [Doc, string[], string[]][] = []; + @observable _selectedResult: Doc | undefined = undefined; + @observable _deletedDocsStatus: boolean = false; + @observable _onlyAliases: boolean = true; - @action.bound - openSearch(e: React.SyntheticEvent) { - e.stopPropagation(); - this._results.forEach(result => Doc.BrushDoc(result[0])); + constructor(props: any) { + super(props); + SearchBox.Instance = this; } - resetSearch = action((close: boolean) => { - this._results.forEach(result => { - Doc.UnBrushDoc(result[0]); - Doc.ClearSearchMatches(); - }); - close && (this.open = this._searchbarOpen = false); + onInputChange = action((e: React.ChangeEvent) => { + this._searchString = e.target.value; + this.submitSearch(); }); - @action.bound - closeResults() { - this._results = []; - this._resultsSet.clear(); - this._visibleElements = []; - this._visibleDocuments = []; - this._numTotalResults = -1; - this._endIndex = -1; - this._curRequest = undefined; - } + onSelectChange = action((e: React.ChangeEvent) => { + this._docTypeString = e.target.value; + this.submitSearch(); + }); - @action - resultsScrolled = (e?: React.UIEvent) => { - this._endIndex = 30; - const headers = new Set(["title", "author", "text", "type", "data", "*lastModified", "context"]); + onResultClick = action((doc: Doc) => { + this.selectElement(doc); + this._selectedResult = doc; + }); - if (this._numTotalResults <= this._maxSearchIndex) { - this._numTotalResults = this._results.length; + static foreachRecursiveDoc(docs: Doc[], func: (doc: Doc) => void) { + const blockedTypes = [DocumentType.PRESELEMENT, DocumentType.KVP, DocumentType.FILTER, DocumentType.SEARCH, DocumentType.SEARCHITEM, DocumentType.FONTICON, DocumentType.BUTTON, DocumentType.SCRIPTING]; + let newarray: Doc[] = []; + while (docs.length > 0) { + newarray = []; + docs.filter(d => d).forEach(d => { + const dtype = StrCast(d.type, "string") as DocumentType; + if (dtype && !blockedTypes.includes(dtype)) { + const fieldKey = Doc.LayoutFieldKey(d); + const annos = !Field.toString(Doc.LayoutField(d) as Field).includes("CollectionView"); + const data = d[annos ? fieldKey + "-annotations" : fieldKey]; + data && newarray.push(...DocListCast(data)); + func(d); + } + }); + docs = newarray; } + } - // only hit right at the beginning - // visibleElements is all of the elements (even the ones you can't see) - if (this._visibleElements.length !== this._numTotalResults) { - // undefined until a searchitem is put in there - this._visibleElements = Array(this._numTotalResults === -1 ? 0 : this._numTotalResults); - this._visibleDocuments = Array(this._numTotalResults === -1 ? 0 : this._numTotalResults); - } - let max = this._numResultsPerPage; - max > this._results.length ? max = this._results.length : console.log(""); - for (let i = this._pageStart; i < max; i++) { - //if the index is out of the window then put a placeholder in - //should ones that have already been found get set to placeholders? - - let result: [Doc, string[], string[]] | undefined = undefined; - - result = this._results[i]; - if (result) { - const highlights = Array.from([...Array.from(new Set(result[1]).values())]); - const lines = new List(result[2]); - highlights.forEach((item) => headers.add(item)); - Doc.SetSearchMatch(result[0], { searchMatch: 1 }); - if (i < this._visibleDocuments.length) { - this._visibleDocuments[i] = result[0]; - Doc.BrushDoc(result[0]); - Doc.AddDocToList(this.dataDoc, this.props.fieldKey, result[0]); - this.children++; + @action + searchCollection(query: string) { + const selectedCollection = CollectionDockingView.Instance; + query = query.toLowerCase(); + + if (selectedCollection !== undefined) { + console.log("hello111") + // this._currentSelectedCollection = selectedCollection; + const docs = DocListCast(selectedCollection.dataDoc[Doc.LayoutFieldKey(selectedCollection.dataDoc)]); + const found: [Doc, string[], string[]][] = []; + SearchBox.foreachRecursiveDoc(docs, (doc: Doc) => { + console.log("HELLO") + if (this._docTypeString == "all" || this._docTypeString == doc.type) { + const hlights = new Set(); + SearchBox.documentKeys(doc).forEach(key => Field.toString(doc[key] as Field).toLowerCase().includes(query) && hlights.add(key)); + Array.from(hlights.keys()).length > 0 && found.push([doc, Array.from(hlights.keys()), []]); } - } - } - if (this.props.Document._schemaHeaders === undefined) { - this.props.Document._schemaHeaders = new List([new SchemaHeaderField("title", "#f1efeb")]); - } - if (this._maxSearchIndex >= this._numTotalResults) { - this._visibleElements.length = this._results.length; - this._visibleDocuments.length = this._results.length; + }); + + this._results = found; + //this.setSearchFilter(selectedCollection, this.filter && found.length ? this._docsforfilter : undefined); } } - getTransform = () => this.props.ScreenToLocalTransform().translate(-5, -65);// listBox padding-left and pres-box-cont minHeight - panelHeight = () => this.props.PanelHeight(); - selectElement = (doc: Doc) => { /* this.gotoDocument(this.childDocs.indexOf(doc), NumCasst(this.layoutDoc._itemIndex)); */ }; - returnHeight = () => NumCast(this.layoutDoc._height); - returnLength = () => Math.min(window.innerWidth, 51 + 205 * Cast(this.props.Document._schemaHeaders, listSpec(SchemaHeaderField), []).length); - - setSearchFilter = action((collectionView: { props: { Document: Doc } }, docsForFilter: Doc[] | undefined) => { - if (collectionView) { - const docFilters = Cast(this.props.Document._docFilters, listSpec("string"), null); - collectionView.props.Document._searchFilterDocs = docsForFilter?.length ? new List(docsForFilter) : undefined; - collectionView.props.Document._docFilters = docsForFilter?.length && docFilters?.length ? new List(docFilters) : undefined; + static documentKeys(doc: Doc) { + const keys: { [key: string]: boolean } = {}; + // bcz: ugh. this is untracked since otherwise a large collection of documents will blast the server for all their fields. + // then as each document's fields come back, we update the documents _proxies. Each time we do this, the whole schema will be + // invalidated and re-rendered. This workaround will inquire all of the document fields before the options button is clicked. + // then by the time the options button is clicked, all of the fields should be in place. If a new field is added while this menu + // is displayed (unlikely) it won't show up until something else changes. + //TODO Types + Doc.GetAllPrototypes(doc).map(proto => Object.keys(proto).forEach(key => keys[key] = false)); + return Array.from(Object.keys(keys)); + } + + @action + submitSearch = async () => { + Doc.ClearSearchMatches(); + this._results = []; + + this.dataDoc[this.fieldKey] = new List([]); + let query = StrCast(this._searchString); + Doc.SetSearchQuery(query); + this._results = []; + + if (query) { + this.searchCollection(query); } - }); + } + + selectElement = async (doc: Doc) => { + await DocumentManager.Instance.jumpToDocument(doc, true); // documents open in new tab instead of on right + } render() { - const myDashboards = DocListCast(CurrentUserUtils.MyDashboards.data); + const results = this._results.map(result => { + var className = "searchBox-results-scroll-view-result"; + + if (this._selectedResult == result[0]) { + className += " searchBox-results-scroll-view-result-selected" + } + + return (
this.onResultClick(result[0])} className={className}>
{result[0].title}
) + }) return (
-
-
- -
-
- -
-
- {`${this._results.length}` + " of " + `${this.realTotalResults}`} -
-
-
+
+ +
- {!this._searchbarOpen ? (null) : -
r?.focus()}> -
-
- window.innerWidth || this.children > 6 ? true : false} - focus={this.selectElement} - ScreenToLocalTransform={Transform.Identity} - /> -
setupMoveUpEvents(this, e, (e: PointerEvent, down: number[], delta: number[]) => { - this.props.Document._height = NumCast(this.props.Document._height) + delta[1]; - return false; - }, returnFalse, emptyFunction)} - > - -
-
-
+
+
+ {`${this._results.length}` + " result" + (this._results.length == 1 ? "" : "s")}
- } +
+ {results} +
+
); } -} \ No newline at end of file +}*/ \ No newline at end of file -- cgit v1.2.3-70-g09d2 From 2ec093982c06965086326df73d365e1b54f6a2a2 Mon Sep 17 00:00:00 2001 From: dg314 Date: Wed, 4 Aug 2021 03:19:16 -0400 Subject: search panel updates --- src/client/util/CurrentUserUtils.ts | 27 ++++++----- src/client/views/GlobalKeyHandler.ts | 7 ++- src/client/views/MainView.tsx | 37 -------------- src/client/views/search/SearchBox.scss | 19 ++++++-- src/client/views/search/SearchBox.tsx | 89 +++++++++++++++++----------------- 5 files changed, 81 insertions(+), 98 deletions(-) (limited to 'src/client/util/CurrentUserUtils.ts') diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts index 31384da3b..734b96b1e 100644 --- a/src/client/util/CurrentUserUtils.ts +++ b/src/client/util/CurrentUserUtils.ts @@ -46,6 +46,7 @@ export class CurrentUserUtils { //TODO tfs: these should be temporary... private static mainDocId: string | undefined; + public static searchBtn: Doc; public static get id() { return this.curr_id; } public static get MainDocId() { return this.mainDocId; } public static set MainDocId(id: string | undefined) { this.mainDocId = id; } @@ -533,15 +534,6 @@ export class CurrentUserUtils { ]; } - /*static setupSearchPanel(doc: Doc) { - if (doc.mySearchPanelDoc === undefined) { - doc.mySearchPanelDoc = new PrefetchProxy(Docs.Create.SearchDocument({ - _width: 500, _height: 300, backgroundColor: "dimGray", ignoreClick: true, _searchDoc: true, - childDropAction: "alias", _lockedPosition: true, _viewType: CollectionViewType.Schema, title: "sidebar search stack", system: true - })) as any as Doc; - } - }*/ - static async setupMenuPanel(doc: Doc, sharingDocumentId: string, linkDatabaseId: string) { if (doc.menuStack === undefined) { await this.setupSharingSidebar(doc, sharingDocumentId, linkDatabaseId); // sets up the right sidebar collection for mobile upload documents and sharing @@ -562,10 +554,23 @@ export class CurrentUserUtils { _height: 60, watchedDocuments, onClick: ScriptField.MakeScript(click, { scriptContext: "any" }) - })); + }) + ); + + menuBtns.forEach(menuBtn => { + if (menuBtn.title == "Search") { + this.searchBtn = menuBtn; + } + }); // hack -- last button is assumed to be the userDoc menuBtns[menuBtns.length - 1].hidden = ComputedField.MakeFunction("IsNoviceMode()"); + menuBtns.forEach(menuBtn => { + if (menuBtn.title == "Search") { + doc.searchBtn = menuBtn + } + }) + doc.menuStack = new PrefetchProxy(Docs.Create.StackingDocument(menuBtns, { title: "menuItemPanel", childDropAction: "alias", @@ -950,7 +955,7 @@ export class CurrentUserUtils { if (doc.mySearchPanel === undefined) { doc.mySearchPanel = new PrefetchProxy(Docs.Create.SearchDocument({ backgroundColor: "dimGray", ignoreClick: true, _searchDoc: true, - childDropAction: "alias", _lockedPosition: true, _viewType: CollectionViewType.Schema, title: "sidebar search stack", system: true + childDropAction: "alias", _lockedPosition: true, _viewType: CollectionViewType.Schema, title: "Search Sidebar", system: true })) as any as Doc; } } diff --git a/src/client/views/GlobalKeyHandler.ts b/src/client/views/GlobalKeyHandler.ts index d92cba3eb..2a3cb36c7 100644 --- a/src/client/views/GlobalKeyHandler.ts +++ b/src/client/views/GlobalKeyHandler.ts @@ -27,7 +27,6 @@ import { LightboxView } from "./LightboxView"; import { MainView } from "./MainView"; import { DocumentLinksButton } from "./nodes/DocumentLinksButton"; import { AnchorMenu } from "./pdf/AnchorMenu"; -import { SearchBox } from "./search/SearchBox"; import { CurrentUserUtils } from "../util/CurrentUserUtils"; import { SettingsManager } from "../util/SettingsManager"; @@ -225,7 +224,11 @@ export class KeyManager { PromiseValue(Cast(Doc.UserDoc()["tabs-button-tools"], Doc)).then(pv => pv && (pv.onClick as ScriptField).script.run({ this: pv })); break; case "f": - SearchBox.Instance.enter(undefined); + const searchBtn = Doc.UserDoc().searchBtn as Doc; + + if (searchBtn) { + MainView.Instance.selectMenu(searchBtn); + } break; case "o": const target = SelectionManager.Views()[0]; diff --git a/src/client/views/MainView.tsx b/src/client/views/MainView.tsx index 0d957518b..35222e91f 100644 --- a/src/client/views/MainView.tsx +++ b/src/client/views/MainView.tsx @@ -387,9 +387,6 @@ export class MainView extends React.Component { case "Settings": SettingsManager.Instance.open(); break; - case "Catalog": - SearchBox.Instance.enter(undefined); - break; case "Help": break; default: @@ -522,40 +519,6 @@ export class MainView extends React.Component { ; } - /*@computed get search() { - TraceMobx(); - return
- -
; - }*/ - @computed get invisibleWebBox() { // see note under the makeLink method in HypothesisUtils.ts return !DocumentLinksButton.invisibleWebDoc ? null :
diff --git a/src/client/views/search/SearchBox.scss b/src/client/views/search/SearchBox.scss index f8e994da7..e4d1ac6a3 100644 --- a/src/client/views/search/SearchBox.scss +++ b/src/client/views/search/SearchBox.scss @@ -22,17 +22,18 @@ .searchBox-type { display: block; - width: 50px; + width: 55px; outline: none; padding: 1px 5px 1px 5px; color: black; height: 25px; border: 1px solid black; + border-right: 0px; } .searchBox-input { display: block; - width: calc(100% - 50px); + width: calc(100% - 55px); outline: none; padding: 1px 5px 1px 5px; color: black; @@ -74,10 +75,20 @@ background: gray; } - .titletitle { + .searchBox-result-title { display: relative; float: left; - left: 50px; + width: calc(100% - 60px); + text-align: left; + } + + .searchBox-result-type { + font-size: 12px; + display: relative; + float: right; + width: 60px; + text-align: right; + color: #333; } } } diff --git a/src/client/views/search/SearchBox.tsx b/src/client/views/search/SearchBox.tsx index 374a754bf..3cbb4b3b1 100644 --- a/src/client/views/search/SearchBox.tsx +++ b/src/client/views/search/SearchBox.tsx @@ -35,29 +35,30 @@ export const searchSchema = createSchema({ Document: Doc }); type SearchBoxDocument = makeInterface<[typeof documentSchema, typeof searchSchema]>; const SearchBoxDocument = makeInterface(documentSchema, searchSchema); +const selectValues = ["all", "rtf", "image", "pdf", "web", "video", "audio", "collection"] + @observer export class SearchBox extends ViewBoxBaseComponent(SearchBoxDocument) { public static LayoutString(fieldKey: string) { return FieldView.LayoutString(SearchBox, fieldKey); } public static Instance: SearchBox; - private _allIcons: string[] = [DocumentType.INK, DocumentType.AUDIO, DocumentType.COL, DocumentType.IMG, DocumentType.LINK, DocumentType.PDF, DocumentType.RTF, DocumentType.VID, DocumentType.WEB]; private _resultsSet = new Map(); private _inputRef = React.createRef(); - private _disposers: { [name: string]: IReactionDisposer } = {}; - private _blockedTypes = [DocumentType.PRESELEMENT, DocumentType.KVP, DocumentType.FILTER, DocumentType.SEARCH, DocumentType.SEARCHITEM, DocumentType.FONTICON, DocumentType.BUTTON, DocumentType.SCRIPTING]; @observable _searchString = ""; @observable _docTypeString = "all"; - @observable _icons: string[] = this._allIcons; @observable _results: [Doc, string[], string[]][] = []; @observable _selectedResult: Doc | undefined = undefined; @observable _deletedDocsStatus: boolean = false; @observable _onlyAliases: boolean = true; - @computed get filter() { return this._results?.length && (this.currentSelectedCollection?.props.Document._searchFilterDocs || this.currentSelectedCollection?.props.Document._docFilters); } constructor(props: any) { super(props); SearchBox.Instance = this; + this._searchString = "reset_search"; + this.submitSearch(); + this._searchString = ""; + this.submitSearch(); } componentDidMount = action(() => { @@ -67,11 +68,9 @@ export class SearchBox extends ViewBoxBaseComponent disposer?.()); + this.resetSearch; } - @computed get currentSelectedCollection() { return CollectionDockingView.Instance; } - onInputChange = action((e: React.ChangeEvent) => { this._searchString = e.target.value; this.submitSearch(); @@ -79,32 +78,13 @@ export class SearchBox extends ViewBoxBaseComponent) => { this._docTypeString = e.target.value; - this.submitSearch(); }); - /*enter = action((e: React.KeyboardEvent | undefined) => { - if (!e || e.key === "Enter") { - this.submitSearch(); - } - });*/ - onResultClick = action((doc: Doc) => { this.selectElement(doc); this._selectedResult = doc; }); - @action - filterDocsByType(docs: Doc[]) { - const finalDocs: Doc[] = []; - docs.forEach(doc => { - const layoutresult = StrCast(doc.type, "string") as DocumentType; - if (layoutresult && !this._blockedTypes.includes(layoutresult) && this._icons.includes(layoutresult)) { - finalDocs.push(doc); - } - }); - return finalDocs; - } - static foreachRecursiveDoc(docs: Doc[], func: (doc: Doc) => void) { let newarray: Doc[] = []; while (docs.length > 0) { @@ -120,23 +100,39 @@ export class SearchBox extends ViewBoxBaseComponent { - const hlights = new Set(); - SearchBox.documentKeys(doc).forEach(key => Field.toString(doc[key] as Field).toLowerCase().includes(query) && hlights.add(key)); - Array.from(hlights.keys()).length > 0 && found.push([doc, Array.from(hlights.keys()), []]); + const dtype = StrCast(doc.type, "string") as DocumentType; + if (dtype && !blockedTypes.includes(dtype)) { + const hlights = new Set(); + SearchBox.documentKeys(doc).forEach(key => Field.toString(doc[key] as Field).toLowerCase().includes(query) && hlights.add(key)); + Array.from(hlights.keys()).length > 0 && this._results.push([doc, Array.from(hlights.keys()), []]); + } }); - - this._results = found; } + + this._results = Array.from(new Set(this._results)) + this._selectedResult = undefined } static documentKeys(doc: Doc) { @@ -155,7 +151,7 @@ export class SearchBox extends ViewBoxBaseComponent { this.resetSearch(); - this.dataDoc[this.fieldKey] = new List([]); + //this.dataDoc[this.fieldKey] = new List([]); let query = StrCast(this._searchString); Doc.SetSearchQuery(query); this._results = []; @@ -169,6 +165,7 @@ export class SearchBox extends ViewBoxBaseComponent { this._results.forEach(result => { Doc.UnBrushDoc(result[0]); + Doc.UnHighlightDoc(result[0]); Doc.ClearSearchMatches(); }); }); @@ -178,6 +175,8 @@ export class SearchBox extends ViewBoxBaseComponent { var className = "searchBox-results-scroll-view-result"; @@ -186,28 +185,30 @@ export class SearchBox extends ViewBoxBaseComponent this.onResultClick(result[0])} className={className}>
{result[0].title}
) + validResults++; + return (
this.onResultClick(result[0])} className={className}>
{result[0].title}
{SearchBox.formatType(StrCast(result[0].type))}
) } return null; }) - results.filter(result => result) + results.filter(result => result); + + const selectOptions = selectValues.map(value => { + return + }) return (
- +
- {`${results.length}` + " result" + (results.length == 1 ? "" : "s")} + {`${validResults}` + " result" + (validResults == 1 ? "" : "s")}
{results} -- cgit v1.2.3-70-g09d2 From f5c126ba41bb15837c3527e588ba6fb3c79f3e89 Mon Sep 17 00:00:00 2001 From: geireann Date: Sat, 14 Aug 2021 13:29:46 -0400 Subject: code reorganising and updates --- package-lock.json | 5 +- src/client/documents/Documents.ts | 15 +- src/client/util/CurrentUserUtils.ts | 171 ++- src/client/util/tempCurrentUserUtils.ts | 1389 ++++++++++++++++++++ .../views/collections/CollectionLinearView.scss | 139 -- .../views/collections/CollectionLinearView.tsx | 193 --- .../views/collections/collectionFreeForm/index.ts | 7 + .../views/collections/collectionGrid/index.ts | 2 + .../collectionLinearView/CollectionLinearView.scss | 139 ++ .../collectionLinearView/CollectionLinearView.tsx | 192 +++ .../collections/collectionLinearView/index.ts | 1 + src/client/views/nodes/DocumentContentsView.tsx | 2 +- src/client/views/nodes/FontIconBox.scss | 103 -- src/client/views/nodes/FontIconBox.tsx | 96 -- src/client/views/nodes/button/FontIconBadge.tsx | 37 + src/client/views/nodes/button/FontIconBox.scss | 103 ++ src/client/views/nodes/button/FontIconBox.tsx | 295 +++++ 17 files changed, 2328 insertions(+), 561 deletions(-) create mode 100644 src/client/util/tempCurrentUserUtils.ts delete mode 100644 src/client/views/collections/CollectionLinearView.scss delete mode 100644 src/client/views/collections/CollectionLinearView.tsx create mode 100644 src/client/views/collections/collectionFreeForm/index.ts create mode 100644 src/client/views/collections/collectionGrid/index.ts create mode 100644 src/client/views/collections/collectionLinearView/CollectionLinearView.scss create mode 100644 src/client/views/collections/collectionLinearView/CollectionLinearView.tsx create mode 100644 src/client/views/collections/collectionLinearView/index.ts delete mode 100644 src/client/views/nodes/FontIconBox.scss delete mode 100644 src/client/views/nodes/FontIconBox.tsx create mode 100644 src/client/views/nodes/button/FontIconBadge.tsx create mode 100644 src/client/views/nodes/button/FontIconBox.scss create mode 100644 src/client/views/nodes/button/FontIconBox.tsx (limited to 'src/client/util/CurrentUserUtils.ts') diff --git a/package-lock.json b/package-lock.json index 58cdf8805..59ae898bf 100644 --- a/package-lock.json +++ b/package-lock.json @@ -7694,14 +7694,13 @@ "resolved": "https://registry.npmjs.org/image-size-stream/-/image-size-stream-1.1.0.tgz", "integrity": "sha1-Ivou2mbG31AQh0bacUkmSy0l+Gs=", "requires": { - "image-size": "image-size@github:netroy/image-size#da2c863807a3e9602617bdd357b0de3ab4a064c1", "readable-stream": "^1.0.33", "tryit": "^1.0.1" }, "dependencies": { "image-size": { - "version": "git+ssh://git@github.com/netroy/image-size.git#da2c863807a3e9602617bdd357b0de3ab4a064c1", - "from": "image-size@github:netroy/image-size#da2c863807a3e9602617bdd357b0de3ab4a064c1" + "version": "git+https://github.com/netroy/image-size.git#da2c863807a3e9602617bdd357b0de3ab4a064c1", + "from": "git+https://github.com/netroy/image-size.git#da2c863807a3e9602617bdd357b0de3ab4a064c1" }, "isarray": { "version": "0.0.1", diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts index 142c37ea4..a15b017bd 100644 --- a/src/client/documents/Documents.ts +++ b/src/client/documents/Documents.ts @@ -37,7 +37,7 @@ import { ColorBox } from "../views/nodes/ColorBox"; import { ComparisonBox } from "../views/nodes/ComparisonBox"; import { DocFocusOptions } from "../views/nodes/DocumentView"; import { FilterBox } from "../views/nodes/FilterBox"; -import { FontIconBox } from "../views/nodes/FontIconBox"; +import { FontIconBox } from "../views/nodes/button/FontIconBox"; import { FormattedTextBox } from "../views/nodes/formattedText/FormattedTextBox"; import { ImageBox } from "../views/nodes/ImageBox"; import { KeyValueBox } from "../views/nodes/KeyValueBox"; @@ -215,7 +215,19 @@ export class DocumentOptions { annotationOn?: Doc; isPushpin?: boolean; _removeDropProperties?: List; // list of properties that should be removed from a document when it is dropped. e.g., a creator button may be forceActive to allow it be dragged, but the forceActive property can be removed from the dropped document + + //BUTTONS iconShape?: string; // shapes of the fonticon border + btnType?: string; + btnList?: List; + docColorBtn?: string; + userColorBtn?: string; + canClick?: string; + + //LINEAR VIEW + linearViewIsExpanded?: boolean; // is linear view expanded + linearViewExpandable?: boolean; // can linear view be expanded + layout_linkView?: Doc; // view template for a link document layout_keyValue?: string; // view tempalte for key value docs linkRelationship?: string; // type of relatinoship a link represents @@ -266,7 +278,6 @@ export class DocumentOptions { selectedIndex?: number; // which item in a linear view has been selected using the "thumb doc" ui clipboard?: Doc; searchQuery?: string; // for quersyBox - linearViewIsExpanded?: boolean; // is linear view expanded useLinkSmallAnchor?: boolean; // whether links to this document should use a miniature linkAnchorBox border?: string; //for searchbox hoverBackgroundColor?: string; // background color of a label when hovered diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts index 66f9d060f..ecce573a1 100644 --- a/src/client/util/CurrentUserUtils.ts +++ b/src/client/util/CurrentUserUtils.ts @@ -2,13 +2,14 @@ import { computed, observable, reaction } from "mobx"; import * as rp from 'request-promise'; import { DataSym, Doc, DocListCast, DocListCastAsync } from "../../fields/Doc"; import { Id } from "../../fields/FieldSymbols"; +import { InkTool } from "../../fields/InkField"; import { List } from "../../fields/List"; import { PrefetchProxy } from "../../fields/Proxy"; import { RichTextField } from "../../fields/RichTextField"; import { listSpec } from "../../fields/Schema"; import { SchemaHeaderField } from "../../fields/SchemaHeaderField"; import { ComputedField, ScriptField } from "../../fields/ScriptField"; -import { BoolCast, Cast, NumCast, PromiseValue, StrCast, DateCast } from "../../fields/Types"; +import { BoolCast, Cast, DateCast, NumCast, PromiseValue, StrCast } from "../../fields/Types"; import { nullAudio } from "../../fields/URLField"; import { SharingPermissions } from "../../fields/util"; import { Utils } from "../../Utils"; @@ -19,6 +20,7 @@ import { Networking } from "../Network"; import { CollectionDockingView } from "../views/collections/CollectionDockingView"; import { DimUnit } from "../views/collections/collectionMulticolumn/CollectionMulticolumnView"; import { CollectionView, CollectionViewType } from "../views/collections/CollectionView"; +import { Colors } from "../views/global/globalEnums"; import { MainView } from "../views/MainView"; import { FormattedTextBox } from "../views/nodes/formattedText/FormattedTextBox"; import { LabelBox } from "../views/nodes/LabelBox"; @@ -31,13 +33,11 @@ import { LinkManager } from "./LinkManager"; import { Scripting } from "./Scripting"; import { SearchUtil } from "./SearchUtil"; import { SelectionManager } from "./SelectionManager"; -import { UndoManager } from "./UndoManager"; -import { SnappingManager } from "./SnappingManager"; -import { InkTool } from "../../fields/InkField"; -import { SharingManager } from "./SharingManager"; -import { computedFn } from "mobx-utils"; import { ColorScheme } from "./SettingsManager"; -import { Colors } from "../views/global/globalEnums"; +import { SharingManager } from "./SharingManager"; +import { SnappingManager } from "./SnappingManager"; +import { UndoManager } from "./UndoManager"; +import { ButtonType } from "../views/nodes/button/FontIconBox"; export let resolvedPorts: { server: number, socket: number }; @@ -68,13 +68,14 @@ export class CurrentUserUtils { [this.ficon({ ignoreClick: true, icon: "mobile", + btnType: ButtonType.ClickButton, backgroundColor: "transparent" }), this.mobileTextContainer({}, [this.mobileButtonText({}, "NEW MOBILE BUTTON"), this.mobileButtonInfo({}, "You can customize this button and make it your own.")])]); doc["template-mobile-button"] = CurrentUserUtils.ficon({ onDragStart: ScriptField.MakeFunction('copyDragFactory(this.dragFactory)'), - dragFactory: new PrefetchProxy(queryTemplate) as any as Doc, title: "mobile button", icon: "mobile" + dragFactory: new PrefetchProxy(queryTemplate) as any as Doc, title: "mobile button", icon: "mobile", btnType: ButtonType.ClickButton, }); } @@ -89,7 +90,8 @@ export class CurrentUserUtils { slideTemplate.isTemplateDoc = makeTemplate(slideTemplate); doc["template-button-slides"] = CurrentUserUtils.ficon({ onDragStart: ScriptField.MakeFunction('copyDragFactory(this.dragFactory)'), - dragFactory: new PrefetchProxy(slideTemplate) as any as Doc, title: "presentation slide", icon: "address-card" + dragFactory: new PrefetchProxy(slideTemplate) as any as Doc, title: "presentation slide", icon: "address-card", + btnType: ButtonType.ClickButton }); } @@ -135,7 +137,8 @@ export class CurrentUserUtils { doc["template-button-link"] = CurrentUserUtils.ficon({ onDragStart: ScriptField.MakeFunction('copyDragFactory(this.dragFactory)'), - dragFactory: new PrefetchProxy(linkTemplate) as any as Doc, title: "link view", icon: "window-maximize", system: true + dragFactory: new PrefetchProxy(linkTemplate) as any as Doc, title: "link view", icon: "window-maximize", system: true, + btnType: ButtonType.ClickButton }); } @@ -166,7 +169,8 @@ export class CurrentUserUtils { doc["template-button-switch"] = CurrentUserUtils.ficon({ onDragStart: ScriptField.MakeFunction('copyDragFactory(this.dragFactory)'), - dragFactory: new PrefetchProxy(box) as any as Doc, title: "data switch", icon: "toggle-on", system: true + dragFactory: new PrefetchProxy(box) as any as Doc, title: "data switch", icon: "toggle-on", system: true, + btnType: ButtonType.ClickButton }); } @@ -215,7 +219,11 @@ export class CurrentUserUtils { doc["template-button-detail"] = CurrentUserUtils.ficon({ onDragStart: ScriptField.MakeFunction('copyDragFactory(this.dragFactory)'), - dragFactory: new PrefetchProxy(detailView) as any as Doc, title: "detailView", icon: "window-maximize", system: true + dragFactory: new PrefetchProxy(detailView) as any as Doc, + title: "detailView", + icon: "window-maximize", + system: true, + btnType: ButtonType.ClickButton, }); } @@ -501,6 +509,7 @@ export class CurrentUserUtils { icon, title, toolTip, + btnType: ButtonType.ClickButton, ignoreClick, _dropAction: "alias", onDragStart: drag ? ScriptField.MakeFunction(drag) : undefined, @@ -556,7 +565,7 @@ export class CurrentUserUtils { const menuBtns = (await CurrentUserUtils.menuBtnDescriptions(doc)).map(({ title, target, icon, click, watchedDocuments }) => Docs.Create.FontIconDocument({ icon, - iconShape: "square", + btnType: ButtonType.MenuButton, _stayInCollection: true, _hideContextMenu: true, system: true, @@ -577,7 +586,6 @@ export class CurrentUserUtils { title: "menuItemPanel", childDropAction: "alias", _chromeHidden: true, - backgroundColor: Colors.DARK_GRAY, boxShadow: "rgba(0,0,0,0)", dropConverter: ScriptField.MakeScript("convertToButtons(dragData)", { dragData: DragManager.DocumentDragData.name }), ignoreClick: true, @@ -637,7 +645,7 @@ export class CurrentUserUtils { onClick: data.click ? ScriptField.MakeScript(data.click) : undefined, backgroundColor: data.backgroundColor, system: true }, - [this.ficon({ ignoreClick: true, icon: data.icon, backgroundColor: "rgba(0,0,0,0)", system: true }), this.mobileTextContainer({}, [this.mobileButtonText({}, data.title), this.mobileButtonInfo({}, data.info)])]) + [this.ficon({ ignoreClick: true, icon: data.icon, backgroundColor: "rgba(0,0,0,0)", system: true, btnType: ButtonType.ClickButton, }), this.mobileTextContainer({}, [this.mobileButtonText({}, data.title), this.mobileButtonInfo({}, data.info)])]) ); } @@ -747,8 +755,8 @@ export class CurrentUserUtils { if (doc.myTools === undefined) { const toolsStack = new PrefetchProxy(Docs.Create.StackingDocument([doc.myCreators as Doc, doc.myColorPicker as Doc], { - title: "My Tools", _width: 500, _yMargin: 20, ignoreClick: true, _lockedPosition: true, _forceActive: true, - system: true, _stayInCollection: true, _hideContextMenu: true, _chromeHidden: true, + title: "My Tools", _showTitle: "title", _width: 500, _yMargin: 20, ignoreClick: true, _lockedPosition: true, _forceActive: true, + system: true, _stayInCollection: true, _hideContextMenu: true, _chromeHidden: true, boxShadow: "0 0", })) as any as Doc; doc.myTools = toolsStack; @@ -869,9 +877,9 @@ export class CurrentUserUtils { } static blist = (opts: DocumentOptions, docs: Doc[]) => new PrefetchProxy(Docs.Create.LinearDocument(docs, { - ...opts, _gridGap: 5, _xMargin: 5, _yMargin: 5, _height: 42, _width: 100, boxShadow: "0 0", _forceActive: true, + ...opts, _gridGap: 5, _xMargin: 5, _yMargin: 5, _width: 100, boxShadow: "0 0", _forceActive: true, dropConverter: ScriptField.MakeScript("convertToButtons(dragData)", { dragData: DragManager.DocumentDragData.name }), - backgroundColor: "black", _lockedPosition: true, linearViewIsExpanded: true, system: true + _lockedPosition: true, linearViewIsExpanded: true, system: true })) as any as Doc static ficon = (opts: DocumentOptions) => new PrefetchProxy(Docs.Create.FontIconDocument({ @@ -881,18 +889,133 @@ export class CurrentUserUtils { /// sets up the default list of buttons to be shown in the expanding button menu at the bottom of the Dash window static setupDockedButtons(doc: Doc) { if (doc["dockedBtn-undo"] === undefined) { - doc["dockedBtn-undo"] = CurrentUserUtils.ficon({ onClick: ScriptField.MakeScript("undo()"), dontUndo: true, _stayInCollection: true, _dropAction: "alias", _hideContextMenu: true, _removeDropProperties: new List(["dropAction", "_hideContextMenu", "stayInCollection"]), toolTip: "click to undo", title: "undo", icon: "undo-alt", system: true }); + doc["dockedBtn-undo"] = CurrentUserUtils.ficon({ onClick: ScriptField.MakeScript("undo()"), dontUndo: true, _stayInCollection: true, _dropAction: "alias", _hideContextMenu: true, _removeDropProperties: new List(["dropAction", "_hideContextMenu", "stayInCollection"]), toolTip: "Click to undo", title: "undo", icon: "undo-alt", system: true }); } if (doc["dockedBtn-redo"] === undefined) { - doc["dockedBtn-redo"] = CurrentUserUtils.ficon({ onClick: ScriptField.MakeScript("redo()"), dontUndo: true, _stayInCollection: true, _dropAction: "alias", _hideContextMenu: true, _removeDropProperties: new List(["dropAction", "_hideContextMenu", "stayInCollection"]), toolTip: "click to redo", title: "redo", icon: "redo-alt", system: true }); + doc["dockedBtn-redo"] = CurrentUserUtils.ficon({ onClick: ScriptField.MakeScript("redo()"), dontUndo: true, _stayInCollection: true, _dropAction: "alias", _hideContextMenu: true, _removeDropProperties: new List(["dropAction", "_hideContextMenu", "stayInCollection"]), toolTip: "Click to redo", title: "redo", icon: "redo-alt", system: true }); } if (doc.dockedBtns === undefined) { - doc.dockedBtns = CurrentUserUtils.blist({ title: "docked buttons", ignoreClick: true }, [doc["dockedBtn-undo"] as Doc, doc["dockedBtn-redo"] as Doc]); + doc.dockedBtns = CurrentUserUtils.blist({ title: "docked buttons", linearViewExpandable: true, ignoreClick: true }, [doc["dockedBtn-undo"] as Doc, doc["dockedBtn-redo"] as Doc]); } (doc["dockedBtn-undo"] as Doc).dontUndo = true; (doc["dockedBtn-redo"] as Doc).dontUndo = true; } + static textTools(doc: Doc) { + return [ + { + title: "Font", toolTip: "Font", width: 100, btnType: ButtonType.DropdownList, ignoreClick: true, + list: ["Roboto", "Roboto Mono", "Nunito", "Times New Roman", "Arial", "Georgia", + "Comic Sans MS", "Tahoma", "Impact", "Crimson Text"], + scriptDoc: Doc.UserDoc(), toggle: 'userDoc._fontFamily' + }, + { + title: "Bold", toolTip: "Bold (Ctrl+B)", btnType: ButtonType.ToggleButton, icon: "bold", click: 'toggleBold()', + scriptDoc: Doc.UserDoc(), + toggle: 'userDoc._boldActive' + }, + { title: "Italic", toolTip: "Italic (Ctrl+I)", btnType: ButtonType.ToggleButton, icon: "italic", click: 'toggleItalic()', scriptDoc: Doc.UserDoc(), toggle: 'userDoc._italicsActive' }, + { title: "Underline", toolTip: "Underline (Ctrl+U)", btnType: ButtonType.ToggleButton, icon: "underline", click: 'toggleUnderline()', scriptDoc: Doc.UserDoc(), toggle: 'userDoc._underlineActive' }, + // { title: "Strikethrough", tooltip: "Strikethrough", btnType: ButtonType.ToggleButton, icon: "strikethrough", click: 'toggleStrikethrough()', toggle: 'userDoc._underlineActive' }, + // { title: "Superscript", tooltip: "Superscript", btnType: ButtonType.ToggleButton, icon: "superscript", click: 'toggleSuperscript()', toggle: 'userDoc._underlineActive' }, + // { title: "Subscript", tooltip: "Subscript", btnType: ButtonType.ToggleButton, icon: "subscript", click: 'toggleSubscript()', toggle: 'userDoc._underlineActive' }, + { title: "Highlight", toolTip: "Highlight", btnType: ButtonType.ColorButton, icon: "highlighter", ignoreClick: true, scriptDoc: Doc.UserDoc(), userColorBtn: 'userDoc._highlightColor' }, + { title: "Text color", toolTip: "Text color", btnType: ButtonType.ColorButton, icon: "fill-drip", ignoreClick: true, scriptDoc: Doc.UserDoc(), userColorBtn: 'userDoc._textColor' }, + // { title: "Link", tooltip: "Link", btnType: ButtonType.DropdownButton, icon: "link", click: '', ignoreClick: true }, + ]; + } + + static async contextMenuBtnDescriptions(doc: Doc) { + return [ + // { title: "Perspective", tooltip: "Change document's perspective", type: "btn", btnType: ButtonType.DropdownButton, ignoreClick: true, icon: "desktop", click: '' }, + { + title: "Perspective", toolTip: "Perspective", width: 100, btnType: ButtonType.DropdownList, ignoreClick: true, + list: [CollectionViewType.Freeform, CollectionViewType.Schema, CollectionViewType.Tree, + CollectionViewType.Stacking, CollectionViewType.Masonry, CollectionViewType.Multicolumn, + CollectionViewType.Multirow, CollectionViewType.Time, CollectionViewType.Carousel, + CollectionViewType.Carousel3D, CollectionViewType.Linear, CollectionViewType.Map, + CollectionViewType.Grid], + scriptDoc: 'selectedDoc', + toggle: 'selectedDoc._viewType' + }, + { + title: "Background", toolTip: "Background", btnType: ButtonType.ColorButton, scriptDoc: 'selectedDoc', + docColorBtn: 'selectedDoc.backgroundColor', width: 60, ignoreClick: true, icon: "fill-drip", + canClick: 'numSelected > 0' + }, + { title: "Overlay", toolTip: "Overlay", btnType: ButtonType.ToggleButton, icon: "layer-group", click: 'toggleOverlay()', toggle: 'selectedDoc.z', canClick: 'numSelected > 0' }, + { title: "Text Tools", type: "TextMenu", icon: "font" }, + // { title: "Ink Tools", type: "LinearMenu", icon: "pen-nib" }, + // { title: "GFX Tools", type: "LinearMenu", icon: "shapes" }, + // { title: "Alias", btnType: ButtonType.ClickButton, icon: "copy" }, + ]; + } + + // Default context menu buttons + static async setupContextMenuButtons(doc: Doc) { + const docList: Doc[] = []; + + const contextMenuBtns = (await CurrentUserUtils.contextMenuBtnDescriptions(doc)).map(({ title, width, toolTip, ignoreClick, icon, type, btnType, click, toggle, scriptDoc, canClick, docColorBtn }) => { + const textDocList: Doc[] = []; + if (type === "TextMenu") { + const textBtns = (CurrentUserUtils.textTools(doc)).map(({ title, width, list, toolTip, ignoreClick, icon, btnType, click, toggle, scriptDoc, userColorBtn }) => { + textDocList.push(Docs.Create.FontIconDocument({ + _nativeWidth: width ? width : 25, + _nativeHeight: 25, + _width: width ? width : 25, + _height: 25, + icon, + toolTip, + userColorBtn, + + // testToggle: toggle ? ScriptField.MakeScript(toggle, { this: scriptDoc, scriptContext: "any" }) : undefined, + // toggle: toggle, + btnType: btnType, + btnList: new List(list), + ignoreClick: ignoreClick, + _stayInCollection: true, + _hideContextMenu: true, + system: true, + dontUndo: true, + title, + backgroundColor: "black", + _dropAction: "alias", + _removeDropProperties: new List(["dropAction", "_stayInCollection"]), + onClick: click ? ScriptField.MakeScript(click, { scriptContext: "any" }) : undefined + })); + }); + docList.push(CurrentUserUtils.blist({ ignoreClick: true, linearViewExpandable: true, _height: 30, backgroundColor: "transparent" }, textDocList)); + } else { + docList.push(Docs.Create.FontIconDocument({ + _nativeWidth: width ? width : 30, + _nativeHeight: 30, + _width: width ? width : 30, + _height: 30, + icon, + toolTip, + // testToggle: toggle ? ScriptField.MakeScript(toggle, { scriptContext: "any" }) : undefined, + // toggle: toggle, + docColorBtn, + canClick: canClick, + btnType: btnType, + ignoreClick: ignoreClick, + _stayInCollection: true, + _hideContextMenu: true, + system: true, + dontUndo: true, + title, + backgroundColor: "black", + _dropAction: "alias", + _removeDropProperties: new List(["dropAction", "_stayInCollection"]), + onClick: click ? ScriptField.MakeScript(click, { scriptContext: "any" }) : undefined + })); + } + }); + + if (doc.contextMenuBtns === undefined) { + doc.contextMenuBtns = CurrentUserUtils.blist({ title: "menu buttons", ignoreClick: true, linearViewExpandable: false, _height: 35 }, docList); + } + } // sets up the default set of documents to be shown in the Overlay layer static setupOverlays(doc: Doc) { if (doc.myOverlayDocs === undefined) { @@ -1052,8 +1175,8 @@ export class CurrentUserUtils { setTimeout(() => this.setupDefaultPresentation(doc), 0); // presentation that's initially triggered // setup reactions to change the highlights on the undo/redo buttons -- would be better to encode this in the undo/redo buttons, but the undo/redo stacks are not wired up that way yet - doc["dockedBtn-undo"] && reaction(() => UndoManager.undoStack.slice(), () => Doc.GetProto(doc["dockedBtn-undo"] as Doc).opacity = UndoManager.CanUndo() ? 1 : 0.4, { fireImmediately: true }); - doc["dockedBtn-redo"] && reaction(() => UndoManager.redoStack.slice(), () => Doc.GetProto(doc["dockedBtn-redo"] as Doc).opacity = UndoManager.CanRedo() ? 1 : 0.4, { fireImmediately: true }); + // doc["dockedBtn-undo"] && reaction(() => UndoManager.undoStack.slice(), () => Doc.GetProto(doc["dockedBtn-undo"] as Doc).opacity = UndoManager.CanUndo() ? 1 : 0.4, { fireImmediately: true }); + // doc["dockedBtn-redo"] && reaction(() => UndoManager.redoStack.slice(), () => Doc.GetProto(doc["dockedBtn-redo"] as Doc).opacity = UndoManager.CanRedo() ? 1 : 0.4, { fireImmediately: true }); // uncomment this to setup a default note style that uses the custom header layout // PromiseValue(doc.emptyHeader).then(factory => { diff --git a/src/client/util/tempCurrentUserUtils.ts b/src/client/util/tempCurrentUserUtils.ts new file mode 100644 index 000000000..3fba672e6 --- /dev/null +++ b/src/client/util/tempCurrentUserUtils.ts @@ -0,0 +1,1389 @@ +import { computed, observable, reaction, action } from "mobx"; +import * as rp from 'request-promise'; +import { DataSym, Doc, DocListCast, DocListCastAsync, AclReadonly } from "../../fields/Doc"; +import { Id } from "../../fields/FieldSymbols"; +import { List } from "../../fields/List"; +import { PrefetchProxy } from "../../fields/Proxy"; +import { RichTextField } from "../../fields/RichTextField"; +import { listSpec } from "../../fields/Schema"; +import { SchemaHeaderField } from "../../fields/SchemaHeaderField"; +import { ComputedField, ScriptField } from "../../fields/ScriptField"; +import { BoolCast, Cast, NumCast, PromiseValue, StrCast, DateCast } from "../../fields/Types"; +import { nullAudio } from "../../fields/URLField"; +import { SharingPermissions } from "../../fields/util"; +import { Utils } from "../../Utils"; +import { DocServer } from "../DocServer"; +import { Docs, DocumentOptions, DocUtils } from "../documents/Documents"; +import { DocumentType } from "../documents/DocumentTypes"; +import { Networking } from "../Network"; +import { CollectionDockingView } from "../views/collections/collectionDocking/CollectionDockingView"; +import { DimUnit } from "../views/collections/collectionMulticolumn/CollectionMulticolumnView"; +import { CollectionView, CollectionViewType } from "../views/collections/CollectionView"; +import { MainView } from "../views/MainView"; +import { FormattedTextBox } from "../views/nodes/formattedText/FormattedTextBox"; +import { LabelBox } from "../views/nodes/LabelBox"; +import { OverlayView } from "../views/OverlayView"; +import { DocumentManager } from "./DocumentManager"; +import { DragManager } from "./DragManager"; +import { makeTemplate } from "./DropConverter"; +import { HistoryUtil } from "./History"; +import { LinkManager } from "./LinkManager"; +import { Scripting } from "./Scripting"; +import { SearchUtil } from "./SearchUtil"; +import { SelectionManager } from "./SelectionManager"; +import { SnappingManager } from "./SnappingManager"; +import { InkTool } from "../../fields/InkField"; +import { ButtonType } from "../views/nodes/FontIconBox"; + + +export let resolvedPorts: { server: number, socket: number }; +const headerViewVersion = "0.1"; +export class CurrentUserUtils { + private static curr_id: string; + //TODO tfs: these should be temporary... + private static mainDocId: string | undefined; + + public static get id() { return this.curr_id; } + public static get MainDocId() { return this.mainDocId; } + public static set MainDocId(id: string | undefined) { this.mainDocId = id; } + @computed public static get UserDocument() { return Doc.UserDoc(); } + + @observable public static GuestTarget: Doc | undefined; + @observable public static GuestDashboard: Doc | undefined; + @observable public static GuestMobile: Doc | undefined; + @observable public static propertiesWidth: number = 0; + + // sets up the default User Templates - slideView, headerView + static setupUserTemplateButtons(doc: Doc) { + // Prototype for mobile button (not sure if 'Advanced Item Prototypes' is ideal location) + if (doc["template-mobile-button"] === undefined) { + const queryTemplate = this.mobileButton({ + title: "NEW MOBILE BUTTON", + onClick: undefined, + }, + [this.ficon({ + ignoreClick: true, + icon: "mobile", + btnType: ButtonType.ClickButton, + backgroundColor: "transparent" + }), + this.mobileTextContainer({}, + [this.mobileButtonText({}, "NEW MOBILE BUTTON"), this.mobileButtonInfo({}, "You can customize this button and make it your own.")])]); + doc["template-mobile-button"] = CurrentUserUtils.ficon({ + onDragStart: ScriptField.MakeFunction('copyDragFactory(this.dragFactory)'), + dragFactory: new PrefetchProxy(queryTemplate) as any as Doc, title: "mobile button", + btnType: ButtonType.ClickButton, + icon: "mobile" + }); + } + + if (doc["template-button-slides"] === undefined) { + const slideTemplate = Docs.Create.MultirowDocument( + [ + Docs.Create.MulticolumnDocument([], { title: "data", _height: 200, system: true }), + Docs.Create.TextDocument("", { title: "text", _height: 100, system: true }) + ], + { _width: 400, _height: 300, title: "slideView", _xMargin: 3, _yMargin: 3, system: true } + ); + slideTemplate.isTemplateDoc = makeTemplate(slideTemplate); + doc["template-button-slides"] = CurrentUserUtils.ficon({ + onDragStart: ScriptField.MakeFunction('copyDragFactory(this.dragFactory)'), + dragFactory: new PrefetchProxy(slideTemplate) as any as Doc, title: "presentation slide", + icon: "address-card", + btnType: ButtonType.ClickButton + }); + } + + if (doc["template-button-link"] === undefined) { // set _backgroundColor to transparent to prevent link dot from obscuring document it's attached to. + const linkTemplate = Doc.MakeDelegate(Docs.Create.TextDocument(" ", { title: "header", _autoHeight: true, system: true }, "header")); // text needs to be a space to allow templateText to be created + linkTemplate.system = true; + Doc.GetProto(linkTemplate).layout = + "
" + + " " + + " " + + "
"; + (linkTemplate.proto as Doc).isTemplateDoc = makeTemplate(linkTemplate.proto as Doc, true, "linkView"); + + const rtf2 = { + doc: { + type: "doc", content: [ + { + type: "paragraph", + content: [{ + type: "dashField", + attrs: { + fieldKey: "src", + hideKey: false + } + }] + }, + { type: "paragraph" }, + { + type: "paragraph", + content: [{ + type: "dashField", + attrs: { + fieldKey: "dst", + hideKey: false + } + }] + }] + }, + selection: { type: "text", anchor: 1, head: 1 }, + storedMarks: [] + }; + linkTemplate.header = new RichTextField(JSON.stringify(rtf2), ""); + + doc["template-button-link"] = CurrentUserUtils.ficon({ + onDragStart: ScriptField.MakeFunction('copyDragFactory(this.dragFactory)'), + dragFactory: new PrefetchProxy(linkTemplate) as any as Doc, title: "link view", + btnType: ButtonType.ClickButton, + icon: "window-maximize", system: true + }); + } + + if (doc["template-button-switch"] === undefined) { + const { FreeformDocument, MulticolumnDocument, TextDocument } = Docs.Create; + + const yes = FreeformDocument([], { title: "yes", _height: 35, _width: 50, _dimUnit: DimUnit.Pixel, _dimMagnitude: 40, system: true }); + const name = TextDocument("name", { title: "name", _height: 35, _width: 70, _dimMagnitude: 1, system: true }); + const no = FreeformDocument([], { title: "no", _height: 100, _width: 100, system: true }); + const labelTemplate = { + doc: { + type: "doc", content: [{ + type: "paragraph", + content: [{ type: "dashField", attrs: { fieldKey: "PARAMS", hideKey: true } }] + }] + }, + selection: { type: "text", anchor: 1, head: 1 }, + storedMarks: [] + }; + Doc.GetProto(name).text = new RichTextField(JSON.stringify(labelTemplate), "PARAMS"); + Doc.GetProto(yes).backgroundColor = ComputedField.MakeFunction("self[this.PARAMS] ? 'green':'red'"); + // Doc.GetProto(no).backgroundColor = ComputedField.MakeFunction("!self[this.PARAMS] ? 'red':'white'"); + // Doc.GetProto(yes).onClick = ScriptField.MakeScript("self[this.PARAMS] = true"); + Doc.GetProto(yes).onClick = ScriptField.MakeScript("self[this.PARAMS] = !self[this.PARAMS]"); + // Doc.GetProto(no).onClick = ScriptField.MakeScript("self[this.PARAMS] = false"); + const box = MulticolumnDocument([/*no, */ yes, name], { title: "value", _width: 120, _height: 35, system: true }); + box.isTemplateDoc = makeTemplate(box, true, "switch"); + + doc["template-button-switch"] = CurrentUserUtils.ficon({ + onDragStart: ScriptField.MakeFunction('copyDragFactory(this.dragFactory)'), + dragFactory: new PrefetchProxy(box) as any as Doc, title: "data switch", + btnType: ButtonType.ClickButton, + icon: "toggle-on", system: true + }); + } + + if (doc["template-button-detail"] === undefined) { + const { TextDocument, MasonryDocument, CarouselDocument } = Docs.Create; + + const openInTarget = ScriptField.MakeScript("openOnRight(self.doubleClickView)"); + const carousel = CarouselDocument([], { + title: "data", _height: 350, _itemIndex: 0, "_carousel-caption-xMargin": 10, "_carousel-caption-yMargin": 10, + onChildDoubleClick: openInTarget, backgroundColor: "#9b9b9b3F", system: true + }); + + const details = TextDocument("", { title: "details", _height: 200, _autoHeight: true, system: true }); + const short = TextDocument("", { title: "shortDescription", treeViewOpen: true, treeViewExpandedView: "layout", _height: 75, _autoHeight: true, system: true }); + const long = TextDocument("", { title: "longDescription", treeViewOpen: false, treeViewExpandedView: "layout", _height: 150, _autoHeight: true, system: true }); + + const buxtonFieldKeys = ["year", "originalPrice", "degreesOfFreedom", "company", "attribute", "primaryKey", "secondaryKey", "dimensions"]; + const detailedTemplate = { + doc: { + type: "doc", content: buxtonFieldKeys.map(fieldKey => ({ + type: "paragraph", + content: [{ type: "dashField", attrs: { fieldKey } }] + })) + }, + selection: { type: "text", anchor: 1, head: 1 }, + storedMarks: [] + }; + details.text = new RichTextField(JSON.stringify(detailedTemplate), buxtonFieldKeys.join(" ")); + + const shared = { _autoHeight: true, _xMargin: 0 }; + const detailViewOpts = { title: "detailView", _width: 300, _fontFamily: "Arial", _fontSize: "12px" }; + const descriptionWrapperOpts = { title: "descriptions", _height: 300, _columnWidth: -1, treeViewHideTitle: true, _pivotField: "title", system: true }; + + const descriptionWrapper = MasonryDocument([details, short, long], { ...shared, ...descriptionWrapperOpts }); + descriptionWrapper._columnHeaders = new List([ + new SchemaHeaderField("[A Short Description]", "dimGray", undefined, undefined, undefined, false), + new SchemaHeaderField("[Long Description]", "dimGray", undefined, undefined, undefined, true), + new SchemaHeaderField("[Details]", "dimGray", undefined, undefined, undefined, true), + ]); + const detailView = Docs.Create.StackingDocument([carousel, descriptionWrapper], { ...shared, ...detailViewOpts, _chromeHidden: true, system: true }); + detailView.isTemplateDoc = makeTemplate(detailView); + + details.title = "Details"; + short.title = "A Short Description"; + long.title = "Long Description"; + + doc["template-button-detail"] = CurrentUserUtils.ficon({ + onDragStart: ScriptField.MakeFunction('copyDragFactory(this.dragFactory)'), + dragFactory: new PrefetchProxy(detailView) as any as Doc, title: "detailView", + btnType: ButtonType.ClickButton, + icon: "window-maximize", system: true + }); + } + + const requiredTypes = [ + doc["template-button-slides"] as Doc, + doc["template-mobile-button"] as Doc, + doc["template-button-detail"] as Doc, + doc["template-button-link"] as Doc, + //doc["template-button-switch"] as Doc] + ]; + if (doc["template-buttons"] === undefined) { + doc["template-buttons"] = new PrefetchProxy(Docs.Create.MasonryDocument(requiredTypes, { + title: "Advanced Item Prototypes", _xMargin: 0, _showTitle: "title", _chromeHidden: true, + hidden: ComputedField.MakeFunction("IsNoviceMode()") as any, + _stayInCollection: true, _hideContextMenu: true, + _autoHeight: true, _width: 500, _height: 300, _fitWidth: true, _columnWidth: 35, ignoreClick: true, _lockedPosition: true, + dropConverter: ScriptField.MakeScript("convertToButtons(dragData)", { dragData: DragManager.DocumentDragData.name }), system: true + })); + } else { + const curButnTypes = Cast(doc["template-buttons"], Doc, null); + DocListCastAsync(curButnTypes.data).then(async curBtns => { + curBtns && await Promise.all(curBtns); + requiredTypes.map(btype => Doc.AddDocToList(curButnTypes, "data", btype)); + }); + } + return doc["template-buttons"] as Doc; + } + + // setup the different note type skins + static setupNoteTemplates(doc: Doc) { + if (doc["template-note-Note"] === undefined) { + const noteView = Docs.Create.TextDocument("", { title: "text", isTemplateDoc: true, backgroundColor: "yellow", system: true }); + noteView.isTemplateDoc = makeTemplate(noteView, true, "Note"); + doc["template-note-Note"] = new PrefetchProxy(noteView); + } + if (doc["template-note-Idea"] === undefined) { + const noteView = Docs.Create.TextDocument("", { title: "text", backgroundColor: "pink", system: true }); + noteView.isTemplateDoc = makeTemplate(noteView, true, "Idea"); + doc["template-note-Idea"] = new PrefetchProxy(noteView); + } + if (doc["template-note-Topic"] === undefined) { + const noteView = Docs.Create.TextDocument("", { title: "text", backgroundColor: "lightblue", system: true }); + noteView.isTemplateDoc = makeTemplate(noteView, true, "Topic"); + doc["template-note-Topic"] = new PrefetchProxy(noteView); + } + if (doc["template-note-Todo"] === undefined) { + const noteView = Docs.Create.TextDocument("", { + title: "text", backgroundColor: "orange", _autoHeight: false, _height: 100, _showCaption: "caption", + layout: FormattedTextBox.LayoutString("Todo"), caption: RichTextField.DashField("taskStatus"), system: true + }); + noteView.isTemplateDoc = makeTemplate(noteView, true, "Todo"); + doc["template-note-Todo"] = new PrefetchProxy(noteView); + } + const taskStatusValues = [ + { title: "todo", _backgroundColor: "blue", color: "white", system: true }, + { title: "in progress", _backgroundColor: "yellow", color: "black", system: true }, + { title: "completed", _backgroundColor: "green", color: "white", system: true } + ]; + if (doc.fieldTypes === undefined) { + doc.fieldTypes = Docs.Create.TreeDocument([], { title: "field enumerations", system: true }); + DocUtils.addFieldEnumerations(Doc.GetProto(doc["template-note-Todo"] as any as Doc), "taskStatus", taskStatusValues); + } + + if (doc["template-notes"] === undefined) { + doc["template-notes"] = new PrefetchProxy(Docs.Create.TreeDocument([doc["template-note-Note"] as any as Doc, doc["template-note-Idea"] as any as Doc, doc["template-note-Topic"] as any as Doc], // doc["template-note-Todo"] as any as Doc], + { title: "Note Layouts", _height: 75, system: true })); + } else { + const curNoteTypes = Cast(doc["template-notes"], Doc, null); + const requiredTypes = [doc["template-note-Note"] as any as Doc, doc["template-note-Idea"] as any as Doc, doc["template-note-Topic"] as any as Doc];//, doc["template-note-Todo"] as any as Doc]; + DocListCastAsync(curNoteTypes.data).then(async curNotes => { + curNotes && await Promise.all(curNotes); + requiredTypes.map(ntype => Doc.AddDocToList(curNoteTypes, "data", ntype)); + }); + } + + return doc["template-notes"] as Doc; + } + + // creates Note templates, and initial "user" templates + static setupDocTemplates(doc: Doc) { + const noteTemplates = CurrentUserUtils.setupNoteTemplates(doc); + const userTemplateBtns = CurrentUserUtils.setupUserTemplateButtons(doc); + const clickTemplates = CurrentUserUtils.setupClickEditorTemplates(doc); + if (doc.templateDocs === undefined) { + doc.templateDocs = new PrefetchProxy(Docs.Create.TreeDocument([noteTemplates, userTemplateBtns, clickTemplates], { + title: "template layouts", _xPadding: 0, system: true, + dropConverter: ScriptField.MakeScript("convertToButtons(dragData)", { dragData: DragManager.DocumentDragData.name }) + })); + } + } + + // setup templates for different document types when they are iconified from Document Decorations + static setupDefaultIconTemplates(doc: Doc) { + if (doc["template-icon-view"] === undefined) { + const iconView = Docs.Create.LabelDocument({ + title: "icon", textTransform: "unset", letterSpacing: "unset", layout: LabelBox.LayoutString("title"), _backgroundColor: "dimGray", + _width: 150, _height: 70, _xPadding: 10, _yPadding: 10, isTemplateDoc: true, onDoubleClick: ScriptField.MakeScript("deiconifyView(self)"), system: true + }); + // Docs.Create.TextDocument("", { + // title: "icon", _width: 150, _height: 30, isTemplateDoc: true, onDoubleClick: ScriptField.MakeScript("deiconifyView(self)") + // }); + // Doc.GetProto(iconView).icon = new RichTextField('{"doc":{"type":"doc","content":[{"type":"paragraph","attrs":{"align":null,"color":null,"id":null,"indent":null,"inset":null,"lineSpacing":null,"paddingBottom":null,"paddingTop":null},"content":[{"type":"dashField","attrs":{"fieldKey":"title","docid":""}}]}]},"selection":{"type":"text","anchor":2,"head":2},"storedMarks":[]}', ""); + iconView.isTemplateDoc = makeTemplate(iconView); + doc["template-icon-view"] = new PrefetchProxy(iconView); + } + if (doc["template-icon-view-rtf"] === undefined) { + const iconRtfView = Docs.Create.LabelDocument({ + title: "icon_" + DocumentType.RTF, textTransform: "unset", letterSpacing: "unset", layout: LabelBox.LayoutString("text"), + _width: 150, _height: 70, _xPadding: 10, _yPadding: 10, isTemplateDoc: true, onDoubleClick: ScriptField.MakeScript("deiconifyView(self)"), system: true + }); + iconRtfView.isTemplateDoc = makeTemplate(iconRtfView, true, "icon_" + DocumentType.RTF); + doc["template-icon-view-rtf"] = new PrefetchProxy(iconRtfView); + } + if (doc["template-icon-view-button"] === undefined) { + const iconBtnView = Docs.Create.FontIconDocument({ + title: "icon_" + DocumentType.BUTTON, _nativeHeight: 30, _nativeWidth: 30, + _width: 30, _height: 30, isTemplateDoc: true, onDoubleClick: ScriptField.MakeScript("deiconifyView(self)"), system: true + }); + iconBtnView.isTemplateDoc = makeTemplate(iconBtnView, true, "icon_" + DocumentType.BUTTON); + doc["template-icon-view-button"] = new PrefetchProxy(iconBtnView); + } + if (doc["template-icon-view-img"] === undefined) { + const iconImageView = Docs.Create.ImageDocument("http://www.cs.brown.edu/~bcz/face.gif", { + title: "data", _width: 50, isTemplateDoc: true, onDoubleClick: ScriptField.MakeScript("deiconifyView(self)"), system: true + }); + iconImageView.isTemplateDoc = makeTemplate(iconImageView, true, "icon_" + DocumentType.IMG); + doc["template-icon-view-img"] = new PrefetchProxy(iconImageView); + } + if (doc["template-icon-view-col"] === undefined) { + const iconColView = Docs.Create.TreeDocument([], { title: "data", _width: 180, _height: 80, onDoubleClick: ScriptField.MakeScript("deiconifyView(self)"), system: true }); + iconColView.isTemplateDoc = makeTemplate(iconColView, true, "icon_" + DocumentType.COL); + doc["template-icon-view-col"] = new PrefetchProxy(iconColView); + } + if (doc["template-icons"] === undefined) { + doc["template-icons"] = new PrefetchProxy(Docs.Create.TreeDocument([doc["template-icon-view"] as Doc, doc["template-icon-view-img"] as Doc, doc["template-icon-view-button"] as Doc, + doc["template-icon-view-col"] as Doc, doc["template-icon-view-rtf"] as Doc, doc["template-icon-view-pdf"] as Doc], { title: "icon templates", _height: 75, system: true })); + } else { + const templateIconsDoc = Cast(doc["template-icons"], Doc, null); + const requiredTypes = [doc["template-icon-view"] as Doc, doc["template-icon-view-img"] as Doc, doc["template-icon-view-button"] as Doc, + doc["template-icon-view-col"] as Doc, doc["template-icon-view-rtf"] as Doc]; + DocListCastAsync(templateIconsDoc.data).then(async curIcons => { + curIcons && await Promise.all(curIcons); + requiredTypes.map(ntype => Doc.AddDocToList(templateIconsDoc, "data", ntype)); + }); + } + return doc["template-icons"] as Doc; + } + + static creatorBtnDescriptors(doc: Doc): { + title: string, toolTip: string, icon: string, drag?: string, ignoreClick?: boolean, + click?: string, backgroundColor?: string, dragFactory?: Doc, noviceMode?: boolean, clickFactory?: Doc + }[] { + if (doc.emptyPresentation === undefined) { + doc.emptyPresentation = Docs.Create.PresDocument(new List(), + { title: "Untitled Presentation", _viewType: CollectionViewType.Stacking, _fitWidth: true, _width: 400, _height: 500, targetDropAction: "alias", _chromeHidden: true, boxShadow: "0 0", system: true, cloneFieldFilter: new List(["system"]) }); + ((doc.emptyPresentation as Doc).proto as Doc)["dragFactory-count"] = 0; + } + if (doc.emptyCollection === undefined) { + doc.emptyCollection = Docs.Create.FreeformDocument([], + { _nativeWidth: undefined, _nativeHeight: undefined, _fitWidth: true, _width: 150, _height: 100, title: "freeform", system: true, cloneFieldFilter: new List(["system"]) }); + ((doc.emptyCollection as Doc).proto as Doc)["dragFactory-count"] = 0; + } + if (doc.emptyPane === undefined) { + doc.emptyPane = Docs.Create.FreeformDocument([], { _nativeWidth: undefined, _nativeHeight: undefined, _width: 500, _height: 800, title: "Untitled Tab", system: true, cloneFieldFilter: new List(["system"]) }); + ((doc.emptyPane as Doc).proto as Doc)["dragFactory-count"] = 0; + } + if (doc.emptySlide === undefined) { + const textDoc = Docs.Create.TreeDocument([], { title: "Slide", _viewType: CollectionViewType.Tree, _fontSize: "20px", treeViewType: "outline", _xMargin: 0, _yMargin: 0, _width: 300, _height: 200, _singleLine: true, backgroundColor: "transparent", system: true, cloneFieldFilter: new List(["system"]) }); + Doc.GetProto(textDoc).title = ComputedField.MakeFunction('self.text?.Text'); + FormattedTextBox.SelectOnLoad = textDoc[Id]; + doc.emptySlide = textDoc; + } + if ((doc.emptyHeader as Doc)?.version !== headerViewVersion) { + const json = { + doc: { + type: "doc", + content: [ + { + type: "paragraph", attrs: {}, content: [{ + type: "dashField", + attrs: { fieldKey: "author", docid: "", hideKey: false }, + marks: [{ type: "strong" }] + }, { + type: "dashField", + attrs: { fieldKey: "creationDate", docid: "", hideKey: false }, + marks: [{ type: "strong" }] + }] + }] + }, + selection: { type: "text", anchor: 1, head: 1 }, + storedMarks: [] + }; + const headerTemplate = Docs.Create.RTFDocument(new RichTextField(JSON.stringify(json), ""), { + title: "text", version: headerViewVersion, target: doc, _height: 70, _headerPointerEvents: "all", + _headerHeight: 12, _headerFontSize: 9, _autoHeight: true, system: true, _fitWidth: true, + cloneFieldFilter: new List(["system"]) + }, "header"); + const headerBtnHgt = 10; + headerTemplate[DataSym].layout = + "" + + ` ` + + " " + + ` Metadata` + + ""; + + // "
" + + // " " + + // " " + + // "
"; + (headerTemplate.proto as Doc).isTemplateDoc = makeTemplate(headerTemplate.proto as Doc, true, "headerView"); + doc.emptyHeader = headerTemplate; + ((doc.emptyHeader as Doc).proto as Doc)["dragFactory-count"] = 0; + } + if (doc.emptyComparison === undefined) { + doc.emptyComparison = Docs.Create.ComparisonDocument({ title: "compare", _width: 300, _height: 300, system: true, cloneFieldFilter: new List(["system"]) }); + } + if (doc.emptyScript === undefined) { + doc.emptyScript = Docs.Create.ScriptingDocument(undefined, { _width: 200, _height: 250, title: "script", system: true, cloneFieldFilter: new List(["system"]) }); + ((doc.emptyScript as Doc).proto as Doc)["dragFactory-count"] = 0; + } + if (doc.emptyScreenshot === undefined) { + doc.emptyScreenshot = Docs.Create.ScreenshotDocument("empty screenshot", { _fitWidth: true, _width: 400, _height: 200, system: true, cloneFieldFilter: new List(["system"]) }); + } + if (doc.emptyWall === undefined) { + doc.emptyWall = Docs.Create.ScreenshotDocument("", { _fitWidth: true, _width: 400, _height: 200, title: "screen snapshot", system: true, cloneFieldFilter: new List(["system"]) }); + (doc.emptyWall as Doc).videoWall = true; + } + if (doc.emptyAudio === undefined) { + doc.emptyAudio = Docs.Create.AudioDocument(nullAudio, { _width: 200, title: "audio recording", system: true, cloneFieldFilter: new List(["system"]) }); + ((doc.emptyAudio as Doc).proto as Doc)["dragFactory-count"] = 0; + } + if (doc.emptyNote === undefined) { + doc.emptyNote = Docs.Create.TextDocument("", { _width: 200, title: "text note", _autoHeight: true, system: true, cloneFieldFilter: new List(["system"]) }); + ((doc.emptyNote as Doc).proto as Doc)["dragFactory-count"] = 0; + } + if (doc.emptyImage === undefined) { + doc.emptyImage = Docs.Create.ImageDocument("https://upload.wikimedia.org/wikipedia/commons/thumb/3/3a/Cat03.jpg/1200px-Cat03.jpg", { _width: 250, _nativeWidth: 250, title: "an image of a cat", system: true }); + } + if (doc.emptyButton === undefined) { + doc.emptyButton = Docs.Create.ButtonDocument({ _width: 150, _height: 50, _xPadding: 10, _yPadding: 10, title: "Button", system: true, cloneFieldFilter: new List(["system"]) }); + ((doc.emptyButton as Doc).proto as Doc)["dragFactory-count"] = 0; + } + if (doc.emptyWebpage === undefined) { + doc.emptyWebpage = Docs.Create.WebDocument("", { title: "webpage", _nativeWidth: 850, isTemplateDoc: true, _height: 512, _width: 400, useCors: true, system: true, cloneFieldFilter: new List(["system"]) }); + } + if (doc.activeMobileMenu === undefined) { + this.setupActiveMobileMenu(doc); + } + return [ + { toolTip: "Tap to create a note in a new pane, drag for a note", title: "Note", icon: "sticky-note", click: 'openOnRight(copyDragFactory(this.clickFactory))', drag: 'copyDragFactory(this.dragFactory)', dragFactory: doc.emptyNote as Doc, noviceMode: true, clickFactory: doc.emptyNote as Doc, }, + { toolTip: "Tap to create a collection in a new pane, drag for a collection", title: "Col", icon: "folder", click: 'openOnRight(copyDragFactory(this.clickFactory))', drag: 'copyDragFactory(this.dragFactory)', dragFactory: doc.emptyCollection as Doc, noviceMode: true, clickFactory: doc.emptyPane as Doc, }, + { toolTip: "Tap to create a webpage in a new pane, drag for a webpage", title: "Web", icon: "globe-asia", click: 'openOnRight(copyDragFactory(this.dragFactory))', drag: 'copyDragFactory(this.dragFactory)', dragFactory: doc.emptyWebpage as Doc, noviceMode: true }, + { toolTip: "Tap to create a progressive slide", title: "Slide", icon: "file", click: 'openOnRight(copyDragFactory(this.dragFactory))', drag: 'copyDragFactory(this.dragFactory)', dragFactory: doc.emptySlide as Doc, noviceMode: true }, + { toolTip: "Tap to create a cat image in a new pane, drag for a cat image", title: "Image", icon: "cat", click: 'openOnRight(copyDragFactory(this.dragFactory))', drag: 'copyDragFactory(this.dragFactory)', dragFactory: doc.emptyImage as Doc }, + { toolTip: "Tap to create a comparison box in a new pane, drag for a comparison box", title: "Compare", icon: "columns", click: 'openOnRight(copyDragFactory(this.dragFactory))', drag: 'copyDragFactory(this.dragFactory)', dragFactory: doc.emptyComparison as Doc, noviceMode: true }, + { toolTip: "Tap to create a screen grabber in a new pane, drag for a screen grabber", title: "Grab", icon: "photo-video", click: 'openOnRight(copyDragFactory(this.dragFactory))', drag: 'copyDragFactory(this.dragFactory)', dragFactory: doc.emptyScreenshot as Doc, noviceMode: true }, + { toolTip: "Tap to create a videoWall", title: "Wall", icon: "photo-video", click: 'openOnRight(copyDragFactory(this.dragFactory))', drag: 'copyDragFactory(this.dragFactory)', dragFactory: doc.emptyWall as Doc }, + { toolTip: "Tap to create an audio recorder in a new pane, drag for an audio recorder", title: "Audio", icon: "microphone", click: 'openOnRight(copyDragFactory(this.dragFactory))', drag: 'copyDragFactory(this.dragFactory)', dragFactory: doc.emptyAudio as Doc, noviceMode: true }, + { toolTip: "Tap to create a button in a new pane, drag for a button", title: "Button", icon: "bolt", click: 'openOnRight(copyDragFactory(this.dragFactory))', drag: 'copyDragFactory(this.dragFactory)', dragFactory: doc.emptyButton as Doc }, + // { toolTip: "Tap to create a presentation in a new pane, drag for a presentation", title: "Trails", icon: "pres-trail", click: 'openOnRight(Doc.UserDoc().activePresentation = copyDragFactory(this.dragFactory))', drag: `Doc.UserDoc().activePresentation = copyDragFactory(this.dragFactory)`, dragFactory: doc.emptyPresentation as Doc, noviceMode: true }, + { toolTip: "Tap to create a scripting box in a new pane, drag for a scripting box", title: "Script", icon: "terminal", click: 'openOnRight(copyDragFactory(this.dragFactory))', drag: 'copyDragFactory(this.dragFactory)', dragFactory: doc.emptyScript as Doc }, + { toolTip: "Tap to create a mobile view in a new pane, drag for a mobile view", title: "Phone", icon: "mobile", click: 'openOnRight(Doc.UserDoc().activeMobileMenu)', drag: 'this.dragFactory', dragFactory: doc.activeMobileMenu as Doc }, + { toolTip: "Tap to create a custom header note document, drag for a custom header note", title: "Custom", icon: "window-maximize", click: 'openOnRight(delegateDragFactory(this.dragFactory))', drag: 'delegateDragFactory(this.dragFactory)', dragFactory: doc.emptyHeader as Doc }, + { toolTip: "Toggle a Calculator REPL", title: "repl", icon: "calculator", click: 'addOverlayWindow("ScriptingRepl", { x: 300, y: 100, width: 200, height: 200, title: "Scripting REPL" })' }, + ]; + + } + + // setup the "creator" buttons for the sidebar-- eg. the default set of draggable document creation tools + static async setupCreatorButtons(doc: Doc) { + let alreadyCreatedButtons: string[] = []; + const dragCreatorSet = await Cast(doc.myItemCreators, Doc, null); + if (dragCreatorSet) { + const dragCreators = await Cast(dragCreatorSet.data, listSpec(Doc)); + if (dragCreators) { + const dragDocs = await Promise.all(dragCreators); + alreadyCreatedButtons = dragDocs.map(d => StrCast(d.title)); + } + } + const buttons = CurrentUserUtils.creatorBtnDescriptors(doc).filter(d => !alreadyCreatedButtons?.includes(d.title)); + const creatorBtns = buttons.map(({ title, toolTip, icon, ignoreClick, drag, click, backgroundColor, dragFactory, noviceMode, clickFactory }) => Docs.Create.FontIconDocument({ + _nativeWidth: 50, _nativeHeight: 50, _width: 30, _height: 25, + icon, + title, + toolTip, + btnType: ButtonType.ClickButton, + ignoreClick, + _dropAction: "alias", + onDragStart: drag ? ScriptField.MakeFunction(drag) : undefined, + onClick: click ? ScriptField.MakeScript(click) : undefined, + backgroundColor, + _hideContextMenu: true, + _removeDropProperties: new List(["_stayInCollection"]), + _stayInCollection: true, + dragFactory, + clickFactory, + hidden: !noviceMode ? ComputedField.MakeFunction("IsNoviceMode()") as any : undefined, + system: true, + })); + + if (dragCreatorSet === undefined) { + doc.myItemCreators = new PrefetchProxy(Docs.Create.MasonryDocument(creatorBtns, { + title: "Basic Item Creators", _showTitle: "title", _xMargin: 0, _stayInCollection: true, _hideContextMenu: true, _chromeHidden: true, + _autoHeight: true, _width: 500, _height: 300, _fitWidth: true, _columnWidth: 35, ignoreClick: true, _lockedPosition: true, + dropConverter: ScriptField.MakeScript("convertToButtons(dragData)", { dragData: DragManager.DocumentDragData.name }), system: true + })); + } else { + creatorBtns.forEach(nb => Doc.AddDocToList(doc.myItemCreators as Doc, "data", nb)); + } + return doc.myItemCreators as Doc; + } + + static async menuBtnDescriptions(doc: Doc) { + return [ + { title: "Dashboards", target: Cast(doc.myDashboards, Doc, null), icon: "desktop", click: 'selectMainMenu(self)' }, + { title: "My Files", target: Cast(doc.myFilesystem, Doc, null), icon: "file", click: 'selectMainMenu(self)' }, + { title: "Tools", target: Cast(doc.myTools, Doc, null), icon: "wrench", click: 'selectMainMenu(self)' }, + { title: "Import", target: Cast(doc.myImportPanel, Doc, null), icon: "upload", click: 'selectMainMenu(self)' }, + { title: "Recently Closed", target: Cast(doc.myRecentlyClosedDocs, Doc, null), icon: "archive", click: 'selectMainMenu(self)' }, + { title: "Sharing", target: Cast(doc.mySharedDocs, Doc, null), icon: "users", click: 'selectMainMenu(self)', watchedDocuments: doc.mySharedDocs as Doc }, + // { title: "Filter", target: Cast(doc.currentFilter, Doc, null), icon: "filter", click: 'selectMainMenu(self)' }, + { title: "Pres. Trails", target: Cast(doc.myPresentations, Doc, null), icon: "pres-trail", click: 'selectMainMenu(self)' }, + // { title: "Help", target: undefined as any, icon: "question-circle", click: 'selectMainMenu(self)' }, + // { title: "Settings", target: undefined as any, icon: "cog", click: 'selectMainMenu(self)' }, + { title: "User Doc", target: Cast(doc.myUserDoc, Doc, null), icon: "address-card", click: 'selectMainMenu(self)' }, + ]; + } + + static setupSearchPanel(doc: Doc) { + if (doc.mySearchPanelDoc === undefined) { + doc.mySearchPanelDoc = new PrefetchProxy(Docs.Create.SearchDocument({ + _width: 500, _height: 300, backgroundColor: "dimGray", ignoreClick: true, _searchDoc: true, + childDropAction: "alias", _lockedPosition: true, _viewType: CollectionViewType.Schema, title: "sidebar search stack", system: true + })) as any as Doc; + } + } + static async setupMenuPanel(doc: Doc, sharingDocumentId: string, linkDatabaseId: string) { + if (doc.menuStack === undefined) { + await this.setupSharingSidebar(doc, sharingDocumentId, linkDatabaseId); // sets up the right sidebar collection for mobile upload documents and sharing + const menuBtns = (await CurrentUserUtils.menuBtnDescriptions(doc)).map(({ title, target, icon, click, watchedDocuments }) => + Docs.Create.FontIconDocument({ + icon, + btnType: ButtonType.MenuButton, + _stayInCollection: true, + _hideContextMenu: true, + system: true, + dontUndo: true, + title, + target, + _dropAction: "alias", + _removeDropProperties: new List(["dropAction", "_stayInCollection"]), + _width: 60, + _height: 60, + watchedDocuments, + onClick: ScriptField.MakeScript(click, { scriptContext: "any" }) + })); + // hack -- last button is assumed to be the userDoc + menuBtns[menuBtns.length - 1].hidden = ComputedField.MakeFunction("IsNoviceMode()"); + + doc.menuStack = new PrefetchProxy(Docs.Create.StackingDocument(menuBtns, { + title: "menuItemPanel", + childDropAction: "alias", + _chromeHidden: true, + dropConverter: ScriptField.MakeScript("convertToButtons(dragData)", { dragData: DragManager.DocumentDragData.name }), + ignoreClick: true, + _gridGap: 0, + _yMargin: 0, + _yPadding: 0, _xMargin: 0, _autoHeight: false, _width: 60, _columnWidth: 60, _lockedPosition: true, system: true + })); + } + // this resets all sidebar buttons to being deactivated + PromiseValue(Cast(doc.menuStack, Doc)).then(stack => { + stack && PromiseValue(stack.data).then(btns => { + DocListCastAsync(btns).then(bts => bts?.forEach(btn => { + btn.dontUndo = true; + btn.system = true; + if (btn.title === "Catalog" || btn.title === "My Files") { // migration from Catalog to My Files + btn.target = Doc.UserDoc().myFilesystem; + btn.title = "My Files"; + } + })); + }); + }); + return doc.menuStack as Doc; + } + + + // Sets up mobile menu if it is undefined creates a new one, otherwise returns existing menu + static setupActiveMobileMenu(doc: Doc) { + if (doc.activeMobileMenu === undefined) { + doc.activeMobileMenu = this.setupMobileMenu(); + } + return doc.activeMobileMenu as Doc; + } + + // Sets up mobileMenu stacking document + static setupMobileMenu() { + const menu = new PrefetchProxy(Docs.Create.StackingDocument(this.setupMobileButtons(), { + _width: 980, ignoreClick: true, _lockedPosition: false, title: "home", _yMargin: 100, system: true, _chromeHidden: true, + })); + return menu; + } + + // SEts up mobile buttons for inside mobile menu + static setupMobileButtons(doc?: Doc, buttons?: string[]) { + const docProtoData: { title: string, icon: string, drag?: string, ignoreClick?: boolean, click?: string, activePen?: Doc, backgroundColor?: string, info: string, dragFactory?: Doc }[] = [ + { title: "DASHBOARDS", icon: "bars", click: 'switchToMobileLibrary()', backgroundColor: "lightgrey", info: "Access your Dashboards from your mobile, and navigate through all of your documents. " }, + { title: "UPLOAD", icon: "upload", click: 'openMobileUploads()', backgroundColor: "lightgrey", info: "Upload files from your mobile device so they can be accessed on Dash Web." }, + { title: "MOBILE UPLOAD", icon: "mobile", click: 'switchToMobileUploadCollection()', backgroundColor: "lightgrey", info: "Access the collection of your mobile uploads." }, + { title: "RECORD", icon: "microphone", click: 'openMobileAudio()', backgroundColor: "lightgrey", info: "Use your phone to record, dictate and then upload audio onto Dash Web." }, + { title: "PRESENTATION", icon: "desktop", click: 'switchToMobilePresentation()', backgroundColor: "lightgrey", info: "Use your phone as a remote for you presentation." }, + { title: "SETTINGS", icon: "cog", click: 'openMobileSettings()', backgroundColor: "lightgrey", info: "Change your password, log out, or manage your account security." } + ]; + // returns a list of mobile buttons + return docProtoData.filter(d => !buttons || !buttons.includes(d.title)).map(data => + this.mobileButton({ + title: data.title, + _lockedPosition: true, + onClick: data.click ? ScriptField.MakeScript(data.click) : undefined, + backgroundColor: data.backgroundColor, system: true + }, + [this.ficon({ ignoreClick: true, icon: data.icon, backgroundColor: "rgba(0,0,0,0)", btnType: ButtonType.ClickButton, system: true }), this.mobileTextContainer({}, [this.mobileButtonText({}, data.title), this.mobileButtonInfo({}, data.info)])]) + ); + } + + // sets up the main document for the mobile button + static mobileButton = (opts: DocumentOptions, docs: Doc[]) => Docs.Create.MulticolumnDocument(docs, { + ...opts, + _removeDropProperties: new List(["dropAction"]), _nativeWidth: 900, _nativeHeight: 250, _width: 900, _height: 250, _yMargin: 15, + borderRounding: "5px", boxShadow: "0 0", system: true + }) as any as Doc + + // sets up the text container for the information contained within the mobile button + static mobileTextContainer = (opts: DocumentOptions, docs: Doc[]) => Docs.Create.MultirowDocument(docs, { + ...opts, + _removeDropProperties: new List(["dropAction"]), _nativeWidth: 450, _nativeHeight: 250, _width: 450, _height: 250, _yMargin: 25, + backgroundColor: "rgba(0,0,0,0)", borderRounding: "0", boxShadow: "0 0", ignoreClick: true, system: true + }) as any as Doc + + // Sets up the title of the button + static mobileButtonText = (opts: DocumentOptions, buttonTitle: string) => Docs.Create.TextDocument(buttonTitle, { + ...opts, + title: buttonTitle, _fontSize: "37px", _xMargin: 0, _yMargin: 0, ignoreClick: true, backgroundColor: "rgba(0,0,0,0)", system: true + }) as any as Doc + + // Sets up the description of the button + static mobileButtonInfo = (opts: DocumentOptions, buttonInfo: string) => Docs.Create.TextDocument(buttonInfo, { + ...opts, + title: "info", _fontSize: "25px", _xMargin: 0, _yMargin: 0, ignoreClick: true, backgroundColor: "rgba(0,0,0,0)", _dimMagnitude: 2, system: true + }) as any as Doc + + + static setupThumbButtons(doc: Doc) { + const docProtoData: { title: string, icon: string, drag?: string, ignoreClick?: boolean, pointerDown?: string, pointerUp?: string, clipboard?: Doc, backgroundColor?: string, dragFactory?: Doc }[] = [ + { title: "use pen", icon: "pen-nib", pointerUp: "resetPen()", pointerDown: 'setPen(2, this.backgroundColor)', backgroundColor: "blue" }, + { title: "use highlighter", icon: "highlighter", pointerUp: "resetPen()", pointerDown: 'setPen(20, this.backgroundColor)', backgroundColor: "yellow" }, + { title: "notepad", icon: "clipboard", pointerUp: "GestureOverlay.Instance.closeFloatingDoc()", pointerDown: 'GestureOverlay.Instance.openFloatingDoc(this.clipboard)', clipboard: Docs.Create.FreeformDocument([], { _width: 300, _height: 300, system: true }), backgroundColor: "orange" }, + { title: "interpret text", icon: "font", pointerUp: "setToolglass('none')", pointerDown: "setToolglass('inktotext')", backgroundColor: "orange" }, + { title: "ignore gestures", icon: "signature", pointerUp: "setToolglass('none')", pointerDown: "setToolglass('ignoregesture')", backgroundColor: "green" }, + ]; + return docProtoData.map(data => Docs.Create.FontIconDocument({ + _nativeWidth: 10, _nativeHeight: 10, _width: 10, _height: 10, title: data.title, icon: data.icon, + _dropAction: data.pointerDown ? "copy" : undefined, ignoreClick: data.ignoreClick, + onDragStart: data.drag ? ScriptField.MakeFunction(data.drag) : undefined, + clipboard: data.clipboard, + onPointerUp: data.pointerUp ? ScriptField.MakeScript(data.pointerUp) : undefined, onPointerDown: data.pointerDown ? ScriptField.MakeScript(data.pointerDown) : undefined, + backgroundColor: data.backgroundColor, + _removeDropProperties: new List(["dropAction"]), dragFactory: data.dragFactory, system: true + })); + } + + static setupThumbDoc(userDoc: Doc) { + if (!userDoc.thumbDoc) { + const thumbDoc = Docs.Create.LinearDocument(CurrentUserUtils.setupThumbButtons(userDoc), { + _width: 100, _height: 50, ignoreClick: true, _lockedPosition: true, title: "buttons", + _autoHeight: true, _yMargin: 5, linearViewIsExpanded: true, backgroundColor: "white", system: true + }); + thumbDoc.inkToTextDoc = Docs.Create.LinearDocument([], { + _width: 300, _height: 25, _autoHeight: true, linearViewIsExpanded: true, flexDirection: "column", system: true + }); + userDoc.thumbDoc = thumbDoc; + } + return Cast(userDoc.thumbDoc, Doc); + } + + static setupMobileInkingDoc(userDoc: Doc) { + return Docs.Create.FreeformDocument([], { title: "Mobile Inking", backgroundColor: "white", system: true }); + } + + static setupMobileUploadDoc(userDoc: Doc) { + // const addButton = Docs.Create.FontIconDocument({ onDragStart: ScriptField.MakeScript('addWebToMobileUpload()'), title: "Add Web Doc to Upload Collection", icon: "plus", backgroundColor: "black" }) + const webDoc = Docs.Create.WebDocument("https://www.britannica.com/biography/Miles-Davis", { + title: "Upload Images From the Web", _lockedPosition: true, system: true + }); + const uploadDoc = Docs.Create.StackingDocument([], { + title: "Mobile Upload Collection", backgroundColor: "white", _lockedPosition: true, system: true, _chromeHidden: true, + }); + return Docs.Create.StackingDocument([webDoc, uploadDoc], { + _width: screen.width, _lockedPosition: true, title: "Upload", _autoHeight: true, _yMargin: 80, backgroundColor: "lightgray", system: true, _chromeHidden: true, + }); + } + + static setupLibrary(userDoc: Doc) { + return CurrentUserUtils.setupDashboards(userDoc); + } + + // setup the Creator button which will display the creator panel. This panel will include the drag creators and the color picker. + // when clicked, this panel will be displayed in the target container (ie, sidebarContainer) + static async setupToolsBtnPanel(doc: Doc) { + // setup a masonry view of all he creators + const creatorBtns = await CurrentUserUtils.setupCreatorButtons(doc); + const templateBtns = CurrentUserUtils.setupUserTemplateButtons(doc); + + doc["tabs-button-tools"] = undefined; + + if (doc.myCreators === undefined) { + doc.myCreators = new PrefetchProxy(Docs.Create.StackingDocument([creatorBtns, templateBtns], { + title: "all Creators", _yMargin: 0, _autoHeight: true, _xMargin: 0, _fitWidth: true, + _width: 500, _height: 300, ignoreClick: true, _lockedPosition: true, system: true, _chromeHidden: true, + })); + } + // setup a color picker + if (doc.myColorPicker === undefined) { + const color = Docs.Create.ColorDocument({ + title: "color picker", ignoreClick: true, _width: 220, _dropAction: "alias", _hideContextMenu: true, _stayInCollection: true, _forceActive: true, _removeDropProperties: new List(["dropAction", "_stayInCollection", "_hideContextMenu", "forceActive"]), system: true + }); + doc.myColorPicker = new PrefetchProxy(color); + } + + if (doc.myTools === undefined) { + const toolsStack = new PrefetchProxy(Docs.Create.StackingDocument([doc.myCreators as Doc, doc.myColorPicker as Doc], { + title: "My Tools", _showTitle: "title", _width: 500, _yMargin: 20, ignoreClick: true, _lockedPosition: true, _forceActive: true, + system: true, _stayInCollection: true, _hideContextMenu: true, _chromeHidden: true, boxShadow: "0 0", + })) as any as Doc; + + doc.myTools = toolsStack; + } + } + + static async setupDashboards(doc: Doc) { + // setup dashboards library item + await doc.myDashboards; + if (doc.myDashboards === undefined) { + doc.myDashboards = new PrefetchProxy(Docs.Create.TreeDocument([], { + title: "My Dashboards", _showTitle: "title", _height: 400, childHideLinkButton: true, + treeViewHideTitle: true, _xMargin: 5, _yMargin: 5, _gridGap: 5, _forceActive: true, childDropAction: "alias", + treeViewTruncateTitleWidth: 150, ignoreClick: true, + _lockedPosition: true, boxShadow: "0 0", childDontRegisterViews: true, targetDropAction: "same", system: true + })); + const newDashboard = ScriptField.MakeScript(`createNewDashboard(Doc.UserDoc())`); + (doc.myDashboards as any as Doc).contextMenuScripts = new List([newDashboard!]); + (doc.myDashboards as any as Doc).contextMenuLabels = new List(["Create New Dashboard"]); + } + return doc.myDashboards as any as Doc; + } + + static async setupPresentations(doc: Doc) { + await doc.myPresentations; + if (doc.myPresentations === undefined) { + doc.myPresentations = new PrefetchProxy(Docs.Create.TreeDocument([], { + title: "My Trails", _showTitle: "title", _height: 100, + treeViewHideTitle: true, _xMargin: 5, _yMargin: 5, _gridGap: 5, _forceActive: true, childDropAction: "alias", + treeViewTruncateTitleWidth: 150, ignoreClick: true, + _lockedPosition: true, boxShadow: "0 0", childDontRegisterViews: true, targetDropAction: "same", system: true + })); + const newPresentations = ScriptField.MakeScript(`createNewPresentation()`); + (doc.myPresentations as any as Doc).contextMenuScripts = new List([newPresentations!]); + (doc.myPresentations as any as Doc).contextMenuLabels = new List(["Create New Presentation"]); + const presentations = doc.myPresentations as any as Doc; + } + return doc.myPresentations as any as Doc; + } + + static async setupFilesystem(doc: Doc) { + await doc.myFilesystem; + if (doc.myFilesystem === undefined) { + doc.myFileOrphans = Docs.Create.TreeDocument([], { title: "Unfiled", _stayInCollection: true, system: true, isFolder: true }); + doc.myFileRoot = Docs.Create.TreeDocument([], { title: "file root", _stayInCollection: true, system: true, isFolder: true }); + doc.myFilesystem = new PrefetchProxy(Docs.Create.TreeDocument([doc.myFileRoot as Doc, doc.myFileOrphans as Doc], { + title: "My Documents", _showTitle: "title", _height: 100, + treeViewHideTitle: true, _xMargin: 5, _yMargin: 5, _gridGap: 5, _forceActive: true, childDropAction: "alias", + treeViewTruncateTitleWidth: 150, ignoreClick: true, + isFolder: true, treeViewType: "fileSystem", childHideLinkButton: true, + _lockedPosition: true, boxShadow: "0 0", childDontRegisterViews: true, targetDropAction: "proto", system: true + })); + } + return doc.myFilesystem as any as Doc; + } + + static setupRecentlyClosedDocs(doc: Doc) { + // setup Recently Closed library item + if (doc.myRecentlyClosedDocs === undefined) { + doc.myRecentlyClosedDocs = new PrefetchProxy(Docs.Create.TreeDocument([], { + title: "Recently Closed", _showTitle: "title", treeViewShowClearButton: true, childHideLinkButton: true, + treeViewHideTitle: true, _xMargin: 5, _yMargin: 5, _gridGap: 5, _forceActive: true, childDropAction: "alias", + treeViewTruncateTitleWidth: 150, ignoreClick: true, + _lockedPosition: true, boxShadow: "0 0", childDontRegisterViews: true, targetDropAction: "same", system: true + })); + const clearAll = ScriptField.MakeScript(`getProto(self).data = new List([])`); + (doc.myRecentlyClosedDocs as any as Doc).contextMenuScripts = new List([clearAll!]); + (doc.myRecentlyClosedDocs as any as Doc).contextMenuLabels = new List(["Clear All"]); + } + } + static setupFilterDocs(doc: Doc) { + // setup Filter item + if (doc.currentFilter === undefined) { + doc.currentFilter = Docs.Create.FilterDocument({ + title: "unnamed filter", _height: 150, + treeViewHideTitle: true, _xMargin: 5, _yMargin: 5, _gridGap: 5, _forceActive: true, childDropAction: "none", + treeViewTruncateTitleWidth: 150, ignoreClick: true, + _lockedPosition: true, boxShadow: "0 0", childDontRegisterViews: true, targetDropAction: "same", system: true, _autoHeight: true, _fitWidth: true + }); + const clearAll = ScriptField.MakeScript(`getProto(self).data = new List([])`); + (doc.currentFilter as Doc).contextMenuScripts = new List([clearAll!]); + (doc.currentFilter as Doc).contextMenuLabels = new List(["Clear All"]); + (doc.currentFilter as Doc).filterBoolean = "AND"; + } + } + + static setupUserDoc(doc: Doc) { + if (doc.myUserDoc === undefined) { + doc.treeViewOpen = true; + doc.treeViewExpandedView = "fields"; + doc.myUserDoc = new PrefetchProxy(Docs.Create.TreeDocument([doc], { + treeViewHideTitle: true, _xMargin: 5, _yMargin: 5, _gridGap: 5, _forceActive: true, title: "My UserDoc", _showTitle: "title", + treeViewTruncateTitleWidth: 150, ignoreClick: true, + _lockedPosition: true, boxShadow: "0 0", childDontRegisterViews: true, targetDropAction: "same", system: true + })) as any as Doc; + } + } + + static setupSidebarContainer(doc: Doc) { + if (doc.sidebar === undefined) { + const sidebarContainer = new Doc(); + sidebarContainer.system = true; + doc.sidebar = new PrefetchProxy(sidebarContainer); + } + return doc.sidebar as Doc; + } + + // setup the list of sidebar mode buttons which determine what is displayed in the sidebar + static async setupSidebarButtons(doc: Doc) { + CurrentUserUtils.setupSidebarContainer(doc); + await CurrentUserUtils.setupToolsBtnPanel(doc); + CurrentUserUtils.setupImportSidebar(doc); + CurrentUserUtils.setupDashboards(doc); + CurrentUserUtils.setupPresentations(doc); + CurrentUserUtils.setupFilesystem(doc); + CurrentUserUtils.setupRecentlyClosedDocs(doc); + // CurrentUserUtils.setupFilterDocs(doc); + CurrentUserUtils.setupUserDoc(doc); + } + + static blist = (opts: DocumentOptions, docs: Doc[]) => new PrefetchProxy(Docs.Create.LinearDocument(docs, { + ...opts, _gridGap: 5, _xMargin: 5, _yMargin: 5, _width: 100, boxShadow: "0 0", _forceActive: true, + dropConverter: ScriptField.MakeScript("convertToButtons(dragData)", { dragData: DragManager.DocumentDragData.name }), + _lockedPosition: true, linearViewIsExpanded: true, system: true + })) as any as Doc + + static ficon = (opts: DocumentOptions) => new PrefetchProxy(Docs.Create.FontIconDocument({ + ...opts, _dropAction: "alias", _removeDropProperties: new List(["_dropAction", "stayInCollection"]), _nativeWidth: 40, _nativeHeight: 40, _width: 40, _height: 40, system: true + })) as any as Doc + + /// sets up the default list of buttons to be shown in the expanding button menu at the bottom of the Dash window + static setupDockedButtons(doc: Doc) { + if (doc["dockedBtn-undo"] === undefined) { + doc["dockedBtn-undo"] = CurrentUserUtils.ficon({ onClick: ScriptField.MakeScript("undo()"), btnType: ButtonType.ClickButton, dontUndo: true, _stayInCollection: true, _dropAction: "alias", _hideContextMenu: true, _removeDropProperties: new List(["dropAction", "_hideContextMenu", "stayInCollection"]), toolTip: "Click to undo", title: "Undo", icon: "undo-alt", system: true, canClick: 'canUndo' }); + } + if (doc["dockedBtn-redo"] === undefined) { + doc["dockedBtn-redo"] = CurrentUserUtils.ficon({ onClick: ScriptField.MakeScript("redo()"), btnType: ButtonType.ClickButton, dontUndo: true, _stayInCollection: true, _dropAction: "alias", _hideContextMenu: true, _removeDropProperties: new List(["dropAction", "_hideContextMenu", "stayInCollection"]), toolTip: "Click to redo", title: "Redo", icon: "redo-alt", system: true, canClick: 'canRedo' }); + } + if (doc.dockedBtns === undefined) { + doc.dockedBtns = CurrentUserUtils.blist({ title: "docked buttons", ignoreClick: true, linearViewExpandable: true, _height: 42 }, [doc["dockedBtn-undo"] as Doc, doc["dockedBtn-redo"] as Doc]); + } + (doc["dockedBtn-undo"] as Doc).dontUndo = true; + (doc["dockedBtn-redo"] as Doc).dontUndo = true; + } + + static textTools(doc: Doc) { + return [ + { + title: "Font", toolTip: "Font", width: 100, btnType: ButtonType.DropdownList, ignoreClick: true, + list: ["Roboto", "Roboto Mono", "Nunito", "Times New Roman", "Arial", "Georgia", + "Comic Sans MS", "Tahoma", "Impact", "Crimson Text"], + scriptDoc: Doc.UserDoc(), toggle: 'userDoc._fontFamily' + }, + { + title: "Bold", toolTip: "Bold (Ctrl+B)", btnType: ButtonType.ToggleButton, icon: "bold", click: 'toggleBold()', + scriptDoc: Doc.UserDoc(), + toggle: 'userDoc._boldActive' + }, + { title: "Italic", toolTip: "Italic (Ctrl+I)", btnType: ButtonType.ToggleButton, icon: "italic", click: 'toggleItalic()', scriptDoc: Doc.UserDoc(), toggle: 'userDoc._italicsActive' }, + { title: "Underline", toolTip: "Underline (Ctrl+U)", btnType: ButtonType.ToggleButton, icon: "underline", click: 'toggleUnderline()', scriptDoc: Doc.UserDoc(), toggle: 'userDoc._underlineActive' }, + // { title: "Strikethrough", tooltip: "Strikethrough", btnType: ButtonType.ToggleButton, icon: "strikethrough", click: 'toggleStrikethrough()', toggle: 'userDoc._underlineActive' }, + // { title: "Superscript", tooltip: "Superscript", btnType: ButtonType.ToggleButton, icon: "superscript", click: 'toggleSuperscript()', toggle: 'userDoc._underlineActive' }, + // { title: "Subscript", tooltip: "Subscript", btnType: ButtonType.ToggleButton, icon: "subscript", click: 'toggleSubscript()', toggle: 'userDoc._underlineActive' }, + { title: "Highlight", toolTip: "Highlight", btnType: ButtonType.ColorButton, icon: "highlighter", ignoreClick: true, scriptDoc: Doc.UserDoc(), userColorBtn: 'userDoc._highlightColor' }, + { title: "Text color", toolTip: "Text color", btnType: ButtonType.ColorButton, icon: "fill-drip", ignoreClick: true, scriptDoc: Doc.UserDoc(), userColorBtn: 'userDoc._textColor' }, + // { title: "Link", tooltip: "Link", btnType: ButtonType.DropdownButton, icon: "link", click: '', ignoreClick: true }, + ]; + } + + static async contextMenuBtnDescriptions(doc: Doc) { + return [ + // { title: "Perspective", tooltip: "Change document's perspective", type: "btn", btnType: ButtonType.DropdownButton, ignoreClick: true, icon: "desktop", click: '' }, + { + title: "Perspective", toolTip: "Perspective", width: 100, btnType: ButtonType.DropdownList, ignoreClick: true, + list: [CollectionViewType.Freeform, CollectionViewType.Schema, CollectionViewType.Tree, + CollectionViewType.Stacking, CollectionViewType.Masonry, CollectionViewType.Multicolumn, + CollectionViewType.Multirow, CollectionViewType.Time, CollectionViewType.Carousel, + CollectionViewType.Carousel3D, CollectionViewType.Linear, CollectionViewType.Map, + CollectionViewType.Grid], + scriptDoc: 'selectedDoc', + toggle: 'selectedDoc._viewType' + }, + { + title: "Background", toolTip: "Background", btnType: ButtonType.ColorButton, scriptDoc: 'selectedDoc', + docColorBtn: 'selectedDoc.backgroundColor', width: 60, ignoreClick: true, icon: "fill-drip", + canClick: 'numSelected > 0' + }, + { title: "Overlay", toolTip: "Overlay", btnType: ButtonType.ToggleButton, icon: "layer-group", click: 'toggleOverlay()', toggle: 'selectedDoc.z', canClick: 'numSelected > 0' }, + { title: "Text Tools", type: "TextMenu", icon: "font" }, + // { title: "Ink Tools", type: "LinearMenu", icon: "pen-nib" }, + // { title: "GFX Tools", type: "LinearMenu", icon: "shapes" }, + // { title: "Alias", btnType: ButtonType.ClickButton, icon: "copy" }, + ]; + } + + // Default context menu buttons + static async setupContextMenuButtons(doc: Doc) { + const docList: Doc[] = []; + + const contextMenuBtns = (await CurrentUserUtils.contextMenuBtnDescriptions(doc)).map(({ title, width, toolTip, ignoreClick, icon, type, btnType, click, toggle, scriptDoc, canClick, docColorBtn }) => { + const textDocList: Doc[] = []; + if (type === "TextMenu") { + const textBtns = (CurrentUserUtils.textTools(doc)).map(({ title, width, list, toolTip, ignoreClick, icon, btnType, click, toggle, scriptDoc, userColorBtn }) => { + textDocList.push(Docs.Create.FontIconDocument({ + _nativeWidth: width ? width : 25, + _nativeHeight: 25, + _width: width ? width : 25, + _height: 25, + icon, + toolTip, + userColorBtn, + // testToggle: toggle ? ScriptField.MakeScript(toggle, { this: scriptDoc, scriptContext: "any" }) : undefined, + // toggle: toggle, + btnType: btnType, + btnList: new List(list), + ignoreClick: ignoreClick, + _stayInCollection: true, + _hideContextMenu: true, + system: true, + dontUndo: true, + title, + backgroundColor: "black", + _dropAction: "alias", + _removeDropProperties: new List(["dropAction", "_stayInCollection"]), + onClick: click ? ScriptField.MakeScript(click, { scriptContext: "any" }) : undefined + })); + }); + docList.push(CurrentUserUtils.blist({ ignoreClick: true, linearViewExpandable: true, _height: 30, backgroundColor: "transparent" }, textDocList)); + } else { + docList.push(Docs.Create.FontIconDocument({ + _nativeWidth: width ? width : 30, + _nativeHeight: 30, + _width: width ? width : 30, + _height: 30, + icon, + toolTip, + // testToggle: toggle ? ScriptField.MakeScript(toggle, { scriptContext: "any" }) : undefined, + // toggle: toggle, + docColorBtn, + canClick: canClick, + btnType: btnType, + ignoreClick: ignoreClick, + _stayInCollection: true, + _hideContextMenu: true, + system: true, + dontUndo: true, + title, + backgroundColor: "black", + _dropAction: "alias", + _removeDropProperties: new List(["dropAction", "_stayInCollection"]), + onClick: click ? ScriptField.MakeScript(click, { scriptContext: "any" }) : undefined + })); + } + }); + + if (doc.contextMenuBtns === undefined) { + doc.contextMenuBtns = CurrentUserUtils.blist({ title: "menu buttons", ignoreClick: true, linearViewExpandable: false, _height: 35 }, docList); + } + } + + // sets up the default set of documents to be shown in the Overlay layer + static setupOverlays(doc: Doc) { + if (doc.myOverlayDocs === undefined) { + doc.myOverlayDocs = new PrefetchProxy(Docs.Create.FreeformDocument([], { title: "overlay documents", backgroundColor: "#aca3a6", system: true })); + } + } + + // the initial presentation Doc to use + static setupDefaultPresentation(doc: Doc) { + if (doc["template-presentation"] === undefined) { + doc["template-presentation"] = new PrefetchProxy(Docs.Create.PresElementBoxDocument({ + title: "pres element template", backgroundColor: "transparent", _xMargin: 5, _fitWidth: true, _height: 46, isTemplateDoc: true, isTemplateForField: "data", system: true + })); + } + } + + // Sharing sidebar is where shared documents are contained + static async setupSharingSidebar(doc: Doc, sharingDocumentId: string, linkDatabaseId: string) { + if (doc.myLinkDatabase === undefined) { + let linkDocs = Docs.newAccount ? undefined : await DocServer.GetRefField(linkDatabaseId); + if (!linkDocs) { + linkDocs = new Doc(linkDatabaseId, true); + (linkDocs as Doc).author = Doc.CurrentUserEmail; + (linkDocs as Doc).data = new List([]); + (linkDocs as Doc)["acl-Public"] = SharingPermissions.Add; + } + doc.myLinkDatabase = new PrefetchProxy(linkDocs); + } + if (doc.mySharedDocs === undefined) { + let sharedDocs = Docs.newAccount ? undefined : await DocServer.GetRefField(sharingDocumentId + "outer"); + if (!sharedDocs) { + sharedDocs = Docs.Create.StackingDocument([], { + title: "My SharedDocs", childDropAction: "alias", system: true, contentPointerEvents: "none", childLimitHeight: 0, _yMargin: 50, _gridGap: 15, + _showTitle: "title", ignoreClick: true, _lockedPosition: true, "acl-Public": SharingPermissions.Add, "_acl-Public": SharingPermissions.Add, + _chromeHidden: true, boxShadow: "0 0", + }, sharingDocumentId + "outer", sharingDocumentId); + (sharedDocs as Doc)["acl-Public"] = (sharedDocs as Doc)[DataSym]["acl-Public"] = SharingPermissions.Add; + } + if (sharedDocs instanceof Doc) { + Doc.GetProto(sharedDocs).userColor = sharedDocs.userColor || "rgb(202, 202, 202)"; + } + doc.mySharedDocs = new PrefetchProxy(sharedDocs); + } + } + + // Import sidebar is where shared documents are contained + static setupImportSidebar(doc: Doc) { + if (doc.myImportDocs === undefined) { + doc.myImportDocs = new PrefetchProxy(Docs.Create.StackingDocument([], { + title: "My ImportDocuments", _forceActive: true, ignoreClick: true, _stayInCollection: true, _hideContextMenu: true, childLimitHeight: 0, + childDropAction: "alias", _autoHeight: true, _yMargin: 50, _gridGap: 15, _lockedPosition: true, system: true, _chromeHidden: true, + })); + } + if (doc.myImportPanel === undefined) { + const uploads = Cast(doc.myImportDocs, Doc, null); + const newUpload = CurrentUserUtils.ficon({ onClick: ScriptField.MakeScript("importDocument()"), btnType: ButtonType.ClickButton, toolTip: "Import External document", _stayInCollection: true, _hideContextMenu: true, title: "Import", icon: "upload", system: true }); + doc.myImportPanel = new PrefetchProxy(Docs.Create.StackingDocument([newUpload, uploads], { title: "My ImportPanel", _yMargin: 20, _showTitle: "title", ignoreClick: true, _chromeHidden: true, _stayInCollection: true, _hideContextMenu: true, _lockedPosition: true, system: true, boxShadow: "0 0" })); + } + } + + static setupClickEditorTemplates(doc: Doc) { + if (doc["clickFuncs-child"] === undefined) { + // to use this function, select it from the context menu of a collection. then edit the onChildClick script. Add two Doc variables: 'target' and 'thisContainer', then assign 'target' to some target collection. After that, clicking on any document in the initial collection will open it in the target + const openInTarget = Docs.Create.ScriptingDocument(ScriptField.MakeScript( + "docCast(thisContainer.target).then((target) => target && (target.proto.data = new List([self]))) ", + { thisContainer: Doc.name }), { + title: "Click to open in target", _width: 300, _height: 200, + targetScriptKey: "onChildClick", system: true + }); + + const openDetail = Docs.Create.ScriptingDocument(ScriptField.MakeScript( + "openOnRight(self.doubleClickView)", + {}), { title: "Double click to open doubleClickView", _width: 300, _height: 200, targetScriptKey: "onChildDoubleClick", system: true }); + + doc["clickFuncs-child"] = Docs.Create.TreeDocument([openInTarget, openDetail], { title: "on Child Click function templates", system: true }); + } + // this is equivalent to using PrefetchProxies to make sure all the childClickFuncs have been retrieved. + PromiseValue(Cast(doc["clickFuncs-child"], Doc)).then(func => func && PromiseValue(func.data).then(DocListCast)); + + if (doc.clickFuncs === undefined) { + const onClick = Docs.Create.ScriptingDocument(undefined, { + title: "onClick", "onClick-rawScript": "console.log('click')", + isTemplateDoc: true, isTemplateForField: "onClick", _width: 300, _height: 200, system: true + }, "onClick"); + const onChildClick = Docs.Create.ScriptingDocument(undefined, { + title: "onChildClick", "onChildClick-rawScript": "console.log('child click')", + isTemplateDoc: true, isTemplateForField: "onChildClick", _width: 300, _height: 200, system: true + }, "onChildClick"); + const onDoubleClick = Docs.Create.ScriptingDocument(undefined, { + title: "onDoubleClick", "onDoubleClick-rawScript": "console.log('double click')", + isTemplateDoc: true, isTemplateForField: "onDoubleClick", _width: 300, _height: 200, system: true + }, "onDoubleClick"); + const onChildDoubleClick = Docs.Create.ScriptingDocument(undefined, { + title: "onChildDoubleClick", "onChildDoubleClick-rawScript": "console.log('child double click')", + isTemplateDoc: true, isTemplateForField: "onChildDoubleClick", _width: 300, _height: 200, system: true + }, "onChildDoubleClick"); + const onCheckedClick = Docs.Create.ScriptingDocument(undefined, { + title: "onCheckedClick", "onCheckedClick-rawScript": "console.log(heading + checked + containingTreeView)", + "onCheckedClick-params": new List(["heading", "checked", "containingTreeView"]), isTemplateDoc: true, + isTemplateForField: "onCheckedClick", _width: 300, _height: 200, system: true + }, "onCheckedClick"); + doc.clickFuncs = Docs.Create.TreeDocument([onClick, onChildClick, onDoubleClick, onCheckedClick], { title: "onClick funcs", system: true }); + } + PromiseValue(Cast(doc.clickFuncs, Doc)).then(func => func && PromiseValue(func.data).then(DocListCast)); + + return doc.clickFuncs as Doc; + } + + static async updateUserDocument(doc: Doc, sharingDocumentId: string, linkDatabaseId: string) { + if (!doc.globalGroupDatabase) doc.globalGroupDatabase = Docs.Prototypes.MainGroupDocument(); + const groups = await DocListCastAsync((doc.globalGroupDatabase as Doc).data); + reaction(() => DateCast((doc.globalGroupDatabase as Doc)["data-lastModified"]), + async () => { + const groups = await DocListCastAsync((doc.globalGroupDatabase as Doc).data); + const mygroups = groups?.filter(group => JSON.parse(StrCast(group.members)).includes(Doc.CurrentUserEmail)) || []; + SnappingManager.SetCachedGroups(["Public", ...mygroups?.map(g => StrCast(g.title))]); + }, { fireImmediately: true }); + // Document properties on load + doc.system = true; + doc.noviceMode = doc.noviceMode === undefined ? "true" : doc.noviceMode; + doc.title = Doc.CurrentUserEmail; + doc._raiseWhenDragged = true; + doc._showLabel = false; + doc._showMenuLabel = true; + doc.activeInkColor = StrCast(doc.activeInkColor, "rgb(0, 0, 0)"); + doc.activeInkWidth = StrCast(doc.activeInkWidth, "1"); + doc.activeInkBezier = StrCast(doc.activeInkBezier, "0"); + doc.activeFillColor = StrCast(doc.activeFillColor, ""); + doc.activeArrowStart = StrCast(doc.activeArrowStart, ""); + doc.activeArrowEnd = StrCast(doc.activeArrowEnd, ""); + doc.activeDash = StrCast(doc.activeDash, "0"); + doc.fontSize = StrCast(doc.fontSize, "12px"); + doc.fontFamily = StrCast(doc.fontFamily, "Arial"); + doc.fontColor = StrCast(doc.fontColor, "black"); + doc.fontHighlight = StrCast(doc.fontHighlight, ""); + doc.defaultAclPrivate = BoolCast(doc.defaultAclPrivate, true); + doc.activeCollectionBackground = StrCast(doc.activeCollectionBackground, "white"); + doc.activeCollectionNestedBackground = Cast(doc.activeCollectionNestedBackground, "string", null); + doc.noviceMode = BoolCast(doc.noviceMode, true); + doc["constants-snapThreshold"] = NumCast(doc["constants-snapThreshold"], 10); // + doc["constants-dragThreshold"] = NumCast(doc["constants-dragThreshold"], 4); // + Utils.DRAG_THRESHOLD = NumCast(doc["constants-dragThreshold"]); + doc.savedFilters = new List(); + doc.filterDocCount = 0; + this.setupDefaultIconTemplates(doc); // creates a set of icon templates triggered by the document deoration icon + this.setupDocTemplates(doc); // sets up the template menu of templates + this.setupActiveMobileMenu(doc); // sets up the current mobile menu for Dash Mobile + this.setupSearchPanel(doc); + this.setupOverlays(doc); // documents in overlay layer + this.setupDockedButtons(doc); // the bottom bar of font icons + this.setupContextMenuButtons(doc); //buttons for context menu + await this.setupSidebarButtons(doc); // the pop-out left sidebar of tools/panels + await this.setupMenuPanel(doc, sharingDocumentId, linkDatabaseId); + if (!doc.globalScriptDatabase) doc.globalScriptDatabase = Docs.Prototypes.MainScriptDocument(); + + setTimeout(() => this.setupDefaultPresentation(doc), 0); // presentation that's initially triggered + + // setup reactions to change the highlights on the undo/redo buttons -- would be better to encode this in the undo/redo buttons, but the undo/redo stacks are not wired up that way yet + // doc["dockedBtn-undo"] && reaction(() => UndoManager.undoStack.slice(), () => Doc.GetProto(doc["dockedBtn-undo"] as Doc).opacity = UndoManager.CanUndo() ? 1 : 0.4, { fireImmediately: true }); + // doc["dockedBtn-redo"] && reaction(() => UndoManager.redoStack.slice(), () => Doc.GetProto(doc["dockedBtn-redo"] as Doc).opacity = UndoManager.CanRedo() ? 1 : 0.4, { fireImmediately: true }); + + // uncomment this to setup a default note style that uses the custom header layout + // PromiseValue(doc.emptyHeader).then(factory => { + // if (Cast(doc.defaultTextLayout, Doc, null)?.version !== headerViewVersion) { + // const deleg = Doc.delegateDragFactory(factory as Doc); + // deleg.title = "header"; + // doc.defaultTextLayout = new PrefetchProxy(deleg); + // Doc.AddDocToList(Cast(doc["template-notes"], Doc, null), "data", deleg); + // } + // }); + setTimeout(() => DocServer.UPDATE_SERVER_CACHE(), 2500); + doc.fieldInfos = await Docs.setupFieldInfos(); + return doc; + } + + public static async loadCurrentUser() { + return rp.get(Utils.prepend("/getCurrentUser")).then(async response => { + if (response) { + const result: { id: string, email: string, cacheDocumentIds: string } = JSON.parse(response); + Doc.CurrentUserEmail = result.email; + resolvedPorts = JSON.parse(await Networking.FetchFromServer("/resolvedPorts")); + DocServer.init(window.location.protocol, window.location.hostname, resolvedPorts.socket, result.email); + result.cacheDocumentIds && (await DocServer.GetRefFields(result.cacheDocumentIds.split(";"))); + return result; + } else { + throw new Error("There should be a user! Why does Dash think there isn't one?"); + } + }); + } + + public static async loadUserDocument(id: string) { + this.curr_id = id; + await rp.get(Utils.prepend("/getUserDocumentIds")).then(ids => { + const { userDocumentId, sharingDocumentId, linkDatabaseId } = JSON.parse(ids); + if (userDocumentId !== "guest") { + return DocServer.GetRefField(userDocumentId).then(async field => { + Docs.newAccount = !(field instanceof Doc); + await Docs.Prototypes.initialize(); + const userDoc = Docs.newAccount ? new Doc(userDocumentId, true) : field as Doc; + const updated = this.updateUserDocument(Doc.SetUserDoc(userDoc), sharingDocumentId, linkDatabaseId); + (await DocListCastAsync(Cast(Doc.UserDoc().myLinkDatabase, Doc, null)?.data))?.forEach(async link => { // make sure anchors are loaded to avoid incremental updates to computedFn's in LinkManager + const a1 = await Cast(link?.anchor1, Doc, null); + const a2 = await Cast(link?.anchor2, Doc, null); + }); + return updated; + }); + } else { + throw new Error("There should be a user id! Why does Dash think there isn't one?"); + } + }); + } + + public static _urlState: HistoryUtil.DocUrl; + + public static openDashboard = (userDoc: Doc, doc: Doc, fromHistory = false) => { + CurrentUserUtils.MainDocId = doc[Id]; + + if (doc) { // this has the side-effect of setting the main container since we're assigning the active/guest dashboard + !("presentationView" in doc) && (doc.presentationView = new List([Docs.Create.TreeDocument([], { title: "Presentation" })])); + userDoc ? (userDoc.activeDashboard = doc) : (CurrentUserUtils.GuestDashboard = doc); + } + const state = CurrentUserUtils._urlState; + if (state.sharing === true && !userDoc) { + DocServer.Control.makeReadOnly(); + } else { + fromHistory || HistoryUtil.pushState({ + type: "doc", + docId: doc[Id], + readonly: state.readonly, + nro: state.nro, + sharing: false, + }); + if (state.readonly === true || state.readonly === null) { + DocServer.Control.makeReadOnly(); + } else if (state.safe) { + if (!state.nro) { + DocServer.Control.makeReadOnly(); + } + CollectionView.SetSafeMode(true); + } else if (state.nro || state.nro === null || state.readonly === false) { + } else if (doc.readOnly) { + DocServer.Control.makeReadOnly(); + } else { + DocServer.Control.makeEditable(); + } + } + + return true; + } + + public static importDocument = () => { + const input = document.createElement("input"); + input.type = "file"; + input.multiple = true; + input.accept = ".zip, application/pdf, video/*, image/*, audio/*"; + input.onchange = async _e => { + const upload = Utils.prepend("/uploadDoc"); + const formData = new FormData(); + const file = input.files && input.files[0]; + if (file && file.type === 'application/zip') { + formData.append('file', file); + formData.append('remap', "true"); + const response = await fetch(upload, { method: "POST", body: formData }); + const json = await response.json(); + if (json !== "error") { + const doc = Docs.newAccount ? undefined : await DocServer.GetRefField(json); + if (doc instanceof Doc) { + setTimeout(() => SearchUtil.Search(`{!join from=id to=proto_i}id:link*`, true, {}).then(docs => + docs.docs.forEach(d => LinkManager.Instance.addLink(d))), 2000); // need to give solr some time to update so that this query will find any link docs we've added. + } + } + } else if (input.files && input.files.length !== 0) { + const importDocs = Cast(Doc.UserDoc().myImportDocs, Doc, null); + const disposer = OverlayView.ShowSpinner(); + DocListCastAsync(importDocs.data).then(async list => { + const results = await DocUtils.uploadFilesToDocs(Array.from(input.files || []), {}); + if (results.length !== input.files?.length) { + alert("Error uploading files - possibly due to unsupported file types"); + } + list?.splice(0, 0, ...results); + disposer(); + }); + } else { + console.log("No file selected"); + } + }; + input.click(); + } + + public static async snapshotDashboard(userDoc: Doc) { + const copy = await CollectionDockingView.Copy(CurrentUserUtils.ActiveDashboard); + Doc.AddDocToList(Cast(userDoc.myDashboards, Doc, null), "data", copy); + CurrentUserUtils.openDashboard(userDoc, copy); + } + + public static createNewDashboard = async (userDoc: Doc, id?: string) => { + const myPresentations = await userDoc.myPresentations as Doc; + const presentation = Doc.MakeCopy(userDoc.emptyPresentation as Doc, true); + const dashboards = await Cast(userDoc.myDashboards, Doc) as Doc; + const dashboardCount = DocListCast(dashboards.data).length + 1; + const emptyPane = Cast(userDoc.emptyPane, Doc, null); + emptyPane["dragFactory-count"] = NumCast(emptyPane["dragFactory-count"]) + 1; + const freeformOptions: DocumentOptions = { + x: 0, + y: 400, + _width: 1500, + _height: 1000, + _fitWidth: true, + title: `Untitled Tab ${NumCast(emptyPane["dragFactory-count"])}`, + }; + const freeformDoc = CurrentUserUtils.GuestTarget || Docs.Create.FreeformDocument([], freeformOptions); + const dashboardDoc = Docs.Create.StandardCollectionDockingDocument([{ doc: freeformDoc, initialWidth: 600 }], { title: `Dashboard ${dashboardCount}` }, id, "row"); + Doc.AddDocToList(myPresentations, "data", presentation); + userDoc.activePresentation = presentation; + const toggleTheme = ScriptField.MakeScript(`Doc.UserDoc().darkScheme = !Doc.UserDoc().darkScheme`); + const toggleComic = ScriptField.MakeScript(`toggleComicMode()`); + const snapshotDashboard = ScriptField.MakeScript(`snapshotDashboard()`); + const createDashboard = ScriptField.MakeScript(`createNewDashboard()`); + dashboardDoc.contextMenuScripts = new List([toggleTheme!, toggleComic!, snapshotDashboard!, createDashboard!]); + dashboardDoc.contextMenuLabels = new List(["Toggle Theme Colors", "Toggle Comic Mode", "Snapshot Dashboard", "Create Dashboard"]); + + Doc.AddDocToList(dashboards, "data", dashboardDoc); + CurrentUserUtils.openDashboard(userDoc, dashboardDoc); + } + + public static GetNewTextDoc(title: string, x: number, y: number, width?: number, height?: number, noMargins?: boolean, annotationOn?: Doc, maxHeight?: number) { + const tbox = Docs.Create.TextDocument("", { + _xMargin: noMargins ? 0 : undefined, _yMargin: noMargins ? 0 : undefined, annotationOn, docMaxAutoHeight: maxHeight, + _width: width || 200, _height: height || 100, x: x, y: y, _fitWidth: true, _autoHeight: true, _fontSize: StrCast(Doc.UserDoc().fontSize), + _fontFamily: StrCast(Doc.UserDoc().fontFamily), title + }); + const template = Doc.UserDoc().defaultTextLayout; + if (template instanceof Doc) { + tbox._width = NumCast(template._width); + tbox.layoutKey = "layout_" + StrCast(template.title); + Doc.GetProto(tbox)[StrCast(tbox.layoutKey)] = template; + } + return tbox; + } + + public static get MySearchPanelDoc() { return Cast(Doc.UserDoc().mySearchPanelDoc, Doc, null); } + public static get ActiveDashboard() { return Cast(Doc.UserDoc().activeDashboard, Doc, null); } + public static get ActivePresentation() { return Cast(Doc.UserDoc().activePresentation, Doc, null); } + public static get MyRecentlyClosed() { return Cast(Doc.UserDoc().myRecentlyClosedDocs, Doc, null); } + public static get MyDashboards() { return Cast(Doc.UserDoc().myDashboards, Doc, null); } + public static get EmptyPane() { return Cast(Doc.UserDoc().emptyPane, Doc, null); } + public static get OverlayDocs() { return DocListCast((Doc.UserDoc().myOverlayDocs as Doc)?.data); } + public static set SelectedTool(tool: InkTool) { Doc.UserDoc().activeInkTool = tool; } + @computed public static get SelectedTool(): InkTool { return StrCast(Doc.UserDoc().activeInkTool, InkTool.None) as InkTool; } +} + +Scripting.addGlobal(function openDragFactory(dragFactory: Doc) { + const copy = Doc.copyDragFactory(dragFactory); + if (copy) { + CollectionDockingView.AddSplit(copy, "right"); + const view = DocumentManager.Instance.getFirstDocumentView(copy); + view && SelectionManager.SelectView(view, false); + } +}); +Scripting.addGlobal(function IsNoviceMode() { return Doc.UserDoc().noviceMode; }, + "is Dash in novice mode"); +Scripting.addGlobal(function snapshotDashboard() { CurrentUserUtils.snapshotDashboard(Doc.UserDoc()); }, + "creates a snapshot copy of a dashboard"); +Scripting.addGlobal(function createNewDashboard() { return CurrentUserUtils.createNewDashboard(Doc.UserDoc()); }, + "creates a new dashboard when called"); +Scripting.addGlobal(function createNewPresentation() { return MainView.Instance.createNewPresentation(); }, + "creates a new presentation when called"); +Scripting.addGlobal(function links(doc: any) { return new List(LinkManager.Instance.getAllRelatedLinks(doc)); }, + "returns all the links to the document or its annotations", "(doc: any)"); +Scripting.addGlobal(function importDocument() { return CurrentUserUtils.importDocument(); }, + "imports files from device directly into the import sidebar"); \ No newline at end of file diff --git a/src/client/views/collections/CollectionLinearView.scss b/src/client/views/collections/CollectionLinearView.scss deleted file mode 100644 index 46e40489b..000000000 --- a/src/client/views/collections/CollectionLinearView.scss +++ /dev/null @@ -1,139 +0,0 @@ -@import "../global/globalCssVariables"; -@import "../_nodeModuleOverrides"; - -.collectionLinearView-outer { - overflow: visible; - height: 100%; - pointer-events: none; - - .collectionLinearView { - display: flex; - height: 100%; - align-items: center; - - >span { - background: $dark-gray; - color: $white; - border-radius: 18px; - margin-right: 6px; - cursor: pointer; - } - - .bottomPopup-background { - background: $medium-blue; - display: flex; - border-radius: 10px; - height: 35; - transform: translate3d(6px, 0px, 0px); - align-content: center; - justify-content: center; - align-items: center; - } - - .bottomPopup-text { - color: $white; - display: inline; - white-space: nowrap; - padding-left: 8px; - padding-right: 20px; - vertical-align: middle; - font-size: 12.5px; - } - - .bottomPopup-descriptions { - cursor:pointer; - display: inline; - white-space: nowrap; - padding-left: 8px; - padding-right: 8px; - vertical-align: middle; - background-color: $light-gray; - border-radius: 3px; - color: black; - margin-right: 5px; - } - - .bottomPopup-exit { - cursor:pointer; - display: inline; - white-space: nowrap; - margin-right: 10px; - padding-left: 8px; - padding-right: 8px; - vertical-align: middle; - background-color: $close-red; - border-radius: 3px; - color: black; - } - - >label { - margin-top: "auto"; - margin-bottom: "auto"; - background: $dark-gray; - color: $white; - display: inline-block; - border-radius: 18px; - font-size: 12.5px; - width: 18px; - height: 18px; - margin-top: auto; - margin-bottom: auto; - margin-right: 3px; - cursor: pointer; - transition: transform 0.2s; - } - - label p { - padding-left: 5px; - } - - label:hover { - background: $medium-gray; - transform: scale(1.15); - } - - >input { - display: none; - } - - >input:not(:checked)~.collectionLinearView-content { - display: none; - } - - >input:checked~label { - transform: rotate(45deg); - transition: transform 0.5s; - cursor: pointer; - } - - .collectionLinearView-content { - display: flex; - opacity: 1; - position: relative; - margin-top: auto; - - .collectionLinearView-docBtn, - .collectionLinearView-docBtn-scalable { - position: relative; - margin: auto; - margin-left: 3px; - transform-origin: center 80%; - } - - .collectionLinearView-docBtn-scalable:hover { - transform: scale(1.15); - } - - .collectionLinearView-round-button { - width: 18px; - height: 18px; - border-radius: 18px; - font-size: 15px; - } - - .collectionLinearView-round-button:hover { - transform: scale(1.15); - } - } - } -} \ No newline at end of file diff --git a/src/client/views/collections/CollectionLinearView.tsx b/src/client/views/collections/CollectionLinearView.tsx deleted file mode 100644 index 52c836556..000000000 --- a/src/client/views/collections/CollectionLinearView.tsx +++ /dev/null @@ -1,193 +0,0 @@ -import { Tooltip } from '@material-ui/core'; -import { action, IReactionDisposer, observable, reaction, runInAction } from 'mobx'; -import { observer } from 'mobx-react'; -import * as React from 'react'; -import { Doc, HeightSym, WidthSym } from '../../../fields/Doc'; -import { documentSchema } from '../../../fields/documentSchemas'; -import { Id } from '../../../fields/FieldSymbols'; -import { makeInterface } from '../../../fields/Schema'; -import { BoolCast, NumCast, ScriptCast, StrCast } from '../../../fields/Types'; -import { emptyFunction, returnEmptyDoclist, returnFalse, returnTrue, Utils } from '../../../Utils'; -import { DragManager } from '../../util/DragManager'; -import { Transform } from '../../util/Transform'; -import { DocumentLinksButton } from '../nodes/DocumentLinksButton'; -import { DocumentView } from '../nodes/DocumentView'; -import { LinkDescriptionPopup } from '../nodes/LinkDescriptionPopup'; -import { StyleProp } from '../StyleProvider'; -import "./CollectionLinearView.scss"; -import { CollectionSubView } from './CollectionSubView'; -import { CollectionViewType } from './CollectionView'; - - -type LinearDocument = makeInterface<[typeof documentSchema,]>; -const LinearDocument = makeInterface(documentSchema); - -@observer -export class CollectionLinearView extends CollectionSubView(LinearDocument) { - @observable public addMenuToggle = React.createRef(); - @observable private _selectedIndex = -1; - private _dropDisposer?: DragManager.DragDropDisposer; - private _widthDisposer?: IReactionDisposer; - private _selectedDisposer?: IReactionDisposer; - - componentWillUnmount() { - this._dropDisposer?.(); - this._widthDisposer?.(); - this._selectedDisposer?.(); - this.childLayoutPairs.map((pair, ind) => ScriptCast(pair.layout.proto?.onPointerUp)?.script.run({ this: pair.layout.proto }, console.log)); - } - - componentDidMount() { - this._widthDisposer = reaction(() => 5 + (this.layoutDoc.linearViewIsExpanded ? this.childDocs.length * (this.rootDoc[HeightSym]()) : 10), - width => this.childDocs.length && (this.layoutDoc._width = width), - { fireImmediately: true } - ); - - this._selectedDisposer = reaction( - () => NumCast(this.layoutDoc.selectedIndex), - (i) => runInAction(() => { - this._selectedIndex = i; - let selected: any = undefined; - this.childLayoutPairs.map(async (pair, ind) => { - const isSelected = this._selectedIndex === ind; - if (isSelected) { - selected = pair; - } - else { - ScriptCast(pair.layout.proto?.onPointerUp)?.script.run({ this: pair.layout.proto }, console.log); - } - }); - if (selected && selected.layout) { - ScriptCast(selected.layout.proto?.onPointerDown)?.script.run({ this: selected.layout.proto }, console.log); - } - }), - { fireImmediately: true } - ); - } - protected createDashEventsTarget = (ele: HTMLDivElement) => { //used for stacking and masonry view - this._dropDisposer && this._dropDisposer(); - if (ele) { - this._dropDisposer = DragManager.MakeDropTarget(ele, this.onInternalDrop.bind(this), this.layoutDoc); - } - } - - dimension = () => NumCast(this.rootDoc._height); // 2 * the padding - getTransform = (ele: React.RefObject) => () => { - if (!ele.current) return Transform.Identity(); - const { scale, translateX, translateY } = Utils.GetScreenTransform(ele.current); - return new Transform(-translateX, -translateY, 1); - } - - @action - exitLongLinks = () => { - if (DocumentLinksButton.StartLink) { - if (DocumentLinksButton.StartLink.Document) { - action((e: React.PointerEvent) => { - Doc.UnBrushDoc(DocumentLinksButton.StartLink?.Document as Doc); - }); - } - } - DocumentLinksButton.StartLink = undefined; - DocumentLinksButton.StartLinkView = undefined; - } - - @action - changeDescriptionSetting = () => { - if (LinkDescriptionPopup.showDescriptions) { - if (LinkDescriptionPopup.showDescriptions === "ON") { - LinkDescriptionPopup.showDescriptions = "OFF"; - LinkDescriptionPopup.descriptionPopup = false; - } else { - LinkDescriptionPopup.showDescriptions = "ON"; - } - } else { - LinkDescriptionPopup.showDescriptions = "OFF"; - LinkDescriptionPopup.descriptionPopup = false; - } - } - - render() { - const guid = Utils.GenerateGuid(); - const flexDir: any = StrCast(this.Document.flexDirection); - const backgroundColor = this.props.styleProvider?.(this.rootDoc, this.props, StyleProp.BackgroundColor); - const color = this.props.styleProvider?.(this.rootDoc, this.props, StyleProp.Color); - - const menuOpener = ; - - return
-
-
{BoolCast(this.layoutDoc.linearViewIsExpanded) ? "Close menu" : "Open menu"}
} placement="top"> - {menuOpener} -
- this.layoutDoc.linearViewIsExpanded = this.addMenuToggle.current!.checked)} /> - -
- {this.childLayoutPairs.map((pair, ind) => { - const nested = pair.layout._viewType === CollectionViewType.Linear; - const dref = React.createRef(); - const scalable = pair.layout.onClick || pair.layout.onDragStart; - return
- -
; - })} -
- {DocumentLinksButton.StartLink ? e.stopPropagation()} > - - Creating link from: {DocumentLinksButton.AnnotationId ? "Annotation in " : " "} {StrCast(DocumentLinksButton.StartLink.title).length < 51 ? DocumentLinksButton.StartLink.title : StrCast(DocumentLinksButton.StartLink.title).slice(0, 50) + '...'} - - -
{"Toggle description pop-up"}
} placement="top"> - - Labels: {LinkDescriptionPopup.showDescriptions ? LinkDescriptionPopup.showDescriptions : "ON"} - -
- -
Exit linking mode
} placement="top"> - - Stop - -
- -
: null} -
-
; - } -} \ No newline at end of file diff --git a/src/client/views/collections/collectionFreeForm/index.ts b/src/client/views/collections/collectionFreeForm/index.ts new file mode 100644 index 000000000..702dc8d42 --- /dev/null +++ b/src/client/views/collections/collectionFreeForm/index.ts @@ -0,0 +1,7 @@ +export * from "./CollectionFreeFormLayoutEngines"; +export * from "./CollectionFreeFormLinkView"; +export * from "./CollectionFreeFormLinksView"; +export * from "./CollectionFreeFormRemoteCursors"; +export * from "./CollectionFreeFormView"; +export * from "./MarqueeOptionsMenu"; +export * from "./MarqueeView"; \ No newline at end of file diff --git a/src/client/views/collections/collectionGrid/index.ts b/src/client/views/collections/collectionGrid/index.ts new file mode 100644 index 000000000..be5d5667a --- /dev/null +++ b/src/client/views/collections/collectionGrid/index.ts @@ -0,0 +1,2 @@ +export * from "./Grid"; +export * from "./CollectionGridView"; \ No newline at end of file diff --git a/src/client/views/collections/collectionLinearView/CollectionLinearView.scss b/src/client/views/collections/collectionLinearView/CollectionLinearView.scss new file mode 100644 index 000000000..a10d43917 --- /dev/null +++ b/src/client/views/collections/collectionLinearView/CollectionLinearView.scss @@ -0,0 +1,139 @@ +@import "../../global/globalCssVariables"; +@import "../../_nodeModuleOverrides"; + +.collectionLinearView-outer { + overflow: visible; + height: 100%; + pointer-events: none; + + .collectionLinearView { + display: flex; + height: 100%; + align-items: center; + + >span { + background: $dark-gray; + color: $white; + border-radius: 18px; + margin-right: 6px; + cursor: pointer; + } + + .bottomPopup-background { + background: $medium-blue; + display: flex; + border-radius: 10px; + height: 35; + transform: translate3d(6px, 0px, 0px); + align-content: center; + justify-content: center; + align-items: center; + } + + .bottomPopup-text { + color: $white; + display: inline; + white-space: nowrap; + padding-left: 8px; + padding-right: 20px; + vertical-align: middle; + font-size: 12.5px; + } + + .bottomPopup-descriptions { + cursor:pointer; + display: inline; + white-space: nowrap; + padding-left: 8px; + padding-right: 8px; + vertical-align: middle; + background-color: $light-gray; + border-radius: 3px; + color: black; + margin-right: 5px; + } + + .bottomPopup-exit { + cursor:pointer; + display: inline; + white-space: nowrap; + margin-right: 10px; + padding-left: 8px; + padding-right: 8px; + vertical-align: middle; + background-color: $close-red; + border-radius: 3px; + color: black; + } + + >label { + margin-top: "auto"; + margin-bottom: "auto"; + background: $dark-gray; + color: $white; + display: inline-block; + border-radius: 18px; + font-size: 12.5px; + width: 18px; + height: 18px; + margin-top: auto; + margin-bottom: auto; + margin-right: 3px; + cursor: pointer; + transition: transform 0.2s; + } + + label p { + padding-left: 5px; + } + + label:hover { + background: $medium-gray; + transform: scale(1.15); + } + + >input { + display: none; + } + + >input:not(:checked)~.collectionLinearView-content { + display: none; + } + + >input:checked~label { + transform: rotate(45deg); + transition: transform 0.5s; + cursor: pointer; + } + + .collectionLinearView-content { + display: flex; + opacity: 1; + position: relative; + margin-top: auto; + + .collectionLinearView-docBtn, + .collectionLinearView-docBtn-scalable { + position: relative; + margin: auto; + margin-left: 3px; + transform-origin: center 80%; + } + + .collectionLinearView-docBtn-scalable:hover { + transform: scale(1.15); + } + + .collectionLinearView-round-button { + width: 18px; + height: 18px; + border-radius: 18px; + font-size: 15px; + } + + .collectionLinearView-round-button:hover { + transform: scale(1.15); + } + } + } +} \ No newline at end of file diff --git a/src/client/views/collections/collectionLinearView/CollectionLinearView.tsx b/src/client/views/collections/collectionLinearView/CollectionLinearView.tsx new file mode 100644 index 000000000..8e2ba2275 --- /dev/null +++ b/src/client/views/collections/collectionLinearView/CollectionLinearView.tsx @@ -0,0 +1,192 @@ +import { Tooltip } from '@material-ui/core'; +import { action, IReactionDisposer, observable, reaction, runInAction } from 'mobx'; +import { observer } from 'mobx-react'; +import * as React from 'react'; +import { makeInterface } from '../../../../fields/Schema'; +import { documentSchema } from '../../../../fields/documentSchemas'; +import { CollectionSubView } from '../CollectionSubView'; +import { DragManager } from '../../../util/DragManager'; +import { ScriptCast, NumCast, StrCast, BoolCast } from '../../../../fields/Types'; +import { HeightSym, Doc, WidthSym } from '../../../../fields/Doc'; +import { Utils, returnFalse, returnTrue, emptyFunction, returnEmptyDoclist } from '../../../../Utils'; +import { DocumentLinksButton } from '../../nodes/DocumentLinksButton'; +import { LinkDescriptionPopup } from '../../nodes/LinkDescriptionPopup'; +import { StyleProp } from '../../StyleProvider'; +import { CollectionViewType } from '../CollectionView'; +import { Id } from '../../../../fields/FieldSymbols'; +import { DocumentView } from '../../nodes/DocumentView'; +import { Transform } from '../../../util/Transform'; + + +type LinearDocument = makeInterface<[typeof documentSchema,]>; +const LinearDocument = makeInterface(documentSchema); + +@observer +export class CollectionLinearView extends CollectionSubView(LinearDocument) { + @observable public addMenuToggle = React.createRef(); + @observable private _selectedIndex = -1; + private _dropDisposer?: DragManager.DragDropDisposer; + private _widthDisposer?: IReactionDisposer; + private _selectedDisposer?: IReactionDisposer; + + componentWillUnmount() { + this._dropDisposer?.(); + this._widthDisposer?.(); + this._selectedDisposer?.(); + this.childLayoutPairs.map((pair, ind) => ScriptCast(pair.layout.proto?.onPointerUp)?.script.run({ this: pair.layout.proto }, console.log)); + } + + componentDidMount() { + this._widthDisposer = reaction(() => 5 + (this.layoutDoc.linearViewIsExpanded ? this.childDocs.length * (this.rootDoc[HeightSym]()) : 10), + width => this.childDocs.length && (this.layoutDoc._width = width), + { fireImmediately: true } + ); + + this._selectedDisposer = reaction( + () => NumCast(this.layoutDoc.selectedIndex), + (i) => runInAction(() => { + this._selectedIndex = i; + let selected: any = undefined; + this.childLayoutPairs.map(async (pair, ind) => { + const isSelected = this._selectedIndex === ind; + if (isSelected) { + selected = pair; + } + else { + ScriptCast(pair.layout.proto?.onPointerUp)?.script.run({ this: pair.layout.proto }, console.log); + } + }); + if (selected && selected.layout) { + ScriptCast(selected.layout.proto?.onPointerDown)?.script.run({ this: selected.layout.proto }, console.log); + } + }), + { fireImmediately: true } + ); + } + protected createDashEventsTarget = (ele: HTMLDivElement) => { //used for stacking and masonry view + this._dropDisposer && this._dropDisposer(); + if (ele) { + this._dropDisposer = DragManager.MakeDropTarget(ele, this.onInternalDrop.bind(this), this.layoutDoc); + } + } + + dimension = () => NumCast(this.rootDoc._height); // 2 * the padding + getTransform = (ele: React.RefObject) => () => { + if (!ele.current) return Transform.Identity(); + const { scale, translateX, translateY } = Utils.GetScreenTransform(ele.current); + return new Transform(-translateX, -translateY, 1); + } + + @action + exitLongLinks = () => { + if (DocumentLinksButton.StartLink) { + if (DocumentLinksButton.StartLink.Document) { + action((e: React.PointerEvent) => { + Doc.UnBrushDoc(DocumentLinksButton.StartLink?.Document as Doc); + }); + } + } + DocumentLinksButton.StartLink = undefined; + DocumentLinksButton.StartLinkView = undefined; + } + + @action + changeDescriptionSetting = () => { + if (LinkDescriptionPopup.showDescriptions) { + if (LinkDescriptionPopup.showDescriptions === "ON") { + LinkDescriptionPopup.showDescriptions = "OFF"; + LinkDescriptionPopup.descriptionPopup = false; + } else { + LinkDescriptionPopup.showDescriptions = "ON"; + } + } else { + LinkDescriptionPopup.showDescriptions = "OFF"; + LinkDescriptionPopup.descriptionPopup = false; + } + } + + render() { + const guid = Utils.GenerateGuid(); + const flexDir: any = StrCast(this.Document.flexDirection); + const backgroundColor = this.props.styleProvider?.(this.rootDoc, this.props, StyleProp.BackgroundColor); + const color = this.props.styleProvider?.(this.rootDoc, this.props, StyleProp.Color); + + const menuOpener = ; + + return
+
+
{BoolCast(this.layoutDoc.linearViewIsExpanded) ? "Close menu" : "Open menu"}
} placement="top"> + {menuOpener} +
+ this.layoutDoc.linearViewIsExpanded = this.addMenuToggle.current!.checked)} /> + +
+ {this.childLayoutPairs.map((pair, ind) => { + const nested = pair.layout._viewType === CollectionViewType.Linear; + const dref = React.createRef(); + const scalable = pair.layout.onClick || pair.layout.onDragStart; + return
+ +
; + })} +
+ {DocumentLinksButton.StartLink ? e.stopPropagation()} > + + Creating link from: {DocumentLinksButton.AnnotationId ? "Annotation in " : " "} {StrCast(DocumentLinksButton.StartLink.title).length < 51 ? DocumentLinksButton.StartLink.title : StrCast(DocumentLinksButton.StartLink.title).slice(0, 50) + '...'} + + +
{"Toggle description pop-up"}
} placement="top"> + + Labels: {LinkDescriptionPopup.showDescriptions ? LinkDescriptionPopup.showDescriptions : "ON"} + +
+ +
Exit linking mode
} placement="top"> + + Stop + +
+ +
: null} +
+
; + } +} \ No newline at end of file diff --git a/src/client/views/collections/collectionLinearView/index.ts b/src/client/views/collections/collectionLinearView/index.ts new file mode 100644 index 000000000..ff73e14ae --- /dev/null +++ b/src/client/views/collections/collectionLinearView/index.ts @@ -0,0 +1 @@ +export * from "./CollectionLinearView"; \ No newline at end of file diff --git a/src/client/views/nodes/DocumentContentsView.tsx b/src/client/views/nodes/DocumentContentsView.tsx index 3d2cdf5a4..544125ede 100644 --- a/src/client/views/nodes/DocumentContentsView.tsx +++ b/src/client/views/nodes/DocumentContentsView.tsx @@ -23,7 +23,7 @@ import "./DocumentView.scss"; import { EquationBox } from "./EquationBox"; import { FieldView, FieldViewProps } from "./FieldView"; import { FilterBox } from "./FilterBox"; -import { FontIconBox } from "./FontIconBox"; +import { FontIconBox } from "./button/FontIconBox"; import { FormattedTextBox, FormattedTextBoxProps } from "./formattedText/FormattedTextBox"; import { FunctionPlotBox } from "./FunctionPlotBox"; import { ImageBox } from "./ImageBox"; diff --git a/src/client/views/nodes/FontIconBox.scss b/src/client/views/nodes/FontIconBox.scss deleted file mode 100644 index 718af2c16..000000000 --- a/src/client/views/nodes/FontIconBox.scss +++ /dev/null @@ -1,103 +0,0 @@ -@import "../global/globalCssVariables"; - -.fontIconBox-label { - color: $white; - margin-right: 4px; - margin-top: 1px; - position: relative; - text-align: center; - font-size: 7px; - letter-spacing: normal; - background-color: inherit; - border-radius: 8px; - margin-top: -8px; - padding: 0; - width: 100%; -} - -.fontIconBadge-container { - position:absolute; - z-index: 1000; - top: 12px; - - .fontIconBadge { - position: absolute; - top: -10px; - right: -10px; - color: $white; - background: $pink; - font-weight: 300; - border-radius: 100%; - width: 25px; - height: 25px; - text-align: center; - padding-top: 4px; - font-size: 12px; - } -} - -.menuButton-circle, -.menuButton-round { - border-radius: 100%; - background-color: $dark-gray; - padding: 0; - - .fontIconBox-label { - //margin-left: -10px; // button padding is 10px; - bottom: 0; - position: absolute; - } - - &:hover { - background-color: $light-gray; - } -} - -.menuButton-square { - padding-top: 3px; - padding-bottom: 3px; - background-color: $dark-gray; - - .fontIconBox-label { - border-radius: 0px; - margin-top: 0px; - border-radius: "inherit"; - } -} - -.menuButton, -.menuButton-circle, -.menuButton-round, -.menuButton-square { - margin-left: -5%; - width: 110%; - height: 100%; - pointer-events: all; - touch-action: none; - - .menuButton-wrap { - touch-action: none; - border-radius: 8px; - width: 100%; - } - - .menuButton-icon-square { - width: auto; - height: 29px; - padding: 4px; - } - - svg { - width: 95% !important; - height: 95%; - } -} -.menuButton-round { - width: 100%; - svg { - width: 50% !important; - height: 50%; - position: relative; - bottom: 2px; - } -} \ No newline at end of file diff --git a/src/client/views/nodes/FontIconBox.tsx b/src/client/views/nodes/FontIconBox.tsx deleted file mode 100644 index 0d415e238..000000000 --- a/src/client/views/nodes/FontIconBox.tsx +++ /dev/null @@ -1,96 +0,0 @@ -import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'; -import { Tooltip } from '@material-ui/core'; -import { observer } from 'mobx-react'; -import * as React from 'react'; -import { AclPrivate, Doc, DocListCast } from '../../../fields/Doc'; -import { createSchema, makeInterface } from '../../../fields/Schema'; -import { ScriptField } from '../../../fields/ScriptField'; -import { Cast, StrCast } from '../../../fields/Types'; -import { GetEffectiveAcl } from '../../../fields/util'; -import { emptyFunction, returnFalse, setupMoveUpEvents } from "../../../Utils"; -import { DragManager } from '../../util/DragManager'; -import { ContextMenu } from '../ContextMenu'; -import { DocComponent } from '../DocComponent'; -import { StyleProp } from '../StyleProvider'; -import { FieldView, FieldViewProps } from './FieldView'; -import './FontIconBox.scss'; -import { Colors } from '../global/globalEnums'; -const FontIconSchema = createSchema({ - icon: "string", -}); - -type FontIconDocument = makeInterface<[typeof FontIconSchema]>; -const FontIconDocument = makeInterface(FontIconSchema); -@observer -export class FontIconBox extends DocComponent(FontIconDocument) { - public static LayoutString(fieldKey: string) { return FieldView.LayoutString(FontIconBox, fieldKey); } - showTemplate = (): void => { - const dragFactory = Cast(this.layoutDoc.dragFactory, Doc, null); - dragFactory && this.props.addDocTab(dragFactory, "add:right"); - } - dragAsTemplate = (): void => { this.layoutDoc.onDragStart = ScriptField.MakeFunction('getCopy(this.dragFactory, true)'); }; - useAsPrototype = (): void => { this.layoutDoc.onDragStart = ScriptField.MakeFunction('makeDelegate(this.dragFactory, true)'); }; - - specificContextMenu = (): void => { - if (!Doc.UserDoc().noviceMode) { - const cm = ContextMenu.Instance; - cm.addItem({ description: "Show Template", event: this.showTemplate, icon: "tag" }); - cm.addItem({ description: "Use as Render Template", event: this.dragAsTemplate, icon: "tag" }); - cm.addItem({ description: "Use as Prototype", event: this.useAsPrototype, icon: "tag" }); - } - } - - render() { - const label = StrCast(this.rootDoc.label, StrCast(this.rootDoc.title)); - const color = this.props.styleProvider?.(this.rootDoc, this.props, StyleProp.Color); - const backgroundColor = this.props.styleProvider?.(this.rootDoc, this.props, StyleProp.BackgroundColor); - const shape = StrCast(this.layoutDoc.iconShape, label ? "round" : "circle"); - const icon = StrCast(this.dataDoc.icon, "user") as any; - const presSize = shape === 'round' ? 25 : 30; - const presTrailsIcon = ; - const button = ; - return !this.layoutDoc.toolTip ? button : - {StrCast(this.layoutDoc.toolTip)}
}> - {button} - ; - } -} - -interface FontIconBadgeProps { - collection: Doc | undefined; -} - -@observer -export class FontIconBadge extends React.Component { - _notifsRef = React.createRef(); - - onPointerDown = (e: React.PointerEvent) => { - setupMoveUpEvents(this, e, - (e: PointerEvent) => { - const dragData = new DragManager.DocumentDragData([this.props.collection!]); - DragManager.StartDocumentDrag([this._notifsRef.current!], dragData, e.x, e.y); - return true; - }, - returnFalse, emptyFunction, false); - } - - render() { - if (!(this.props.collection instanceof Doc)) return (null); - const length = DocListCast(this.props.collection.data).filter(d => GetEffectiveAcl(d) !== AclPrivate).length; // Object.keys(d).length).length; // filter out any documents that we can't read - return
-
0 ? { "display": "initial" } : { "display": "none" }} - onPointerDown={this.onPointerDown} > - {length} -
-
; - } -} \ No newline at end of file diff --git a/src/client/views/nodes/button/FontIconBadge.tsx b/src/client/views/nodes/button/FontIconBadge.tsx new file mode 100644 index 000000000..3be723052 --- /dev/null +++ b/src/client/views/nodes/button/FontIconBadge.tsx @@ -0,0 +1,37 @@ + +import { AclPrivate, Doc, DocListCast } from '../../../../fields/Doc'; +import { GetEffectiveAcl } from '../../../../fields/util'; +import { emptyFunction, returnFalse, setupMoveUpEvents } from "../../../../Utils"; +import { DragManager } from '../../../util/DragManager'; +import './FontIconBox.scss'; +import { observer } from 'mobx-react'; +import React from 'react'; +interface FontIconBadgeProps { + collection: Doc | undefined; +} + +@observer +export class FontIconBadge extends React.Component { + _notifsRef = React.createRef(); + + onPointerDown = (e: React.PointerEvent) => { + setupMoveUpEvents(this, e, + (e: PointerEvent) => { + const dragData = new DragManager.DocumentDragData([this.props.collection!]); + DragManager.StartDocumentDrag([this._notifsRef.current!], dragData, e.x, e.y); + return true; + }, + returnFalse, emptyFunction, false); + } + + render() { + if (!(this.props.collection instanceof Doc)) return (null); + const length = DocListCast(this.props.collection.data).filter(d => GetEffectiveAcl(d) !== AclPrivate).length; // Object.keys(d).length).length; // filter out any documents that we can't read + return
+
0 ? { "display": "initial" } : { "display": "none" }} + onPointerDown={this.onPointerDown} > + {length} +
+
; + } +} \ No newline at end of file diff --git a/src/client/views/nodes/button/FontIconBox.scss b/src/client/views/nodes/button/FontIconBox.scss new file mode 100644 index 000000000..d4f1b9379 --- /dev/null +++ b/src/client/views/nodes/button/FontIconBox.scss @@ -0,0 +1,103 @@ +@import "../../global/globalCssVariables"; + +.fontIconBox-label { + color: $white; + margin-right: 4px; + margin-top: 1px; + position: relative; + text-align: center; + font-size: 7px; + letter-spacing: normal; + background-color: inherit; + border-radius: 8px; + margin-top: -8px; + padding: 0; + width: 100%; +} + +.fontIconBadge-container { + position:absolute; + z-index: 1000; + top: 12px; + + .fontIconBadge { + position: absolute; + top: -10px; + right: -10px; + color: $white; + background: $pink; + font-weight: 300; + border-radius: 100%; + width: 25px; + height: 25px; + text-align: center; + padding-top: 4px; + font-size: 12px; + } +} + +.menuButton-circle, +.menuButton-round { + border-radius: 100%; + background-color: $dark-gray; + padding: 0; + + .fontIconBox-label { + //margin-left: -10px; // button padding is 10px; + bottom: 0; + position: absolute; + } + + &:hover { + background-color: $light-gray; + } +} + +.menuButton-square { + padding-top: 3px; + padding-bottom: 3px; + background-color: $dark-gray; + + .fontIconBox-label { + border-radius: 0px; + margin-top: 0px; + border-radius: "inherit"; + } +} + +.menuButton, +.menuButton-circle, +.menuButton-round, +.menuButton-square { + margin-left: -5%; + width: 110%; + height: 100%; + pointer-events: all; + touch-action: none; + + .menuButton-wrap { + touch-action: none; + border-radius: 8px; + width: 100%; + } + + .menuButton-icon-square { + width: auto; + height: 29px; + padding: 4px; + } + + svg { + width: 95% !important; + height: 95%; + } +} +.menuButton-round { + width: 100%; + svg { + width: 50% !important; + height: 50%; + position: relative; + bottom: 2px; + } +} \ No newline at end of file diff --git a/src/client/views/nodes/button/FontIconBox.tsx b/src/client/views/nodes/button/FontIconBox.tsx new file mode 100644 index 000000000..f98d01dfc --- /dev/null +++ b/src/client/views/nodes/button/FontIconBox.tsx @@ -0,0 +1,295 @@ +import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'; +import { Tooltip } from '@material-ui/core'; +import { action, computed, observable } from 'mobx'; +import { observer } from 'mobx-react'; +import React from 'react'; +import { ColorState, SketchPicker } from 'react-color'; +import { Doc, StrListCast } from '../../../../fields/Doc'; +import { createSchema, makeInterface } from '../../../../fields/Schema'; +import { ScriptField } from '../../../../fields/ScriptField'; +import { BoolCast, Cast, StrCast } from '../../../../fields/Types'; +import { SelectionManager } from '../../../util/SelectionManager'; +import { ColorScheme } from '../../../util/SettingsManager'; +import { undoBatch, UndoManager } from '../../../util/UndoManager'; +import { ContextMenu } from '../../ContextMenu'; +import { DocComponent } from '../../DocComponent'; +import { StyleProp } from '../../StyleProvider'; +import { FieldView, FieldViewProps } from '../FieldView'; +import { FontIconBadge } from './FontIconBadge'; +import './FontIconBox.scss'; +const FontIconSchema = createSchema({ + icon: "string", +}); + +export enum ButtonType { + MenuButton = "menuBtn", + DropdownList = "drpdownList", + DropdownButton = "drpdownBtn", + ClickButton = "clickBtn", + DoubleButton = "dblBtn", + ToggleButton = "tglBtn", + ColorButton = "colorBtn" +} + +type FontIconDocument = makeInterface<[typeof FontIconSchema]>; +const FontIconDocument = makeInterface(FontIconSchema); +@observer +export class FontIconBox extends DocComponent(FontIconDocument) { + public static LayoutString(fieldKey: string) { return FieldView.LayoutString(FontIconBox, fieldKey); } + showTemplate = (): void => { + const dragFactory = Cast(this.layoutDoc.dragFactory, Doc, null); + dragFactory && this.props.addDocTab(dragFactory, "add:right"); + } + dragAsTemplate = (): void => { this.layoutDoc.onDragStart = ScriptField.MakeFunction('getCopy(this.dragFactory, true)'); }; + useAsPrototype = (): void => { this.layoutDoc.onDragStart = ScriptField.MakeFunction('makeDelegate(this.dragFactory, true)'); }; + + specificContextMenu = (): void => { + if (!Doc.UserDoc().noviceMode) { + const cm = ContextMenu.Instance; + cm.addItem({ description: "Show Template", event: this.showTemplate, icon: "tag" }); + cm.addItem({ description: "Use as Render Template", event: this.dragAsTemplate, icon: "tag" }); + cm.addItem({ description: "Use as Prototype", event: this.useAsPrototype, icon: "tag" }); + } + } + + + + // Determining UI Specs + @observable private label = StrCast(this.rootDoc.label, StrCast(this.rootDoc.title)); + @observable private color = this.props.styleProvider?.(this.rootDoc, this.props, StyleProp.Color); + @observable private backgroundColor = this.props.styleProvider?.(this.rootDoc, this.props, StyleProp.BackgroundColor); + @observable private icon = StrCast(this.dataDoc.icon, "user") as any; + @observable private dropdown: boolean = BoolCast(this.rootDoc.dropDownOpen); + @observable private dropdownDirection: string = StrCast(this.rootDoc.dropDownDirection); + @observable private buttonList: string[] = StrListCast(this.rootDoc.btnList); + @observable private activeFont: string = StrCast(Doc.UserDoc()._fontFamily); + @observable private type = StrCast(this.rootDoc.btnType); + + /** + * Types of buttons in dash: + * - Main menu button (LHS) + * - Tool button + * - Expandable button (CollectionLinearView) + * - Button inside of CollectionLinearView vs. outside of CollectionLinearView + * - Action button + * - Dropdown button + * - Color button + * - Dropdown list + **/ + + /** + * Dropdown button + */ + @computed get dropdownButton() { + const active: string = StrCast(this.rootDoc.dropDownOpen); + return ( +
this.rootDoc.dropDownOpen = !this.rootDoc.dropDownOpen)}> + + {!this.label || !Doc.UserDoc()._showLabel ? (null) :
{this.label}
} +
+ +
+ {this.rootDoc.dropDownOpen ? +
+ {/* DROPDOWN BOX CONTENTS */} +
: null} +
+ ); + } + + @undoBatch setColor = action((color: ColorState, docColor?: string, userColor?: string) => { + console.log(docColor, userColor); + if (docColor) { + const numSelected = SelectionManager.Views().length; + const selectedDoc = numSelected > 0 ? SelectionManager.Views()[0].Document : undefined; + eval(docColor); + } + else if (userColor) { + const userDoc = Doc.UserDoc(); + eval(userColor); + } + }); + + + + /** + * Default + */ + @computed get defaultButton() { + const active: string = StrCast(this.rootDoc.dropDownOpen); + return ( +
+
+ + {!this.label || !Doc.UserDoc()._showLabel ? (null) :
{this.label}
} + +
+
+ ) + } + + + render() { + // Variables called through eval (from button) + const canUndo: boolean = UndoManager.CanUndo(); + const canRedo: boolean = UndoManager.CanRedo(); + const numSelected = SelectionManager.Views().length; + const selectedDoc = numSelected > 0 ? SelectionManager.Views()[0].Document : undefined; + const userDoc = Doc.UserDoc(); + + // Toggle and canClick properties as determined from the variable passed into the button doc + // const toggle = this.rootDoc.toggle ? ScriptCast(this.rootDoc.toggle) : undefined; + const canClick: boolean = this.rootDoc.canClick ? eval(StrCast(this.rootDoc.canClick)) : false; + // if (toggle) { + // console.log(StrCast(this.rootDoc.title), toggle); + // toggle.script.run(); + // } + const dark: boolean = Doc.UserDoc().colorScheme === ColorScheme.Dark; + + const active: string = StrCast(this.rootDoc.dropDownOpen); + const label = !this.label || !Doc.UserDoc()._showLabel ? (null) : +
+ {this.label} +
; + const menuLabel = !this.label || !Doc.UserDoc()._showMenuLabel ? (null) : +
+ {this.label} +
; + const dropdownCaret =
+ +
; + const colorBox = (func: (color: ColorState) => void) => ; + const items = this.buttonList.map((value) => { + return
Doc.UserDoc()._fontFamily = value}> + {value} +
; + }); + + /** + * Menu Panel Button: menuBtn + * Dropdown Button: dropDownBtn + * doubleBtn + **/ + + // CODEDUMP: glr + // const presSize = type === ButtonType.MenuButton ? 30 : 25; + // const presTrailsIcon = ; + + // TODO:glr Add label of button type + let button = ( + <> + {this.defaultButton} + + ); + + switch (this.type) { + case ButtonType.DropdownButton: + button = ( + <> + {this.dropdownButton} + + ); + break; + case ButtonType.DropdownList: + button = ( +
this.rootDoc.dropDownOpen = !this.rootDoc.dropDownOpen}> + {/* {toggle} */} + {label} + {dropdownCaret} + {this.rootDoc.dropDownOpen ? + <> +
+ {items} +
+
{ e.stopPropagation(); this.rootDoc.dropDownOpen = false; }} /> + + : null} +
+ ); + break; + case ButtonType.ColorButton: + button = ( +
this.rootDoc.dropDownOpen = !this.rootDoc.dropDownOpen} + onPointerDown={e => e.stopPropagation()}> + + {label} + {dropdownCaret} + {this.rootDoc.dropDownOpen ? + <> +
e.stopPropagation()} + onClick={e => e.stopPropagation()} + style={{ left: 0 }}> + {colorBox((color) => this.setColor(color, StrCast(this.rootDoc.docColor), StrCast(this.rootDoc.userColor)))} +
+
{ e.stopPropagation(); this.rootDoc.dropDownOpen = false; }} /> + + : null} +
+ ); + break; + // case ButtonType.ToggleButton: + // button = ( + //
+ // + // {label} + //
+ // ); + // break; + case ButtonType.ClickButton: + button = ( +
+ + {label} +
+ ); + break; + case ButtonType.DoubleButton: + button = ( +
+ + {label} +
+ ); + break; + case ButtonType.MenuButton: + button = ( +
+ + {menuLabel} +
+ //
+ // + // {label} + //
+ ); + break; + default: + break; + } + + return !this.layoutDoc.toolTip ? button : + {StrCast(this.layoutDoc.toolTip)}
}> + {button} + ; + } +} -- cgit v1.2.3-70-g09d2 From 4d21696c1b49c2c383adcd01974c18461123b83c Mon Sep 17 00:00:00 2001 From: bobzel Date: Tue, 17 Aug 2021 16:55:15 -0400 Subject: made dashboard context menu items context sensitive to whether they're called from MyDashboards, MySharedDocs or elsewhere. Made treeViewOpen a playground field so that users don't interfere with each other. Made Docking views not generate alias of their tabs when shared. --- src/client/util/CurrentUserUtils.ts | 35 +++++++++++----------- src/client/views/MainView.tsx | 2 +- .../views/collections/CollectionDockingView.tsx | 2 +- .../views/collections/CollectionTreeView.tsx | 13 ++++++-- src/client/views/collections/CollectionView.tsx | 24 +++++++++------ src/client/views/collections/TreeView.tsx | 25 +++++++++++----- src/client/views/nodes/DocumentView.tsx | 2 +- 7 files changed, 63 insertions(+), 40 deletions(-) (limited to 'src/client/util/CurrentUserUtils.ts') diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts index 34990e121..85762a73f 100644 --- a/src/client/util/CurrentUserUtils.ts +++ b/src/client/util/CurrentUserUtils.ts @@ -765,8 +765,13 @@ export class CurrentUserUtils { _lockedPosition: true, boxShadow: "0 0", childDontRegisterViews: true, targetDropAction: "same", treeViewType: "fileSystem", isFolder: true, system: true })); const newDashboard = ScriptField.MakeScript(`createNewDashboard(Doc.UserDoc())`); - (doc.myDashboards as any as Doc).contextMenuScripts = new List([newDashboard!]); - (doc.myDashboards as any as Doc).contextMenuLabels = new List(["Create New Dashboard"]); + const toggleTheme = ScriptField.MakeScript(`Doc.UserDoc().darkScheme = !Doc.UserDoc().darkScheme`); + const toggleComic = ScriptField.MakeScript(`toggleComicMode()`); + const snapshotDashboard = ScriptField.MakeScript(`snapshotDashboard()`); + const shareDashboard = ScriptField.MakeScript(`shareDashboard(self)`); + const removeDashboard = ScriptField.MakeScript('removeDashboard(self)'); + (doc.myDashboards as any as Doc).childContextMenuScripts = new List([newDashboard!, toggleTheme!, toggleComic!, snapshotDashboard!, shareDashboard!, removeDashboard!]); + (doc.myDashboards as any as Doc).childContextMenuLabels = new List(["Create New Dashboard", "Toggle Theme Colors", "Toggle Comic Mode", "Snapshot Dashboard", "Share Dashboard", "Remove Dashboard"]); } return doc.myDashboards as any as Doc; } @@ -933,6 +938,11 @@ export class CurrentUserUtils { } if (sharedDocs instanceof Doc) { Doc.GetProto(sharedDocs).userColor = sharedDocs.userColor || "rgb(202, 202, 202)"; + const addToDashboards = ScriptField.MakeScript(`addToDashboards(self)`); + const dashboardFilter = ScriptField.MakeFunction(`doc._viewType === '${CollectionViewType.Docking}'`, { doc: Doc.name }); + sharedDocs.childContextMenuFilters = new List([dashboardFilter!,]); + sharedDocs.childContextMenuScripts = new List([addToDashboards!,]); + sharedDocs.childContextMenuLabels = new List(["Add to Dashboards",]); } doc.mySharedDocs = new PrefetchProxy(sharedDocs); } @@ -1228,15 +1238,6 @@ export class CurrentUserUtils { Doc.AddDocToList(myPresentations, "data", presentation); userDoc.activePresentation = presentation; - const toggleTheme = ScriptField.MakeScript(`Doc.UserDoc().darkScheme = !Doc.UserDoc().darkScheme`); - const toggleComic = ScriptField.MakeScript(`toggleComicMode()`); - const snapshotDashboard = ScriptField.MakeScript(`snapshotDashboard()`); - const createDashboard = ScriptField.MakeScript(`createNewDashboard()`); - const shareDashboard = ScriptField.MakeScript(`shareDashboard(self)`); - const addToDashboards = ScriptField.MakeScript(`addToDashboards(self)`); - const removeDashboard = ScriptField.MakeScript('removeDashboard(self)'); - dashboardDoc.contextMenuScripts = new List([toggleTheme!, toggleComic!, snapshotDashboard!, createDashboard!, shareDashboard!, addToDashboards!, removeDashboard!]); - dashboardDoc.contextMenuLabels = new List(["Toggle Theme Colors", "Toggle Comic Mode", "Snapshot Dashboard", "Create Dashboard", "Share Dashboard", "Add to Dashboards", "Remove Dashboard"]); Doc.AddDocToList(dashboards, "data", dashboardDoc); CurrentUserUtils.openDashboard(userDoc, dashboardDoc); @@ -1306,17 +1307,15 @@ Scripting.addGlobal(async function addToDashboards(dashboard: Doc) { const allDocs = await DocListCastAsync(dashboard[DataSym]["data-all"]); // moves the data-all field from the datadoc to the layoutdoc, necessary for off screen docs tab to function properly - dashboard["data-all"] = new List(allDocs); - dashboardAlias["data-all"] = new List((allDocs || []).map(doc => Doc.MakeAlias(doc))); - - const dockingConfig = JSON.parse(StrCast(dashboardAlias.dockingConfig)); - dockingConfig.content = []; - dashboardAlias.dockingConfig = JSON.stringify(dockingConfig); + // dashboard["data-all"] = new List(allDocs); + // dashboardAlias["data-all"] = new List((allDocs || []).map(doc => Doc.MakeAlias(doc))); + // const dockingConfig = JSON.parse(StrCast(dashboardAlias.dockingConfig)); + // dashboardAlias.dockingConfig = JSON.stringify(dockingConfig); dashboardAlias.data = new List(DocListCast(dashboard.data).map(tabFolder => Doc.MakeAlias(tabFolder))); DocListCast(dashboardAlias.data).forEach(doc => doc.dashboard = dashboardAlias); - DocListCast(dashboardAlias.data)[0].data = new List(); + //new List(); DocListCast(dashboardAlias.data)[1].data = ComputedField.MakeFunction(`dynamicOffScreenDocs(self.dashboard)`) as any; Doc.AddDocToList(CurrentUserUtils.MyDashboards, "data", dashboardAlias); CurrentUserUtils.openDashboard(Doc.UserDoc(), dashboardAlias); diff --git a/src/client/views/MainView.tsx b/src/client/views/MainView.tsx index b0b8d7f41..4d2a0a4c4 100644 --- a/src/client/views/MainView.tsx +++ b/src/client/views/MainView.tsx @@ -107,7 +107,7 @@ export class MainView extends React.Component { new InkStrokeProperties(); this._sidebarContent.proto = undefined; if (!MainView.Live) { - DocServer.setPlaygroundFields(["dataTransition", "autoHeight", "showSidebar", "sidebarWidthPercent", "viewTransition", + DocServer.setPlaygroundFields(["dataTransition", "treeViewOpen", "autoHeight", "showSidebar", "sidebarWidthPercent", "viewTransition", "panX", "panY", "width", "height", "nativeWidth", "nativeHeight", "text-scrollHeight", "text-height", "hideMinimap", "viewScale", "scrollTop", "hidden", "curPage", "viewType", "chromeHidden", "nativeWidth"]); // can play with these fields on someone else's } diff --git a/src/client/views/collections/CollectionDockingView.tsx b/src/client/views/collections/CollectionDockingView.tsx index c0d39b2a2..cae08e1f4 100644 --- a/src/client/views/collections/CollectionDockingView.tsx +++ b/src/client/views/collections/CollectionDockingView.tsx @@ -170,7 +170,7 @@ export class CollectionDockingView extends CollectionSubView(doc => doc) { const aliasDocList = DocListCast(alias["data-all"]); // if aliasDocList contains the alias, don't do anything // otherwise add the original or an alias depending on whether the doc you're looking at is the current doc or a different alias - !DocListCast(document.aliases).some(a => aliasDocList.includes(a)) && Doc.AddDocToList(alias, "data-all", alias !== instance.props.Document ? Doc.MakeAlias(document) : document); + !DocListCast(document.aliases).some(a => aliasDocList.includes(a)) && Doc.AddDocToList(alias, "data-all", document);//alias !== instance.props.Document ? Doc.MakeAlias(document) : document); }); } const docContentConfig = CollectionDockingView.makeDocumentConfig(document, panelName); diff --git a/src/client/views/collections/CollectionTreeView.tsx b/src/client/views/collections/CollectionTreeView.tsx index 3eece0086..c0553ca60 100644 --- a/src/client/views/collections/CollectionTreeView.tsx +++ b/src/client/views/collections/CollectionTreeView.tsx @@ -1,10 +1,10 @@ import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'; import { action, computed, reaction, IReactionDisposer, observable } from "mobx"; import { observer } from "mobx-react"; -import { DataSym, Doc, DocListCast, HeightSym, Opt, WidthSym } from '../../../fields/Doc'; +import { DataSym, Doc, DocListCast, HeightSym, Opt, WidthSym, StrListCast } from '../../../fields/Doc'; import { Id } from '../../../fields/FieldSymbols'; import { List } from '../../../fields/List'; -import { Document } from '../../../fields/Schema'; +import { Document, listSpec } from '../../../fields/Schema'; import { ScriptField } from '../../../fields/ScriptField'; import { BoolCast, Cast, NumCast, ScriptCast, StrCast } from '../../../fields/Types'; import { TraceMobx } from '../../../fields/util'; @@ -215,6 +215,11 @@ export class CollectionTreeView extends CollectionSubView
; } + childContextMenuItems = () => { + const customScripts = Cast(this.doc.childContextMenuScripts, listSpec(ScriptField), []); + const filterScripts = Cast(this.doc.childContextMenuFilters, listSpec(ScriptField), []); + return StrListCast(this.doc.childContextMenuLabels).map((label, i) => ({ script: customScripts[i], filter: filterScripts[i], label })); + } @computed get treeViewElements() { TraceMobx(); const dropAction = StrCast(this.doc.childDropAction) as dropActionType; @@ -247,7 +252,9 @@ export class CollectionTreeView extends CollectionSubView boolean;// whether child documents can be dragged if collection can be dragged (eg., in a when a Pile document is in startburst mode) childFitWidth?: () => boolean; childOpacity?: () => number; + childContextMenuItems?: () => { script: ScriptField, label: string }[]; childHideTitle?: () => boolean; // whether to hide the documentdecorations title for children childHideDecorationTitle?: () => boolean; childLayoutTemplate?: () => (Doc | undefined);// specify a layout Doc template to use for children of the collection @@ -186,15 +187,20 @@ export class CollectionView extends ViewBoxAnnotatableComponent this.rootDoc.isInPlaceContainer = !this.rootDoc.isInPlaceContainer, icon: "project-diagram" }); - optionItems.push({ - description: "Create Branch", event: async () => this.props.addDocTab(await BranchCreate(this.rootDoc), "add:right"), icon: "project-diagram" - }); - optionItems.push({ - description: "Pull Master", event: () => BranchTask(this.rootDoc, "pull"), icon: "project-diagram" - }); - optionItems.push({ - description: "Merge Branches", event: () => BranchTask(this.rootDoc, "merge"), icon: "project-diagram" - }); + if (!Doc.UserDoc().noviceMode) { + optionItems.push({ + description: "Create Branch", event: async () => this.props.addDocTab(await BranchCreate(this.rootDoc), "add:right"), icon: "project-diagram" + }); + optionItems.push({ + description: "Pull Master", event: () => BranchTask(this.rootDoc, "pull"), icon: "project-diagram" + }); + optionItems.push({ + description: "Merge Branches", event: () => BranchTask(this.rootDoc, "merge"), icon: "project-diagram" + }); + } + if (this.Document._viewType === CollectionViewType.Docking) { + optionItems.push({ description: "Create Dashboard", event: () => CurrentUserUtils.createNewDashboard(Doc.UserDoc()), icon: "project-diagram" }); + } !options && cm.addItem({ description: "Options...", subitems: optionItems, icon: "hand-point-right" }); diff --git a/src/client/views/collections/TreeView.tsx b/src/client/views/collections/TreeView.tsx index 206e48aac..0598be49b 100644 --- a/src/client/views/collections/TreeView.tsx +++ b/src/client/views/collections/TreeView.tsx @@ -1,7 +1,7 @@ import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'; import { action, computed, IReactionDisposer, observable, reaction } from "mobx"; import { observer } from "mobx-react"; -import { DataSym, Doc, DocListCast, DocListCastOrNull, Field, HeightSym, Opt, WidthSym } from '../../../fields/Doc'; +import { DataSym, Doc, DocListCast, DocListCastOrNull, Field, HeightSym, Opt, WidthSym, StrListCast } from '../../../fields/Doc'; import { Id } from '../../../fields/FieldSymbols'; import { List } from '../../../fields/List'; import { RichTextField } from '../../../fields/RichTextField'; @@ -54,6 +54,7 @@ export interface TreeViewProps { indentDocument?: (editTitle: boolean) => void; outdentDocument?: (editTitle: boolean) => void; ScreenToLocalTransform: () => Transform; + contextMenuItems: { script: ScriptField, filter: ScriptField, label: string }[]; dontRegisterView?: boolean; styleProvider?: StyleProviderFunc | undefined; treeViewHideHeaderFields: () => boolean; @@ -336,7 +337,7 @@ export class TreeView extends React.Component { this.props.dropAction, this.props.addDocTab, this.titleStyleProvider, this.props.ScreenToLocalTransform, this.props.isContentActive, this.props.panelWidth, this.props.renderDepth, this.props.treeViewHideHeaderFields, [...this.props.renderedIds, doc[Id]], this.props.onCheckedClick, this.props.onChildClick, this.props.skipFields, false, this.props.whenChildContentsActiveChanged, - this.props.dontRegisterView, emptyFunction, emptyFunction); + this.props.dontRegisterView, emptyFunction, emptyFunction, this.childContextMenuItems()); } else { contentElement = { StrCast(this.doc.childDropAction, this.props.dropAction) as dropActionType, this.props.addDocTab, this.titleStyleProvider, this.props.ScreenToLocalTransform, this.props.isContentActive, this.props.panelWidth, this.props.renderDepth, this.props.treeViewHideHeaderFields, [...this.props.renderedIds, this.doc[Id]], this.props.onCheckedClick, this.props.onChildClick, this.props.skipFields, false, this.props.whenChildContentsActiveChanged, - this.props.dontRegisterView, emptyFunction, emptyFunction)} + this.props.dontRegisterView, emptyFunction, emptyFunction, this.childContextMenuItems())} ; } else if (this.treeViewExpandedView === "fields") { return
    @@ -507,11 +508,19 @@ export class TreeView extends React.Component { } contextMenuItems = () => { const makeFolder = { script: ScriptField.MakeFunction(`scriptContext.makeFolder()`, { scriptContext: "any" })!, label: "New Folder" }; - return this.doc.isFolder ? [makeFolder] : + const openAlias = { script: ScriptField.MakeFunction(`openOnRight(getAlias(self))`)!, label: "Open Alias" }; + const focusDoc = { script: ScriptField.MakeFunction(`DocFocusOrOpen(self)`)!, label: "Focus or Open" }; + return [...this.props.contextMenuItems.filter(mi => !mi.filter ? true : mi.filter.script.run({ doc: this.doc })?.result), ... (this.doc.isFolder ? [makeFolder] : Doc.IsSystem(this.doc) ? [] : this.props.treeView.fileSysMode && this.doc === Doc.GetProto(this.doc) ? - [{ script: ScriptField.MakeFunction(`openOnRight(getAlias(self))`)!, label: "Open Alias" }, makeFolder] : - [{ script: ScriptField.MakeFunction(`openOnRight(getAlias(self))`)!, label: "Open Alias" }, { script: ScriptField.MakeFunction(`DocFocusOrOpen(self)`)!, label: "Focus or Open" }]; + [openAlias, makeFolder] : + this.doc.viewType === CollectionViewType.Docking ? [] : + [openAlias, focusDoc])]; + } + childContextMenuItems = () => { + const customScripts = Cast(this.doc.childContextMenuScripts, listSpec(ScriptField), []); + const customFilters = Cast(this.doc.childContextMenuFilters, listSpec(ScriptField), []); + return StrListCast(this.doc.childContextMenuLabels).map((label, i) => ({ script: customScripts[i], filter: customFilters[i], label })); } onChildClick = () => this.props.onChildClick?.() ?? (this._editTitleScript?.() || ScriptCast(this.doc.treeChildClick)); @@ -817,7 +826,8 @@ export class TreeView extends React.Component { whenChildContentsActiveChanged: (isActive: boolean) => void, dontRegisterView: boolean | undefined, observerHeight: (ref: any) => void, - unobserveHeight: (ref: any) => void + unobserveHeight: (ref: any) => void, + contextMenuItems: ({ script: ScriptField, filter: ScriptField, label: string }[]) ) { const viewSpecScript = Cast(conainerCollection.viewSpecScript, ScriptField); if (viewSpecScript) { @@ -882,6 +892,7 @@ export class TreeView extends React.Component { parentTreeView={parentTreeView} observeHeight={observerHeight} unobserveHeight={unobserveHeight} + contextMenuItems={contextMenuItems} />; }); } diff --git a/src/client/views/nodes/DocumentView.tsx b/src/client/views/nodes/DocumentView.tsx index 745d58656..a29f2f662 100644 --- a/src/client/views/nodes/DocumentView.tsx +++ b/src/client/views/nodes/DocumentView.tsx @@ -664,7 +664,7 @@ export class DocumentViewInternal extends DocComponent + StrListCast(this.Document.contextMenuLabels).forEach((label, i) => cm.addItem({ description: label, event: () => customScripts[i]?.script.run({ documentView: this, this: this.layoutDoc, scriptContext: this.props.scriptContext, self: this.rootDoc }), icon: "sticky-note" })); this.props.contextMenuItems?.().forEach(item => item.label && cm.addItem({ description: item.label, event: () => item.script.script.run({ this: this.layoutDoc, scriptContext: this.props.scriptContext, self: this.rootDoc }), icon: "sticky-note" })); -- cgit v1.2.3-70-g09d2 From 917ebb4a7b6840f57abbf8dbcc197919f3ee3aac Mon Sep 17 00:00:00 2001 From: geireann Date: Wed, 18 Aug 2021 17:27:07 -0400 Subject: updates towards a menu --- src/client/documents/Documents.ts | 1 + src/client/util/CurrentUserUtils.ts | 6 +- src/client/views/MainView.scss | 5 - src/client/views/MainView.tsx | 2 + src/client/views/StyleProvider.tsx | 3 +- src/client/views/collections/CollectionMenu.scss | 1255 ++++++++++---------- src/client/views/collections/CollectionMenu.tsx | 101 +- .../collectionLinearView/CollectionLinearView.scss | 33 +- .../collectionLinearView/CollectionLinearView.tsx | 43 +- src/client/views/nodes/DocumentView.tsx | 29 +- src/client/views/nodes/button/FontIconBadge.tsx | 13 +- src/client/views/nodes/button/FontIconBox.scss | 262 ++-- src/client/views/nodes/button/FontIconBox.tsx | 81 +- 13 files changed, 1022 insertions(+), 812 deletions(-) (limited to 'src/client/util/CurrentUserUtils.ts') diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts index 36cbd2059..817fbb9d6 100644 --- a/src/client/documents/Documents.ts +++ b/src/client/documents/Documents.ts @@ -227,6 +227,7 @@ export class DocumentOptions { //LINEAR VIEW linearViewIsExpanded?: boolean; // is linear view expanded linearViewExpandable?: boolean; // can linear view be expanded + linearViewToggleButton?: string; // button to open close linear view group layout_linkView?: Doc; // view template for a link document layout_keyValue?: string; // view tempalte for key value docs diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts index 620602070..cd4c217b5 100644 --- a/src/client/util/CurrentUserUtils.ts +++ b/src/client/util/CurrentUserUtils.ts @@ -547,7 +547,7 @@ export class CurrentUserUtils { { title: "Import", target: Cast(doc.myImportPanel, Doc, null), icon: "upload", click: 'selectMainMenu(self)' }, { title: "Recently Closed", target: Cast(doc.myRecentlyClosedDocs, Doc, null), icon: "archive", click: 'selectMainMenu(self)' }, { title: "Sharing", target: Cast(doc.mySharedDocs, Doc, null), icon: "users", click: 'selectMainMenu(self)', watchedDocuments: doc.mySharedDocs as Doc }, - { title: "Pres. Trails", target: Cast(doc.myPresentations, Doc, null), icon: "pres-trail", click: 'selectMainMenu(self)' }, + // { title: "Pres. Trails", target: Cast(doc.myPresentations, Doc, null), icon: "pres-trail", click: 'selectMainMenu(self)' }, // { title: "Help", target: undefined as any, icon: "question-circle", click: 'selectMainMenu(self)' }, // { title: "Settings", target: undefined as any, icon: "cog", click: 'selectMainMenu(self)' }, { title: "User Doc", target: Cast(doc.myUserDoc, Doc, null), icon: "address-card", click: 'selectMainMenu(self)' }, @@ -594,6 +594,7 @@ export class CurrentUserUtils { title: "menuItemPanel", childDropAction: "alias", _chromeHidden: true, + backgroundColor: Colors.DARK_GRAY, boxShadow: "rgba(0,0,0,0)", dropConverter: ScriptField.MakeScript("convertToButtons(dragData)", { dragData: DragManager.DocumentDragData.name }), ignoreClick: true, @@ -998,7 +999,7 @@ export class CurrentUserUtils { onClick: click ? ScriptField.MakeScript(click, { scriptContext: "any" }) : undefined })); }); - docList.push(CurrentUserUtils.blist({ ignoreClick: true, linearViewExpandable: true, _height: 30, backgroundColor: "transparent" }, textDocList)); + docList.push(CurrentUserUtils.blist({ ignoreClick: true, linearViewExpandable: true, icon:"Text", _height: 30, backgroundColor: "transparent" }, textDocList)); } else { docList.push(Docs.Create.FontIconDocument({ _nativeWidth: width ? width : 30, @@ -1197,6 +1198,7 @@ export class CurrentUserUtils { this.setupSearchSidebar(doc); // sets up the search sidebar this.setupActiveMobileMenu(doc); // sets up the current mobile menu for Dash Mobile this.setupOverlays(doc); // documents in overlay layer + this.setupContextMenuButtons(doc); // set up context menu buttons this.setupDockedButtons(doc); // the bottom bar of font icons await this.setupSidebarButtons(doc); // the pop-out left sidebar of tools/panels await this.setupMenuPanel(doc, sharingDocumentId, linkDatabaseId); diff --git a/src/client/views/MainView.scss b/src/client/views/MainView.scss index d913f2069..817e45699 100644 --- a/src/client/views/MainView.scss +++ b/src/client/views/MainView.scss @@ -265,11 +265,6 @@ height: 35px; padding: 5px; } - - svg { - width: 95% !important; - height: 95%; - } } .mainView-searchPanel { diff --git a/src/client/views/MainView.tsx b/src/client/views/MainView.tsx index 6a388c5b4..5c1408148 100644 --- a/src/client/views/MainView.tsx +++ b/src/client/views/MainView.tsx @@ -439,6 +439,7 @@ export class MainView extends React.Component { this._flyoutWidth = (this._flyoutWidth || 250); this._sidebarContent.proto = button.target as any; this.LastButton = button; + console.log(button.title); }); closeFlyout = action(() => { @@ -446,6 +447,7 @@ export class MainView extends React.Component { this._panelContent = "none"; this._sidebarContent.proto = undefined; this._flyoutWidth = 0; + console.log("close flyout"); }); remButtonDoc = (doc: Doc | Doc[]) => (doc instanceof Doc ? [doc] : doc).reduce((flg: boolean, doc) => flg && Doc.RemoveDocFromList(Doc.UserDoc().dockedBtns as Doc, "data", doc), true); diff --git a/src/client/views/StyleProvider.tsx b/src/client/views/StyleProvider.tsx index c9e532745..85520f6b3 100644 --- a/src/client/views/StyleProvider.tsx +++ b/src/client/views/StyleProvider.tsx @@ -96,6 +96,7 @@ export function DefaultStyleProvider(doc: Opt, props: Opt = StrCast(doc?.[fieldKey + "color"], StrCast(doc?._color)); if (docColor) return docColor; const backColor = backgroundCol(); @@ -114,8 +115,8 @@ export function DefaultStyleProvider(doc: Opt, props: Opt = StrCast(doc?.[fieldKey + "backgroundColor"], StrCast(doc?._backgroundColor, isCaption ? "rgba(0,0,0,0.4)" : "")); - if (MainView.Instance.LastButton === doc) return darkScheme() ? Colors.MEDIUM_GRAY : Colors.LIGHT_GRAY; switch (doc?.type) { case DocumentType.PRESELEMENT: docColor = docColor || (darkScheme() ? "" : ""); break; case DocumentType.PRES: docColor = docColor || (darkScheme() ? Colors.DARK_GRAY : Colors.WHITE); break; diff --git a/src/client/views/collections/CollectionMenu.scss b/src/client/views/collections/CollectionMenu.scss index f04b19ef7..163566d22 100644 --- a/src/client/views/collections/CollectionMenu.scss +++ b/src/client/views/collections/CollectionMenu.scss @@ -1,628 +1,659 @@ @import "../global/globalCssVariables"; -.collectionMenu-cont { - position: relative; - display: inline-flex; - width: 100%; - opacity: 0.9; - z-index: 901; - transition: top .5s; - background: $dark-gray; - color: $white; - transform-origin: top left; - top: 0; - width: 100%; - - .recordButtonOutline { - border-radius: 100%; - width: 18px; - height: 18px; - border: solid 1px $white; - display: flex; - align-items: center; - justify-content: center; - } - - .recordButtonInner { - border-radius: 100%; - width: 70%; - height: 70%; - background: $white; - } - - .collectionMenu { - display: flex; - height: 100%; - overflow: visible; - z-index: 901; - border: unset; - - .collectionMenu-divider { - height: 100%; - margin-left: 3px; - margin-right: 3px; - width: 2px; - background-color: $medium-gray; - } - - .collectionViewBaseChrome { - display: flex; - align-items: center; - - .collectionViewBaseChrome-viewPicker { - font-size: $small-text; - outline-color: $black; - color: $white; - border: none; - background: $dark-gray; - } - - .collectionViewBaseChrome-viewPicker:focus { - outline: none; - border: none; - } - - .collectionViewBaseChrome-viewPicker:active { - outline-color: $black; - } - - .collectionViewBaseChrome-button { - font-size: $small-text; - text-transform: uppercase; - letter-spacing: 2px; - background: $white; - color: $pink; - outline-color: $black; - border: none; - padding: 12px 10px 11px 10px; - margin-left: 10px; - } - - .collectionViewBaseChrome-cmdPicker { - margin-left: 3px; - margin-right: 0px; - font-size: $small-text; - text-transform: capitalize; - color: $white; - border: none; - background: $dark-gray; - } - - .collectionViewBaseChrome-cmdPicker:focus { - border: none; - outline: none; - } - - .commandEntry-outerDiv { - pointer-events: all; - background-color: transparent; - display: flex; - flex-direction: row; - align-items: center; - justify-content: center; - height: 100%; - overflow: hidden; - - .commandEntry-drop { - color: $white; - width: 30px; - margin-top: auto; - margin-bottom: auto; - } - } - - .commandEntry-outerDiv:hover{ - background-color: $drop-shadow; - - .collectionViewBaseChrome-viewPicker, - .collectionViewBaseChrome-cmdPicker{ - background: $dark-gray; - } - } - - .collectionViewBaseChrome-collapse { - transition: all .5s, opacity 0.3s; - position: absolute; - width: 30px; - transform-origin: top left; - pointer-events: all; - // margin-top: 10px; - } - - @media only screen and (max-device-width: 480px) { - .collectionViewBaseChrome-collapse { - display: none; - } - } - - .collectionViewBaseChrome-template, - .collectionViewBaseChrome-viewModes { - align-items: center; - height: 100%; - display: flex; - background: transparent; - color: $medium-gray; - justify-content: center; - } - - .collectionViewBaseChrome-viewSpecs { - margin-left: 5px; - display: grid; - border: none; - border-right: solid $medium-gray 1px; - - .collectionViewBaseChrome-filterIcon { - position: relative; - display: flex; - margin: auto; - background: $dark-gray; - color: $white; - width: 30px; - height: 30px; - align-items: center; - justify-content: center; - border: none; - border-right: solid $medium-gray 1px; - } - - .collectionViewBaseChrome-viewSpecsInput { - padding: 12px 10px 11px 10px; - border: 0px; - color: $medium-gray; - text-align: center; - letter-spacing: 2px; - outline-color: $black; - font-size: $small-text; - background: $white; - height: 100%; - width: 75px; - } - - .collectionViewBaseChrome-viewSpecsMenu { - overflow: hidden; - transition: height .5s, display .5s; - position: absolute; - top: 60px; - z-index: 100; - display: flex; - flex-direction: column; - background: $white; - box-shadow: $medium-gray 2px 2px 4px; - - .qs-datepicker { - left: unset; - right: 0; - } - - .collectionViewBaseChrome-viewSpecsMenu-row { - display: grid; - grid-template-columns: 150px 200px 150px; - margin-top: 10px; - margin-right: 10px; - - .collectionViewBaseChrome-viewSpecsMenu-rowLeft, - .collectionViewBaseChrome-viewSpecsMenu-rowMiddle, - .collectionViewBaseChrome-viewSpecsMenu-rowRight { - font-size: $small-text; - letter-spacing: 2px; - color: $medium-gray; - margin-left: 10px; - padding: 5px; - border: none; - outline-color: $black; - } - } - - .collectionViewBaseChrome-viewSpecsMenu-lastRow { - display: grid; - grid-template-columns: 1fr 1fr 1fr; - grid-gap: 10px; - margin: 10px; - } - } - } - } - - .collectionStackingViewChrome-cont, - .collectionTreeViewChrome-cont, - .collection3DCarouselViewChrome-cont { - display: flex; - justify-content: space-between; - } - - .collectionGridViewChrome-cont { - display: flex; - margin-left: 10; - - .collectionGridViewChrome-viewPicker { - font-size: $small-text; - //text-transform: uppercase; - //letter-spacing: 2px; - background: $dark-gray; - color: $white; - outline-color: $black; - color: $white; - border: none; - border-right: solid $medium-gray 1px; - } - - .collectionGridViewChrome-viewPicker:active { - outline-color: $black; - } - - .grid-control { - align-self: center; - display: flex; - flex-direction: row; - margin-right: 5px; - - .grid-icon { - margin-right: 5px; - align-self: center; - } - - .flexLabel { - margin-bottom: 0; - } - - .collectionGridViewChrome-entryBox { - width: 50%; - color: $black; - } - - .collectionGridViewChrome-columnButton { - color: $black; - } - } - } - - .collectionStackingViewChrome-sort, - .collectionTreeViewChrome-sort { - display: flex; - align-items: center; - justify-content: space-between; - - .collectionStackingViewChrome-sortIcon, - .collectionTreeViewChrome-sortIcon { - transition: transform .5s; - margin-left: 10px; - } - } - - button:hover { - transform: scale(1); - } - - - .collectionStackingViewChrome-pivotField-cont, - .collectionTreeViewChrome-pivotField-cont, - .collection3DCarouselViewChrome-scrollSpeed-cont { - justify-self: right; - align-items: center; - display: flex; - grid-auto-columns: auto; - font-size: $small-text; - letter-spacing: 2px; - - .collectionStackingViewChrome-pivotField-label, - .collectionTreeViewChrome-pivotField-label, - .collection3DCarouselViewChrome-scrollSpeed-label { - grid-column: 1; - margin-right: 7px; - user-select: none; - font-family: $sans-serif; - letter-spacing: normal; - } - - .collectionStackingViewChrome-sortIcon { - transition: transform .5s; - grid-column: 3; - text-align: center; - display: flex; - justify-content: center; - align-items: center; - cursor: pointer; - width: 25px; - height: 25px; - border-radius: 100%; - } - - .collectionStackingViewChrome-sortIcon:hover { - background-color: $drop-shadow; - } - - .collectionStackingViewChrome-pivotField, - .collectionTreeViewChrome-pivotField, - .collection3DCarouselViewChrome-scrollSpeed { - color: $white; - grid-column: 2; - grid-row: 1; - width: 90%; - min-width: 100px; - display: flex; - height: 80%; - border-radius: 7px; - align-items: center; - background: $white; - - .editable-view-input, - input, - .editableView-container-editing-oneLine, - .editableView-container-editing { - margin: auto; - border: 0px; - color: $light-gray !important; - text-align: center; - letter-spacing: 2px; - outline-color: $black; - height: 100%; - } - - .react-autosuggest__container { - margin: 0; - color: $medium-gray; - padding: 0px; - } - } - } - - .collectionStackingViewChrome-pivotField:hover, - .collectionTreeViewChrome-pivotField:hover, - .collection3DCarouselViewChrome-scrollSpeed:hover { - cursor: text; - } - - } -} - -.collectionMenu-webUrlButtons { - margin-left: 44; - background: lightGray; +.collectionMenu-container { display: flex; -} - -.webBox-urlEditor { - position: relative; - opacity: 0.9; - z-index: 901; - transition: top .5s; - - .urlEditor { - display: grid; - grid-template-columns: 1fr auto; - padding-bottom: 10px; - overflow: hidden; - margin-top: 5px; - height: 35px; - - .editorBase { - display: flex; - - .editor-collapse { - transition: all .5s, opacity 0.3s; - position: absolute; - width: 40px; - transform-origin: top left; - } - - .switchToText { - color: $medium-gray; - } - - .switchToText:hover { - color: $dark-gray; - } - } - - button:hover { - transform: scale(1); - } - } -} - -.collectionMenu-urlInput { - padding: 12px 10px 11px 10px; - border: 0px; - color: $black; - font-size: $small-text; - letter-spacing: 2px; - outline-color: $black; - background: $white; - width: 100%; - min-width: 350px; - margin-right: 10px; - height: 100%; -} - -.collectionFreeFormMenu-cont { - display: inline-flex; position: relative; + align-content: center; + justify-content: space-between; + background-color: $dark-gray; + height: 35px; + border-bottom: $standard-border; + padding-right: 5px; align-items: center; - height: 100%; - - .color-previewI { - width: 60%; - top: 80%; - position: absolute; - height: 4px; - } - - .color-previewII { - width: 80%; - height: 80%; - margin-left: 10%; - position: absolute; - bottom: 5; - } - - .btn-group { - display: grid; - grid-template-columns: auto auto auto auto; - margin: auto; - /* Make the buttons appear below each other */ - } - .btn-draw { - display: inline-flex; - margin: auto; - /* Make the buttons appear below each other */ - } - - .fwdKeyframe, - .numKeyframe, - .backKeyframe { + .collectionMenu-hardCodedButton { cursor: pointer; - position: relative; - width: 20; - height: 30; - bottom: 0; - background: $dark-gray; - display: inline-flex; - align-items: center; color: $white; - } - - .backKeyframe { - svg { - display: block; - margin: auto; - } - } - - - .numKeyframe { - flex-direction: column; - padding-top: 5px; - } - - .fwdKeyframe { - svg { - display: block; - margin: auto; - } - - border-right: solid $medium-gray 1px; - } -} - -.collectionSchemaViewChrome-cont { - display: flex; - font-size: $small-text; - - .collectionSchemaViewChrome-toggle { - display: flex; - margin-left: 10px; - } - - .collectionSchemaViewChrome-label { - text-transform: uppercase; - letter-spacing: 2px; - margin-right: 5px; + width: 31.5px; + height: 90%; + padding: 5; + text-align: center; display: flex; - flex-direction: column; justify-content: center; - } - - .collectionSchemaViewChrome-toggler { - width: 100px; - height: 35px; - background-color: $black; + align-items: center; position: relative; - } - - .collectionSchemaViewChrome-togglerButton { - width: 47px; - height: 30px; - background-color: $light-gray; - // position: absolute; - transition: all 0.5s ease; - // top: 3px; - margin-top: 3px; - color: $medium-gray; - letter-spacing: 2px; - text-transform: uppercase; - display: flex; - flex-direction: column; - justify-content: center; - text-align: center; + transition: 0.2s; - &.on { - margin-left: 3px; - } - - &.off { - margin-left: 50px; + &:hover { + border-radius:5px; + background-color: rgba(0,0,0,0.2); } } } - -.commandEntry-outerDiv { - display: flex; - flex-direction: column; - height: 40px; -} - -.commandEntry-inputArea { - display: flex; - flex-direction: row; - width: 150px; - margin: auto auto auto auto; -} - -.react-autosuggest__container { - position: relative; - width: 100%; - margin-left: 5px; - margin-right: 5px; -} - -.react-autosuggest__input { - border: 1px solid $light-gray; - border-radius: 4px; - width: 100%; -} - -.react-autosuggest__input--focused { - outline: none; -} - -.react-autosuggest__input--open { - border-bottom-left-radius: 0; - border-bottom-right-radius: 0; -} - -.react-autosuggest__suggestions-container { - display: none; -} - -.react-autosuggest__suggestions-container--open { - display: block; - position: fixed; - overflow-y: auto; - max-height: 400px; - width: 180px; - border: 1px solid $light-gray; - background-color: $white; - font-family: $sans-serif; - font-weight: 300; - font-size: $large-header; - border-bottom-left-radius: 4px; - border-bottom-right-radius: 4px; - z-index: 2; -} - -.react-autosuggest__suggestions-list { - margin: 0; - padding: 0; - list-style-type: none; -} - -.react-autosuggest__suggestion { - cursor: pointer; - padding: 10px 20px; -} - -.react-autosuggest__suggestion--highlighted { - background-color: $light-gray; -} \ No newline at end of file +// .collectionMenu-cont { +// position: relative; +// display: inline-flex; +// width: 100%; +// opacity: 0.9; +// z-index: 901; +// transition: top .5s; +// background: $dark-gray; +// color: $white; +// transform-origin: top left; +// top: 0; +// width: 100%; + +// .recordButtonOutline { +// border-radius: 100%; +// width: 18px; +// height: 18px; +// border: solid 1px $white; +// display: flex; +// align-items: center; +// justify-content: center; +// } + +// .recordButtonInner { +// border-radius: 100%; +// width: 70%; +// height: 70%; +// background: $white; +// } + +// .collectionMenu { +// display: flex; +// height: 100%; +// overflow: visible; +// z-index: 901; +// border: unset; + +// .collectionMenu-divider { +// height: 100%; +// margin-left: 3px; +// margin-right: 3px; +// width: 2px; +// background-color: $medium-gray; +// } + +// .collectionViewBaseChrome { +// display: flex; +// align-items: center; + +// .collectionViewBaseChrome-viewPicker { +// font-size: $small-text; +// outline-color: $black; +// color: $white; +// border: none; +// background: $dark-gray; +// } + +// .collectionViewBaseChrome-viewPicker:focus { +// outline: none; +// border: none; +// } + +// .collectionViewBaseChrome-viewPicker:active { +// outline-color: $black; +// } + +// .collectionViewBaseChrome-button { +// font-size: $small-text; +// text-transform: uppercase; +// letter-spacing: 2px; +// background: $white; +// color: $pink; +// outline-color: $black; +// border: none; +// padding: 12px 10px 11px 10px; +// margin-left: 10px; +// } + +// .collectionViewBaseChrome-cmdPicker { +// margin-left: 3px; +// margin-right: 0px; +// font-size: $small-text; +// text-transform: capitalize; +// color: $white; +// border: none; +// background: $dark-gray; +// } + +// .collectionViewBaseChrome-cmdPicker:focus { +// border: none; +// outline: none; +// } + +// .commandEntry-outerDiv { +// pointer-events: all; +// background-color: transparent; +// display: flex; +// flex-direction: row; +// align-items: center; +// justify-content: center; +// height: 100%; +// overflow: hidden; + +// .commandEntry-drop { +// color: $white; +// width: 30px; +// margin-top: auto; +// margin-bottom: auto; +// } +// } + +// .commandEntry-outerDiv:hover{ +// background-color: $drop-shadow; + +// .collectionViewBaseChrome-viewPicker, +// .collectionViewBaseChrome-cmdPicker{ +// background: $dark-gray; +// } +// } + +// .collectionViewBaseChrome-collapse { +// transition: all .5s, opacity 0.3s; +// position: absolute; +// width: 30px; +// transform-origin: top left; +// pointer-events: all; +// // margin-top: 10px; +// } + +// @media only screen and (max-device-width: 480px) { +// .collectionViewBaseChrome-collapse { +// display: none; +// } +// } + +// .collectionViewBaseChrome-template, +// .collectionViewBaseChrome-viewModes { +// align-items: center; +// height: 100%; +// display: flex; +// background: transparent; +// color: $medium-gray; +// justify-content: center; +// } + +// .collectionViewBaseChrome-viewSpecs { +// margin-left: 5px; +// display: grid; +// border: none; +// border-right: solid $medium-gray 1px; + +// .collectionViewBaseChrome-filterIcon { +// position: relative; +// display: flex; +// margin: auto; +// background: $dark-gray; +// color: $white; +// width: 30px; +// height: 30px; +// align-items: center; +// justify-content: center; +// border: none; +// border-right: solid $medium-gray 1px; +// } + +// .collectionViewBaseChrome-viewSpecsInput { +// padding: 12px 10px 11px 10px; +// border: 0px; +// color: $medium-gray; +// text-align: center; +// letter-spacing: 2px; +// outline-color: $black; +// font-size: $small-text; +// background: $white; +// height: 100%; +// width: 75px; +// } + +// .collectionViewBaseChrome-viewSpecsMenu { +// overflow: hidden; +// transition: height .5s, display .5s; +// position: absolute; +// top: 60px; +// z-index: 100; +// display: flex; +// flex-direction: column; +// background: $white; +// box-shadow: $medium-gray 2px 2px 4px; + +// .qs-datepicker { +// left: unset; +// right: 0; +// } + +// .collectionViewBaseChrome-viewSpecsMenu-row { +// display: grid; +// grid-template-columns: 150px 200px 150px; +// margin-top: 10px; +// margin-right: 10px; + +// .collectionViewBaseChrome-viewSpecsMenu-rowLeft, +// .collectionViewBaseChrome-viewSpecsMenu-rowMiddle, +// .collectionViewBaseChrome-viewSpecsMenu-rowRight { +// font-size: $small-text; +// letter-spacing: 2px; +// color: $medium-gray; +// margin-left: 10px; +// padding: 5px; +// border: none; +// outline-color: $black; +// } +// } + +// .collectionViewBaseChrome-viewSpecsMenu-lastRow { +// display: grid; +// grid-template-columns: 1fr 1fr 1fr; +// grid-gap: 10px; +// margin: 10px; +// } +// } +// } +// } + +// .collectionStackingViewChrome-cont, +// .collectionTreeViewChrome-cont, +// .collection3DCarouselViewChrome-cont { +// display: flex; +// justify-content: space-between; +// } + +// .collectionGridViewChrome-cont { +// display: flex; +// margin-left: 10; + +// .collectionGridViewChrome-viewPicker { +// font-size: $small-text; +// //text-transform: uppercase; +// //letter-spacing: 2px; +// background: $dark-gray; +// color: $white; +// outline-color: $black; +// color: $white; +// border: none; +// border-right: solid $medium-gray 1px; +// } + +// .collectionGridViewChrome-viewPicker:active { +// outline-color: $black; +// } + +// .grid-control { +// align-self: center; +// display: flex; +// flex-direction: row; +// margin-right: 5px; + +// .grid-icon { +// margin-right: 5px; +// align-self: center; +// } + +// .flexLabel { +// margin-bottom: 0; +// } + +// .collectionGridViewChrome-entryBox { +// width: 50%; +// color: $black; +// } + +// .collectionGridViewChrome-columnButton { +// color: $black; +// } +// } +// } + +// .collectionStackingViewChrome-sort, +// .collectionTreeViewChrome-sort { +// display: flex; +// align-items: center; +// justify-content: space-between; + +// .collectionStackingViewChrome-sortIcon, +// .collectionTreeViewChrome-sortIcon { +// transition: transform .5s; +// margin-left: 10px; +// } +// } + +// button:hover { +// transform: scale(1); +// } + + +// .collectionStackingViewChrome-pivotField-cont, +// .collectionTreeViewChrome-pivotField-cont, +// .collection3DCarouselViewChrome-scrollSpeed-cont { +// justify-self: right; +// align-items: center; +// display: flex; +// grid-auto-columns: auto; +// font-size: $small-text; +// letter-spacing: 2px; + +// .collectionStackingViewChrome-pivotField-label, +// .collectionTreeViewChrome-pivotField-label, +// .collection3DCarouselViewChrome-scrollSpeed-label { +// grid-column: 1; +// margin-right: 7px; +// user-select: none; +// font-family: $sans-serif; +// letter-spacing: normal; +// } + +// .collectionStackingViewChrome-sortIcon { +// transition: transform .5s; +// grid-column: 3; +// text-align: center; +// display: flex; +// justify-content: center; +// align-items: center; +// cursor: pointer; +// width: 25px; +// height: 25px; +// border-radius: 100%; +// } + +// .collectionStackingViewChrome-sortIcon:hover { +// background-color: $drop-shadow; +// } + +// .collectionStackingViewChrome-pivotField, +// .collectionTreeViewChrome-pivotField, +// .collection3DCarouselViewChrome-scrollSpeed { +// color: $white; +// grid-column: 2; +// grid-row: 1; +// width: 90%; +// min-width: 100px; +// display: flex; +// height: 80%; +// border-radius: 7px; +// align-items: center; +// background: $white; + +// .editable-view-input, +// input, +// .editableView-container-editing-oneLine, +// .editableView-container-editing { +// margin: auto; +// border: 0px; +// color: $light-gray !important; +// text-align: center; +// letter-spacing: 2px; +// outline-color: $black; +// height: 100%; +// } + +// .react-autosuggest__container { +// margin: 0; +// color: $medium-gray; +// padding: 0px; +// } +// } +// } + +// .collectionStackingViewChrome-pivotField:hover, +// .collectionTreeViewChrome-pivotField:hover, +// .collection3DCarouselViewChrome-scrollSpeed:hover { +// cursor: text; +// } + +// } +// } + +// .collectionMenu-webUrlButtons { +// margin-left: 44; +// background: lightGray; +// display: flex; +// } + +// .webBox-urlEditor { +// position: relative; +// opacity: 0.9; +// z-index: 901; +// transition: top .5s; + +// .urlEditor { +// display: grid; +// grid-template-columns: 1fr auto; +// padding-bottom: 10px; +// overflow: hidden; +// margin-top: 5px; +// height: 35px; + +// .editorBase { +// display: flex; + +// .editor-collapse { +// transition: all .5s, opacity 0.3s; +// position: absolute; +// width: 40px; +// transform-origin: top left; +// } + +// .switchToText { +// color: $medium-gray; +// } + +// .switchToText:hover { +// color: $dark-gray; +// } +// } + +// button:hover { +// transform: scale(1); +// } +// } +// } + +// .collectionMenu-urlInput { +// padding: 12px 10px 11px 10px; +// border: 0px; +// color: $black; +// font-size: $small-text; +// letter-spacing: 2px; +// outline-color: $black; +// background: $white; +// width: 100%; +// min-width: 350px; +// margin-right: 10px; +// height: 100%; +// } + +// .collectionFreeFormMenu-cont { +// display: inline-flex; +// position: relative; +// align-items: center; +// height: 100%; + +// .color-previewI { +// width: 60%; +// top: 80%; +// position: absolute; +// height: 4px; +// } + +// .color-previewII { +// width: 80%; +// height: 80%; +// margin-left: 10%; +// position: absolute; +// bottom: 5; +// } + +// .btn-group { +// display: grid; +// grid-template-columns: auto auto auto auto; +// margin: auto; +// /* Make the buttons appear below each other */ +// } + +// .btn-draw { +// display: inline-flex; +// margin: auto; +// /* Make the buttons appear below each other */ +// } + +// .fwdKeyframe, +// .numKeyframe, +// .backKeyframe { +// cursor: pointer; +// position: relative; +// width: 20; +// height: 30; +// bottom: 0; +// background: $dark-gray; +// display: inline-flex; +// align-items: center; +// color: $white; +// } + +// .backKeyframe { +// svg { +// display: block; +// margin: auto; +// } +// } + + +// .numKeyframe { +// flex-direction: column; +// padding-top: 5px; +// } + +// .fwdKeyframe { +// svg { +// display: block; +// margin: auto; +// } + +// border-right: solid $medium-gray 1px; +// } +// } + +// .collectionSchemaViewChrome-cont { +// display: flex; +// font-size: $small-text; + +// .collectionSchemaViewChrome-toggle { +// display: flex; +// margin-left: 10px; +// } + +// .collectionSchemaViewChrome-label { +// text-transform: uppercase; +// letter-spacing: 2px; +// margin-right: 5px; +// display: flex; +// flex-direction: column; +// justify-content: center; +// } + +// .collectionSchemaViewChrome-toggler { +// width: 100px; +// height: 35px; +// background-color: $black; +// position: relative; +// } + +// .collectionSchemaViewChrome-togglerButton { +// width: 47px; +// height: 30px; +// background-color: $light-gray; +// // position: absolute; +// transition: all 0.5s ease; +// // top: 3px; +// margin-top: 3px; +// color: $medium-gray; +// letter-spacing: 2px; +// text-transform: uppercase; +// display: flex; +// flex-direction: column; +// justify-content: center; +// text-align: center; + +// &.on { +// margin-left: 3px; +// } + +// &.off { +// margin-left: 50px; +// } +// } +// } + + +// .commandEntry-outerDiv { +// display: flex; +// flex-direction: column; +// height: 40px; +// } + +// .commandEntry-inputArea { +// display: flex; +// flex-direction: row; +// width: 150px; +// margin: auto auto auto auto; +// } + +// .react-autosuggest__container { +// position: relative; +// width: 100%; +// margin-left: 5px; +// margin-right: 5px; +// } + +// .react-autosuggest__input { +// border: 1px solid $light-gray; +// border-radius: 4px; +// width: 100%; +// } + +// .react-autosuggest__input--focused { +// outline: none; +// } + +// .react-autosuggest__input--open { +// border-bottom-left-radius: 0; +// border-bottom-right-radius: 0; +// } + +// .react-autosuggest__suggestions-container { +// display: none; +// } + +// .react-autosuggest__suggestions-container--open { +// display: block; +// position: fixed; +// overflow-y: auto; +// max-height: 400px; +// width: 180px; +// border: 1px solid $light-gray; +// background-color: $white; +// font-family: $sans-serif; +// font-weight: 300; +// font-size: $large-header; +// border-bottom-left-radius: 4px; +// border-bottom-right-radius: 4px; +// z-index: 2; +// } + +// .react-autosuggest__suggestions-list { +// margin: 0; +// padding: 0; +// list-style-type: none; +// } + +// .react-autosuggest__suggestion { +// cursor: pointer; +// padding: 10px 20px; +// } + +// .react-autosuggest__suggestion--highlighted { +// background-color: $light-gray; +// } \ No newline at end of file diff --git a/src/client/views/collections/CollectionMenu.tsx b/src/client/views/collections/CollectionMenu.tsx index 8f4df4a92..55af4650f 100644 --- a/src/client/views/collections/CollectionMenu.tsx +++ b/src/client/views/collections/CollectionMenu.tsx @@ -15,29 +15,31 @@ import { RichTextField } from "../../../fields/RichTextField"; import { listSpec } from "../../../fields/Schema"; import { ScriptField } from "../../../fields/ScriptField"; import { BoolCast, Cast, NumCast, StrCast } from "../../../fields/Types"; -import { emptyFunction, setupMoveUpEvents, Utils } from "../../../Utils"; +import { emptyFunction, returnEmptyDoclist, returnEmptyFilter, returnFalse, returnTrue, setupMoveUpEvents, Utils } from "../../../Utils"; +import { Docs } from "../../documents/Documents"; import { DocumentType } from "../../documents/DocumentTypes"; import { CurrentUserUtils } from "../../util/CurrentUserUtils"; import { DragManager } from "../../util/DragManager"; import { Scripting } from "../../util/Scripting"; import { SelectionManager } from "../../util/SelectionManager"; +import { Transform } from "../../util/Transform"; import { undoBatch } from "../../util/UndoManager"; import { AntimodeMenu, AntimodeMenuProps } from "../AntimodeMenu"; import { EditableView } from "../EditableView"; import { GestureOverlay } from "../GestureOverlay"; -import { ActiveFillColor, ActiveInkColor, SetActiveArrowEnd, SetActiveArrowStart, SetActiveBezierApprox, SetActiveFillColor, SetActiveInkColor, SetActiveInkWidth, ActiveArrowStart, ActiveArrowEnd } from "../InkingStroke"; +import { ActiveFillColor, ActiveInkColor, SetActiveArrowEnd, SetActiveArrowStart, SetActiveBezierApprox, SetActiveFillColor, SetActiveInkColor, SetActiveInkWidth } from "../InkingStroke"; +import { LightboxView } from "../LightboxView"; import { CollectionFreeFormDocumentView } from "../nodes/CollectionFreeFormDocumentView"; import { DocumentView } from "../nodes/DocumentView"; +import { FormattedTextBox } from "../nodes/formattedText/FormattedTextBox"; import { RichTextMenu } from "../nodes/formattedText/RichTextMenu"; import { PresBox } from "../nodes/trails/PresBox"; +import { DefaultStyleProvider } from "../StyleProvider"; +import { CollectionDockingView } from "./CollectionDockingView"; +import { CollectionLinearView } from "./CollectionLinearView"; import "./CollectionMenu.scss"; import { CollectionViewType, COLLECTION_BORDER_WIDTH } from "./CollectionView"; import { TabDocView } from "./TabDocView"; -import { LightboxView } from "../LightboxView"; -import { Docs } from "../../documents/Documents"; -import { DocumentManager } from "../../util/DocumentManager"; -import { CollectionDockingView } from "./CollectionDockingView"; -import { FormattedTextBox } from "../nodes/formattedText/FormattedTextBox"; @observer export class CollectionMenu extends AntimodeMenu { @@ -46,6 +48,8 @@ export class CollectionMenu extends AntimodeMenu { @observable SelectedCollection: DocumentView | undefined; @observable FieldKey: string; + private _docBtnRef = React.createRef(); + constructor(props: any) { super(props); this.FieldKey = ""; @@ -82,30 +86,85 @@ export class CollectionMenu extends AntimodeMenu { } } + buttonBarXf = () => { + if (!this._docBtnRef.current) return Transform.Identity(); + const { scale, translateX, translateY } = Utils.GetScreenTransform(this._docBtnRef.current); + return new Transform(-translateX, -translateY, 1 / scale); + } + + @computed get contMenuButtons() { + const selDoc = Doc.UserDoc().contextMenuBtns; + return !(selDoc instanceof Doc) ? (null) :
    + 100} + PanelHeight={() => 35} + renderDepth={0} + focus={() => undefined} + whenChildContentsActiveChanged={emptyFunction} + docFilters={returnEmptyFilter} + docRangeFilters={returnEmptyFilter} + searchFilterDocs={returnEmptyDoclist} + ContainingCollectionView={undefined} + ContainingCollectionDoc={undefined} /> +
    ; + } + render() { - const button = Pin Menu
} key="pin menu" placement="bottom"> - - ; const propIcon = CurrentUserUtils.propertiesWidth > 0 ? "angle-double-right" : "angle-double-left"; const propTitle = CurrentUserUtils.propertiesWidth > 0 ? "Close Properties Panel" : "Open Properties Panel"; const prop = {propTitle}
} key="properties" placement="bottom"> - +
; - return this.getElement(!this.SelectedCollection ? [/*button*/] : - [, - prop, - /*button*/]); + // NEW BUTTONS + //dash col linear view buttons + const contMenuButtons = +
+ {this.contMenuButtons} + {prop} +
; + + return contMenuButtons; + + // const button = Pin Menu
} key="pin menu" placement="bottom"> + // + // ; + + // OLD BUTTONS + // return this.getElement(!this.SelectedCollection ? [/*button*/] : + // [, + // prop, + // /*button*/]); } } diff --git a/src/client/views/collections/collectionLinearView/CollectionLinearView.scss b/src/client/views/collections/collectionLinearView/CollectionLinearView.scss index a10d43917..db39e304b 100644 --- a/src/client/views/collections/collectionLinearView/CollectionLinearView.scss +++ b/src/client/views/collections/collectionLinearView/CollectionLinearView.scss @@ -5,12 +5,22 @@ overflow: visible; height: 100%; pointer-events: none; + // background-color: rgba(0, 0, 0, 0.2); + border-radius: 5px; + padding-left: 5px; + padding-right: 5px; + border-left: $standard-border; + border-right: $standard-border; .collectionLinearView { display: flex; height: 100%; align-items: center; + .collectionView{ + overflow: visible !important; + } + >span { background: $dark-gray; color: $white; @@ -67,29 +77,25 @@ } >label { - margin-top: "auto"; - margin-bottom: "auto"; background: $dark-gray; color: $white; - display: inline-block; + display: flex; border-radius: 18px; font-size: 12.5px; - width: 18px; - height: 18px; + font-weight:100; + width: fit-content; + height: 100%; margin-top: auto; margin-bottom: auto; margin-right: 3px; cursor: pointer; transition: transform 0.2s; - } - - label p { - padding-left: 5px; - } + align-items: center; + justify-content: center; - label:hover { - background: $medium-gray; - transform: scale(1.15); + &:hover { + background: $medium-gray; + } } >input { @@ -110,7 +116,6 @@ display: flex; opacity: 1; position: relative; - margin-top: auto; .collectionLinearView-docBtn, .collectionLinearView-docBtn-scalable { diff --git a/src/client/views/collections/collectionLinearView/CollectionLinearView.tsx b/src/client/views/collections/collectionLinearView/CollectionLinearView.tsx index 8e2ba2275..e7970758a 100644 --- a/src/client/views/collections/collectionLinearView/CollectionLinearView.tsx +++ b/src/client/views/collections/collectionLinearView/CollectionLinearView.tsx @@ -2,20 +2,21 @@ import { Tooltip } from '@material-ui/core'; import { action, IReactionDisposer, observable, reaction, runInAction } from 'mobx'; import { observer } from 'mobx-react'; import * as React from 'react'; -import { makeInterface } from '../../../../fields/Schema'; +import { Doc, HeightSym, WidthSym } from '../../../../fields/Doc'; import { documentSchema } from '../../../../fields/documentSchemas'; -import { CollectionSubView } from '../CollectionSubView'; +import { Id } from '../../../../fields/FieldSymbols'; +import { makeInterface } from '../../../../fields/Schema'; +import { BoolCast, NumCast, ScriptCast, StrCast } from '../../../../fields/Types'; +import { emptyFunction, returnEmptyDoclist, returnFalse, returnTrue, Utils } from '../../../../Utils'; import { DragManager } from '../../../util/DragManager'; -import { ScriptCast, NumCast, StrCast, BoolCast } from '../../../../fields/Types'; -import { HeightSym, Doc, WidthSym } from '../../../../fields/Doc'; -import { Utils, returnFalse, returnTrue, emptyFunction, returnEmptyDoclist } from '../../../../Utils'; +import { Transform } from '../../../util/Transform'; import { DocumentLinksButton } from '../../nodes/DocumentLinksButton'; +import { DocumentView } from '../../nodes/DocumentView'; import { LinkDescriptionPopup } from '../../nodes/LinkDescriptionPopup'; import { StyleProp } from '../../StyleProvider'; -import { CollectionViewType } from '../CollectionView'; -import { Id } from '../../../../fields/FieldSymbols'; -import { DocumentView } from '../../nodes/DocumentView'; -import { Transform } from '../../../util/Transform'; +import "./CollectionLinearView.scss"; +import { CollectionSubView } from '.././CollectionSubView'; +import { CollectionViewType } from '.././CollectionView'; type LinearDocument = makeInterface<[typeof documentSchema,]>; @@ -108,33 +109,37 @@ export class CollectionLinearView extends CollectionSubView(LinearDocument) { render() { const guid = Utils.GenerateGuid(); const flexDir: any = StrCast(this.Document.flexDirection); + const expandable: boolean = BoolCast(this.props.Document.linearViewExpandable); const backgroundColor = this.props.styleProvider?.(this.rootDoc, this.props, StyleProp.BackgroundColor); const color = this.props.styleProvider?.(this.rootDoc, this.props, StyleProp.Color); + const icon: string = StrCast(this.props.Document.icon); const menuOpener = ; return
-
{BoolCast(this.layoutDoc.linearViewIsExpanded) ? "Close menu" : "Open menu"}
} placement="top"> + {!expandable ? (null) :
{BoolCast(this.props.Document.linearViewIsExpanded) ? "Close menu" : "Open menu"}
} placement="top"> {menuOpener} -
- this.layoutDoc.linearViewIsExpanded = this.addMenuToggle.current!.checked)} /> +
} + this.props.Document.linearViewIsExpanded = this.addMenuToggle.current!.checked)} />
{this.childLayoutPairs.map((pair, ind) => { const nested = pair.layout._viewType === CollectionViewType.Linear; const dref = React.createRef(); - const scalable = pair.layout.onClick || pair.layout.onDragStart; - return
{ LightboxView.SetCookie(StrCast(anchor["cookies-set"])); - // copying over VIEW fields immediately allows the view type to switch to create the right _componentView - Array.from(Object.keys(Doc.GetProto(anchor))).filter(key => key.startsWith(ViewSpecPrefix)).forEach(spec => { - this.layoutDoc[spec.replace(ViewSpecPrefix, "")] = ((field) => field instanceof ObjectField ? ObjectField.MakeCopy(field) : field)(anchor[spec]); - }); + // copying over VIEW fields immediately allows the view type to switch to create the right _componentView + Array.from(Object.keys(Doc.GetProto(anchor))).filter(key => key.startsWith(ViewSpecPrefix)).forEach(spec => { + this.layoutDoc[spec.replace(ViewSpecPrefix, "")] = ((field) => field instanceof ObjectField ? ObjectField.MakeCopy(field) : field)(anchor[spec]); + }); // after a timeout, the right _componentView should have been created, so call it to update its view spec values setTimeout(() => this._componentView?.setViewSpec?.(anchor, LinkDocPreview.LinkInfo ? true : false)); - const focusSpeed = this._componentView?.scrollFocus?.(anchor, !LinkDocPreview.LinkInfo); // bcz: smooth parameter should really be passed into focus() instead of inferred here + const focusSpeed = this._componentView?.scrollFocus?.(anchor, !LinkDocPreview.LinkInfo); // bcz: smooth parameter should really be passed into focus() instead of inferred here const endFocus = focusSpeed === undefined ? options?.afterFocus : async (moved: boolean) => options?.afterFocus ? options?.afterFocus(true) : ViewAdjustment.doNothing; this.props.focus(options?.docTransform ? anchor : this.rootDoc, { ...options, afterFocus: (didFocus: boolean) => @@ -764,7 +765,7 @@ export class DocumentViewInternal extends DocComponent console.log(this.props.Document[DataSym]), icon: "hand-point-right" }); cm.addItem({ description: "Help...", noexpand: true, subitems: helpItems, icon: "question" }); } - + if (!this.topMost) e?.stopPropagation(); // DocumentViews should stop propagation of this event cm.displayMenu((e?.pageX || pageX || 0) - 15, (e?.pageY || pageY || 0) - 15); DocumentViewInternal.SelectAfterContextMenu && !this.props.isSelected(true) && setTimeout(() => SelectionManager.SelectView(this.props.DocumentView(), false), 300); // on a mac, the context menu is triggered on mouse down, but a YouTube video becaomes interactive when selected which means that the context menu won't show up. by delaying the selection until hopefully after the pointer up, the context menu will appear. @@ -949,12 +950,13 @@ export class DocumentViewInternal extends DocComponent { TraceMobx(); const xshift = () => (this.props.Document.isInkMask ? InkingStroke.MaskDim : Math.abs(this.Xshift) <= 0.001 ? this.props.PanelWidth() : undefined); const yshift = () => (this.props.Document.isInkMask ? InkingStroke.MaskDim : Math.abs(this.Yshift) <= 0.001 ? this.props.PanelHeight() : undefined); + const isButton: boolean = this.props.Document.type === DocumentType.FONTICON || this.props.Document._viewType === CollectionViewType.Linear; return (
{!this.props.Document || !this.props.PanelWidth() ? (null) : (
; const FontIconDocument = makeInterface(FontIconSchema); @observer -export class FontIconBox extends DocComponent(FontIconDocument) { +export class FontIconBox extends DocComponent(FontIconDocument) { public static LayoutString(fieldKey: string) { return FieldView.LayoutString(FontIconBox, fieldKey); } showTemplate = (): void => { const dragFactory = Cast(this.layoutDoc.dragFactory, Doc, null); @@ -56,8 +59,6 @@ export class FontIconBox extends DocComponent( // Determining UI Specs @observable private label = StrCast(this.rootDoc.label, StrCast(this.rootDoc.title)); - @observable private color = this.props.styleProvider?.(this.rootDoc, this.props, StyleProp.Color); - @observable private backgroundColor = this.props.styleProvider?.(this.rootDoc, this.props, StyleProp.BackgroundColor); @observable private icon = StrCast(this.dataDoc.icon, "user") as any; @observable private dropdown: boolean = BoolCast(this.rootDoc.dropDownOpen); @observable private dropdownDirection: string = StrCast(this.rootDoc.dropDownDirection); @@ -82,16 +83,18 @@ export class FontIconBox extends DocComponent( */ @computed get dropdownButton() { const active: string = StrCast(this.rootDoc.dropDownOpen); + const color = this.props.styleProvider?.(this.rootDoc, this.props, StyleProp.Color); + const backgroundColor = this.props.styleProvider?.(this.rootDoc, this.props, StyleProp.BackgroundColor); return (
this.rootDoc.dropDownOpen = !this.rootDoc.dropDownOpen)}> - - {!this.label || !Doc.UserDoc()._showLabel ? (null) :
{this.label}
} + + {!this.label || !Doc.UserDoc()._showLabel ? (null) :
{this.label}
}
- +
{this.rootDoc.dropDownOpen ?
( * Default */ @computed get defaultButton() { + const color = this.props.styleProvider?.(this.rootDoc, this.props, StyleProp.Color); + const backgroundColor = this.props.styleProvider?.(this.rootDoc, this.props, StyleProp.BackgroundColor); const active: string = StrCast(this.rootDoc.dropDownOpen); return (
- {!this.label || !Doc.UserDoc()._showLabel ? (null) :
{this.label}
} - + {!this.label || !Doc.UserDoc()._showLabel ? (null) :
{this.label}
} + {/* */}
) @@ -136,6 +141,8 @@ export class FontIconBox extends DocComponent( render() { + const color = this.props.styleProvider?.(this.rootDoc, this.props, StyleProp.Color); + const backgroundColor = this.props.styleProvider?.(this.rootDoc, this.props, StyleProp.BackgroundColor); // Variables called through eval (from button) const canUndo: boolean = UndoManager.CanUndo(); const canRedo: boolean = UndoManager.CanRedo(); @@ -144,7 +151,7 @@ export class FontIconBox extends DocComponent( const userDoc = Doc.UserDoc(); // Toggle and canClick properties as determined from the variable passed into the button doc - // const toggle = this.rootDoc.toggle ? ScriptCast(this.rootDoc.toggle) : undefined; + const toggle = this.rootDoc.toggle ? ScriptCast(this.rootDoc.toggle) : undefined; const canClick: boolean = this.rootDoc.canClick ? eval(StrCast(this.rootDoc.canClick)) : false; // if (toggle) { // console.log(StrCast(this.rootDoc.title), toggle); @@ -154,11 +161,11 @@ export class FontIconBox extends DocComponent( const active: string = StrCast(this.rootDoc.dropDownOpen); const label = !this.label || !Doc.UserDoc()._showLabel ? (null) : -
+
{this.label}
; const menuLabel = !this.label || !Doc.UserDoc()._showMenuLabel ? (null) : -
+
{this.label}
; const dropdownCaret =
( style={{ borderBottomRightRadius: this.dropdown ? 0 : undefined }}>
; - const colorBox = (func: (color: ColorState) => void) => void) => ; @@ -207,9 +214,9 @@ export class FontIconBox extends DocComponent( case ButtonType.DropdownList: button = (
this.rootDoc.dropDownOpen = !this.rootDoc.dropDownOpen}> - {/* {toggle} */} + {toggle} {label} {dropdownCaret} {this.rootDoc.dropDownOpen ? @@ -227,10 +234,10 @@ export class FontIconBox extends DocComponent( case ButtonType.ColorButton: button = (
this.rootDoc.dropDownOpen = !this.rootDoc.dropDownOpen} onPointerDown={e => e.stopPropagation()}> - + {label} {dropdownCaret} {this.rootDoc.dropDownOpen ? @@ -247,40 +254,36 @@ export class FontIconBox extends DocComponent(
); break; - // case ButtonType.ToggleButton: - // button = ( - //
- // - // {label} - //
- // ); - // break; + case ButtonType.ToggleButton: + button = ( +
+ + {label} +
+ ); + break; case ButtonType.ClickButton: button = ( -
- +
+ {label}
); break; case ButtonType.DoubleButton: button = ( -
- +
+ {label}
); break; case ButtonType.MenuButton: button = ( -
- +
+ {menuLabel}
- //
- // - // {label} - //
); break; default: -- cgit v1.2.3-70-g09d2 From 94cfa66db4d667cd0dae9c6ddbe152cbff27819f Mon Sep 17 00:00:00 2001 From: geireann <60007097+geireann@users.noreply.github.com> Date: Thu, 19 Aug 2021 11:24:54 -0400 Subject: updates --- package-lock.json | 5 +++-- src/client/util/CurrentUserUtils.ts | 17 +++++++++-------- src/client/views/nodes/button/FontIconBox.scss | 17 ++++++++++++++--- src/client/views/nodes/button/FontIconBox.tsx | 11 ++++++++++- 4 files changed, 36 insertions(+), 14 deletions(-) (limited to 'src/client/util/CurrentUserUtils.ts') diff --git a/package-lock.json b/package-lock.json index 59ae898bf..7810e3120 100644 --- a/package-lock.json +++ b/package-lock.json @@ -7694,13 +7694,14 @@ "resolved": "https://registry.npmjs.org/image-size-stream/-/image-size-stream-1.1.0.tgz", "integrity": "sha1-Ivou2mbG31AQh0bacUkmSy0l+Gs=", "requires": { + "image-size": "github:netroy/image-size#da2c863807a3e9602617bdd357b0de3ab4a064c1", "readable-stream": "^1.0.33", "tryit": "^1.0.1" }, "dependencies": { "image-size": { - "version": "git+https://github.com/netroy/image-size.git#da2c863807a3e9602617bdd357b0de3ab4a064c1", - "from": "git+https://github.com/netroy/image-size.git#da2c863807a3e9602617bdd357b0de3ab4a064c1" + "version": "github:netroy/image-size#da2c863807a3e9602617bdd357b0de3ab4a064c1", + "from": "github:netroy/image-size#da2c863807a3e9602617bdd357b0de3ab4a064c1" }, "isarray": { "version": "0.0.1", diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts index cd4c217b5..d03ef4aca 100644 --- a/src/client/util/CurrentUserUtils.ts +++ b/src/client/util/CurrentUserUtils.ts @@ -70,14 +70,14 @@ export class CurrentUserUtils { [this.ficon({ ignoreClick: true, icon: "mobile", - btnType: ButtonType.ClickButton, + btnType: ButtonType.ToolButton, backgroundColor: "transparent" }), this.mobileTextContainer({}, [this.mobileButtonText({}, "NEW MOBILE BUTTON"), this.mobileButtonInfo({}, "You can customize this button and make it your own.")])]); doc["template-mobile-button"] = CurrentUserUtils.ficon({ onDragStart: ScriptField.MakeFunction('copyDragFactory(this.dragFactory)'), - dragFactory: new PrefetchProxy(queryTemplate) as any as Doc, title: "mobile button", icon: "mobile", btnType: ButtonType.ClickButton, + dragFactory: new PrefetchProxy(queryTemplate) as any as Doc, title: "mobile button", icon: "mobile", btnType: ButtonType.ToolButton, }); } @@ -93,7 +93,7 @@ export class CurrentUserUtils { doc["template-button-slides"] = CurrentUserUtils.ficon({ onDragStart: ScriptField.MakeFunction('copyDragFactory(this.dragFactory)'), dragFactory: new PrefetchProxy(slideTemplate) as any as Doc, title: "presentation slide", icon: "address-card", - btnType: ButtonType.ClickButton + btnType: ButtonType.ToolButton }); } @@ -140,7 +140,7 @@ export class CurrentUserUtils { doc["template-button-link"] = CurrentUserUtils.ficon({ onDragStart: ScriptField.MakeFunction('copyDragFactory(this.dragFactory)'), dragFactory: new PrefetchProxy(linkTemplate) as any as Doc, title: "link view", icon: "window-maximize", system: true, - btnType: ButtonType.ClickButton + btnType: ButtonType.ToolButton }); } @@ -172,7 +172,7 @@ export class CurrentUserUtils { doc["template-button-switch"] = CurrentUserUtils.ficon({ onDragStart: ScriptField.MakeFunction('copyDragFactory(this.dragFactory)'), dragFactory: new PrefetchProxy(box) as any as Doc, title: "data switch", icon: "toggle-on", system: true, - btnType: ButtonType.ClickButton + btnType: ButtonType.ToolButton }); } @@ -225,7 +225,7 @@ export class CurrentUserUtils { title: "detailView", icon: "window-maximize", system: true, - btnType: ButtonType.ClickButton, + btnType: ButtonType.ToolButton, }); } @@ -511,12 +511,13 @@ export class CurrentUserUtils { icon, title, toolTip, - btnType: ButtonType.ClickButton, + btnType: ButtonType.ToolButton, ignoreClick, _dropAction: "alias", onDragStart: drag ? ScriptField.MakeFunction(drag) : undefined, onClick: click ? ScriptField.MakeScript(click) : undefined, - backgroundColor, + backgroundColor: backgroundColor ? backgroundColor : Colors.DARK_GRAY, + color: Colors.WHITE, _hideContextMenu: true, _removeDropProperties: new List(["_stayInCollection"]), _stayInCollection: true, diff --git a/src/client/views/nodes/button/FontIconBox.scss b/src/client/views/nodes/button/FontIconBox.scss index 46a499466..0c866988d 100644 --- a/src/client/views/nodes/button/FontIconBox.scss +++ b/src/client/views/nodes/button/FontIconBox.scss @@ -38,12 +38,24 @@ &.clickBtn { cursor: pointer; + width: 40px; } &.tglBtn { cursor: pointer; } + &.toolBtn { + cursor: pointer; + width: 40px; + border-radius: 100%; + + svg { + width: 60% !important; + height: 60%; + } + } + &.menuBtn { cursor: pointer; border-radius: 0px; @@ -109,7 +121,7 @@ } .list-item:hover { - background-color:lightgrey; + background-color: lightgrey; } } } @@ -201,5 +213,4 @@ // background:transparent; // position: fixed; // } -// } - +// } \ No newline at end of file diff --git a/src/client/views/nodes/button/FontIconBox.tsx b/src/client/views/nodes/button/FontIconBox.tsx index 2c6369e9f..9e7608dc3 100644 --- a/src/client/views/nodes/button/FontIconBox.tsx +++ b/src/client/views/nodes/button/FontIconBox.tsx @@ -27,7 +27,8 @@ export enum ButtonType { ClickButton = "clickBtn", DoubleButton = "dblBtn", ToggleButton = "tglBtn", - ColorButton = "colorBtn" + ColorButton = "colorBtn", + ToolButton = "toolBtn" } export interface ButtonProps extends FieldViewProps { @@ -254,6 +255,14 @@ export class FontIconBox extends DocComponent(Fon
); break; + case ButtonType.ToolButton: + button = ( +
+ + {label} +
+ ); + break; case ButtonType.ToggleButton: button = (
-- cgit v1.2.3-70-g09d2 From d5841cda5aa838cf02b26a7ffbcc2b1713a66f36 Mon Sep 17 00:00:00 2001 From: geireann Date: Thu, 19 Aug 2021 17:43:33 -0400 Subject: menu nearing final updates --- src/client/documents/Documents.ts | 2 + src/client/util/CurrentUserUtils.ts | 115 +- src/client/util/tempCurrentUserUtils.ts | 1389 -------------------- src/client/views/DocumentButtonBar.tsx | 5 +- src/client/views/collections/CollectionMenu.tsx | 1 + .../collectionLinearView/CollectionLinearView.scss | 11 +- .../collectionLinearView/CollectionLinearView.tsx | 2 +- src/client/views/nodes/button/ButtonScripts.ts | 14 + src/client/views/nodes/button/FontIconBox.scss | 64 +- src/client/views/nodes/button/FontIconBox.tsx | 375 ++++-- 10 files changed, 414 insertions(+), 1564 deletions(-) delete mode 100644 src/client/util/tempCurrentUserUtils.ts create mode 100644 src/client/views/nodes/button/ButtonScripts.ts (limited to 'src/client/util/CurrentUserUtils.ts') diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts index 817fbb9d6..f6b2e0736 100644 --- a/src/client/documents/Documents.ts +++ b/src/client/documents/Documents.ts @@ -223,11 +223,13 @@ export class DocumentOptions { docColorBtn?: string; userColorBtn?: string; canClick?: string; + script?: string; //LINEAR VIEW linearViewIsExpanded?: boolean; // is linear view expanded linearViewExpandable?: boolean; // can linear view be expanded linearViewToggleButton?: string; // button to open close linear view group + linearViewSubMenu?: boolean; layout_linkView?: Doc; // view template for a link document layout_keyValue?: string; // view tempalte for key value docs diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts index d03ef4aca..4ff0446ad 100644 --- a/src/client/util/CurrentUserUtils.ts +++ b/src/client/util/CurrentUserUtils.ts @@ -923,44 +923,58 @@ export class CurrentUserUtils { title: "Font", toolTip: "Font", width: 100, btnType: ButtonType.DropdownList, ignoreClick: true, list: ["Roboto", "Roboto Mono", "Nunito", "Times New Roman", "Arial", "Georgia", "Comic Sans MS", "Tahoma", "Impact", "Crimson Text"], - scriptDoc: Doc.UserDoc(), toggle: 'userDoc._fontFamily' + script: 'changeFont' }, + { title: "Bold", toolTip: "Bold (Ctrl+B)", btnType: ButtonType.ToggleButton, icon: "bold", click: 'toggleBold()', script: 'toggleBold' }, + { title: "Italic", toolTip: "Italic (Ctrl+I)", btnType: ButtonType.ToggleButton, icon: "italic", click: 'toggleItalic()', script: 'toggleItalic' }, + { title: "Underline", toolTip: "Underline (Ctrl+U)", btnType: ButtonType.ToggleButton, icon: "underline", click: 'toggleUnderline()', script: 'toggleUnderline' }, + // { title: "Strikethrough", tooltip: "Strikethrough", btnType: ButtonType.ToggleButton, icon: "strikethrough", click: 'toggleStrikethrough()'}, + // { title: "Superscript", tooltip: "Superscript", btnType: ButtonType.ToggleButton, icon: "superscript", click: 'toggleSuperscript()'}, + // { title: "Subscript", tooltip: "Subscript", btnType: ButtonType.ToggleButton, icon: "subscript", click: 'toggleSubscript()'}, + { title: "Highlight", toolTip: "Highlight", btnType: ButtonType.ColorButton, icon: "highlighter", ignoreClick: true, scriptDoc: Doc.UserDoc(), userColorBtn: 'userDoc._highlightColor' }, + { title: "Text color", toolTip: "Text color", btnType: ButtonType.ColorButton, icon: "fill-drip", ignoreClick: true, scriptDoc: Doc.UserDoc(), script:'console.log("test")', userColorBtn: 'userDoc._textColor' }, + ]; + } + + static inkTools(doc: Doc) { + return [ + { title: "Pen", toolTip: "Pen (Ctrl+P)", btnType: ButtonType.ToggleButton, icon: "pen", click: 'togglePen()', script: 'togglePen' }, + { title: "Highlighter", toolTip: "Highlighter (Ctrl+H)", btnType: ButtonType.ToggleButton, icon: "highlighter", click: 'toggleHighlighter()', script: 'toggleHighlighter' }, + { title: "Circle", toolTip: "Circle (Ctrl+Shift+C)", btnType: ButtonType.ToggleButton, icon: "circle", click: 'toggleCircle()', script: 'toggleCircle' }, + { title: "Square", toolTip: "Square (Ctrl+Shift+S)", btnType: ButtonType.ToggleButton, icon: "square", click: 'toggleSquare()', script: 'toggleSquare' }, + { title: "Line", toolTip: "Line (Ctrl+Shift+L)", btnType: ButtonType.ToggleButton, icon: "fill-drip", click: 'toggleLine()', script: 'toggleLine' }, + ]; + } + + static webTools(doc: Doc) { + return [ { - title: "Bold", toolTip: "Bold (Ctrl+B)", btnType: ButtonType.ToggleButton, icon: "bold", click: 'toggleBold()', - scriptDoc: Doc.UserDoc(), - toggle: 'userDoc._boldActive' + title: "Font", toolTip: "Font", width: 100, btnType: ButtonType.DropdownList, ignoreClick: true, + list: ["Roboto", "Roboto Mono", "Nunito", "Times New Roman", "Arial", "Georgia", + "Comic Sans MS", "Tahoma", "Impact", "Crimson Text"], + script: 'changeFont' }, - { title: "Italic", toolTip: "Italic (Ctrl+I)", btnType: ButtonType.ToggleButton, icon: "italic", click: 'toggleItalic()', scriptDoc: Doc.UserDoc(), toggle: 'userDoc._italicsActive' }, - { title: "Underline", toolTip: "Underline (Ctrl+U)", btnType: ButtonType.ToggleButton, icon: "underline", click: 'toggleUnderline()', scriptDoc: Doc.UserDoc(), toggle: 'userDoc._underlineActive' }, - // { title: "Strikethrough", tooltip: "Strikethrough", btnType: ButtonType.ToggleButton, icon: "strikethrough", click: 'toggleStrikethrough()', toggle: 'userDoc._underlineActive' }, - // { title: "Superscript", tooltip: "Superscript", btnType: ButtonType.ToggleButton, icon: "superscript", click: 'toggleSuperscript()', toggle: 'userDoc._underlineActive' }, - // { title: "Subscript", tooltip: "Subscript", btnType: ButtonType.ToggleButton, icon: "subscript", click: 'toggleSubscript()', toggle: 'userDoc._underlineActive' }, - { title: "Highlight", toolTip: "Highlight", btnType: ButtonType.ColorButton, icon: "highlighter", ignoreClick: true, scriptDoc: Doc.UserDoc(), userColorBtn: 'userDoc._highlightColor' }, - { title: "Text color", toolTip: "Text color", btnType: ButtonType.ColorButton, icon: "fill-drip", ignoreClick: true, scriptDoc: Doc.UserDoc(), userColorBtn: 'userDoc._textColor' }, - // { title: "Link", tooltip: "Link", btnType: ButtonType.DropdownButton, icon: "link", click: '', ignoreClick: true }, ]; } static async contextMenuBtnDescriptions(doc: Doc) { return [ - // { title: "Perspective", tooltip: "Change document's perspective", type: "btn", btnType: ButtonType.DropdownButton, ignoreClick: true, icon: "desktop", click: '' }, { - title: "Perspective", toolTip: "Perspective", width: 100, btnType: ButtonType.DropdownList, ignoreClick: true, + title: "Perspective", toolTip: "View", width: 100, btnType: ButtonType.DropdownList, ignoreClick: true, list: [CollectionViewType.Freeform, CollectionViewType.Schema, CollectionViewType.Tree, - CollectionViewType.Stacking, CollectionViewType.Masonry, CollectionViewType.Multicolumn, - CollectionViewType.Multirow, CollectionViewType.Time, CollectionViewType.Carousel, - CollectionViewType.Carousel3D, CollectionViewType.Linear, CollectionViewType.Map, - CollectionViewType.Grid], - scriptDoc: 'selectedDoc', - toggle: 'selectedDoc._viewType' + CollectionViewType.Stacking, CollectionViewType.Masonry, CollectionViewType.Multicolumn, + CollectionViewType.Multirow, CollectionViewType.Time, CollectionViewType.Carousel, + CollectionViewType.Carousel3D, CollectionViewType.Linear, CollectionViewType.Map, + CollectionViewType.Grid], + script: 'changeView', }, { - title: "Background", toolTip: "Background", btnType: ButtonType.ColorButton, scriptDoc: 'selectedDoc', - docColorBtn: 'selectedDoc.backgroundColor', width: 60, ignoreClick: true, icon: "fill-drip", - canClick: 'numSelected > 0' + title: "Background", toolTip: "Background", btnType: ButtonType.ColorButton, width: 60, ignoreClick: true, icon: "fill-drip", + script: "changeBackgroundColor" }, - { title: "Overlay", toolTip: "Overlay", btnType: ButtonType.ToggleButton, icon: "layer-group", click: 'toggleOverlay()', toggle: 'selectedDoc.z', canClick: 'numSelected > 0' }, - { title: "Text Tools", type: "TextMenu", icon: "font" }, + { title: "Overlay", toolTip: "Overlay", btnType: ButtonType.ToggleButton, icon: "layer-group", click: 'toggleOverlay()' }, + { title: "Text", type: "TextMenu" }, + { title: "Ink & GFX", type: "InkMenu" }, // { title: "Ink Tools", type: "LinearMenu", icon: "pen-nib" }, // { title: "GFX Tools", type: "LinearMenu", icon: "shapes" }, // { title: "Alias", btnType: ButtonType.ClickButton, icon: "copy" }, @@ -971,21 +985,44 @@ export class CurrentUserUtils { static async setupContextMenuButtons(doc: Doc) { const docList: Doc[] = []; - const contextMenuBtns = (await CurrentUserUtils.contextMenuBtnDescriptions(doc)).map(({ title, width, toolTip, ignoreClick, icon, type, btnType, click, toggle, scriptDoc, canClick, docColorBtn }) => { + const contextMenuBtns = (await CurrentUserUtils.contextMenuBtnDescriptions(doc)).map(({ title, width, list, toolTip, ignoreClick, icon, type, btnType, click, script }) => { const textDocList: Doc[] = []; if (type === "TextMenu") { - const textBtns = (CurrentUserUtils.textTools(doc)).map(({ title, width, list, toolTip, ignoreClick, icon, btnType, click, toggle, scriptDoc, userColorBtn }) => { + const textBtns = (CurrentUserUtils.textTools(doc)).map(({ title, width, list, toolTip, ignoreClick, icon, btnType, click, script, userColorBtn }) => { textDocList.push(Docs.Create.FontIconDocument({ - _nativeWidth: width ? width : 25, - _nativeHeight: 25, - _width: width ? width : 25, - _height: 25, + _nativeWidth: width ? width : 30, + _nativeHeight: 30, + _width: width ? width : 30, + _height: 30, icon, toolTip, userColorBtn, - - // testToggle: toggle ? ScriptField.MakeScript(toggle, { this: scriptDoc, scriptContext: "any" }) : undefined, - // toggle: toggle, + script, + btnType: btnType, + btnList: new List(list), + ignoreClick: ignoreClick, + _stayInCollection: true, + _hideContextMenu: true, + system: true, + dontUndo: true, + title, + backgroundColor: "black", + _dropAction: "alias", + _removeDropProperties: new List(["dropAction", "_stayInCollection"]), + onClick: click ? ScriptField.MakeScript(click, { doc: Doc.name }) : undefined + })); + }); + docList.push(CurrentUserUtils.blist({ linearViewSubMenu: true, ignoreClick: true, linearViewExpandable: true, icon:title, _height: 30, backgroundColor: "transparent" }, textDocList)); + } else if (type === "InkMenu") { + const inkBtns = (CurrentUserUtils.inkTools(doc)).map(({ title, toolTip, icon, btnType, click }) => { + textDocList.push(Docs.Create.FontIconDocument({ + _nativeWidth: width ? width : 30, + _nativeHeight: 30, + _width: width ? width : 30, + _height: 30, + icon, + toolTip, + script, btnType: btnType, btnList: new List(list), ignoreClick: ignoreClick, @@ -997,10 +1034,10 @@ export class CurrentUserUtils { backgroundColor: "black", _dropAction: "alias", _removeDropProperties: new List(["dropAction", "_stayInCollection"]), - onClick: click ? ScriptField.MakeScript(click, { scriptContext: "any" }) : undefined + onClick: click ? ScriptField.MakeScript(click, { doc: Doc.name }) : undefined })); }); - docList.push(CurrentUserUtils.blist({ ignoreClick: true, linearViewExpandable: true, icon:"Text", _height: 30, backgroundColor: "transparent" }, textDocList)); + docList.push(CurrentUserUtils.blist({ linearViewSubMenu: true, ignoreClick: true, linearViewExpandable: true, icon:title, _height: 30, backgroundColor: "transparent" }, textDocList)); } else { docList.push(Docs.Create.FontIconDocument({ _nativeWidth: width ? width : 30, @@ -1011,9 +1048,9 @@ export class CurrentUserUtils { toolTip, // testToggle: toggle ? ScriptField.MakeScript(toggle, { scriptContext: "any" }) : undefined, // toggle: toggle, - docColorBtn, - canClick: canClick, + script, btnType: btnType, + btnList: new List(list), ignoreClick: ignoreClick, _stayInCollection: true, _hideContextMenu: true, @@ -1093,7 +1130,7 @@ export class CurrentUserUtils { } if (doc.myImportPanel === undefined) { const uploads = Cast(doc.myImportDocs, Doc, null); - const newUpload = CurrentUserUtils.ficon({ onClick: ScriptField.MakeScript("importDocument()"), toolTip: "Import External document", _stayInCollection: true, _hideContextMenu: true, title: "Import", icon: "upload", system: true }); + const newUpload = CurrentUserUtils.ficon({ onClick: ScriptField.MakeScript("importDocument()"), toolTip: "Import External document", _stayInCollection: true, _hideContextMenu: true, title: "Import", type: ButtonType.ToolButton, icon: "upload", system: true }); doc.myImportPanel = new PrefetchProxy(Docs.Create.StackingDocument([newUpload, uploads], { title: "My ImportPanel", _yMargin: 20, _showTitle: "title", ignoreClick: true, _chromeHidden: true, _stayInCollection: true, _hideContextMenu: true, _lockedPosition: true, system: true, boxShadow: "0 0" })); } } diff --git a/src/client/util/tempCurrentUserUtils.ts b/src/client/util/tempCurrentUserUtils.ts deleted file mode 100644 index 3fba672e6..000000000 --- a/src/client/util/tempCurrentUserUtils.ts +++ /dev/null @@ -1,1389 +0,0 @@ -import { computed, observable, reaction, action } from "mobx"; -import * as rp from 'request-promise'; -import { DataSym, Doc, DocListCast, DocListCastAsync, AclReadonly } from "../../fields/Doc"; -import { Id } from "../../fields/FieldSymbols"; -import { List } from "../../fields/List"; -import { PrefetchProxy } from "../../fields/Proxy"; -import { RichTextField } from "../../fields/RichTextField"; -import { listSpec } from "../../fields/Schema"; -import { SchemaHeaderField } from "../../fields/SchemaHeaderField"; -import { ComputedField, ScriptField } from "../../fields/ScriptField"; -import { BoolCast, Cast, NumCast, PromiseValue, StrCast, DateCast } from "../../fields/Types"; -import { nullAudio } from "../../fields/URLField"; -import { SharingPermissions } from "../../fields/util"; -import { Utils } from "../../Utils"; -import { DocServer } from "../DocServer"; -import { Docs, DocumentOptions, DocUtils } from "../documents/Documents"; -import { DocumentType } from "../documents/DocumentTypes"; -import { Networking } from "../Network"; -import { CollectionDockingView } from "../views/collections/collectionDocking/CollectionDockingView"; -import { DimUnit } from "../views/collections/collectionMulticolumn/CollectionMulticolumnView"; -import { CollectionView, CollectionViewType } from "../views/collections/CollectionView"; -import { MainView } from "../views/MainView"; -import { FormattedTextBox } from "../views/nodes/formattedText/FormattedTextBox"; -import { LabelBox } from "../views/nodes/LabelBox"; -import { OverlayView } from "../views/OverlayView"; -import { DocumentManager } from "./DocumentManager"; -import { DragManager } from "./DragManager"; -import { makeTemplate } from "./DropConverter"; -import { HistoryUtil } from "./History"; -import { LinkManager } from "./LinkManager"; -import { Scripting } from "./Scripting"; -import { SearchUtil } from "./SearchUtil"; -import { SelectionManager } from "./SelectionManager"; -import { SnappingManager } from "./SnappingManager"; -import { InkTool } from "../../fields/InkField"; -import { ButtonType } from "../views/nodes/FontIconBox"; - - -export let resolvedPorts: { server: number, socket: number }; -const headerViewVersion = "0.1"; -export class CurrentUserUtils { - private static curr_id: string; - //TODO tfs: these should be temporary... - private static mainDocId: string | undefined; - - public static get id() { return this.curr_id; } - public static get MainDocId() { return this.mainDocId; } - public static set MainDocId(id: string | undefined) { this.mainDocId = id; } - @computed public static get UserDocument() { return Doc.UserDoc(); } - - @observable public static GuestTarget: Doc | undefined; - @observable public static GuestDashboard: Doc | undefined; - @observable public static GuestMobile: Doc | undefined; - @observable public static propertiesWidth: number = 0; - - // sets up the default User Templates - slideView, headerView - static setupUserTemplateButtons(doc: Doc) { - // Prototype for mobile button (not sure if 'Advanced Item Prototypes' is ideal location) - if (doc["template-mobile-button"] === undefined) { - const queryTemplate = this.mobileButton({ - title: "NEW MOBILE BUTTON", - onClick: undefined, - }, - [this.ficon({ - ignoreClick: true, - icon: "mobile", - btnType: ButtonType.ClickButton, - backgroundColor: "transparent" - }), - this.mobileTextContainer({}, - [this.mobileButtonText({}, "NEW MOBILE BUTTON"), this.mobileButtonInfo({}, "You can customize this button and make it your own.")])]); - doc["template-mobile-button"] = CurrentUserUtils.ficon({ - onDragStart: ScriptField.MakeFunction('copyDragFactory(this.dragFactory)'), - dragFactory: new PrefetchProxy(queryTemplate) as any as Doc, title: "mobile button", - btnType: ButtonType.ClickButton, - icon: "mobile" - }); - } - - if (doc["template-button-slides"] === undefined) { - const slideTemplate = Docs.Create.MultirowDocument( - [ - Docs.Create.MulticolumnDocument([], { title: "data", _height: 200, system: true }), - Docs.Create.TextDocument("", { title: "text", _height: 100, system: true }) - ], - { _width: 400, _height: 300, title: "slideView", _xMargin: 3, _yMargin: 3, system: true } - ); - slideTemplate.isTemplateDoc = makeTemplate(slideTemplate); - doc["template-button-slides"] = CurrentUserUtils.ficon({ - onDragStart: ScriptField.MakeFunction('copyDragFactory(this.dragFactory)'), - dragFactory: new PrefetchProxy(slideTemplate) as any as Doc, title: "presentation slide", - icon: "address-card", - btnType: ButtonType.ClickButton - }); - } - - if (doc["template-button-link"] === undefined) { // set _backgroundColor to transparent to prevent link dot from obscuring document it's attached to. - const linkTemplate = Doc.MakeDelegate(Docs.Create.TextDocument(" ", { title: "header", _autoHeight: true, system: true }, "header")); // text needs to be a space to allow templateText to be created - linkTemplate.system = true; - Doc.GetProto(linkTemplate).layout = - "
" + - " " + - " " + - "
"; - (linkTemplate.proto as Doc).isTemplateDoc = makeTemplate(linkTemplate.proto as Doc, true, "linkView"); - - const rtf2 = { - doc: { - type: "doc", content: [ - { - type: "paragraph", - content: [{ - type: "dashField", - attrs: { - fieldKey: "src", - hideKey: false - } - }] - }, - { type: "paragraph" }, - { - type: "paragraph", - content: [{ - type: "dashField", - attrs: { - fieldKey: "dst", - hideKey: false - } - }] - }] - }, - selection: { type: "text", anchor: 1, head: 1 }, - storedMarks: [] - }; - linkTemplate.header = new RichTextField(JSON.stringify(rtf2), ""); - - doc["template-button-link"] = CurrentUserUtils.ficon({ - onDragStart: ScriptField.MakeFunction('copyDragFactory(this.dragFactory)'), - dragFactory: new PrefetchProxy(linkTemplate) as any as Doc, title: "link view", - btnType: ButtonType.ClickButton, - icon: "window-maximize", system: true - }); - } - - if (doc["template-button-switch"] === undefined) { - const { FreeformDocument, MulticolumnDocument, TextDocument } = Docs.Create; - - const yes = FreeformDocument([], { title: "yes", _height: 35, _width: 50, _dimUnit: DimUnit.Pixel, _dimMagnitude: 40, system: true }); - const name = TextDocument("name", { title: "name", _height: 35, _width: 70, _dimMagnitude: 1, system: true }); - const no = FreeformDocument([], { title: "no", _height: 100, _width: 100, system: true }); - const labelTemplate = { - doc: { - type: "doc", content: [{ - type: "paragraph", - content: [{ type: "dashField", attrs: { fieldKey: "PARAMS", hideKey: true } }] - }] - }, - selection: { type: "text", anchor: 1, head: 1 }, - storedMarks: [] - }; - Doc.GetProto(name).text = new RichTextField(JSON.stringify(labelTemplate), "PARAMS"); - Doc.GetProto(yes).backgroundColor = ComputedField.MakeFunction("self[this.PARAMS] ? 'green':'red'"); - // Doc.GetProto(no).backgroundColor = ComputedField.MakeFunction("!self[this.PARAMS] ? 'red':'white'"); - // Doc.GetProto(yes).onClick = ScriptField.MakeScript("self[this.PARAMS] = true"); - Doc.GetProto(yes).onClick = ScriptField.MakeScript("self[this.PARAMS] = !self[this.PARAMS]"); - // Doc.GetProto(no).onClick = ScriptField.MakeScript("self[this.PARAMS] = false"); - const box = MulticolumnDocument([/*no, */ yes, name], { title: "value", _width: 120, _height: 35, system: true }); - box.isTemplateDoc = makeTemplate(box, true, "switch"); - - doc["template-button-switch"] = CurrentUserUtils.ficon({ - onDragStart: ScriptField.MakeFunction('copyDragFactory(this.dragFactory)'), - dragFactory: new PrefetchProxy(box) as any as Doc, title: "data switch", - btnType: ButtonType.ClickButton, - icon: "toggle-on", system: true - }); - } - - if (doc["template-button-detail"] === undefined) { - const { TextDocument, MasonryDocument, CarouselDocument } = Docs.Create; - - const openInTarget = ScriptField.MakeScript("openOnRight(self.doubleClickView)"); - const carousel = CarouselDocument([], { - title: "data", _height: 350, _itemIndex: 0, "_carousel-caption-xMargin": 10, "_carousel-caption-yMargin": 10, - onChildDoubleClick: openInTarget, backgroundColor: "#9b9b9b3F", system: true - }); - - const details = TextDocument("", { title: "details", _height: 200, _autoHeight: true, system: true }); - const short = TextDocument("", { title: "shortDescription", treeViewOpen: true, treeViewExpandedView: "layout", _height: 75, _autoHeight: true, system: true }); - const long = TextDocument("", { title: "longDescription", treeViewOpen: false, treeViewExpandedView: "layout", _height: 150, _autoHeight: true, system: true }); - - const buxtonFieldKeys = ["year", "originalPrice", "degreesOfFreedom", "company", "attribute", "primaryKey", "secondaryKey", "dimensions"]; - const detailedTemplate = { - doc: { - type: "doc", content: buxtonFieldKeys.map(fieldKey => ({ - type: "paragraph", - content: [{ type: "dashField", attrs: { fieldKey } }] - })) - }, - selection: { type: "text", anchor: 1, head: 1 }, - storedMarks: [] - }; - details.text = new RichTextField(JSON.stringify(detailedTemplate), buxtonFieldKeys.join(" ")); - - const shared = { _autoHeight: true, _xMargin: 0 }; - const detailViewOpts = { title: "detailView", _width: 300, _fontFamily: "Arial", _fontSize: "12px" }; - const descriptionWrapperOpts = { title: "descriptions", _height: 300, _columnWidth: -1, treeViewHideTitle: true, _pivotField: "title", system: true }; - - const descriptionWrapper = MasonryDocument([details, short, long], { ...shared, ...descriptionWrapperOpts }); - descriptionWrapper._columnHeaders = new List([ - new SchemaHeaderField("[A Short Description]", "dimGray", undefined, undefined, undefined, false), - new SchemaHeaderField("[Long Description]", "dimGray", undefined, undefined, undefined, true), - new SchemaHeaderField("[Details]", "dimGray", undefined, undefined, undefined, true), - ]); - const detailView = Docs.Create.StackingDocument([carousel, descriptionWrapper], { ...shared, ...detailViewOpts, _chromeHidden: true, system: true }); - detailView.isTemplateDoc = makeTemplate(detailView); - - details.title = "Details"; - short.title = "A Short Description"; - long.title = "Long Description"; - - doc["template-button-detail"] = CurrentUserUtils.ficon({ - onDragStart: ScriptField.MakeFunction('copyDragFactory(this.dragFactory)'), - dragFactory: new PrefetchProxy(detailView) as any as Doc, title: "detailView", - btnType: ButtonType.ClickButton, - icon: "window-maximize", system: true - }); - } - - const requiredTypes = [ - doc["template-button-slides"] as Doc, - doc["template-mobile-button"] as Doc, - doc["template-button-detail"] as Doc, - doc["template-button-link"] as Doc, - //doc["template-button-switch"] as Doc] - ]; - if (doc["template-buttons"] === undefined) { - doc["template-buttons"] = new PrefetchProxy(Docs.Create.MasonryDocument(requiredTypes, { - title: "Advanced Item Prototypes", _xMargin: 0, _showTitle: "title", _chromeHidden: true, - hidden: ComputedField.MakeFunction("IsNoviceMode()") as any, - _stayInCollection: true, _hideContextMenu: true, - _autoHeight: true, _width: 500, _height: 300, _fitWidth: true, _columnWidth: 35, ignoreClick: true, _lockedPosition: true, - dropConverter: ScriptField.MakeScript("convertToButtons(dragData)", { dragData: DragManager.DocumentDragData.name }), system: true - })); - } else { - const curButnTypes = Cast(doc["template-buttons"], Doc, null); - DocListCastAsync(curButnTypes.data).then(async curBtns => { - curBtns && await Promise.all(curBtns); - requiredTypes.map(btype => Doc.AddDocToList(curButnTypes, "data", btype)); - }); - } - return doc["template-buttons"] as Doc; - } - - // setup the different note type skins - static setupNoteTemplates(doc: Doc) { - if (doc["template-note-Note"] === undefined) { - const noteView = Docs.Create.TextDocument("", { title: "text", isTemplateDoc: true, backgroundColor: "yellow", system: true }); - noteView.isTemplateDoc = makeTemplate(noteView, true, "Note"); - doc["template-note-Note"] = new PrefetchProxy(noteView); - } - if (doc["template-note-Idea"] === undefined) { - const noteView = Docs.Create.TextDocument("", { title: "text", backgroundColor: "pink", system: true }); - noteView.isTemplateDoc = makeTemplate(noteView, true, "Idea"); - doc["template-note-Idea"] = new PrefetchProxy(noteView); - } - if (doc["template-note-Topic"] === undefined) { - const noteView = Docs.Create.TextDocument("", { title: "text", backgroundColor: "lightblue", system: true }); - noteView.isTemplateDoc = makeTemplate(noteView, true, "Topic"); - doc["template-note-Topic"] = new PrefetchProxy(noteView); - } - if (doc["template-note-Todo"] === undefined) { - const noteView = Docs.Create.TextDocument("", { - title: "text", backgroundColor: "orange", _autoHeight: false, _height: 100, _showCaption: "caption", - layout: FormattedTextBox.LayoutString("Todo"), caption: RichTextField.DashField("taskStatus"), system: true - }); - noteView.isTemplateDoc = makeTemplate(noteView, true, "Todo"); - doc["template-note-Todo"] = new PrefetchProxy(noteView); - } - const taskStatusValues = [ - { title: "todo", _backgroundColor: "blue", color: "white", system: true }, - { title: "in progress", _backgroundColor: "yellow", color: "black", system: true }, - { title: "completed", _backgroundColor: "green", color: "white", system: true } - ]; - if (doc.fieldTypes === undefined) { - doc.fieldTypes = Docs.Create.TreeDocument([], { title: "field enumerations", system: true }); - DocUtils.addFieldEnumerations(Doc.GetProto(doc["template-note-Todo"] as any as Doc), "taskStatus", taskStatusValues); - } - - if (doc["template-notes"] === undefined) { - doc["template-notes"] = new PrefetchProxy(Docs.Create.TreeDocument([doc["template-note-Note"] as any as Doc, doc["template-note-Idea"] as any as Doc, doc["template-note-Topic"] as any as Doc], // doc["template-note-Todo"] as any as Doc], - { title: "Note Layouts", _height: 75, system: true })); - } else { - const curNoteTypes = Cast(doc["template-notes"], Doc, null); - const requiredTypes = [doc["template-note-Note"] as any as Doc, doc["template-note-Idea"] as any as Doc, doc["template-note-Topic"] as any as Doc];//, doc["template-note-Todo"] as any as Doc]; - DocListCastAsync(curNoteTypes.data).then(async curNotes => { - curNotes && await Promise.all(curNotes); - requiredTypes.map(ntype => Doc.AddDocToList(curNoteTypes, "data", ntype)); - }); - } - - return doc["template-notes"] as Doc; - } - - // creates Note templates, and initial "user" templates - static setupDocTemplates(doc: Doc) { - const noteTemplates = CurrentUserUtils.setupNoteTemplates(doc); - const userTemplateBtns = CurrentUserUtils.setupUserTemplateButtons(doc); - const clickTemplates = CurrentUserUtils.setupClickEditorTemplates(doc); - if (doc.templateDocs === undefined) { - doc.templateDocs = new PrefetchProxy(Docs.Create.TreeDocument([noteTemplates, userTemplateBtns, clickTemplates], { - title: "template layouts", _xPadding: 0, system: true, - dropConverter: ScriptField.MakeScript("convertToButtons(dragData)", { dragData: DragManager.DocumentDragData.name }) - })); - } - } - - // setup templates for different document types when they are iconified from Document Decorations - static setupDefaultIconTemplates(doc: Doc) { - if (doc["template-icon-view"] === undefined) { - const iconView = Docs.Create.LabelDocument({ - title: "icon", textTransform: "unset", letterSpacing: "unset", layout: LabelBox.LayoutString("title"), _backgroundColor: "dimGray", - _width: 150, _height: 70, _xPadding: 10, _yPadding: 10, isTemplateDoc: true, onDoubleClick: ScriptField.MakeScript("deiconifyView(self)"), system: true - }); - // Docs.Create.TextDocument("", { - // title: "icon", _width: 150, _height: 30, isTemplateDoc: true, onDoubleClick: ScriptField.MakeScript("deiconifyView(self)") - // }); - // Doc.GetProto(iconView).icon = new RichTextField('{"doc":{"type":"doc","content":[{"type":"paragraph","attrs":{"align":null,"color":null,"id":null,"indent":null,"inset":null,"lineSpacing":null,"paddingBottom":null,"paddingTop":null},"content":[{"type":"dashField","attrs":{"fieldKey":"title","docid":""}}]}]},"selection":{"type":"text","anchor":2,"head":2},"storedMarks":[]}', ""); - iconView.isTemplateDoc = makeTemplate(iconView); - doc["template-icon-view"] = new PrefetchProxy(iconView); - } - if (doc["template-icon-view-rtf"] === undefined) { - const iconRtfView = Docs.Create.LabelDocument({ - title: "icon_" + DocumentType.RTF, textTransform: "unset", letterSpacing: "unset", layout: LabelBox.LayoutString("text"), - _width: 150, _height: 70, _xPadding: 10, _yPadding: 10, isTemplateDoc: true, onDoubleClick: ScriptField.MakeScript("deiconifyView(self)"), system: true - }); - iconRtfView.isTemplateDoc = makeTemplate(iconRtfView, true, "icon_" + DocumentType.RTF); - doc["template-icon-view-rtf"] = new PrefetchProxy(iconRtfView); - } - if (doc["template-icon-view-button"] === undefined) { - const iconBtnView = Docs.Create.FontIconDocument({ - title: "icon_" + DocumentType.BUTTON, _nativeHeight: 30, _nativeWidth: 30, - _width: 30, _height: 30, isTemplateDoc: true, onDoubleClick: ScriptField.MakeScript("deiconifyView(self)"), system: true - }); - iconBtnView.isTemplateDoc = makeTemplate(iconBtnView, true, "icon_" + DocumentType.BUTTON); - doc["template-icon-view-button"] = new PrefetchProxy(iconBtnView); - } - if (doc["template-icon-view-img"] === undefined) { - const iconImageView = Docs.Create.ImageDocument("http://www.cs.brown.edu/~bcz/face.gif", { - title: "data", _width: 50, isTemplateDoc: true, onDoubleClick: ScriptField.MakeScript("deiconifyView(self)"), system: true - }); - iconImageView.isTemplateDoc = makeTemplate(iconImageView, true, "icon_" + DocumentType.IMG); - doc["template-icon-view-img"] = new PrefetchProxy(iconImageView); - } - if (doc["template-icon-view-col"] === undefined) { - const iconColView = Docs.Create.TreeDocument([], { title: "data", _width: 180, _height: 80, onDoubleClick: ScriptField.MakeScript("deiconifyView(self)"), system: true }); - iconColView.isTemplateDoc = makeTemplate(iconColView, true, "icon_" + DocumentType.COL); - doc["template-icon-view-col"] = new PrefetchProxy(iconColView); - } - if (doc["template-icons"] === undefined) { - doc["template-icons"] = new PrefetchProxy(Docs.Create.TreeDocument([doc["template-icon-view"] as Doc, doc["template-icon-view-img"] as Doc, doc["template-icon-view-button"] as Doc, - doc["template-icon-view-col"] as Doc, doc["template-icon-view-rtf"] as Doc, doc["template-icon-view-pdf"] as Doc], { title: "icon templates", _height: 75, system: true })); - } else { - const templateIconsDoc = Cast(doc["template-icons"], Doc, null); - const requiredTypes = [doc["template-icon-view"] as Doc, doc["template-icon-view-img"] as Doc, doc["template-icon-view-button"] as Doc, - doc["template-icon-view-col"] as Doc, doc["template-icon-view-rtf"] as Doc]; - DocListCastAsync(templateIconsDoc.data).then(async curIcons => { - curIcons && await Promise.all(curIcons); - requiredTypes.map(ntype => Doc.AddDocToList(templateIconsDoc, "data", ntype)); - }); - } - return doc["template-icons"] as Doc; - } - - static creatorBtnDescriptors(doc: Doc): { - title: string, toolTip: string, icon: string, drag?: string, ignoreClick?: boolean, - click?: string, backgroundColor?: string, dragFactory?: Doc, noviceMode?: boolean, clickFactory?: Doc - }[] { - if (doc.emptyPresentation === undefined) { - doc.emptyPresentation = Docs.Create.PresDocument(new List(), - { title: "Untitled Presentation", _viewType: CollectionViewType.Stacking, _fitWidth: true, _width: 400, _height: 500, targetDropAction: "alias", _chromeHidden: true, boxShadow: "0 0", system: true, cloneFieldFilter: new List(["system"]) }); - ((doc.emptyPresentation as Doc).proto as Doc)["dragFactory-count"] = 0; - } - if (doc.emptyCollection === undefined) { - doc.emptyCollection = Docs.Create.FreeformDocument([], - { _nativeWidth: undefined, _nativeHeight: undefined, _fitWidth: true, _width: 150, _height: 100, title: "freeform", system: true, cloneFieldFilter: new List(["system"]) }); - ((doc.emptyCollection as Doc).proto as Doc)["dragFactory-count"] = 0; - } - if (doc.emptyPane === undefined) { - doc.emptyPane = Docs.Create.FreeformDocument([], { _nativeWidth: undefined, _nativeHeight: undefined, _width: 500, _height: 800, title: "Untitled Tab", system: true, cloneFieldFilter: new List(["system"]) }); - ((doc.emptyPane as Doc).proto as Doc)["dragFactory-count"] = 0; - } - if (doc.emptySlide === undefined) { - const textDoc = Docs.Create.TreeDocument([], { title: "Slide", _viewType: CollectionViewType.Tree, _fontSize: "20px", treeViewType: "outline", _xMargin: 0, _yMargin: 0, _width: 300, _height: 200, _singleLine: true, backgroundColor: "transparent", system: true, cloneFieldFilter: new List(["system"]) }); - Doc.GetProto(textDoc).title = ComputedField.MakeFunction('self.text?.Text'); - FormattedTextBox.SelectOnLoad = textDoc[Id]; - doc.emptySlide = textDoc; - } - if ((doc.emptyHeader as Doc)?.version !== headerViewVersion) { - const json = { - doc: { - type: "doc", - content: [ - { - type: "paragraph", attrs: {}, content: [{ - type: "dashField", - attrs: { fieldKey: "author", docid: "", hideKey: false }, - marks: [{ type: "strong" }] - }, { - type: "dashField", - attrs: { fieldKey: "creationDate", docid: "", hideKey: false }, - marks: [{ type: "strong" }] - }] - }] - }, - selection: { type: "text", anchor: 1, head: 1 }, - storedMarks: [] - }; - const headerTemplate = Docs.Create.RTFDocument(new RichTextField(JSON.stringify(json), ""), { - title: "text", version: headerViewVersion, target: doc, _height: 70, _headerPointerEvents: "all", - _headerHeight: 12, _headerFontSize: 9, _autoHeight: true, system: true, _fitWidth: true, - cloneFieldFilter: new List(["system"]) - }, "header"); - const headerBtnHgt = 10; - headerTemplate[DataSym].layout = - "" + - ` ` + - " " + - ` Metadata` + - ""; - - // "
" + - // " " + - // " " + - // "
"; - (headerTemplate.proto as Doc).isTemplateDoc = makeTemplate(headerTemplate.proto as Doc, true, "headerView"); - doc.emptyHeader = headerTemplate; - ((doc.emptyHeader as Doc).proto as Doc)["dragFactory-count"] = 0; - } - if (doc.emptyComparison === undefined) { - doc.emptyComparison = Docs.Create.ComparisonDocument({ title: "compare", _width: 300, _height: 300, system: true, cloneFieldFilter: new List(["system"]) }); - } - if (doc.emptyScript === undefined) { - doc.emptyScript = Docs.Create.ScriptingDocument(undefined, { _width: 200, _height: 250, title: "script", system: true, cloneFieldFilter: new List(["system"]) }); - ((doc.emptyScript as Doc).proto as Doc)["dragFactory-count"] = 0; - } - if (doc.emptyScreenshot === undefined) { - doc.emptyScreenshot = Docs.Create.ScreenshotDocument("empty screenshot", { _fitWidth: true, _width: 400, _height: 200, system: true, cloneFieldFilter: new List(["system"]) }); - } - if (doc.emptyWall === undefined) { - doc.emptyWall = Docs.Create.ScreenshotDocument("", { _fitWidth: true, _width: 400, _height: 200, title: "screen snapshot", system: true, cloneFieldFilter: new List(["system"]) }); - (doc.emptyWall as Doc).videoWall = true; - } - if (doc.emptyAudio === undefined) { - doc.emptyAudio = Docs.Create.AudioDocument(nullAudio, { _width: 200, title: "audio recording", system: true, cloneFieldFilter: new List(["system"]) }); - ((doc.emptyAudio as Doc).proto as Doc)["dragFactory-count"] = 0; - } - if (doc.emptyNote === undefined) { - doc.emptyNote = Docs.Create.TextDocument("", { _width: 200, title: "text note", _autoHeight: true, system: true, cloneFieldFilter: new List(["system"]) }); - ((doc.emptyNote as Doc).proto as Doc)["dragFactory-count"] = 0; - } - if (doc.emptyImage === undefined) { - doc.emptyImage = Docs.Create.ImageDocument("https://upload.wikimedia.org/wikipedia/commons/thumb/3/3a/Cat03.jpg/1200px-Cat03.jpg", { _width: 250, _nativeWidth: 250, title: "an image of a cat", system: true }); - } - if (doc.emptyButton === undefined) { - doc.emptyButton = Docs.Create.ButtonDocument({ _width: 150, _height: 50, _xPadding: 10, _yPadding: 10, title: "Button", system: true, cloneFieldFilter: new List(["system"]) }); - ((doc.emptyButton as Doc).proto as Doc)["dragFactory-count"] = 0; - } - if (doc.emptyWebpage === undefined) { - doc.emptyWebpage = Docs.Create.WebDocument("", { title: "webpage", _nativeWidth: 850, isTemplateDoc: true, _height: 512, _width: 400, useCors: true, system: true, cloneFieldFilter: new List(["system"]) }); - } - if (doc.activeMobileMenu === undefined) { - this.setupActiveMobileMenu(doc); - } - return [ - { toolTip: "Tap to create a note in a new pane, drag for a note", title: "Note", icon: "sticky-note", click: 'openOnRight(copyDragFactory(this.clickFactory))', drag: 'copyDragFactory(this.dragFactory)', dragFactory: doc.emptyNote as Doc, noviceMode: true, clickFactory: doc.emptyNote as Doc, }, - { toolTip: "Tap to create a collection in a new pane, drag for a collection", title: "Col", icon: "folder", click: 'openOnRight(copyDragFactory(this.clickFactory))', drag: 'copyDragFactory(this.dragFactory)', dragFactory: doc.emptyCollection as Doc, noviceMode: true, clickFactory: doc.emptyPane as Doc, }, - { toolTip: "Tap to create a webpage in a new pane, drag for a webpage", title: "Web", icon: "globe-asia", click: 'openOnRight(copyDragFactory(this.dragFactory))', drag: 'copyDragFactory(this.dragFactory)', dragFactory: doc.emptyWebpage as Doc, noviceMode: true }, - { toolTip: "Tap to create a progressive slide", title: "Slide", icon: "file", click: 'openOnRight(copyDragFactory(this.dragFactory))', drag: 'copyDragFactory(this.dragFactory)', dragFactory: doc.emptySlide as Doc, noviceMode: true }, - { toolTip: "Tap to create a cat image in a new pane, drag for a cat image", title: "Image", icon: "cat", click: 'openOnRight(copyDragFactory(this.dragFactory))', drag: 'copyDragFactory(this.dragFactory)', dragFactory: doc.emptyImage as Doc }, - { toolTip: "Tap to create a comparison box in a new pane, drag for a comparison box", title: "Compare", icon: "columns", click: 'openOnRight(copyDragFactory(this.dragFactory))', drag: 'copyDragFactory(this.dragFactory)', dragFactory: doc.emptyComparison as Doc, noviceMode: true }, - { toolTip: "Tap to create a screen grabber in a new pane, drag for a screen grabber", title: "Grab", icon: "photo-video", click: 'openOnRight(copyDragFactory(this.dragFactory))', drag: 'copyDragFactory(this.dragFactory)', dragFactory: doc.emptyScreenshot as Doc, noviceMode: true }, - { toolTip: "Tap to create a videoWall", title: "Wall", icon: "photo-video", click: 'openOnRight(copyDragFactory(this.dragFactory))', drag: 'copyDragFactory(this.dragFactory)', dragFactory: doc.emptyWall as Doc }, - { toolTip: "Tap to create an audio recorder in a new pane, drag for an audio recorder", title: "Audio", icon: "microphone", click: 'openOnRight(copyDragFactory(this.dragFactory))', drag: 'copyDragFactory(this.dragFactory)', dragFactory: doc.emptyAudio as Doc, noviceMode: true }, - { toolTip: "Tap to create a button in a new pane, drag for a button", title: "Button", icon: "bolt", click: 'openOnRight(copyDragFactory(this.dragFactory))', drag: 'copyDragFactory(this.dragFactory)', dragFactory: doc.emptyButton as Doc }, - // { toolTip: "Tap to create a presentation in a new pane, drag for a presentation", title: "Trails", icon: "pres-trail", click: 'openOnRight(Doc.UserDoc().activePresentation = copyDragFactory(this.dragFactory))', drag: `Doc.UserDoc().activePresentation = copyDragFactory(this.dragFactory)`, dragFactory: doc.emptyPresentation as Doc, noviceMode: true }, - { toolTip: "Tap to create a scripting box in a new pane, drag for a scripting box", title: "Script", icon: "terminal", click: 'openOnRight(copyDragFactory(this.dragFactory))', drag: 'copyDragFactory(this.dragFactory)', dragFactory: doc.emptyScript as Doc }, - { toolTip: "Tap to create a mobile view in a new pane, drag for a mobile view", title: "Phone", icon: "mobile", click: 'openOnRight(Doc.UserDoc().activeMobileMenu)', drag: 'this.dragFactory', dragFactory: doc.activeMobileMenu as Doc }, - { toolTip: "Tap to create a custom header note document, drag for a custom header note", title: "Custom", icon: "window-maximize", click: 'openOnRight(delegateDragFactory(this.dragFactory))', drag: 'delegateDragFactory(this.dragFactory)', dragFactory: doc.emptyHeader as Doc }, - { toolTip: "Toggle a Calculator REPL", title: "repl", icon: "calculator", click: 'addOverlayWindow("ScriptingRepl", { x: 300, y: 100, width: 200, height: 200, title: "Scripting REPL" })' }, - ]; - - } - - // setup the "creator" buttons for the sidebar-- eg. the default set of draggable document creation tools - static async setupCreatorButtons(doc: Doc) { - let alreadyCreatedButtons: string[] = []; - const dragCreatorSet = await Cast(doc.myItemCreators, Doc, null); - if (dragCreatorSet) { - const dragCreators = await Cast(dragCreatorSet.data, listSpec(Doc)); - if (dragCreators) { - const dragDocs = await Promise.all(dragCreators); - alreadyCreatedButtons = dragDocs.map(d => StrCast(d.title)); - } - } - const buttons = CurrentUserUtils.creatorBtnDescriptors(doc).filter(d => !alreadyCreatedButtons?.includes(d.title)); - const creatorBtns = buttons.map(({ title, toolTip, icon, ignoreClick, drag, click, backgroundColor, dragFactory, noviceMode, clickFactory }) => Docs.Create.FontIconDocument({ - _nativeWidth: 50, _nativeHeight: 50, _width: 30, _height: 25, - icon, - title, - toolTip, - btnType: ButtonType.ClickButton, - ignoreClick, - _dropAction: "alias", - onDragStart: drag ? ScriptField.MakeFunction(drag) : undefined, - onClick: click ? ScriptField.MakeScript(click) : undefined, - backgroundColor, - _hideContextMenu: true, - _removeDropProperties: new List(["_stayInCollection"]), - _stayInCollection: true, - dragFactory, - clickFactory, - hidden: !noviceMode ? ComputedField.MakeFunction("IsNoviceMode()") as any : undefined, - system: true, - })); - - if (dragCreatorSet === undefined) { - doc.myItemCreators = new PrefetchProxy(Docs.Create.MasonryDocument(creatorBtns, { - title: "Basic Item Creators", _showTitle: "title", _xMargin: 0, _stayInCollection: true, _hideContextMenu: true, _chromeHidden: true, - _autoHeight: true, _width: 500, _height: 300, _fitWidth: true, _columnWidth: 35, ignoreClick: true, _lockedPosition: true, - dropConverter: ScriptField.MakeScript("convertToButtons(dragData)", { dragData: DragManager.DocumentDragData.name }), system: true - })); - } else { - creatorBtns.forEach(nb => Doc.AddDocToList(doc.myItemCreators as Doc, "data", nb)); - } - return doc.myItemCreators as Doc; - } - - static async menuBtnDescriptions(doc: Doc) { - return [ - { title: "Dashboards", target: Cast(doc.myDashboards, Doc, null), icon: "desktop", click: 'selectMainMenu(self)' }, - { title: "My Files", target: Cast(doc.myFilesystem, Doc, null), icon: "file", click: 'selectMainMenu(self)' }, - { title: "Tools", target: Cast(doc.myTools, Doc, null), icon: "wrench", click: 'selectMainMenu(self)' }, - { title: "Import", target: Cast(doc.myImportPanel, Doc, null), icon: "upload", click: 'selectMainMenu(self)' }, - { title: "Recently Closed", target: Cast(doc.myRecentlyClosedDocs, Doc, null), icon: "archive", click: 'selectMainMenu(self)' }, - { title: "Sharing", target: Cast(doc.mySharedDocs, Doc, null), icon: "users", click: 'selectMainMenu(self)', watchedDocuments: doc.mySharedDocs as Doc }, - // { title: "Filter", target: Cast(doc.currentFilter, Doc, null), icon: "filter", click: 'selectMainMenu(self)' }, - { title: "Pres. Trails", target: Cast(doc.myPresentations, Doc, null), icon: "pres-trail", click: 'selectMainMenu(self)' }, - // { title: "Help", target: undefined as any, icon: "question-circle", click: 'selectMainMenu(self)' }, - // { title: "Settings", target: undefined as any, icon: "cog", click: 'selectMainMenu(self)' }, - { title: "User Doc", target: Cast(doc.myUserDoc, Doc, null), icon: "address-card", click: 'selectMainMenu(self)' }, - ]; - } - - static setupSearchPanel(doc: Doc) { - if (doc.mySearchPanelDoc === undefined) { - doc.mySearchPanelDoc = new PrefetchProxy(Docs.Create.SearchDocument({ - _width: 500, _height: 300, backgroundColor: "dimGray", ignoreClick: true, _searchDoc: true, - childDropAction: "alias", _lockedPosition: true, _viewType: CollectionViewType.Schema, title: "sidebar search stack", system: true - })) as any as Doc; - } - } - static async setupMenuPanel(doc: Doc, sharingDocumentId: string, linkDatabaseId: string) { - if (doc.menuStack === undefined) { - await this.setupSharingSidebar(doc, sharingDocumentId, linkDatabaseId); // sets up the right sidebar collection for mobile upload documents and sharing - const menuBtns = (await CurrentUserUtils.menuBtnDescriptions(doc)).map(({ title, target, icon, click, watchedDocuments }) => - Docs.Create.FontIconDocument({ - icon, - btnType: ButtonType.MenuButton, - _stayInCollection: true, - _hideContextMenu: true, - system: true, - dontUndo: true, - title, - target, - _dropAction: "alias", - _removeDropProperties: new List(["dropAction", "_stayInCollection"]), - _width: 60, - _height: 60, - watchedDocuments, - onClick: ScriptField.MakeScript(click, { scriptContext: "any" }) - })); - // hack -- last button is assumed to be the userDoc - menuBtns[menuBtns.length - 1].hidden = ComputedField.MakeFunction("IsNoviceMode()"); - - doc.menuStack = new PrefetchProxy(Docs.Create.StackingDocument(menuBtns, { - title: "menuItemPanel", - childDropAction: "alias", - _chromeHidden: true, - dropConverter: ScriptField.MakeScript("convertToButtons(dragData)", { dragData: DragManager.DocumentDragData.name }), - ignoreClick: true, - _gridGap: 0, - _yMargin: 0, - _yPadding: 0, _xMargin: 0, _autoHeight: false, _width: 60, _columnWidth: 60, _lockedPosition: true, system: true - })); - } - // this resets all sidebar buttons to being deactivated - PromiseValue(Cast(doc.menuStack, Doc)).then(stack => { - stack && PromiseValue(stack.data).then(btns => { - DocListCastAsync(btns).then(bts => bts?.forEach(btn => { - btn.dontUndo = true; - btn.system = true; - if (btn.title === "Catalog" || btn.title === "My Files") { // migration from Catalog to My Files - btn.target = Doc.UserDoc().myFilesystem; - btn.title = "My Files"; - } - })); - }); - }); - return doc.menuStack as Doc; - } - - - // Sets up mobile menu if it is undefined creates a new one, otherwise returns existing menu - static setupActiveMobileMenu(doc: Doc) { - if (doc.activeMobileMenu === undefined) { - doc.activeMobileMenu = this.setupMobileMenu(); - } - return doc.activeMobileMenu as Doc; - } - - // Sets up mobileMenu stacking document - static setupMobileMenu() { - const menu = new PrefetchProxy(Docs.Create.StackingDocument(this.setupMobileButtons(), { - _width: 980, ignoreClick: true, _lockedPosition: false, title: "home", _yMargin: 100, system: true, _chromeHidden: true, - })); - return menu; - } - - // SEts up mobile buttons for inside mobile menu - static setupMobileButtons(doc?: Doc, buttons?: string[]) { - const docProtoData: { title: string, icon: string, drag?: string, ignoreClick?: boolean, click?: string, activePen?: Doc, backgroundColor?: string, info: string, dragFactory?: Doc }[] = [ - { title: "DASHBOARDS", icon: "bars", click: 'switchToMobileLibrary()', backgroundColor: "lightgrey", info: "Access your Dashboards from your mobile, and navigate through all of your documents. " }, - { title: "UPLOAD", icon: "upload", click: 'openMobileUploads()', backgroundColor: "lightgrey", info: "Upload files from your mobile device so they can be accessed on Dash Web." }, - { title: "MOBILE UPLOAD", icon: "mobile", click: 'switchToMobileUploadCollection()', backgroundColor: "lightgrey", info: "Access the collection of your mobile uploads." }, - { title: "RECORD", icon: "microphone", click: 'openMobileAudio()', backgroundColor: "lightgrey", info: "Use your phone to record, dictate and then upload audio onto Dash Web." }, - { title: "PRESENTATION", icon: "desktop", click: 'switchToMobilePresentation()', backgroundColor: "lightgrey", info: "Use your phone as a remote for you presentation." }, - { title: "SETTINGS", icon: "cog", click: 'openMobileSettings()', backgroundColor: "lightgrey", info: "Change your password, log out, or manage your account security." } - ]; - // returns a list of mobile buttons - return docProtoData.filter(d => !buttons || !buttons.includes(d.title)).map(data => - this.mobileButton({ - title: data.title, - _lockedPosition: true, - onClick: data.click ? ScriptField.MakeScript(data.click) : undefined, - backgroundColor: data.backgroundColor, system: true - }, - [this.ficon({ ignoreClick: true, icon: data.icon, backgroundColor: "rgba(0,0,0,0)", btnType: ButtonType.ClickButton, system: true }), this.mobileTextContainer({}, [this.mobileButtonText({}, data.title), this.mobileButtonInfo({}, data.info)])]) - ); - } - - // sets up the main document for the mobile button - static mobileButton = (opts: DocumentOptions, docs: Doc[]) => Docs.Create.MulticolumnDocument(docs, { - ...opts, - _removeDropProperties: new List(["dropAction"]), _nativeWidth: 900, _nativeHeight: 250, _width: 900, _height: 250, _yMargin: 15, - borderRounding: "5px", boxShadow: "0 0", system: true - }) as any as Doc - - // sets up the text container for the information contained within the mobile button - static mobileTextContainer = (opts: DocumentOptions, docs: Doc[]) => Docs.Create.MultirowDocument(docs, { - ...opts, - _removeDropProperties: new List(["dropAction"]), _nativeWidth: 450, _nativeHeight: 250, _width: 450, _height: 250, _yMargin: 25, - backgroundColor: "rgba(0,0,0,0)", borderRounding: "0", boxShadow: "0 0", ignoreClick: true, system: true - }) as any as Doc - - // Sets up the title of the button - static mobileButtonText = (opts: DocumentOptions, buttonTitle: string) => Docs.Create.TextDocument(buttonTitle, { - ...opts, - title: buttonTitle, _fontSize: "37px", _xMargin: 0, _yMargin: 0, ignoreClick: true, backgroundColor: "rgba(0,0,0,0)", system: true - }) as any as Doc - - // Sets up the description of the button - static mobileButtonInfo = (opts: DocumentOptions, buttonInfo: string) => Docs.Create.TextDocument(buttonInfo, { - ...opts, - title: "info", _fontSize: "25px", _xMargin: 0, _yMargin: 0, ignoreClick: true, backgroundColor: "rgba(0,0,0,0)", _dimMagnitude: 2, system: true - }) as any as Doc - - - static setupThumbButtons(doc: Doc) { - const docProtoData: { title: string, icon: string, drag?: string, ignoreClick?: boolean, pointerDown?: string, pointerUp?: string, clipboard?: Doc, backgroundColor?: string, dragFactory?: Doc }[] = [ - { title: "use pen", icon: "pen-nib", pointerUp: "resetPen()", pointerDown: 'setPen(2, this.backgroundColor)', backgroundColor: "blue" }, - { title: "use highlighter", icon: "highlighter", pointerUp: "resetPen()", pointerDown: 'setPen(20, this.backgroundColor)', backgroundColor: "yellow" }, - { title: "notepad", icon: "clipboard", pointerUp: "GestureOverlay.Instance.closeFloatingDoc()", pointerDown: 'GestureOverlay.Instance.openFloatingDoc(this.clipboard)', clipboard: Docs.Create.FreeformDocument([], { _width: 300, _height: 300, system: true }), backgroundColor: "orange" }, - { title: "interpret text", icon: "font", pointerUp: "setToolglass('none')", pointerDown: "setToolglass('inktotext')", backgroundColor: "orange" }, - { title: "ignore gestures", icon: "signature", pointerUp: "setToolglass('none')", pointerDown: "setToolglass('ignoregesture')", backgroundColor: "green" }, - ]; - return docProtoData.map(data => Docs.Create.FontIconDocument({ - _nativeWidth: 10, _nativeHeight: 10, _width: 10, _height: 10, title: data.title, icon: data.icon, - _dropAction: data.pointerDown ? "copy" : undefined, ignoreClick: data.ignoreClick, - onDragStart: data.drag ? ScriptField.MakeFunction(data.drag) : undefined, - clipboard: data.clipboard, - onPointerUp: data.pointerUp ? ScriptField.MakeScript(data.pointerUp) : undefined, onPointerDown: data.pointerDown ? ScriptField.MakeScript(data.pointerDown) : undefined, - backgroundColor: data.backgroundColor, - _removeDropProperties: new List(["dropAction"]), dragFactory: data.dragFactory, system: true - })); - } - - static setupThumbDoc(userDoc: Doc) { - if (!userDoc.thumbDoc) { - const thumbDoc = Docs.Create.LinearDocument(CurrentUserUtils.setupThumbButtons(userDoc), { - _width: 100, _height: 50, ignoreClick: true, _lockedPosition: true, title: "buttons", - _autoHeight: true, _yMargin: 5, linearViewIsExpanded: true, backgroundColor: "white", system: true - }); - thumbDoc.inkToTextDoc = Docs.Create.LinearDocument([], { - _width: 300, _height: 25, _autoHeight: true, linearViewIsExpanded: true, flexDirection: "column", system: true - }); - userDoc.thumbDoc = thumbDoc; - } - return Cast(userDoc.thumbDoc, Doc); - } - - static setupMobileInkingDoc(userDoc: Doc) { - return Docs.Create.FreeformDocument([], { title: "Mobile Inking", backgroundColor: "white", system: true }); - } - - static setupMobileUploadDoc(userDoc: Doc) { - // const addButton = Docs.Create.FontIconDocument({ onDragStart: ScriptField.MakeScript('addWebToMobileUpload()'), title: "Add Web Doc to Upload Collection", icon: "plus", backgroundColor: "black" }) - const webDoc = Docs.Create.WebDocument("https://www.britannica.com/biography/Miles-Davis", { - title: "Upload Images From the Web", _lockedPosition: true, system: true - }); - const uploadDoc = Docs.Create.StackingDocument([], { - title: "Mobile Upload Collection", backgroundColor: "white", _lockedPosition: true, system: true, _chromeHidden: true, - }); - return Docs.Create.StackingDocument([webDoc, uploadDoc], { - _width: screen.width, _lockedPosition: true, title: "Upload", _autoHeight: true, _yMargin: 80, backgroundColor: "lightgray", system: true, _chromeHidden: true, - }); - } - - static setupLibrary(userDoc: Doc) { - return CurrentUserUtils.setupDashboards(userDoc); - } - - // setup the Creator button which will display the creator panel. This panel will include the drag creators and the color picker. - // when clicked, this panel will be displayed in the target container (ie, sidebarContainer) - static async setupToolsBtnPanel(doc: Doc) { - // setup a masonry view of all he creators - const creatorBtns = await CurrentUserUtils.setupCreatorButtons(doc); - const templateBtns = CurrentUserUtils.setupUserTemplateButtons(doc); - - doc["tabs-button-tools"] = undefined; - - if (doc.myCreators === undefined) { - doc.myCreators = new PrefetchProxy(Docs.Create.StackingDocument([creatorBtns, templateBtns], { - title: "all Creators", _yMargin: 0, _autoHeight: true, _xMargin: 0, _fitWidth: true, - _width: 500, _height: 300, ignoreClick: true, _lockedPosition: true, system: true, _chromeHidden: true, - })); - } - // setup a color picker - if (doc.myColorPicker === undefined) { - const color = Docs.Create.ColorDocument({ - title: "color picker", ignoreClick: true, _width: 220, _dropAction: "alias", _hideContextMenu: true, _stayInCollection: true, _forceActive: true, _removeDropProperties: new List(["dropAction", "_stayInCollection", "_hideContextMenu", "forceActive"]), system: true - }); - doc.myColorPicker = new PrefetchProxy(color); - } - - if (doc.myTools === undefined) { - const toolsStack = new PrefetchProxy(Docs.Create.StackingDocument([doc.myCreators as Doc, doc.myColorPicker as Doc], { - title: "My Tools", _showTitle: "title", _width: 500, _yMargin: 20, ignoreClick: true, _lockedPosition: true, _forceActive: true, - system: true, _stayInCollection: true, _hideContextMenu: true, _chromeHidden: true, boxShadow: "0 0", - })) as any as Doc; - - doc.myTools = toolsStack; - } - } - - static async setupDashboards(doc: Doc) { - // setup dashboards library item - await doc.myDashboards; - if (doc.myDashboards === undefined) { - doc.myDashboards = new PrefetchProxy(Docs.Create.TreeDocument([], { - title: "My Dashboards", _showTitle: "title", _height: 400, childHideLinkButton: true, - treeViewHideTitle: true, _xMargin: 5, _yMargin: 5, _gridGap: 5, _forceActive: true, childDropAction: "alias", - treeViewTruncateTitleWidth: 150, ignoreClick: true, - _lockedPosition: true, boxShadow: "0 0", childDontRegisterViews: true, targetDropAction: "same", system: true - })); - const newDashboard = ScriptField.MakeScript(`createNewDashboard(Doc.UserDoc())`); - (doc.myDashboards as any as Doc).contextMenuScripts = new List([newDashboard!]); - (doc.myDashboards as any as Doc).contextMenuLabels = new List(["Create New Dashboard"]); - } - return doc.myDashboards as any as Doc; - } - - static async setupPresentations(doc: Doc) { - await doc.myPresentations; - if (doc.myPresentations === undefined) { - doc.myPresentations = new PrefetchProxy(Docs.Create.TreeDocument([], { - title: "My Trails", _showTitle: "title", _height: 100, - treeViewHideTitle: true, _xMargin: 5, _yMargin: 5, _gridGap: 5, _forceActive: true, childDropAction: "alias", - treeViewTruncateTitleWidth: 150, ignoreClick: true, - _lockedPosition: true, boxShadow: "0 0", childDontRegisterViews: true, targetDropAction: "same", system: true - })); - const newPresentations = ScriptField.MakeScript(`createNewPresentation()`); - (doc.myPresentations as any as Doc).contextMenuScripts = new List([newPresentations!]); - (doc.myPresentations as any as Doc).contextMenuLabels = new List(["Create New Presentation"]); - const presentations = doc.myPresentations as any as Doc; - } - return doc.myPresentations as any as Doc; - } - - static async setupFilesystem(doc: Doc) { - await doc.myFilesystem; - if (doc.myFilesystem === undefined) { - doc.myFileOrphans = Docs.Create.TreeDocument([], { title: "Unfiled", _stayInCollection: true, system: true, isFolder: true }); - doc.myFileRoot = Docs.Create.TreeDocument([], { title: "file root", _stayInCollection: true, system: true, isFolder: true }); - doc.myFilesystem = new PrefetchProxy(Docs.Create.TreeDocument([doc.myFileRoot as Doc, doc.myFileOrphans as Doc], { - title: "My Documents", _showTitle: "title", _height: 100, - treeViewHideTitle: true, _xMargin: 5, _yMargin: 5, _gridGap: 5, _forceActive: true, childDropAction: "alias", - treeViewTruncateTitleWidth: 150, ignoreClick: true, - isFolder: true, treeViewType: "fileSystem", childHideLinkButton: true, - _lockedPosition: true, boxShadow: "0 0", childDontRegisterViews: true, targetDropAction: "proto", system: true - })); - } - return doc.myFilesystem as any as Doc; - } - - static setupRecentlyClosedDocs(doc: Doc) { - // setup Recently Closed library item - if (doc.myRecentlyClosedDocs === undefined) { - doc.myRecentlyClosedDocs = new PrefetchProxy(Docs.Create.TreeDocument([], { - title: "Recently Closed", _showTitle: "title", treeViewShowClearButton: true, childHideLinkButton: true, - treeViewHideTitle: true, _xMargin: 5, _yMargin: 5, _gridGap: 5, _forceActive: true, childDropAction: "alias", - treeViewTruncateTitleWidth: 150, ignoreClick: true, - _lockedPosition: true, boxShadow: "0 0", childDontRegisterViews: true, targetDropAction: "same", system: true - })); - const clearAll = ScriptField.MakeScript(`getProto(self).data = new List([])`); - (doc.myRecentlyClosedDocs as any as Doc).contextMenuScripts = new List([clearAll!]); - (doc.myRecentlyClosedDocs as any as Doc).contextMenuLabels = new List(["Clear All"]); - } - } - static setupFilterDocs(doc: Doc) { - // setup Filter item - if (doc.currentFilter === undefined) { - doc.currentFilter = Docs.Create.FilterDocument({ - title: "unnamed filter", _height: 150, - treeViewHideTitle: true, _xMargin: 5, _yMargin: 5, _gridGap: 5, _forceActive: true, childDropAction: "none", - treeViewTruncateTitleWidth: 150, ignoreClick: true, - _lockedPosition: true, boxShadow: "0 0", childDontRegisterViews: true, targetDropAction: "same", system: true, _autoHeight: true, _fitWidth: true - }); - const clearAll = ScriptField.MakeScript(`getProto(self).data = new List([])`); - (doc.currentFilter as Doc).contextMenuScripts = new List([clearAll!]); - (doc.currentFilter as Doc).contextMenuLabels = new List(["Clear All"]); - (doc.currentFilter as Doc).filterBoolean = "AND"; - } - } - - static setupUserDoc(doc: Doc) { - if (doc.myUserDoc === undefined) { - doc.treeViewOpen = true; - doc.treeViewExpandedView = "fields"; - doc.myUserDoc = new PrefetchProxy(Docs.Create.TreeDocument([doc], { - treeViewHideTitle: true, _xMargin: 5, _yMargin: 5, _gridGap: 5, _forceActive: true, title: "My UserDoc", _showTitle: "title", - treeViewTruncateTitleWidth: 150, ignoreClick: true, - _lockedPosition: true, boxShadow: "0 0", childDontRegisterViews: true, targetDropAction: "same", system: true - })) as any as Doc; - } - } - - static setupSidebarContainer(doc: Doc) { - if (doc.sidebar === undefined) { - const sidebarContainer = new Doc(); - sidebarContainer.system = true; - doc.sidebar = new PrefetchProxy(sidebarContainer); - } - return doc.sidebar as Doc; - } - - // setup the list of sidebar mode buttons which determine what is displayed in the sidebar - static async setupSidebarButtons(doc: Doc) { - CurrentUserUtils.setupSidebarContainer(doc); - await CurrentUserUtils.setupToolsBtnPanel(doc); - CurrentUserUtils.setupImportSidebar(doc); - CurrentUserUtils.setupDashboards(doc); - CurrentUserUtils.setupPresentations(doc); - CurrentUserUtils.setupFilesystem(doc); - CurrentUserUtils.setupRecentlyClosedDocs(doc); - // CurrentUserUtils.setupFilterDocs(doc); - CurrentUserUtils.setupUserDoc(doc); - } - - static blist = (opts: DocumentOptions, docs: Doc[]) => new PrefetchProxy(Docs.Create.LinearDocument(docs, { - ...opts, _gridGap: 5, _xMargin: 5, _yMargin: 5, _width: 100, boxShadow: "0 0", _forceActive: true, - dropConverter: ScriptField.MakeScript("convertToButtons(dragData)", { dragData: DragManager.DocumentDragData.name }), - _lockedPosition: true, linearViewIsExpanded: true, system: true - })) as any as Doc - - static ficon = (opts: DocumentOptions) => new PrefetchProxy(Docs.Create.FontIconDocument({ - ...opts, _dropAction: "alias", _removeDropProperties: new List(["_dropAction", "stayInCollection"]), _nativeWidth: 40, _nativeHeight: 40, _width: 40, _height: 40, system: true - })) as any as Doc - - /// sets up the default list of buttons to be shown in the expanding button menu at the bottom of the Dash window - static setupDockedButtons(doc: Doc) { - if (doc["dockedBtn-undo"] === undefined) { - doc["dockedBtn-undo"] = CurrentUserUtils.ficon({ onClick: ScriptField.MakeScript("undo()"), btnType: ButtonType.ClickButton, dontUndo: true, _stayInCollection: true, _dropAction: "alias", _hideContextMenu: true, _removeDropProperties: new List(["dropAction", "_hideContextMenu", "stayInCollection"]), toolTip: "Click to undo", title: "Undo", icon: "undo-alt", system: true, canClick: 'canUndo' }); - } - if (doc["dockedBtn-redo"] === undefined) { - doc["dockedBtn-redo"] = CurrentUserUtils.ficon({ onClick: ScriptField.MakeScript("redo()"), btnType: ButtonType.ClickButton, dontUndo: true, _stayInCollection: true, _dropAction: "alias", _hideContextMenu: true, _removeDropProperties: new List(["dropAction", "_hideContextMenu", "stayInCollection"]), toolTip: "Click to redo", title: "Redo", icon: "redo-alt", system: true, canClick: 'canRedo' }); - } - if (doc.dockedBtns === undefined) { - doc.dockedBtns = CurrentUserUtils.blist({ title: "docked buttons", ignoreClick: true, linearViewExpandable: true, _height: 42 }, [doc["dockedBtn-undo"] as Doc, doc["dockedBtn-redo"] as Doc]); - } - (doc["dockedBtn-undo"] as Doc).dontUndo = true; - (doc["dockedBtn-redo"] as Doc).dontUndo = true; - } - - static textTools(doc: Doc) { - return [ - { - title: "Font", toolTip: "Font", width: 100, btnType: ButtonType.DropdownList, ignoreClick: true, - list: ["Roboto", "Roboto Mono", "Nunito", "Times New Roman", "Arial", "Georgia", - "Comic Sans MS", "Tahoma", "Impact", "Crimson Text"], - scriptDoc: Doc.UserDoc(), toggle: 'userDoc._fontFamily' - }, - { - title: "Bold", toolTip: "Bold (Ctrl+B)", btnType: ButtonType.ToggleButton, icon: "bold", click: 'toggleBold()', - scriptDoc: Doc.UserDoc(), - toggle: 'userDoc._boldActive' - }, - { title: "Italic", toolTip: "Italic (Ctrl+I)", btnType: ButtonType.ToggleButton, icon: "italic", click: 'toggleItalic()', scriptDoc: Doc.UserDoc(), toggle: 'userDoc._italicsActive' }, - { title: "Underline", toolTip: "Underline (Ctrl+U)", btnType: ButtonType.ToggleButton, icon: "underline", click: 'toggleUnderline()', scriptDoc: Doc.UserDoc(), toggle: 'userDoc._underlineActive' }, - // { title: "Strikethrough", tooltip: "Strikethrough", btnType: ButtonType.ToggleButton, icon: "strikethrough", click: 'toggleStrikethrough()', toggle: 'userDoc._underlineActive' }, - // { title: "Superscript", tooltip: "Superscript", btnType: ButtonType.ToggleButton, icon: "superscript", click: 'toggleSuperscript()', toggle: 'userDoc._underlineActive' }, - // { title: "Subscript", tooltip: "Subscript", btnType: ButtonType.ToggleButton, icon: "subscript", click: 'toggleSubscript()', toggle: 'userDoc._underlineActive' }, - { title: "Highlight", toolTip: "Highlight", btnType: ButtonType.ColorButton, icon: "highlighter", ignoreClick: true, scriptDoc: Doc.UserDoc(), userColorBtn: 'userDoc._highlightColor' }, - { title: "Text color", toolTip: "Text color", btnType: ButtonType.ColorButton, icon: "fill-drip", ignoreClick: true, scriptDoc: Doc.UserDoc(), userColorBtn: 'userDoc._textColor' }, - // { title: "Link", tooltip: "Link", btnType: ButtonType.DropdownButton, icon: "link", click: '', ignoreClick: true }, - ]; - } - - static async contextMenuBtnDescriptions(doc: Doc) { - return [ - // { title: "Perspective", tooltip: "Change document's perspective", type: "btn", btnType: ButtonType.DropdownButton, ignoreClick: true, icon: "desktop", click: '' }, - { - title: "Perspective", toolTip: "Perspective", width: 100, btnType: ButtonType.DropdownList, ignoreClick: true, - list: [CollectionViewType.Freeform, CollectionViewType.Schema, CollectionViewType.Tree, - CollectionViewType.Stacking, CollectionViewType.Masonry, CollectionViewType.Multicolumn, - CollectionViewType.Multirow, CollectionViewType.Time, CollectionViewType.Carousel, - CollectionViewType.Carousel3D, CollectionViewType.Linear, CollectionViewType.Map, - CollectionViewType.Grid], - scriptDoc: 'selectedDoc', - toggle: 'selectedDoc._viewType' - }, - { - title: "Background", toolTip: "Background", btnType: ButtonType.ColorButton, scriptDoc: 'selectedDoc', - docColorBtn: 'selectedDoc.backgroundColor', width: 60, ignoreClick: true, icon: "fill-drip", - canClick: 'numSelected > 0' - }, - { title: "Overlay", toolTip: "Overlay", btnType: ButtonType.ToggleButton, icon: "layer-group", click: 'toggleOverlay()', toggle: 'selectedDoc.z', canClick: 'numSelected > 0' }, - { title: "Text Tools", type: "TextMenu", icon: "font" }, - // { title: "Ink Tools", type: "LinearMenu", icon: "pen-nib" }, - // { title: "GFX Tools", type: "LinearMenu", icon: "shapes" }, - // { title: "Alias", btnType: ButtonType.ClickButton, icon: "copy" }, - ]; - } - - // Default context menu buttons - static async setupContextMenuButtons(doc: Doc) { - const docList: Doc[] = []; - - const contextMenuBtns = (await CurrentUserUtils.contextMenuBtnDescriptions(doc)).map(({ title, width, toolTip, ignoreClick, icon, type, btnType, click, toggle, scriptDoc, canClick, docColorBtn }) => { - const textDocList: Doc[] = []; - if (type === "TextMenu") { - const textBtns = (CurrentUserUtils.textTools(doc)).map(({ title, width, list, toolTip, ignoreClick, icon, btnType, click, toggle, scriptDoc, userColorBtn }) => { - textDocList.push(Docs.Create.FontIconDocument({ - _nativeWidth: width ? width : 25, - _nativeHeight: 25, - _width: width ? width : 25, - _height: 25, - icon, - toolTip, - userColorBtn, - // testToggle: toggle ? ScriptField.MakeScript(toggle, { this: scriptDoc, scriptContext: "any" }) : undefined, - // toggle: toggle, - btnType: btnType, - btnList: new List(list), - ignoreClick: ignoreClick, - _stayInCollection: true, - _hideContextMenu: true, - system: true, - dontUndo: true, - title, - backgroundColor: "black", - _dropAction: "alias", - _removeDropProperties: new List(["dropAction", "_stayInCollection"]), - onClick: click ? ScriptField.MakeScript(click, { scriptContext: "any" }) : undefined - })); - }); - docList.push(CurrentUserUtils.blist({ ignoreClick: true, linearViewExpandable: true, _height: 30, backgroundColor: "transparent" }, textDocList)); - } else { - docList.push(Docs.Create.FontIconDocument({ - _nativeWidth: width ? width : 30, - _nativeHeight: 30, - _width: width ? width : 30, - _height: 30, - icon, - toolTip, - // testToggle: toggle ? ScriptField.MakeScript(toggle, { scriptContext: "any" }) : undefined, - // toggle: toggle, - docColorBtn, - canClick: canClick, - btnType: btnType, - ignoreClick: ignoreClick, - _stayInCollection: true, - _hideContextMenu: true, - system: true, - dontUndo: true, - title, - backgroundColor: "black", - _dropAction: "alias", - _removeDropProperties: new List(["dropAction", "_stayInCollection"]), - onClick: click ? ScriptField.MakeScript(click, { scriptContext: "any" }) : undefined - })); - } - }); - - if (doc.contextMenuBtns === undefined) { - doc.contextMenuBtns = CurrentUserUtils.blist({ title: "menu buttons", ignoreClick: true, linearViewExpandable: false, _height: 35 }, docList); - } - } - - // sets up the default set of documents to be shown in the Overlay layer - static setupOverlays(doc: Doc) { - if (doc.myOverlayDocs === undefined) { - doc.myOverlayDocs = new PrefetchProxy(Docs.Create.FreeformDocument([], { title: "overlay documents", backgroundColor: "#aca3a6", system: true })); - } - } - - // the initial presentation Doc to use - static setupDefaultPresentation(doc: Doc) { - if (doc["template-presentation"] === undefined) { - doc["template-presentation"] = new PrefetchProxy(Docs.Create.PresElementBoxDocument({ - title: "pres element template", backgroundColor: "transparent", _xMargin: 5, _fitWidth: true, _height: 46, isTemplateDoc: true, isTemplateForField: "data", system: true - })); - } - } - - // Sharing sidebar is where shared documents are contained - static async setupSharingSidebar(doc: Doc, sharingDocumentId: string, linkDatabaseId: string) { - if (doc.myLinkDatabase === undefined) { - let linkDocs = Docs.newAccount ? undefined : await DocServer.GetRefField(linkDatabaseId); - if (!linkDocs) { - linkDocs = new Doc(linkDatabaseId, true); - (linkDocs as Doc).author = Doc.CurrentUserEmail; - (linkDocs as Doc).data = new List([]); - (linkDocs as Doc)["acl-Public"] = SharingPermissions.Add; - } - doc.myLinkDatabase = new PrefetchProxy(linkDocs); - } - if (doc.mySharedDocs === undefined) { - let sharedDocs = Docs.newAccount ? undefined : await DocServer.GetRefField(sharingDocumentId + "outer"); - if (!sharedDocs) { - sharedDocs = Docs.Create.StackingDocument([], { - title: "My SharedDocs", childDropAction: "alias", system: true, contentPointerEvents: "none", childLimitHeight: 0, _yMargin: 50, _gridGap: 15, - _showTitle: "title", ignoreClick: true, _lockedPosition: true, "acl-Public": SharingPermissions.Add, "_acl-Public": SharingPermissions.Add, - _chromeHidden: true, boxShadow: "0 0", - }, sharingDocumentId + "outer", sharingDocumentId); - (sharedDocs as Doc)["acl-Public"] = (sharedDocs as Doc)[DataSym]["acl-Public"] = SharingPermissions.Add; - } - if (sharedDocs instanceof Doc) { - Doc.GetProto(sharedDocs).userColor = sharedDocs.userColor || "rgb(202, 202, 202)"; - } - doc.mySharedDocs = new PrefetchProxy(sharedDocs); - } - } - - // Import sidebar is where shared documents are contained - static setupImportSidebar(doc: Doc) { - if (doc.myImportDocs === undefined) { - doc.myImportDocs = new PrefetchProxy(Docs.Create.StackingDocument([], { - title: "My ImportDocuments", _forceActive: true, ignoreClick: true, _stayInCollection: true, _hideContextMenu: true, childLimitHeight: 0, - childDropAction: "alias", _autoHeight: true, _yMargin: 50, _gridGap: 15, _lockedPosition: true, system: true, _chromeHidden: true, - })); - } - if (doc.myImportPanel === undefined) { - const uploads = Cast(doc.myImportDocs, Doc, null); - const newUpload = CurrentUserUtils.ficon({ onClick: ScriptField.MakeScript("importDocument()"), btnType: ButtonType.ClickButton, toolTip: "Import External document", _stayInCollection: true, _hideContextMenu: true, title: "Import", icon: "upload", system: true }); - doc.myImportPanel = new PrefetchProxy(Docs.Create.StackingDocument([newUpload, uploads], { title: "My ImportPanel", _yMargin: 20, _showTitle: "title", ignoreClick: true, _chromeHidden: true, _stayInCollection: true, _hideContextMenu: true, _lockedPosition: true, system: true, boxShadow: "0 0" })); - } - } - - static setupClickEditorTemplates(doc: Doc) { - if (doc["clickFuncs-child"] === undefined) { - // to use this function, select it from the context menu of a collection. then edit the onChildClick script. Add two Doc variables: 'target' and 'thisContainer', then assign 'target' to some target collection. After that, clicking on any document in the initial collection will open it in the target - const openInTarget = Docs.Create.ScriptingDocument(ScriptField.MakeScript( - "docCast(thisContainer.target).then((target) => target && (target.proto.data = new List([self]))) ", - { thisContainer: Doc.name }), { - title: "Click to open in target", _width: 300, _height: 200, - targetScriptKey: "onChildClick", system: true - }); - - const openDetail = Docs.Create.ScriptingDocument(ScriptField.MakeScript( - "openOnRight(self.doubleClickView)", - {}), { title: "Double click to open doubleClickView", _width: 300, _height: 200, targetScriptKey: "onChildDoubleClick", system: true }); - - doc["clickFuncs-child"] = Docs.Create.TreeDocument([openInTarget, openDetail], { title: "on Child Click function templates", system: true }); - } - // this is equivalent to using PrefetchProxies to make sure all the childClickFuncs have been retrieved. - PromiseValue(Cast(doc["clickFuncs-child"], Doc)).then(func => func && PromiseValue(func.data).then(DocListCast)); - - if (doc.clickFuncs === undefined) { - const onClick = Docs.Create.ScriptingDocument(undefined, { - title: "onClick", "onClick-rawScript": "console.log('click')", - isTemplateDoc: true, isTemplateForField: "onClick", _width: 300, _height: 200, system: true - }, "onClick"); - const onChildClick = Docs.Create.ScriptingDocument(undefined, { - title: "onChildClick", "onChildClick-rawScript": "console.log('child click')", - isTemplateDoc: true, isTemplateForField: "onChildClick", _width: 300, _height: 200, system: true - }, "onChildClick"); - const onDoubleClick = Docs.Create.ScriptingDocument(undefined, { - title: "onDoubleClick", "onDoubleClick-rawScript": "console.log('double click')", - isTemplateDoc: true, isTemplateForField: "onDoubleClick", _width: 300, _height: 200, system: true - }, "onDoubleClick"); - const onChildDoubleClick = Docs.Create.ScriptingDocument(undefined, { - title: "onChildDoubleClick", "onChildDoubleClick-rawScript": "console.log('child double click')", - isTemplateDoc: true, isTemplateForField: "onChildDoubleClick", _width: 300, _height: 200, system: true - }, "onChildDoubleClick"); - const onCheckedClick = Docs.Create.ScriptingDocument(undefined, { - title: "onCheckedClick", "onCheckedClick-rawScript": "console.log(heading + checked + containingTreeView)", - "onCheckedClick-params": new List(["heading", "checked", "containingTreeView"]), isTemplateDoc: true, - isTemplateForField: "onCheckedClick", _width: 300, _height: 200, system: true - }, "onCheckedClick"); - doc.clickFuncs = Docs.Create.TreeDocument([onClick, onChildClick, onDoubleClick, onCheckedClick], { title: "onClick funcs", system: true }); - } - PromiseValue(Cast(doc.clickFuncs, Doc)).then(func => func && PromiseValue(func.data).then(DocListCast)); - - return doc.clickFuncs as Doc; - } - - static async updateUserDocument(doc: Doc, sharingDocumentId: string, linkDatabaseId: string) { - if (!doc.globalGroupDatabase) doc.globalGroupDatabase = Docs.Prototypes.MainGroupDocument(); - const groups = await DocListCastAsync((doc.globalGroupDatabase as Doc).data); - reaction(() => DateCast((doc.globalGroupDatabase as Doc)["data-lastModified"]), - async () => { - const groups = await DocListCastAsync((doc.globalGroupDatabase as Doc).data); - const mygroups = groups?.filter(group => JSON.parse(StrCast(group.members)).includes(Doc.CurrentUserEmail)) || []; - SnappingManager.SetCachedGroups(["Public", ...mygroups?.map(g => StrCast(g.title))]); - }, { fireImmediately: true }); - // Document properties on load - doc.system = true; - doc.noviceMode = doc.noviceMode === undefined ? "true" : doc.noviceMode; - doc.title = Doc.CurrentUserEmail; - doc._raiseWhenDragged = true; - doc._showLabel = false; - doc._showMenuLabel = true; - doc.activeInkColor = StrCast(doc.activeInkColor, "rgb(0, 0, 0)"); - doc.activeInkWidth = StrCast(doc.activeInkWidth, "1"); - doc.activeInkBezier = StrCast(doc.activeInkBezier, "0"); - doc.activeFillColor = StrCast(doc.activeFillColor, ""); - doc.activeArrowStart = StrCast(doc.activeArrowStart, ""); - doc.activeArrowEnd = StrCast(doc.activeArrowEnd, ""); - doc.activeDash = StrCast(doc.activeDash, "0"); - doc.fontSize = StrCast(doc.fontSize, "12px"); - doc.fontFamily = StrCast(doc.fontFamily, "Arial"); - doc.fontColor = StrCast(doc.fontColor, "black"); - doc.fontHighlight = StrCast(doc.fontHighlight, ""); - doc.defaultAclPrivate = BoolCast(doc.defaultAclPrivate, true); - doc.activeCollectionBackground = StrCast(doc.activeCollectionBackground, "white"); - doc.activeCollectionNestedBackground = Cast(doc.activeCollectionNestedBackground, "string", null); - doc.noviceMode = BoolCast(doc.noviceMode, true); - doc["constants-snapThreshold"] = NumCast(doc["constants-snapThreshold"], 10); // - doc["constants-dragThreshold"] = NumCast(doc["constants-dragThreshold"], 4); // - Utils.DRAG_THRESHOLD = NumCast(doc["constants-dragThreshold"]); - doc.savedFilters = new List(); - doc.filterDocCount = 0; - this.setupDefaultIconTemplates(doc); // creates a set of icon templates triggered by the document deoration icon - this.setupDocTemplates(doc); // sets up the template menu of templates - this.setupActiveMobileMenu(doc); // sets up the current mobile menu for Dash Mobile - this.setupSearchPanel(doc); - this.setupOverlays(doc); // documents in overlay layer - this.setupDockedButtons(doc); // the bottom bar of font icons - this.setupContextMenuButtons(doc); //buttons for context menu - await this.setupSidebarButtons(doc); // the pop-out left sidebar of tools/panels - await this.setupMenuPanel(doc, sharingDocumentId, linkDatabaseId); - if (!doc.globalScriptDatabase) doc.globalScriptDatabase = Docs.Prototypes.MainScriptDocument(); - - setTimeout(() => this.setupDefaultPresentation(doc), 0); // presentation that's initially triggered - - // setup reactions to change the highlights on the undo/redo buttons -- would be better to encode this in the undo/redo buttons, but the undo/redo stacks are not wired up that way yet - // doc["dockedBtn-undo"] && reaction(() => UndoManager.undoStack.slice(), () => Doc.GetProto(doc["dockedBtn-undo"] as Doc).opacity = UndoManager.CanUndo() ? 1 : 0.4, { fireImmediately: true }); - // doc["dockedBtn-redo"] && reaction(() => UndoManager.redoStack.slice(), () => Doc.GetProto(doc["dockedBtn-redo"] as Doc).opacity = UndoManager.CanRedo() ? 1 : 0.4, { fireImmediately: true }); - - // uncomment this to setup a default note style that uses the custom header layout - // PromiseValue(doc.emptyHeader).then(factory => { - // if (Cast(doc.defaultTextLayout, Doc, null)?.version !== headerViewVersion) { - // const deleg = Doc.delegateDragFactory(factory as Doc); - // deleg.title = "header"; - // doc.defaultTextLayout = new PrefetchProxy(deleg); - // Doc.AddDocToList(Cast(doc["template-notes"], Doc, null), "data", deleg); - // } - // }); - setTimeout(() => DocServer.UPDATE_SERVER_CACHE(), 2500); - doc.fieldInfos = await Docs.setupFieldInfos(); - return doc; - } - - public static async loadCurrentUser() { - return rp.get(Utils.prepend("/getCurrentUser")).then(async response => { - if (response) { - const result: { id: string, email: string, cacheDocumentIds: string } = JSON.parse(response); - Doc.CurrentUserEmail = result.email; - resolvedPorts = JSON.parse(await Networking.FetchFromServer("/resolvedPorts")); - DocServer.init(window.location.protocol, window.location.hostname, resolvedPorts.socket, result.email); - result.cacheDocumentIds && (await DocServer.GetRefFields(result.cacheDocumentIds.split(";"))); - return result; - } else { - throw new Error("There should be a user! Why does Dash think there isn't one?"); - } - }); - } - - public static async loadUserDocument(id: string) { - this.curr_id = id; - await rp.get(Utils.prepend("/getUserDocumentIds")).then(ids => { - const { userDocumentId, sharingDocumentId, linkDatabaseId } = JSON.parse(ids); - if (userDocumentId !== "guest") { - return DocServer.GetRefField(userDocumentId).then(async field => { - Docs.newAccount = !(field instanceof Doc); - await Docs.Prototypes.initialize(); - const userDoc = Docs.newAccount ? new Doc(userDocumentId, true) : field as Doc; - const updated = this.updateUserDocument(Doc.SetUserDoc(userDoc), sharingDocumentId, linkDatabaseId); - (await DocListCastAsync(Cast(Doc.UserDoc().myLinkDatabase, Doc, null)?.data))?.forEach(async link => { // make sure anchors are loaded to avoid incremental updates to computedFn's in LinkManager - const a1 = await Cast(link?.anchor1, Doc, null); - const a2 = await Cast(link?.anchor2, Doc, null); - }); - return updated; - }); - } else { - throw new Error("There should be a user id! Why does Dash think there isn't one?"); - } - }); - } - - public static _urlState: HistoryUtil.DocUrl; - - public static openDashboard = (userDoc: Doc, doc: Doc, fromHistory = false) => { - CurrentUserUtils.MainDocId = doc[Id]; - - if (doc) { // this has the side-effect of setting the main container since we're assigning the active/guest dashboard - !("presentationView" in doc) && (doc.presentationView = new List([Docs.Create.TreeDocument([], { title: "Presentation" })])); - userDoc ? (userDoc.activeDashboard = doc) : (CurrentUserUtils.GuestDashboard = doc); - } - const state = CurrentUserUtils._urlState; - if (state.sharing === true && !userDoc) { - DocServer.Control.makeReadOnly(); - } else { - fromHistory || HistoryUtil.pushState({ - type: "doc", - docId: doc[Id], - readonly: state.readonly, - nro: state.nro, - sharing: false, - }); - if (state.readonly === true || state.readonly === null) { - DocServer.Control.makeReadOnly(); - } else if (state.safe) { - if (!state.nro) { - DocServer.Control.makeReadOnly(); - } - CollectionView.SetSafeMode(true); - } else if (state.nro || state.nro === null || state.readonly === false) { - } else if (doc.readOnly) { - DocServer.Control.makeReadOnly(); - } else { - DocServer.Control.makeEditable(); - } - } - - return true; - } - - public static importDocument = () => { - const input = document.createElement("input"); - input.type = "file"; - input.multiple = true; - input.accept = ".zip, application/pdf, video/*, image/*, audio/*"; - input.onchange = async _e => { - const upload = Utils.prepend("/uploadDoc"); - const formData = new FormData(); - const file = input.files && input.files[0]; - if (file && file.type === 'application/zip') { - formData.append('file', file); - formData.append('remap', "true"); - const response = await fetch(upload, { method: "POST", body: formData }); - const json = await response.json(); - if (json !== "error") { - const doc = Docs.newAccount ? undefined : await DocServer.GetRefField(json); - if (doc instanceof Doc) { - setTimeout(() => SearchUtil.Search(`{!join from=id to=proto_i}id:link*`, true, {}).then(docs => - docs.docs.forEach(d => LinkManager.Instance.addLink(d))), 2000); // need to give solr some time to update so that this query will find any link docs we've added. - } - } - } else if (input.files && input.files.length !== 0) { - const importDocs = Cast(Doc.UserDoc().myImportDocs, Doc, null); - const disposer = OverlayView.ShowSpinner(); - DocListCastAsync(importDocs.data).then(async list => { - const results = await DocUtils.uploadFilesToDocs(Array.from(input.files || []), {}); - if (results.length !== input.files?.length) { - alert("Error uploading files - possibly due to unsupported file types"); - } - list?.splice(0, 0, ...results); - disposer(); - }); - } else { - console.log("No file selected"); - } - }; - input.click(); - } - - public static async snapshotDashboard(userDoc: Doc) { - const copy = await CollectionDockingView.Copy(CurrentUserUtils.ActiveDashboard); - Doc.AddDocToList(Cast(userDoc.myDashboards, Doc, null), "data", copy); - CurrentUserUtils.openDashboard(userDoc, copy); - } - - public static createNewDashboard = async (userDoc: Doc, id?: string) => { - const myPresentations = await userDoc.myPresentations as Doc; - const presentation = Doc.MakeCopy(userDoc.emptyPresentation as Doc, true); - const dashboards = await Cast(userDoc.myDashboards, Doc) as Doc; - const dashboardCount = DocListCast(dashboards.data).length + 1; - const emptyPane = Cast(userDoc.emptyPane, Doc, null); - emptyPane["dragFactory-count"] = NumCast(emptyPane["dragFactory-count"]) + 1; - const freeformOptions: DocumentOptions = { - x: 0, - y: 400, - _width: 1500, - _height: 1000, - _fitWidth: true, - title: `Untitled Tab ${NumCast(emptyPane["dragFactory-count"])}`, - }; - const freeformDoc = CurrentUserUtils.GuestTarget || Docs.Create.FreeformDocument([], freeformOptions); - const dashboardDoc = Docs.Create.StandardCollectionDockingDocument([{ doc: freeformDoc, initialWidth: 600 }], { title: `Dashboard ${dashboardCount}` }, id, "row"); - Doc.AddDocToList(myPresentations, "data", presentation); - userDoc.activePresentation = presentation; - const toggleTheme = ScriptField.MakeScript(`Doc.UserDoc().darkScheme = !Doc.UserDoc().darkScheme`); - const toggleComic = ScriptField.MakeScript(`toggleComicMode()`); - const snapshotDashboard = ScriptField.MakeScript(`snapshotDashboard()`); - const createDashboard = ScriptField.MakeScript(`createNewDashboard()`); - dashboardDoc.contextMenuScripts = new List([toggleTheme!, toggleComic!, snapshotDashboard!, createDashboard!]); - dashboardDoc.contextMenuLabels = new List(["Toggle Theme Colors", "Toggle Comic Mode", "Snapshot Dashboard", "Create Dashboard"]); - - Doc.AddDocToList(dashboards, "data", dashboardDoc); - CurrentUserUtils.openDashboard(userDoc, dashboardDoc); - } - - public static GetNewTextDoc(title: string, x: number, y: number, width?: number, height?: number, noMargins?: boolean, annotationOn?: Doc, maxHeight?: number) { - const tbox = Docs.Create.TextDocument("", { - _xMargin: noMargins ? 0 : undefined, _yMargin: noMargins ? 0 : undefined, annotationOn, docMaxAutoHeight: maxHeight, - _width: width || 200, _height: height || 100, x: x, y: y, _fitWidth: true, _autoHeight: true, _fontSize: StrCast(Doc.UserDoc().fontSize), - _fontFamily: StrCast(Doc.UserDoc().fontFamily), title - }); - const template = Doc.UserDoc().defaultTextLayout; - if (template instanceof Doc) { - tbox._width = NumCast(template._width); - tbox.layoutKey = "layout_" + StrCast(template.title); - Doc.GetProto(tbox)[StrCast(tbox.layoutKey)] = template; - } - return tbox; - } - - public static get MySearchPanelDoc() { return Cast(Doc.UserDoc().mySearchPanelDoc, Doc, null); } - public static get ActiveDashboard() { return Cast(Doc.UserDoc().activeDashboard, Doc, null); } - public static get ActivePresentation() { return Cast(Doc.UserDoc().activePresentation, Doc, null); } - public static get MyRecentlyClosed() { return Cast(Doc.UserDoc().myRecentlyClosedDocs, Doc, null); } - public static get MyDashboards() { return Cast(Doc.UserDoc().myDashboards, Doc, null); } - public static get EmptyPane() { return Cast(Doc.UserDoc().emptyPane, Doc, null); } - public static get OverlayDocs() { return DocListCast((Doc.UserDoc().myOverlayDocs as Doc)?.data); } - public static set SelectedTool(tool: InkTool) { Doc.UserDoc().activeInkTool = tool; } - @computed public static get SelectedTool(): InkTool { return StrCast(Doc.UserDoc().activeInkTool, InkTool.None) as InkTool; } -} - -Scripting.addGlobal(function openDragFactory(dragFactory: Doc) { - const copy = Doc.copyDragFactory(dragFactory); - if (copy) { - CollectionDockingView.AddSplit(copy, "right"); - const view = DocumentManager.Instance.getFirstDocumentView(copy); - view && SelectionManager.SelectView(view, false); - } -}); -Scripting.addGlobal(function IsNoviceMode() { return Doc.UserDoc().noviceMode; }, - "is Dash in novice mode"); -Scripting.addGlobal(function snapshotDashboard() { CurrentUserUtils.snapshotDashboard(Doc.UserDoc()); }, - "creates a snapshot copy of a dashboard"); -Scripting.addGlobal(function createNewDashboard() { return CurrentUserUtils.createNewDashboard(Doc.UserDoc()); }, - "creates a new dashboard when called"); -Scripting.addGlobal(function createNewPresentation() { return MainView.Instance.createNewPresentation(); }, - "creates a new presentation when called"); -Scripting.addGlobal(function links(doc: any) { return new List(LinkManager.Instance.getAllRelatedLinks(doc)); }, - "returns all the links to the document or its annotations", "(doc: any)"); -Scripting.addGlobal(function importDocument() { return CurrentUserUtils.importDocument(); }, - "imports files from device directly into the import sidebar"); \ No newline at end of file diff --git a/src/client/views/DocumentButtonBar.tsx b/src/client/views/DocumentButtonBar.tsx index 5f09a322c..5640e5132 100644 --- a/src/client/views/DocumentButtonBar.tsx +++ b/src/client/views/DocumentButtonBar.tsx @@ -27,6 +27,7 @@ import React = require("react"); import { PresBox } from './nodes/trails/PresBox'; import { undoBatch } from '../util/UndoManager'; import { CollectionViewType } from './collections/CollectionView'; +import { Colors } from './global/globalEnums'; const higflyout = require("@hig/flyout"); export const { anchorPoints } = higflyout; export const Flyout = higflyout.default; @@ -187,9 +188,9 @@ export class DocumentButtonBar extends React.Component<{ views: () => (DocumentV get followLinkButton() { const targetDoc = this.view0?.props.Document; return !targetDoc ? (null) : {"follow primary link on click"}
}> +
{"Set onClick to follow primary link"}
}>
this.props.views().map(view => view?.docView?.toggleFollowLink(undefined, false, false)))}>
diff --git a/src/client/views/collections/CollectionMenu.tsx b/src/client/views/collections/CollectionMenu.tsx index 55af4650f..1f36e94cf 100644 --- a/src/client/views/collections/CollectionMenu.tsx +++ b/src/client/views/collections/CollectionMenu.tsx @@ -1284,3 +1284,4 @@ Scripting.addGlobal(function gotoFrame(doc: any, newFrame: any) { CollectionFreeFormDocumentView.updateKeyframe(childDocs, currentFrame || 0); doc._currentFrame = newFrame === undefined ? 0 : Math.max(0, newFrame); }); + diff --git a/src/client/views/collections/collectionLinearView/CollectionLinearView.scss b/src/client/views/collections/collectionLinearView/CollectionLinearView.scss index db39e304b..9c766e03f 100644 --- a/src/client/views/collections/collectionLinearView/CollectionLinearView.scss +++ b/src/client/views/collections/collectionLinearView/CollectionLinearView.scss @@ -6,11 +6,12 @@ height: 100%; pointer-events: none; // background-color: rgba(0, 0, 0, 0.2); - border-radius: 5px; - padding-left: 5px; - padding-right: 5px; - border-left: $standard-border; - border-right: $standard-border; + + &.true { + padding-left: 5px; + padding-right: 5px; + border-left: $standard-border; + } .collectionLinearView { display: flex; diff --git a/src/client/views/collections/collectionLinearView/CollectionLinearView.tsx b/src/client/views/collections/collectionLinearView/CollectionLinearView.tsx index e7970758a..a8846fd45 100644 --- a/src/client/views/collections/collectionLinearView/CollectionLinearView.tsx +++ b/src/client/views/collections/collectionLinearView/CollectionLinearView.tsx @@ -119,7 +119,7 @@ export class CollectionLinearView extends CollectionSubView(LinearDocument) {

{BoolCast(this.layoutDoc.linearViewIsExpanded) ? icon ? icon : "–" : icon ? icon : "+"}

; - return
+ return
{!expandable ? (null) :
{BoolCast(this.props.Document.linearViewIsExpanded) ? "Close menu" : "Open menu"}
} placement="top"> {menuOpener} diff --git a/src/client/views/nodes/button/ButtonScripts.ts b/src/client/views/nodes/button/ButtonScripts.ts new file mode 100644 index 000000000..bb4dd8bc9 --- /dev/null +++ b/src/client/views/nodes/button/ButtonScripts.ts @@ -0,0 +1,14 @@ +import { Scripting } from "../../../util/Scripting"; +import { SelectionManager } from "../../../util/SelectionManager"; + +// toggle: Set overlay status of selected document +Scripting.addGlobal(function changeView(view: string) { + const selected = SelectionManager.Views().length ? SelectionManager.Views()[0] : undefined; + selected ? selected.Document._viewType = view : console.log("[FontIconBox.tsx] changeView failed"); +}); + +// toggle: Set overlay status of selected document +Scripting.addGlobal(function toggleOverlay() { + const selected = SelectionManager.Views().length ? SelectionManager.Views()[0] : undefined; + selected ? selected.props.CollectionFreeFormDocumentView?.().float() : console.log("failed"); +}); \ No newline at end of file diff --git a/src/client/views/nodes/button/FontIconBox.scss b/src/client/views/nodes/button/FontIconBox.scss index 0c866988d..72fab74d9 100644 --- a/src/client/views/nodes/button/FontIconBox.scss +++ b/src/client/views/nodes/button/FontIconBox.scss @@ -43,6 +43,11 @@ &.tglBtn { cursor: pointer; + + svg { + width: 50% !important; + height: 50%; + } } &.toolBtn { @@ -99,6 +104,8 @@ overflow: hidden; cursor: pointer; background: transparent; + align-content: center; + align-items: center; .menuButton-dropdownList { position: absolute; @@ -145,6 +152,39 @@ } } + .menuButton-dropdown { + display: flex; + justify-content: center; + align-items: center; + font-size: 15px; + /* background-color: #b9b9b9; */ + grid-column: 2; + border-radius: 0px 7px 7px 0px; + /* position: absolute; */ + width: 13px; + height: 100%; + right: 0; + } + + .menuButton-dropdown-header{ + width: 100%; + font-weight: 300; + overflow:hidden; + font-size: 12px; + white-space: nowrap; + text-overflow: ellipsis; + } + + .dropbox-background { + width: 100vw; + height: 100vh; + top: 0; + z-index: 20; + left: 0; + background:transparent; + position: fixed; + } + } @@ -186,31 +226,11 @@ // position: absolute; // } -// .menuButton-dropdown { -// display: flex; -// justify-content: center; -// align-items: center; -// font-size: 15px; -// /* background-color: #b9b9b9; */ -// grid-column: 2; -// border-radius: 0px 7px 7px 0px; -// /* position: absolute; */ -// width: 13px; -// height: 100%; -// right: 0; -// } + // &:hover { // background-color: $light-gray; // } -// .dropbox-background { -// width: 100vw; -// height: 100vh; -// top: 0; -// z-index: 20; -// left: 0; -// background:transparent; -// position: fixed; -// } + // } \ No newline at end of file diff --git a/src/client/views/nodes/button/FontIconBox.tsx b/src/client/views/nodes/button/FontIconBox.tsx index 9e7608dc3..9a54579dc 100644 --- a/src/client/views/nodes/button/FontIconBox.tsx +++ b/src/client/views/nodes/button/FontIconBox.tsx @@ -56,15 +56,12 @@ export class FontIconBox extends DocComponent(Fon } } - - // Determining UI Specs @observable private label = StrCast(this.rootDoc.label, StrCast(this.rootDoc.title)); @observable private icon = StrCast(this.dataDoc.icon, "user") as any; @observable private dropdown: boolean = BoolCast(this.rootDoc.dropDownOpen); @observable private dropdownDirection: string = StrCast(this.rootDoc.dropDownDirection); @observable private buttonList: string[] = StrListCast(this.rootDoc.btnList); - @observable private activeFont: string = StrCast(Doc.UserDoc()._fontFamily); @observable private type = StrCast(this.rootDoc.btnType); /** @@ -106,18 +103,185 @@ export class FontIconBox extends DocComponent(Fon ); } - @undoBatch setColor = action((color: ColorState, docColor?: string, userColor?: string) => { - console.log(docColor, userColor); - if (docColor) { - const numSelected = SelectionManager.Views().length; - const selectedDoc = numSelected > 0 ? SelectionManager.Views()[0].Document : undefined; - eval(docColor); + /** + * Dropdown button + */ + @computed get dropdownListButton() { + const active: string = StrCast(this.rootDoc.dropDownOpen); + const color = this.props.styleProvider?.(this.rootDoc, this.props, StyleProp.Color); + const backgroundColor = this.props.styleProvider?.(this.rootDoc, this.props, StyleProp.BackgroundColor); + + const script: string = StrCast(this.rootDoc.script); + + let noviceList: string[] = []; + let text:string | undefined; + let dropdown = true; + let show = true; + let icon: IconProp = "caret-down"; + + + if (script == 'changeView'){ + const selected = SelectionManager.Views().length ? SelectionManager.Views()[0] : undefined; + if (selected && StrCast(selected.Document.type) == DocumentType.COL){ + text = StrCast(selected.Document._viewType); + } else if (selected) { + dropdown = false; + text = StrCast(selected.Document.type); + icon = Doc.toIcon(selected.Document); + } + noviceList = [CollectionViewType.Freeform, CollectionViewType.Schema, CollectionViewType.Stacking]; + } else if (script == 'changeFont') { + const selected = SelectionManager.Views().length ? SelectionManager.Views()[0] : undefined; + if (selected && StrCast(selected.Document.type) == DocumentType.RTF){ + text = StrCast(selected.Document._fontFamily); + } else { + text = StrCast(Doc.UserDoc()._fontFamily); + } + noviceList = ["Roboto", "Times New Roman", "Arial", "Georgia", + "Comic Sans MS", "Tahoma", "Impact", "Crimson Text"]; + } else { + show = false; } - else if (userColor) { - const userDoc = Doc.UserDoc(); - eval(userColor); + + const items = this.buttonList.map((value) => { + // console.log(value); + if (Doc.UserDoc().noviceMode && !noviceList.includes(value)){ + return; + } + const click = () => { + const s = ScriptField.MakeScript(script+'("'+value+'")'); + if (s){ + // console.log(s.script); + s.script.run().result; + } + } + return
+ {value[0].toUpperCase() + value.slice(1)} +
; + }); + + const label = !this.label || !Doc.UserDoc()._showLabel ? (null) : +
+ {this.label} +
; + + return ( +
this.rootDoc.dropDownOpen = !this.rootDoc.dropDownOpen : undefined}> +
+ {text && text[0].toUpperCase() + text.slice(1)} +
+ {label} +
+ +
+ {this.rootDoc.dropDownOpen ? +
+
+ {items} +
+
{ e.stopPropagation(); this.rootDoc.dropDownOpen = false; }} /> +
+ : null} +
+ ); + } + + + @computed get rangeButton() { + return ( +
+ +
+ ) + } + + /** + * Colour button + */ + @computed get colorButton() { + const active: string = StrCast(this.rootDoc.dropDownOpen); + const color = this.props.styleProvider?.(this.rootDoc, this.props, StyleProp.Color); + const backgroundColor = this.props.styleProvider?.(this.rootDoc, this.props, StyleProp.BackgroundColor); + const numSelected = SelectionManager.Views().length; + const selectedDoc = numSelected > 0 ? SelectionManager.Views()[0].Document : undefined; + const colorBox = (func: (color: ColorState) => void) => ; + const label = !this.label || !Doc.UserDoc()._showLabel ? (null) : +
+ {this.label} +
; + const dropdownCaret =
+ +
; + const script: string = StrCast(this.rootDoc.script); + const click = (value: ColorState) => { + const hex: string = value.hex; + const s = ScriptField.MakeScript(script+'("'+hex+'")'); + if (s){ + // console.log(s.script); + s.script.run().result; + } } - }); + return ( +
this.rootDoc.dropDownOpen = !this.rootDoc.dropDownOpen} + onPointerDown={e => e.stopPropagation()}> + + {label} + {dropdownCaret} + {this.rootDoc.dropDownOpen ? +
+
e.stopPropagation()} + onClick={e => e.stopPropagation()} + style={{ left: 0 }}> + {colorBox((color) => click(color))} +
+
{ e.stopPropagation(); this.rootDoc.dropDownOpen = false; }} /> +
+ : null} +
+ ); + } + + @computed get toggleButton() { + const numSelected = SelectionManager.Views().length; + const selectedDoc = numSelected > 0 ? SelectionManager.Views()[0].Document : undefined; + + const script: string = StrCast(this.rootDoc.script)+"(true)"; + let toggleTrue: boolean | undefined = false; + if (script == 'toggleOverlay'){ + toggleTrue = selectedDoc && BoolCast(selectedDoc.z); + console.log('toggleOverlay'); + } + const boolResult = ScriptField.MakeScript(script)?.script.run().result; + // console.log(this.rootDoc.title, script, boolResult); + const color = this.props.styleProvider?.(this.rootDoc, this.props, StyleProp.Color); + const backgroundColor = this.props.styleProvider?.(this.rootDoc, this.props, StyleProp.BackgroundColor); + // const canClick: boolean = this.rootDoc.canClick ? eval(StrCast(this.rootDoc.canClick)) : false; + const label = !this.label || !Doc.UserDoc()._showLabel ? (null) : +
+ {this.label} +
; + return ( +
+ + {label} +
+ ) + } @@ -151,13 +315,7 @@ export class FontIconBox extends DocComponent(Fon const selectedDoc = numSelected > 0 ? SelectionManager.Views()[0].Document : undefined; const userDoc = Doc.UserDoc(); - // Toggle and canClick properties as determined from the variable passed into the button doc - const toggle = this.rootDoc.toggle ? ScriptCast(this.rootDoc.toggle) : undefined; - const canClick: boolean = this.rootDoc.canClick ? eval(StrCast(this.rootDoc.canClick)) : false; - // if (toggle) { - // console.log(StrCast(this.rootDoc.title), toggle); - // toggle.script.run(); - // } + const dark: boolean = Doc.UserDoc().colorScheme === ColorScheme.Dark; const active: string = StrCast(this.rootDoc.dropDownOpen); @@ -169,111 +327,34 @@ export class FontIconBox extends DocComponent(Fon
{this.label}
; - const dropdownCaret =
- -
; - const colorBox = (func: (color: ColorState) => void) => ; - const items = this.buttonList.map((value) => { - return
Doc.UserDoc()._fontFamily = value}> - {value} -
; - }); - - /** - * Menu Panel Button: menuBtn - * Dropdown Button: dropDownBtn - * doubleBtn - **/ - - // CODEDUMP: glr - // const presSize = type === ButtonType.MenuButton ? 30 : 25; - // const presTrailsIcon = ; - + // TODO:glr Add label of button type - let button = ( - <> - {this.defaultButton} - - ); + let button = this.defaultButton; switch (this.type) { case ButtonType.DropdownButton: - button = ( - <> - {this.dropdownButton} - - ); + button = this.dropdownButton; break; case ButtonType.DropdownList: - button = ( -
this.rootDoc.dropDownOpen = !this.rootDoc.dropDownOpen}> - {toggle} - {label} - {dropdownCaret} - {this.rootDoc.dropDownOpen ? - <> -
- {items} -
-
{ e.stopPropagation(); this.rootDoc.dropDownOpen = false; }} /> - - : null} -
- ); + button = this.dropdownListButton; break; case ButtonType.ColorButton: - button = ( -
this.rootDoc.dropDownOpen = !this.rootDoc.dropDownOpen} - onPointerDown={e => e.stopPropagation()}> - - {label} - {dropdownCaret} - {this.rootDoc.dropDownOpen ? - <> -
e.stopPropagation()} - onClick={e => e.stopPropagation()} - style={{ left: 0 }}> - {colorBox((color) => this.setColor(color, StrCast(this.rootDoc.docColor), StrCast(this.rootDoc.userColor)))} -
-
{ e.stopPropagation(); this.rootDoc.dropDownOpen = false; }} /> - - : null} -
- ); + button = this.colorButton; break; case ButtonType.ToolButton: button = ( -
+
{label}
); break; case ButtonType.ToggleButton: - button = ( -
- - {label} -
- ); + button = this.toggleButton; break; case ButtonType.ClickButton: button = ( -
+
{label}
@@ -299,9 +380,91 @@ export class FontIconBox extends DocComponent(Fon break; } - return !this.layoutDoc.toolTip ? button : + return !this.layoutDoc.toolTip || this.type === ButtonType.DropdownList || this.type === ButtonType.ColorButton ? button : {StrCast(this.layoutDoc.toolTip)}
}> {button} ; } } + +// SCRIPTING BUTTONS + +import { Scripting } from "../../../util/Scripting"; +import { CollectionViewType } from '../../collections/CollectionView'; +import { DocumentType } from '../../../documents/DocumentTypes'; +import { Colors } from '../../global/globalEnums'; +import { IconProp } from '@fortawesome/fontawesome-svg-core'; + +// toggle: Set overlay status of selected document +Scripting.addGlobal(function changeView(view: string) { + const selected = SelectionManager.Views().length ? SelectionManager.Views()[0] : undefined; + selected ? selected.Document._viewType = view : console.log("[FontIconBox.tsx] changeView failed"); +}); + +// toggle: Set overlay status of selected document +Scripting.addGlobal(function changeBackgroundColor(color?: string, checkResult?: boolean) { + const selected = SelectionManager.Views().length ? SelectionManager.Views()[0] : undefined; + if (checkResult){ + return selected && selected.Document._backgroundColor; + } + selected ? selected.Document._backgroundColor = color : console.log("[FontIconBox.tsx] changeBackgroundColor failed"); +}); + +// toggle: Set overlay status of selected document +Scripting.addGlobal(function toggleOverlay(checkResult?:boolean) { + const selected = SelectionManager.Views().length ? SelectionManager.Views()[0] : undefined; + if (checkResult){ + return selected && selected.Document.z == 1; + } + selected ? selected.props.CollectionFreeFormDocumentView?.().float() : console.log("[FontIconBox.tsx] toggleOverlay failed"); +}); + +// toggle: Set overlay status of selected document +Scripting.addGlobal(function changeFont(font: string) { + // TODO: glr check if font selected and change selected font + SelectionManager.Views().map(dv => dv.props.Document._fontFamily = font); + console.log(font); + Doc.UserDoc()._fontFamily = font; + return Doc.UserDoc()._fontFamily; +}); + +// toggle: Set overlay status of selected document +Scripting.addGlobal(function changeFontColor(color: string) { + // TODO: glr check if font selected and change selected font + console.log(color); + Doc.UserDoc()._fontColor = color; +}); + +// toggle: Set overlay status of selected document +Scripting.addGlobal(function changeFontSize(size: string) { + // TODO: glr check if font selected and change selected font + console.log(size); + Doc.UserDoc()._fontSize = size; +}); + +Scripting.addGlobal(function toggleBold(checkResult?:boolean) { + if(checkResult) { + console.log("got here"); + return Doc.UserDoc().bold; + } + // TODO: glr check if font selected and change selected font + SelectionManager.Views().map(dv => dv.props.Document.bold = !dv.props.Document.bold); + Doc.UserDoc().bold = !Doc.UserDoc().bold; + return Doc.UserDoc().bold; +}); + +Scripting.addGlobal(function toggleUnderline(checkResult?:boolean) { + if(checkResult) return Doc.UserDoc().underline; + // TODO: glr check if font selected and change selected font + SelectionManager.Views().map(dv => dv.props.Document.underline = !dv.props.Document.underline); + Doc.UserDoc().bold = !Doc.UserDoc().underline; + return Doc.UserDoc().underline; +}); + +Scripting.addGlobal(function toggleItalic(checkResult?:boolean) { + if(checkResult) return Doc.UserDoc().italic; + // TODO: glr check if font selected and change selected font + SelectionManager.Views().map(dv => dv.props.Document.italic = !dv.props.Document.italic); + Doc.UserDoc().bold = !Doc.UserDoc().italic; + return Doc.UserDoc().italic; +}); \ No newline at end of file -- cgit v1.2.3-70-g09d2 From 3051d9a16dff8efbf4d32465812093cae7508c74 Mon Sep 17 00:00:00 2001 From: bobzel Date: Thu, 19 Aug 2021 18:42:46 -0400 Subject: fixed errors and warnings --- src/client/util/CurrentUserUtils.ts | 8 ++++---- src/client/util/LinkManager.ts | 4 ++-- src/client/util/SharingManager.tsx | 2 +- src/client/views/nodes/FilterBox.tsx | 4 ++-- src/client/views/nodes/ScreenshotBox.tsx | 2 +- .../views/nodes/formattedText/ProsemirrorExampleTransfer.ts | 2 +- src/fields/Doc.ts | 2 +- 7 files changed, 12 insertions(+), 12 deletions(-) (limited to 'src/client/util/CurrentUserUtils.ts') diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts index e446e3752..1f37163d7 100644 --- a/src/client/util/CurrentUserUtils.ts +++ b/src/client/util/CurrentUserUtils.ts @@ -567,7 +567,7 @@ export class CurrentUserUtils { ); menuBtns.forEach(menuBtn => { - if (menuBtn.title == "Search") { + if (menuBtn.title === "Search") { this.searchBtn = menuBtn; } }); @@ -575,10 +575,10 @@ export class CurrentUserUtils { menuBtns[menuBtns.length - 1].hidden = ComputedField.MakeFunction("IsNoviceMode()"); menuBtns.forEach(menuBtn => { - if (menuBtn.title == "Search") { - doc.searchBtn = menuBtn + if (menuBtn.title === "Search") { + doc.searchBtn = menuBtn; } - }) + }); doc.menuStack = new PrefetchProxy(Docs.Create.StackingDocument(menuBtns, { title: "menuItemPanel", diff --git a/src/client/util/LinkManager.ts b/src/client/util/LinkManager.ts index c33dff8d1..3579083e4 100644 --- a/src/client/util/LinkManager.ts +++ b/src/client/util/LinkManager.ts @@ -47,7 +47,7 @@ export class LinkManager { Doc.GetProto(link)[DirectLinksSym].add(link); } })); - } + }; const remLinkFromDoc = (link: Doc) => { const a1 = link?.anchor1; const a2 = link?.anchor2; @@ -58,7 +58,7 @@ export class LinkManager { Doc.GetProto(link)[DirectLinksSym].delete(link); } })); - } + }; const watchUserLinkDB = (userLinkDBDoc: Doc) => { LinkManager.links.push(...DocListCast(userLinkDBDoc.data)); const toRealField = (field: Field) => field instanceof ProxyField ? field.value() : field; // see List.ts. data structure is not a simple list of Docs, but a list of ProxyField/Fields diff --git a/src/client/util/SharingManager.tsx b/src/client/util/SharingManager.tsx index 6c4556250..6d7f7e8df 100644 --- a/src/client/util/SharingManager.tsx +++ b/src/client/util/SharingManager.tsx @@ -513,7 +513,7 @@ export class SharingManager extends React.Component<{}> { if (this.myDocAcls) { const newDocs: Doc[] = []; - SearchBox.foreachRecursiveDoc(docs, doc => newDocs.push(doc)); + SearchBox.foreachRecursiveDoc(docs, (depth, doc) => newDocs.push(doc)); docs = newDocs.filter(doc => GetEffectiveAcl(doc) === AclAdmin); } diff --git a/src/client/views/nodes/FilterBox.tsx b/src/client/views/nodes/FilterBox.tsx index c892a9f6c..beefc4a82 100644 --- a/src/client/views/nodes/FilterBox.tsx +++ b/src/client/views/nodes/FilterBox.tsx @@ -101,7 +101,7 @@ export class FilterBox extends ViewBoxBaseComponent(); const activeTabs = DocListCast(targetDoc.data); - SearchBox.foreachRecursiveDoc(activeTabs, (doc: Doc) => allDocs.add(doc)); + SearchBox.foreachRecursiveDoc(activeTabs, (depth, doc) => allDocs.add(doc)); setTimeout(action(() => this._allDocs = Array.from(allDocs))); } return this._allDocs; @@ -482,7 +482,7 @@ Scripting.addGlobal(function determineCheckedState(layoutDoc: Doc, facetHeader: Scripting.addGlobal(function readFacetData(layoutDoc: Doc, facetHeader: string) { const allCollectionDocs = new Set(); const activeTabs = DocListCast(layoutDoc.data); - SearchBox.foreachRecursiveDoc(activeTabs, (doc: Doc) => allCollectionDocs.add(doc)); + SearchBox.foreachRecursiveDoc(activeTabs, (depth: number, doc: Doc) => allCollectionDocs.add(doc)); const set = new Set(); if (facetHeader === "tags") allCollectionDocs.forEach(child => Field.toString(child[facetHeader] as Field).split(":").forEach(key => set.add(key))); else allCollectionDocs.forEach(child => set.add(Field.toString(child[facetHeader] as Field))); diff --git a/src/client/views/nodes/ScreenshotBox.tsx b/src/client/views/nodes/ScreenshotBox.tsx index 68ab3193b..f0db0b594 100644 --- a/src/client/views/nodes/ScreenshotBox.tsx +++ b/src/client/views/nodes/ScreenshotBox.tsx @@ -265,7 +265,7 @@ export class ScreenshotBox extends ViewBoxAnnotatableComponent { if (this.dataDoc[this.fieldKey + "-dictation"]) return; diff --git a/src/client/views/nodes/formattedText/ProsemirrorExampleTransfer.ts b/src/client/views/nodes/formattedText/ProsemirrorExampleTransfer.ts index eff400a98..76a5675de 100644 --- a/src/client/views/nodes/formattedText/ProsemirrorExampleTransfer.ts +++ b/src/client/views/nodes/formattedText/ProsemirrorExampleTransfer.ts @@ -84,7 +84,7 @@ export function buildKeymap>(schema: S, props: any, mapKey break; } return true; - } + }; const toggleEditableMark = (mark: any) => (state: EditorState, dispatch: (tx: Transaction) => void) => canEdit(state) && toggleMark(mark)(state, dispatch); diff --git a/src/fields/Doc.ts b/src/fields/Doc.ts index 1eeadeedc..e4087cf43 100644 --- a/src/fields/Doc.ts +++ b/src/fields/Doc.ts @@ -257,7 +257,7 @@ export class Doc extends RefField { DocServer.GetRefField(this[Id], true); } }; - const writeMode = DocServer.getFieldWriteMode(fKey as string); + const writeMode = DocServer.getFieldWriteMode(fKey); if (fKey.startsWith("acl") || writeMode !== DocServer.WriteMode.Playground) { delete this[CachedUpdates][fKey]; await fn(); -- cgit v1.2.3-70-g09d2 From 077e4ba816afd35bba4622e53d4dca62b74bf292 Mon Sep 17 00:00:00 2001 From: geireann Date: Thu, 19 Aug 2021 21:56:57 -0400 Subject: menu UI updates --- src/Utils.ts | 48 ++++------------------ src/client/util/CurrentUserUtils.ts | 35 ++++++++-------- src/client/views/StyleProvider.tsx | 8 +--- src/client/views/collections/TabDocView.tsx | 2 + .../collectionLinearView/CollectionLinearView.scss | 28 +++++++------ .../collectionLinearView/CollectionLinearView.tsx | 4 +- src/client/views/nodes/button/FontIconBox.scss | 21 ++++++---- src/client/views/nodes/button/FontIconBox.tsx | 2 +- 8 files changed, 62 insertions(+), 86 deletions(-) (limited to 'src/client/util/CurrentUserUtils.ts') diff --git a/src/Utils.ts b/src/Utils.ts index 194c38a6f..0887759ee 100644 --- a/src/Utils.ts +++ b/src/Utils.ts @@ -3,6 +3,8 @@ import v5 = require("uuid/v5"); import { ColorState } from 'react-color'; import { Socket } from 'socket.io'; import { Message } from './server/Message'; +import { Colors } from './client/views/global/globalEnums'; +import Color = require('color'); export namespace Utils { export let DRAG_THRESHOLD = 4; @@ -556,46 +558,12 @@ export function simulateMouseClick(element: Element | null | undefined, x: numbe } export function lightOrDark(color: any) { - - // Variables for red, green, blue values - var r, g, b, hsp; - - // Check the format of the color, HEX or RGB? - if (color.match(/^rgb/)) { - - // If RGB --> store the red, green, blue values in separate variables - color = color.match(/^rgba?\((\d+),\s*(\d+),\s*(\d+)(?:,\s*(\d+(?:\.\d+)?))?\)$/); - - r = color[1]; - g = color[2]; - b = color[3]; - } - else { - - // If hex --> Convert it to RGB: http://gist.github.com/983661 - color = +("0x" + color.slice(1).replace( - color.length < 5 && /./g, '$&$&')); - - r = color >> 16; - g = color >> 8 & 255; - b = color & 255; - } - - // HSP (Highly Sensitive Poo) equation from http://alienryderflex.com/hsp.html - hsp = Math.sqrt( - 0.299 * (r * r) + - 0.587 * (g * g) + - 0.114 * (b * b) - ); - - // Using the HSP value, determine whether the color is light or dark - if (hsp > 127.5) { - return 'light'; - } - else { - - return 'dark'; - } + const nonAlphaColor = color.startsWith("#") ? (color as string).substring(0, 7) : + color.startsWith("rgba") ? color.replace(/,.[^,]*\)/, ")").replace("rgba", "rgb") : color; + const col = Color(nonAlphaColor).rgb(); + const colsum = (col.red() + col.green() + col.blue()); + if (colsum / col.alpha() > 400 || col.alpha() < 0.25) return Colors.DARK_GRAY; + else return Colors.WHITE; } diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts index 4ff0446ad..0440367de 100644 --- a/src/client/util/CurrentUserUtils.ts +++ b/src/client/util/CurrentUserUtils.ts @@ -990,10 +990,10 @@ export class CurrentUserUtils { if (type === "TextMenu") { const textBtns = (CurrentUserUtils.textTools(doc)).map(({ title, width, list, toolTip, ignoreClick, icon, btnType, click, script, userColorBtn }) => { textDocList.push(Docs.Create.FontIconDocument({ - _nativeWidth: width ? width : 30, - _nativeHeight: 30, - _width: width ? width : 30, - _height: 30, + _nativeWidth: width ? width : 25, + _nativeHeight: 25, + _width: width ? width : 25, + _height: 25, icon, toolTip, userColorBtn, @@ -1006,7 +1006,8 @@ export class CurrentUserUtils { system: true, dontUndo: true, title, - backgroundColor: "black", + color: Colors.WHITE, + backgroundColor: "transparent", _dropAction: "alias", _removeDropProperties: new List(["dropAction", "_stayInCollection"]), onClick: click ? ScriptField.MakeScript(click, { doc: Doc.name }) : undefined @@ -1016,10 +1017,10 @@ export class CurrentUserUtils { } else if (type === "InkMenu") { const inkBtns = (CurrentUserUtils.inkTools(doc)).map(({ title, toolTip, icon, btnType, click }) => { textDocList.push(Docs.Create.FontIconDocument({ - _nativeWidth: width ? width : 30, - _nativeHeight: 30, - _width: width ? width : 30, - _height: 30, + _nativeWidth: width ? width : 25, + _nativeHeight: 25, + _width: width ? width : 25, + _height: 25, icon, toolTip, script, @@ -1031,7 +1032,8 @@ export class CurrentUserUtils { system: true, dontUndo: true, title, - backgroundColor: "black", + color: Colors.WHITE, + backgroundColor: "transparent", _dropAction: "alias", _removeDropProperties: new List(["dropAction", "_stayInCollection"]), onClick: click ? ScriptField.MakeScript(click, { doc: Doc.name }) : undefined @@ -1040,14 +1042,12 @@ export class CurrentUserUtils { docList.push(CurrentUserUtils.blist({ linearViewSubMenu: true, ignoreClick: true, linearViewExpandable: true, icon:title, _height: 30, backgroundColor: "transparent" }, textDocList)); } else { docList.push(Docs.Create.FontIconDocument({ - _nativeWidth: width ? width : 30, - _nativeHeight: 30, - _width: width ? width : 30, - _height: 30, + _nativeWidth: width ? width : 25, + _nativeHeight: 25, + _width: width ? width : 25, + _height: 25, icon, toolTip, - // testToggle: toggle ? ScriptField.MakeScript(toggle, { scriptContext: "any" }) : undefined, - // toggle: toggle, script, btnType: btnType, btnList: new List(list), @@ -1057,7 +1057,8 @@ export class CurrentUserUtils { system: true, dontUndo: true, title, - backgroundColor: "black", + color: Colors.WHITE, + backgroundColor: "transparent", _dropAction: "alias", _removeDropProperties: new List(["dropAction", "_stayInCollection"]), onClick: click ? ScriptField.MakeScript(click, { scriptContext: "any" }) : undefined diff --git a/src/client/views/StyleProvider.tsx b/src/client/views/StyleProvider.tsx index 85520f6b3..470ae7c77 100644 --- a/src/client/views/StyleProvider.tsx +++ b/src/client/views/StyleProvider.tsx @@ -21,6 +21,7 @@ import "./nodes/FilterBox.scss"; import "./StyleProvider.scss"; import React = require("react"); import Color = require('color'); +import { lightOrDark } from '../../Utils'; export enum StyleLayers { Background = "background" @@ -101,12 +102,7 @@ export function DefaultStyleProvider(doc: Opt, props: Opt 400 || col.alpha() < 0.25) return Colors.DARK_GRAY; - return Colors.WHITE; + return lightOrDark(backColor) case StyleProp.Hidden: return BoolCast(doc?._hidden); case StyleProp.BorderRounding: return StrCast(doc?.[fieldKey + "borderRounding"], doc?._viewType === CollectionViewType.Pile ? "50%" : ""); case StyleProp.TitleHeight: return 15; diff --git a/src/client/views/collections/TabDocView.tsx b/src/client/views/collections/TabDocView.tsx index 1969d728c..9ff1a0f61 100644 --- a/src/client/views/collections/TabDocView.tsx +++ b/src/client/views/collections/TabDocView.tsx @@ -124,6 +124,8 @@ export class TabDocView extends React.Component { tab.element[0].prepend(iconWrap); tab._disposers.layerDisposer = reaction(() => ({ layer: tab.DashDoc.activeLayer, color: this.tabColor }), ({ layer, color }) => { + console.log("TabDocView: " + this.tabColor); + console.log("lightOrDark: " + lightOrDark(this.tabColor)); const textColor = lightOrDark(this.tabColor); //not working with StyleProp.Color titleEle.style.color = textColor; titleEle.style.backgroundColor = "transparent"; diff --git a/src/client/views/collections/collectionLinearView/CollectionLinearView.scss b/src/client/views/collections/collectionLinearView/CollectionLinearView.scss index 9c766e03f..b37233892 100644 --- a/src/client/views/collections/collectionLinearView/CollectionLinearView.scss +++ b/src/client/views/collections/collectionLinearView/CollectionLinearView.scss @@ -5,12 +5,16 @@ overflow: visible; height: 100%; pointer-events: none; - // background-color: rgba(0, 0, 0, 0.2); &.true { padding-left: 5px; padding-right: 5px; border-left: $standard-border; + background-color: #4476f780; + } + + >input:not(:checked)~&.true { + background-color: transparent; } .collectionLinearView { @@ -78,24 +82,25 @@ } >label { - background: $dark-gray; + pointer-events: all; + cursor: pointer; + background-color: $medium-blue; + padding: 5; + border-radius: 2px; + height: 25; + + margin: 0; color: $white; display: flex; - border-radius: 18px; - font-size: 12.5px; - font-weight:100; + font-weight: 100; width: fit-content; - height: 100%; - margin-top: auto; - margin-bottom: auto; - margin-right: 3px; - cursor: pointer; transition: transform 0.2s; align-items: center; justify-content: center; + transition:0.1s; &:hover { - background: $medium-gray; + transform: scale(1.05); } } @@ -122,7 +127,6 @@ .collectionLinearView-docBtn-scalable { position: relative; margin: auto; - margin-left: 3px; transform-origin: center 80%; } diff --git a/src/client/views/collections/collectionLinearView/CollectionLinearView.tsx b/src/client/views/collections/collectionLinearView/CollectionLinearView.tsx index a8846fd45..5d89d82b4 100644 --- a/src/client/views/collections/collectionLinearView/CollectionLinearView.tsx +++ b/src/client/views/collections/collectionLinearView/CollectionLinearView.tsx @@ -114,12 +114,12 @@ export class CollectionLinearView extends CollectionSubView(LinearDocument) { const color = this.props.styleProvider?.(this.rootDoc, this.props, StyleProp.Color); const icon: string = StrCast(this.props.Document.icon); - const menuOpener = ; - return
+ return
{!expandable ? (null) :
{BoolCast(this.props.Document.linearViewIsExpanded) ? "Close menu" : "Open menu"}
} placement="top"> {menuOpener} diff --git a/src/client/views/nodes/button/FontIconBox.scss b/src/client/views/nodes/button/FontIconBox.scss index 72fab74d9..8dfb66e30 100644 --- a/src/client/views/nodes/button/FontIconBox.scss +++ b/src/client/views/nodes/button/FontIconBox.scss @@ -6,7 +6,11 @@ justify-content: center; align-items: center; font-size: 80%; - border-radius: 7px; + border-radius: 2px; + + &:hover { + background-color: rgba(0,0,0,0.3) !important; + } .menuButton-wrap { grid-column: 1; @@ -94,8 +98,7 @@ width: 100px; display: grid; grid-auto-columns: 80px 20px; - justify-items: flex-start; - padding-left: 10px; + justify-items: center; font-family: 'Roboto'; white-space: nowrap; text-overflow: ellipsis; @@ -113,14 +116,15 @@ height: fit-content; top: 100%; z-index: 21; - background-color: #e3e3e3; - box-shadow: 0px 3px 4px rgba(0, 0, 0, 0.3); - border-radius: 3px; + background-color: $white; + box-shadow: 0px 3px 4px rgba(0,0,0,0.3); + padding: 1px; .list-item { - color: black; + color: $black; width: 100%; height: 25px; + font-weight: 400; display: flex; justify-content: left; align-items: center; @@ -169,7 +173,8 @@ .menuButton-dropdown-header{ width: 100%; font-weight: 300; - overflow:hidden; + padding: 5px; + overflow: hidden; font-size: 12px; white-space: nowrap; text-overflow: ellipsis; diff --git a/src/client/views/nodes/button/FontIconBox.tsx b/src/client/views/nodes/button/FontIconBox.tsx index 9a54579dc..84ad03fa2 100644 --- a/src/client/views/nodes/button/FontIconBox.tsx +++ b/src/client/views/nodes/button/FontIconBox.tsx @@ -169,7 +169,7 @@ export class FontIconBox extends DocComponent(Fon return (
this.rootDoc.dropDownOpen = !this.rootDoc.dropDownOpen : undefined}>
{text && text[0].toUpperCase() + text.slice(1)} -- cgit v1.2.3-70-g09d2 From 0eede4546f2ddc862a42a43e0daa1fc02dfe6cae Mon Sep 17 00:00:00 2001 From: geireann <60007097+geireann@users.noreply.github.com> Date: Fri, 20 Aug 2021 13:05:04 -0400 Subject: more updates --- src/client/documents/Documents.ts | 3 ++- src/client/util/CurrentUserUtils.ts | 14 +++++++------- src/client/views/DocumentDecorations.scss | 6 +++++- src/client/views/collections/CollectionMenu.scss | 8 ++++---- src/client/views/collections/CollectionMenu.tsx | 19 +++++++++++-------- .../collectionLinearView/CollectionLinearView.scss | 13 +++++++------ .../collectionLinearView/CollectionLinearView.tsx | 16 +++++++++++----- src/client/views/global/globalCssVariables.scss | 9 +++++++-- src/client/views/global/globalEnums.tsx | 1 + src/client/views/nodes/button/FontIconBox.scss | 10 +++++----- src/client/views/topbar/TopBar.scss | 22 ++++++++++++---------- src/client/views/topbar/TopBar.tsx | 2 +- 12 files changed, 73 insertions(+), 50 deletions(-) (limited to 'src/client/util/CurrentUserUtils.ts') diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts index f6b2e0736..b7ba6f1fe 100644 --- a/src/client/documents/Documents.ts +++ b/src/client/documents/Documents.ts @@ -230,6 +230,8 @@ export class DocumentOptions { linearViewExpandable?: boolean; // can linear view be expanded linearViewToggleButton?: string; // button to open close linear view group linearViewSubMenu?: boolean; + flexGap?: number; // Linear view flex gap + flexDirection?: "unset" | "row" | "column" | "row-reverse" | "column-reverse"; layout_linkView?: Doc; // view template for a link document layout_keyValue?: string; // view tempalte for key value docs @@ -277,7 +279,6 @@ export class DocumentOptions { text?: string; textTransform?: string; // is linear view expanded letterSpacing?: string; // is linear view expanded - flexDirection?: "unset" | "row" | "column" | "row-reverse" | "column-reverse"; selectedIndex?: number; // which item in a linear view has been selected using the "thumb doc" ui clipboard?: Doc; searchQuery?: string; // for quersyBox diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts index 0440367de..0210b5a1d 100644 --- a/src/client/util/CurrentUserUtils.ts +++ b/src/client/util/CurrentUserUtils.ts @@ -892,10 +892,10 @@ export class CurrentUserUtils { CurrentUserUtils.setupUserDoc(doc); } - static blist = (opts: DocumentOptions, docs: Doc[]) => new PrefetchProxy(Docs.Create.LinearDocument(docs, { - ...opts, _gridGap: 5, _xMargin: 5, _yMargin: 5, _width: 100, boxShadow: "0 0", _forceActive: true, + static linearButtonList = (opts: DocumentOptions, docs: Doc[]) => new PrefetchProxy(Docs.Create.LinearDocument(docs, { + ...opts, _gridGap: 5, _xMargin: 5, _yMargin: 5, boxShadow: "0 0", _forceActive: true, dropConverter: ScriptField.MakeScript("convertToButtons(dragData)", { dragData: DragManager.DocumentDragData.name }), - _lockedPosition: true, linearViewIsExpanded: true, system: true + _lockedPosition: true, linearViewIsExpanded: true, system: true, flexDirection: "column" })) as any as Doc static ficon = (opts: DocumentOptions) => new PrefetchProxy(Docs.Create.FontIconDocument({ @@ -911,7 +911,7 @@ export class CurrentUserUtils { doc["dockedBtn-redo"] = CurrentUserUtils.ficon({ onClick: ScriptField.MakeScript("redo()"), dontUndo: true, _stayInCollection: true, _dropAction: "alias", _hideContextMenu: true, _removeDropProperties: new List(["dropAction", "_hideContextMenu", "stayInCollection"]), toolTip: "Click to redo", title: "redo", icon: "redo-alt", system: true }); } if (doc.dockedBtns === undefined) { - doc.dockedBtns = CurrentUserUtils.blist({ title: "docked buttons", linearViewExpandable: true, ignoreClick: true }, [doc["dockedBtn-undo"] as Doc, doc["dockedBtn-redo"] as Doc]); + doc.dockedBtns = CurrentUserUtils.linearButtonList({ title: "docked buttons", linearViewExpandable: true, ignoreClick: true }, [doc["dockedBtn-undo"] as Doc, doc["dockedBtn-redo"] as Doc]); } (doc["dockedBtn-undo"] as Doc).dontUndo = true; (doc["dockedBtn-redo"] as Doc).dontUndo = true; @@ -1013,7 +1013,7 @@ export class CurrentUserUtils { onClick: click ? ScriptField.MakeScript(click, { doc: Doc.name }) : undefined })); }); - docList.push(CurrentUserUtils.blist({ linearViewSubMenu: true, ignoreClick: true, linearViewExpandable: true, icon:title, _height: 30, backgroundColor: "transparent" }, textDocList)); + docList.push(CurrentUserUtils.linearButtonList({ linearViewSubMenu: true, flexGap: 5, ignoreClick: true, linearViewExpandable: true, icon:title, _height: 30, backgroundColor: "transparent" }, textDocList)); } else if (type === "InkMenu") { const inkBtns = (CurrentUserUtils.inkTools(doc)).map(({ title, toolTip, icon, btnType, click }) => { textDocList.push(Docs.Create.FontIconDocument({ @@ -1039,7 +1039,7 @@ export class CurrentUserUtils { onClick: click ? ScriptField.MakeScript(click, { doc: Doc.name }) : undefined })); }); - docList.push(CurrentUserUtils.blist({ linearViewSubMenu: true, ignoreClick: true, linearViewExpandable: true, icon:title, _height: 30, backgroundColor: "transparent" }, textDocList)); + docList.push(CurrentUserUtils.linearButtonList({ linearViewSubMenu: true, flexGap: 5, ignoreClick: true, linearViewExpandable: true, icon:title, _height: 30, backgroundColor: "transparent" }, textDocList)); } else { docList.push(Docs.Create.FontIconDocument({ _nativeWidth: width ? width : 25, @@ -1067,7 +1067,7 @@ export class CurrentUserUtils { }); if (doc.contextMenuBtns === undefined) { - doc.contextMenuBtns = CurrentUserUtils.blist({ title: "menu buttons", ignoreClick: true, linearViewExpandable: false, _height: 35 }, docList); + doc.contextMenuBtns = CurrentUserUtils.linearButtonList({ title: "menu buttons", flexGap: 0, ignoreClick: true, linearViewExpandable: false, _height: 35 }, docList); } } // sets up the default set of documents to be shown in the Overlay layer diff --git a/src/client/views/DocumentDecorations.scss b/src/client/views/DocumentDecorations.scss index 316f63240..d34efd01a 100644 --- a/src/client/views/DocumentDecorations.scss +++ b/src/client/views/DocumentDecorations.scss @@ -51,6 +51,7 @@ $linkGap : 3px; pointer-events: auto; background: $medium-gray; opacity: 0.1; + &:hover { opacity: 1; } @@ -94,6 +95,7 @@ $linkGap : 3px; position: absolute; } } + .documentDecorations-rotation { background: transparent; right: -15; @@ -189,6 +191,7 @@ $linkGap : 3px; margin-left: 5px; height: 22px; position: absolute; + .documentDecorations-titleSpan { width: 100%; border-radius: 8px; @@ -263,7 +266,7 @@ $linkGap : 3px; } .link-button-container { - border-radius: 10px; + border-radius: 13px; width: max-content; height: auto; display: flex; @@ -338,6 +341,7 @@ $linkGap : 3px; .documentdecorations-icon { margin: 0px; } + .templating-button, .docDecs-tagButton { width: 20px; diff --git a/src/client/views/collections/CollectionMenu.scss b/src/client/views/collections/CollectionMenu.scss index 163566d22..c35f088a6 100644 --- a/src/client/views/collections/CollectionMenu.scss +++ b/src/client/views/collections/CollectionMenu.scss @@ -14,8 +14,8 @@ .collectionMenu-hardCodedButton { cursor: pointer; color: $white; - width: 31.5px; - height: 90%; + width: 25px; + height: 25px; padding: 5; text-align: center; display: flex; @@ -23,10 +23,10 @@ align-items: center; position: relative; transition: 0.2s; + border-radius: 3px; &:hover { - border-radius:5px; - background-color: rgba(0,0,0,0.2); + background-color: rgba(0, 0, 0, 0.2); } } } diff --git a/src/client/views/collections/CollectionMenu.tsx b/src/client/views/collections/CollectionMenu.tsx index 1f36e94cf..77e5132fc 100644 --- a/src/client/views/collections/CollectionMenu.tsx +++ b/src/client/views/collections/CollectionMenu.tsx @@ -40,6 +40,7 @@ import { CollectionLinearView } from "./CollectionLinearView"; import "./CollectionMenu.scss"; import { CollectionViewType, COLLECTION_BORDER_WIDTH } from "./CollectionView"; import { TabDocView } from "./TabDocView"; +import { Colors } from "../global/globalEnums"; @observer export class CollectionMenu extends AntimodeMenu { @@ -135,7 +136,9 @@ export class CollectionMenu extends AntimodeMenu { const propTitle = CurrentUserUtils.propertiesWidth > 0 ? "Close Properties Panel" : "Open Properties Panel"; const prop = {propTitle}
} key="properties" placement="bottom"> -
0 ? Colors.MEDIUM_BLUE : undefined }} + key="properties" onPointerDown={this.toggleProperties}>
@@ -143,11 +146,11 @@ export class CollectionMenu extends AntimodeMenu { // NEW BUTTONS //dash col linear view buttons - const contMenuButtons = -
- {this.contMenuButtons} - {prop} -
; + const contMenuButtons = +
+ {this.contMenuButtons} + {prop} +
; return contMenuButtons; @@ -779,7 +782,7 @@ export class CollectionFreeFormViewChrome extends React.Component { SetActiveInkWidth(wid); this._widthBtn = false; this.editProperties(wid, "width"); })} style={{ backgroundColor: this._widthBtn ? "121212" : "", zIndex: 1001, fontSize: this._dotsize[i], padding: 0, textAlign: "center" }}> • - + )}
; } @@ -1050,7 +1053,7 @@ export class CollectionTreeViewChrome extends React.Component
Sort -
+
diff --git a/src/client/views/collections/collectionLinearView/CollectionLinearView.scss b/src/client/views/collections/collectionLinearView/CollectionLinearView.scss index 2b3f8f2c9..44752e034 100644 --- a/src/client/views/collections/collectionLinearView/CollectionLinearView.scss +++ b/src/client/views/collections/collectionLinearView/CollectionLinearView.scss @@ -5,12 +5,12 @@ overflow: visible; height: 100%; pointer-events: none; - + &.true { padding-left: 5px; padding-right: 5px; border-left: $standard-border; - background-color: #4476f73d; + background-color: $medium-blue-alt; } >input:not(:checked)~&.true { @@ -21,8 +21,9 @@ display: flex; height: 100%; align-items: center; + gap: 5px; - .collectionView{ + .collectionView { overflow: visible !important; } @@ -56,7 +57,7 @@ } .bottomPopup-descriptions { - cursor:pointer; + cursor: pointer; display: inline; white-space: nowrap; padding-left: 8px; @@ -69,7 +70,7 @@ } .bottomPopup-exit { - cursor:pointer; + cursor: pointer; display: inline; white-space: nowrap; margin-right: 10px; @@ -97,7 +98,7 @@ transition: transform 0.2s; align-items: center; justify-content: center; - transition:0.1s; + transition: 0.1s; &:hover { transform: scale(1.05); diff --git a/src/client/views/collections/collectionLinearView/CollectionLinearView.tsx b/src/client/views/collections/collectionLinearView/CollectionLinearView.tsx index 3327bef36..713d93f97 100644 --- a/src/client/views/collections/collectionLinearView/CollectionLinearView.tsx +++ b/src/client/views/collections/collectionLinearView/CollectionLinearView.tsx @@ -108,12 +108,13 @@ export class CollectionLinearView extends CollectionSubView(LinearDocument) { } render() { - const guid = Utils.GenerateGuid(); - const flexDir: any = StrCast(this.Document.flexDirection); - const expandable: boolean = BoolCast(this.props.Document.linearViewExpandable); + const guid = Utils.GenerateGuid(); // Generate a unique ID to use as the label + const flexDir: any = StrCast(this.Document.flexDirection); // Specify direction of linear view content + const flexGap: number = NumCast(this.Document.flexGap); // Specify the gap between linear view content + const expandable: boolean = BoolCast(this.props.Document.linearViewExpandable); // Specify whether it is expandable or not const backgroundColor = this.props.styleProvider?.(this.rootDoc, this.props, StyleProp.BackgroundColor); const color = this.props.styleProvider?.(this.rootDoc, this.props, StyleProp.Color); - const icon: string = StrCast(this.props.Document.icon); + const icon: string = StrCast(this.props.Document.icon); // Menu opener toggle const menuOpener =