From bd6b9c40f150fab76e8907c45e29fa809f9acae0 Mon Sep 17 00:00:00 2001
From: usodhi <61431818+usodhi@users.noreply.github.com>
Date: Fri, 2 Apr 2021 19:04:09 -0400
Subject: dashboard sharing initial setup, inherits acls from dashboard - looks
 like it works

---
 src/client/util/CurrentUserUtils.ts | 20 +++++++++++++++-----
 1 file changed, 15 insertions(+), 5 deletions(-)

(limited to 'src/client/util/CurrentUserUtils.ts')

diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts
index 849020392..f1357e3d7 100644
--- a/src/client/util/CurrentUserUtils.ts
+++ b/src/client/util/CurrentUserUtils.ts
@@ -35,6 +35,7 @@ import { UndoManager } from "./UndoManager";
 import { SnappingManager } from "./SnappingManager";
 import { InkTool } from "../../fields/InkField";
 import { computedFn } from "mobx-utils";
+import { SharingManager } from "./SharingManager";
 
 
 export let resolvedPorts: { server: number, socket: number };
@@ -907,9 +908,9 @@ export class CurrentUserUtils {
         if (doc.mySharedDocs === undefined) {
             let sharedDocs = Docs.newAccount ? undefined : await DocServer.GetRefField(sharingDocumentId + "outer");
             if (!sharedDocs) {
-                sharedDocs = Docs.Create.StackingDocument([], {
-                    title: "My SharedDocs", childDropAction: "alias", system: true, contentPointerEvents: "none", childLimitHeight: 0, _yMargin: 50, _gridGap: 15,
-                    _showTitle: "title", ignoreClick: true, _lockedPosition: true, "acl-Public": SharingPermissions.Add, "_acl-Public": SharingPermissions.Add, _chromeHidden: true,
+                sharedDocs = Docs.Create.TreeDocument([], {
+                    title: "My SharedDocs", childDropAction: "alias", system: true, contentPointerEvents: "all", childLimitHeight: 0, _yMargin: 50, _gridGap: 15,
+                    _showTitle: "title", ignoreClick: false, _lockedPosition: true, "acl-Public": SharingPermissions.Add, "_acl-Public": SharingPermissions.Add, _chromeHidden: true,
                 }, sharingDocumentId + "outer", sharingDocumentId);
                 (sharedDocs as Doc)["acl-Public"] = (sharedDocs as Doc)[DataSym]["acl-Public"] = SharingPermissions.Add;
             }
@@ -1188,8 +1189,10 @@ export class CurrentUserUtils {
         const toggleComic = ScriptField.MakeScript(`toggleComicMode()`);
         const snapshotDashboard = ScriptField.MakeScript(`snapshotDashboard()`);
         const createDashboard = ScriptField.MakeScript(`createNewDashboard()`);
-        dashboardDoc.contextMenuScripts = new List<ScriptField>([toggleTheme!, toggleComic!, snapshotDashboard!, createDashboard!]);
-        dashboardDoc.contextMenuLabels = new List<string>(["Toggle Theme Colors", "Toggle Comic Mode", "Snapshot Dashboard", "Create Dashboard"]);
+        const shareDashboard = ScriptField.MakeScript(`shareDashboard()`);
+        const addToDashboards = ScriptField.MakeScript(`addToDashboards(self)`);
+        dashboardDoc.contextMenuScripts = new List<ScriptField>([toggleTheme!, toggleComic!, snapshotDashboard!, createDashboard!, shareDashboard!, addToDashboards!]);
+        dashboardDoc.contextMenuLabels = new List<string>(["Toggle Theme Colors", "Toggle Comic Mode", "Snapshot Dashboard", "Create Dashboard", "Share Dashboard", "Add to Dashboards"]);
 
         Doc.AddDocToList(dashboards, "data", dashboardDoc);
         CurrentUserUtils.openDashboard(userDoc, dashboardDoc);
@@ -1241,3 +1244,10 @@ Scripting.addGlobal(function links(doc: any) { return new List(LinkManager.Insta
     "returns all the links to the document or its annotations", "(doc: any)");
 Scripting.addGlobal(function importDocument() { return CurrentUserUtils.importDocument(); },
     "imports files from device directly into the import sidebar");
+Scripting.addGlobal(function shareDashboard() {
+    CurrentUserUtils.ActiveDashboard.isShared = true;
+    SharingManager.Instance.open(undefined, CurrentUserUtils.ActiveDashboard);
+},
+    "opens sharing dialog for Dashboard");
+Scripting.addGlobal(function addToDashboards(dashboard: Doc) { Doc.AddDocToList(CurrentUserUtils.MyDashboards, "data", dashboard); },
+    "adds Dashboard to set of Dashboards");
\ No newline at end of file
-- 
cgit v1.2.3-70-g09d2


From d252d6dba8b789215ed8da5b66889a26b06a2a18 Mon Sep 17 00:00:00 2001
From: usodhi <61431818+usodhi@users.noreply.github.com>
Date: Sat, 3 Apr 2021 20:13:58 -0400
Subject: dashboard sharing works, aliases to go

---
 src/client/util/CurrentUserUtils.ts |  7 +++----
 src/client/util/SharingManager.tsx  | 24 +++++++++++++++++++++++-
 src/client/views/PropertiesView.tsx |  2 +-
 src/fields/Doc.ts                   |  2 +-
 4 files changed, 28 insertions(+), 7 deletions(-)

(limited to 'src/client/util/CurrentUserUtils.ts')

diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts
index f1357e3d7..fdceb60f3 100644
--- a/src/client/util/CurrentUserUtils.ts
+++ b/src/client/util/CurrentUserUtils.ts
@@ -1189,7 +1189,7 @@ export class CurrentUserUtils {
         const toggleComic = ScriptField.MakeScript(`toggleComicMode()`);
         const snapshotDashboard = ScriptField.MakeScript(`snapshotDashboard()`);
         const createDashboard = ScriptField.MakeScript(`createNewDashboard()`);
-        const shareDashboard = ScriptField.MakeScript(`shareDashboard()`);
+        const shareDashboard = ScriptField.MakeScript(`shareDashboard(self)`);
         const addToDashboards = ScriptField.MakeScript(`addToDashboards(self)`);
         dashboardDoc.contextMenuScripts = new List<ScriptField>([toggleTheme!, toggleComic!, snapshotDashboard!, createDashboard!, shareDashboard!, addToDashboards!]);
         dashboardDoc.contextMenuLabels = new List<string>(["Toggle Theme Colors", "Toggle Comic Mode", "Snapshot Dashboard", "Create Dashboard", "Share Dashboard", "Add to Dashboards"]);
@@ -1244,9 +1244,8 @@ Scripting.addGlobal(function links(doc: any) { return new List(LinkManager.Insta
     "returns all the links to the document or its annotations", "(doc: any)");
 Scripting.addGlobal(function importDocument() { return CurrentUserUtils.importDocument(); },
     "imports files from device directly into the import sidebar");
-Scripting.addGlobal(function shareDashboard() {
-    CurrentUserUtils.ActiveDashboard.isShared = true;
-    SharingManager.Instance.open(undefined, CurrentUserUtils.ActiveDashboard);
+Scripting.addGlobal(function shareDashboard(dashboard: Doc) {
+    SharingManager.Instance.open(undefined, dashboard);
 },
     "opens sharing dialog for Dashboard");
 Scripting.addGlobal(function addToDashboards(dashboard: Doc) { Doc.AddDocToList(CurrentUserUtils.MyDashboards, "data", dashboard); },
diff --git a/src/client/util/SharingManager.tsx b/src/client/util/SharingManager.tsx
index ded56d1da..ca14154b2 100644
--- a/src/client/util/SharingManager.tsx
+++ b/src/client/util/SharingManager.tsx
@@ -5,7 +5,7 @@ import { observer } from "mobx-react";
 import * as React from "react";
 import Select from "react-select";
 import * as RequestPromise from "request-promise";
-import { AclAddonly, AclAdmin, AclEdit, AclPrivate, AclReadonly, AclSym, DataSym, Doc, DocListCast, DocListCastAsync, Opt } from "../../fields/Doc";
+import { AclAddonly, AclAdmin, AclEdit, AclPrivate, AclReadonly, AclSym, AclUnset, DataSym, Doc, DocListCast, DocListCastAsync, Opt } from "../../fields/Doc";
 import { List } from "../../fields/List";
 import { Cast, StrCast } from "../../fields/Types";
 import { distributeAcls, GetEffectiveAcl, normalizeEmail, SharingPermissions, TraceMobx } from "../../fields/util";
@@ -17,6 +17,7 @@ import { MainViewModal } from "../views/MainViewModal";
 import { DocumentView } from "../views/nodes/DocumentView";
 import { TaskCompletionBox } from "../views/nodes/TaskCompletedBox";
 import { SearchBox } from "../views/search/SearchBox";
+import { CurrentUserUtils } from "./CurrentUserUtils";
 import { DocumentManager } from "./DocumentManager";
 import { GroupManager, UserOptions } from "./GroupManager";
 import { GroupMemberView } from "./GroupMemberView";
@@ -170,6 +171,7 @@ export class SharingManager extends React.Component<{}> {
             doc.author === Doc.CurrentUserEmail && !doc[myAcl] && distributeAcls(myAcl, SharingPermissions.Admin, doc);
             distributeAcls(acl, permission as SharingPermissions, doc);
 
+            this.setDashboardBackground(doc, permission as SharingPermissions);
             if (permission !== SharingPermissions.None) return Doc.AddDocToList(sharingDoc, storage, doc);
             else return GetEffectiveAcl(doc, user.email) === AclPrivate && Doc.RemoveDocFromList(sharingDoc, storage, (doc.aliasOf as Doc || doc));
         }).some(success => !success);
@@ -192,6 +194,7 @@ export class SharingManager extends React.Component<{}> {
         return !docs.map(doc => {
             doc.author === Doc.CurrentUserEmail && !doc[`acl-${Doc.CurrentUserEmailNormalized}`] && distributeAcls(`acl-${Doc.CurrentUserEmailNormalized}`, SharingPermissions.Admin, doc);
             distributeAcls(acl, permission as SharingPermissions, doc);
+            this.setDashboardBackground(doc, permission as SharingPermissions);
 
             if (group instanceof Doc) {
                 const members: string[] = JSON.parse(StrCast(group.members));
@@ -246,6 +249,25 @@ export class SharingManager extends React.Component<{}> {
         }
     }
 
+    /**
+     * Sets the background of the Dashboard if it has been shared as a visual indicator
+     */
+    setDashboardBackground = async (doc: Doc, permission: SharingPermissions) => {
+        if (Doc.IndexOf(doc, DocListCast(CurrentUserUtils.MyDashboards.data)) !== -1) {
+            if (permission !== SharingPermissions.None) {
+                doc.isShared = true;
+                doc.backgroundColor = "green";
+            }
+            else {
+                const acls = doc[DataSym][AclSym];
+                if (Object.keys(acls).every(key => key === `acl-${Doc.CurrentUserEmailNormalized}` ? true : [AclUnset, AclPrivate].includes(acls[key]))) {
+                    doc.isShared = undefined;
+                    doc.backgroundColor = undefined;
+                }
+            }
+        }
+    }
+
     /**
      * Removes the documents shared with a user through a group when the user is removed from the group.
      * @param group 
diff --git a/src/client/views/PropertiesView.tsx b/src/client/views/PropertiesView.tsx
index c8ce8bfeb..0fc6c75d0 100644
--- a/src/client/views/PropertiesView.tsx
+++ b/src/client/views/PropertiesView.tsx
@@ -400,7 +400,7 @@ export class PropertiesView extends React.Component<PropertiesViewProps> {
         const showAdmin = effectiveAcls.every(acl => acl === AclAdmin);
 
         // users in common between all docs
-        const commonKeys = intersection(...docs.map(doc => this.layoutDocAcls ? doc?.[AclSym] && Object.keys(doc[AclSym]) : doc?.[DataSym][AclSym] && Object.keys(doc[DataSym][AclSym])));
+        const commonKeys: string[] = intersection(...docs.map(doc => this.layoutDocAcls ? doc?.[AclSym] && Object.keys(doc[AclSym]) : doc?.[DataSym][AclSym] && Object.keys(doc[DataSym][AclSym])));
 
         const tableEntries = [];
 
diff --git a/src/fields/Doc.ts b/src/fields/Doc.ts
index b37c2fdfe..1719a6445 100644
--- a/src/fields/Doc.ts
+++ b/src/fields/Doc.ts
@@ -22,7 +22,7 @@ import { listSpec } from "./Schema";
 import { ComputedField, ScriptField } from "./ScriptField";
 import { Cast, FieldValue, NumCast, StrCast, ToConstructor } from "./Types";
 import { AudioField, ImageField, PdfField, VideoField, WebField } from "./URLField";
-import { deleteProperty, getField, getter, inheritParentAcls, makeEditable, makeReadOnly, normalizeEmail, setter, SharingPermissions, updateFunction } from "./util";
+import { deleteProperty, GetEffectiveAcl, getField, getter, inheritParentAcls, makeEditable, makeReadOnly, normalizeEmail, setter, SharingPermissions, updateFunction } from "./util";
 import JSZip = require("jszip");
 import { CurrentUserUtils } from "../client/util/CurrentUserUtils";
 
-- 
cgit v1.2.3-70-g09d2


From 95a42c92c9b4b2af8703afe85ece4e32975a3047 Mon Sep 17 00:00:00 2001
From: usodhi <61431818+usodhi@users.noreply.github.com>
Date: Tue, 13 Apr 2021 10:39:36 -0400
Subject: typos and minor changes

---
 src/client/DocServer.ts             | 2 +-
 src/client/util/CurrentUserUtils.ts | 1 -
 src/fields/Doc.ts                   | 4 ++--
 3 files changed, 3 insertions(+), 4 deletions(-)

(limited to 'src/client/util/CurrentUserUtils.ts')

diff --git a/src/client/DocServer.ts b/src/client/DocServer.ts
index 1d7497cf8..59278d2af 100644
--- a/src/client/DocServer.ts
+++ b/src/client/DocServer.ts
@@ -225,7 +225,7 @@ export namespace DocServer {
      * the server if the document has not been cached.
      * @param id the id of the requested document
      */
-    const _GetRefFieldImpl = (id: string, force: boolean = false): Promise<Opt<RefField>> => {
+    const _GetRefFieldImpl = async (id: string, force: boolean = false): Promise<Opt<RefField>> => {
         // an initial pass through the cache to determine whether the document needs to be fetched,
         // is already in the process of being fetched or already exists in the
         // cache
diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts
index b7c2d60d8..86f563b7e 100644
--- a/src/client/util/CurrentUserUtils.ts
+++ b/src/client/util/CurrentUserUtils.ts
@@ -516,7 +516,6 @@ export class CurrentUserUtils {
             { title: "Import", target: Cast(doc.myImportPanel, Doc, null), icon: "upload", click: 'selectMainMenu(self)' },
             { title: "Recently Closed", target: Cast(doc.myRecentlyClosedDocs, Doc, null), icon: "archive", click: 'selectMainMenu(self)' },
             { title: "Sharing", target: Cast(doc.mySharedDocs, Doc, null), icon: "users", click: 'selectMainMenu(self)', watchedDocuments: doc.mySharedDocs as Doc },
-            // { title: "Filter", target: Cast(doc.currentFilter, Doc, null), icon: "filter", click: 'selectMainMenu(self)' },
             { title: "Pres. Trails", target: Cast(doc.myPresentations, Doc, null), icon: "pres-trail", click: 'selectMainMenu(self)' },
             { title: "Help", target: undefined as any, icon: "question-circle", click: 'selectMainMenu(self)' },
             { title: "Settings", target: undefined as any, icon: "cog", click: 'selectMainMenu(self)' },
diff --git a/src/fields/Doc.ts b/src/fields/Doc.ts
index 30e8b60bd..478334038 100644
--- a/src/fields/Doc.ts
+++ b/src/fields/Doc.ts
@@ -539,7 +539,7 @@ export namespace Doc {
                     const clones = await Promise.all(docs.map(async d => Doc.makeClone(d, cloneMap, rtfs, exclusions, dontCreate, asBranch)));
                     !dontCreate && assignKey(new List<Doc>(clones));
                 } else if (doc[key] instanceof Doc) {
-                    assignKey(key.includes("layout[") ? undefined : key.startsWith("layout") ? doc[key] as Doc : await Doc.makeClone(doc[key] as Doc, cloneMap, rtfs, exclusions, dontCreate, asBranch)); // reference documents except copy documents that are expanded teplate fields 
+                    assignKey(key.includes("layout[") ? undefined : key.startsWith("layout") ? doc[key] as Doc : await Doc.makeClone(doc[key] as Doc, cloneMap, rtfs, exclusions, dontCreate, asBranch)); // reference documents except copy documents that are expanded template fields 
                 } else {
                     !dontCreate && assignKey(ObjectField.MakeCopy(field));
                     if (field instanceof RichTextField) {
@@ -562,7 +562,7 @@ export namespace Doc {
                 } else if (field instanceof ObjectField) {
                     await copyObjectField(field);
                 } else if (field instanceof Promise) {
-                    debugger; //This shouldn't happend...
+                    debugger; //This shouldn't happen...
                 } else {
                     assignKey(field);
                 }
-- 
cgit v1.2.3-70-g09d2


From 2e76877dc1c9c5b1c226f5bd0394d17cabfec0b4 Mon Sep 17 00:00:00 2001
From: usodhi <61431818+usodhi@users.noreply.github.com>
Date: Mon, 17 May 2021 18:01:44 -0400
Subject: trying dynamic off screen docs

---
 src/client/documents/Documents.ts                  | 20 ++++++++--
 src/client/util/CurrentUserUtils.ts                | 33 ++++++++++++++---
 src/client/util/SharingManager.tsx                 | 40 ++++++++++++--------
 .../views/collections/CollectionDockingView.tsx    | 43 ++++++++++++++--------
 src/client/views/collections/TreeView.tsx          |  9 ++++-
 src/fields/util.ts                                 | 18 +++++----
 6 files changed, 115 insertions(+), 48 deletions(-)

(limited to 'src/client/util/CurrentUserUtils.ts')

diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts
index 1e2919bad..906603d78 100644
--- a/src/client/documents/Documents.ts
+++ b/src/client/documents/Documents.ts
@@ -648,8 +648,9 @@ export namespace Docs {
          * constructor just generates a new GUID. This is currently used
          * only when creating a DockDocument from the current user's already existing
          * main document.
+         * @param layoutData whether the fieldKey field on the layout doc should store the data or the data doc
          */
-        function InstanceFromProto(proto: Doc, data: Field | undefined, options: DocumentOptions, delegId?: string, fieldKey: string = "data", protoId?: string) {
+        function InstanceFromProto(proto: Doc, data: Field | undefined, options: DocumentOptions, delegId?: string, fieldKey: string = "data", protoId?: string, layoutData?: boolean) {
             const viewKeys = ["x", "y", "system"]; // keys that should be addded to the view document even though they don't begin with an "_"
             const { omit: dataProps, extract: viewProps } = OmitKeys(options, viewKeys, "^_");
 
@@ -660,7 +661,17 @@ export namespace Docs {
             dataProps[`${fieldKey}-lastModified`] = new DateField;
             dataProps["acl-Override"] = "None";
             dataProps["acl-Public"] = Doc.UserDoc()?.defaultAclPrivate ? SharingPermissions.None : SharingPermissions.Add;
-            dataProps[fieldKey] = data;
+
+            if (layoutData) {
+                viewProps[fieldKey] = data;
+                const list = new List<Doc>();
+                console.log(DocListCast(data));
+                DocListCast(data).forEach(doc => {
+                    list.push(...DocListCast(doc.data));
+                });
+                dataProps[fieldKey + "-all"] = list;
+            }
+            else dataProps[fieldKey] = data;
             // so that the list of annotations is already initialised, prevents issues in addonly.
             // without this, if a doc has no annotations but the user has AddOnly privileges, they won't be able to add an annotation because they would have needed to create the field's list which they don't have permissions to do.
             dataProps[fieldKey + "-annotations"] = new List<Doc>();
@@ -891,7 +902,7 @@ export namespace Docs {
         export function DockDocument(documents: Array<Doc>, config: string, options: DocumentOptions, id?: string) {
             const tabs = TreeDocument(documents, { title: "On-Screen Tabs", childDontRegisterViews: true, freezeChildren: "remove|add", treeViewExpandedViewLock: true, treeViewExpandedView: "data", _fitWidth: true, system: true });
             const all = TreeDocument([], { title: "Off-Screen Tabs", childDontRegisterViews: true, freezeChildren: "add", treeViewExpandedViewLock: true, treeViewExpandedView: "data", system: true });
-            return InstanceFromProto(Prototypes.get(DocumentType.COL), new List([tabs, all]), { freezeChildren: "remove|add", treeViewExpandedViewLock: true, treeViewExpandedView: "data", ...options, _viewType: CollectionViewType.Docking, dockingConfig: config }, id);
+            return InstanceFromProto(Prototypes.get(DocumentType.COL), new List([tabs, all]), { freezeChildren: "remove|add", treeViewExpandedViewLock: true, treeViewExpandedView: "data", ...options, _viewType: CollectionViewType.Docking, dockingConfig: config }, id, undefined, undefined, true);
         }
 
         export function DirectoryImportDocument(options: DocumentOptions = {}) {
@@ -1426,4 +1437,7 @@ Scripting.addGlobal(function generateLinkTitle(self: Doc) {
     const anchor2title = self.anchor2 && self.anchor2 !== self ? Cast(self.anchor2, Doc, null).title : "<?>";
     const relation = self.linkRelationship || "to";
     return `${anchor1title} (${relation}) ${anchor2title}`;
+});
+Scripting.addGlobal(function openTabAlias(tab: Doc) {
+    CollectionDockingView.AddSplit(Doc.MakeAlias(tab), "right");
 });
\ No newline at end of file
diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts
index 5dbded00e..6fdf649a4 100644
--- a/src/client/util/CurrentUserUtils.ts
+++ b/src/client/util/CurrentUserUtils.ts
@@ -750,7 +750,7 @@ export class CurrentUserUtils {
                 title: "My Dashboards", _height: 400, childHideLinkButton: true,
                 treeViewHideTitle: true, _xMargin: 5, _yMargin: 5, _gridGap: 5, _forceActive: true, childDropAction: "alias",
                 treeViewTruncateTitleWidth: 150, ignoreClick: true,
-                _lockedPosition: true, boxShadow: "0 0", childDontRegisterViews: true, targetDropAction: "same", system: true
+                _lockedPosition: true, boxShadow: "0 0", childDontRegisterViews: true, targetDropAction: "same", treeViewType: "fileSystem", isFolder: true, system: true
             }));
             const newDashboard = ScriptField.MakeScript(`createNewDashboard(Doc.UserDoc())`);
             (doc.myDashboards as any as Doc).contextMenuScripts = new List<ScriptField>([newDashboard!]);
@@ -851,7 +851,6 @@ export class CurrentUserUtils {
         CurrentUserUtils.setupPresentations(doc);
         CurrentUserUtils.setupFilesystem(doc);
         CurrentUserUtils.setupRecentlyClosedDocs(doc);
-        // CurrentUserUtils.setupFilterDocs(doc);
         CurrentUserUtils.setupUserDoc(doc);
     }
 
@@ -1186,7 +1185,11 @@ export class CurrentUserUtils {
             title: `Untitled Tab ${NumCast(emptyPane["dragFactory-count"])}`,
         };
         const freeformDoc = CurrentUserUtils.GuestTarget || Docs.Create.FreeformDocument([], freeformOptions);
-        const dashboardDoc = Docs.Create.StandardCollectionDockingDocument([{ doc: freeformDoc, initialWidth: 600 }], { title: `Dashboard ${dashboardCount}` }, id, "row");
+        const dashboardDoc = Docs.Create.StandardCollectionDockingDocument([{ doc: freeformDoc, initialWidth: 600 }], { title: `Dashboard ${dashboardCount}` }, id, "row"); // add isFolder:true here?
+        freeformDoc.context = dashboardDoc;
+
+        DocListCast(dashboardDoc.data)[1].data = ComputedField.MakeFunction(`dynamicOffScreenDocs(dashboardDoc)`, { dashboardDoc: Doc.name }, { dashboardDoc }) as any;
+
         Doc.AddDocToList(myPresentations, "data", presentation);
         userDoc.activePresentation = presentation;
         const toggleTheme = ScriptField.MakeScript(`self.darkScheme = !self.darkScheme`);
@@ -1252,7 +1255,25 @@ Scripting.addGlobal(function shareDashboard(dashboard: Doc) {
     SharingManager.Instance.open(undefined, dashboard);
 },
     "opens sharing dialog for Dashboard");
-Scripting.addGlobal(function addToDashboards(dashboard: Doc) { Doc.AddDocToList(CurrentUserUtils.MyDashboards, "data", dashboard); },
+Scripting.addGlobal(function addToDashboards(dashboard: Doc) {
+    const dashboardAlias = Doc.MakeAlias(dashboard);
+    dashboardAlias.data = new List<Doc>(DocListCast(dashboard.data).map(tabFolder => Doc.MakeAlias(tabFolder)));
+    // DocListCast(dashboardAlias.data).forEach(tabFolder => {
+    //     tabFolder.data = new List<Doc>(DocListCast(tabFolder.data).map(tab => Doc.MakeAlias(tab)));
+    // });
+    Doc.AddDocToList(CurrentUserUtils.MyDashboards, "data", dashboardAlias);
+    CurrentUserUtils.openDashboard(Doc.UserDoc(), dashboardAlias);
+},
     "adds Dashboard to set of Dashboards");
-Scripting.addGlobal(function toggleComicMode() { Doc.UserDoc().renderStyle = Doc.UserDoc().renderStyle === "comic" ? undefined : "comic"; },
-    "toggle between regular rendeing and an informal sketch/comic style");
+
+Scripting.addGlobal(function dynamicOffScreenDocs(dashboard: Doc) {
+    const allDocs = DocListCast(dashboard[DataSym]["data-all"]);
+    console.log(allDocs);
+    const onScreenTab = DocListCast(dashboard.data)[0];
+    const onScreenDocs = DocListCast(onScreenTab.data);
+    return allDocs.reduce((result: Doc[], doc) => {
+        !onScreenDocs.includes(doc) && (result.push(doc));
+        // console.log(doc);
+        return result;
+    }, []);
+});
diff --git a/src/client/util/SharingManager.tsx b/src/client/util/SharingManager.tsx
index 2f8ecd4ee..18f254cd6 100644
--- a/src/client/util/SharingManager.tsx
+++ b/src/client/util/SharingManager.tsx
@@ -173,10 +173,14 @@ export class SharingManager extends React.Component<{}> {
         const target = targetDoc || this.targetDoc!;
         const acl = `acl-${normalizeEmail(user.email)}`;
         const myAcl = `acl-${Doc.CurrentUserEmailNormalized}`;
+        console.log(DocListCast(CurrentUserUtils.MyDashboards.data));
+        console.log(target);
+        console.log(DocListCast(CurrentUserUtils.MyDashboards.data).indexOf(target));
+        const isDashboard = DocListCast(CurrentUserUtils.MyDashboards.data).indexOf(target) !== -1;
 
         const docs = SelectionManager.Views().length < 2 ? [target] : SelectionManager.Views().map(docView => docView.props.Document);
         return !docs.map(doc => {
-            doc.author === Doc.CurrentUserEmail && !doc[myAcl] && distributeAcls(myAcl, SharingPermissions.Admin, doc);
+            doc.author === Doc.CurrentUserEmail && !doc[myAcl] && distributeAcls(myAcl, SharingPermissions.Admin, doc, undefined, undefined, isDashboard);
 
             if (permission === SharingPermissions.None) {
                 if (doc[acl] && doc[acl] !== SharingPermissions.None) doc.numUsersShared = NumCast(doc.numUsersShared, 1) - 1;
@@ -185,7 +189,7 @@ export class SharingManager extends React.Component<{}> {
                 if (!doc[acl] || doc[acl] === SharingPermissions.None) doc.numUsersShared = NumCast(doc.numUsersShared, 0) + 1;
             }
 
-            distributeAcls(acl, permission as SharingPermissions, doc);
+            distributeAcls(acl, permission as SharingPermissions, doc, undefined, undefined, isDashboard);
 
             this.setDashboardBackground(doc, permission as SharingPermissions);
             if (permission !== SharingPermissions.None) return Doc.AddDocToList(sharingDoc, storage, doc);
@@ -203,12 +207,13 @@ export class SharingManager extends React.Component<{}> {
         const target = targetDoc || this.targetDoc!;
         const key = normalizeEmail(StrCast(group.title));
         const acl = `acl-${key}`;
+        const isDashboard = DocListCast(CurrentUserUtils.MyDashboards.data).indexOf(target) !== -1;
 
         const docs = SelectionManager.Views().length < 2 ? [target] : SelectionManager.Views().map(docView => docView.props.Document);
 
         // ! ensures it returns true if document has been shared successfully, false otherwise
         return !docs.map(doc => {
-            doc.author === Doc.CurrentUserEmail && !doc[`acl-${Doc.CurrentUserEmailNormalized}`] && distributeAcls(`acl-${Doc.CurrentUserEmailNormalized}`, SharingPermissions.Admin, doc);
+            doc.author === Doc.CurrentUserEmail && !doc[`acl-${Doc.CurrentUserEmailNormalized}`] && distributeAcls(`acl-${Doc.CurrentUserEmailNormalized}`, SharingPermissions.Admin, doc, undefined, undefined, isDashboard);
 
             if (permission === SharingPermissions.None) {
                 if (doc[acl] && doc[acl] !== SharingPermissions.None) doc.numGroupsShared = NumCast(doc.numGroupsShared, 1) - 1;
@@ -217,7 +222,7 @@ export class SharingManager extends React.Component<{}> {
                 if (!doc[acl] || doc[acl] === SharingPermissions.None) doc.numGroupsShared = NumCast(doc.numGroupsShared, 0) + 1;
             }
 
-            distributeAcls(acl, permission as SharingPermissions, doc);
+            distributeAcls(acl, permission as SharingPermissions, doc, undefined, undefined, isDashboard);
             this.setDashboardBackground(doc, permission as SharingPermissions);
 
             if (group instanceof Doc) {
@@ -267,8 +272,10 @@ export class SharingManager extends React.Component<{}> {
             });
         }
         else {
+            const dashboards = DocListCast(CurrentUserUtils.MyDashboards.data);
             docs.forEach(doc => {
-                if (GetEffectiveAcl(doc) === AclAdmin) distributeAcls(`acl-${shareWith}`, permission, doc);
+                const isDashboard = dashboards.indexOf(doc) !== -1;
+                if (GetEffectiveAcl(doc) === AclAdmin) distributeAcls(`acl-${shareWith}`, permission, doc, undefined, undefined, isDashboard);
             });
         }
     }
@@ -316,10 +323,11 @@ export class SharingManager extends React.Component<{}> {
      */
     removeGroup = (group: Doc) => {
         if (group.docsShared) {
+            const dashboards = DocListCast(CurrentUserUtils.MyDashboards.data);
             DocListCast(group.docsShared).forEach(doc => {
                 const acl = `acl-${StrCast(group.title)}`;
-
-                distributeAcls(acl, SharingPermissions.None, doc);
+                const isDashboard = dashboards.indexOf(doc) !== -1;
+                distributeAcls(acl, SharingPermissions.None, doc, undefined, undefined, isDashboard);
 
                 const members: string[] = JSON.parse(StrCast(group.members));
                 const users: ValidatedUser[] = this.users.filter(({ user: { email } }) => members.includes(email));
@@ -445,16 +453,16 @@ export class SharingManager extends React.Component<{}> {
         }
     }
 
-    distributeOverCollection = (targetDoc?: Doc) => {
-        const target = targetDoc || this.targetDoc!;
+    // distributeOverCollection = (targetDoc?: Doc) => {
+    //     const target = targetDoc || this.targetDoc!;
 
-        const docs = SelectionManager.Views().length < 2 ? [target] : SelectionManager.Views().map(docView => docView.props.Document);
-        docs.forEach(doc => {
-            for (const [key, value] of Object.entries(doc[AclSym])) {
-                distributeAcls(key, this.AclMap.get(value)! as SharingPermissions, target);
-            }
-        });
-    }
+    //     const docs = SelectionManager.Views().length < 2 ? [target] : SelectionManager.Views().map(docView => docView.props.Document);
+    //     docs.forEach(doc => {
+    //         for (const [key, value] of Object.entries(doc[AclSym])) {
+    //             distributeAcls(key, this.AclMap.get(value)! as SharingPermissions, target);
+    //         }
+    //     });
+    // }
 
     /**
      * Sorting algorithm to sort users.
diff --git a/src/client/views/collections/CollectionDockingView.tsx b/src/client/views/collections/CollectionDockingView.tsx
index 388f9a909..819667834 100644
--- a/src/client/views/collections/CollectionDockingView.tsx
+++ b/src/client/views/collections/CollectionDockingView.tsx
@@ -4,7 +4,7 @@ import { action, IReactionDisposer, observable, reaction, runInAction } from "mo
 import { observer } from "mobx-react";
 import * as ReactDOM from 'react-dom';
 import * as GoldenLayout from "../../../client/goldenLayout";
-import { Doc, DocListCast, Opt, DocListCastAsync } from "../../../fields/Doc";
+import { Doc, DocListCast, Opt, DocListCastAsync, DataSym } from "../../../fields/Doc";
 import { Id } from '../../../fields/FieldSymbols';
 import { InkTool } from '../../../fields/InkField';
 import { List } from '../../../fields/List';
@@ -24,6 +24,7 @@ import React = require("react");
 import { DocumentType } from '../../documents/DocumentTypes';
 import { listSpec } from '../../../fields/Schema';
 import { LightboxView } from '../LightboxView';
+import { inheritParentAcls } from '../../../fields/util';
 const _global = (window /* browser */ || global /* node */) as any;
 
 @observer
@@ -160,6 +161,7 @@ export class CollectionDockingView extends CollectionSubView(doc => doc) {
         }
         const instance = CollectionDockingView.Instance;
         if (!instance) return false;
+        else Doc.AddDocToList(instance.props.Document[DataSym], "data-all", document);
         const docContentConfig = CollectionDockingView.makeDocumentConfig(document, panelName);
 
         if (!pullSide && stack) {
@@ -381,15 +383,22 @@ export class CollectionDockingView extends CollectionSubView(doc => doc) {
         setTimeout(async () => {
             const sublists = await DocListCastAsync(this.props.Document[this.props.fieldKey]);
             const tabs = sublists && Cast(sublists[0], Doc, null);
-            const other = sublists && Cast(sublists[1], Doc, null);
+            // const other = sublists && Cast(sublists[1], Doc, null);
             const tabdocs = await DocListCastAsync(tabs?.data);
-            const otherdocs = await DocListCastAsync(other?.data);
-            tabs && (Doc.GetProto(tabs).data = new List<Doc>(docs));
-            const otherSet = new Set<Doc>();
-            otherdocs?.filter(doc => !docs.includes(doc)).forEach(doc => otherSet.add(doc));
-            tabdocs?.filter(doc => !docs.includes(doc) && doc.type !== DocumentType.KVP).forEach(doc => otherSet.add(doc));
-            const vals = Array.from(otherSet.values()).filter(val => val instanceof Doc).map(d => d).filter(d => d.type !== DocumentType.KVP);
-            other && (Doc.GetProto(other).data = new List<Doc>(vals));
+            // const otherdocs = await DocListCastAsync(other?.data);
+            if (tabs) {
+                tabs.data = new List<Doc>(docs);
+                // DocListCast(tabs.aliases).forEach(tab => tab !== tabs && (tab.data = new List<Doc>(docs)));
+            }
+            // const otherSet = new Set<Doc>();
+            // otherdocs?.filter(doc => !docs.includes(doc)).forEach(doc => otherSet.add(doc));
+            // tabdocs?.filter(doc => !docs.includes(doc) && doc.type !== DocumentType.KVP).forEach(doc => otherSet.add(doc));
+            // const vals = Array.from(otherSet.values()).filter(val => val instanceof Doc).map(d => d).filter(d => d.type !== DocumentType.KVP);
+            // this.props.Document[DataSym][this.props.fieldKey + "-all"] = new List<Doc>([...docs, ...vals]);
+            // if (other) {
+            //     other.data = new List<Doc>(vals);
+            //     // DocListCast(other.aliases).forEach(tab => tab !== other && (tab.data = new List<Doc>(vals)));
+            // }
         }, 0);
     }
 
@@ -399,7 +408,7 @@ export class CollectionDockingView extends CollectionSubView(doc => doc) {
         tab.reactComponents?.forEach((ele: any) => ReactDOM.unmountComponentAtNode(ele));
     }
     tabCreated = (tab: any) => {
-        tab.contentItem.element[0]?.firstChild?.firstChild?.InitTab?.(tab);  // have to explicitly initialize tabs that reuse contents from previous abs (ie, when dragging a tab around a new tab is created for the old content)
+        tab.contentItem.element[0]?.firstChild?.firstChild?.InitTab?.(tab);  // have to explicitly initialize tabs that reuse contents from previous tabs (ie, when dragging a tab around a new tab is created for the old content)
     }
 
     stackCreated = (stack: any) => {
@@ -407,9 +416,11 @@ export class CollectionDockingView extends CollectionSubView(doc => doc) {
             if (e.target === stack.header?.element[0] && e.button === 2) {
                 const emptyPane = CurrentUserUtils.EmptyPane;
                 emptyPane["dragFactory-count"] = NumCast(emptyPane["dragFactory-count"]) + 1;
-                CollectionDockingView.AddSplit(Docs.Create.FreeformDocument([], {
-                    _width: this.props.PanelWidth(), _height: this.props.PanelHeight(), _fitWidth: true, title: `Untitled Tab ${NumCast(emptyPane["dragFactory-count"])}`
-                }), "", stack);
+                const docToAdd = Docs.Create.FreeformDocument([], {
+                    _width: this.props.PanelWidth(), _height: this.props.PanelHeight(), _fitWidth: true, title: `Untitled Tab ${NumCast(emptyPane["dragFactory-count"])}`,
+                });
+                this.props.Document.isShared && inheritParentAcls(this.props.Document, docToAdd);
+                CollectionDockingView.AddSplit(docToAdd, "", stack);
             }
         });
 
@@ -430,9 +441,11 @@ export class CollectionDockingView extends CollectionSubView(doc => doc) {
                 // stack.config.fixed = !stack.config.fixed;  // force the stack to have a fixed size
                 const emptyPane = CurrentUserUtils.EmptyPane;
                 emptyPane["dragFactory-count"] = NumCast(emptyPane["dragFactory-count"]) + 1;
-                CollectionDockingView.AddSplit(Docs.Create.FreeformDocument([], {
+                const docToAdd = Docs.Create.FreeformDocument([], {
                     _width: this.props.PanelWidth(), _height: this.props.PanelHeight(), _fitWidth: true, title: `Untitled Tab ${NumCast(emptyPane["dragFactory-count"])}`
-                }), "", stack);
+                });
+                this.props.Document.isShared && inheritParentAcls(this.props.Document, docToAdd);
+                CollectionDockingView.AddSplit(docToAdd, "", stack);
             }));
     }
 
diff --git a/src/client/views/collections/TreeView.tsx b/src/client/views/collections/TreeView.tsx
index 2e98fb508..ba4af2a6d 100644
--- a/src/client/views/collections/TreeView.tsx
+++ b/src/client/views/collections/TreeView.tsx
@@ -151,7 +151,10 @@ export class TreeView extends React.Component<TreeViewProps> {
             this.treeViewOpen = !this.treeViewOpen;
         } else {
             // choose an appropriate alias or make one. --- choose the first alias that (1) user owns,  (2) has no context field ... otherwise make a new alias
+            // this.props.addDocTab(CurrentUserUtils.ActiveDashboard.isShared ? Doc.MakeAlias(this.props.document) : this.props.document, "add:right");
+            // choose an appropriate alias or make one -- -- choose the first alias that (1) the user owns, (2) has no context field - if I own it and someone else does not have it open,, otherwise create an alias
             this.props.addDocTab(this.props.document, "add:right");
+
         }
     }
     constructor(props: any) {
@@ -507,7 +510,11 @@ export class TreeView extends React.Component<TreeViewProps> {
                     [{ script: ScriptField.MakeFunction(`DocFocusOrOpen(self)`)!, label: "Focus or Open" }];
     }
     onChildClick = () => this.props.onChildClick?.() ?? (this._editTitleScript?.() || ScriptCast(this.doc.treeChildClick));
-    onChildDoubleClick = () => (!this.props.treeView.outlineMode && this._openScript?.()) || ScriptCast(this.doc.treeChildDoubleClick);
+
+    onChildDoubleClick = () => {
+        console.log(this.props.document.onChildDoubleClick);
+        return (!this.props.treeView.outlineMode && this._openScript?.()) || ScriptCast(this.doc.treeChildDoubleClick)
+    };
 
     refocus = () => this.props.treeView.props.focus(this.props.treeView.props.Document);
     ignoreEvent = (e: any) => {
diff --git a/src/fields/util.ts b/src/fields/util.ts
index a4c99928a..882c7fee8 100644
--- a/src/fields/util.ts
+++ b/src/fields/util.ts
@@ -136,11 +136,9 @@ export function denormalizeEmail(email: string) {
  * Copies parent's acl fields to the child
  */
 export function inheritParentAcls(parent: Doc, child: Doc) {
-    if (parent.isShared) {
-        const dataDoc = parent[DataSym];
-        for (const key of Object.keys(dataDoc)) {
-            key.startsWith("acl") && distributeAcls(key, dataDoc[key], child);
-        }
+    const dataDoc = parent[DataSym];
+    for (const key of Object.keys(dataDoc)) {
+        key.startsWith("acl") && distributeAcls(key, dataDoc[key], child);
     }
 }
 
@@ -228,7 +226,7 @@ function getEffectiveAcl(target: any, user?: string): symbol {
  * @param inheritingFromCollection whether the target is being assigned rights after being dragged into a collection (and so is inheriting the acls from the collection)
  * inheritingFromCollection is not currently being used but could be used if acl assignment defaults change
  */
-export function distributeAcls(key: string, acl: SharingPermissions, target: Doc, inheritingFromCollection?: boolean, visited?: Doc[]) {
+export function distributeAcls(key: string, acl: SharingPermissions, target: Doc, inheritingFromCollection?: boolean, visited?: Doc[], isDashboard?: boolean) {
     if (!visited) visited = [] as Doc[];
     if (visited.includes(target)) return;
     visited.push(target);
@@ -249,6 +247,12 @@ export function distributeAcls(key: string, acl: SharingPermissions, target: Doc
     if (GetEffectiveAcl(target) === AclAdmin && (!inheritingFromCollection || !target[key] || HierarchyMapping.get(StrCast(target[key]))! > HierarchyMapping.get(acl)!)) {
         target[key] = acl;
         layoutDocChanged = true;
+
+        if (isDashboard) {
+            DocListCast(target[Doc.LayoutFieldKey(target)]).forEach(d => {
+                distributeAcls(key, acl, d, inheritingFromCollection, visited);
+            });
+        }
     }
 
     if (dataDoc && (!inheritingFromCollection || !dataDoc[key] || HierarchyMapping.get(StrCast(dataDoc[key]))! > HierarchyMapping.get(acl)!)) {
@@ -263,7 +267,7 @@ export function distributeAcls(key: string, acl: SharingPermissions, target: Doc
         links.forEach(link => distributeAcls(key, acl, link, inheritingFromCollection, visited));
 
         // maps over the children of the document
-        DocListCast(dataDoc[Doc.LayoutFieldKey(dataDoc)]).map(d => {
+        DocListCast(dataDoc[Doc.LayoutFieldKey(dataDoc) + (isDashboard ? "-all" : "")]).map(d => { // this is now on the layoutdoc instead - figure out the "data-all" approach for the datadoc
             // if (GetEffectiveAcl(d) === AclAdmin && (!inheritingFromCollection || !d[key] || HierarchyMapping.get(StrCast(d[key]))! > HierarchyMapping.get(acl)!)) {
             distributeAcls(key, acl, d, inheritingFromCollection, visited);
             // }
-- 
cgit v1.2.3-70-g09d2


From 7c18243dd38656b63334f48d9270d912ce6384fa Mon Sep 17 00:00:00 2001
From: bobzel <zzzman@gmail.com>
Date: Mon, 17 May 2021 18:45:01 -0400
Subject: fixes for offscreen tabs

---
 src/client/util/CurrentUserUtils.ts | 25 ++++++++++++++-----------
 1 file changed, 14 insertions(+), 11 deletions(-)

(limited to 'src/client/util/CurrentUserUtils.ts')

diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts
index 6fdf649a4..a8327ae93 100644
--- a/src/client/util/CurrentUserUtils.ts
+++ b/src/client/util/CurrentUserUtils.ts
@@ -1187,8 +1187,8 @@ export class CurrentUserUtils {
         const freeformDoc = CurrentUserUtils.GuestTarget || Docs.Create.FreeformDocument([], freeformOptions);
         const dashboardDoc = Docs.Create.StandardCollectionDockingDocument([{ doc: freeformDoc, initialWidth: 600 }], { title: `Dashboard ${dashboardCount}` }, id, "row"); // add isFolder:true here?
         freeformDoc.context = dashboardDoc;
-
-        DocListCast(dashboardDoc.data)[1].data = ComputedField.MakeFunction(`dynamicOffScreenDocs(dashboardDoc)`, { dashboardDoc: Doc.name }, { dashboardDoc }) as any;
+        DocListCast(dashboardDoc.data).forEach(doc => doc.dashboard = dashboardDoc);
+        DocListCast(dashboardDoc.data)[1].data = ComputedField.MakeFunction(`dynamicOffScreenDocs(self.dashboard)`) as any;
 
         Doc.AddDocToList(myPresentations, "data", presentation);
         userDoc.activePresentation = presentation;
@@ -1267,13 +1267,16 @@ Scripting.addGlobal(function addToDashboards(dashboard: Doc) {
     "adds Dashboard to set of Dashboards");
 
 Scripting.addGlobal(function dynamicOffScreenDocs(dashboard: Doc) {
-    const allDocs = DocListCast(dashboard[DataSym]["data-all"]);
-    console.log(allDocs);
-    const onScreenTab = DocListCast(dashboard.data)[0];
-    const onScreenDocs = DocListCast(onScreenTab.data);
-    return allDocs.reduce((result: Doc[], doc) => {
-        !onScreenDocs.includes(doc) && (result.push(doc));
-        // console.log(doc);
-        return result;
-    }, []);
+    if (dashboard[DataSym] instanceof Doc) {
+        const allDocs = DocListCast(dashboard[DataSym]["data-all"]);
+        console.log(allDocs);
+        const onScreenTab = DocListCast(dashboard.data)[0];
+        const onScreenDocs = DocListCast(onScreenTab.data);
+        return new List<Doc>(allDocs.reduce((result: Doc[], doc) => {
+            !onScreenDocs.includes(doc) && (result.push(doc));
+            // console.log(doc);
+            return result;
+        }, []));
+    }
+    return [];
 });
-- 
cgit v1.2.3-70-g09d2


From 77c16aa9f00a9d1b5e31ddf5a68d56f183f13691 Mon Sep 17 00:00:00 2001
From: usodhi <61431818+usodhi@users.noreply.github.com>
Date: Thu, 20 May 2021 12:47:46 -0400
Subject: dashboard sharing, aliases now work? needs more testing

---
 src/client/util/CurrentUserUtils.ts                   | 19 +++++++++++++------
 .../views/collections/CollectionDockingView.tsx       |  6 +++++-
 2 files changed, 18 insertions(+), 7 deletions(-)

(limited to 'src/client/util/CurrentUserUtils.ts')

diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts
index a8327ae93..e143887fa 100644
--- a/src/client/util/CurrentUserUtils.ts
+++ b/src/client/util/CurrentUserUtils.ts
@@ -1255,12 +1255,20 @@ Scripting.addGlobal(function shareDashboard(dashboard: Doc) {
     SharingManager.Instance.open(undefined, dashboard);
 },
     "opens sharing dialog for Dashboard");
-Scripting.addGlobal(function addToDashboards(dashboard: Doc) {
+Scripting.addGlobal(async function addToDashboards(dashboard: Doc) {
     const dashboardAlias = Doc.MakeAlias(dashboard);
+    const dockingConfig = JSON.parse(StrCast(dashboardAlias.dockingConfig));
+    dockingConfig.content = [];
+    dashboardAlias.dockingConfig = JSON.stringify(dockingConfig);
+
+    const allDocs = await DocListCastAsync(dashboard[DataSym]["data-all"]);
+
+    dashboardAlias["data-all"] = new List<Doc>((allDocs || []).map(doc => Doc.MakeAlias(doc)));
+
     dashboardAlias.data = new List<Doc>(DocListCast(dashboard.data).map(tabFolder => Doc.MakeAlias(tabFolder)));
-    // DocListCast(dashboardAlias.data).forEach(tabFolder => {
-    //     tabFolder.data = new List<Doc>(DocListCast(tabFolder.data).map(tab => Doc.MakeAlias(tab)));
-    // });
+    DocListCast(dashboardAlias.data).forEach(doc => doc.dashboard = dashboardAlias);
+    DocListCast(dashboardAlias.data)[0].data = new List<Doc>();
+    DocListCast(dashboardAlias.data)[1].data = ComputedField.MakeFunction(`dynamicOffScreenDocs(self.dashboard)`) as any;
     Doc.AddDocToList(CurrentUserUtils.MyDashboards, "data", dashboardAlias);
     CurrentUserUtils.openDashboard(Doc.UserDoc(), dashboardAlias);
 },
@@ -1268,13 +1276,12 @@ Scripting.addGlobal(function addToDashboards(dashboard: Doc) {
 
 Scripting.addGlobal(function dynamicOffScreenDocs(dashboard: Doc) {
     if (dashboard[DataSym] instanceof Doc) {
-        const allDocs = DocListCast(dashboard[DataSym]["data-all"]);
+        const allDocs = DocListCast(dashboard["data-all"]);
         console.log(allDocs);
         const onScreenTab = DocListCast(dashboard.data)[0];
         const onScreenDocs = DocListCast(onScreenTab.data);
         return new List<Doc>(allDocs.reduce((result: Doc[], doc) => {
             !onScreenDocs.includes(doc) && (result.push(doc));
-            // console.log(doc);
             return result;
         }, []));
     }
diff --git a/src/client/views/collections/CollectionDockingView.tsx b/src/client/views/collections/CollectionDockingView.tsx
index 819667834..235fe8950 100644
--- a/src/client/views/collections/CollectionDockingView.tsx
+++ b/src/client/views/collections/CollectionDockingView.tsx
@@ -161,7 +161,11 @@ export class CollectionDockingView extends CollectionSubView(doc => doc) {
         }
         const instance = CollectionDockingView.Instance;
         if (!instance) return false;
-        else Doc.AddDocToList(instance.props.Document[DataSym], "data-all", document);
+        else {
+            const docList = DocListCast(instance.props.Document[DataSym]["data-all"]);
+            !docList.includes(document) && !docList.includes(document.aliasOf as Doc) && Doc.AddDocToList(instance.props.Document[DataSym], "data-all", document);
+            DocListCast(instance.props.Document[DataSym]["aliases"]).forEach(alias => !alias.aliasOf && alias !== instance.props.Document && Doc.AddDocToList(alias, "data-all", Doc.MakeAlias(document)));
+        }
         const docContentConfig = CollectionDockingView.makeDocumentConfig(document, panelName);
 
         if (!pullSide && stack) {
-- 
cgit v1.2.3-70-g09d2


From b85e7819ae46558a659cac73817be0b812d6abbe Mon Sep 17 00:00:00 2001
From: usodhi <61431818+usodhi@users.noreply.github.com>
Date: Mon, 31 May 2021 20:18:19 -0400
Subject: sharing dashboard works? pending fixing remnant on screen tabs

---
 src/client/documents/Documents.ts                  | 17 +++---------
 src/client/util/CurrentUserUtils.ts                | 30 +++++++++++++++++++---
 .../views/collections/CollectionDockingView.tsx    |  9 ++++++-
 3 files changed, 38 insertions(+), 18 deletions(-)

(limited to 'src/client/util/CurrentUserUtils.ts')

diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts
index 6fb6f70b3..70541b559 100644
--- a/src/client/documents/Documents.ts
+++ b/src/client/documents/Documents.ts
@@ -648,9 +648,8 @@ export namespace Docs {
          * constructor just generates a new GUID. This is currently used
          * only when creating a DockDocument from the current user's already existing
          * main document.
-         * @param layoutData whether the fieldKey field on the layout doc should store the data or the data doc
          */
-        function InstanceFromProto(proto: Doc, data: Field | undefined, options: DocumentOptions, delegId?: string, fieldKey: string = "data", protoId?: string, layoutData?: boolean) {
+        function InstanceFromProto(proto: Doc, data: Field | undefined, options: DocumentOptions, delegId?: string, fieldKey: string = "data", protoId?: string) {
             const viewKeys = ["x", "y", "system"]; // keys that should be addded to the view document even though they don't begin with an "_"
             const { omit: dataProps, extract: viewProps } = OmitKeys(options, viewKeys, "^_");
 
@@ -662,16 +661,8 @@ export namespace Docs {
             dataProps["acl-Override"] = "None";
             dataProps["acl-Public"] = Doc.UserDoc()?.defaultAclPrivate ? SharingPermissions.None : SharingPermissions.Add;
 
-            if (layoutData) {
-                viewProps[fieldKey] = data;
-                const list = new List<Doc>();
-                console.log(DocListCast(data));
-                DocListCast(data).forEach(doc => {
-                    list.push(...DocListCast(doc.data));
-                });
-                dataProps[fieldKey + "-all"] = list;
-            }
-            else dataProps[fieldKey] = data;
+            dataProps[fieldKey] = data;
+
             // so that the list of annotations is already initialised, prevents issues in addonly.
             // without this, if a doc has no annotations but the user has AddOnly privileges, they won't be able to add an annotation because they would have needed to create the field's list which they don't have permissions to do.
             dataProps[fieldKey + "-annotations"] = new List<Doc>();
@@ -902,7 +893,7 @@ export namespace Docs {
         export function DockDocument(documents: Array<Doc>, config: string, options: DocumentOptions, id?: string) {
             const tabs = TreeDocument(documents, { title: "On-Screen Tabs", childDontRegisterViews: true, freezeChildren: "remove|add", treeViewExpandedViewLock: true, treeViewExpandedView: "data", _fitWidth: true, system: true });
             const all = TreeDocument([], { title: "Off-Screen Tabs", childDontRegisterViews: true, freezeChildren: "add", treeViewExpandedViewLock: true, treeViewExpandedView: "data", system: true });
-            return InstanceFromProto(Prototypes.get(DocumentType.COL), new List([tabs, all]), { freezeChildren: "remove|add", treeViewExpandedViewLock: true, treeViewExpandedView: "data", ...options, _viewType: CollectionViewType.Docking, dockingConfig: config }, id, undefined, undefined, true);
+            return InstanceFromProto(Prototypes.get(DocumentType.COL), new List([tabs, all]), { freezeChildren: "remove|add", treeViewExpandedViewLock: true, treeViewExpandedView: "data", ...options, _viewType: CollectionViewType.Docking, dockingConfig: config }, id);
         }
 
         export function DirectoryImportDocument(options: DocumentOptions = {}) {
diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts
index e143887fa..90a2378fe 100644
--- a/src/client/util/CurrentUserUtils.ts
+++ b/src/client/util/CurrentUserUtils.ts
@@ -1187,6 +1187,22 @@ export class CurrentUserUtils {
         const freeformDoc = CurrentUserUtils.GuestTarget || Docs.Create.FreeformDocument([], freeformOptions);
         const dashboardDoc = Docs.Create.StandardCollectionDockingDocument([{ doc: freeformDoc, initialWidth: 600 }], { title: `Dashboard ${dashboardCount}` }, id, "row"); // add isFolder:true here?
         freeformDoc.context = dashboardDoc;
+
+        // switching the tabs from the datadoc to the regular doc
+        const dashboardTabs = dashboardDoc[DataSym].data;
+        dashboardDoc[DataSym].data = new List<Doc>();
+        dashboardDoc.data = dashboardTabs;
+
+        // collating all docs on the dashboard to make a data-all field
+        const allDocs = new List<Doc>();
+        const allDocs2 = new List<Doc>(); // Array.from, spread, splice all cause so stack or acl issues for some reason
+        DocListCast(dashboardTabs).forEach(doc => {
+            const tabDocs = DocListCast(doc.data);
+            allDocs.push(...tabDocs);
+            allDocs2.push(...tabDocs);
+        });
+        dashboardDoc[DataSym]["data-all"] = allDocs;
+        dashboardDoc["data-all"] = allDocs2;
         DocListCast(dashboardDoc.data).forEach(doc => doc.dashboard = dashboardDoc);
         DocListCast(dashboardDoc.data)[1].data = ComputedField.MakeFunction(`dynamicOffScreenDocs(self.dashboard)`) as any;
 
@@ -1257,14 +1273,18 @@ Scripting.addGlobal(function shareDashboard(dashboard: Doc) {
     "opens sharing dialog for Dashboard");
 Scripting.addGlobal(async function addToDashboards(dashboard: Doc) {
     const dashboardAlias = Doc.MakeAlias(dashboard);
-    const dockingConfig = JSON.parse(StrCast(dashboardAlias.dockingConfig));
-    dockingConfig.content = [];
-    dashboardAlias.dockingConfig = JSON.stringify(dockingConfig);
 
     const allDocs = await DocListCastAsync(dashboard[DataSym]["data-all"]);
 
+    // moves the data-all field from the datadoc to the layoutdoc, necessary for off screen docs tab to function properly
+    dashboard["data-all"] = new List<Doc>(allDocs);
     dashboardAlias["data-all"] = new List<Doc>((allDocs || []).map(doc => Doc.MakeAlias(doc)));
 
+    const dockingConfig = JSON.parse(StrCast(dashboardAlias.dockingConfig));
+    dockingConfig.content = [];
+    dashboardAlias.dockingConfig = JSON.stringify(dockingConfig);
+
+
     dashboardAlias.data = new List<Doc>(DocListCast(dashboard.data).map(tabFolder => Doc.MakeAlias(tabFolder)));
     DocListCast(dashboardAlias.data).forEach(doc => doc.dashboard = dashboardAlias);
     DocListCast(dashboardAlias.data)[0].data = new List<Doc>();
@@ -1274,10 +1294,12 @@ Scripting.addGlobal(async function addToDashboards(dashboard: Doc) {
 },
     "adds Dashboard to set of Dashboards");
 
+/**
+ * Dynamically computes which docs should be rendered in the off-screen tabs tree of a dashboard.
+ */
 Scripting.addGlobal(function dynamicOffScreenDocs(dashboard: Doc) {
     if (dashboard[DataSym] instanceof Doc) {
         const allDocs = DocListCast(dashboard["data-all"]);
-        console.log(allDocs);
         const onScreenTab = DocListCast(dashboard.data)[0];
         const onScreenDocs = DocListCast(onScreenTab.data);
         return new List<Doc>(allDocs.reduce((result: Doc[], doc) => {
diff --git a/src/client/views/collections/CollectionDockingView.tsx b/src/client/views/collections/CollectionDockingView.tsx
index 235fe8950..2e44b65e6 100644
--- a/src/client/views/collections/CollectionDockingView.tsx
+++ b/src/client/views/collections/CollectionDockingView.tsx
@@ -163,8 +163,15 @@ export class CollectionDockingView extends CollectionSubView(doc => doc) {
         if (!instance) return false;
         else {
             const docList = DocListCast(instance.props.Document[DataSym]["data-all"]);
+            // adds the doc of the newly created tab to the data-all field if it doesn't already include that doc or one of its aliases
             !docList.includes(document) && !docList.includes(document.aliasOf as Doc) && Doc.AddDocToList(instance.props.Document[DataSym], "data-all", document);
-            DocListCast(instance.props.Document[DataSym]["aliases"]).forEach(alias => !alias.aliasOf && alias !== instance.props.Document && Doc.AddDocToList(alias, "data-all", Doc.MakeAlias(document)));
+            // adds an alias of the doc to the data-all field of the layoutdocs of the aliases
+            DocListCast(instance.props.Document[DataSym].aliases).forEach(alias => {
+                const aliasDocList = DocListCast(alias["data-all"]);
+                // if aliasDocList contains the alias, don't do anything
+                // otherwise add the original or an alias depending on whether the doc you're looking at is the current doc or a different alias
+                !DocListCast(document.aliases).some(a => aliasDocList.includes(a)) && Doc.AddDocToList(alias, "data-all", alias !== instance.props.Document ? Doc.MakeAlias(document) : document);
+            });
         }
         const docContentConfig = CollectionDockingView.makeDocumentConfig(document, panelName);
 
-- 
cgit v1.2.3-70-g09d2


From 16ecec059993f4f5ac3680afc0eb00eb559db91e Mon Sep 17 00:00:00 2001
From: usodhi <61431818+usodhi@users.noreply.github.com>
Date: Mon, 31 May 2021 21:31:30 -0400
Subject: folderised dashboards

---
 src/client/documents/Documents.ts   | 4 ++--
 src/client/util/CurrentUserUtils.ts | 2 +-
 2 files changed, 3 insertions(+), 3 deletions(-)

(limited to 'src/client/util/CurrentUserUtils.ts')

diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts
index 70541b559..da4e926b4 100644
--- a/src/client/documents/Documents.ts
+++ b/src/client/documents/Documents.ts
@@ -891,8 +891,8 @@ export namespace Docs {
         }
 
         export function DockDocument(documents: Array<Doc>, config: string, options: DocumentOptions, id?: string) {
-            const tabs = TreeDocument(documents, { title: "On-Screen Tabs", childDontRegisterViews: true, freezeChildren: "remove|add", treeViewExpandedViewLock: true, treeViewExpandedView: "data", _fitWidth: true, system: true });
-            const all = TreeDocument([], { title: "Off-Screen Tabs", childDontRegisterViews: true, freezeChildren: "add", treeViewExpandedViewLock: true, treeViewExpandedView: "data", system: true });
+            const tabs = TreeDocument(documents, { title: "On-Screen Tabs", childDontRegisterViews: true, freezeChildren: "remove|add", treeViewExpandedViewLock: true, treeViewExpandedView: "data", _fitWidth: true, system: true, isFolder: true });
+            const all = TreeDocument([], { title: "Off-Screen Tabs", childDontRegisterViews: true, freezeChildren: "add", treeViewExpandedViewLock: true, treeViewExpandedView: "data", system: true, isFolder: true });
             return InstanceFromProto(Prototypes.get(DocumentType.COL), new List([tabs, all]), { freezeChildren: "remove|add", treeViewExpandedViewLock: true, treeViewExpandedView: "data", ...options, _viewType: CollectionViewType.Docking, dockingConfig: config }, id);
         }
 
diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts
index be99d6ce4..6236e1ac9 100644
--- a/src/client/util/CurrentUserUtils.ts
+++ b/src/client/util/CurrentUserUtils.ts
@@ -1185,7 +1185,7 @@ export class CurrentUserUtils {
             title: `Untitled Tab ${NumCast(emptyPane["dragFactory-count"])}`,
         };
         const freeformDoc = CurrentUserUtils.GuestTarget || Docs.Create.FreeformDocument([], freeformOptions);
-        const dashboardDoc = Docs.Create.StandardCollectionDockingDocument([{ doc: freeformDoc, initialWidth: 600 }], { title: `Dashboard ${dashboardCount}` }, id, "row"); // add isFolder:true here?
+        const dashboardDoc = Docs.Create.StandardCollectionDockingDocument([{ doc: freeformDoc, initialWidth: 600 }], { title: `Dashboard ${dashboardCount}`, isFolder: true }, id, "row");
         freeformDoc.context = dashboardDoc;
 
         // switching the tabs from the datadoc to the regular doc
-- 
cgit v1.2.3-70-g09d2


From fe672afad987b246b8be79366d2d9c45b6fba502 Mon Sep 17 00:00:00 2001
From: usodhi <61431818+usodhi@users.noreply.github.com>
Date: Thu, 10 Jun 2021 00:15:56 -0400
Subject: removed isfolder flag from dashboard to allow double click to open
 dashboard

---
 src/client/util/CurrentUserUtils.ts | 2 +-
 1 file changed, 1 insertion(+), 1 deletion(-)

(limited to 'src/client/util/CurrentUserUtils.ts')

diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts
index 6236e1ac9..8b3597d57 100644
--- a/src/client/util/CurrentUserUtils.ts
+++ b/src/client/util/CurrentUserUtils.ts
@@ -1185,7 +1185,7 @@ export class CurrentUserUtils {
             title: `Untitled Tab ${NumCast(emptyPane["dragFactory-count"])}`,
         };
         const freeformDoc = CurrentUserUtils.GuestTarget || Docs.Create.FreeformDocument([], freeformOptions);
-        const dashboardDoc = Docs.Create.StandardCollectionDockingDocument([{ doc: freeformDoc, initialWidth: 600 }], { title: `Dashboard ${dashboardCount}`, isFolder: true }, id, "row");
+        const dashboardDoc = Docs.Create.StandardCollectionDockingDocument([{ doc: freeformDoc, initialWidth: 600 }], { title: `Dashboard ${dashboardCount}` }, id, "row");
         freeformDoc.context = dashboardDoc;
 
         // switching the tabs from the datadoc to the regular doc
-- 
cgit v1.2.3-70-g09d2


From 9d03a05ae686768a542da499b6d5e1ce4d9c20fd Mon Sep 17 00:00:00 2001
From: usodhi <61431818+usodhi@users.noreply.github.com>
Date: Sun, 27 Jun 2021 16:18:55 -0400
Subject: can delete dashboards

---
 src/client/util/CurrentUserUtils.ts | 14 ++++++++++++--
 1 file changed, 12 insertions(+), 2 deletions(-)

(limited to 'src/client/util/CurrentUserUtils.ts')

diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts
index 8b3597d57..9f01b165f 100644
--- a/src/client/util/CurrentUserUtils.ts
+++ b/src/client/util/CurrentUserUtils.ts
@@ -1214,8 +1214,9 @@ export class CurrentUserUtils {
         const createDashboard = ScriptField.MakeScript(`createNewDashboard()`);
         const shareDashboard = ScriptField.MakeScript(`shareDashboard(self)`);
         const addToDashboards = ScriptField.MakeScript(`addToDashboards(self)`);
-        dashboardDoc.contextMenuScripts = new List<ScriptField>([toggleTheme!, toggleComic!, snapshotDashboard!, createDashboard!, shareDashboard!, addToDashboards!]);
-        dashboardDoc.contextMenuLabels = new List<string>(["Toggle Theme Colors", "Toggle Comic Mode", "Snapshot Dashboard", "Create Dashboard", "Share Dashboard", "Add to Dashboards"]);
+        const removeDashboard = ScriptField.MakeScript('removeDashboard(self)');
+        dashboardDoc.contextMenuScripts = new List<ScriptField>([toggleTheme!, toggleComic!, snapshotDashboard!, createDashboard!, shareDashboard!, addToDashboards!, removeDashboard!]);
+        dashboardDoc.contextMenuLabels = new List<string>(["Toggle Theme Colors", "Toggle Comic Mode", "Snapshot Dashboard", "Create Dashboard", "Share Dashboard", "Add to Dashboards", "Remove Dashboard"]);
 
         Doc.AddDocToList(dashboards, "data", dashboardDoc);
         CurrentUserUtils.openDashboard(userDoc, dashboardDoc);
@@ -1271,6 +1272,15 @@ Scripting.addGlobal(function shareDashboard(dashboard: Doc) {
     SharingManager.Instance.open(undefined, dashboard);
 },
     "opens sharing dialog for Dashboard");
+Scripting.addGlobal(async function removeDashboard(dashboard: Doc) {
+    console.log(dashboard);
+    const dashboards = await DocListCastAsync(CurrentUserUtils.MyDashboards.data);
+    if (dashboards && dashboards.length > 1) {
+        if (dashboard === CurrentUserUtils.ActiveDashboard) CurrentUserUtils.openDashboard(Doc.UserDoc(), dashboards.find(doc => doc !== dashboard)!);
+        Doc.RemoveDocFromList(CurrentUserUtils.MyDashboards, "data", dashboard);
+    }
+},
+    "Remove Dashboard from Dashboards");
 Scripting.addGlobal(async function addToDashboards(dashboard: Doc) {
     const dashboardAlias = Doc.MakeAlias(dashboard);
 
-- 
cgit v1.2.3-70-g09d2


From d6e313be26323d7e8265714665c71e2d571764ae Mon Sep 17 00:00:00 2001
From: usodhi <61431818+usodhi@users.noreply.github.com>
Date: Sun, 27 Jun 2021 17:20:59 -0400
Subject: whoops

---
 src/client/util/CurrentUserUtils.ts | 1 -
 1 file changed, 1 deletion(-)

(limited to 'src/client/util/CurrentUserUtils.ts')

diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts
index 9f01b165f..4584d3282 100644
--- a/src/client/util/CurrentUserUtils.ts
+++ b/src/client/util/CurrentUserUtils.ts
@@ -1273,7 +1273,6 @@ Scripting.addGlobal(function shareDashboard(dashboard: Doc) {
 },
     "opens sharing dialog for Dashboard");
 Scripting.addGlobal(async function removeDashboard(dashboard: Doc) {
-    console.log(dashboard);
     const dashboards = await DocListCastAsync(CurrentUserUtils.MyDashboards.data);
     if (dashboards && dashboards.length > 1) {
         if (dashboard === CurrentUserUtils.ActiveDashboard) CurrentUserUtils.openDashboard(Doc.UserDoc(), dashboards.find(doc => doc !== dashboard)!);
-- 
cgit v1.2.3-70-g09d2


From 212d49772c1c2aa3d0a9382ef144dc3037faa8c2 Mon Sep 17 00:00:00 2001
From: bobzel <zzzman@gmail.com>
Date: Thu, 15 Jul 2021 23:59:38 -0400
Subject: cleaned up autoHeight for text in conjunction with sidebars and
 titles and some layout scripts

---
 src/client/util/CurrentUserUtils.ts                | 13 +++++++---
 src/client/views/DocumentDecorations.tsx           |  4 +--
 src/client/views/SidebarAnnos.tsx                  |  5 +++-
 .../views/nodes/formattedText/FormattedTextBox.tsx | 29 +++++++++++-----------
 4 files changed, 31 insertions(+), 20 deletions(-)

(limited to 'src/client/util/CurrentUserUtils.ts')

diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts
index 12733e815..5bab827d5 100644
--- a/src/client/util/CurrentUserUtils.ts
+++ b/src/client/util/CurrentUserUtils.ts
@@ -406,11 +406,18 @@ export class CurrentUserUtils {
                 storedMarks: []
             };
             const headerTemplate = Docs.Create.RTFDocument(new RichTextField(JSON.stringify(json), ""), { title: "header", version: headerViewVersion, target: doc, _height: 70, _headerPointerEvents: "all", _headerHeight: 12, _headerFontSize: 9, _autoHeight: true, system: true, cloneFieldFilter: new List<string>(["system"]) }, "header"); // text needs to be a space to allow templateText to be created
+            const headerBtnHgt = 10;
             headerTemplate[DataSym].layout =
-                "<div style={'height:100%'}>" +
-                "    <FormattedTextBox {...props} fieldKey={'header'} dontSelectOnLoad={'true'} ignoreAutoHeight={'true'} pointerEvents='{this._headerPointerEvents||`none`}' fontSize='{this._headerFontSize}px' height='{this._headerHeight}px' background='{this._headerColor||this.target.mySharedDocs.userColor}' />" +
-                "    <FormattedTextBox {...props} fieldKey={'text'} position='absolute' top='{(this._headerHeight)*scale}px' height='calc({100/scale}% - {this._headerHeight}px)'/>" +
+                "<div style='height:100%'>" +
+                `    <FormattedTextBox {...props} fieldKey={'text'} height='calc(100% - ${headerBtnHgt}px - {this._headerHeight}px)'/>` +
+                "    <FormattedTextBox {...props} fieldKey={'header'}  dontSelectOnLoad='true' ignoreAutoHeight='true' fontSize='{this._headerFontSize}px' height='{this._headerHeight||1}px' background={this._headerColor ||this.target.mySharedDocs.userColor||'lightGray'} />" +
+                `    <HTMLdiv fontSize='${headerBtnHgt - 1}' onClick={‘(this._headerHeight=Math.min(Math.max(1,this._height-30),this._headerHeight===1?50:1)) && (this._autoHeightMargins=this._headerHeight+${headerBtnHgt})’}  height='${headerBtnHgt}px' background='yellow' >Metadata</HTMLdiv>` +
                 "</div>";
+
+            // "<div style={'height:100%'}>" +
+            // "    <FormattedTextBox {...props} fieldKey={'header'} dontSelectOnLoad={'true'} ignoreAutoHeight={'true'} pointerEvents='{this._headerPointerEvents||`none`}' fontSize='{this._headerFontSize}px' height='{this._headerHeight}px' background='{this._headerColor||this.target.mySharedDocs.userColor}' />" +
+            // "    <FormattedTextBox {...props} fieldKey={'text'} position='absolute' top='{(this._headerHeight)*scale}px' height='calc({100/scale}% - {this._headerHeight}px)'/>" +
+            // "</div>";
             (headerTemplate.proto as Doc).isTemplateDoc = makeTemplate(headerTemplate.proto as Doc, true, "headerView");
             doc.emptyHeader = headerTemplate;
             ((doc.emptyHeader as Doc).proto as Doc)["dragFactory-count"] = 0;
diff --git a/src/client/views/DocumentDecorations.tsx b/src/client/views/DocumentDecorations.tsx
index bf939d57c..65a97a49d 100644
--- a/src/client/views/DocumentDecorations.tsx
+++ b/src/client/views/DocumentDecorations.tsx
@@ -235,7 +235,7 @@ export class DocumentDecorations extends React.Component<{ boundsLeft: number, b
         this._resizeUndo = UndoManager.StartBatch("DocDecs resize");
         this._snapX = e.pageX;
         this._snapY = e.pageY;
-        DragManager.docsBeingDragged.forEach(doc => this._dragHeights.set(doc, { start: NumCast(doc._height), lowest: NumCast(doc._height) }));
+        SelectionManager.Views().forEach(docView => this._dragHeights.set(docView.layoutDoc, { start: NumCast(docView.rootDoc._height), lowest: NumCast(docView.rootDoc._height) }));
     }
 
     onPointerMove = (e: PointerEvent, down: number[], move: number[]): boolean => {
@@ -382,7 +382,7 @@ export class DocumentDecorations extends React.Component<{ boundsLeft: number, b
         SnappingManager.clearSnapLines();
 
         // detect autoHeight gesture and apply
-        DragManager.docsBeingDragged.map(doc => ({ doc, hgts: this._dragHeights.get(doc) }))
+        SelectionManager.Views().map(docView => ({ doc: docView.layoutDoc, hgts: this._dragHeights.get(docView.layoutDoc) }))
             .filter(pair => pair.hgts && pair.hgts.lowest < pair.hgts.start && pair.hgts.lowest <= 20)
             .forEach(pair => pair.doc._autoHeight = true);
         //need to change points for resize, or else rotation/control points will fail.
diff --git a/src/client/views/SidebarAnnos.tsx b/src/client/views/SidebarAnnos.tsx
index 59ff1c340..9c5a54574 100644
--- a/src/client/views/SidebarAnnos.tsx
+++ b/src/client/views/SidebarAnnos.tsx
@@ -78,7 +78,9 @@ export class SidebarAnnos extends React.Component<FieldViewProps & ExtraProps> {
     docFilters = () => [...StrListCast(this.props.layoutDoc._docFilters), ...StrListCast(this.props.layoutDoc[this.filtersKey])];
 
     sidebarStyleProvider = (doc: Opt<Doc>, props: Opt<FieldViewProps | DocumentViewProps>, property: string) => {
-        if (property === StyleProp.ShowTitle) return StrCast(this.props.layoutDoc["sidebar-childShowTitle"], "title");
+        if (property === StyleProp.ShowTitle) {
+            return doc === this.props.rootDoc ? 0 : StrCast(this.props.layoutDoc["sidebar-childShowTitle"], "title");
+        }
         return this.props.styleProvider?.(doc, props, property);
     }
     render() {
@@ -117,6 +119,7 @@ export class SidebarAnnos extends React.Component<FieldViewProps & ExtraProps> {
                         styleProvider={this.sidebarStyleProvider}
                         docFilters={this.docFilters}
                         scaleField={this.sidebarKey() + "-scale"}
+                        setHeight={(height) => this.props.setHeight(height + this.filtersHeight())}
                         isAnnotationOverlay={false}
                         select={emptyFunction}
                         scaling={returnOne}
diff --git a/src/client/views/nodes/formattedText/FormattedTextBox.tsx b/src/client/views/nodes/formattedText/FormattedTextBox.tsx
index 42cb02782..95d8f555c 100644
--- a/src/client/views/nodes/formattedText/FormattedTextBox.tsx
+++ b/src/client/views/nodes/formattedText/FormattedTextBox.tsx
@@ -124,8 +124,9 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
     @computed get autoHeight() { return this.layoutDoc._autoHeight && !this.props.ignoreAutoHeight; }
     @computed get textHeight() { return NumCast(this.rootDoc[this.fieldKey + "-height"]); }
     @computed get scrollHeight() { return NumCast(this.rootDoc[this.fieldKey + "-scrollHeight"]); }
-    @computed get sidebarHeight() { return NumCast(this.rootDoc[this.SidebarKey + "-height"]); }
+    @computed get sidebarHeight() { return !this.sidebarWidth() ? 0 : NumCast(this.rootDoc[this.SidebarKey + "-height"]); }
     @computed get titleHeight() { return this.props.styleProvider?.(this.layoutDoc, this.props, StyleProp.HeaderMargin) || 0; }
+    @computed get autoHeightMargins() { return this.titleHeight + (this.layoutDoc._autoHeightMargins && !this.props.dontSelectOnLoad ? NumCast(this.layoutDoc._autoHeightMargins) : 0); }
     @computed get _recording() { return this.dataDoc?.mediaState === "recording"; }
     set _recording(value) {
         !this.dataDoc.recordingSource && (this.dataDoc.mediaState = value ? "recording" : undefined);
@@ -780,7 +781,7 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
     // Since we also monitor all component height changes, this will update the document's height.
     resetNativeHeight = (scrollHeight: number) => {
         const nh = this.layoutDoc.isTemplateForField ? 0 : NumCast(this.layoutDoc._nativeHeight);
-        this.rootDoc[this.fieldKey + "-height"] = scrollHeight + this.titleHeight;
+        this.rootDoc[this.fieldKey + "-height"] = scrollHeight;
         if (nh) this.layoutDoc._nativeHeight = scrollHeight;
     }
 
@@ -793,8 +794,8 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
             ({ width, scrollHeight, autoHeight }) => width && autoHeight && this.resetNativeHeight(scrollHeight)
         );
         this._disposers.componentHeights = reaction(  // set the document height when one of the component heights changes and autoHeight is on
-            () => ({ sidebarHeight: this.sidebarHeight, textHeight: this.textHeight, autoHeight: this.autoHeight }),
-            ({ sidebarHeight, textHeight, autoHeight }) => autoHeight && this.props.setHeight(Math.max(sidebarHeight, textHeight)));
+            () => ({ sidebarHeight: this.sidebarHeight, textHeight: this.textHeight, autoHeight: this.autoHeight, marginsHeight: this.autoHeightMargins }),
+            ({ sidebarHeight, textHeight, autoHeight, marginsHeight }) => autoHeight && this.props.setHeight(marginsHeight + Math.max(sidebarHeight, textHeight)));
         this._disposers.links = reaction(() => DocListCast(this.Document.links), // if a link is deleted, then remove all hyperlinks that reference it from the text's marks
             newLinks => {
                 this._cachedLinks.forEach(l => !newLinks.includes(l) && this.RemoveLinkFromDoc(l));
@@ -1422,16 +1423,15 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
     }
     tryUpdateScrollHeight() {
         if (!LightboxView.LightboxDoc || LightboxView.IsLightboxDocView(this.props.docViewPath())) {
-            setTimeout(() => { // bcz: don't know why this is needed, but without it, the size of the textbox is too big as it includes the size of the title header.  after the timeout, the size seems to get computed correctly.
-                const proseHeight = this.ProseRef?.scrollHeight || 0;
-                const scrollHeight = this.ProseRef && Math.min(NumCast(this.layoutDoc.docMaxAutoHeight, proseHeight), proseHeight);
-                if (scrollHeight && this.props.renderDepth && !this.props.dontRegisterView) {  // if top === 0, then the text box is growing upward (as the overlay caption) which doesn't contribute to the height computation
-                    const setScrollHeight = () => this.rootDoc[this.fieldKey + "-scrollHeight"] = scrollHeight;
-                    if (this.rootDoc === this.layoutDoc.doc || this.layoutDoc.resolvedDataDoc) {
-                        setScrollHeight();
-                    } else setTimeout(setScrollHeight, 10); // if we have a template that hasn't been resolved yet, we can't set the height or we'd be setting it on the unresolved template.  So set a timeout and hope its arrived...
-                }
-            });
+            const margins = 2 * NumCast(this.layoutDoc._yMargin, this.props.yPadding || 0);
+            const proseHeight = !this.ProseRef ? 0 : Array.from(this.ProseRef.children[0].children).reduce((p, child) => p + Number(getComputedStyle(child).height.replace("px", "")), margins);
+            const scrollHeight = this.ProseRef && Math.min(NumCast(this.layoutDoc.docMaxAutoHeight, proseHeight), proseHeight);
+            if (scrollHeight && this.props.renderDepth && !this.props.dontRegisterView) {  // if top === 0, then the text box is growing upward (as the overlay caption) which doesn't contribute to the height computation
+                const setScrollHeight = () => this.rootDoc[this.fieldKey + "-scrollHeight"] = scrollHeight;
+                if (this.rootDoc === this.layoutDoc.doc || this.layoutDoc.resolvedDataDoc) {
+                    setScrollHeight();
+                } else setTimeout(setScrollHeight, 10); // if we have a template that hasn't been resolved yet, we can't set the height or we'd be setting it on the unresolved template.  So set a timeout and hope its arrived...
+            }
         }
     }
     fitToBox = () => this.props.Document._fitToBox;
@@ -1471,6 +1471,7 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
                     layoutDoc={this.layoutDoc}
                     dataDoc={this.dataDoc}
                     PanelWidth={this.sidebarWidth}
+                    setHeight={this.setSidebarHeight}
                     sidebarAddDocument={this.sidebarAddDocument}
                     moveDocument={this.moveDocument}
                     removeDocument={this.removeDocument}
-- 
cgit v1.2.3-70-g09d2


From 48dbde117728e4b36bae11f0f16a796059ecf7ee Mon Sep 17 00:00:00 2001
From: dg314 <david_grossman@brown.edu>
Date: Sat, 17 Jul 2021 15:13:39 -0400
Subject: initial search panel

---
 src/client/util/CurrentUserUtils.ts                |  27 ++++-
 src/client/views/MainView.tsx                      |  11 +-
 src/client/views/StyleProvider.tsx                 |   2 +-
 .../views/collections/CollectionSchemaView.tsx     |   2 +-
 src/client/views/collections/SchemaTable.tsx       |   3 +-
 src/client/views/search/SearchBox.tsx              | 117 ++-------------------
 6 files changed, 41 insertions(+), 121 deletions(-)

(limited to 'src/client/util/CurrentUserUtils.ts')

diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts
index 12733e815..596ccd9a6 100644
--- a/src/client/util/CurrentUserUtils.ts
+++ b/src/client/util/CurrentUserUtils.ts
@@ -35,6 +35,8 @@ import { UndoManager } from "./UndoManager";
 import { SnappingManager } from "./SnappingManager";
 import { InkTool } from "../../fields/InkField";
 import { computedFn } from "mobx-utils";
+import { CollectionSchemaBooleanCell } from "../views/collections/CollectionSchemaCells";
+import { Console } from "console";
 
 
 export let resolvedPorts: { server: number, socket: number };
@@ -53,6 +55,7 @@ export class CurrentUserUtils {
     @observable public static GuestDashboard: Doc | undefined;
     @observable public static GuestMobile: Doc | undefined;
     @observable public static propertiesWidth: number = 0;
+    @observable public static searchPanelWidth: number = 0;
 
     // sets up the default User Templates - slideView,  headerView
     static setupUserTemplateButtons(doc: Doc) {
@@ -516,6 +519,7 @@ export class CurrentUserUtils {
     static async menuBtnDescriptions(doc: Doc) {
         return [
             { title: "Dashboards", target: Cast(doc.myDashboards, Doc, null), icon: "desktop", click: 'selectMainMenu(self)' },
+            { title: "Search", target: Cast(doc.mySearchPanel, Doc, null), icon: "search", click: 'selectMainMenu(self)' },
             { title: "My Files", target: Cast(doc.myFilesystem, Doc, null), icon: "file", click: 'selectMainMenu(self)' },
             { title: "Tools", target: Cast(doc.myTools, Doc, null), icon: "wrench", click: 'selectMainMenu(self)' },
             { title: "Import", target: Cast(doc.myImportPanel, Doc, null), icon: "upload", click: 'selectMainMenu(self)' },
@@ -529,14 +533,15 @@ export class CurrentUserUtils {
         ];
     }
 
-    static setupSearchPanel(doc: Doc) {
+    /*static setupSearchPanel(doc: Doc) {
         if (doc.mySearchPanelDoc === undefined) {
             doc.mySearchPanelDoc = new PrefetchProxy(Docs.Create.SearchDocument({
                 _width: 500, _height: 300, backgroundColor: "dimGray", ignoreClick: true, _searchDoc: true,
                 childDropAction: "alias", _lockedPosition: true, _viewType: CollectionViewType.Schema, title: "sidebar search stack", system: true
             })) as any as Doc;
         }
-    }
+    }*/
+
     static async setupMenuPanel(doc: Doc, sharingDocumentId: string, linkDatabaseId: string) {
         if (doc.menuStack === undefined) {
             await this.setupSharingSidebar(doc, sharingDocumentId, linkDatabaseId);  // sets up the right sidebar collection for mobile upload documents and sharing
@@ -807,6 +812,7 @@ export class CurrentUserUtils {
             (doc.myRecentlyClosedDocs as any as Doc).contextMenuLabels = new List<string>(["Clear All"]);
         }
     }
+
     static setupFilterDocs(doc: Doc) {
         // setup Filter item
         if (doc.currentFilter === undefined) {
@@ -939,6 +945,21 @@ export class CurrentUserUtils {
         }
     }
 
+    // Search sidebar is where searches within the document are performed
+    static setupSearchSidebar(doc: Doc) {
+        if (doc.mySearchPanelDoc === undefined) {
+            doc.mySearchPanelDoc = new PrefetchProxy(Docs.Create.SearchDocument({
+                _width: 500, _height: 300, backgroundColor: "dimGray", ignoreClick: true, _searchDoc: true,
+                childDropAction: "alias", _lockedPosition: true, _viewType: CollectionViewType.Schema, title: "sidebar search stack", system: true
+            })) as any as Doc;
+        }
+        if (doc.mySearchPanel === undefined) {
+            const searchPanelDoc = Cast(doc.mySearchPanelDoc, Doc, null);
+            //const newUpload = CurrentUserUtils.ficon({ onClick: ScriptField.MakeScript("importDocument()"), toolTip: "Import External document", _stayInCollection: true, _hideContextMenu: true, title: "Import", icon: "upload", system: true });
+            doc.mySearchPanel = new PrefetchProxy(Docs.Create.StackingDocument([searchPanelDoc], { title: "Search", _yMargin: 20, ignoreClick: true, _chromeHidden: true, _stayInCollection: true, _hideContextMenu: true, _lockedPosition: true, system: true }));
+        }
+    }
+
     static setupClickEditorTemplates(doc: Doc) {
         if (doc["clickFuncs-child"] === undefined) {
             // to use this function, select it from the context menu of a collection.  then edit the onChildClick script.  Add two Doc variables: 'target' and 'thisContainer', then assign 'target' to some target collection.  After that, clicking on any document in the initial collection will open it in the target
@@ -1023,8 +1044,8 @@ export class CurrentUserUtils {
         this.setupDefaultIconTemplates(doc);  // creates a set of icon templates triggered by the document deoration icon
         this.setupDocTemplates(doc); // sets up the template menu of templates
         this.setupImportSidebar(doc);
+        this.setupSearchSidebar(doc); // sets up the search sidebar
         this.setupActiveMobileMenu(doc); // sets up the current mobile menu for Dash Mobile
-        this.setupSearchPanel(doc);
         this.setupOverlays(doc);  // documents in overlay layer
         this.setupDockedButtons(doc);  // the bottom bar of font icons
         await this.setupSidebarButtons(doc); // the pop-out left sidebar of tools/panels
diff --git a/src/client/views/MainView.tsx b/src/client/views/MainView.tsx
index 4eeb1fc95..bc9c6f4d2 100644
--- a/src/client/views/MainView.tsx
+++ b/src/client/views/MainView.tsx
@@ -180,8 +180,8 @@ export class MainView extends React.Component {
             const targClass = targets[0].className.toString();
             if (SearchBox.Instance._searchbarOpen || SearchBox.Instance.open) {
                 const check = targets.some((thing) =>
-                    (thing.className === "collectionSchemaView-searchContainer" || (thing as any)?.dataset.icon === "filter" ||
-                        thing.className === "collectionSchema-header-menuOptions"));
+                (thing.className === "collectionSchemaView-searchContainer" || (thing as any)?.dataset.icon === "filter" ||
+                    thing.className === "collectionSchema-header-menuOptions"));
                 !check && SearchBox.Instance.resetSearch(true);
             }
             !targClass.includes("contextMenu") && ContextMenu.Instance.closeMenu();
@@ -388,7 +388,6 @@ export class MainView extends React.Component {
                     SettingsManager.Instance.open();
                     break;
                 case "Catalog":
-                    SearchBox.Instance._searchFullDB = "My Stuff";
                     SearchBox.Instance.enter(undefined);
                     break;
                 case "Help":
@@ -523,7 +522,7 @@ export class MainView extends React.Component {
         </svg>;
     }
 
-    @computed get search() {
+    /*@computed get search() {
         TraceMobx();
         return <div className="mainView-searchPanel">
             <SearchBox Document={CurrentUserUtils.MySearchPanelDoc}
@@ -555,7 +554,7 @@ export class MainView extends React.Component {
                 ContainingCollectionView={undefined}
                 ContainingCollectionDoc={undefined} />
         </div>;
-    }
+    }*/
 
     @computed get invisibleWebBox() { // see note under the makeLink method in HypothesisUtils.ts
         return !DocumentLinksButton.invisibleWebDoc ? null :
@@ -604,7 +603,7 @@ export class MainView extends React.Component {
             <GroupManager />
             <GoogleAuthenticationManager />
             <DocumentDecorations boundsLeft={this.leftOffset} boundsTop={this.topOffset} />
-            {this.search}
+            {/*this.search*/}
             <CollectionMenu />
             {LinkDescriptionPopup.descriptionPopup ? <LinkDescriptionPopup /> : null}
             {DocumentLinksButton.LinkEditorDocView ? <LinkMenu docView={DocumentLinksButton.LinkEditorDocView} changeFlyout={emptyFunction} /> : (null)}
diff --git a/src/client/views/StyleProvider.tsx b/src/client/views/StyleProvider.tsx
index 9e61351c4..e670420d1 100644
--- a/src/client/views/StyleProvider.tsx
+++ b/src/client/views/StyleProvider.tsx
@@ -100,7 +100,7 @@ export function DefaultStyleProvider(doc: Opt<Doc>, props: Opt<DocumentViewProps
             const backColor = backgroundCol();// || (darkScheme() ? "black" : "white");
             if (!backColor) return undefined;
             const nonAlphaColor = backColor.startsWith("#") ? (backColor as string).substring(0, 7) :
-                backColor.startsWith("rgba") ? backColor.replace(/,.[^,]*\)/, ")").replace("rgba", "rgb") : backColor
+                backColor.startsWith("rgba") ? backColor.replace(/,.[^,]*\)/, ")").replace("rgba", "rgb") : backColor;
             const col = Color(nonAlphaColor).rgb();
             const colsum = (col.red() + col.green() + col.blue());
             if (colsum / col.alpha() > 400 || col.alpha() < 0.25) return "black";
diff --git a/src/client/views/collections/CollectionSchemaView.tsx b/src/client/views/collections/CollectionSchemaView.tsx
index b33c437a9..971dd5cbf 100644
--- a/src/client/views/collections/CollectionSchemaView.tsx
+++ b/src/client/views/collections/CollectionSchemaView.tsx
@@ -556,7 +556,7 @@ export class CollectionSchemaView extends CollectionSubView(doc => doc) {
             style={{
                 overflow: this.props.scrollOverflow === true ? "scroll" : undefined, backgroundColor: "white",
                 pointerEvents: this.props.Document._searchDoc !== undefined && !this.props.isContentActive() && !SnappingManager.GetIsDragging() ? "none" : undefined,
-                width: name === "collectionSchemaView-searchContainer" ? "auto" : this.props.PanelWidth() || "100%", height: this.props.PanelHeight() || "100%", position: "relative",
+                width: this.props.PanelWidth() || "100%", height: this.props.PanelHeight() || "100%", position: "relative",
             }}  >
             <div className="collectionSchemaView-tableContainer"
                 style={{ width: `calc(100% - ${this.previewWidth()}px)` }}
diff --git a/src/client/views/collections/SchemaTable.tsx b/src/client/views/collections/SchemaTable.tsx
index 0c69ee030..0175b0dc2 100644
--- a/src/client/views/collections/SchemaTable.tsx
+++ b/src/client/views/collections/SchemaTable.tsx
@@ -196,6 +196,7 @@ export class SchemaTable extends React.Component<SchemaTableProps> {
                 <div onClick={e => this.changeSorting(col)} style={{ width: 21, padding: 1, display: "inline", zIndex: 1, background: "inherit", cursor: "hand" }}>
                     <FontAwesomeIcon icon={sortIcon} size="lg" />
                 </div>
+                {this.props.Document._chromeHidden || this.props.addDocument == returnFalse ? undefined : <div className="collectionSchemaView-addRow" onClick={this.createRow}>+ new</div>}
             </div>;
 
             return {
@@ -559,7 +560,7 @@ export class SchemaTable extends React.Component<SchemaTableProps> {
             onPointerDown={this.props.onPointerDown} onClick={this.props.onClick} onWheel={e => this.props.active(true) && e.stopPropagation()}
             onDrop={e => this.props.onDrop(e, {})} onContextMenu={this.onContextMenu} >
             {this.reactTable}
-            {this.props.Document._chromeHidden ? undefined : <div className="collectionSchemaView-addRow" onClick={this.createRow}>+ new</div>}
+            {this.props.Document._chromeHidden || this.props.addDocument == returnFalse ? undefined : <div className="collectionSchemaView-addRow" onClick={this.createRow}>+ new</div>}
             {!this._showDoc ? (null) :
                 <div className="collectionSchemaView-documentPreview" ref="overlay"
                     style={{
diff --git a/src/client/views/search/SearchBox.tsx b/src/client/views/search/SearchBox.tsx
index b722868d6..740a28825 100644
--- a/src/client/views/search/SearchBox.tsx
+++ b/src/client/views/search/SearchBox.tsx
@@ -3,9 +3,9 @@ import { Tooltip } from '@material-ui/core';
 import { action, computed, IReactionDisposer, observable, reaction, runInAction } from 'mobx';
 import { observer } from 'mobx-react';
 import * as React from 'react';
-import { Doc, DocListCast, Field, Opt, DocListCastAsync } from '../../../fields/Doc';
+import { Doc, DocListCast, Field, Opt, DocListCastAsync, DataSym, HeightSym } from '../../../fields/Doc';
 import { documentSchema } from "../../../fields/documentSchemas";
-import { Copy, Id } from '../../../fields/FieldSymbols';
+import { Copy, Id, ToString } from '../../../fields/FieldSymbols';
 import { List } from '../../../fields/List';
 import { createSchema, listSpec, makeInterface } from '../../../fields/Schema';
 import { SchemaHeaderField } from '../../../fields/SchemaHeaderField';
@@ -52,8 +52,6 @@ export class SearchBox extends ViewBoxBaseComponent<FieldViewProps, SearchBoxDoc
     private docsforfilter: Doc[] | undefined = [];
     private realTotalResults: number = 0;
     private newsearchstring = "";
-    private collectionRef = React.createRef<HTMLDivElement>();
-
 
     @observable _undoBackground: string | undefined = "";
     @observable _icons: string[] = this._allIcons;
@@ -116,62 +114,6 @@ export class SearchBox extends ViewBoxBaseComponent<FieldViewProps, SearchBoxDoc
         }
     });
 
-    getFinalQuery(query: string): string {
-        //alters the query so it looks in the correct fields
-        //if this is true, th`en not all of the field boxes are checked
-        //TODO: data
-        const initialfilters = Cast(this.props.Document._docFilters, listSpec("string"), []);
-
-        const filters: string[] = [];
-
-        for (const initFilter of initialfilters) {
-            const fields = initFilter.split(":");
-            if (fields[2] !== undefined) {
-                filters.push(fields[0]);
-                filters.push(fields[1]);
-                filters.push(fields[2]);
-            }
-        }
-
-        const finalfilters: { [key: string]: string[] } = {};
-
-        for (let i = 0; i < filters.length; i = i++) {
-            const fields = filters[i].split(":");
-            if (finalfilters[fields[0]] !== undefined) {
-                finalfilters[fields[0]].push(fields[1]);
-            }
-            else {
-                finalfilters[fields[0]] = [fields[1]];
-            }
-        }
-
-        for (const key in finalfilters) {
-            const values = finalfilters[key];
-            if (values.length === 1) {
-                const mod = "_t:";
-                const newWords: string[] = [];
-                const oldWords = values[0].split(" ");
-                oldWords.forEach((word, i) => i === 0 ? newWords.push(key + mod + word) : newWords.push("AND " + key + mod + word));
-                query = `(${query}) AND (${newWords.join(" ")})`;
-            }
-            else {
-                for (let i = 0; i < values.length; i++) {
-                    const mod = "_t:";
-                    const newWords: string[] = [];
-                    const oldWords = values[i].split(" ");
-                    oldWords.forEach((word, i) => i === 0 ? newWords.push(key + mod + word) : newWords.push("AND " + key + mod + word));
-                    const v = "(" + newWords.join(" ") + ")";
-                    if (i === 0) {
-                        query = `(${query}) AND (${v}` + (values.length === 1 ? ")" : "");
-                    }
-                    else query = query + " OR " + v + (i === values.length - 1 ? ")" : "");
-                }
-            }
-        }
-
-        return query.replace(/-\s+/g, '');
-    }
-
     @action
     filterDocsByType(docs: Doc[]) {
         const finalDocs: Doc[] = [];
@@ -340,7 +282,6 @@ export class SearchBox extends ViewBoxBaseComponent<FieldViewProps, SearchBoxDoc
                             this._results[index][1].push(...hlights);
                             this._results[index][2].push(...line);
                         }
-
                     }));
 
                     this._curRequest = undefined;
@@ -360,37 +301,6 @@ export class SearchBox extends ViewBoxBaseComponent<FieldViewProps, SearchBoxDoc
         return this._lockPromise;
     }
 
-    startDragCollection = async () => {
-        const res = await this.getAllResults(this.getFinalQuery(StrCast(this.layoutDoc._searchString)));
-        const filtered = this.filterDocsByType(res.docs);
-        const docs = filtered.map(doc => Doc.GetT(doc, "isPrototype", "boolean", true) ? Doc.MakeDelegate(doc) : Doc.MakeAlias(doc));
-        let x = 0;
-        let y = 0;
-        for (const doc of docs.map(d => Doc.Layout(d))) {
-            doc.x = x;
-            doc.y = y;
-            const size = 200;
-            const aspect = Doc.NativeHeight(doc) / (Doc.NativeWidth(doc) || 1);
-            if (aspect > 1) {
-                doc._height = size;
-                doc._width = size / aspect;
-            } else if (aspect > 0) {
-                doc._width = size;
-                doc._height = size * aspect;
-            } else {
-                doc._width = size;
-                doc._height = size;
-            }
-            x += 250;
-            if (x > 1000) {
-                x = 0;
-                y += 300;
-            }
-        }
-        const headers = Cast(this.props.Document._schemaHeaders, listSpec(SchemaHeaderField), []).map(h => { const v = h[Copy](); v.color = "#f1efeb"; return v; });
-        return Docs.Create.SchemaDocument(headers, DocListCast(this.dataDoc[this.fieldKey]), { _autoHeight: true, _viewType: CollectionViewType.Schema, title: StrCast(this.layoutDoc._searchString) });
-    }
-
     @action.bound
     openSearch(e: React.SyntheticEvent) {
         e.stopPropagation();
@@ -479,6 +389,7 @@ export class SearchBox extends ViewBoxBaseComponent<FieldViewProps, SearchBoxDoc
 
     render() {
         const myDashboards = DocListCast(CurrentUserUtils.MyDashboards.data);
+
         return (
             <div style={{ pointerEvents: "all" }} className="searchBox-container">
                 <div className="searchBox-bar" style={{ background: SearchBox.Instance._undoBackground }}>
@@ -487,7 +398,7 @@ export class SearchBox extends ViewBoxBaseComponent<FieldViewProps, SearchBoxDoc
                             {`${Doc.CurrentUserEmail}`}
                             <div className="searchBox-logoff" onClick={() => window.location.assign(Utils.prepend("/logout"))}>
                                 Logoff
-                        </div>
+                            </div>
                         </div>
                         <div className="searchBox-lozenge" onClick={() => DocServer.UPDATE_SERVER_CACHE()}>
                             {`UI project`}
@@ -499,10 +410,10 @@ export class SearchBox extends ViewBoxBaseComponent<FieldViewProps, SearchBoxDoc
                             </select>
                             <div className="searchBox-dashboards" onClick={undoBatch(() => CurrentUserUtils.createNewDashboard(Doc.UserDoc()))}>
                                 New
-                        </div>
+                            </div>
                             <div className="searchBox-dashboards" onClick={undoBatch(() => CurrentUserUtils.snapshotDashboard(Doc.UserDoc()))}>
                                 Snapshot
-                        </div>
+                            </div>
                         </div>
                     </div>
                     <div className="searchBox-query" >
@@ -511,24 +422,12 @@ export class SearchBox extends ViewBoxBaseComponent<FieldViewProps, SearchBoxDoc
                             style={{ padding: 1, paddingLeft: 20, paddingRight: 60, color: "black", height: 20, width: 250 }} />
                         <div style={{ display: "flex", alignItems: "center" }}>
                             <div style={{ position: "absolute", left: 10 }}>
-                                <Tooltip title={<div className="dash-tooltip" >drag search results as collection</div>}>
-                                    <div ref={this.collectionRef}><FontAwesomeIcon onPointerDown={SetupDrag(this.collectionRef, () => StrCast(this.layoutDoc._searchString) ? this.startDragCollection() : undefined)} icon={"search"} size="lg"
-                                        style={{ cursor: "hand", color: "black", padding: 1, position: "relative" }} /></div>
-                                </Tooltip>
+                                <FontAwesomeIcon icon={"search"} size="lg"
+                                    style={{ color: "black", padding: 1, position: "relative" }} />
                             </div>
                             <div style={{ position: "absolute", left: Doc.UserDoc().noviceMode ? 220 : 200, width: 30, zIndex: 9000, color: "grey", background: "white", }}>
                                 {`${this._results.length}` + " of " + `${this.realTotalResults}`}
                             </div>
-                            {Doc.UserDoc().noviceMode ? (null) : <div style={{ cursor: "default", left: 235, position: "absolute", }}>
-                                <Tooltip title={<div className="dash-tooltip" >only display documents matching search</div>} >
-                                    <div>
-                                        <FontAwesomeIcon icon={"filter"} size="lg"
-                                            style={{ cursor: "hand", padding: 1, backgroundColor: this.filter ? "white" : "lightgray", color: this.filter ? "black" : "white" }}
-                                            onPointerDown={e => { e.stopPropagation(); SetupDrag(this.collectionRef, () => this.layoutDoc._searchString ? this.startDragCollection() : undefined); }}
-                                            onClick={action(() => this.setSearchFilter(this.currentSelectedCollection, this.filter ? undefined : this.docsforfilter))} />
-                                    </div>
-                                </Tooltip>
-                            </div>}
                         </div>
                     </div >
                 </div >
-- 
cgit v1.2.3-70-g09d2


From 1291e8a45ec9e3aeccd2ca74c0f549a18a16f0d7 Mon Sep 17 00:00:00 2001
From: usodhi <61431818+usodhi@users.noreply.github.com>
Date: Sat, 17 Jul 2021 16:23:29 -0400
Subject: preventing alias of on-screen doc from being added to off-screen doc
 list

---
 src/client/util/CurrentUserUtils.ts | 2 +-
 1 file changed, 1 insertion(+), 1 deletion(-)

(limited to 'src/client/util/CurrentUserUtils.ts')

diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts
index f3ba7334b..c96a6f656 100644
--- a/src/client/util/CurrentUserUtils.ts
+++ b/src/client/util/CurrentUserUtils.ts
@@ -1319,7 +1319,7 @@ Scripting.addGlobal(function dynamicOffScreenDocs(dashboard: Doc) {
         const onScreenTab = DocListCast(dashboard.data)[0];
         const onScreenDocs = DocListCast(onScreenTab.data);
         return new List<Doc>(allDocs.reduce((result: Doc[], doc) => {
-            !onScreenDocs.includes(doc) && (result.push(doc));
+            !onScreenDocs.includes(doc) && !onScreenDocs.includes(doc.aliasOf as Doc) && (result.push(doc));
             return result;
         }, []));
     }
-- 
cgit v1.2.3-70-g09d2


From 26f609792f477bc76b95c4c8eb0385da44e809be Mon Sep 17 00:00:00 2001
From: bobzel <zzzman@gmail.com>
Date: Thu, 22 Jul 2021 19:04:55 -0400
Subject: fixed custom text doc template.

---
 src/client/util/CurrentUserUtils.ts | 2 +-
 1 file changed, 1 insertion(+), 1 deletion(-)

(limited to 'src/client/util/CurrentUserUtils.ts')

diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts
index 5bab827d5..8a98304b2 100644
--- a/src/client/util/CurrentUserUtils.ts
+++ b/src/client/util/CurrentUserUtils.ts
@@ -405,7 +405,7 @@ export class CurrentUserUtils {
                 selection: { type: "text", anchor: 1, head: 1 },
                 storedMarks: []
             };
-            const headerTemplate = Docs.Create.RTFDocument(new RichTextField(JSON.stringify(json), ""), { title: "header", version: headerViewVersion, target: doc, _height: 70, _headerPointerEvents: "all", _headerHeight: 12, _headerFontSize: 9, _autoHeight: true, system: true, cloneFieldFilter: new List<string>(["system"]) }, "header"); // text needs to be a space to allow templateText to be created
+            const headerTemplate = Docs.Create.RTFDocument(new RichTextField(JSON.stringify(json), ""), { title: "text", version: headerViewVersion, target: doc, _height: 70, _headerPointerEvents: "all", _headerHeight: 12, _headerFontSize: 9, _autoHeight: true, system: true, cloneFieldFilter: new List<string>(["system"]) }, "header"); // text needs to be a space to allow templateText to be created
             const headerBtnHgt = 10;
             headerTemplate[DataSym].layout =
                 "<div style='height:100%'>" +
-- 
cgit v1.2.3-70-g09d2


From 14e66ac5bcdaa5e244be68ccb8cbb0c495917910 Mon Sep 17 00:00:00 2001
From: bobzel <zzzman@gmail.com>
Date: Fri, 23 Jul 2021 14:41:18 -0400
Subject: fixed issues with layoutString templates (eg customView): scale
 properly when in a time view, have a data doc, scripts are called with
 'scale' parmeter

---
 src/client/util/CurrentUserUtils.ts                | 16 +++++++++------
 src/client/views/DocComponent.tsx                  |  2 +-
 src/client/views/nodes/DocumentContentsView.tsx    | 11 +++++-----
 .../views/nodes/formattedText/FormattedTextBox.tsx | 11 +++++-----
 src/fields/Doc.ts                                  | 24 ++++++++++++++++++++--
 5 files changed, 45 insertions(+), 19 deletions(-)

(limited to 'src/client/util/CurrentUserUtils.ts')

diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts
index 8a98304b2..22504f102 100644
--- a/src/client/util/CurrentUserUtils.ts
+++ b/src/client/util/CurrentUserUtils.ts
@@ -405,14 +405,18 @@ export class CurrentUserUtils {
                 selection: { type: "text", anchor: 1, head: 1 },
                 storedMarks: []
             };
-            const headerTemplate = Docs.Create.RTFDocument(new RichTextField(JSON.stringify(json), ""), { title: "text", version: headerViewVersion, target: doc, _height: 70, _headerPointerEvents: "all", _headerHeight: 12, _headerFontSize: 9, _autoHeight: true, system: true, cloneFieldFilter: new List<string>(["system"]) }, "header"); // text needs to be a space to allow templateText to be created
+            const headerTemplate = Docs.Create.RTFDocument(new RichTextField(JSON.stringify(json), ""), {
+                title: "text", version: headerViewVersion, target: doc, _height: 70, _headerPointerEvents: "all",
+                _headerHeight: 12, _headerFontSize: 9, _autoHeight: true, system: true, _fitWidth: true,
+                cloneFieldFilter: new List<string>(["system"])
+            }, "header");
             const headerBtnHgt = 10;
             headerTemplate[DataSym].layout =
-                "<div style='height:100%'>" +
-                `    <FormattedTextBox {...props} fieldKey={'text'} height='calc(100% - ${headerBtnHgt}px - {this._headerHeight}px)'/>` +
-                "    <FormattedTextBox {...props} fieldKey={'header'}  dontSelectOnLoad='true' ignoreAutoHeight='true' fontSize='{this._headerFontSize}px' height='{this._headerHeight||1}px' background={this._headerColor ||this.target.mySharedDocs.userColor||'lightGray'} />" +
-                `    <HTMLdiv fontSize='${headerBtnHgt - 1}' onClick={‘(this._headerHeight=Math.min(Math.max(1,this._height-30),this._headerHeight===1?50:1)) && (this._autoHeightMargins=this._headerHeight+${headerBtnHgt})’}  height='${headerBtnHgt}px' background='yellow' >Metadata</HTMLdiv>` +
-                "</div>";
+                "<HTMLdiv transformOrigin='top left' width='{100/scale}%' height='{100/scale}%' transform='scale({scale})'>" +
+                `    <FormattedTextBox {...props} dontScale='true' fieldKey={'text'}  height='calc(100% - ${headerBtnHgt}px - {this._headerHeight}px)'/>` +
+                "    <FormattedTextBox {...props} dontScale='true' fieldKey={'header'}  dontSelectOnLoad='true' ignoreAutoHeight='true' fontSize='{this._headerFontSize}px' height='{(this._headerHeight||1)}px' background='{this._headerColor ||this.target.mySharedDocs.userColor||`lightGray`}' />" +
+                `    <HTMLdiv fontSize='${headerBtnHgt - 1}px' height='${headerBtnHgt}px' background='yellow' onClick={‘(this._headerHeight=scale*Math.min(Math.max(1,this._height-30),this._headerHeight===1?50:1)) && (this._autoHeightMargins=this._headerHeight+${headerBtnHgt})’}  >Metadata</HTMLdiv>` +
+                "</HTMLdiv>";
 
             // "<div style={'height:100%'}>" +
             // "    <FormattedTextBox {...props} fieldKey={'header'} dontSelectOnLoad={'true'} ignoreAutoHeight={'true'} pointerEvents='{this._headerPointerEvents||`none`}' fontSize='{this._headerFontSize}px' height='{this._headerHeight}px' background='{this._headerColor||this.target.mySharedDocs.userColor}' />" +
diff --git a/src/client/views/DocComponent.tsx b/src/client/views/DocComponent.tsx
index da8af7cc0..0b70ce68d 100644
--- a/src/client/views/DocComponent.tsx
+++ b/src/client/views/DocComponent.tsx
@@ -119,7 +119,7 @@ export function ViewBoxAnnotatableComponent<P extends ViewBoxAnnotatableProps, T
 
         styleFromLayoutString = (scale: number) => {
             const style: { [key: string]: any } = {};
-            const divKeys = ["width", "height", "fontSize", "left", "background", "left", "right", "top", "bottom", "pointerEvents", "position"];
+            const divKeys = ["width", "height", "fontSize", "transform", "left", "background", "left", "right", "top", "bottom", "pointerEvents", "position"];
             const replacer = (match: any, expr: string, offset: any, string: any) => { // bcz: this executes a script to convert a property expression string:  { script }  into a value
                 return ScriptField.MakeFunction(expr, { self: Doc.name, this: Doc.name, scale: "number" })?.script.run({ self: this.rootDoc, this: this.layoutDoc, scale }).result as string || "";
             };
diff --git a/src/client/views/nodes/DocumentContentsView.tsx b/src/client/views/nodes/DocumentContentsView.tsx
index a0a40becb..9b75cd8f9 100644
--- a/src/client/views/nodes/DocumentContentsView.tsx
+++ b/src/client/views/nodes/DocumentContentsView.tsx
@@ -64,6 +64,7 @@ interface HTMLtagProps {
     htmltag: string;
     onClick?: ScriptField;
     onInput?: ScriptField;
+    scaling: number;
 }
 
 //"<HTMLdiv borderRadius='100px' onClick={this.bannerColor=this.bannerColor==='red'?'green':'red'} overflow='hidden' position='absolute' width='100%' height='100%' transform='rotate({2*this.x+this.y}deg)'> <ImageBox {...props} fieldKey={'data'}/> <HTMLspan width='200px' top='0' height='35px' textAlign='center' paddingTop='10px' transform='translate(-40px, 45px) rotate(-45deg)' position='absolute' color='{this.bannerColor===`green`?`light`:`dark`}blue' backgroundColor='{this.bannerColor===`green`?`dark`:`light`}blue'> {this.title}</HTMLspan></HTMLdiv>"
@@ -82,7 +83,7 @@ interface HTMLtagProps {
 export class HTMLtag extends React.Component<HTMLtagProps> {
     click = (e: React.MouseEvent) => {
         const clickScript = (this.props as any).onClick as Opt<ScriptField>;
-        clickScript?.script.run({ this: this.props.Document, self: this.props.RootDoc });
+        clickScript?.script.run({ this: this.props.Document, self: this.props.RootDoc, scale: this.props.scaling });
     }
     onInput = (e: React.FormEvent<HTMLDivElement>) => {
         const onInputScript = (this.props as any).onInput as Opt<ScriptField>;
@@ -90,9 +91,9 @@ export class HTMLtag extends React.Component<HTMLtagProps> {
     }
     render() {
         const style: { [key: string]: any } = {};
-        const divKeys = OmitKeys(this.props, ["children", "htmltag", "RootDoc", "Document", "key", "onInput", "onClick", "__proto__"]).omit;
+        const divKeys = OmitKeys(this.props, ["children", "htmltag", "RootDoc", "scaling", "Document", "key", "onInput", "onClick", "__proto__"]).omit;
         const replacer = (match: any, expr: string, offset: any, string: any) => { // bcz: this executes a script to convert a propery expression string:  { script }  into a value
-            return ScriptField.MakeFunction(expr, { self: Doc.name, this: Doc.name })?.script.run({ self: this.props.RootDoc, this: this.props.Document }).result as string || "";
+            return ScriptField.MakeFunction(expr, { self: Doc.name, this: Doc.name, scale: "number" })?.script.run({ self: this.props.RootDoc, this: this.props.Document, scale: this.props.scaling }).result as string || "";
         };
         Object.keys(divKeys).map((prop: string) => {
             const p = (this.props as any)[prop] as string;
@@ -184,7 +185,7 @@ export class DocumentContentsView extends React.Component<DocumentViewProps & Fo
 
         // replace HTML<tag> with corresponding HTML tag as in:  <HTMLdiv> becomes  <HTMLtag Document={props.Document} htmltag='div'> 
         const replacer2 = (match: any, p1: string, offset: any, string: any) => {
-            return `<HTMLtag RootDoc={props.RootDoc} Document={props.Document} htmltag='${p1}'`;
+            return `<HTMLtag RootDoc={props.RootDoc} Document={props.Document} scaling='${this.props.scaling?.() || 1}' htmltag='${p1}'`;
         };
         layoutFrame = layoutFrame.replace(/<HTML([a-zA-Z0-9_-]+)/g, replacer2);
 
@@ -200,7 +201,7 @@ export class DocumentContentsView extends React.Component<DocumentViewProps & Fo
             if (splits.length > 1) {
                 const code = XRegExp.matchRecursive(splits[1], "{", "}", "", { valueNames: ["between", "left", "match", "right", "between"] });
                 layoutFrame = splits[0] + ` ${func}={props.${func}} ` + splits[1].substring(code[1].end + 1);
-                return ScriptField.MakeScript(code[1].value, { this: Doc.name, self: Doc.name, value: "string" });
+                return ScriptField.MakeScript(code[1].value, { this: Doc.name, self: Doc.name, scale: "number", value: "string" });
             }
             return undefined;
             // add input function to props
diff --git a/src/client/views/nodes/formattedText/FormattedTextBox.tsx b/src/client/views/nodes/formattedText/FormattedTextBox.tsx
index 95d8f555c..6dd63fb47 100644
--- a/src/client/views/nodes/formattedText/FormattedTextBox.tsx
+++ b/src/client/views/nodes/formattedText/FormattedTextBox.tsx
@@ -71,6 +71,7 @@ export interface FormattedTextBoxProps {
     xPadding?: number;   // used to override document's settings for xMargin --- see CollectionCarouselView
     yPadding?: number;
     noSidebar?: boolean;
+    dontScale?: boolean;
     dontSelectOnLoad?: boolean; // suppress selecting the text box when loaded (and mark as not being associated with scrollTop document field)
 }
 export const GoogleRef = "googleDocId";
@@ -126,7 +127,7 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
     @computed get scrollHeight() { return NumCast(this.rootDoc[this.fieldKey + "-scrollHeight"]); }
     @computed get sidebarHeight() { return !this.sidebarWidth() ? 0 : NumCast(this.rootDoc[this.SidebarKey + "-height"]); }
     @computed get titleHeight() { return this.props.styleProvider?.(this.layoutDoc, this.props, StyleProp.HeaderMargin) || 0; }
-    @computed get autoHeightMargins() { return this.titleHeight + (this.layoutDoc._autoHeightMargins && !this.props.dontSelectOnLoad ? NumCast(this.layoutDoc._autoHeightMargins) : 0); }
+    @computed get autoHeightMargins() { return this.titleHeight + NumCast(this.layoutDoc._autoHeightMargins); }
     @computed get _recording() { return this.dataDoc?.mediaState === "recording"; }
     set _recording(value) {
         !this.dataDoc.recordingSource && (this.dataDoc.mediaState = value ? "recording" : undefined);
@@ -1524,10 +1525,10 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
             <div className="formattedTextBox-cont"
                 onWheel={e => this.isContentActive() && e.stopPropagation()}
                 style={{
-                    transform: `scale(${scale})`,
-                    transformOrigin: "top left",
-                    width: `${100 / scale}%`,
-                    height: `${100 / scale}%`,
+                    transform: this.props.dontScale ? undefined : `scale(${scale})`,
+                    transformOrigin: this.props.dontScale ? undefined : "top left",
+                    width: this.props.dontScale ? undefined : `${100 / scale}%`,
+                    height: this.props.dontScale ? undefined : `${100 / scale}%`,
                     // overflowY: this.layoutDoc._autoHeight ? "hidden" : undefined,
                     ...this.styleFromLayoutString(scale)   // this converts any expressions in the format string to style props.  e.g., <FormattedTextBox height='{this._headerHeight}px' >
                 }}>
diff --git a/src/fields/Doc.ts b/src/fields/Doc.ts
index bd0ba3ad7..464a8ad05 100644
--- a/src/fields/Doc.ts
+++ b/src/fields/Doc.ts
@@ -803,6 +803,27 @@ export namespace Doc {
         return undefined;
     }
 
+    // Makes a delegate of a document by first creating a delegate where data should be stored
+    // (ie, the 'data' doc), and then creates another delegate of that (ie, the 'layout' doc).
+    // This is appropriate if you're trying to create a document that behaves like all
+    // regularly created documents (e.g, text docs, pdfs, etc which all have data/layout docs)
+    export function MakeDelegateWithProto(doc: Doc, id?: string, title?: string): Doc {
+        const delegateProto = new Doc();
+        delegateProto[Initializing] = true;
+        delegateProto.proto = doc;
+        delegateProto.author = Doc.CurrentUserEmail;
+        delegateProto.isPrototype = true;
+        title && (delegateProto.title = title);
+        const delegate = new Doc(id, true);
+        delegate[Initializing] = true;
+        delegate.proto = delegateProto;
+        delegate.author = Doc.CurrentUserEmail;
+        Doc.AddDocToList(delegateProto[DataSym], "aliases", delegate);
+        delegate[Initializing] = false;
+        delegateProto[Initializing] = false;
+        return delegate;
+    }
+
     let _applyCount: number = 0;
     export function ApplyTemplate(templateDoc: Doc) {
         if (templateDoc) {
@@ -1150,8 +1171,7 @@ export namespace Doc {
         return ndoc;
     }
     export function delegateDragFactory(dragFactory: Doc) {
-        const ndoc = Doc.MakeDelegate(dragFactory);
-        ndoc.isPrototype = true;
+        const ndoc = Doc.MakeDelegateWithProto(dragFactory);
         if (ndoc && dragFactory["dragFactory-count"] !== undefined) {
             dragFactory["dragFactory-count"] = NumCast(dragFactory["dragFactory-count"]) + 1;
             Doc.GetProto(ndoc).title = ndoc.title + " " + NumCast(dragFactory["dragFactory-count"]).toString();
-- 
cgit v1.2.3-70-g09d2


From fc1559fd74bde212f418b27806b68a76748153ad Mon Sep 17 00:00:00 2001
From: dg314 <david_grossman@brown.edu>
Date: Thu, 29 Jul 2021 15:12:03 -0400
Subject: search panel updates

---
 src/client/util/CurrentUserUtils.ts    |  11 +-
 src/client/views/MainView.tsx          |   6 +-
 src/client/views/search/SearchBox.scss | 173 ++++--------
 src/client/views/search/SearchBox.tsx  | 491 +++++++++++++++------------------
 4 files changed, 291 insertions(+), 390 deletions(-)

(limited to 'src/client/util/CurrentUserUtils.ts')

diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts
index 596ccd9a6..31384da3b 100644
--- a/src/client/util/CurrentUserUtils.ts
+++ b/src/client/util/CurrentUserUtils.ts
@@ -947,17 +947,12 @@ export class CurrentUserUtils {
 
     // Search sidebar is where searches within the document are performed
     static setupSearchSidebar(doc: Doc) {
-        if (doc.mySearchPanelDoc === undefined) {
-            doc.mySearchPanelDoc = new PrefetchProxy(Docs.Create.SearchDocument({
-                _width: 500, _height: 300, backgroundColor: "dimGray", ignoreClick: true, _searchDoc: true,
+        if (doc.mySearchPanel === undefined) {
+            doc.mySearchPanel = new PrefetchProxy(Docs.Create.SearchDocument({
+                backgroundColor: "dimGray", ignoreClick: true, _searchDoc: true,
                 childDropAction: "alias", _lockedPosition: true, _viewType: CollectionViewType.Schema, title: "sidebar search stack", system: true
             })) as any as Doc;
         }
-        if (doc.mySearchPanel === undefined) {
-            const searchPanelDoc = Cast(doc.mySearchPanelDoc, Doc, null);
-            //const newUpload = CurrentUserUtils.ficon({ onClick: ScriptField.MakeScript("importDocument()"), toolTip: "Import External document", _stayInCollection: true, _hideContextMenu: true, title: "Import", icon: "upload", system: true });
-            doc.mySearchPanel = new PrefetchProxy(Docs.Create.StackingDocument([searchPanelDoc], { title: "Search", _yMargin: 20, ignoreClick: true, _chromeHidden: true, _stayInCollection: true, _hideContextMenu: true, _lockedPosition: true, system: true }));
-        }
     }
 
     static setupClickEditorTemplates(doc: Doc) {
diff --git a/src/client/views/MainView.tsx b/src/client/views/MainView.tsx
index bc9c6f4d2..0d957518b 100644
--- a/src/client/views/MainView.tsx
+++ b/src/client/views/MainView.tsx
@@ -178,12 +178,12 @@ export class MainView extends React.Component {
         const targets = document.elementsFromPoint(e.x, e.y);
         if (targets.length) {
             const targClass = targets[0].className.toString();
-            if (SearchBox.Instance._searchbarOpen || SearchBox.Instance.open) {
+            /*if (SearchBox.Instance._resultsOpen) {
                 const check = targets.some((thing) =>
                 (thing.className === "collectionSchemaView-searchContainer" || (thing as any)?.dataset.icon === "filter" ||
                     thing.className === "collectionSchema-header-menuOptions"));
                 !check && SearchBox.Instance.resetSearch(true);
-            }
+            }*/
             !targClass.includes("contextMenu") && ContextMenu.Instance.closeMenu();
             !["timeline-menu-desc", "timeline-menu-item", "timeline-menu-input"].includes(targClass) && TimelineMenu.Instance.closeMenu();
         }
@@ -192,7 +192,7 @@ export class MainView extends React.Component {
     initEventListeners = () => {
         window.addEventListener("drop", e => e.preventDefault(), false);  // prevent default behavior of navigating to a new web page
         window.addEventListener("dragover", e => e.preventDefault(), false);
-        document.addEventListener("pointermove", action(e => SearchBox.Instance._undoBackground = UndoManager.batchCounter ? "#000000a8" : undefined));
+        //document.addEventListener("pointermove", action(e => SearchBox.Instance._undoBackground = UndoManager.batchCounter ? "#000000a8" : undefined));
         document.addEventListener("pointerdown", this.globalPointerDown);
         document.addEventListener("click", (e: MouseEvent) => {
             if (!e.cancelBubble) {
diff --git a/src/client/views/search/SearchBox.scss b/src/client/views/search/SearchBox.scss
index 4f5b7e41a..f8e994da7 100644
--- a/src/client/views/search/SearchBox.scss
+++ b/src/client/views/search/SearchBox.scss
@@ -2,141 +2,84 @@
 @import "./NaviconButton.scss";
 
 .searchBox-container {
-    display: flex;
-    flex-direction: column;
     width: 100%;
     height: 100%;
-    position: relative;
     font-size: 10px;
     line-height: 1;
-    overflow-y: auto;
-    overflow-x: visible;
-    background: lightgrey;
-    overflow: visible;
+    background: none;
     z-index: 1000;
+    padding: 0px;
+    cursor: default;
 
     .searchBox-bar {
-        height: $searchpanel-height;
+        width: 100%;
+        height: 35px;
         display: flex;
         justify-content: center;
         align-items: center;
-        background-color: black;
+        background-color: none;
+        padding: 5px;
 
-        .searchBox-lozenges {
-            position: absolute;
-            left: 15;
-            display: flex;
-
-            .searchBox-lozenge-user,
-            .searchBox-lozenge-dashboard,
-            .searchBox-lozenge {
-                height: 18px;
-                padding: 4px;
-                margin-right: 5px;
-                display: flex;
-                align-items: center;
-                border: grey 1px solid;
-                .searchBox-logoff,
-                .searchBox-dashboards {
-                    border-radius: 3px;
-                    background: olivedrab;
-                    color: white;
-                    display: none;
-                    margin-left: 5px;
-                    padding: 1px 2px 1px 2px;
-                    cursor: pointer;
-                }
-                .searchBox-logoff {
-                    background: red;
-                }
-
-                .searchBox-dashSelect{
-                    border: none;
-                    background-color: transparent;
+        .searchBox-type {
+            display: block;
+            width: 50px;
+            outline: none;
+            padding: 1px 5px 1px 5px;
+            color: black;
+            height: 25px;
+            border: 1px solid black;
+        }
 
-                    &:hover {
-                        cursor: pointer;
-                    }
-                }
-            }
-            .searchBox-lozenge-user:hover {
-                .searchBox-logoff {
-                    display:inline-block;
-                }
-            }
-            .searchBox-lozenge-dashboard:hover {
-                .searchBox-dashboards {
-                    display:inline-block;
-                }
-            }
+        .searchBox-input {
+            display: block;
+            width: calc(100% - 50px);
+            outline: none;
+            padding: 1px 5px 1px 5px;
+            color: black;
+            height: 25px;
+            border: 1px solid black;
         }
-        .searchBox-query {
-            position: relative;
+    }
+
+    .searchBox-results-container {
+        display: flex;
+        flex-direction: column;
+        width: 100%;
+        height: 100%;
+        justify-content: "center";
+    
+        .searchBox-results-count {
             display: flex;
-            width: 450;
+            color: gray;
+            margin-left: 5px;
         }
-        .searchBox-barChild {
+    
+        .searchBox-results-scroll-view {
+            margin-top: 10px;
+            display: inline-block;
+            width: 100%;
+            height: calc(100% - 55px);
+            overflow-y: scroll;
 
-            &.searchBox-collection {
-                flex: 0 1 auto;
-                margin-left: 2px;
-                margin-right: 2px
-            }
+            .searchBox-results-scroll-view-result {
+                display: inline-block;
+                vertical-align: middle;
+                width: 100%;
+                height: 40px;
+                cursor: pointer;
+                font-size: 15px;
+                padding: 10px;
 
-            &.searchBox-input {
-                margin:5px;
-                border-radius:20px;
-                border:black;    
-                display: block;
-                width: 130px;
-                -webkit-transition: width 0.4s;
-                transition: width 0.4s;
-                align-self: stretch;
-                outline:none;
-                &:focus {
-                    width: 500px;
-                    outline:none;
+                &.searchBox-results-scroll-view-result-selected {
+                    background: gray;
                 }
-            }
-            &.searchBox-filter {
-                align-self: stretch;
-                button{
-                    transform:none;
-                    &:hover {
-                        transform: none;
-                    }
-                }
-            }
 
-            &.searchBox-submit {
-                margin-left: 2px;
-                margin-right: 2px
-            }
-
-            &.searchBox-close {
-                color: $light-color;
-                max-height: $searchpanel-height;
+                .titletitle {
+                    display: relative;
+                    float: left;
+                    left: 50px;
+                }
             }
         }
-    }   
-}
-
-.searchBox-results {
-    display: flex;
-    flex-direction: column;
-    top: 300px;
-    display: flex;
-    flex-direction: column;
-    height: 100%;
-    overflow: visible;
-
-    .no-result {
-        width: 500px;
-        background: $light-color-secondary;
-        padding: 10px;
-        height: 50px;
-        text-transform: uppercase;
-        text-align: left;
-        font-weight: bold;
     }
 }
\ No newline at end of file
diff --git a/src/client/views/search/SearchBox.tsx b/src/client/views/search/SearchBox.tsx
index cc4590969..374a754bf 100644
--- a/src/client/views/search/SearchBox.tsx
+++ b/src/client/views/search/SearchBox.tsx
@@ -3,7 +3,7 @@ import { Tooltip } from '@material-ui/core';
 import { action, computed, IReactionDisposer, observable, reaction, runInAction } from 'mobx';
 import { observer } from 'mobx-react';
 import * as React from 'react';
-import { Doc, DocListCast, Field, Opt, DocListCastAsync, DataSym, HeightSym } from '../../../fields/Doc';
+import { Doc, DocListCast, Field, Opt, DocListCastAsync, DataSym, HeightSym, FieldsSym } from '../../../fields/Doc';
 import { documentSchema } from "../../../fields/documentSchemas";
 import { Copy, Id, ToString } from '../../../fields/FieldSymbols';
 import { List } from '../../../fields/List';
@@ -26,6 +26,9 @@ import "./SearchBox.scss";
 import { undoBatch } from "../../util/UndoManager";
 import { DocServer } from "../../DocServer";
 import { MainView } from "../MainView";
+import { DocumentManager } from "../../util/DocumentManager";
+import { CollectionSchemaBooleanCell } from "../collections/CollectionSchemaCells";
+import { transpileModule } from "typescript";
 
 export const searchSchema = createSchema({ Document: Doc });
 
@@ -38,33 +41,18 @@ export class SearchBox extends ViewBoxBaseComponent<FieldViewProps, SearchBoxDoc
     public static Instance: SearchBox;
 
     private _allIcons: string[] = [DocumentType.INK, DocumentType.AUDIO, DocumentType.COL, DocumentType.IMG, DocumentType.LINK, DocumentType.PDF, DocumentType.RTF, DocumentType.VID, DocumentType.WEB];
-    private _numResultsPerPage = 500;
-    private _numTotalResults = -1;
-    private _endIndex = -1;
-    private _lockPromise?: Promise<void>;
     private _resultsSet = new Map<Doc, number>();
     private _inputRef = React.createRef<HTMLInputElement>();
-    private _maxSearchIndex: number = 0;
-    private _curRequest?: Promise<any> = undefined;
     private _disposers: { [name: string]: IReactionDisposer } = {};
     private _blockedTypes = [DocumentType.PRESELEMENT, DocumentType.KVP, DocumentType.FILTER, DocumentType.SEARCH, DocumentType.SEARCHITEM, DocumentType.FONTICON, DocumentType.BUTTON, DocumentType.SCRIPTING];
 
-    private docsforfilter: Doc[] | undefined = [];
-    private realTotalResults: number = 0;
-    private newsearchstring = "";
-
-    @observable _undoBackground: string | undefined = "";
+    @observable _searchString = "";
+    @observable _docTypeString = "all";
     @observable _icons: string[] = this._allIcons;
     @observable _results: [Doc, string[], string[]][] = [];
-    @observable _visibleElements: JSX.Element[] = [];
-    @observable _visibleDocuments: Doc[] = [];
+    @observable _selectedResult: Doc | undefined = undefined;
     @observable _deletedDocsStatus: boolean = false;
     @observable _onlyAliases: boolean = true;
-    @observable _searchbarOpen = false;
-    @observable _noResults = "";
-    @observable _pageStart = 0;
-    @observable open = false;
-    @observable children = 0;
     @computed get filter() { return this._results?.length && (this.currentSelectedCollection?.props.Document._searchFilterDocs || this.currentSelectedCollection?.props.Document._docFilters); }
 
     constructor(props: any) {
@@ -76,8 +64,6 @@ export class SearchBox extends ViewBoxBaseComponent<FieldViewProps, SearchBoxDoc
         if (this._inputRef.current) {
             this._inputRef.current.focus();
         }
-        this._disposers.filters = reaction(() => this.props.Document._docFilters,
-            (filters: any) => this.setSearchFilter(this.currentSelectedCollection, !this.filter ? undefined : this.docsforfilter));
     });
 
     componentWillUnmount() {
@@ -86,32 +72,25 @@ export class SearchBox extends ViewBoxBaseComponent<FieldViewProps, SearchBoxDoc
 
     @computed get currentSelectedCollection() { return CollectionDockingView.Instance; }
 
-    onChange = action((e: React.ChangeEvent<HTMLInputElement>) => {
-        this.newsearchstring = e.target.value;
-        if (e.target.value === "") {
-            console.log("Reset start");
-            this.docsforfilter = undefined;
-            this.setSearchFilter(this.currentSelectedCollection, undefined);
-            this.resetSearch(false);
-
-            this.open = false;
-            this._results = [];
-            this._resultsSet.clear();
-            this._visibleElements = [];
-            this._numTotalResults = -1;
-            this._endIndex = -1;
-            this._curRequest = undefined;
-            this._maxSearchIndex = 0;
-        }
+    onInputChange = action((e: React.ChangeEvent<HTMLInputElement>) => {
+        this._searchString = e.target.value;
+        this.submitSearch();
     });
 
-    enter = action((e: React.KeyboardEvent | undefined) => {
+    onSelectChange = action((e: React.ChangeEvent<HTMLSelectElement>) => {
+        this._docTypeString = e.target.value;
+        this.submitSearch();
+    });
+
+    /*enter = action((e: React.KeyboardEvent | undefined) => {
         if (!e || e.key === "Enter") {
-            this.layoutDoc._searchString = this.newsearchstring;
-            this._pageStart = 0;
-            this.open = true;
             this.submitSearch();
         }
+    });*/
+
+    onResultClick = action((doc: Doc) => {
+        this.selectElement(doc);
+        this._selectedResult = doc;
     });
 
     @action
@@ -126,21 +105,6 @@ export class SearchBox extends ViewBoxBaseComponent<FieldViewProps, SearchBoxDoc
         return finalDocs;
     }
 
-    static async foreachRecursiveDocAsync(docs: Doc[], func: (doc: Doc) => void) {
-        let newarray: Doc[] = [];
-        while (docs.length > 0) {
-            newarray = [];
-            await Promise.all(docs.filter(d => d).map(async d => {
-                const fieldKey = Doc.LayoutFieldKey(d);
-                const annos = !Field.toString(Doc.LayoutField(d) as Field).includes("CollectionView");
-                const data = d[annos ? fieldKey + "-annotations" : fieldKey];
-                const docs = await DocListCastAsync(data);
-                docs && newarray.push(...docs);
-                func(d);
-            }));
-            docs = newarray;
-        }
-    }
     static foreachRecursiveDoc(docs: Doc[], func: (doc: Doc) => void) {
         let newarray: Doc[] = [];
         while (docs.length > 0) {
@@ -172,15 +136,7 @@ export class SearchBox extends ViewBoxBaseComponent<FieldViewProps, SearchBoxDoc
             });
 
             this._results = found;
-            this.docsforfilter = this._results.map(r => r[0]);
-            this.setSearchFilter(selectedCollection, this.filter && found.length ? this.docsforfilter : undefined);
-            this._numTotalResults = found.length;
-            this.realTotalResults = found.length;
         }
-        else {
-            this._noResults = "No collection selected :(";
-        }
-
     }
 
     static documentKeys(doc: Doc) {
@@ -197,246 +153,253 @@ export class SearchBox extends ViewBoxBaseComponent<FieldViewProps, SearchBoxDoc
 
     @action
     submitSearch = async () => {
-        this.resetSearch(false);
-
-        //this.props.Document._docFilters = new List();
-        this._noResults = "";
+        this.resetSearch();
 
         this.dataDoc[this.fieldKey] = new List<Doc>([]);
-        this.children = 0;
-        let query = StrCast(this.layoutDoc._searchString);
+        let query = StrCast(this._searchString);
         Doc.SetSearchQuery(query);
         this._results = [];
         this._resultsSet.clear();
-        this._visibleElements = [];
-        this._visibleDocuments = [];
 
         if (query) {
-            this._endIndex = 12;
-            this._maxSearchIndex = 0;
-            this._numTotalResults = -1;
             this.searchCollection(query);
-            runInAction(() => {
-                this.open = this._searchbarOpen = true;
-                this.resultsScrolled();
-            });
         }
     }
 
-    getAllResults = async (query: string) => {
-        return SearchUtil.Search(query, true, { fq: this.filterQuery, start: 0, rows: 10000000 });
-    }
+    resetSearch = action(() => {
+        this._results.forEach(result => {
+            Doc.UnBrushDoc(result[0]);
+            Doc.ClearSearchMatches();
+        });
+    });
 
-    private get filterQuery() {
-        const baseExpr = "NOT system_b:true";
-        const authorExpr = undefined;
-        const includeDeleted = this._deletedDocsStatus ? "" : " NOT deleted_b:true";
-        const typeExpr = this._onlyAliases ? "NOT {!join from=id to=proto_i}type_t:*" : `(type_t:* OR {!join from=id to=proto_i}type_t:*) ${this._blockedTypes.map(type => `NOT ({!join from=id to=proto_i}type_t:${type}) AND NOT type_t:${type}`).join(" AND ")}`;
-        // fq: type_t:collection OR {!join from=id to=proto_i}type_t:collection   q:text_t:hello
-        return [baseExpr, authorExpr, includeDeleted, typeExpr].filter(q => q).join(" AND ").replace(/AND $/, "");
+    selectElement = async (doc: Doc) => {
+        await DocumentManager.Instance.jumpToDocument(doc, true); // documents open in new tab instead of on right    
     }
 
-    @computed get primarySort() {
-        const suffixMap = (type: ColumnType) => {
-            switch (type) {
-                case ColumnType.Date: return "_d";
-                case ColumnType.String: return "_t";
-                case ColumnType.Boolean: return "_b";
-                case ColumnType.Number: return "_n";
+    render() {
+        const results = this._results.map(result => {
+            var className = "searchBox-results-scroll-view-result";
+
+            if (this._selectedResult == result[0]) {
+                className += " searchBox-results-scroll-view-result-selected"
             }
-        };
-        const headers = Cast(this.props.Document._schemaHeaders, listSpec(SchemaHeaderField), []);
-        return headers.reduce((p: Opt<string>, header: SchemaHeaderField) => p || (header.desc !== undefined && suffixMap(header.type) ? (header.heading + suffixMap(header.type) + (header.desc ? " desc" : " asc")) : undefined), undefined);
-    }
 
-    searchDatabase = async (query: string) => {
-        this._lockPromise && (await this._lockPromise);
-        this._lockPromise = new Promise(async res => {
-            while (this._results.length <= this._endIndex && (this._numTotalResults === -1 || this._maxSearchIndex < this._numTotalResults)) {
-                this._curRequest = SearchUtil.Search(query, true, { onlyAliases: true, allowAliases: true, /*sort: this.primarySort,*/ fq: this.filterQuery, start: 0, rows: this._numResultsPerPage, hl: "on", "hl.fl": "*", }).then(action(async (res: SearchUtil.DocSearchResult) => {
-                    // happens at the beginning
-                    this.realTotalResults = res.numFound <= 0 ? 0 : res.numFound;
-                    if (res.numFound !== this._numTotalResults && this._numTotalResults === -1) {
-                        this._numTotalResults = res.numFound;
-                    }
-                    const highlighting = res.highlighting || {};
-                    const highlightList = res.docs.map(doc => highlighting[doc[Id]]);
-                    const lines = new Map<string, string[]>();
-                    res.docs.map((doc, i) => lines.set(doc[Id], res.lines[i]));
-                    const docs = res.docs;
-                    const highlights: typeof res.highlighting = {};
-                    docs.forEach((doc, index) => highlights[doc[Id]] = highlightList[index]);
-                    const filteredDocs = this.filterDocsByType(docs);
-
-                    runInAction(() => filteredDocs.forEach((doc, i) => {
-                        const index = this._resultsSet.get(doc);
-                        const highlight = highlights[doc[Id]];
-                        const line = lines.get(doc[Id]) || [];
-                        const hlights = highlight ? Object.keys(highlight).map(key => key.substring(0, key.length - 2)).filter(k => k) : [];
-                        // if (this.findCommonElements(hlights)) {
-                        // }
-                        if (index === undefined) {
-                            this._resultsSet.set(doc, this._results.length);
-                            this._results.push([doc, hlights, line]);
-                        } else {
-                            this._results[index][1].push(...hlights);
-                            this._results[index][2].push(...line);
-                        }
-                    }));
-
-                    this._curRequest = undefined;
-                }));
-                this._maxSearchIndex += this._numResultsPerPage;
-
-                await this._curRequest;
+            if (this._docTypeString == "all" || this._docTypeString == result[0].type) {
+                return (<div key={result[0][Id]} onClick={() => this.onResultClick(result[0])} className={className}><div className="titletitle">{result[0].title}</div></div>)
             }
 
-            this.resultsScrolled();
+            return null;
+        })
 
-            const selectedCollection = this.currentSelectedCollection;//SelectionManager.SelectedDocuments()[0];
-            this.docsforfilter = this._results.map(r => r[0]);
-            this.setSearchFilter(selectedCollection, this.filter ? this.docsforfilter : undefined);
-            res();
-        });
-        return this._lockPromise;
+        results.filter(result => result)
+
+        return (
+            <div style={{ pointerEvents: "all" }} className="searchBox-container">
+                <div className="searchBox-bar">
+                    <select name="type" id="searchBox-type" className="searchBox-type" onChange={this.onSelectChange}>
+                        <option value="all">All</option>
+                        <option value="rtf">Text</option>
+                        <option value="img">Image</option>
+                        <option value="pdf">PDF</option>
+                    </select>
+                    <input defaultValue={""} autoComplete="off" onChange={this.onInputChange} type="text" placeholder="Search..." id="search-input" ref={this._inputRef} className="searchBox-input" />
+                </div >
+                <div className="searchBox-results-container">
+                    <div className="searchBox-results-count">
+                        {`${results.length}` + " result" + (results.length == 1 ? "" : "s")}
+                    </div>
+                    <div className="searchBox-results-scroll-view">
+                        {results}
+                    </div>
+                </div>
+            </div >
+        );
     }
+}
+
+
+
+/*
+import { FontAwesomeIcon } from "@fortawesome/react-fontawesome";
+import { Tooltip } from '@material-ui/core';
+import { action, computed, IReactionDisposer, observable, reaction, runInAction } from 'mobx';
+import { observer } from 'mobx-react';
+import * as React from 'react';
+import { Doc, DocListCast, Field, Opt, DocListCastAsync, DataSym, HeightSym, FieldsSym } from '../../../fields/Doc';
+import { documentSchema } from "../../../fields/documentSchemas";
+import { Copy, Id, ToString } from '../../../fields/FieldSymbols';
+import { List } from '../../../fields/List';
+import { createSchema, listSpec, makeInterface } from '../../../fields/Schema';
+import { SchemaHeaderField } from '../../../fields/SchemaHeaderField';
+import { Cast, NumCast, StrCast } from '../../../fields/Types';
+import { emptyFunction, returnFalse, returnZero, setupMoveUpEvents, Utils } from '../../../Utils';
+import { Docs } from '../../documents/Documents';
+import { DocumentType } from "../../documents/DocumentTypes";
+import { CurrentUserUtils } from "../../util/CurrentUserUtils";
+import { SetupDrag } from '../../util/DragManager';
+import { SearchUtil } from '../../util/SearchUtil';
+import { Transform } from '../../util/Transform';
+import { CollectionDockingView } from "../collections/CollectionDockingView";
+import { CollectionSchemaView, ColumnType } from "../collections/CollectionSchemaView";
+import { CollectionViewType } from '../collections/CollectionView';
+import { ViewBoxBaseComponent } from "../DocComponent";
+import { FieldView, FieldViewProps } from '../nodes/FieldView';
+import "./SearchBox.scss";
+import { undoBatch } from "../../util/UndoManager";
+import { DocServer } from "../../DocServer";
+import { MainView } from "../MainView";
+import { SelectionManager } from "../../util/SelectionManager";
+import { CollectionSchemaBooleanCell } from "../collections/CollectionSchemaCells";
+import { transpileModule } from "typescript";
+import { DocumentManager } from "../../util/DocumentManager";
+
+export const searchSchema = createSchema({ Document: Doc });
+
+type SearchBoxDocument = makeInterface<[typeof documentSchema, typeof searchSchema]>;
+const SearchBoxDocument = makeInterface(documentSchema, searchSchema);
+
+@observer
+export class SearchBox extends ViewBoxBaseComponent<FieldViewProps, SearchBoxDocument>(SearchBoxDocument) {
+    public static LayoutString(fieldKey: string) { return FieldView.LayoutString(SearchBox, fieldKey); }
+    public static Instance: SearchBox;
+
+    @observable _searchString = "";
+    @observable _docTypeString = "all";
+    @observable _results: [Doc, string[], string[]][] = [];
+    @observable _selectedResult: Doc | undefined = undefined;
+    @observable _deletedDocsStatus: boolean = false;
+    @observable _onlyAliases: boolean = true;
 
-    @action.bound
-    openSearch(e: React.SyntheticEvent) {
-        e.stopPropagation();
-        this._results.forEach(result => Doc.BrushDoc(result[0]));
+    constructor(props: any) {
+        super(props);
+        SearchBox.Instance = this;
     }
 
-    resetSearch = action((close: boolean) => {
-        this._results.forEach(result => {
-            Doc.UnBrushDoc(result[0]);
-            Doc.ClearSearchMatches();
-        });
-        close && (this.open = this._searchbarOpen = false);
+    onInputChange = action((e: React.ChangeEvent<HTMLInputElement>) => {
+        this._searchString = e.target.value;
+        this.submitSearch();
     });
 
-    @action.bound
-    closeResults() {
-        this._results = [];
-        this._resultsSet.clear();
-        this._visibleElements = [];
-        this._visibleDocuments = [];
-        this._numTotalResults = -1;
-        this._endIndex = -1;
-        this._curRequest = undefined;
-    }
+    onSelectChange = action((e: React.ChangeEvent<HTMLSelectElement>) => {
+        this._docTypeString = e.target.value;
+        this.submitSearch();
+    });
 
-    @action
-    resultsScrolled = (e?: React.UIEvent<HTMLDivElement>) => {
-        this._endIndex = 30;
-        const headers = new Set<string>(["title", "author", "text", "type", "data", "*lastModified", "context"]);
+    onResultClick = action((doc: Doc) => {
+        this.selectElement(doc);
+        this._selectedResult = doc;
+    });
 
-        if (this._numTotalResults <= this._maxSearchIndex) {
-            this._numTotalResults = this._results.length;
+    static foreachRecursiveDoc(docs: Doc[], func: (doc: Doc) => void) {
+        const blockedTypes = [DocumentType.PRESELEMENT, DocumentType.KVP, DocumentType.FILTER, DocumentType.SEARCH, DocumentType.SEARCHITEM, DocumentType.FONTICON, DocumentType.BUTTON, DocumentType.SCRIPTING];
+        let newarray: Doc[] = [];
+        while (docs.length > 0) {
+            newarray = [];
+            docs.filter(d => d).forEach(d => {
+                const dtype = StrCast(d.type, "string") as DocumentType;
+                if (dtype && !blockedTypes.includes(dtype)) {
+                    const fieldKey = Doc.LayoutFieldKey(d);
+                    const annos = !Field.toString(Doc.LayoutField(d) as Field).includes("CollectionView");
+                    const data = d[annos ? fieldKey + "-annotations" : fieldKey];
+                    data && newarray.push(...DocListCast(data));
+                    func(d);
+                }
+            });
+            docs = newarray;
         }
+    }
 
-        // only hit right at the beginning
-        // visibleElements is all of the elements (even the ones you can't see)
-        if (this._visibleElements.length !== this._numTotalResults) {
-            // undefined until a searchitem is put in there
-            this._visibleElements = Array<JSX.Element>(this._numTotalResults === -1 ? 0 : this._numTotalResults);
-            this._visibleDocuments = Array<Doc>(this._numTotalResults === -1 ? 0 : this._numTotalResults);
-        }
-        let max = this._numResultsPerPage;
-        max > this._results.length ? max = this._results.length : console.log("");
-        for (let i = this._pageStart; i < max; i++) {
-            //if the index is out of the window then put a placeholder in
-            //should ones that have already been found get set to placeholders?
-
-            let result: [Doc, string[], string[]] | undefined = undefined;
-
-            result = this._results[i];
-            if (result) {
-                const highlights = Array.from([...Array.from(new Set(result[1]).values())]);
-                const lines = new List<string>(result[2]);
-                highlights.forEach((item) => headers.add(item));
-                Doc.SetSearchMatch(result[0], { searchMatch: 1 });
-                if (i < this._visibleDocuments.length) {
-                    this._visibleDocuments[i] = result[0];
-                    Doc.BrushDoc(result[0]);
-                    Doc.AddDocToList(this.dataDoc, this.props.fieldKey, result[0]);
-                    this.children++;
+    @action
+    searchCollection(query: string) {
+        const selectedCollection = CollectionDockingView.Instance;
+        query = query.toLowerCase();
+
+        if (selectedCollection !== undefined) {
+            console.log("hello111")
+            // this._currentSelectedCollection = selectedCollection;
+            const docs = DocListCast(selectedCollection.dataDoc[Doc.LayoutFieldKey(selectedCollection.dataDoc)]);
+            const found: [Doc, string[], string[]][] = [];
+            SearchBox.foreachRecursiveDoc(docs, (doc: Doc) => {
+                console.log("HELLO")
+                if (this._docTypeString == "all" || this._docTypeString == doc.type) {
+                    const hlights = new Set<string>();
+                    SearchBox.documentKeys(doc).forEach(key => Field.toString(doc[key] as Field).toLowerCase().includes(query) && hlights.add(key));
+                    Array.from(hlights.keys()).length > 0 && found.push([doc, Array.from(hlights.keys()), []]);
                 }
-            }
-        }
-        if (this.props.Document._schemaHeaders === undefined) {
-            this.props.Document._schemaHeaders = new List<SchemaHeaderField>([new SchemaHeaderField("title", "#f1efeb")]);
-        }
-        if (this._maxSearchIndex >= this._numTotalResults) {
-            this._visibleElements.length = this._results.length;
-            this._visibleDocuments.length = this._results.length;
+            });
+
+            this._results = found;
+            //this.setSearchFilter(selectedCollection, this.filter && found.length ? this._docsforfilter : undefined);
         }
     }
 
-    getTransform = () => this.props.ScreenToLocalTransform().translate(-5, -65);// listBox padding-left and pres-box-cont minHeight
-    panelHeight = () => this.props.PanelHeight();
-    selectElement = (doc: Doc) => { /* this.gotoDocument(this.childDocs.indexOf(doc), NumCasst(this.layoutDoc._itemIndex)); */ };
-    returnHeight = () => NumCast(this.layoutDoc._height);
-    returnLength = () => Math.min(window.innerWidth, 51 + 205 * Cast(this.props.Document._schemaHeaders, listSpec(SchemaHeaderField), []).length);
-
-    setSearchFilter = action((collectionView: { props: { Document: Doc } }, docsForFilter: Doc[] | undefined) => {
-        if (collectionView) {
-            const docFilters = Cast(this.props.Document._docFilters, listSpec("string"), null);
-            collectionView.props.Document._searchFilterDocs = docsForFilter?.length ? new List<Doc>(docsForFilter) : undefined;
-            collectionView.props.Document._docFilters = docsForFilter?.length && docFilters?.length ? new List<string>(docFilters) : undefined;
+    static documentKeys(doc: Doc) {
+        const keys: { [key: string]: boolean } = {};
+        // bcz: ugh.  this is untracked since otherwise a large collection of documents will blast the server for all their fields.
+        //  then as each document's fields come back, we update the documents _proxies.  Each time we do this, the whole schema will be
+        //  invalidated and re-rendered.   This workaround will inquire all of the document fields before the options button is clicked.
+        //  then by the time the options button is clicked, all of the fields should be in place.  If a new field is added while this menu
+        //  is displayed (unlikely) it won't show up until something else changes.
+        //TODO Types
+        Doc.GetAllPrototypes(doc).map(proto => Object.keys(proto).forEach(key => keys[key] = false));
+        return Array.from(Object.keys(keys));
+    }
+
+    @action
+    submitSearch = async () => {
+        Doc.ClearSearchMatches();
+        this._results = [];
+
+        this.dataDoc[this.fieldKey] = new List<Doc>([]);
+        let query = StrCast(this._searchString);
+        Doc.SetSearchQuery(query);
+        this._results = [];
+
+        if (query) {
+            this.searchCollection(query);
         }
-    });
+    }
+
+    selectElement = async (doc: Doc) => {
+        await DocumentManager.Instance.jumpToDocument(doc, true); // documents open in new tab instead of on right
+    }
 
     render() {
-        const myDashboards = DocListCast(CurrentUserUtils.MyDashboards.data);
+        const results = this._results.map(result => {
+            var className = "searchBox-results-scroll-view-result";
+
+            if (this._selectedResult == result[0]) {
+                className += " searchBox-results-scroll-view-result-selected"
+            }
+
+            return (<div key={result[0][Id]} onClick={() => this.onResultClick(result[0])} className={className}><div className="titletitle">{result[0].title}</div></div>)
+        })
 
         return (
             <div style={{ pointerEvents: "all" }} className="searchBox-container">
-                <div className="searchBox-bar" style={{ background: SearchBox.Instance._undoBackground }}>
-                    <div className="searchBox-query" >
-                        <input defaultValue={""} autoComplete="off" onChange={this.onChange} type="text" placeholder="Search..." id="search-input" ref={this._inputRef}
-                            className="searchBox-barChild searchBox-input" onKeyPress={this.enter}
-                            style={{ padding: 1, paddingLeft: 20, paddingRight: 60, color: "black", height: 20, width: 250 }} />
-                        <div style={{ display: "flex", alignItems: "center" }}>
-                            <div style={{ position: "absolute", left: 10 }}>
-                                <FontAwesomeIcon icon={"search"} size="lg"
-                                    style={{ color: "black", padding: 1, position: "relative" }} />
-                            </div>
-                            <div style={{ position: "absolute", left: Doc.UserDoc().noviceMode ? 220 : 200, width: 30, zIndex: 9000, color: "grey", background: "white", }}>
-                                {`${this._results.length}` + " of " + `${this.realTotalResults}`}
-                            </div>
-                        </div>
-                    </div >
+                <div className="searchBox-bar">
+                    <select name="type" id="searchBox-type" className="searchBox-type" onChange={this.onSelectChange}>
+                        <option value="all">All</option>
+                        <option value="rtf">Text</option>
+                        <option value="img">Img</option>
+                        <option value="pdf">PDF</option>
+                        <option value="video">Vid</option>
+                        <option value="audio">Aud</option>
+                        <option value="inks">Ink</option>
+                        <option value="col">Col</option>
+                    </select>
+                    <input defaultValue={""} autoComplete="off" onChange={this.onInputChange} type="text" placeholder="Search..." id="search-input" className="searchBox-input" />
                 </div >
-                {!this._searchbarOpen ? (null) :
-                    <div style={{ zIndex: 20000, color: "black" }} ref={(r) => r?.focus()}>
-                        <div style={{ display: "flex", justifyContent: "center", }}>
-                            <div style={{ display: this.open ? "flex" : "none", overflow: "auto", position: "absolute" }}>
-                                <CollectionSchemaView {...this.props}
-                                    CollectionView={undefined}
-                                    addDocument={returnFalse}
-                                    Document={this.props.Document}
-                                    moveDocument={returnFalse}
-                                    removeDocument={returnFalse}
-                                    PanelHeight={this.open ? this.returnHeight : returnZero}
-                                    PanelWidth={this.open ? this.returnLength : returnZero}
-                                    scrollOverflow={length > window.innerWidth || this.children > 6 ? true : false}
-                                    focus={this.selectElement}
-                                    ScreenToLocalTransform={Transform.Identity}
-                                />
-                                <div style={{ position: "absolute", right: 5, bottom: 7, width: 15, height: 15, }}
-                                    onPointerDown={e => setupMoveUpEvents(this, e, (e: PointerEvent, down: number[], delta: number[]) => {
-                                        this.props.Document._height = NumCast(this.props.Document._height) + delta[1];
-                                        return false;
-                                    }, returnFalse, emptyFunction)}
-                                >
-                                    <FontAwesomeIcon icon="grip-lines" size="lg" />
-                                </div>
-                            </div>
-                        </div>
+                <div className="searchBox-results-container">
+                    <div className="searchBox-results-count">
+                        {`${this._results.length}` + " result" + (this._results.length == 1 ? "" : "s")}
                     </div>
-                }
+                    <div className="searchBox-results-scroll-view">
+                        {results}
+                    </div>
+                </div>
             </div >
         );
     }
-}
\ No newline at end of file
+}*/
\ No newline at end of file
-- 
cgit v1.2.3-70-g09d2


From c9f379adab864132e6cf044f808a43254601e4bb Mon Sep 17 00:00:00 2001
From: geireann <geireann.lindfield@gmail.com>
Date: Fri, 30 Jul 2021 13:26:25 -0400
Subject: major UI / updates + refactoring

---
 deploy/assets/favicon.png                          |  Bin 0 -> 22180 bytes
 deploy/index.html                                  |  114 +-
 deploy/loader.css                                  |   85 +
 deploy/loader.js                                   |   14 +
 src/client/documents/Documents.ts                  |    4 +-
 src/client/util/CurrentUserUtils.ts                |   44 +-
 src/client/views/AntimodeMenu.scss                 |    1 +
 src/client/views/DocumentButtonBar.tsx             |    2 +-
 src/client/views/MainView.scss                     |   30 +-
 src/client/views/MainView.tsx                      |   29 +-
 src/client/views/PropertiesView.tsx                |    2 +-
 src/client/views/_nodeModuleOverrides.scss         |    4 +-
 src/client/views/collections/CollectionMenu.scss   |    4 +-
 src/client/views/collections/CollectionMenu.tsx    |    2 +-
 src/client/views/collections/TabDocView.tsx        |    2 +-
 .../collectionFreeForm/CollectionFreeFormView.tsx  |   10 +-
 .../collections/collectionFreeForm/MarqueeView.tsx |    3 +-
 src/client/views/global/globalCssVariables.scss    |    3 +
 src/client/views/nodes/DocumentContentsView.tsx    |    4 +-
 src/client/views/nodes/DocumentView.tsx            |    2 +-
 src/client/views/nodes/FontIconBox.tsx             |    3 +-
 src/client/views/nodes/PresBox.scss                | 1243 ----------
 src/client/views/nodes/PresBox.tsx                 | 2472 --------------------
 .../views/nodes/formattedText/RichTextMenu.tsx     |   10 +-
 src/client/views/nodes/trails/PresBox.scss         | 1243 ++++++++++
 src/client/views/nodes/trails/PresBox.tsx          | 2440 +++++++++++++++++++
 src/client/views/nodes/trails/PresElementBox.scss  |  235 ++
 src/client/views/nodes/trails/PresElementBox.tsx   |  388 +++
 src/client/views/nodes/trails/PresEnums.ts         |   28 +
 src/client/views/nodes/trails/index.ts             |    3 +
 .../views/presentationview/PresElementBox.scss     |  235 --
 .../views/presentationview/PresElementBox.tsx      |  386 ---
 src/client/views/topbar/TopBar.scss                |   12 +-
 src/client/views/topbar/TopBar.tsx                 |   89 +-
 tslint.json                                        |   41 +-
 35 files changed, 4587 insertions(+), 4600 deletions(-)
 create mode 100644 deploy/assets/favicon.png
 create mode 100644 deploy/loader.css
 create mode 100644 deploy/loader.js
 delete mode 100644 src/client/views/nodes/PresBox.scss
 delete mode 100644 src/client/views/nodes/PresBox.tsx
 create mode 100644 src/client/views/nodes/trails/PresBox.scss
 create mode 100644 src/client/views/nodes/trails/PresBox.tsx
 create mode 100644 src/client/views/nodes/trails/PresElementBox.scss
 create mode 100644 src/client/views/nodes/trails/PresElementBox.tsx
 create mode 100644 src/client/views/nodes/trails/PresEnums.ts
 create mode 100644 src/client/views/nodes/trails/index.ts
 delete mode 100644 src/client/views/presentationview/PresElementBox.scss
 delete mode 100644 src/client/views/presentationview/PresElementBox.tsx

(limited to 'src/client/util/CurrentUserUtils.ts')

diff --git a/deploy/assets/favicon.png b/deploy/assets/favicon.png
new file mode 100644
index 000000000..59595b910
Binary files /dev/null and b/deploy/assets/favicon.png differ
diff --git a/deploy/index.html b/deploy/index.html
index dda0c6457..d96215391 100644
--- a/deploy/index.html
+++ b/deploy/index.html
@@ -1,114 +1,22 @@
 <html style="overflow: hidden;">
 
 <head>
-    <title>Dash Web</title>
-    <link href="https://fonts.googleapis.com/css?family=Fjalla+One|Hind+Siliguri:300" rel="stylesheet">
-    <link href='https://fonts.googleapis.com/css?family=Roboto:300,400,500' rel='stylesheet'>
+    <title>Dash</title>
+    <link rel="preconnect" href="https://fonts.googleapis.com">
+    <link rel="preconnect" href="https://fonts.gstatic.com" crossorigin>
+    <link
+        href="https://fonts.googleapis.com/css2?family=IBM+Plex+Sans:ital,wght@0,300;0,400;0,500;0,700;1,300;1,400;1,500;1,700&family=Lato:ital,wght@0,300;0,400;0,700;1,300;1,400;1,700&family=Merriweather:ital,wght@0,300;0,400;0,700;1,300;1,400;1,700&family=Roboto:ital,wght@0,300;0,400;0,500;1,300;1,400;1,500&display=swap"
+        rel="stylesheet">
+    <link rel="shortcut icon" type="image/jpg" href="./assets/favicon.png" />
     <link rel="stylesheet" href="https://maxcdn.bootstrapcdn.com/bootstrap/3.3.7/css/bootstrap.min.css"
         integrity="sha384-BVYiiSIFeK1dGmJRAkycuHAHRg32OmUcww7on3RYdg4Va+PmSTsz/K68vbdEjh4u" crossorigin="anonymous">
     <script src="https://cdnjs.cloudflare.com/ajax/libs/typescript/3.3.1/typescript.min.js"></script>
-
-    <script>
-        function getCookie(cname) {
-            var name = cname + "=";
-            var ca = document.cookie.split(';');
-            for (var i = 0; i < ca.length; i++) {
-                var c = ca[i];
-                while (c.charAt(0) == ' ') {
-                    c = c.substring(1);
-                }
-                if (c.indexOf(name) == 0) {
-                    return Number(c.substring(name.length, c.length));
-                }
-            }
-            return 3000;
-        } 
-    </script>
-    <style>
-        .dash-loader {
-            display: flex;
-            align-content: center;
-            justify-content: center;
-            background-color: #AEDDF8;
-            transition: 3s;
-            z-index: 10;
-            width: 100vw;
-            height: 100vh;
-        }
-
-        .dash-loader-container {
-            display: grid;
-            grid-auto-rows: auto 30px auto;
-        }
-
-        .dash-progress-bar {
-            width: 200px;
-            height: 5px;
-            align-self: center;
-            margin-top: 20px;
-            background-color: #ececec;
-            border-radius: 5px;
-            overflow: hidden;
-        }
-
-        .dash-progress {
-            width: 0%;
-            height: 20px;
-            background-color: #5b9fdd;
-            transition: 0.1s;
-        }
-
-        .dash-animation-container {
-            width: 10vw;
-            height: 10vw;
-            display: flex;
-            align-items: center;
-            justify-content: center;
-            border-radius: 100%;
-            background-color: #5B9FDD;
-            justify-self: center;
-            align-self: flex-end;
-        }
-
-        .dash-loader-text {
-            font-size: 15px;
-            font-family: "Roboto";
-            text-align: center;
-            color: #5B9FDD;
-        }
-
-        .dash-d-path {
-            stroke-dasharray: 1000;
-            stroke-dashoffset: 1000;
-            animation: dash-d-path 3s linear infinite;
-        }
-
-        @keyframes dash-d-path {
-            0% {
-                stroke-dashoffset: 1000;
-            }
-
-            20% {
-                stroke-dashoffset: 0;
-            }
-
-            70% {
-                stroke-dashoffset: 0;
-            }
-
-            90% {
-                stroke-dashoffset: 1000;
-            }
-
-            100% {
-                stroke-dashoffset: 1000;
-            }
-        }
-    </style>
+    <script src="loader.js"></script>
+    <link rel="stylesheet" href="./loader.css" />
 </head>
 
 <body style="display:flex" id="dash-body">
-    <div class="dash-loader" id="loader" style="z-index:10; width:100%; height:100%;">
+    <div class="dash-loader" id="loader">
         <div class="dash-loader-container">
             <div class="dash-animation-container">
                 <svg xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" width="100px"
@@ -127,7 +35,7 @@
                     console.log("Last Load = " + load);
                     let dashmesg = (width, msg) => {
                         if (document.getElementById("dash-progress")) document.getElementById("dash-progress").style.width = width
-                        if (document.getElementById("dash-progress")) document.getElementById("dash-progress").innerHTML = msg
+                        if (document.getElementById("dash-progress")) document.getElementById("dash-loader-text").innerHTML = msg
                     }
                     setTimeout(() => dashmesg("10%", "Loading Dash..."), load / 10);
                     setTimeout(() => dashmesg("33%", "Preparing dashboards..."), load / 3);
diff --git a/deploy/loader.css b/deploy/loader.css
new file mode 100644
index 000000000..4be0cc98c
--- /dev/null
+++ b/deploy/loader.css
@@ -0,0 +1,85 @@
+.dash-loader {
+    display: flex;
+    align-content: center;
+    justify-content: center;
+    background-color: #BDDDF5;
+    transition: 3s;
+    z-index: 10;
+    z-index:10; 
+    width:100%;
+    height:100%;
+}
+
+.dash-loader-container {
+    display: flex;
+    flex-direction: column;
+    justify-content: center;
+    align-items: center;
+    align-content: center;
+}
+
+.dash-progress-bar {
+    width: 200px;
+    height: 5px;
+    align-self: center;
+    margin-top: 20px;
+    background-color: #ececec;
+    border-radius: 5px;
+    overflow: hidden;
+}
+
+.dash-progress {
+    width: 0%;
+    height: 20px;
+    background-color: #4476F7;
+    transition: 0.1s;
+}
+
+.dash-animation-container {
+    width: 10vw;
+    height: 10vw;
+    display: flex;
+    align-items: center;
+    justify-content: center;
+    border-radius: 100%;
+    background-color: #4476F7;
+    justify-self: center;
+}
+
+.dash-loader-text {
+    font-size: 15px;
+    font-family: "Roboto";
+    font-weight: bold;
+    text-align: center;
+    color: #4476F7;
+    user-select: none;
+    -webkit-user-select: none;
+}
+
+.dash-d-path {
+    stroke-dasharray: 1000;
+    stroke-dashoffset: 1000;
+    animation: dash-d-path 3s linear infinite;
+}
+
+@keyframes dash-d-path {
+    0% {
+        stroke-dashoffset: 1000;
+    }
+
+    20% {
+        stroke-dashoffset: 0;
+    }
+
+    70% {
+        stroke-dashoffset: 0;
+    }
+
+    90% {
+        stroke-dashoffset: 1000;
+    }
+
+    100% {
+        stroke-dashoffset: 1000;
+    }
+}
\ No newline at end of file
diff --git a/deploy/loader.js b/deploy/loader.js
new file mode 100644
index 000000000..0be421e14
--- /dev/null
+++ b/deploy/loader.js
@@ -0,0 +1,14 @@
+function getCookie(cname) {
+    var name = cname + "=";
+    var ca = document.cookie.split(';');
+    for (var i = 0; i < ca.length; i++) {
+        var c = ca[i];
+        while (c.charAt(0) == ' ') {
+            c = c.substring(1);
+        }
+        if (c.indexOf(name) == 0) {
+            return Number(c.substring(name.length, c.length));
+        }
+    }
+    return 3000;
+} 
\ No newline at end of file
diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts
index f1db3e32c..81465a241 100644
--- a/src/client/documents/Documents.ts
+++ b/src/client/documents/Documents.ts
@@ -45,14 +45,14 @@ import { LabelBox } from "../views/nodes/LabelBox";
 import { LinkBox } from "../views/nodes/LinkBox";
 import { LinkDescriptionPopup } from "../views/nodes/LinkDescriptionPopup";
 import { PDFBox } from "../views/nodes/PDFBox";
-import { PresBox } from "../views/nodes/PresBox";
+import { PresBox } from "../views/nodes/trails/PresBox";
 import { ScreenshotBox } from "../views/nodes/ScreenshotBox";
 import { ScriptingBox } from "../views/nodes/ScriptingBox";
 import { SliderBox } from "../views/nodes/SliderBox";
 import { TaskCompletionBox } from "../views/nodes/TaskCompletedBox";
 import { VideoBox } from "../views/nodes/VideoBox";
 import { WebBox } from "../views/nodes/WebBox";
-import { PresElementBox } from "../views/presentationview/PresElementBox";
+import { PresElementBox } from "../views/nodes/trails/PresElementBox";
 import { SearchBox } from "../views/search/SearchBox";
 import { DashWebRTCVideo } from "../views/webcam/DashWebRTCVideo";
 import { DocumentType } from "./DocumentTypes";
diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts
index 22504f102..62fab1b23 100644
--- a/src/client/util/CurrentUserUtils.ts
+++ b/src/client/util/CurrentUserUtils.ts
@@ -35,6 +35,8 @@ import { UndoManager } from "./UndoManager";
 import { SnappingManager } from "./SnappingManager";
 import { InkTool } from "../../fields/InkField";
 import { computedFn } from "mobx-utils";
+import { ColorScheme } from "./SettingsManager";
+import { Colors } from "../views/global/globalEnums";
 
 
 export let resolvedPorts: { server: number, socket: number };
@@ -472,7 +474,7 @@ export class CurrentUserUtils {
             { toolTip: "Tap to create a videoWall", title: "Wall", icon: "photo-video", click: 'openOnRight(copyDragFactory(this.dragFactory))', drag: 'copyDragFactory(this.dragFactory)', dragFactory: doc.emptyWall as Doc },
             { toolTip: "Tap to create an audio recorder in a new pane, drag for an audio recorder", title: "Audio", icon: "microphone", click: 'openOnRight(copyDragFactory(this.dragFactory))', drag: 'copyDragFactory(this.dragFactory)', dragFactory: doc.emptyAudio as Doc, noviceMode: true },
             { toolTip: "Tap to create a button in a new pane, drag for a button", title: "Button", icon: "bolt", click: 'openOnRight(copyDragFactory(this.dragFactory))', drag: 'copyDragFactory(this.dragFactory)', dragFactory: doc.emptyButton as Doc },
-            { toolTip: "Tap to create a presentation in a new pane, drag for a presentation", title: "Trails", icon: "pres-trail", click: 'openOnRight(Doc.UserDoc().activePresentation = copyDragFactory(this.dragFactory))', drag: `Doc.UserDoc().activePresentation = copyDragFactory(this.dragFactory)`, dragFactory: doc.emptyPresentation as Doc, noviceMode: true },
+            // { toolTip: "Tap to create a presentation in a new pane, drag for a presentation", title: "Trails", icon: "pres-trail", click: 'openOnRight(Doc.UserDoc().activePresentation = copyDragFactory(this.dragFactory))', drag: `Doc.UserDoc().activePresentation = copyDragFactory(this.dragFactory)`, dragFactory: doc.emptyPresentation as Doc, noviceMode: true },
             { toolTip: "Tap to create a scripting box in a new pane, drag for a scripting box", title: "Script", icon: "terminal", click: 'openOnRight(copyDragFactory(this.dragFactory))', drag: 'copyDragFactory(this.dragFactory)', dragFactory: doc.emptyScript as Doc },
             { toolTip: "Tap to create a mobile view in a new pane, drag for a mobile view", title: "Phone", icon: "mobile", click: 'openOnRight(Doc.UserDoc().activeMobileMenu)', drag: 'this.dragFactory', dragFactory: doc.activeMobileMenu as Doc },
             { toolTip: "Tap to create a custom header note document, drag for a custom header note", title: "Custom", icon: "window-maximize", click: 'openOnRight(delegateDragFactory(this.dragFactory))', drag: 'delegateDragFactory(this.dragFactory)', dragFactory: doc.emptyHeader as Doc },
@@ -534,8 +536,8 @@ export class CurrentUserUtils {
             { title: "Sharing", target: Cast(doc.mySharedDocs, Doc, null), icon: "users", click: 'selectMainMenu(self)', watchedDocuments: doc.mySharedDocs as Doc },
             // { title: "Filter", target: Cast(doc.currentFilter, Doc, null), icon: "filter", click: 'selectMainMenu(self)' },
             { title: "Pres. Trails", target: Cast(doc.myPresentations, Doc, null), icon: "pres-trail", click: 'selectMainMenu(self)' },
-            { title: "Help", target: undefined as any, icon: "question-circle", click: 'selectMainMenu(self)' },
-            { title: "Settings", target: undefined as any, icon: "cog", click: 'selectMainMenu(self)' },
+            // { title: "Help", target: undefined as any, icon: "question-circle", click: 'selectMainMenu(self)' },
+            // { title: "Settings", target: undefined as any, icon: "cog", click: 'selectMainMenu(self)' },
             { title: "User Doc", target: Cast(doc.myUserDoc, Doc, null), icon: "address-card", click: 'selectMainMenu(self)' },
         ];
     }
@@ -561,7 +563,6 @@ export class CurrentUserUtils {
                     dontUndo: true,
                     title,
                     target,
-                    backgroundColor: "black",
                     _dropAction: "alias",
                     _removeDropProperties: new List<string>(["dropAction", "_stayInCollection"]),
                     _width: 60,
@@ -576,8 +577,10 @@ export class CurrentUserUtils {
                 title: "menuItemPanel",
                 childDropAction: "alias",
                 _chromeHidden: true,
+                backgroundColor: Colors.DARK_GRAY,
+                boxShadow: "rgba(0,0,0,0)",
                 dropConverter: ScriptField.MakeScript("convertToButtons(dragData)", { dragData: DragManager.DocumentDragData.name }),
-                backgroundColor: "black", ignoreClick: true,
+                ignoreClick: true,
                 _gridGap: 0,
                 _yMargin: 0,
                 _yPadding: 0, _xMargin: 0, _autoHeight: false, _width: 60, _columnWidth: 60, _lockedPosition: true, system: true
@@ -587,8 +590,6 @@ export class CurrentUserUtils {
         PromiseValue(Cast(doc.menuStack, Doc)).then(stack => {
             stack && PromiseValue(stack.data).then(btns => {
                 DocListCastAsync(btns).then(bts => bts?.forEach(btn => {
-                    btn.color = "white";
-                    btn._backgroundColor = "";
                     btn.dontUndo = true;
                     btn.system = true;
                     if (btn.title === "Catalog" || btn.title === "My Files") { // migration from Catalog to My Files
@@ -759,7 +760,7 @@ export class CurrentUserUtils {
         await doc.myDashboards;
         if (doc.myDashboards === undefined) {
             doc.myDashboards = new PrefetchProxy(Docs.Create.TreeDocument([], {
-                title: "My Dashboards", _height: 400, childHideLinkButton: true,
+                title: "My Dashboards", _showTitle: "title", _height: 400, childHideLinkButton: true,
                 treeViewHideTitle: true, _xMargin: 5, _yMargin: 5, _gridGap: 5, _forceActive: true, childDropAction: "alias",
                 treeViewTruncateTitleWidth: 150, ignoreClick: true,
                 _lockedPosition: true, boxShadow: "0 0", childDontRegisterViews: true, targetDropAction: "same", system: true
@@ -775,7 +776,7 @@ export class CurrentUserUtils {
         await doc.myPresentations;
         if (doc.myPresentations === undefined) {
             doc.myPresentations = new PrefetchProxy(Docs.Create.TreeDocument([], {
-                title: "My Presentations", _height: 100,
+                title: "My Trails", _showTitle: "title", _height: 100,
                 treeViewHideTitle: true, _xMargin: 5, _yMargin: 5, _gridGap: 5, _forceActive: true, childDropAction: "alias",
                 treeViewTruncateTitleWidth: 150, ignoreClick: true,
                 _lockedPosition: true, boxShadow: "0 0", childDontRegisterViews: true, targetDropAction: "same", system: true
@@ -794,7 +795,7 @@ export class CurrentUserUtils {
             doc.myFileOrphans = Docs.Create.TreeDocument([], { title: "Unfiled", _stayInCollection: true, system: true, isFolder: true });
             doc.myFileRoot = Docs.Create.TreeDocument([], { title: "file root", _stayInCollection: true, system: true, isFolder: true });
             doc.myFilesystem = new PrefetchProxy(Docs.Create.TreeDocument([doc.myFileRoot as Doc, doc.myFileOrphans as Doc], {
-                title: "My Documents", _height: 100,
+                title: "My Documents", _showTitle: "title", _height: 100,
                 treeViewHideTitle: true, _xMargin: 5, _yMargin: 5, _gridGap: 5, _forceActive: true, childDropAction: "alias",
                 treeViewTruncateTitleWidth: 150, ignoreClick: true,
                 isFolder: true, treeViewType: "fileSystem", childHideLinkButton: true,
@@ -808,7 +809,7 @@ export class CurrentUserUtils {
         // setup Recently Closed library item
         if (doc.myRecentlyClosedDocs === undefined) {
             doc.myRecentlyClosedDocs = new PrefetchProxy(Docs.Create.TreeDocument([], {
-                title: "Recently Closed", treeViewShowClearButton: true, childHideLinkButton: true,
+                title: "Recently Closed", _showTitle: "title", treeViewShowClearButton: true, childHideLinkButton: true,
                 treeViewHideTitle: true, _xMargin: 5, _yMargin: 5, _gridGap: 5, _forceActive: true, childDropAction: "alias",
                 treeViewTruncateTitleWidth: 150, ignoreClick: true,
                 _lockedPosition: true, boxShadow: "0 0", childDontRegisterViews: true, targetDropAction: "same", system: true
@@ -839,7 +840,7 @@ export class CurrentUserUtils {
             doc.treeViewOpen = true;
             doc.treeViewExpandedView = "fields";
             doc.myUserDoc = new PrefetchProxy(Docs.Create.TreeDocument([doc], {
-                treeViewHideTitle: true, _xMargin: 5, _yMargin: 5, _gridGap: 5, _forceActive: true, title: "My UserDoc",
+                treeViewHideTitle: true, _xMargin: 5, _yMargin: 5, _gridGap: 5, _forceActive: true, title: "My UserDoc", _showTitle: "title",
                 treeViewTruncateTitleWidth: 150, ignoreClick: true,
                 _lockedPosition: true, boxShadow: "0 0", childDontRegisterViews: true, targetDropAction: "same", system: true
             })) as any as Doc;
@@ -859,6 +860,7 @@ export class CurrentUserUtils {
     static async setupSidebarButtons(doc: Doc) {
         CurrentUserUtils.setupSidebarContainer(doc);
         await CurrentUserUtils.setupToolsBtnPanel(doc);
+        CurrentUserUtils.setupImportSidebar(doc);
         CurrentUserUtils.setupDashboards(doc);
         CurrentUserUtils.setupPresentations(doc);
         CurrentUserUtils.setupFilesystem(doc);
@@ -891,6 +893,7 @@ export class CurrentUserUtils {
         (doc["dockedBtn-undo"] as Doc).dontUndo = true;
         (doc["dockedBtn-redo"] as Doc).dontUndo = true;
     }
+
     // sets up the default set of documents to be shown in the Overlay layer
     static setupOverlays(doc: Doc) {
         if (doc.myOverlayDocs === undefined) {
@@ -924,7 +927,8 @@ export class CurrentUserUtils {
             if (!sharedDocs) {
                 sharedDocs = Docs.Create.StackingDocument([], {
                     title: "My SharedDocs", childDropAction: "alias", system: true, contentPointerEvents: "none", childLimitHeight: 0, _yMargin: 50, _gridGap: 15,
-                    _showTitle: "title", ignoreClick: true, _lockedPosition: true, "acl-Public": SharingPermissions.Add, "_acl-Public": SharingPermissions.Add, _chromeHidden: true,
+                    _showTitle: "title", ignoreClick: true, _lockedPosition: true, "acl-Public": SharingPermissions.Add, "_acl-Public": SharingPermissions.Add,
+                    _chromeHidden: true, boxShadow: "0 0",
                 }, sharingDocumentId + "outer", sharingDocumentId);
                 (sharedDocs as Doc)["acl-Public"] = (sharedDocs as Doc)[DataSym]["acl-Public"] = SharingPermissions.Add;
             }
@@ -939,14 +943,14 @@ export class CurrentUserUtils {
     static setupImportSidebar(doc: Doc) {
         if (doc.myImportDocs === undefined) {
             doc.myImportDocs = new PrefetchProxy(Docs.Create.StackingDocument([], {
-                title: "My ImportDocuments", _forceActive: true, ignoreClick: true, _showTitle: "title", _stayInCollection: true, _hideContextMenu: true, childLimitHeight: 0,
+                title: "My ImportDocuments", _forceActive: true, ignoreClick: true, _stayInCollection: true, _hideContextMenu: true, childLimitHeight: 0,
                 childDropAction: "alias", _autoHeight: true, _yMargin: 50, _gridGap: 15, _lockedPosition: true, system: true, _chromeHidden: true,
             }));
         }
         if (doc.myImportPanel === undefined) {
             const uploads = Cast(doc.myImportDocs, Doc, null);
             const newUpload = CurrentUserUtils.ficon({ onClick: ScriptField.MakeScript("importDocument()"), toolTip: "Import External document", _stayInCollection: true, _hideContextMenu: true, title: "Import", icon: "upload", system: true });
-            doc.myImportPanel = new PrefetchProxy(Docs.Create.StackingDocument([newUpload, uploads], { title: "My ImportPanel", _yMargin: 20, ignoreClick: true, _chromeHidden: true, _stayInCollection: true, _hideContextMenu: true, _lockedPosition: true, system: true }));
+            doc.myImportPanel = new PrefetchProxy(Docs.Create.StackingDocument([newUpload, uploads], { title: "My ImportPanel", _yMargin: 20, _showTitle: "title", ignoreClick: true, _chromeHidden: true, _stayInCollection: true, _hideContextMenu: true, _lockedPosition: true, system: true, boxShadow: "0 0" }));
         }
     }
 
@@ -1007,10 +1011,14 @@ export class CurrentUserUtils {
                 const mygroups = groups?.filter(group => JSON.parse(StrCast(group.members)).includes(Doc.CurrentUserEmail)) || [];
                 SnappingManager.SetCachedGroups(["Public", ...mygroups?.map(g => StrCast(g.title))]);
             }, { fireImmediately: true });
+        // Document properties on load
         doc.system = true;
+        doc.darkScheme = ColorScheme.Dark;
         doc.noviceMode = doc.noviceMode === undefined ? "true" : doc.noviceMode;
         doc.title = Doc.CurrentUserEmail;
         doc._raiseWhenDragged = true;
+        doc._showLabel = false;
+        doc._showMenuLabel = true;
         doc.activeInkColor = StrCast(doc.activeInkColor, "rgb(0, 0, 0)");
         doc.activeInkWidth = StrCast(doc.activeInkWidth, "1");
         doc.activeInkBezier = StrCast(doc.activeInkBezier, "0");
@@ -1201,7 +1209,7 @@ export class CurrentUserUtils {
         const dashboardDoc = Docs.Create.StandardCollectionDockingDocument([{ doc: freeformDoc, initialWidth: 600 }], { title: `Dashboard ${dashboardCount}` }, id, "row");
         Doc.AddDocToList(myPresentations, "data", presentation);
         userDoc.activePresentation = presentation;
-        const toggleTheme = ScriptField.MakeScript(`self.darkScheme = !self.darkScheme`);
+        const toggleTheme = ScriptField.MakeScript(`Doc.UserDoc().darkScheme = !Doc.UserDoc().darkScheme`);
         const toggleComic = ScriptField.MakeScript(`toggleComicMode()`);
         const snapshotDashboard = ScriptField.MakeScript(`snapshotDashboard()`);
         const createDashboard = ScriptField.MakeScript(`createNewDashboard()`);
@@ -1257,6 +1265,4 @@ Scripting.addGlobal(function createNewPresentation() { return MainView.Instance.
 Scripting.addGlobal(function links(doc: any) { return new List(LinkManager.Instance.getAllRelatedLinks(doc)); },
     "returns all the links to the document or its annotations", "(doc: any)");
 Scripting.addGlobal(function importDocument() { return CurrentUserUtils.importDocument(); },
-    "imports files from device directly into the import sidebar");
-Scripting.addGlobal(function toggleComicMode() { Doc.UserDoc().renderStyle = Doc.UserDoc().renderStyle === "comic" ? undefined : "comic"; },
-    "toggle between regular rendeing and an informal sketch/comic style");
+    "imports files from device directly into the import sidebar");
\ No newline at end of file
diff --git a/src/client/views/AntimodeMenu.scss b/src/client/views/AntimodeMenu.scss
index b509f9f54..e23bf27c1 100644
--- a/src/client/views/AntimodeMenu.scss
+++ b/src/client/views/AntimodeMenu.scss
@@ -6,6 +6,7 @@
     z-index: 10001;
     height: $antimodemenu-height;
     background: $dark-gray;
+    border-bottom: $standard-border;
     // box-shadow: 3px 3px 3px rgba(0, 0, 0, 0.25);
     // border-radius: 0px 6px 6px 6px;
     z-index: 1001;
diff --git a/src/client/views/DocumentButtonBar.tsx b/src/client/views/DocumentButtonBar.tsx
index a5d80cd22..b11aa99b0 100644
--- a/src/client/views/DocumentButtonBar.tsx
+++ b/src/client/views/DocumentButtonBar.tsx
@@ -24,7 +24,7 @@ import { DocumentView } from './nodes/DocumentView';
 import { GoogleRef } from "./nodes/formattedText/FormattedTextBox";
 import { TemplateMenu } from "./TemplateMenu";
 import React = require("react");
-import { PresBox } from './nodes/PresBox';
+import { PresBox } from './nodes/trails/PresBox';
 import { undoBatch } from '../util/UndoManager';
 import { CollectionViewType } from './collections/CollectionView';
 const higflyout = require("@hig/flyout");
diff --git a/src/client/views/MainView.scss b/src/client/views/MainView.scss
index 2069986ad..ba1c91720 100644
--- a/src/client/views/MainView.scss
+++ b/src/client/views/MainView.scss
@@ -22,10 +22,6 @@
     height: 100%;
 }
 
-.mainContent-div-flyout {
-    left: calc(-1 * var(--flyoutHandleWidth));
-}
-
 // add nodes menu. Note that the + button is actually an input label, not an actual button.
 .mainView-docButtons {
     position: absolute;
@@ -111,14 +107,21 @@
     user-select: none;
 }
 
+.properties-container {
+    height: 100%;
+    position: relative;
+    left: 100%;
+    top: calc(-100% - 36px);
+    z-index: 3000;
+}
+
 .mainView-propertiesDragger {
     //background-color: rgb(140, 139, 139);
-    background-color: $light-gray;
+    background-color: $medium-gray;
     height: 55px;
     width: 17px;
     position: absolute;
     top: 50%;
-    border: 1px black solid;
     border-radius: 0;
     border-top-left-radius: 10px;
     border-bottom-left-radius: 10px;
@@ -141,18 +144,6 @@
     }
 }
 
-.mainiView-propertiesView {
-    display: flex;
-    flex-direction: column;
-    height: 100%;
-    position: absolute;
-    right: 0;
-    top: 0;
-    border-left: solid 1px;
-    z-index: 100000;
-    cursor: auto;
-}
-
 .mainView-innerContent, .mainView-innerContent-dark {
     display: contents;
     flex-direction: row;
@@ -171,7 +162,7 @@
     }
 
     .propertiesView {
-        right: 0;
+        left: 0;
         position: absolute;
         z-index: 2;
         background-color: $medium-gray;
@@ -220,6 +211,7 @@
 .mainView-menuPanel {
     min-width: var(--menuPanelWidth);
     background-color: $dark-gray;
+    border-right: $standard-border;
 
     .collectionStackingView {
         scrollbar-width: none;
diff --git a/src/client/views/MainView.tsx b/src/client/views/MainView.tsx
index 7d6bfbd40..49f4f7a6e 100644
--- a/src/client/views/MainView.tsx
+++ b/src/client/views/MainView.tsx
@@ -64,6 +64,7 @@ import { PropertiesView } from './PropertiesView';
 import { SearchBox } from './search/SearchBox';
 import { DefaultStyleProvider, DashboardStyleProvider, StyleProp } from './StyleProvider';
 import { TopBar } from './topbar/TopBar';
+import { Colors } from './global/globalEnums';
 const _global = (window /* browser */ || global /* node */) as any;
 
 @observer
@@ -179,12 +180,12 @@ export class MainView extends React.Component {
         const targets = document.elementsFromPoint(e.x, e.y);
         if (targets.length) {
             const targClass = targets[0].className.toString();
-            if (SearchBox.Instance._searchbarOpen || SearchBox.Instance.open) {
-                const check = targets.some((thing) =>
-                    (thing.className === "collectionSchemaView-searchContainer" || (thing as any)?.dataset.icon === "filter" ||
-                        thing.className === "collectionSchema-header-menuOptions"));
-                !check && SearchBox.Instance.resetSearch(true);
-            }
+            // if (SearchBox.Instance._searchbarOpen || SearchBox.Instance.open) {
+            //     const check = targets.some((thing) =>
+            //         (thing.className === "collectionSchemaView-searchContainer" || (thing as any)?.dataset.icon === "filter" ||
+            //             thing.className === "collectionSchema-header-menuOptions"));
+            //     !check && SearchBox.Instance.resetSearch(true);
+            // }
             !targClass.includes("contextMenu") && ContextMenu.Instance.closeMenu();
             !["timeline-menu-desc", "timeline-menu-item", "timeline-menu-input"].includes(targClass) && TimelineMenu.Instance.closeMenu();
         }
@@ -193,7 +194,7 @@ export class MainView extends React.Component {
     initEventListeners = () => {
         window.addEventListener("drop", e => e.preventDefault(), false);  // prevent default behavior of navigating to a new web page
         window.addEventListener("dragover", e => e.preventDefault(), false);
-        document.addEventListener("pointermove", action(e => SearchBox.Instance._undoBackground = UndoManager.batchCounter ? "#000000a8" : undefined));
+        // document.addEventListener("pointermove", action(e => SearchBox.Instance._undoBackground = UndoManager.batchCounter ? "#000000a8" : undefined));
         document.addEventListener("pointerdown", this.globalPointerDown);
         document.addEventListener("click", (e: MouseEvent) => {
             if (!e.cancelBubble) {
@@ -405,22 +406,26 @@ export class MainView extends React.Component {
     }
 
     @computed get mainInnerContent() {
+        const width = this.propertiesWidth() + this._flyoutWidth + this.menuPanelWidth();
+        const transform = this._flyoutWidth ? 'translate(-28px, 0px)' : undefined;
         return <>
             {this.menuPanel}
             <div key="inner" className={`mainView-innerContent${this.darkScheme ? "-dark" : ""}`}>
                 {this.flyout}
-                <div className="mainView-libraryHandle" style={{ display: !this._flyoutWidth ? "none" : undefined, left: this._flyoutWidth ? (this._flyoutWidth + this.menuPanelWidth() - 10) : -10 }} onPointerDown={this.onFlyoutPointerDown} >
+                <div className="mainView-libraryHandle" style={{ display: !this._flyoutWidth ? "none" : undefined }} onPointerDown={this.onFlyoutPointerDown} >
                     <FontAwesomeIcon icon="chevron-left" color={this.darkScheme ? "white" : "black"} style={{ opacity: "50%" }} size="sm" />
                 </div>
-                <div className="mainView-innerContainer" style={{ width: `calc(100% - ${this.propertiesWidth() + this._flyoutWidth + this.menuPanelWidth()}px)` }}>
+                <div className="mainView-innerContainer" style={{ width: `calc(100% - ${width}px)`, transform: transform }}>
                     <CollectionMenu />
 
                     {this.dockingContent}
 
-                    <div className="mainView-propertiesDragger" key="props" onPointerDown={this.onPropertiesPointerDown} style={{ right: this.propertiesWidth() - 1 }}>
-                        <FontAwesomeIcon icon={this.propertiesWidth() < 10 ? "chevron-left" : "chevron-right"} color={this.darkScheme ? "white" : "black"} size="sm" />
+                    <div className="mainView-propertiesDragger" key="props" onPointerDown={this.onPropertiesPointerDown} style={{ right: this._flyoutWidth ? 0 : this.propertiesWidth() - 1 }}>
+                        <FontAwesomeIcon icon={this.propertiesWidth() < 10 ? "chevron-left" : "chevron-right"} color={this.darkScheme ? Colors.WHITE : Colors.BLACK} size="sm" />
+                    </div>
+                    <div className="properties-container">
+                        {this.propertiesWidth() < 10 ? (null) : <PropertiesView styleProvider={DefaultStyleProvider} width={this.propertiesWidth()} height={this.getContentsHeight()} />}
                     </div>
-                    {this.propertiesWidth() < 10 ? (null) : <PropertiesView styleProvider={DefaultStyleProvider} width={this.propertiesWidth()} height={this.getContentsHeight()} />}
                 </div>
             </div>
         </>;
diff --git a/src/client/views/PropertiesView.tsx b/src/client/views/PropertiesView.tsx
index 4df3e4f00..8136edf04 100644
--- a/src/client/views/PropertiesView.tsx
+++ b/src/client/views/PropertiesView.tsx
@@ -24,7 +24,7 @@ import { EditableView } from "./EditableView";
 import { InkStrokeProperties } from "./InkStrokeProperties";
 import { DocumentView, StyleProviderFunc } from "./nodes/DocumentView";
 import { KeyValueBox } from "./nodes/KeyValueBox";
-import { PresBox } from "./nodes/PresBox";
+import { PresBox } from "./nodes/trails/PresBox";
 import { PropertiesButtons } from "./PropertiesButtons";
 import { PropertiesDocContextSelector } from "./PropertiesDocContextSelector";
 import "./PropertiesView.scss";
diff --git a/src/client/views/_nodeModuleOverrides.scss b/src/client/views/_nodeModuleOverrides.scss
index cb59489c0..140be2140 100644
--- a/src/client/views/_nodeModuleOverrides.scss
+++ b/src/client/views/_nodeModuleOverrides.scss
@@ -58,12 +58,10 @@ div .lm_header {
 .lm_header .lm_controls {
     align-items: center;
     position: absolute;
-    background-color: #000000;
+    background-color: $dark-gray;
     border-radius: 5px;
     display: flex;
-    top: 2px;
     justify-content: space-evenly;
-    right: 2px;
     height: 18px;
     width: 65px;
 }
diff --git a/src/client/views/collections/CollectionMenu.scss b/src/client/views/collections/CollectionMenu.scss
index c0fc774d3..f04b19ef7 100644
--- a/src/client/views/collections/CollectionMenu.scss
+++ b/src/client/views/collections/CollectionMenu.scss
@@ -38,10 +38,10 @@
         border: unset;
 
         .collectionMenu-divider {
-            height: 85%;
+            height: 100%;
             margin-left: 3px;
             margin-right: 3px;
-            width: 1.5px;
+            width: 2px;
             background-color: $medium-gray;
         }
 
diff --git a/src/client/views/collections/CollectionMenu.tsx b/src/client/views/collections/CollectionMenu.tsx
index 6e6fabd0d..a9b978c4e 100644
--- a/src/client/views/collections/CollectionMenu.tsx
+++ b/src/client/views/collections/CollectionMenu.tsx
@@ -29,7 +29,7 @@ import { ActiveFillColor, ActiveInkColor, SetActiveArrowEnd, SetActiveArrowStart
 import { CollectionFreeFormDocumentView } from "../nodes/CollectionFreeFormDocumentView";
 import { DocumentView } from "../nodes/DocumentView";
 import { RichTextMenu } from "../nodes/formattedText/RichTextMenu";
-import { PresBox } from "../nodes/PresBox";
+import { PresBox } from "../nodes/trails/PresBox";
 import "./CollectionMenu.scss";
 import { CollectionViewType, COLLECTION_BORDER_WIDTH } from "./CollectionView";
 import { TabDocView } from "./TabDocView";
diff --git a/src/client/views/collections/TabDocView.tsx b/src/client/views/collections/TabDocView.tsx
index 0e67bebd8..d82810652 100644
--- a/src/client/views/collections/TabDocView.tsx
+++ b/src/client/views/collections/TabDocView.tsx
@@ -25,7 +25,7 @@ import { Transform } from '../../util/Transform';
 import { undoBatch, UndoManager } from "../../util/UndoManager";
 import { LightboxView } from '../LightboxView';
 import { DocFocusOptions, DocumentView, DocumentViewProps } from "../nodes/DocumentView";
-import { PresBox, PinProps, PresMovement } from '../nodes/PresBox';
+import { PinProps, PresBox, PresMovement } from '../nodes/trails';
 import { DefaultLayerProvider, DefaultStyleProvider, StyleLayers, StyleProp } from '../StyleProvider';
 import { CollectionDockingView } from './CollectionDockingView';
 import { CollectionDockingViewMenu } from './CollectionDockingViewMenu';
diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx
index a4e310e6c..c5f6f7bf2 100644
--- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx
+++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx
@@ -38,7 +38,7 @@ import { CollectionFreeFormDocumentView } from "../../nodes/CollectionFreeFormDo
 import { DocFocusOptions, DocumentView, DocumentViewProps, ViewAdjustment, ViewSpecPrefix } from "../../nodes/DocumentView";
 import { FormattedTextBox } from "../../nodes/formattedText/FormattedTextBox";
 import { pageSchema } from "../../nodes/ImageBox";
-import { PresBox } from "../../nodes/PresBox";
+import { PresBox } from "../../nodes/trails/PresBox";
 import { StyleLayers, StyleProp } from "../../StyleProvider";
 import { CollectionDockingView } from "../CollectionDockingView";
 import { CollectionSubView } from "../CollectionSubView";
@@ -834,10 +834,10 @@ export class CollectionFreeFormView extends CollectionSubView<PanZoomDocument, P
                 map(doc => ({ ...this.childDataProvider(doc, ""), ...this.childSizeProvider(doc, "") }));
             if (measuredDocs.length) {
                 const ranges = measuredDocs.reduce(({ xrange, yrange }, { x, y, width, height }) =>  // computes range of content
-                ({
-                    xrange: { min: Math.min(xrange.min, x), max: Math.max(xrange.max, x + width) },
-                    yrange: { min: Math.min(yrange.min, y), max: Math.max(yrange.max, y + height) }
-                })
+                    ({
+                        xrange: { min: Math.min(xrange.min, x), max: Math.max(xrange.max, x + width) },
+                        yrange: { min: Math.min(yrange.min, y), max: Math.max(yrange.max, y + height) }
+                    })
                     , {
                         xrange: { min: Number.MAX_VALUE, max: -Number.MAX_VALUE },
                         yrange: { min: Number.MAX_VALUE, max: -Number.MAX_VALUE }
diff --git a/src/client/views/collections/collectionFreeForm/MarqueeView.tsx b/src/client/views/collections/collectionFreeForm/MarqueeView.tsx
index b1f2750c3..4fae961b1 100644
--- a/src/client/views/collections/collectionFreeForm/MarqueeView.tsx
+++ b/src/client/views/collections/collectionFreeForm/MarqueeView.tsx
@@ -19,7 +19,8 @@ import { Transform } from "../../../util/Transform";
 import { undoBatch, UndoManager } from "../../../util/UndoManager";
 import { ContextMenu } from "../../ContextMenu";
 import { FormattedTextBox } from "../../nodes/formattedText/FormattedTextBox";
-import { PresBox, PresMovement } from "../../nodes/PresBox";
+import { PresBox } from "../../nodes/trails/PresBox";
+import { PresMovement } from "../../nodes/trails/PresEnums";
 import { PreviewCursor } from "../../PreviewCursor";
 import { CollectionDockingView } from "../CollectionDockingView";
 import { SubCollectionViewProps } from "../CollectionSubView";
diff --git a/src/client/views/global/globalCssVariables.scss b/src/client/views/global/globalCssVariables.scss
index a8d4235bd..72adc171b 100644
--- a/src/client/views/global/globalCssVariables.scss
+++ b/src/client/views/global/globalCssVariables.scss
@@ -38,6 +38,9 @@ $antimodemenu-height: 36px;
 $contextMenu-zindex: 100000; // context menu shows up over everything
 $radialMenu-zindex: 100000; // context menu shows up over everything
 
+// borders
+$standard-border: solid 1px #9F9F9F;
+
 $searchpanel-height: 32px;
 $mainTextInput-zindex: 999; // then text input overlay so that it's context menu will appear over decorations, etc
 $docDecorations-zindex: 998; // then doc decorations appear over everything else
diff --git a/src/client/views/nodes/DocumentContentsView.tsx b/src/client/views/nodes/DocumentContentsView.tsx
index 9b75cd8f9..3d2cdf5a4 100644
--- a/src/client/views/nodes/DocumentContentsView.tsx
+++ b/src/client/views/nodes/DocumentContentsView.tsx
@@ -11,7 +11,7 @@ import { CollectionFreeFormView } from "../collections/collectionFreeForm/Collec
 import { CollectionSchemaView } from "../collections/collectionSchema/CollectionSchemaView";
 import { CollectionView } from "../collections/CollectionView";
 import { InkingStroke } from "../InkingStroke";
-import { PresElementBox } from "../presentationview/PresElementBox";
+import { PresElementBox } from "../nodes/trails/PresElementBox";
 import { SearchBox } from "../search/SearchBox";
 import { DashWebRTCVideo } from "../webcam/DashWebRTCVideo";
 import { YoutubeBox } from "./../../apis/youtube/YoutubeBox";
@@ -32,7 +32,7 @@ import { LabelBox } from "./LabelBox";
 import { LinkAnchorBox } from "./LinkAnchorBox";
 import { LinkBox } from "./LinkBox";
 import { PDFBox } from "./PDFBox";
-import { PresBox } from "./PresBox";
+import { PresBox } from "./trails/PresBox";
 import { ScreenshotBox } from "./ScreenshotBox";
 import { ScriptingBox } from "./ScriptingBox";
 import { SliderBox } from "./SliderBox";
diff --git a/src/client/views/nodes/DocumentView.tsx b/src/client/views/nodes/DocumentView.tsx
index 60fa462ad..80a014926 100644
--- a/src/client/views/nodes/DocumentView.tsx
+++ b/src/client/views/nodes/DocumentView.tsx
@@ -43,7 +43,7 @@ import { DocumentLinksButton } from './DocumentLinksButton';
 import "./DocumentView.scss";
 import { LinkAnchorBox } from './LinkAnchorBox';
 import { LinkDocPreview } from "./LinkDocPreview";
-import { PresBox } from './PresBox';
+import { PresBox } from './trails/PresBox';
 import { RadialMenu } from './RadialMenu';
 import React = require("react");
 import { ScriptingBox } from "./ScriptingBox";
diff --git a/src/client/views/nodes/FontIconBox.tsx b/src/client/views/nodes/FontIconBox.tsx
index 6ae4b9726..0d415e238 100644
--- a/src/client/views/nodes/FontIconBox.tsx
+++ b/src/client/views/nodes/FontIconBox.tsx
@@ -14,6 +14,7 @@ import { DocComponent } from '../DocComponent';
 import { StyleProp } from '../StyleProvider';
 import { FieldView, FieldViewProps } from './FieldView';
 import './FontIconBox.scss';
+import { Colors } from '../global/globalEnums';
 const FontIconSchema = createSchema({
     icon: "string",
 });
@@ -47,7 +48,7 @@ export class FontIconBox extends DocComponent<FieldViewProps, FontIconDocument>(
         const icon = StrCast(this.dataDoc.icon, "user") as any;
         const presSize = shape === 'round' ? 25 : 30;
         const presTrailsIcon = <img src={`/assets/${"presTrails.png"}`}
-            style={{ width: presSize, height: presSize, filter: `invert(${color === "white" ? "100%" : "0%"})`, marginBottom: "5px" }} />;
+            style={{ width: presSize, height: presSize, filter: `invert(${color === Colors.DARK_GRAY ? "0%" : "100%"})`, marginBottom: "5px" }} />;
         const button = <button className={`menuButton-${shape}`} onContextMenu={this.specificContextMenu}
             style={{ backgroundColor: backgroundColor, }}>
             <div className="menuButton-wrap">
diff --git a/src/client/views/nodes/PresBox.scss b/src/client/views/nodes/PresBox.scss
deleted file mode 100644
index 5d1c5f4eb..000000000
--- a/src/client/views/nodes/PresBox.scss
+++ /dev/null
@@ -1,1243 +0,0 @@
-@import "../global/globalCssVariables";
-
-.presBox-cont {
-    cursor: auto;
-    position: absolute;
-    display: block;
-    pointer-events: inherit;
-    z-index: 2;
-    font-family: Roboto;
-    width: 100%;
-    min-width: 20px;
-    height: 100%;
-    min-height: 35px;
-    letter-spacing: 2px;
-    overflow: hidden;
-    transition: 0.7s opacity ease;
-
-    .presBox-listCont {
-        position: relative;
-        height: calc(100% - 67px);
-        width: 100%;
-    }
-
-    .presBox-toolbar-dropdown {
-        border-radius: 5px;
-        background-color: white;
-        transform: translate(8px, -5px);
-        box-shadow: 1px 1px 4px 4px rgba(0, 0, 0, 0.25);
-        z-index: 1000;
-        width: calc(100% - 50px);
-        height: max-content;
-        justify-self: center;
-        letter-spacing: normal;
-        height: max-content;
-        font-weight: 500;
-        position: relative;
-        font-size: 13;
-    }
-
-    .presBox-toolbar {
-        position: relative;
-        display: inline-flex;
-        align-items: center;
-        height: 30px;
-        width: 100%;
-        color: $white;
-        background-color: $dark-gray;
-
-        .toolbar-button {
-            cursor: pointer;
-            margin-left: 10px;
-            margin-right: 10px;
-            letter-spacing: 0;
-            display: flex;
-            align-items: center;
-            justify-content: center;
-            transition: 0.5s;
-        }
-
-        .toolbar-button.active {
-            color: $light-blue;
-            background-color: white;
-            border-radius: 100%;
-        }
-
-        .toolbar-transitionButtons {
-            display: block;
-
-            .toolbar-transition {
-                display: flex;
-                font-size: 10;
-                width: 100;
-                background-color: rgba(0, 0, 0, 0);
-                min-width: max-content;
-
-                .toolbar-icon {
-                    margin-right: 5px;
-                }
-            }
-        }
-    }
-
-    .toolbar-moreInfo {
-        position: absolute;
-        right: 5px;
-        display: flex;
-        width: max-content;
-        height: 25px;
-        justify-content: center;
-        transform: rotate(90deg);
-        align-items: center;
-        transition: 0.7s ease;
-
-        .toolbar-moreInfoBall {
-            width: 4px;
-            height: 4px;
-            border-radius: 100%;
-            background-color: white;
-            margin: 1px;
-            position: relative;
-        }
-    }
-
-    .toolbar-moreInfo.active {
-        transform: rotate(0deg);
-    }
-
-    .toolbar-divider {
-        border-left: solid $medium-gray 0.5px;
-        height: 20px;
-    }
-}
-
-.dropdown {
-    font-size: 10;
-    margin-left: 5px;
-    color: $medium-gray;
-    transition: 0.5s ease;
-}
-
-.dropdown.active {
-    transform: rotate(180deg);
-    color: $light-blue;
-    opacity: 0.8;
-}
-
-.presBox-radioButtons {
-    font-size: 10px;
-    font-weight: 200;
-    // background-color: rgba(0, 0, 0, 0.1);
-
-    .checkbox-container {
-        margin-left: 10px;
-        display: inline-flex;
-        width: 100%;
-        height: 20px;
-        align-items: center;
-    }
-
-    .checkbox-dropdown {
-        display: flex;
-        width: 100%;
-        align-items: flex-end;
-        gap: 5px;
-
-        .presBox-viewPicker {
-            width: calc(100% - 120px);
-            min-width: 30px;
-        }
-    }
-}
-
-.presBox-ribbon {
-    position: relative;
-    display: inline;
-    font-family: Roboto;
-    z-index: 100;
-    transition: 0.7s;
-
-    .ribbon-doubleButton {
-        display: inline-flex;
-    }
-
-    .presBox-reactiveGrid {
-        display: grid;
-        justify-content: flex-start;
-        align-items: center;
-        grid-template-columns: repeat(auto-fit, 70px);
-    }
-
-    .ribbon-colorBox {
-        cursor: pointer;
-        border: solid 1px $black;
-        display: flex;
-        margin-left: 5px;
-        margin-top: 5px;
-        margin-bottom: 5px;
-        justify-content: center;
-        align-items: center;
-        height: 15px;
-        width: 15px;
-        padding: 0px;
-        transform: translate(2px, 3px);
-    }
-
-    .ribbon-property {
-        font-size: 11;
-        font-weight: 200;
-        height: 20;
-        background-color: $white;
-        color: $black;
-        border: solid 1px $black;
-        display: flex;
-        margin-left: 5px;
-        margin-top: 5px;
-        margin-bottom: 5px;
-        width: max-content;
-        justify-content: center;
-        align-items: center;
-        padding-right: 10px;
-        padding-left: 10px;
-    }
-
-    .ribbon-propertyUpDown {
-        height: 20;
-        width: 20;
-        margin-top: 5px;
-        display: grid;
-        grid-template-rows: 10px 10px;
-
-        .ribbon-propertyUpDownItem {
-            cursor: pointer;
-            color: white;
-            display: flex;
-            justify-content: center;
-            align-items: center;
-            height: 100%;
-            width: 100%;
-            background: $black;
-        }
-
-        .ribbon-propertyUpDownItem:hover {
-            background: $medium-gray;
-            transform: scale(1.05);
-        }
-    }
-
-    .presBox-subheading {
-        font-size: 11;
-        font-weight: 400;
-        margin-top: 10px;
-    }
-
-    @media screen and (-webkit-min-device-pixel-ratio:0) {
-
-        .multiThumb-slider {
-            display: grid;
-            background-color: $white;
-            height: 10px;
-            border-radius: 10px;
-            overflow: hidden;
-
-            .toolbar-slider {
-                margin-top: 0px;
-                background: none;
-                -webkit-appearance: none;
-                pointer-events: none;
-            }
-
-            .toolbar-slider.start::-webkit-slider-thumb {
-                width: 10px;
-                pointer-events: auto;
-                -webkit-appearance: none;
-                height: 10px;
-                cursor: ew-resize;
-                background: $medium-blue;
-                box-shadow: -100vw 0 0 100vw $white;
-            }
-
-            .toolbar-slider.end::-webkit-slider-thumb {
-                width: 10px;
-                pointer-events: auto;
-                -webkit-appearance: none;
-                height: 10px;
-                cursor: ew-resize;
-                background: $medium-blue;
-                box-shadow: -100vw 0 0 100vw $light-blue;
-            }
-        }
-
-        .toolbar-slider {
-            margin-top: 5px;
-            position: relative;
-            align-self: center;
-            justify-self: left;
-            overflow: hidden;
-            width: 100%;
-            height: 10px;
-            border-radius: 10px;
-            -webkit-appearance: none;
-            background-color: $white;
-        }
-
-        .toolbar-slider:focus {
-            outline: none;
-        }
-
-        .toolbar-slider::-webkit-slider-runnable-track {
-            height: 10px;
-            -webkit-appearance: none;
-            margin-top: -1px;
-        }
-
-        .toolbar-slider::-webkit-slider-thumb {
-            width: 10px;
-            pointer-events: auto;
-            -webkit-appearance: none;
-            height: 10px;
-            cursor: ew-resize;
-            background: $medium-blue;
-            box-shadow: -100vw 0 0 100vw $light-blue;
-        }
-
-        .presBox-checkbox {
-            -webkit-appearance: none;
-            -webkit-user-select: none;
-            -moz-user-select: none;
-            -ms-user-select: none;
-            user-select: none;
-            margin: 0;
-            margin-right: 3px;
-            border-radius: 100%;
-            height: 15px;
-            width: 15px;
-            min-width: 15px;
-            cursor: pointer;
-            background: $white;
-        }
-
-        .presBox-checkbox:focus {
-            outline: none;
-        }
-
-        .presBox-checkbox:hover {
-            background: $light-gray;
-        }
-
-        .presBox-checkbox:checked {
-            background: $light-blue;
-        }
-    }
-
-
-
-    .slider-headers {
-        position: relative;
-        display: grid;
-        justify-content: space-between;
-        width: 100%;
-        height: max-content;
-        grid-template-columns: auto auto auto;
-        grid-template-rows: max-content;
-        font-weight: 100;
-        margin-top: 3px;
-        font-size: 10px;
-
-        .slider-block {
-            width: 63px;
-            border-radius: 5px;
-            text-align: center;
-            margin-bottom: 8px;
-            margin-top: 8px;
-        }
-
-        .slider-number {
-            border-radius: 3px;
-            width: 30px;
-            margin: auto;
-        }
-    }
-
-    .slider-value {
-        top: -20;
-        color: #2f86a2;
-        position: absolute;
-    }
-
-    .slider-value.none,
-    .slider-headers.none,
-    .toolbar-slider.none {
-        display: none;
-    }
-
-    .dropdown-header {
-        padding-bottom: 10px;
-        font-weight: 800;
-        text-align: center;
-        font-size: 16;
-        width: 90%;
-        color: $black;
-        transform: translate(5%, 0px);
-        border-bottom: solid 2px $medium-gray;
-    }
-
-
-    .ribbon-textInput {
-        border-radius: 2px;
-        height: 20px;
-        font-size: 11.5;
-        font-weight: 100;
-        align-self: center;
-        justify-self: left;
-        margin-top: 5px;
-        padding-left: 10px;
-        background-color: $white;
-        border: solid 1px $black;
-        min-width: 80px;
-        max-width: 200px;
-        width: 100%;
-    }
-
-    .presBox-input {
-        width: 30;
-        height: 100%;
-        background: none;
-        border: none;
-        text-align: right;
-    }
-
-    .presBox-input:focus {
-        outline: none;
-    }
-
-    .ribbon-frameSelector {
-        border: $black solid 1px;
-        width: 60px;
-        height: 20px;
-        margin-top: 5px;
-        display: grid;
-        grid-template-columns: auto 27px auto;
-        position: relative;
-        border-radius: 5px;
-        overflow: hidden;
-        align-items: center;
-        justify-self: left;
-
-        .fwdKeyframe,
-        .backKeyframe {
-            cursor: pointer;
-            position: relative;
-            height: 100%;
-            background: $white;
-            display: flex;
-            align-items: center;
-            justify-content: center;
-            text-align: center;
-            color: $black;
-        }
-
-        .numKeyframe {
-            cursor: pointer;
-            font-size: 10;
-            font-weight: 600;
-            position: relative;
-            color: $black;
-            display: flex;
-            width: 100%;
-            height: 100%;
-            text-align: center;
-            align-items: center;
-            justify-content: center;
-        }
-    }
-
-    .ribbon-final-box {
-        align-self: flex-start;
-        justify-self: center;
-        display: grid;
-        margin-top: 10px;
-        grid-template-rows: auto auto;
-        /* padding-left: 10px; */
-        /* padding-right: 10px; */
-        letter-spacing: normal;
-        min-width: max-content;
-        width: 100%;
-        font-size: 13;
-        font-weight: 500;
-        position: relative;
-
-
-        .ribbon-final-button {
-            cursor: pointer;
-            position: relative;
-            font-size: 11;
-            font-weight: normal;
-            letter-spacing: normal;
-            display: flex;
-            justify-content: center;
-            align-items: center;
-            margin-bottom: 5px;
-            height: 25px;
-            color: white;
-            width: 100%;
-            max-width: 120;
-            padding-left: 10;
-            padding-right: 10;
-            border-radius: 10px;
-            background-color: $medium-gray;
-        }
-
-        .ribbon-final-button:hover {
-            transform: scale(1.05);
-            transition: all 0.4s;
-        }
-
-        .ribbon-final-button-hidden {
-            cursor: pointer;
-            position: relative;
-            font-size: 11;
-            font-weight: normal;
-            letter-spacing: normal;
-            display: flex;
-            justify-content: center;
-            align-items: center;
-            margin-bottom: 5px;
-            height: 25px;
-            color: $light-gray;
-            width: 100%;
-            max-width: 120;
-            padding-left: 10;
-            padding-right: 10;
-            border-radius: 10px;
-            background-color: $black;
-        }
-
-        .ribbon-final-button-hidden:hover {
-            transform: scale(1.05);
-            transition: all 0.4s;
-        }
-
-        .ribbon-frameList {
-            width: calc(100% - 5px);
-            height: 50px;
-            background-color: $white;
-            border: 1px solid $medium-gray;
-            grid-template-rows: max-content;
-
-            .frameList-header {
-                display: grid;
-                width: 100%;
-                height: 20px;
-                background-color: $medium-gray;
-
-                .frameList-headerButtons {
-                    display: flex;
-                    grid-column: 7;
-                    width: 60px;
-                    justify-self: right;
-                    justify-content: flex-end;
-
-                    .headerButton {
-                        cursor: pointer;
-                        position: relative;
-                        border-radius: 100%;
-                        z-index: 300;
-                        width: 15px;
-                        height: 15px;
-                        display: flex;
-                        font-size: 10px;
-                        justify-self: center;
-                        align-self: center;
-                        background-color: rgba(0, 0, 0, 0.5);
-                        color: white;
-                        justify-content: center;
-                        align-items: center;
-                        transition: 0.2s;
-                        margin-right: 3px;
-                    }
-
-                    .headerButton:hover {
-                        background-color: rgba(0, 0, 0, 1);
-                        transform: scale(1.15);
-                    }
-                }
-            }
-        }
-    }
-
-    .selectedList {
-        display: block;
-        min-width: 50;
-        max-width: 120;
-        height: 70;
-        overflow-y: scroll;
-
-        .selectedList-items {
-            font-size: 7;
-            font-weight: normal;
-        }
-    }
-
-    .ribbon-button {
-        cursor: pointer;
-        font-size: 10.5;
-        font-weight: 300;
-        height: 20;
-        background-color: $medium-gray;
-        color: white;
-        display: flex;
-        margin-top: 5px;
-        margin-bottom: 5px;
-        border-radius: 5px;
-        margin-right: 5px;
-        width: max-content;
-        justify-content: center;
-        align-items: center;
-        padding-right: 10px;
-        padding-left: 10px;
-    }
-
-    .ribbon-button:hover {
-        transform: scale(1.03);
-        transition: all 0.4s;
-        font-weight: 400;
-        opacity: 1;
-        color: $white;
-        background-color: $black;
-    }
-
-    .ribbon-toggle {
-        cursor: pointer;
-        font-size: 10.5;
-        font-weight: 200;
-        height: 20;
-        background-color: $white;
-        border: solid 1px rgba(0, 0, 0, 0.5);
-        display: flex;
-        color: $black;
-        margin-top: 5px;
-        margin-bottom: 5px;
-        border-radius: 5px;
-        margin-right: 5px;
-        width: max-content;
-        justify-content: center;
-        align-items: center;
-        padding-right: 10px;
-        padding-left: 10px;
-    }
-
-    .ribbon-toggle.active {
-        background-color: #aedef8;
-    }
-
-    .ribbon-toggle:hover {
-        transform: scale(1.03);
-        transition: all 0.4s;
-        border: solid 1px rgba(0, 0, 0, 0.75);
-    }
-
-    svg.svg-inline--fa.fa-thumbtack.fa-w-12.toolbar-thumbtack {
-        right: 40;
-        position: absolute;
-        transform: rotate(45deg);
-    }
-
-    .ribbon-box {
-        display: grid;
-        grid-template-rows: max-content auto;
-        justify-self: center;
-        margin-top: 10px;
-        padding-right: 10px;
-        letter-spacing: normal;
-        width: 100%;
-        height: max-content;
-        font-weight: 500;
-        position: relative;
-        font-size: 13;
-        padding-bottom: 10px;
-        border-bottom: solid 1px $dark-gray;
-
-        .presBox-dropdown:hover {
-            border: solid 1px $medium-blue;
-
-            .presBox-dropdownIcon {
-                color: $medium-blue;
-            }
-        }
-
-        .presBox-dropdown {
-            cursor: pointer;
-            display: grid;
-            grid-template-columns: auto 20%;
-            position: relative;
-            border: solid 1px $black;
-            background-color: $light-gray;
-            border-radius: 5px;
-            font-size: 10;
-            height: 25;
-            color: $black;
-            padding-left: 5px;
-            align-items: center;
-            margin-top: 5px;
-            margin-bottom: 5px;
-            font-weight: 200;
-            width: 100%;
-            min-width: max-content;
-            max-width: 200px;
-            overflow: visible;
-
-
-            .presBox-dropdownOption {
-                cursor: pointer;
-                font-size: 11;
-                display: block;
-                padding-left: 10px;
-                padding-right: 5px;
-                padding-top: 3;
-                padding-bottom: 3;
-            }
-
-            .presBox-dropdownOption:hover {
-                position: relative;
-                background-color: lightgrey;
-            }
-
-            .presBox-dropdownOption.active {
-                position: relative;
-                background-color: $light-blue;
-            }
-
-            .presBox-dropdownOptions {
-                position: absolute;
-                top: 23px;
-                left: -2px;
-                z-index: 200;
-                width: 85%;
-                min-width: max-content;
-                display: block;
-                background: #FFFFFF;
-                border: 0.5px solid #979797;
-                box-sizing: border-box;
-                box-shadow: 0px 4px 4px rgba(0, 0, 0, 0.25);
-            }
-
-            .presBox-dropdownIcon {
-                position: relative;
-                color: black;
-                align-self: center;
-                justify-self: center;
-                margin-right: 2px;
-            }
-        }
-    }
-}
-
-.presBox-ribbon.active {
-    display: grid;
-    grid-template-columns: auto auto auto auto auto;
-    grid-template-rows: 100%;
-    height: 100px;
-    padding-top: 5px;
-    padding-bottom: 5px;
-    border: solid 1px $black;
-    // overflow: auto; 
-
-    ::-webkit-scrollbar {
-        -webkit-appearance: none;
-        height: 3px;
-        width: 8px;
-    }
-
-    ::-webkit-scrollbar-thumb {
-        border-radius: 2px;
-    }
-}
-
-.dropdown-play-button {
-    cursor: pointer;
-    font-size: 12;
-    padding-left: 5px;
-    padding-right: 5px;
-    padding-top: 5px;
-    padding-bottom: 5px;
-    text-align: left;
-    justify-content: left;
-}
-
-.dropdown-play-button:hover {
-    background-color: lightgrey;
-}
-
-.presBox-button-left {
-    cursor: pointer;
-    position: relative;
-    align-self: flex-start;
-    justify-self: flex-start;
-    width: 100%;
-    height: 100%;
-    display: flex;
-    align-items: center;
-    justify-content: center;
-    border-radius: 4px;
-    padding-left: 7px;
-    padding-right: 7px;
-    border-bottom-right-radius: 0;
-    border-top-right-radius: 0;
-}
-
-.presBox-button-right {
-    cursor: pointer;
-    position: relative;
-    text-align: center;
-    border-left: solid 1px $medium-gray;
-    width: 20%;
-    height: 100%;
-    display: flex;
-    align-items: center;
-    justify-content: center;
-    border-radius: 4px;
-    padding-left: 7px;
-    padding-right: 7px;
-    border-bottom-left-radius: 0;
-    border-top-left-radius: 0;
-}
-
-.presBox-button-right.active {
-    background-color: #223063;
-    border: #aedcf6 solid 1px;
-    box-shadow: 0px 4px 10px rgba(0, 0, 0, 0.8);
-}
-
-.dropdown-play {
-    cursor: pointer;
-    right: 0px;
-    top: calc(100% + 2px);
-    display: none;
-    border-radius: 5px;
-    width: max-content;
-    min-height: 20px;
-    height: max-content;
-    box-shadow: 0px 4px 10px rgba(0, 0, 0, 0.8);
-    z-index: 200;
-    background-color: white;
-    color: $black;
-    position: absolute;
-    overflow: hidden;
-}
-
-.dropdown-play.active {
-    display: block;
-}
-
-.open-layout {
-    cursor: pointer;
-    position: relative;
-    display: flex;
-    align-items: center;
-    justify-content: center;
-    transform: translate(0px, -1px);
-    background-color: $white;
-    width: 40px;
-    height: 15px;
-    align-self: center;
-    justify-self: center;
-    border: solid 1px $black;
-    border-top: 0px;
-    border-bottom-right-radius: 7px;
-    border-bottom-left-radius: 7px;
-}
-
-.layout-container {
-    padding: 5px;
-    display: grid;
-    background-color: $white;
-    grid-template-columns: repeat(auto-fit, minmax(90px, 100px));
-    width: 100%;
-    border: solid 1px $black;
-    min-width: 100px;
-    overflow: hidden;
-
-    .layout:hover {
-        border: solid 2px $medium-blue;
-    }
-
-    .layout {
-        cursor: pointer;
-        align-self: center;
-        justify-self: center;
-        margin-top: 5;
-        margin-bottom: 5;
-        position: relative;
-        height: 55px;
-        min-width: 90px;
-        width: 90px;
-        overflow: hidden;
-        background-color: white;
-        border: solid $medium-gray 1px;
-        display: grid;
-        grid-template-rows: auto;
-        align-items: center;
-        text-align: center;
-
-        .title {
-            position: relative;
-            align-self: end;
-            padding-left: 3px;
-            margin-left: 3px;
-            margin-right: 3px;
-            height: 13;
-            font-size: 12;
-            display: flex;
-            background-color: #white;
-        }
-
-        .subtitle {
-            align-self: flex-start;
-            position: relative;
-            padding-left: 3px;
-            margin-left: 3px;
-            margin-right: 3px;
-            font-weight: 400;
-            height: 13;
-            font-size: 9;
-            display: flex;
-            background-color: $white;
-        }
-
-        .content {
-            position: relative;
-            font-weight: 200;
-            align-self: flex-start;
-            padding-left: 3px;
-            margin-left: 3px;
-            margin-right: 3px;
-            height: 13;
-            font-size: 10;
-            display: flex;
-            background-color: $white;
-            height: 33;
-            text-align: left;
-            font-size: 8px;
-        }
-    }
-}
-
-.presBox-buttons {
-    position: relative;
-    width: 100%;
-    background: gray;
-    min-height: 35px;
-    padding-top: 5px;
-    padding-bottom: 5px;
-    display: grid;
-    grid-template-columns: auto auto;
-
-    .presBox-viewPicker {
-        cursor: pointer;
-        height: 25;
-        position: relative;
-        display: inline-block;
-        grid-column: 1;
-        border-radius: 5px;
-        min-width: 15px;
-        max-width: 100px;
-        left: 8px;
-    }
-
-    .presBox-presentPanel {
-        display: flex;
-        justify-self: end;
-        width: 100%;
-        max-width: 300px;
-        min-width: 150px;
-    }
-
-
-
-    select {
-        background: $dark-gray;
-        color: $white;
-    }
-
-    .presBox-button {
-        cursor: pointer;
-        height: 25px;
-        border-radius: 5px;
-        display: none;
-        justify-content: center;
-        align-content: center;
-        align-items: center;
-        text-align: center;
-        letter-spacing: normal;
-        width: inherit;
-        background: $dark-gray;
-        color: $white;
-    }
-
-    .presBox-button.active {
-        display: flex;
-    }
-
-    .presBox-button.active:hover {
-        background-color: $medium-blue;
-    }
-
-    .presBox-button.edit {
-        display: flex;
-        max-width: 25px;
-    }
-
-    .presBox-button.present {
-        display: flex;
-        width: max-content;
-        position: absolute;
-        right: 10px;
-
-        .present-icon {
-            margin-right: 7px;
-        }
-    }
-
-
-
-    .collectionViewBaseChrome-viewPicker {
-        min-width: 50;
-        width: 5%;
-        height: 25;
-        position: relative;
-        display: inline-block;
-        left: 8px;
-    }
-}
-
-.presBox-backward,
-.presBox-forward {
-    width: 25px;
-    border-radius: 5px;
-    top: 50%;
-    position: absolute;
-    display: inline-block;
-}
-
-.presBox-backward {
-    left: 5;
-}
-
-.presBox-forward {
-    right: 5;
-}
-
-// CSS adjusted for mobile devices
-@media only screen and (max-device-width: 480px) {
-    .presBox-cont .presBox-buttons {
-        position: absolute;
-        top: 70%;
-        left: 50%;
-        transform: translate(-50%, 0);
-        width: max-content;
-        height: 15%;
-        z-index: 2;
-        align-items: center;
-        background: rgba(0, 0, 0, 0);
-        display: inline-flex;
-
-        .presBox-button {
-            margin-top: 5%;
-            height: 250;
-            width: 300;
-            font-size: 100;
-            display: flex;
-            align-items: center;
-            background: $dark-gray;
-            color: $white;
-        }
-
-        .presBox-viewPicker {
-            top: -70;
-            left: 2.5%;
-            height: 50;
-            width: 95%;
-            font-size: 30px;
-            position: absolute;
-            min-width: 50px;
-        }
-    }
-
-    .presBox-cont .presBox-listCont {
-        top: 50;
-        height: calc(100% - 80px);
-    }
-
-    .input,
-    .select {
-        font-size: 100%;
-    }
-}
-
-.miniPres {
-    cursor: grab;
-    position: absolute;
-    right: 10;
-    top: 10;
-    opacity: 0.1;
-    transition: all 0.4s;
-    color: $white;
-}
-
-.miniPres:hover {
-    opacity: 1;
-}
-
-.presPanelOverlay {
-    background-color: $dark-gray;
-    color: $white;
-    border-radius: 5px;
-    grid-template-rows: 100%;
-    height: 25;
-    width: max-content;
-    min-width: max-content;
-    justify-content: space-evenly;
-    align-items: center;
-    display: flex;
-    position: absolute;
-    right: 10px;
-    transition: all 0.2s;
-
-    .presPanel-button-text {
-        cursor: pointer;
-        display: flex;
-        height: 20;
-        width: max-content;
-        font-family: Roboto;
-        font-weight: 400;
-        margin-left: 3px;
-        margin-right: 3px;
-        padding-right: 3px;
-        padding-left: 3px;
-        letter-spacing: normal;
-        border-radius: 5px;
-        align-items: center;
-        justify-content: center;
-        transition: all 0.3s;
-    }
-
-    .presPanel-divider {
-        width: 0.5px;
-        height: 80%;
-        border-right: solid 1px $medium-gray;
-    }
-
-    .presPanel-button-frame {
-        justify-self: center;
-        align-self: center;
-        align-items: center;
-        display: grid;
-        grid-template-columns: auto auto auto;
-        justify-content: space-around;
-        font-size: 11;
-        margin-left: 7;
-        width: 30;
-        height: 85%;
-        background-color: rgba(91, 157, 221, 0.4);
-        border-radius: 5px;
-    }
-
-    .presPanel-button {
-        cursor: pointer;
-        display: flex;
-        height: 20;
-        min-width: 20;
-        margin-left: 3px;
-        margin-right: 3px;
-        border-radius: 100%;
-        align-items: center;
-        justify-content: center;
-        transition: all 0.3s;
-    }
-
-    .presPanel-button:hover {
-        background-color: $medium-gray;
-        transform: scale(1.2);
-    }
-
-    .presPanel-button-text:hover {
-        background-color: $medium-gray;
-    }
-
-
-}
-
-// .miniPres {
-//     cursor: grab;
-//     position: absolute;
-//     overflow: hidden;
-//     right: 10;
-//     top: 10;
-//     opacity: 0.1;
-//     transition: all 0.4s;
-//     /* border: solid 1px; */
-//     color: white;
-//     /* box-shadow: black 0.4vw 0.4vw 0.8vw; */
-
-//     .miniPresOverlay {
-//         display: grid;
-//         grid-template-columns: auto auto auto auto auto auto auto auto auto auto;
-//         grid-template-rows: 100%;
-//         height: 100%;
-//         justify-items: center;
-//         align-items: center;
-
-//         .miniPres-button-text {
-//             cursor: pointer;
-//             display: flex;
-//             height: 20;
-//             font-weight: 400;
-//             min-width: 100%;
-//             border-radius: 5px;
-//             align-items: center;
-//             justify-content: center;
-//             transition: all 0.3s;
-//         }
-
-//         .miniPres-button-frame {
-//             justify-self: center;
-//             align-self: center;
-//             align-items: center;
-//             display: grid;
-//             grid-template-columns: auto auto auto;
-//             justify-content: space-around;
-//             font-size: 11;
-//             margin-left: 7;
-//             width: 30;
-//             height: 85%;
-//             background-color: rgba(91, 157, 221, 0.4);
-//             border-radius: 5px;
-//         }
-
-//         .miniPres-divider {
-//             width: 0.5px;
-//             height: 80%;
-//             border-right: solid 2px #5a5a5a;
-//         }
-
-//         .miniPres-button {
-//             cursor: pointer;
-//             display: flex;
-//             height: 20;
-//             min-width: 20;
-//             border-radius: 100%;
-//             align-items: center;
-//             justify-content: center;
-//             transition: all 0.3s;
-//         }
-
-//         .miniPres-button:hover {
-//             background-color: #5a5a5a;
-//         }
-
-//         .miniPres-button-text:hover {
-//             background-color: #5a5a5a;
-//         }
-//     }
-// }
\ No newline at end of file
diff --git a/src/client/views/nodes/PresBox.tsx b/src/client/views/nodes/PresBox.tsx
deleted file mode 100644
index f3fb6ff17..000000000
--- a/src/client/views/nodes/PresBox.tsx
+++ /dev/null
@@ -1,2472 +0,0 @@
-import React = require("react");
-import { FontAwesomeIcon } from "@fortawesome/react-fontawesome";
-import { Tooltip } from "@material-ui/core";
-import { action, computed, IReactionDisposer, observable, ObservableMap, reaction, runInAction } from "mobx";
-import { observer } from "mobx-react";
-import { ColorState, SketchPicker } from "react-color";
-import { Bounce, Fade, Flip, LightSpeed, Roll, Rotate, Zoom } from 'react-reveal';
-import { Doc, DocListCast, DocListCastAsync, FieldResult } from "../../../fields/Doc";
-import { documentSchema } from "../../../fields/documentSchemas";
-import { InkTool } from "../../../fields/InkField";
-import { List } from "../../../fields/List";
-import { PrefetchProxy } from "../../../fields/Proxy";
-import { listSpec, makeInterface } from "../../../fields/Schema";
-import { ScriptField } from "../../../fields/ScriptField";
-import { BoolCast, Cast, NumCast, StrCast } from "../../../fields/Types";
-import { returnFalse, returnOne, returnTrue, emptyFunction } from '../../../Utils';
-import { Docs } from "../../documents/Documents";
-import { DocumentType } from "../../documents/DocumentTypes";
-import { CurrentUserUtils } from "../../util/CurrentUserUtils";
-import { DocumentManager } from "../../util/DocumentManager";
-import { Scripting } from "../../util/Scripting";
-import { SelectionManager } from "../../util/SelectionManager";
-import { undoBatch, UndoManager } from "../../util/UndoManager";
-import { CollectionDockingView } from "../collections/CollectionDockingView";
-import { CollectionView, CollectionViewType } from "../collections/CollectionView";
-import { TabDocView } from "../collections/TabDocView";
-import { ViewBoxBaseComponent } from "../DocComponent";
-import { CollectionFreeFormDocumentView } from "./CollectionFreeFormDocumentView";
-import { FieldView, FieldViewProps } from './FieldView';
-import "./PresBox.scss";
-import Color = require("color");
-import { LightboxView } from "../LightboxView";
-
-export enum PresMovement {
-    Zoom = "zoom",
-    Pan = "pan",
-    Jump = "jump",
-    None = "none",
-}
-
-export enum PresEffect {
-    Zoom = "Zoom",
-    Lightspeed = "Lightspeed",
-    Fade = "Fade in",
-    Flip = "Flip",
-    Rotate = "Rotate",
-    Bounce = "Bounce",
-    Roll = "Roll",
-    None = "None",
-    Left = "left",
-    Right = "right",
-    Center = "center",
-    Top = "top",
-    Bottom = "bottom"
-}
-
-enum PresStatus {
-    Autoplay = "auto",
-    Manual = "manual",
-    Edit = "edit"
-}
-
-export enum PresColor {
-    LightBlue = "#AEDDF8",
-    DarkBlue = "#5B9FDD",
-    LightBackground = "#ececec",
-    SlideBackground = "#d5dce2",
-}
-
-export class PinProps {
-    audioRange?: boolean;
-    unpin?: boolean;
-    setPosition?: boolean;
-    hidePresBox?: boolean;
-}
-
-type PresBoxSchema = makeInterface<[typeof documentSchema]>;
-const PresBoxDocument = makeInterface(documentSchema);
-
-@observer
-export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>(PresBoxDocument) {
-    public static LayoutString(fieldKey: string) { return FieldView.LayoutString(PresBox, fieldKey); }
-
-    static renderEffectsDoc(renderDoc: any, layoutDoc: Doc) {
-        const effectProps = {
-            left: layoutDoc.presEffectDirection === PresEffect.Left,
-            right: layoutDoc.presEffectDirection === PresEffect.Right,
-            top: layoutDoc.presEffectDirection === PresEffect.Top,
-            bottom: layoutDoc.presEffectDirection === PresEffect.Bottom,
-            opposite: true,
-            delay: layoutDoc.presTransition,
-            // when: this.layoutDoc === PresBox.Instance.childDocs[PresBox.Instance.itemIndex]?.presentationTargetDoc,
-        };
-        switch (layoutDoc.presEffect) {
-            case PresEffect.Zoom: return (<Zoom {...effectProps}>{renderDoc}</Zoom>);
-            case PresEffect.Fade: return (<Fade {...effectProps}>{renderDoc}</Fade>);
-            case PresEffect.Flip: return (<Flip {...effectProps}>{renderDoc}</Flip>);
-            case PresEffect.Rotate: return (<Rotate {...effectProps}>{renderDoc}</Rotate>);
-            case PresEffect.Bounce: return (<Bounce {...effectProps}>{renderDoc}</Bounce>);
-            case PresEffect.Roll: return (<Roll {...effectProps}>{renderDoc}</Roll>);
-            case PresEffect.Lightspeed: return (<LightSpeed {...effectProps}>{renderDoc}</LightSpeed>);
-            case PresEffect.None:
-            default: return renderDoc;
-        }
-    }
-    public static EffectsProvider(layoutDoc: Doc, renderDoc: any) {
-        return PresBox.Instance && layoutDoc === PresBox.Instance.childDocs[PresBox.Instance.itemIndex]?.presentationTargetDoc ?
-            PresBox.renderEffectsDoc(renderDoc, layoutDoc)
-            :
-            renderDoc;
-    }
-
-    @observable public static Instance: PresBox;
-
-    @observable _isChildActive = false;
-    @observable _moveOnFromAudio: boolean = true;
-    @observable _presTimer!: NodeJS.Timeout;
-    @observable _presKeyEventsActive: boolean = false;
-
-    @observable _selectedArray: ObservableMap = new ObservableMap<Doc, any>();
-    @observable _eleArray: HTMLElement[] = [];
-    @observable _dragArray: HTMLElement[] = [];
-    @observable _pathBoolean: boolean = false;
-    @observable _expandBoolean: boolean = false;
-
-    private _disposers: { [name: string]: IReactionDisposer } = {};
-    @observable private transitionTools: boolean = false;
-    @observable private newDocumentTools: boolean = false;
-    @observable private progressivizeTools: boolean = false;
-    @observable private openMovementDropdown: boolean = false;
-    @observable private openEffectDropdown: boolean = false;
-    @observable private presentTools: boolean = false;
-    @computed get childDocs() { return DocListCast(this.dataDoc[this.fieldKey]); }
-    @computed get tagDocs() {
-        const tagDocs: Doc[] = [];
-        for (const doc of this.childDocs) {
-            const tagDoc = Cast(doc.presentationTargetDoc, Doc, null);
-            tagDocs.push(tagDoc);
-        }
-        return tagDocs;
-    }
-    @computed get itemIndex() { return NumCast(this.rootDoc._itemIndex); }
-    @computed get activeItem() { return Cast(this.childDocs[NumCast(this.rootDoc._itemIndex)], Doc, null); }
-    @computed get targetDoc() { return Cast(this.activeItem?.presentationTargetDoc, Doc, null); }
-    @computed get scrollable(): boolean {
-        if (this.targetDoc.type === DocumentType.PDF || this.targetDoc.type === DocumentType.WEB || this.targetDoc.type === DocumentType.RTF || this.targetDoc._viewType === CollectionViewType.Stacking) return true;
-        else return false;
-    }
-    @computed get panable(): boolean {
-        if ((this.targetDoc.type === DocumentType.COL && this.targetDoc._viewType === CollectionViewType.Freeform) || this.targetDoc.type === DocumentType.IMG) return true;
-        else return false;
-    }
-    @computed get presElement() { return Cast(Doc.UserDoc().presElement, Doc, null); }
-    constructor(props: any) {
-        super(props);
-        if (Doc.UserDoc().activePresentation = this.rootDoc) runInAction(() => PresBox.Instance = this);
-        if (!this.presElement) { // create exactly one presElmentBox template to use by any and all presentations.
-            Doc.UserDoc().presElement = new PrefetchProxy(Docs.Create.PresElementBoxDocument({
-                title: "pres element template", type: DocumentType.PRESELEMENT, _xMargin: 0, isTemplateDoc: true, isTemplateForField: "data"
-            }));
-            // this script will be called by each presElement to get rendering-specific info that the PresBox knows about but which isn't written to the PresElement
-            // this is a design choice -- we could write this data to the presElements which would require a reaction to keep it up to date, and it would prevent
-            // the preselement docs from being part of multiple presentations since they would all have the same field, or we'd have to keep per-presentation data
-            // stored on each pres element.
-            (this.presElement as Doc).lookupField = ScriptField.MakeFunction("lookupPresBoxField(container, field, data)",
-                { field: "string", data: Doc.name, container: Doc.name });
-        }
-        this.props.Document.presentationFieldKey = this.fieldKey; // provide info to the presElement script so that it can look up rendering information about the presBox
-    }
-    @computed get selectedDocumentView() {
-        if (SelectionManager.Views().length) return SelectionManager.Views()[0];
-        if (this._selectedArray.size) return DocumentManager.Instance.getDocumentView(this.rootDoc);
-    }
-    @computed get isPres(): boolean {
-        document.removeEventListener("keydown", PresBox.keyEventsWrapper, true);
-        if (this.selectedDoc?.type === DocumentType.PRES) {
-            document.removeEventListener("keydown", PresBox.keyEventsWrapper, true);
-            document.addEventListener("keydown", PresBox.keyEventsWrapper, true);
-            return true;
-        }
-        return false;
-    }
-    @computed get selectedDoc() { return this.selectedDocumentView?.rootDoc; }
-
-    @action
-    componentWillUnmount() {
-        document.removeEventListener("keydown", PresBox.keyEventsWrapper, true);
-        this._presKeyEventsActive = false;
-        this.resetPresentation();
-        // Turn of progressivize editors
-        this.turnOffEdit(true);
-        Object.values(this._disposers).forEach(disposer => disposer?.());
-    }
-
-    @action
-    componentDidMount() {
-        this.rootDoc.presBox = this.rootDoc;
-        this.rootDoc._forceRenderEngine = "timeline";
-        this.layoutDoc.presStatus = PresStatus.Edit;
-        this.layoutDoc._gridGap = 0;
-        this.layoutDoc._yMargin = 0;
-        this.turnOffEdit(true);
-        DocListCastAsync((Doc.UserDoc().myPresentations as Doc).data).then(pres =>
-            !pres?.includes(this.rootDoc) && Doc.AddDocToList(Doc.UserDoc().myPresentations as Doc, "data", this.rootDoc));
-        this._disposers.selection = reaction(() => SelectionManager.Views(),
-            views => views.some(view => view.props.Document === this.rootDoc) && this.updateCurrentPresentation());
-    }
-
-    @action
-    updateCurrentPresentation = (pres?: Doc) => {
-        if (pres) Doc.UserDoc().activePresentation = pres;
-        else Doc.UserDoc().activePresentation = this.rootDoc;
-        document.removeEventListener("keydown", PresBox.keyEventsWrapper, true);
-        document.addEventListener("keydown", PresBox.keyEventsWrapper, true);
-        this._presKeyEventsActive = true;
-        PresBox.Instance = this;
-    }
-
-    // There are still other internal frames and should go through all frames before going to next slide
-    nextInternalFrame = (targetDoc: Doc, activeItem: Doc) => {
-        const currentFrame = Cast(targetDoc?._currentFrame, "number", null);
-        const childDocs = DocListCast(targetDoc[Doc.LayoutFieldKey(targetDoc)]);
-        targetDoc._viewTransition = "all 1s";
-        setTimeout(() => targetDoc._viewTransition = undefined, 1010);
-        this.nextKeyframe(targetDoc, activeItem);
-        if (activeItem.presProgressivize) CollectionFreeFormDocumentView.updateKeyframe(childDocs, currentFrame || 0, targetDoc);
-        else targetDoc.keyFrameEditing = true;
-    }
-
-    _mediaTimer!: [NodeJS.Timeout, Doc];
-    // 'Play on next' for audio or video therefore first navigate to the audio/video before it should be played
-    startTempMedia = (targetDoc: Doc, activeItem: Doc) => {
-        const duration: number = NumCast(activeItem.presEndTime) - NumCast(activeItem.presStartTime);
-        if ([DocumentType.VID, DocumentType.AUDIO].includes(targetDoc.type as any)) {
-            const targMedia = DocumentManager.Instance.getDocumentView(targetDoc);
-            targMedia?.ComponentView?.playFrom?.(NumCast(activeItem.presStartTime), NumCast(activeItem.presStartTime) + duration);
-        }
-        // if (targetDoc.type === DocumentType.AUDIO) {
-        //     if (this._mediaTimer && this._mediaTimer[1] === targetDoc) clearTimeout(this._mediaTimer[0]);
-        //     targetDoc._triggerAudio = NumCast(activeItem.presStartTime);
-        //     this._mediaTimer = [setTimeout(() => targetDoc._audioStop = true, duration * 1000), targetDoc];
-        // } else if (targetDoc.type === DocumentType.VID) {
-        //     targetDoc._triggerVideoStop = true;
-        //     setTimeout(() => targetDoc._currentTimecode = NumCast(activeItem.presStartTime), 10);
-        //     setTimeout(() => targetDoc._triggerVideo = true, 20);
-        //     this._mediaTimer = [setTimeout(() => targetDoc._triggerVideoStop = true, (duration * 1000) + 20), targetDoc];
-        // }
-    }
-
-    stopTempMedia = (targetDocField: FieldResult) => {
-        const targetDoc = Cast(targetDocField, Doc, null);
-        if (targetDoc?.type === DocumentType.AUDIO) {
-            if (this._mediaTimer && this._mediaTimer[1] === targetDoc) clearTimeout(this._mediaTimer[0]);
-            targetDoc._audioStop = true;
-        } else if (targetDoc?.type === DocumentType.VID) {
-            if (this._mediaTimer && this._mediaTimer[1] === targetDoc) clearTimeout(this._mediaTimer[0]);
-            targetDoc._triggerVideoStop = true;
-        }
-    }
-
-    // No more frames in current doc and next slide is defined, therefore move to next slide 
-    nextSlide = (activeNext: Doc) => {
-        const targetNext = Cast(activeNext.presentationTargetDoc, Doc, null);
-        let nextSelected = this.itemIndex + 1;
-        this.gotoDocument(nextSelected, this.activeItem);
-        for (nextSelected = nextSelected + 1; nextSelected < this.childDocs.length; nextSelected++) {
-            if (!this.childDocs[nextSelected].groupWithUp) {
-                break;
-            } else {
-                console.log("Title: " + this.childDocs[nextSelected].title);
-                this.gotoDocument(nextSelected, this.activeItem, true);
-            }
-        }
-    }
-
-    // Called when the user activates 'next' - to move to the next part of the pres. trail
-    @action
-    next = () => {
-        const activeNext = Cast(this.childDocs[this.itemIndex + 1], Doc, null);
-        const activeItem: Doc = this.activeItem;
-        const targetDoc: Doc = this.targetDoc;
-        const lastFrame = Cast(targetDoc?.lastFrame, "number", null);
-        const curFrame = NumCast(targetDoc?._currentFrame);
-        let internalFrames: boolean = false;
-        if (activeItem.presProgressivize || activeItem.zoomProgressivize || targetDoc.scrollProgressivize) internalFrames = true;
-        if (internalFrames && lastFrame !== undefined && curFrame < lastFrame) {
-            // Case 1: There are still other frames and should go through all frames before going to next slide
-            this.nextInternalFrame(targetDoc, activeItem);
-        } else if (this.childDocs[this.itemIndex + 1] !== undefined) {
-            // Case 2: No more frames in current doc and next slide is defined, therefore move to next slide 
-            this.nextSlide(activeNext);
-        } else if (this.childDocs[this.itemIndex + 1] === undefined && (this.layoutDoc.presLoop || this.layoutDoc.presStatus === PresStatus.Edit)) {
-            // Case 3: Last slide and presLoop is toggled ON or it is in Edit mode
-            this.gotoDocument(0, this.activeItem);
-        }
-    }
-
-    // Called when the user activates 'back' - to move to the previous part of the pres. trail
-    @action
-    back = () => {
-        const activeItem: Doc = this.activeItem;
-        const targetDoc: Doc = this.targetDoc;
-        const prevItem = Cast(this.childDocs[Math.max(0, this.itemIndex - 1)], Doc, null);
-        const prevTargetDoc = Cast(prevItem.presentationTargetDoc, Doc, null);
-        const lastFrame = Cast(targetDoc.lastFrame, "number", null);
-        const curFrame = NumCast(targetDoc._currentFrame);
-        let prevSelected = this.itemIndex;
-        // Functionality for group with up
-        let didZoom = activeItem.presMovement;
-        for (; !didZoom && prevSelected > 0 && this.childDocs[prevSelected].groupButton; prevSelected--) {
-            didZoom = this.childDocs[prevSelected].presMovement;
-        }
-        if (lastFrame !== undefined && curFrame >= 1) {
-            // Case 1: There are still other frames and should go through all frames before going to previous slide
-            this.prevKeyframe(targetDoc, activeItem);
-        } else if (activeItem && this.childDocs[this.itemIndex - 1] !== undefined) {
-            // Case 2: There are no other frames so it should go to the previous slide
-            prevSelected = Math.max(0, prevSelected - 1);
-            this.gotoDocument(prevSelected, activeItem);
-            if (NumCast(prevTargetDoc.lastFrame) > 0) prevTargetDoc._currentFrame = NumCast(prevTargetDoc.lastFrame);
-        } else if (this.childDocs[this.itemIndex - 1] === undefined && this.layoutDoc.presLoop) {
-            // Case 3: Pres loop is on so it should go to the last slide
-            this.gotoDocument(this.childDocs.length - 1, activeItem);
-        }
-    }
-
-    //The function that is called when a document is clicked or reached through next or back.
-    //it'll also execute the necessary actions if presentation is playing.
-    public gotoDocument = action((index: number, from?: Doc, group?: boolean) => {
-        Doc.UnBrushAllDocs();
-        if (index >= 0 && index < this.childDocs.length) {
-            this.rootDoc._itemIndex = index;
-            const activeItem: Doc = this.activeItem;
-            const targetDoc: Doc = this.targetDoc;
-            if (from?.mediaStopTriggerList && this.layoutDoc.presStatus !== PresStatus.Edit) {
-                DocListCast(from.mediaStopTriggerList).forEach(this.stopTempMedia);
-            }
-            if (from?.mediaStop === "auto" && this.layoutDoc.presStatus !== PresStatus.Edit) {
-                this.stopTempMedia(from.presentationTargetDoc);
-            }
-            // If next slide is audio / video 'Play automatically' then the next slide should be played
-            if (this.layoutDoc.presStatus !== PresStatus.Edit && (targetDoc.type === DocumentType.AUDIO || targetDoc.type === DocumentType.VID) && (activeItem.mediaStart === "auto")) {
-                this.startTempMedia(targetDoc, activeItem);
-            }
-            if (targetDoc) {
-                targetDoc && runInAction(() => {
-                    if (activeItem.presMovement === PresMovement.Jump) targetDoc.focusSpeed = 0;
-                    else targetDoc.focusSpeed = activeItem.presTransition ? activeItem.presTransition : 500;
-                });
-                setTimeout(() => targetDoc.focusSpeed = 500, this.activeItem.presTransition ? NumCast(this.activeItem.presTransition) + 10 : 510);
-            }
-            if (targetDoc?.lastFrame !== undefined) {
-                targetDoc._currentFrame = 0;
-            }
-            if (!group) this._selectedArray.clear();
-            this.childDocs[index] && this._selectedArray.set(this.childDocs[index], undefined); //Update selected array
-            if (this.layoutDoc._viewType === "stacking" && !group) this.navigateToElement(this.childDocs[index]); //Handles movement to element only when presTrail is list
-            this.onHideDocument(); //Handles hide after/before
-        }
-    });
-
-    _navTimer!: NodeJS.Timeout;
-    navigateToView = (targetDoc: Doc, activeItem: Doc) => {
-        clearTimeout(this._navTimer);
-        const bestTarget = DocumentManager.Instance.getFirstDocumentView(targetDoc)?.props.Document;
-        bestTarget && runInAction(() => {
-            if (bestTarget.type === DocumentType.PDF || bestTarget.type === DocumentType.WEB || bestTarget.type === DocumentType.RTF || bestTarget._viewType === CollectionViewType.Stacking) {
-                bestTarget._viewTransition = activeItem.presTransition ? `transform ${activeItem.presTransition}ms` : 'all 0.5s';
-                bestTarget._scrollTop = activeItem.presPinViewScroll;
-            } else if (bestTarget.type === DocumentType.COMPARISON) {
-                bestTarget._clipWidth = activeItem.presPinClipWidth;
-            } else if (bestTarget.type === DocumentType.VID) {
-                bestTarget._currentTimecode = activeItem.presPinTimecode;
-            } else {
-                bestTarget._viewTransition = activeItem.presTransition ? `transform ${activeItem.presTransition}ms` : 'all 0.5s';
-                bestTarget._panX = activeItem.presPinViewX;
-                bestTarget._panY = activeItem.presPinViewY;
-                bestTarget._viewScale = activeItem.presPinViewScale;
-            }
-            this._navTimer = setTimeout(() => bestTarget._viewTransition = undefined, activeItem.presTransition ? NumCast(activeItem.presTransition) + 10 : 510);
-        });
-    }
-
-    /**
-     * This method makes sure that cursor navigates to the element that
-     * has the option open and last in the group. 
-     * Design choice: If the next document is not in presCollection or 
-     * presCollection itself then if there is a presCollection it will add
-     * a new tab. If presCollection is undefined it will open the document
-     * on the right. 
-     */
-    navigateToElement = async (curDoc: Doc) => {
-        const activeItem: Doc = this.activeItem;
-        const targetDoc: Doc = this.targetDoc;
-        const srcContext = Cast(targetDoc.context, Doc, null);
-        const presCollection = Cast(this.layoutDoc.presCollection, Doc, null);
-        const collectionDocView = presCollection ? DocumentManager.Instance.getDocumentView(presCollection) : undefined;
-        const includesDoc: boolean = DocListCast(presCollection?.data).includes(targetDoc);
-        const tab = Array.from(CollectionDockingView.Instance.tabMap).find(tab => tab.DashDoc === srcContext);
-        this.turnOffEdit();
-        // Handles the setting of presCollection
-        if (includesDoc) {
-            //Case 1: Pres collection should not change as it is already the same
-        } else if (tab !== undefined) {
-            // Case 2: Pres collection should update
-            this.layoutDoc.presCollection = srcContext;
-        }
-        const presStatus = this.rootDoc.presStatus;
-        const selViewCache = Array.from(this._selectedArray.keys());
-        const dragViewCache = Array.from(this._dragArray);
-        const eleViewCache = Array.from(this._eleArray);
-        const self = this;
-        const resetSelection = action(() => {
-            const presDocView = DocumentManager.Instance.getDocumentView(self.rootDoc);
-            if (presDocView) SelectionManager.SelectView(presDocView, false);
-            self.rootDoc.presStatus = presStatus;
-            self._selectedArray.clear();
-            selViewCache.forEach(doc => self._selectedArray.set(doc, undefined));
-            self._dragArray.splice(0, self._dragArray.length, ...dragViewCache);
-            self._eleArray.splice(0, self._eleArray.length, ...eleViewCache);
-        });
-        const openInTab = (doc: Doc, finished?: () => void) => {
-            collectionDocView ? collectionDocView.props.addDocTab(doc, "") : this.props.addDocTab(doc, ":left");
-            this.layoutDoc.presCollection = targetDoc;
-            // this still needs some fixing
-            setTimeout(resetSelection, 500);
-            if (doc !== targetDoc) {
-                setTimeout(finished ?? emptyFunction, 100); /// give it some time to create the targetDoc if we're opening up its context
-            } else {
-                finished?.();
-            }
-        };
-        // If openDocument is selected then it should open the document for the user
-        if (activeItem.openDocument) {
-            LightboxView.SetLightboxDoc(targetDoc);
-        } else if (curDoc.presMovement === PresMovement.Pan && targetDoc) {
-            LightboxView.SetLightboxDoc(undefined);
-            await DocumentManager.Instance.jumpToDocument(targetDoc, false, openInTab, srcContext, undefined, undefined, undefined, includesDoc || tab ? undefined : resetSelection); // documents open in new tab instead of on right
-        } else if ((curDoc.presMovement === PresMovement.Zoom || curDoc.presMovement === PresMovement.Jump) && targetDoc) {
-            LightboxView.SetLightboxDoc(undefined);
-            //awaiting jump so that new scale can be found, since jumping is async     
-            await DocumentManager.Instance.jumpToDocument(targetDoc, true, openInTab, srcContext, undefined, undefined, undefined, includesDoc || tab ? undefined : resetSelection); // documents open in new tab instead of on right    
-        }
-        // After navigating to the document, if it is added as a presPinView then it will
-        // adjust the pan and scale to that of the pinView when it was added.
-        if (activeItem.presPinView) {
-            // if targetDoc is not displayed but one of its aliases is, then we need to modify that alias, not the original target
-            this.navigateToView(targetDoc, activeItem);
-        }
-        // TODO: Add progressivize for navigating web (storing websites for given frames)
-
-    }
-
-    /**
-     * Uses the viewfinder to progressivize through the different views of a single collection.
-     * @param presTargetDoc: document for which internal zoom is used
-     */
-    zoomProgressivizeNext = (activeItem: Doc) => {
-        const targetDoc: Doc = this.targetDoc;
-        const srcContext = Cast(targetDoc?.context, Doc, null);
-        const docView = DocumentManager.Instance.getDocumentView(targetDoc);
-        const vfLeft = this.checkList(targetDoc, activeItem["viewfinder-left-indexed"]);
-        const vfWidth = this.checkList(targetDoc, activeItem["viewfinder-width-indexed"]);
-        const vfTop = this.checkList(targetDoc, activeItem["viewfinder-top-indexed"]);
-        const vfHeight = this.checkList(targetDoc, activeItem["viewfinder-height-indexed"]);
-        // Case 1: document that is not a Golden Layout tab
-        if (srcContext) {
-            const srcDocView = DocumentManager.Instance.getDocumentView(srcContext);
-            if (srcDocView) {
-                const layoutdoc = Doc.Layout(targetDoc);
-                const panelWidth: number = srcDocView.props.PanelWidth();
-                const panelHeight: number = srcDocView.props.PanelHeight();
-                const newPanX = NumCast(targetDoc.x) + NumCast(layoutdoc._width) / 2;
-                const newPanY = NumCast(targetDoc.y) + NumCast(layoutdoc._height) / 2;
-                const newScale = 0.9 * Math.min(Number(panelWidth) / vfWidth, Number(panelHeight) / vfHeight);
-                srcContext._panX = newPanX + (vfLeft + (vfWidth / 2));
-                srcContext._panY = newPanY + (vfTop + (vfHeight / 2));
-                srcContext._viewScale = newScale;
-            }
-        }
-        // Case 2: document is the containing collection
-        if (docView && !srcContext) {
-            const panelWidth: number = docView.props.PanelWidth();
-            const panelHeight: number = docView.props.PanelHeight();
-            const newScale = 0.9 * Math.min(Number(panelWidth) / vfWidth, Number(panelHeight) / vfHeight);
-            targetDoc._panX = vfLeft + (vfWidth / 2);
-            targetDoc._panY = vfTop + (vfWidth / 2);
-            targetDoc._viewScale = newScale;
-        }
-        const resize = document.getElementById('resizable');
-        if (resize) {
-            resize.style.width = vfWidth + 'px';
-            resize.style.height = vfHeight + 'px';
-            resize.style.top = vfTop + 'px';
-            resize.style.left = vfLeft + 'px';
-        }
-    }
-
-    /**
-     * For 'Hide Before' and 'Hide After' buttons making sure that
-     * they are hidden each time the presentation is updated.
-     */
-    @action
-    onHideDocument = () => {
-        this.childDocs.forEach((doc, index) => {
-            const curDoc = Cast(doc, Doc, null);
-            const tagDoc = Cast(curDoc.presentationTargetDoc, Doc, null);
-            if (tagDoc) tagDoc.opacity = 1;
-            const itemIndexes: number[] = this.getAllIndexes(this.tagDocs, tagDoc);
-            const curInd: number = itemIndexes.indexOf(index);
-            if (tagDoc === this.layoutDoc.presCollection) { tagDoc.opacity = 1; }
-            else {
-                if (itemIndexes.length > 1 && curDoc.presHideBefore && curInd !== 0) { }
-                else if (curDoc.presHideBefore) {
-                    if (index > this.itemIndex) {
-                        tagDoc.opacity = 0;
-                    } else if (!curDoc.presHideAfter) {
-                        tagDoc.opacity = 1;
-                    }
-                }
-                if (itemIndexes.length > 1 && curDoc.presHideAfter && curInd !== (itemIndexes.length - 1)) { }
-                else if (curDoc.presHideAfter) {
-                    if (index < this.itemIndex) {
-                        tagDoc.opacity = 0;
-                    } else if (!curDoc.presHideBefore) {
-                        tagDoc.opacity = 1;
-                    }
-                }
-            }
-        });
-    }
-
-
-
-    //The function that starts or resets presentaton functionally, depending on presStatus of the layoutDoc
-    @action
-    startAutoPres = (startSlide: number) => {
-        this.updateCurrentPresentation();
-        let activeItem: Doc = this.activeItem;
-        let targetDoc: Doc = this.targetDoc;
-        let duration = NumCast(activeItem.presDuration) + NumCast(activeItem.presTransition);
-        const timer = (ms: number) => new Promise(res => this._presTimer = setTimeout(res, ms));
-        const load = async () => { // Wrap the loop into an async function for this to work
-            for (var i = startSlide; i < this.childDocs.length; i++) {
-                activeItem = Cast(this.childDocs[this.itemIndex], Doc, null);
-                targetDoc = Cast(activeItem.presentationTargetDoc, Doc, null);
-                duration = NumCast(activeItem.presDuration) + NumCast(activeItem.presTransition);
-                if (duration < 100) { duration = 2500; }
-                if (NumCast(targetDoc.lastFrame) > 0) {
-                    for (var f = 0; f < NumCast(targetDoc.lastFrame); f++) {
-                        await timer(duration / NumCast(targetDoc.lastFrame));
-                        this.next();
-                    }
-                }
-
-                await timer(duration); this.next(); // then the created Promise can be awaited
-                if (i === this.childDocs.length - 1) {
-                    setTimeout(() => {
-                        clearTimeout(this._presTimer);
-                        if (this.layoutDoc.presStatus === 'auto' && !this.layoutDoc.presLoop) this.layoutDoc.presStatus = PresStatus.Manual;
-                        else if (this.layoutDoc.presLoop) this.startAutoPres(0);
-                    }, duration);
-                }
-            }
-        };
-        this.layoutDoc.presStatus = PresStatus.Autoplay;
-        this.startPresentation(startSlide);
-        this.gotoDocument(startSlide, activeItem);
-        load();
-    }
-
-    @action
-    pauseAutoPres = () => {
-        if (this.layoutDoc.presStatus === PresStatus.Autoplay) {
-            if (this._presTimer) clearTimeout(this._presTimer);
-            this.layoutDoc.presStatus = PresStatus.Manual;
-            this.layoutDoc.presLoop = false;
-            this.childDocs.forEach(this.stopTempMedia);
-        }
-    }
-
-    //The function that resets the presentation by removing every action done by it. It also
-    //stops the presentaton.
-    resetPresentation = () => {
-        this.rootDoc._itemIndex = 0;
-        this.childDocs.map(doc => Cast(doc.presentationTargetDoc, Doc, null)).filter(doc => doc instanceof Doc).forEach(doc => {
-            try {
-                doc.opacity = 1;
-            } catch (e) {
-                console.log("Reset presentation error: ", e);
-            }
-        });
-    }
-
-    @action togglePath = (srcContext: Doc, off?: boolean) => {
-        if (off) {
-            this._pathBoolean = false;
-            srcContext.presPathView = false;
-        } else {
-            runInAction(() => this._pathBoolean = !this._pathBoolean);
-            srcContext.presPathView = this._pathBoolean;
-        }
-    }
-
-    @action toggleExpandMode = () => {
-        runInAction(() => this._expandBoolean = !this._expandBoolean);
-        this.rootDoc.expandBoolean = this._expandBoolean;
-        this.childDocs.forEach((doc) => {
-            doc.presExpandInlineButton = this._expandBoolean;
-        });
-    }
-
-    /**
-     * The function that starts the presentation at the given index, also checking if actions should be applied
-     * directly at start.
-     * @param startIndex: index that the presentation will start at
-     */
-    startPresentation = (startIndex: number) => {
-        this.updateCurrentPresentation();
-        this.childDocs.map(doc => {
-            const tagDoc = doc.presentationTargetDoc as Doc;
-            if (doc.presHideBefore && this.childDocs.indexOf(doc) > startIndex) {
-                tagDoc.opacity = 0;
-            }
-            if (doc.presHideAfter && this.childDocs.indexOf(doc) < startIndex) {
-                tagDoc.opacity = 0;
-            }
-        });
-    }
-
-    /**
-     * The method called to open the presentation as a minimized view
-     */
-    @action
-    updateMinimize = () => {
-        const docView = DocumentManager.Instance.getDocumentView(this.layoutDoc);
-        if (CurrentUserUtils.OverlayDocs.includes(this.layoutDoc)) {
-            console.log("case 1");
-            this.layoutDoc.presStatus = PresStatus.Edit;
-            Doc.RemoveDocFromList((Doc.UserDoc().myOverlayDocs as Doc), undefined, this.rootDoc);
-            CollectionDockingView.AddSplit(this.rootDoc, "right");
-        } else if (this.layoutDoc.context && docView) {
-            console.log("case 2");
-            this.layoutDoc.presStatus = PresStatus.Edit;
-            clearTimeout(this._presTimer);
-            const pt = this.props.ScreenToLocalTransform().inverse().transformPoint(0, 0);
-            this.rootDoc.x = pt[0] + (this.props.PanelWidth() - 250);
-            this.rootDoc.y = pt[1] + 10;
-            this.rootDoc._height = 35;
-            this.rootDoc._width = 250;
-            docView.props.removeDocument?.(this.layoutDoc);
-            Doc.AddDocToList((Doc.UserDoc().myOverlayDocs as Doc), undefined, this.rootDoc);
-        } else {
-            console.log("case 3");
-            // TODO glr: fix this case
-        }
-    }
-
-    /**
-     * Called when the user changes the view type
-     * Either 'List' (stacking) or 'Slides' (carousel)
-     */
-    // @undoBatch
-    viewChanged = action((e: React.ChangeEvent) => {
-        //@ts-ignore
-        const viewType = e.target.selectedOptions[0].value as CollectionViewType;
-        // pivot field may be set by the user in timeline view (or some other way) -- need to reset it here
-        viewType === CollectionViewType.Stacking && (this.rootDoc._pivotField = undefined);
-        this.rootDoc._viewType = viewType;
-        if (viewType === CollectionViewType.Stacking) this.layoutDoc._gridGap = 0;
-    });
-
-    /**
-     * Called when the user changes the view type
-     * Either 'List' (stacking) or 'Slides' (carousel)
-     */
-    // @undoBatch
-    mediaStopChanged = action((e: React.ChangeEvent) => {
-        const activeItem: Doc = this.activeItem;
-        //@ts-ignore
-        const stopDoc = e.target.selectedOptions[0].value as string;
-        const stopDocIndex: number = Number(stopDoc[0]);
-        activeItem.mediaStopDoc = stopDocIndex;
-        if (this.childDocs[stopDocIndex - 1].mediaStopTriggerList) {
-            const list = DocListCast(this.childDocs[stopDocIndex - 1].mediaStopTriggerList);
-            list.push(activeItem);
-            // this.childDocs[stopDocIndex - 1].mediaStopTriggerList = list;
-            console.log(list);
-        } else {
-            this.childDocs[stopDocIndex - 1].mediaStopTriggerList = new List<Doc>();
-            const list = DocListCast(this.childDocs[stopDocIndex - 1].mediaStopTriggerList);
-            list.push(activeItem);
-            // this.childDocs[stopDocIndex - 1].mediaStopTriggerList = list;
-            console.log(list);
-        }
-    });
-
-
-    setMovementName = action((movement: any, activeItem: Doc): string => {
-        let output: string = 'none';
-        switch (movement) {
-            case PresMovement.Zoom: output = 'Pan & Zoom'; break; //Pan and zoom
-            case PresMovement.Pan: output = 'Pan'; break; //Pan
-            case PresMovement.Jump: output = 'Jump cut'; break; //Jump Cut
-            case PresMovement.None: output = 'None'; break; //None
-            default: output = 'Zoom'; activeItem.presMovement = 'zoom'; break; //default set as zoom
-        }
-        return output;
-    });
-
-    whenChildContentsActiveChanged = action((isActive: boolean) => this.props.whenChildContentsActiveChanged(this._isChildActive = isActive));
-    // For dragging documents into the presentation trail
-    addDocumentFilter = (docs: Doc[]) => {
-        docs.forEach((doc, i) => {
-            if (doc.presentationTargetDoc) return true;
-            if (doc.type === DocumentType.LABEL) {
-                const audio = Cast(doc.annotationOn, Doc, null);
-                if (audio) {
-                    audio.mediaStart = "manual";
-                    audio.mediaStop = "manual";
-                    audio.presStartTime = NumCast(doc._timecodeToShow /* audioStart */, NumCast(doc._timecodeToShow /* videoStart */));
-                    audio.presEndTime = NumCast(doc._timecodeToHide /* audioEnd */, NumCast(doc._timecodeToHide /* videoEnd */));
-                    audio.presDuration = audio.presStartTime - audio.presEndTime;
-                    TabDocView.PinDoc(audio, { audioRange: true });
-                    setTimeout(() => this.removeDocument(doc), 0);
-                    return false;
-                }
-            } else {
-                if (!doc.aliasOf) {
-                    const original = Doc.MakeAlias(doc);
-                    TabDocView.PinDoc(original);
-                    setTimeout(() => this.removeDocument(doc), 0);
-                    return false;
-                } else {
-                    if (!doc.presentationTargetDoc) doc.title = doc.title + " - Slide";
-                    doc.aliasOf instanceof Doc && (doc.presentationTargetDoc = doc.aliasOf);
-                    doc.presMovement = PresMovement.Zoom;
-                    if (this._expandBoolean) doc.presExpandInlineButton = true;
-                }
-            }
-        });
-        return true;
-    }
-    childLayoutTemplate = () => this.rootDoc._viewType !== CollectionViewType.Stacking ? undefined : this.presElement;
-    removeDocument = (doc: Doc) => Doc.RemoveDocFromList(this.dataDoc, this.fieldKey, doc);
-    getTransform = () => this.props.ScreenToLocalTransform().translate(-5, -65);// listBox padding-left and pres-box-cont minHeight
-    panelHeight = () => this.props.PanelHeight() - 40;
-    isContentActive = (outsideReaction?: boolean) => ((CurrentUserUtils.SelectedTool === InkTool.None && this.props.layerProvider?.(this.layoutDoc) !== false) &&
-        (this.layoutDoc.forceActive || this.props.isSelected(outsideReaction) || this._isChildActive || this.props.renderDepth === 0) ? true : false)
-
-    /**
-     * For sorting the array so that the order is maintained when it is dropped.
-     */
-    @action
-    sortArray = (): Doc[] => {
-        return this.childDocs.filter(doc => this._selectedArray.has(doc));
-    }
-
-    /**
-     * Method to get the list of selected items in the order in which they have been selected
-     */
-    @computed get listOfSelected() {
-        const list = Array.from(this._selectedArray.keys()).map((doc: Doc, index: any) => {
-            const curDoc = Cast(doc, Doc, null);
-            const tagDoc = Cast(curDoc.presentationTargetDoc, Doc, null);
-            if (curDoc && curDoc === this.activeItem) return <div key={index} className="selectedList-items"><b>{index + 1}.  {curDoc.title}</b></div>;
-            else if (tagDoc) return <div key={index} className="selectedList-items">{index + 1}.  {curDoc.title}</div>;
-            else if (curDoc) return <div key={index} className="selectedList-items">{index + 1}.  {curDoc.title}</div>;
-        });
-        return list;
-    }
-
-    @action
-    selectPres = () => {
-        const presDocView = DocumentManager.Instance.getDocumentView(this.rootDoc);
-        presDocView && SelectionManager.SelectView(presDocView, false);
-    }
-
-    //Regular click
-    @action
-    selectElement = async (doc: Doc) => {
-        const context = Cast(doc.context, Doc, null);
-        this.gotoDocument(this.childDocs.indexOf(doc), this.activeItem);
-        if (doc.presPinView || doc.presentationTargetDoc === this.layoutDoc.presCollection) setTimeout(() => this.updateCurrentPresentation(context), 0);
-        else this.updateCurrentPresentation(context);
-
-        if (this.activeItem.setPosition &&
-            this.activeItem.y !== undefined &&
-            this.activeItem.x !== undefined &&
-            this.targetDoc.x !== undefined &&
-            this.targetDoc.y !== undefined) {
-            const timer = (ms: number) => new Promise(res => this._presTimer = setTimeout(res, ms));
-            const time = 10;
-            const ydiff = NumCast(this.activeItem.y) - NumCast(this.targetDoc.y);
-            const xdiff = NumCast(this.activeItem.x) - NumCast(this.targetDoc.x);
-
-            for (let i = 0; i < time; i++) {
-                this.targetDoc.x = NumCast(this.targetDoc.x) + xdiff / time;
-                this.targetDoc.y = NumCast(this.targetDoc.y) + ydiff / time;
-                await timer(0.1);
-            }
-        }
-    }
-
-    //Command click
-    @action
-    multiSelect = (doc: Doc, ref: HTMLElement, drag: HTMLElement) => {
-        if (!this._selectedArray.has(doc)) {
-            this._selectedArray.set(doc, undefined);
-            this._eleArray.push(ref);
-            this._dragArray.push(drag);
-        } else {
-            this._selectedArray.delete(doc);
-            this.removeFromArray(this._eleArray, doc);
-            this.removeFromArray(this._dragArray, doc);
-        }
-        this.selectPres();
-    }
-
-    removeFromArray = (arr: any[], val: any) => {
-        const index: number = arr.indexOf(val);
-        const ret: any[] = arr.splice(index, 1);
-        arr = ret;
-    }
-
-    //Shift click
-    @action
-    shiftSelect = (doc: Doc, ref: HTMLElement, drag: HTMLElement) => {
-        this._selectedArray.clear();
-        // const activeItem = Cast(this.childDocs[this.itemIndex], Doc, null);
-        if (this.activeItem) {
-            for (let i = Math.min(this.itemIndex, this.childDocs.indexOf(doc)); i <= Math.max(this.itemIndex, this.childDocs.indexOf(doc)); i++) {
-                this._selectedArray.set(this.childDocs[i], undefined);
-                this._eleArray.push(ref);
-                this._dragArray.push(drag);
-            }
-        }
-        this.selectPres();
-    }
-
-    //regular click
-    @action
-    regularSelect = (doc: Doc, ref: HTMLElement, drag: HTMLElement, focus: boolean) => {
-        this._selectedArray.clear();
-        this._selectedArray.set(doc, undefined);
-        this._eleArray.splice(0, this._eleArray.length, ref);
-        this._dragArray.splice(0, this._dragArray.length, drag);
-        focus && this.selectElement(doc);
-        this.selectPres();
-    }
-
-    modifierSelect = (doc: Doc, ref: HTMLElement, drag: HTMLElement, focus: boolean, cmdClick: boolean, shiftClick: boolean) => {
-        if (cmdClick) this.multiSelect(doc, ref, drag);
-        else if (shiftClick) this.shiftSelect(doc, ref, drag);
-        else this.regularSelect(doc, ref, drag, focus);
-    }
-
-    static keyEventsWrapper = (e: KeyboardEvent) => {
-        PresBox.Instance.keyEvents(e);
-    }
-
-    // Key for when the presentaiton is active
-    @action
-    keyEvents = (e: KeyboardEvent) => {
-        if (e.target instanceof HTMLInputElement) return;
-        let handled = false;
-        const anchorNode = document.activeElement as HTMLDivElement;
-        if (anchorNode && anchorNode.className?.includes("lm_title")) return;
-        switch (e.key) {
-            case "Backspace":
-                if (this.layoutDoc.presStatus === "edit") {
-                    undoBatch(action(() => {
-                        for (const doc of Array.from(this._selectedArray.keys())) {
-                            this.removeDocument(doc);
-                        }
-                        this._selectedArray.clear();
-                        this._eleArray.length = 0;
-                        this._dragArray.length = 0;
-                    }))();
-                    handled = true;
-                }
-                break;
-            case "Escape":
-                if (CurrentUserUtils.OverlayDocs.includes(this.layoutDoc)) { this.updateMinimize(); }
-                else if (this.layoutDoc.presStatus === "edit") { this._selectedArray.clear(); this._eleArray.length = this._dragArray.length = 0; }
-                else this.layoutDoc.presStatus = "edit";
-                if (this._presTimer) clearTimeout(this._presTimer);
-                handled = true;
-                break;
-            case "Down": case "ArrowDown":
-            case "Right": case "ArrowRight":
-                if (e.shiftKey && this.itemIndex < this.childDocs.length - 1) { // TODO: update to work properly
-                    this.rootDoc._itemIndex = NumCast(this.rootDoc._itemIndex) + 1;
-                    this._selectedArray.set(this.childDocs[this.rootDoc._itemIndex], undefined);
-                } else {
-                    this.next();
-                    if (this._presTimer) { clearTimeout(this._presTimer); this.layoutDoc.presStatus = PresStatus.Manual; }
-                }
-                handled = true;
-                break;
-            case "Up": case "ArrowUp":
-            case "Left": case "ArrowLeft":
-                if (e.shiftKey && this.itemIndex !== 0) { // TODO: update to work properly
-                    this.rootDoc._itemIndex = NumCast(this.rootDoc._itemIndex) - 1;
-                    this._selectedArray.set(this.childDocs[this.rootDoc._itemIndex], undefined);
-                } else {
-                    this.back();
-                    if (this._presTimer) { clearTimeout(this._presTimer); this.layoutDoc.presStatus = PresStatus.Manual; }
-                }
-                handled = true;
-                break;
-            case "Spacebar": case " ":
-                if (this.layoutDoc.presStatus === PresStatus.Manual) this.startAutoPres(this.itemIndex);
-                else if (this.layoutDoc.presStatus === PresStatus.Autoplay) if (this._presTimer) clearTimeout(this._presTimer);
-                handled = true;
-                break;
-            case "a":
-                if ((e.metaKey || e.altKey) && this.layoutDoc.presStatus === "edit") {
-                    this._selectedArray.clear();
-                    this.childDocs.forEach(doc => this._selectedArray.set(doc, undefined));
-                    handled = true;
-                }
-            default:
-                break;
-        }
-        if (handled) {
-            e.stopPropagation();
-            e.preventDefault();
-        }
-    }
-
-    /**
-     * 
-     */
-    @action
-    viewPaths = () => {
-        const srcContext = Cast(this.rootDoc.presCollection, Doc, null);
-        if (srcContext) {
-            this.togglePath(srcContext);
-        }
-    }
-
-    getAllIndexes = (arr: Doc[], val: Doc): number[] => {
-        const indexes = [];
-        for (let i = 0; i < arr.length; i++) {
-            arr[i] === val && indexes.push(i);
-        }
-        return indexes;
-    }
-
-    // Adds the index in the pres path graphically
-    @computed get order() {
-        const order: JSX.Element[] = [];
-        const docs: Doc[] = [];
-        const presCollection = Cast(this.rootDoc.presCollection, Doc, null);
-        const dv = DocumentManager.Instance.getDocumentView(presCollection);
-        this.childDocs.filter(doc => Cast(doc.presentationTargetDoc, Doc, null)).forEach((doc, index) => {
-            const tagDoc = Cast(doc.presentationTargetDoc, Doc, null);
-            const srcContext = Cast(tagDoc.context, Doc, null);
-            const width = NumCast(tagDoc._width) / 10;
-            const height = Math.max(NumCast(tagDoc._height) / 10, 15);
-            const edge = Math.max(width, height);
-            const fontSize = edge * 0.8;
-            const gap = 2;
-            if (presCollection === srcContext) {
-                // Case A: Document is contained within the collection
-                if (docs.includes(tagDoc)) {
-                    const prevOccurances: number = this.getAllIndexes(docs, tagDoc).length;
-                    docs.push(tagDoc);
-                    order.push(
-                        <div className="pathOrder"
-                            key={tagDoc.id + 'pres' + index}
-                            style={{ top: NumCast(tagDoc.y) + (prevOccurances * (edge + gap) - (edge / 2)), left: NumCast(tagDoc.x) - (edge / 2), width: edge, height: edge, fontSize: fontSize }}
-                            onClick={() => this.selectElement(doc)}>
-                            <div className="pathOrder-frame">{index + 1}</div>
-                        </div>);
-                } else {
-                    docs.push(tagDoc);
-                    order.push(
-                        <div className="pathOrder"
-                            key={tagDoc.id + 'pres' + index}
-                            style={{ top: NumCast(tagDoc.y) - (edge / 2), left: NumCast(tagDoc.x) - (edge / 2), width: edge, height: edge, fontSize: fontSize }}
-                            onClick={() => this.selectElement(doc)}>
-                            <div className="pathOrder-frame">{index + 1}</div>
-                        </div>);
-                }
-            } else if (doc.presPinView && presCollection === tagDoc && dv) {
-                // Case B: Document is presPinView and is presCollection
-                const scale: number = 1 / NumCast(doc.presPinViewScale);
-                const height: number = dv.props.PanelHeight() * scale;
-                const width: number = dv.props.PanelWidth() * scale;
-                const indWidth = width / 10;
-                const indHeight = Math.max(height / 10, 15);
-                const indEdge = Math.max(indWidth, indHeight);
-                const indFontSize = indEdge * 0.8;
-                const xLoc: number = NumCast(doc.presPinViewX) - (width / 2);
-                const yLoc: number = NumCast(doc.presPinViewY) - (height / 2);
-                docs.push(tagDoc);
-                order.push(
-                    <>
-                        <div className="pathOrder"
-                            key={tagDoc.id + 'pres' + index}
-                            style={{ top: yLoc - (indEdge / 2), left: xLoc - (indEdge / 2), width: indEdge, height: indEdge, fontSize: indFontSize }}
-                            onClick={() => this.selectElement(doc)}
-                        >
-                            <div className="pathOrder-frame">{index + 1}</div>
-                        </div>
-                        <div className="pathOrder-presPinView" style={{ top: yLoc, left: xLoc, width: width, height: height, borderWidth: indEdge / 10 }}></div>
-                    </>);
-            }
-        });
-        return order;
-    }
-
-    /**
-     * Method called for viewing paths which adds a single line with
-     * points at the center of each document added.
-     * Design choice: When this is called it sets _fitToBox as true so the
-     * user can have an overview of all of the documents in the collection.
-     * (Design needed for when documents in presentation trail are in another
-     * collection)
-     */
-    @computed get paths() {
-        let pathPoints = "";
-        const presCollection = Cast(this.rootDoc.presCollection, Doc, null);
-        this.childDocs.forEach((doc, index) => {
-            const tagDoc = Cast(doc.presentationTargetDoc, Doc, null);
-            const srcContext = Cast(tagDoc?.context, Doc, null);
-            if (tagDoc && presCollection === srcContext) {
-                const n1x = NumCast(tagDoc.x) + (NumCast(tagDoc._width) / 2);
-                const n1y = NumCast(tagDoc.y) + (NumCast(tagDoc._height) / 2);
-                if (index = 0) pathPoints = n1x + "," + n1y;
-                else pathPoints = pathPoints + " " + n1x + "," + n1y;
-            } else if (doc.presPinView && presCollection === tagDoc) {
-                const n1x = NumCast(doc.presPinViewX);
-                const n1y = NumCast(doc.presPinViewY);
-                if (index = 0) pathPoints = n1x + "," + n1y;
-                else pathPoints = pathPoints + " " + n1x + "," + n1y;
-            }
-        });
-        return (<polyline
-            points={pathPoints}
-            style={{
-                opacity: 1,
-                stroke: "#69a6db",
-                strokeWidth: 5,
-                strokeDasharray: '10 5',
-                boxShadow: '0px 4px 4px rgba(0, 0, 0, 0.25)',
-            }}
-            fill="none"
-            markerStart="url(#markerArrow)"
-            markerMid="url(#markerSquare)"
-            markerEnd="url(#markerSquareFilled)"
-        />);
-    }
-
-    // Converts seconds to ms and updates presTransition
-    setTransitionTime = (number: String, change?: number) => {
-        let timeInMS = Number(number) * 1000;
-        if (change) timeInMS += change;
-        if (timeInMS < 100) timeInMS = 100;
-        if (timeInMS > 10000) timeInMS = 10000;
-        Array.from(this._selectedArray.keys()).forEach((doc) => doc.presTransition = timeInMS);
-    }
-
-    // Converts seconds to ms and updates presDuration
-    setDurationTime = (number: String, change?: number) => {
-        let timeInMS = Number(number) * 1000;
-        if (change) timeInMS += change;
-        if (timeInMS < 100) timeInMS = 100;
-        if (timeInMS > 20000) timeInMS = 20000;
-        Array.from(this._selectedArray.keys()).forEach((doc) => doc.presDuration = timeInMS);
-    }
-
-    /**
-     * When the movement dropdown is changes
-     */
-    @undoBatch
-    updateMovement = action((movement: any, all?: boolean) => {
-        const array: any[] = all ? this.childDocs : Array.from(this._selectedArray.keys());
-        array.forEach((doc) => {
-            switch (movement) {
-                case PresMovement.Zoom: //Pan and zoom
-                    doc.presMovement = PresMovement.Zoom;
-                    break;
-                case PresMovement.Pan: //Pan
-                    doc.presMovement = PresMovement.Pan;
-                    break;
-                case PresMovement.Jump: //Jump Cut
-                    doc.presJump = true;
-                    doc.presMovement = PresMovement.Jump;
-                    break;
-                case PresMovement.None: default:
-                    doc.presMovement = PresMovement.None;
-                    break;
-            }
-        });
-    });
-
-    @undoBatch
-    @action
-    updateHideBefore = (activeItem: Doc) => {
-        activeItem.presHideBefore = !activeItem.presHideBefore;
-        Array.from(this._selectedArray.keys()).forEach((doc) => doc.presHideBefore = activeItem.presHideBefore);
-    }
-
-    @undoBatch
-    @action
-    updateHideAfter = (activeItem: Doc) => {
-        activeItem.presHideAfter = !activeItem.presHideAfter;
-        Array.from(this._selectedArray.keys()).forEach((doc) => doc.presHideAfter = activeItem.presHideAfter);
-    }
-
-    @undoBatch
-    @action
-    updateOpenDoc = (activeItem: Doc) => {
-        activeItem.openDocument = !activeItem.openDocument;
-        Array.from(this._selectedArray.keys()).forEach((doc) => {
-            doc.openDocument = activeItem.openDocument;
-        });
-    }
-
-    @undoBatch
-    @action
-    updateEffectDirection = (effect: any, all?: boolean) => {
-        const array: any[] = all ? this.childDocs : Array.from(this._selectedArray.keys());
-        array.forEach((doc) => {
-            const tagDoc = Cast(doc.presentationTargetDoc, Doc, null);
-            switch (effect) {
-                case PresEffect.Left:
-                    tagDoc.presEffectDirection = PresEffect.Left;
-                    break;
-                case PresEffect.Right:
-                    tagDoc.presEffectDirection = PresEffect.Right;
-                    break;
-                case PresEffect.Top:
-                    tagDoc.presEffectDirection = PresEffect.Top;
-                    break;
-                case PresEffect.Bottom:
-                    tagDoc.presEffectDirection = PresEffect.Bottom;
-                    break;
-                case PresEffect.Center: default:
-                    tagDoc.presEffectDirection = PresEffect.Center;
-                    break;
-            }
-        });
-    }
-
-    @undoBatch
-    @action
-    updateEffect = (effect: any, all?: boolean) => {
-        const array: any[] = all ? this.childDocs : Array.from(this._selectedArray.keys());
-        array.forEach((doc) => {
-            const tagDoc = Cast(doc.presentationTargetDoc, Doc, null);
-            switch (effect) {
-                case PresEffect.Bounce:
-                    tagDoc.presEffect = PresEffect.Bounce;
-                    break;
-                case PresEffect.Fade:
-                    tagDoc.presEffect = PresEffect.Fade;
-                    break;
-                case PresEffect.Flip:
-                    tagDoc.presEffect = PresEffect.Flip;
-                    break;
-                case PresEffect.Roll:
-                    tagDoc.presEffect = PresEffect.Roll;
-                    break;
-                case PresEffect.Rotate:
-                    tagDoc.presEffect = PresEffect.Rotate;
-                    break;
-                case PresEffect.None: default:
-                    tagDoc.presEffect = PresEffect.None;
-                    break;
-            }
-        });
-    }
-
-    _batch: UndoManager.Batch | undefined = undefined;
-
-    @computed get transitionDropdown() {
-        const activeItem: Doc = this.activeItem;
-        const targetDoc: Doc = this.targetDoc;
-        const type = targetDoc.type;
-        const isPresCollection: boolean = (targetDoc === this.layoutDoc.presCollection);
-        const isPinWithView: boolean = BoolCast(activeItem.presPinView);
-        if (activeItem && targetDoc) {
-            const transitionSpeed = activeItem.presTransition ? NumCast(activeItem.presTransition) / 1000 : 0.5;
-            let duration = activeItem.presDuration ? NumCast(activeItem.presDuration) / 1000 : 2;
-            if (activeItem.type === DocumentType.AUDIO) duration = NumCast(activeItem.duration);
-            const effect = targetDoc.presEffect ? targetDoc.presEffect : 'None';
-            activeItem.presMovement = activeItem.presMovement ? activeItem.presMovement : 'Zoom';
-            return (
-                <div className={`presBox-ribbon ${this.transitionTools && this.layoutDoc.presStatus === PresStatus.Edit ? "active" : ""}`} onPointerDown={e => e.stopPropagation()} onPointerUp={e => e.stopPropagation()} onClick={action(e => { e.stopPropagation(); this.openMovementDropdown = false; this.openEffectDropdown = false; })}>
-                    <div className="ribbon-box">
-                        Movement
-                        {isPresCollection || (isPresCollection && isPinWithView) ?
-                            <div className="ribbon-property" style={{ marginLeft: 0, height: 25, textAlign: 'left', paddingLeft: 5, paddingRight: 5, fontSize: 10 }}>
-                                {this.scrollable ? "Scroll to pinned view" : !isPinWithView ? "No movement" : "Pan & Zoom to pinned view"}
-                            </div>
-                            :
-                            <div className="presBox-dropdown" onClick={action(e => { e.stopPropagation(); this.openMovementDropdown = !this.openMovementDropdown; })} style={{ borderBottomLeftRadius: this.openMovementDropdown ? 0 : 5, border: this.openMovementDropdown ? `solid 2px ${PresColor.DarkBlue}` : 'solid 1px black' }}>
-                                {this.setMovementName(activeItem.presMovement, activeItem)}
-                                <FontAwesomeIcon className='presBox-dropdownIcon' style={{ gridColumn: 2, color: this.openMovementDropdown ? PresColor.DarkBlue : 'black' }} icon={"angle-down"} />
-                                <div className={'presBox-dropdownOptions'} id={'presBoxMovementDropdown'} onPointerDown={e => e.stopPropagation()} style={{ display: this.openMovementDropdown ? "grid" : "none" }}>
-                                    <div className={`presBox-dropdownOption ${activeItem.presMovement === PresMovement.None ? "active" : ""}`} onPointerDown={e => e.stopPropagation()} onClick={() => this.updateMovement(PresMovement.None)}>None</div>
-                                    <div className={`presBox-dropdownOption ${activeItem.presMovement === PresMovement.Zoom ? "active" : ""}`} onPointerDown={e => e.stopPropagation()} onClick={() => this.updateMovement(PresMovement.Zoom)}>Pan {"&"} Zoom</div>
-                                    <div className={`presBox-dropdownOption ${activeItem.presMovement === PresMovement.Pan ? "active" : ""}`} onPointerDown={e => e.stopPropagation()} onClick={() => this.updateMovement(PresMovement.Pan)}>Pan</div>
-                                    <div className={`presBox-dropdownOption ${activeItem.presMovement === PresMovement.Jump ? "active" : ""}`} onPointerDown={e => e.stopPropagation()} onClick={() => this.updateMovement(PresMovement.Jump)}>Jump cut</div>
-                                </div>
-                            </div>
-                        }
-                        <div className="ribbon-doubleButton" style={{ display: activeItem.presMovement === PresMovement.Pan || activeItem.presMovement === PresMovement.Zoom ? "inline-flex" : "none" }}>
-                            <div className="presBox-subheading">Movement Speed</div>
-                            <div className="ribbon-property">
-                                <input className="presBox-input"
-                                    type="number" value={transitionSpeed}
-                                    onChange={action((e) => this.setTransitionTime(e.target.value))} /> s
-                            </div>
-                            <div className="ribbon-propertyUpDown">
-                                <div className="ribbon-propertyUpDownItem" onClick={undoBatch(() => this.setTransitionTime(String(transitionSpeed), 1000))}>
-                                    <FontAwesomeIcon icon={"caret-up"} />
-                                </div>
-                                <div className="ribbon-propertyUpDownItem" onClick={undoBatch(() => this.setTransitionTime(String(transitionSpeed), -1000))}>
-                                    <FontAwesomeIcon icon={"caret-down"} />
-                                </div>
-                            </div>
-                        </div>
-                        <input type="range" step="0.1" min="0.1" max="10" value={transitionSpeed}
-                            className={`toolbar-slider ${activeItem.presMovement === PresMovement.Pan || activeItem.presMovement === PresMovement.Zoom ? "" : "none"}`}
-                            id="toolbar-slider"
-                            onPointerDown={() => this._batch = UndoManager.StartBatch("presTransition")}
-                            onPointerUp={() => this._batch?.end()}
-                            onChange={(e: React.ChangeEvent<HTMLInputElement>) => {
-                                e.stopPropagation();
-                                this.setTransitionTime(e.target.value);
-                            }} />
-                        <div className={`slider-headers ${activeItem.presMovement === PresMovement.Pan || activeItem.presMovement === PresMovement.Zoom ? "" : "none"}`}>
-                            <div className="slider-text">Fast</div>
-                            <div className="slider-text">Medium</div>
-                            <div className="slider-text">Slow</div>
-                        </div>
-                    </div>
-                    <div className="ribbon-box">
-                        Visibility {"&"} Duration
-                        <div className="ribbon-doubleButton">
-                            {isPresCollection ? (null) : <Tooltip title={<><div className="dash-tooltip">{"Hide before presented"}</div></>}><div className={`ribbon-toggle ${activeItem.presHideBefore ? "active" : ""}`} onClick={() => this.updateHideBefore(activeItem)}>Hide before</div></Tooltip>}
-                            {isPresCollection ? (null) : <Tooltip title={<><div className="dash-tooltip">{"Hide after presented"}</div></>}><div className={`ribbon-toggle ${activeItem.presHideAfter ? "active" : ""}`} onClick={() => this.updateHideAfter(activeItem)}>Hide after</div></Tooltip>}
-                            <Tooltip title={<><div className="dash-tooltip">{"Open in lightbox view"}</div></>}><div className="ribbon-toggle" style={{ backgroundColor: activeItem.openDocument ? PresColor.LightBlue : "" }} onClick={() => this.updateOpenDoc(activeItem)}>Lightbox</div></Tooltip>
-                        </div>
-                        {(type === DocumentType.AUDIO || type === DocumentType.VID) ? (null) : <>
-                            <div className="ribbon-doubleButton" >
-                                <div className="presBox-subheading">Slide Duration</div>
-                                <div className="ribbon-property">
-                                    <input className="presBox-input"
-                                        type="number" value={duration}
-                                        onChange={action((e) => this.setDurationTime(e.target.value))} /> s
-                            </div>
-                                <div className="ribbon-propertyUpDown">
-                                    <div className="ribbon-propertyUpDownItem" onClick={undoBatch(() => this.setDurationTime(String(duration), 1000))}>
-                                        <FontAwesomeIcon icon={"caret-up"} />
-                                    </div>
-                                    <div className="ribbon-propertyUpDownItem" onClick={undoBatch(() => this.setDurationTime(String(duration), -1000))}>
-                                        <FontAwesomeIcon icon={"caret-down"} />
-                                    </div>
-                                </div>
-                            </div>
-                            <input type="range" step="0.1" min="0.1" max="20" value={duration}
-                                style={{ display: targetDoc.type === DocumentType.AUDIO ? "none" : "block" }}
-                                className={"toolbar-slider"} id="duration-slider"
-                                onPointerDown={() => { this._batch = UndoManager.StartBatch("presDuration"); }}
-                                onPointerUp={() => { if (this._batch) this._batch.end(); }}
-                                onChange={(e: React.ChangeEvent<HTMLInputElement>) => { e.stopPropagation(); this.setDurationTime(e.target.value); }}
-                            />
-                            <div className={"slider-headers"} style={{ display: targetDoc.type === DocumentType.AUDIO ? "none" : "grid" }}>
-                                <div className="slider-text">Short</div>
-                                <div className="slider-text">Medium</div>
-                                <div className="slider-text">Long</div>
-                            </div>
-                        </>}
-                    </div>
-                    {isPresCollection ? (null) : <div className="ribbon-box">
-                        Effects
-                        <div className="presBox-dropdown" onClick={action(e => { e.stopPropagation(); this.openEffectDropdown = !this.openEffectDropdown; })} style={{ borderBottomLeftRadius: this.openEffectDropdown ? 0 : 5, border: this.openEffectDropdown ? `solid 2px ${PresColor.DarkBlue}` : 'solid 1px black' }}>
-                            {effect}
-                            <FontAwesomeIcon className='presBox-dropdownIcon' style={{ gridColumn: 2, color: this.openEffectDropdown ? PresColor.DarkBlue : 'black' }} icon={"angle-down"} />
-                            <div className={'presBox-dropdownOptions'} id={'presBoxMovementDropdown'} style={{ display: this.openEffectDropdown ? "grid" : "none" }} onPointerDown={e => e.stopPropagation()}>
-                                <div className={`presBox-dropdownOption ${targetDoc.presEffect === PresEffect.None || !targetDoc.presEffect ? "active" : ""}`} onPointerDown={e => e.stopPropagation()} onClick={() => this.updateEffect(PresEffect.None)}>None</div>
-                                <div className={`presBox-dropdownOption ${targetDoc.presEffect === PresEffect.Fade ? "active" : ""}`} onPointerDown={e => e.stopPropagation()} onClick={() => this.updateEffect(PresEffect.Fade)}>Fade In</div>
-                                <div className={`presBox-dropdownOption ${targetDoc.presEffect === PresEffect.Flip ? "active" : ""}`} onPointerDown={e => e.stopPropagation()} onClick={() => this.updateEffect(PresEffect.Flip)}>Flip</div>
-                                <div className={`presBox-dropdownOption ${targetDoc.presEffect === PresEffect.Rotate ? "active" : ""}`} onPointerDown={e => e.stopPropagation()} onClick={() => this.updateEffect(PresEffect.Rotate)}>Rotate</div>
-                                <div className={`presBox-dropdownOption ${targetDoc.presEffect === PresEffect.Bounce ? "active" : ""}`} onPointerDown={e => e.stopPropagation()} onClick={() => this.updateEffect(PresEffect.Bounce)}>Bounce</div>
-                                <div className={`presBox-dropdownOption ${targetDoc.presEffect === PresEffect.Roll ? "active" : ""}`} onPointerDown={e => e.stopPropagation()} onClick={() => this.updateEffect(PresEffect.Roll)}>Roll</div>
-                            </div>
-                        </div>
-                        <div className="ribbon-doubleButton" style={{ display: effect === 'None' ? "none" : "inline-flex" }}>
-                            <div className="presBox-subheading" >Effect direction</div>
-                            <div className="ribbon-property">
-                                {this.effectDirection}
-                            </div>
-                        </div>
-                        <div className="effectDirection" style={{ display: effect === 'None' ? "none" : "grid", width: 40 }}>
-                            <Tooltip title={<><div className="dash-tooltip">{"Enter from left"}</div></>}><div style={{ gridColumn: 1, gridRow: 2, justifySelf: 'center', color: targetDoc.presEffectDirection === PresEffect.Left ? PresColor.LightBlue : "black", cursor: "pointer" }} onClick={() => this.updateEffectDirection(PresEffect.Left)}><FontAwesomeIcon icon={"angle-right"} /></div></Tooltip>
-                            <Tooltip title={<><div className="dash-tooltip">{"Enter from right"}</div></>}><div style={{ gridColumn: 3, gridRow: 2, justifySelf: 'center', color: targetDoc.presEffectDirection === PresEffect.Right ? PresColor.LightBlue : "black", cursor: "pointer" }} onClick={() => this.updateEffectDirection(PresEffect.Right)}><FontAwesomeIcon icon={"angle-left"} /></div></Tooltip>
-                            <Tooltip title={<><div className="dash-tooltip">{"Enter from top"}</div></>}><div style={{ gridColumn: 2, gridRow: 1, justifySelf: 'center', color: targetDoc.presEffectDirection === PresEffect.Top ? PresColor.LightBlue : "black", cursor: "pointer" }} onClick={() => this.updateEffectDirection(PresEffect.Top)}><FontAwesomeIcon icon={"angle-down"} /></div></Tooltip>
-                            <Tooltip title={<><div className="dash-tooltip">{"Enter from bottom"}</div></>}><div style={{ gridColumn: 2, gridRow: 3, justifySelf: 'center', color: targetDoc.presEffectDirection === PresEffect.Bottom ? PresColor.LightBlue : "black", cursor: "pointer" }} onClick={() => this.updateEffectDirection(PresEffect.Bottom)}><FontAwesomeIcon icon={"angle-up"} /></div></Tooltip>
-                            <Tooltip title={<><div className="dash-tooltip">{"Enter from center"}</div></>}><div style={{ gridColumn: 2, gridRow: 2, width: 10, height: 10, alignSelf: 'center', justifySelf: 'center', border: targetDoc.presEffectDirection === PresEffect.Center || !targetDoc.presEffectDirection ? `solid 2px ${PresColor.LightBlue}` : "solid 2px black", borderRadius: "100%", cursor: "pointer" }} onClick={() => this.updateEffectDirection(PresEffect.Center)}></div></Tooltip>
-                        </div>
-                    </div>}
-                    <div className="ribbon-final-box">
-                        <div className="ribbon-final-button-hidden" onClick={() => this.applyTo(this.childDocs)}>
-                            Apply to all
-                        </div>
-                    </div>
-                </div >
-            );
-        }
-    }
-
-    @computed get effectDirection(): string {
-        let effect = '';
-        switch (this.targetDoc.presEffectDirection) {
-            case 'left': effect = "Enter from left"; break;
-            case 'right': effect = "Enter from right"; break;
-            case 'top': effect = "Enter from top"; break;
-            case 'bottom': effect = "Enter from bottom"; break;
-            default: effect = "Enter from center"; break;
-        }
-        return effect;
-    }
-
-    @undoBatch
-    @action
-    applyTo = (array: Doc[]) => {
-        const activeItem: Doc = this.activeItem;
-        const targetDoc: Doc = this.targetDoc;
-        this.updateMovement(activeItem.presMovement, true);
-        this.updateEffect(targetDoc.presEffect, true);
-        this.updateEffectDirection(targetDoc.presEffectDirection, true);
-        array.forEach((doc) => {
-            const curDoc = Cast(doc, Doc, null);
-            const tagDoc = Cast(curDoc.presentationTargetDoc, Doc, null);
-            if (tagDoc && targetDoc) {
-                curDoc.presTransition = activeItem.presTransition;
-                curDoc.presDuration = activeItem.presDuration;
-                curDoc.presHideBefore = activeItem.presHideBefore;
-                curDoc.presHideAfter = activeItem.presHideAfter;
-            }
-        });
-    }
-
-    @computed get presPinViewOptionsDropdown() {
-        const activeItem: Doc = this.activeItem;
-        const targetDoc: Doc = this.targetDoc;
-        const presPinWithViewIcon = <img src="/assets/pinWithView.png" style={{ margin: "auto", width: 16, filter: 'invert(1)' }} />;
-        return (
-            <>
-                {this.panable || this.scrollable || this.targetDoc.type === DocumentType.COMPARISON ? 'Pinned view' : (null)}
-                <div className="ribbon-doubleButton">
-                    <Tooltip title={<><div className="dash-tooltip">{activeItem.presPinView ? "Turn off pin with view" : "Turn on pin with view"}</div></>}><div className="ribbon-toggle" style={{ width: 20, padding: 0, backgroundColor: activeItem.presPinView ? PresColor.LightBlue : "" }}
-                        onClick={() => {
-                            activeItem.presPinView = !activeItem.presPinView;
-                            targetDoc.presPinView = activeItem.presPinView;
-                            if (activeItem.presPinView) {
-                                if (targetDoc.type === DocumentType.PDF || targetDoc.type === DocumentType.RTF || targetDoc.type === DocumentType.WEB || targetDoc._viewType === CollectionViewType.Stacking) {
-                                    const scroll = targetDoc._scrollTop;
-                                    activeItem.presPinView = true;
-                                    activeItem.presPinViewScroll = scroll;
-                                } else if (targetDoc.type === DocumentType.VID) {
-                                    activeItem.presPinTimecode = targetDoc._currentTimecode;
-                                } else if ((targetDoc.type === DocumentType.COL && targetDoc._viewType === CollectionViewType.Freeform) || targetDoc.type === DocumentType.IMG) {
-                                    const x = targetDoc._panX;
-                                    const y = targetDoc._panY;
-                                    const scale = targetDoc._viewScale;
-                                    activeItem.presPinView = true;
-                                    activeItem.presPinViewX = x;
-                                    activeItem.presPinViewY = y;
-                                    activeItem.presPinViewScale = scale;
-                                } else if (targetDoc.type === DocumentType.COMPARISON) {
-                                    const width = targetDoc._clipWidth;
-                                    activeItem.presPinClipWidth = width;
-                                    activeItem.presPinView = true;
-                                }
-                            }
-                        }}>{presPinWithViewIcon}</div></Tooltip>
-                    {activeItem.presPinView ? <Tooltip title={<><div className="dash-tooltip">{"Update the pinned view with the view of the selected document"}</div></>}><div className="ribbon-button"
-                        onClick={() => {
-                            if (targetDoc.type === DocumentType.PDF || targetDoc.type === DocumentType.WEB || targetDoc.type === DocumentType.RTF) {
-                                const scroll = targetDoc._scrollTop;
-                                activeItem.presPinViewScroll = scroll;
-                            } else if (targetDoc.type === DocumentType.VID) {
-                                activeItem.presPinTimecode = targetDoc._currentTimecode;
-                            } else if (targetDoc.type === DocumentType.COMPARISON) {
-                                const clipWidth = targetDoc._clipWidth;
-                                activeItem.presPinClipWidth = clipWidth;
-                            } else {
-                                const x = targetDoc._panX;
-                                const y = targetDoc._panY;
-                                const scale = targetDoc._viewScale;
-                                activeItem.presPinViewX = x;
-                                activeItem.presPinViewY = y;
-                                activeItem.presPinViewScale = scale;
-                            }
-                        }}>Update</div></Tooltip> : (null)}
-                </div>
-            </>
-        );
-    }
-
-    @computed get panOptionsDropdown() {
-        const activeItem: Doc = this.activeItem;
-        const targetDoc: Doc = this.targetDoc;
-        return (
-            <>
-                {this.panable ? <div style={{ display: activeItem.presPinView ? "block" : "none" }}>
-                    <div className="ribbon-doubleButton" style={{ marginRight: 10 }}>
-                        <div className="presBox-subheading">Pan X</div>
-                        <div className="ribbon-property" style={{ paddingRight: 0, paddingLeft: 0 }}>
-                            <input className="presBox-input"
-                                style={{ textAlign: 'left', width: 50 }}
-                                type="number" value={NumCast(activeItem.presPinViewX)}
-                                onChange={action((e: React.ChangeEvent<HTMLInputElement>) => { const val = e.target.value; activeItem.presPinViewX = Number(val); })} />
-                        </div>
-                    </div>
-                    <div className="ribbon-doubleButton" style={{ marginRight: 10 }}>
-                        <div className="presBox-subheading">Pan Y</div>
-                        <div className="ribbon-property" style={{ paddingRight: 0, paddingLeft: 0 }}>
-                            <input className="presBox-input"
-                                style={{ textAlign: 'left', width: 50 }}
-                                type="number" value={NumCast(activeItem.presPinViewY)}
-                                onChange={action((e: React.ChangeEvent<HTMLInputElement>) => { const val = e.target.value; activeItem.presPinViewY = Number(val); })} />
-                        </div>
-                    </div>
-                    <div className="ribbon-doubleButton" style={{ marginRight: 10 }}>
-                        <div className="presBox-subheading">Scale</div>
-                        <div className="ribbon-property" style={{ paddingRight: 0, paddingLeft: 0 }}>
-                            <input className="presBox-input"
-                                style={{ textAlign: 'left', width: 50 }}
-                                type="number" value={NumCast(activeItem.presPinViewScale)}
-                                onChange={action((e: React.ChangeEvent<HTMLInputElement>) => { const val = e.target.value; activeItem.presPinViewScale = Number(val); })} />
-                        </div>
-                    </div>
-                </div> : (null)}
-            </>
-        );
-    }
-
-    @computed get scrollOptionsDropdown() {
-        const activeItem: Doc = this.activeItem;
-        const targetDoc: Doc = this.targetDoc;
-        return (
-            <>
-                {this.scrollable ? <div style={{ display: activeItem.presPinView ? "block" : "none" }}>
-                    <div className="ribbon-doubleButton" style={{ marginRight: 10 }}>
-                        <div className="presBox-subheading">Scroll</div>
-                        <div className="ribbon-property" style={{ paddingRight: 0, paddingLeft: 0 }}>
-                            <input className="presBox-input"
-                                style={{ textAlign: 'left', width: 50 }}
-                                type="number" value={NumCast(activeItem.presPinViewScroll)}
-                                onChange={action((e: React.ChangeEvent<HTMLInputElement>) => { const val = e.target.value; activeItem.presPinViewScroll = Number(val); })} />
-                        </div>
-                    </div>
-                </div> : (null)}
-            </>
-        );
-    }
-
-    @computed get mediaStopSlides() {
-        const activeItem: Doc = this.activeItem;
-        const list = this.childDocs.map((doc, i) => {
-            if (i > this.itemIndex) {
-                return (
-                    <option>{i + 1}. {doc.title}</option>
-                );
-            }
-        });
-        return (
-            list
-        );
-    }
-
-    @computed get mediaOptionsDropdown() {
-        const activeItem: Doc = this.activeItem;
-        const targetDoc: Doc = this.targetDoc;
-        const duration = Math.round(NumCast(activeItem[`${Doc.LayoutFieldKey(activeItem)}-duration`]) * 10);
-        const mediaStopDocInd: number = NumCast(activeItem.mediaStopDoc);
-        const mediaStopDocStr: string = mediaStopDocInd ? mediaStopDocInd + ". " + this.childDocs[mediaStopDocInd - 1].title : "";
-        if (activeItem && targetDoc) {
-            return (
-                <div>
-                    <div className={'presBox-ribbon'} onClick={e => e.stopPropagation()} onPointerUp={e => e.stopPropagation()} onPointerDown={e => e.stopPropagation()}>
-                        <div>
-                            <div className="ribbon-box">
-                                Start {"&"} End Time
-                                <div className={"slider-headers"}>
-                                    <div className="slider-block" >
-                                        <div className="slider-text" style={{ fontWeight: 500 }}>
-                                            Start time (s)
-                                        </div>
-                                        <div id={"startTime"} className="slider-number" style={{ backgroundColor: PresColor.LightBackground }}>
-                                            <input className="presBox-input"
-                                                style={{ textAlign: 'center', width: 30, height: 15, fontSize: 10 }}
-                                                type="number" value={NumCast(activeItem.presStartTime)}
-                                                onChange={action((e: React.ChangeEvent<HTMLInputElement>) => { activeItem.presStartTime = Number(e.target.value); })}
-                                            />
-                                        </div>
-                                    </div>
-                                    <div className="slider-block">
-                                        <div className="slider-text" style={{ fontWeight: 500 }}>
-                                            Duration (s)
-                                        </div>
-                                        <div className="slider-number" style={{ backgroundColor: PresColor.LightBlue }}>
-                                            {Math.round((NumCast(activeItem.presEndTime) - NumCast(activeItem.presStartTime)) * 10) / 10}
-                                        </div>
-                                    </div>
-                                    <div className="slider-block">
-                                        <div className="slider-text" style={{ fontWeight: 500 }}>
-                                            End time (s)
-                                        </div>
-                                        <div id={"endTime"} className="slider-number" style={{ backgroundColor: PresColor.LightBackground }}>
-                                            <input className="presBox-input"
-                                                style={{ textAlign: 'center', width: 30, height: 15, fontSize: 10 }}
-                                                type="number" value={NumCast(activeItem.presEndTime)}
-                                                onChange={action((e: React.ChangeEvent<HTMLInputElement>) => { activeItem.presEndTime = Number(e.target.value); })}
-                                            />
-                                        </div>
-                                    </div>
-                                </div>
-                                <div className="multiThumb-slider">
-                                    <input type="range" step="0.1" min="0" max={duration / 10} value={NumCast(activeItem.presEndTime)}
-                                        style={{ gridColumn: 1, gridRow: 1 }}
-                                        className={`toolbar-slider ${"end"}`}
-                                        id="toolbar-slider"
-                                        onPointerDown={() => {
-                                            this._batch = UndoManager.StartBatch("presEndTime");
-                                            const endBlock = document.getElementById("endTime");
-                                            if (endBlock) {
-                                                endBlock.style.color = PresColor.LightBackground;
-                                                endBlock.style.backgroundColor = PresColor.DarkBlue;
-                                            }
-                                        }}
-                                        onPointerUp={() => {
-                                            this._batch?.end();
-                                            const endBlock = document.getElementById("endTime");
-                                            if (endBlock) {
-                                                endBlock.style.color = "black";
-                                                endBlock.style.backgroundColor = PresColor.LightBackground;
-                                            }
-                                        }}
-                                        onChange={(e: React.ChangeEvent<HTMLInputElement>) => {
-                                            e.stopPropagation();
-                                            activeItem.presEndTime = Number(e.target.value);
-                                        }} />
-                                    <input type="range" step="0.1" min="0" max={duration / 10} value={NumCast(activeItem.presStartTime)}
-                                        style={{ gridColumn: 1, gridRow: 1 }}
-                                        className={`toolbar-slider ${"start"}`}
-                                        id="toolbar-slider"
-                                        onPointerDown={() => {
-                                            this._batch = UndoManager.StartBatch("presStartTime");
-                                            const startBlock = document.getElementById("startTime");
-                                            if (startBlock) {
-                                                startBlock.style.color = PresColor.LightBackground;
-                                                startBlock.style.backgroundColor = PresColor.DarkBlue;
-                                            }
-                                        }}
-                                        onPointerUp={() => {
-                                            this._batch?.end();
-                                            const startBlock = document.getElementById("startTime");
-                                            if (startBlock) {
-                                                startBlock.style.color = "black";
-                                                startBlock.style.backgroundColor = PresColor.LightBackground;
-                                            }
-                                        }}
-                                        onChange={(e: React.ChangeEvent<HTMLInputElement>) => {
-                                            e.stopPropagation();
-                                            activeItem.presStartTime = Number(e.target.value);
-                                        }} />
-                                </div>
-                                <div className={`slider-headers ${activeItem.presMovement === PresMovement.Pan || activeItem.presMovement === PresMovement.Zoom ? "" : "none"}`}>
-                                    <div className="slider-text">0 s</div>
-                                    <div className="slider-text"></div>
-                                    <div className="slider-text">{duration / 10} s</div>
-                                </div>
-                            </div>
-                            <div className="ribbon-final-box">
-                                Playback
-                                <div className="presBox-subheading">Start playing:</div>
-                                <div className="presBox-radioButtons">
-                                    <div className="checkbox-container">
-                                        <input className="presBox-checkbox"
-                                            type="checkbox"
-                                            onChange={() => activeItem.mediaStart = "manual"}
-                                            checked={activeItem.mediaStart === "manual"}
-                                        />
-                                        <div>On click</div>
-                                    </div>
-                                    <div className="checkbox-container">
-                                        <input className="presBox-checkbox"
-                                            type="checkbox"
-                                            onChange={() => activeItem.mediaStart = "auto"}
-                                            checked={activeItem.mediaStart === "auto"}
-                                        />
-                                        <div>Automatically</div>
-                                    </div>
-                                </div>
-                                <div className="presBox-subheading">Stop playing:</div>
-                                <div className="presBox-radioButtons">
-                                    <div className="checkbox-container">
-                                        <input className="presBox-checkbox"
-                                            type="checkbox"
-                                            onChange={() => activeItem.mediaStop = "manual"}
-                                            checked={activeItem.mediaStop === "manual"}
-                                        />
-                                        <div>At audio end time</div>
-                                    </div>
-                                    <div className="checkbox-container">
-                                        <input className="presBox-checkbox"
-                                            type="checkbox"
-                                            onChange={() => activeItem.mediaStop = "auto"}
-                                            checked={activeItem.mediaStop === "auto"}
-                                        />
-                                        <div>On slide change</div>
-                                    </div>
-                                    {/* <div className="checkbox-container">
-                                    <input className="presBox-checkbox"
-                                        type="checkbox"
-                                        onChange={() => activeItem.mediaStop = "afterSlide"}
-                                        checked={activeItem.mediaStop === "afterSlide"}
-                                    />
-                                    <div className="checkbox-dropdown">
-                                        After chosen slide
-                                        <select className="presBox-viewPicker"
-                                            style={{ opacity: activeItem.mediaStop === "afterSlide" && this.itemIndex !== this.childDocs.length - 1 ? 1 : 0.3 }}
-                                            onPointerDown={e => e.stopPropagation()}
-                                            onChange={this.mediaStopChanged}
-                                            value={mediaStopDocStr}>
-                                            {this.mediaStopSlides}
-                                        </select>
-                                    </div>
-                                </div> */}
-                                </div>
-                            </div>
-                        </div>
-                    </div>
-                </div >
-            );
-        }
-    }
-
-    @computed get newDocumentToolbarDropdown() {
-        return (
-            <div>
-                <div className={'presBox-toolbar-dropdown'} style={{ display: this.newDocumentTools && this.layoutDoc.presStatus === "edit" ? "inline-flex" : "none" }} onClick={e => e.stopPropagation()} onPointerUp={e => e.stopPropagation()} onPointerDown={e => e.stopPropagation()}>
-                    <div className="layout-container" style={{ height: 'max-content' }}>
-                        <div className="layout" style={{ border: this.layout === 'blank' ? `solid 2px ${PresColor.DarkBlue}` : '' }} onClick={action(() => { this.layout = 'blank'; this.createNewSlide(this.layout); })} />
-                        <div className="layout" style={{ border: this.layout === 'title' ? `solid 2px ${PresColor.DarkBlue}` : '' }} onClick={action(() => { this.layout = 'title'; this.createNewSlide(this.layout); })}>
-                            <div className="title">Title</div>
-                            <div className="subtitle">Subtitle</div>
-                        </div>
-                        <div className="layout" style={{ border: this.layout === 'header' ? `solid 2px ${PresColor.DarkBlue}` : '' }} onClick={action(() => { this.layout = 'header'; this.createNewSlide(this.layout); })}>
-                            <div className="title" style={{ alignSelf: 'center', fontSize: 10 }}>Section header</div>
-                        </div>
-                        <div className="layout" style={{ border: this.layout === 'content' ? `solid 2px ${PresColor.DarkBlue}` : '' }} onClick={action(() => { this.layout = 'content'; this.createNewSlide(this.layout); })}>
-                            <div className="title" style={{ alignSelf: 'center' }}>Title</div>
-                            <div className="content">Text goes here</div>
-                        </div>
-                    </div>
-                </div>
-            </div >
-        );
-    }
-
-    @observable openLayouts: boolean = false;
-    @observable addFreeform: boolean = true;
-    @observable layout: string = "";
-    @observable title: string = "";
-
-    @computed get newDocumentDropdown() {
-        return (
-            <div>
-                <div className={"presBox-ribbon"} onClick={e => e.stopPropagation()} onPointerDown={e => e.stopPropagation()}>
-                    <div className="ribbon-box">
-                        Slide Title: <br></br>
-                        <input className="ribbon-textInput" placeholder="..." type="text" name="fname"
-                            onChange={(e) => {
-                                e.stopPropagation();
-                                e.preventDefault();
-                                runInAction(() => this.title = e.target.value);
-                            }}>
-                        </input>
-                    </div>
-                    <div className="ribbon-box">
-                        Choose type:
-                        <div className="ribbon-doubleButton">
-                            <div title="Text" className={'ribbon-toggle'} style={{ background: this.addFreeform ? "" : PresColor.LightBlue }} onClick={action(() => this.addFreeform = !this.addFreeform)}>Text</div>
-                            <div title="Freeform" className={'ribbon-toggle'} style={{ background: this.addFreeform ? PresColor.LightBlue : "" }} onClick={action(() => this.addFreeform = !this.addFreeform)}>Freeform</div>
-                        </div>
-                    </div>
-                    <div className="ribbon-box" style={{ display: this.addFreeform ? "grid" : "none" }}>
-                        Preset layouts:
-                        <div className="layout-container" style={{ height: this.openLayouts ? 'max-content' : '75px' }}>
-                            <div className="layout" style={{ border: this.layout === 'blank' ? `solid 2px ${PresColor.DarkBlue}` : '' }} onClick={action(() => this.layout = 'blank')} />
-                            <div className="layout" style={{ border: this.layout === 'title' ? `solid 2px ${PresColor.DarkBlue}` : '' }} onClick={action(() => this.layout = 'title')}>
-                                <div className="title">Title</div>
-                                <div className="subtitle">Subtitle</div>
-                            </div>
-                            <div className="layout" style={{ border: this.layout === 'header' ? `solid 2px ${PresColor.DarkBlue}` : '' }} onClick={action(() => this.layout = 'header')}>
-                                <div className="title" style={{ alignSelf: 'center', fontSize: 10 }}>Section header</div>
-                            </div>
-                            <div className="layout" style={{ border: this.layout === 'content' ? `solid 2px ${PresColor.DarkBlue}` : '' }} onClick={action(() => this.layout = 'content')}>
-                                <div className="title" style={{ alignSelf: 'center' }}>Title</div>
-                                <div className="content">Text goes here</div>
-                            </div>
-                            <div className="layout" style={{ border: this.layout === 'twoColumns' ? `solid 2px ${PresColor.DarkBlue}` : '' }} onClick={action(() => this.layout = 'twoColumns')}>
-                                <div className="title" style={{ alignSelf: 'center', gridColumn: '1/3' }}>Title</div>
-                                <div className="content" style={{ gridColumn: 1, gridRow: 2 }}>Column one text</div>
-                                <div className="content" style={{ gridColumn: 2, gridRow: 2 }}>Column two text</div>
-                            </div>
-                        </div>
-                        <div className="open-layout" onClick={action(() => this.openLayouts = !this.openLayouts)}>
-                            <FontAwesomeIcon style={{ transition: 'all 0.3s', transform: this.openLayouts ? 'rotate(180deg)' : 'rotate(0deg)' }} icon={"caret-down"} size={"lg"} />
-                        </div>
-                    </div>
-                    <div className="ribbon-final-box">
-                        <div className={this.title !== "" && (this.addFreeform && this.layout !== "" || !this.addFreeform) ? "ribbon-final-button-hidden" : "ribbon-final-button"} onClick={() => this.createNewSlide(this.layout, this.title, this.addFreeform)}>
-                            Create New Slide
-                        </div>
-                    </div>
-                </div>
-            </div >
-        );
-    }
-
-    createNewSlide = (layout?: string, title?: string, freeform?: boolean) => {
-        let doc = undefined;
-        if (layout) doc = this.createTemplate(layout);
-        if (freeform && layout) doc = this.createTemplate(layout, title);
-        if (!freeform && !layout) doc = Docs.Create.TextDocument("", { _nativeWidth: 400, _width: 225, title: title });
-        if (doc) {
-            const presCollection = Cast(this.layoutDoc.presCollection, Doc, null);
-            const data = Cast(presCollection?.data, listSpec(Doc));
-            const presData = Cast(this.rootDoc.data, listSpec(Doc));
-            if (data && presData) {
-                data.push(doc);
-                TabDocView.PinDoc(doc);
-                this.gotoDocument(this.childDocs.length, this.activeItem);
-            } else {
-                this.props.addDocTab(doc, "add:right");
-            }
-        }
-    }
-
-    createTemplate = (layout: string, input?: string) => {
-        const activeItem: Doc = this.activeItem;
-        const targetDoc: Doc = this.targetDoc;
-        let x = 0;
-        let y = 0;
-        if (activeItem && targetDoc) {
-            x = NumCast(targetDoc.x);
-            y = NumCast(targetDoc.y) + NumCast(targetDoc._height) + 20;
-        }
-        let doc = undefined;
-        const title = Docs.Create.TextDocument("Click to change title", { title: "Slide title", _width: 380, _height: 60, x: 10, y: 58, _fontSize: "24pt", });
-        const subtitle = Docs.Create.TextDocument("Click to change subtitle", { title: "Slide subtitle", _width: 380, _height: 50, x: 10, y: 118, _fontSize: "16pt" });
-        const header = Docs.Create.TextDocument("Click to change header", { title: "Slide header", _width: 380, _height: 65, x: 10, y: 80, _fontSize: "20pt" });
-        const contentTitle = Docs.Create.TextDocument("Click to change title", { title: "Slide title", _width: 380, _height: 60, x: 10, y: 10, _fontSize: "24pt" });
-        const content = Docs.Create.TextDocument("Click to change text", { title: "Slide text", _width: 380, _height: 145, x: 10, y: 70, _fontSize: "14pt" });
-        const content1 = Docs.Create.TextDocument("Click to change text", { title: "Column 1", _width: 185, _height: 140, x: 10, y: 80, _fontSize: "14pt" });
-        const content2 = Docs.Create.TextDocument("Click to change text", { title: "Column 2", _width: 185, _height: 140, x: 205, y: 80, _fontSize: "14pt" });
-        switch (layout) {
-            case 'blank':
-                doc = Docs.Create.FreeformDocument([], { title: input ? input : "Blank slide", _width: 400, _height: 225, x: x, y: y });
-                break;
-            case 'title':
-                doc = Docs.Create.FreeformDocument([title, subtitle], { title: input ? input : "Title slide", _width: 400, _height: 225, _fitToBox: true, x: x, y: y });
-                break;
-            case 'header':
-                doc = Docs.Create.FreeformDocument([header], { title: input ? input : "Section header", _width: 400, _height: 225, _fitToBox: true, x: x, y: y });
-                break;
-            case 'content':
-                doc = Docs.Create.FreeformDocument([contentTitle, content], { title: input ? input : "Title and content", _width: 400, _height: 225, _fitToBox: true, x: x, y: y });
-                break;
-            case 'twoColumns':
-                doc = Docs.Create.FreeformDocument([contentTitle, content1, content2], { title: input ? input : "Title and two columns", _width: 400, _height: 225, _fitToBox: true, x: x, y: y });
-                break;
-            default:
-                break;
-        }
-        return doc;
-    }
-
-    // Dropdown that appears when the user wants to begin presenting (either minimize or sidebar view)
-    @computed get presentDropdown() {
-        return (
-            <div className={`dropdown-play ${this.presentTools ? "active" : ""}`} onClick={e => e.stopPropagation()} onPointerUp={e => e.stopPropagation()} onPointerDown={e => e.stopPropagation()}>
-                <div className="dropdown-play-button" onClick={undoBatch(action(() => { this.updateMinimize(); this.turnOffEdit(true); this.gotoDocument(this.itemIndex, this.activeItem); }))}>
-                    Mini-player
-                </div>
-                <div className="dropdown-play-button" onClick={undoBatch(action(() => { this.layoutDoc.presStatus = "manual"; this.turnOffEdit(true); this.gotoDocument(this.itemIndex, this.activeItem); }))}>
-                    Sidebar player
-                </div>
-            </div>
-        );
-    }
-
-    // Case in which the document has keyframes to navigate to next key frame
-    @action
-    nextKeyframe = (tagDoc: Doc, curDoc: Doc): void => {
-        const childDocs = DocListCast(tagDoc[Doc.LayoutFieldKey(tagDoc)]);
-        const currentFrame = Cast(tagDoc._currentFrame, "number", null);
-        if (currentFrame === undefined) {
-            tagDoc._currentFrame = 0;
-            // CollectionFreeFormDocumentView.setupScroll(tagDoc, 0);
-            // CollectionFreeFormDocumentView.setupKeyframes(childDocs, 0);
-        }
-        // if (tagDoc.editScrollProgressivize) CollectionFreeFormDocumentView.updateScrollframe(tagDoc, currentFrame);
-        CollectionFreeFormDocumentView.updateKeyframe(childDocs, currentFrame || 0, tagDoc);
-        tagDoc._currentFrame = Math.max(0, (currentFrame || 0) + 1);
-        tagDoc.lastFrame = Math.max(NumCast(tagDoc._currentFrame), NumCast(tagDoc.lastFrame));
-    }
-
-    @action
-    prevKeyframe = (tagDoc: Doc, actItem: Doc): void => {
-        const childDocs = DocListCast(tagDoc[Doc.LayoutFieldKey(tagDoc)]);
-        const currentFrame = Cast(tagDoc._currentFrame, "number", null);
-        if (currentFrame === undefined) {
-            tagDoc._currentFrame = 0;
-            // CollectionFreeFormDocumentView.setupKeyframes(childDocs, 0);
-        }
-        CollectionFreeFormDocumentView.gotoKeyframe(childDocs.slice());
-        tagDoc._currentFrame = Math.max(0, (currentFrame || 0) - 1);
-    }
-
-    /**
-     * Returns the collection type as a string for headers
-     */
-    @computed get stringType(): string {
-        const activeItem: Doc = this.activeItem;
-        const targetDoc: Doc = this.targetDoc;
-        let type: string = '';
-        if (activeItem) {
-            switch (targetDoc.type) {
-                case DocumentType.PDF: type = "PDF"; break;
-                case DocumentType.RTF: type = "Text node"; break;
-                case DocumentType.COL: type = "Collection"; break;
-                case DocumentType.AUDIO: type = "Audio"; break;
-                case DocumentType.VID: type = "Video"; break;
-                case DocumentType.IMG: type = "Image"; break;
-                case DocumentType.WEB: type = "Web page"; break;
-                default: type = "Other node"; break;
-            }
-        }
-        return type;
-    }
-
-    @observable private openActiveColorPicker: boolean = false;
-    @observable private openViewedColorPicker: boolean = false;
-
-
-
-    @computed get progressivizeDropdown() {
-        const activeItem: Doc = this.activeItem;
-        const targetDoc: Doc = this.targetDoc;
-        if (activeItem && targetDoc) {
-            const activeFontColor = targetDoc["pres-text-color"] ? StrCast(targetDoc["pres-text-color"]) : "Black";
-            const viewedFontColor = targetDoc["pres-text-viewed-color"] ? StrCast(targetDoc["pres-text-viewed-color"]) : "Black";
-            return (
-                <div>
-                    <div className={`presBox-ribbon ${this.progressivizeTools && this.layoutDoc.presStatus === "edit" ? "active" : ""}`} onClick={e => e.stopPropagation()} onPointerUp={e => e.stopPropagation()} onPointerDown={e => e.stopPropagation()}>
-                        <div className="ribbon-box">
-                            {this.stringType} selected
-                            <div className="ribbon-doubleButton" style={{ borderTop: 'solid 1px darkgrey', display: (targetDoc.type === DocumentType.COL && targetDoc._viewType === 'freeform') || targetDoc.type === DocumentType.IMG || targetDoc.type === DocumentType.RTF ? "inline-flex" : "none" }}>
-                                <div className="ribbon-toggle" style={{ backgroundColor: activeItem.presProgressivize ? PresColor.LightBlue : "" }} onClick={this.progressivizeChild}>Contents</div>
-                                <div className="ribbon-toggle" style={{ opacity: activeItem.presProgressivize ? 1 : 0.4, backgroundColor: targetDoc.editProgressivize ? PresColor.LightBlue : "" }} onClick={this.editProgressivize}>Edit</div>
-                            </div>
-                            <div className="ribbon-doubleButton" style={{ display: activeItem.presProgressivize ? "inline-flex" : "none" }}>
-                                <div className="presBox-subheading">Active text color</div>
-                                <div className="ribbon-colorBox" style={{ backgroundColor: activeFontColor, height: 15, width: 15 }} onClick={action(() => { this.openActiveColorPicker = !this.openActiveColorPicker; })}>
-                                </div>
-                            </div>
-                            {this.activeColorPicker}
-                            <div className="ribbon-doubleButton" style={{ display: activeItem.presProgressivize ? "inline-flex" : "none" }}>
-                                <div className="presBox-subheading">Viewed font color</div>
-                                <div className="ribbon-colorBox" style={{ backgroundColor: viewedFontColor, height: 15, width: 15 }} onClick={action(() => this.openViewedColorPicker = !this.openViewedColorPicker)}>
-                                </div>
-                            </div>
-                            {this.viewedColorPicker}
-                            <div className="ribbon-doubleButton" style={{ borderTop: 'solid 1px darkgrey', display: (targetDoc.type === DocumentType.COL && targetDoc._viewType === 'freeform') || targetDoc.type === DocumentType.IMG ? "inline-flex" : "none" }}>
-                                <div className="ribbon-toggle" style={{ backgroundColor: activeItem.zoomProgressivize ? PresColor.LightBlue : "" }} onClick={this.progressivizeZoom}>Zoom</div>
-                                <div className="ribbon-toggle" style={{ opacity: activeItem.zoomProgressivize ? 1 : 0.4, backgroundColor: activeItem.editZoomProgressivize ? PresColor.LightBlue : "" }} onClick={this.editZoomProgressivize}>Edit</div>
-                            </div>
-                            <div className="ribbon-doubleButton" style={{ borderTop: 'solid 1px darkgrey', display: targetDoc._viewType === "stacking" || targetDoc.type === DocumentType.PDF || targetDoc.type === DocumentType.WEB || targetDoc.type === DocumentType.RTF ? "inline-flex" : "none" }}>
-                                <div className="ribbon-toggle" style={{ backgroundColor: activeItem.scrollProgressivize ? PresColor.LightBlue : "" }} onClick={this.progressivizeScroll}>Scroll</div>
-                                <div className="ribbon-toggle" style={{ opacity: activeItem.scrollProgressivize ? 1 : 0.4, backgroundColor: targetDoc.editScrollProgressivize ? PresColor.LightBlue : "" }} onClick={this.editScrollProgressivize}>Edit</div>
-                            </div>
-                        </div>
-                        <div className="ribbon-final-box">
-                            Frames
-                            <div className="ribbon-doubleButton">
-                                <div className="ribbon-frameSelector">
-                                    <div key="back" title="back frame" className="backKeyframe" onClick={e => { e.stopPropagation(); this.prevKeyframe(targetDoc, activeItem); }}>
-                                        <FontAwesomeIcon icon={"caret-left"} size={"lg"} />
-                                    </div>
-                                    <div key="num" title="toggle view all" className="numKeyframe" style={{ color: targetDoc.keyFrameEditing ? "white" : "black", backgroundColor: targetDoc.keyFrameEditing ? PresColor.DarkBlue : PresColor.LightBlue }}
-                                        onClick={action(() => targetDoc.keyFrameEditing = !targetDoc.keyFrameEditing)} >
-                                        {NumCast(targetDoc._currentFrame)}
-                                    </div>
-                                    <div key="fwd" title="forward frame" className="fwdKeyframe" onClick={e => { e.stopPropagation(); this.nextKeyframe(targetDoc, activeItem); }}>
-                                        <FontAwesomeIcon icon={"caret-right"} size={"lg"} />
-                                    </div>
-                                </div>
-                                <Tooltip title={<><div className="dash-tooltip">{"Last frame"}</div></>}><div className="ribbon-property">{NumCast(targetDoc.lastFrame)}</div></Tooltip>
-                            </div>
-                            <div className="ribbon-frameList">
-                                {this.frameListHeader}
-                                {this.frameList}
-                            </div>
-                            <div className="ribbon-toggle" style={{ height: 20, backgroundColor: PresColor.LightBlue }} onClick={() => console.log(" TODO: play frames")}>Play</div>
-                        </div>
-                    </div>
-                </div>
-            );
-        }
-    }
-
-    @undoBatch
-    @action
-    switchActive = (color: ColorState) => {
-        const activeItem: Doc = this.activeItem;
-        const targetDoc: Doc = this.targetDoc;
-        const val = String(color.hex);
-        targetDoc["pres-text-color"] = val;
-        return true;
-    }
-    @undoBatch
-    @action
-    switchPresented = (color: ColorState) => {
-        const activeItem: Doc = this.activeItem;
-        const targetDoc: Doc = this.targetDoc;
-        const val = String(color.hex);
-        targetDoc["pres-text-viewed-color"] = val;
-        return true;
-    }
-
-    @computed get activeColorPicker() {
-        const activeItem: Doc = this.activeItem;
-        const targetDoc: Doc = this.targetDoc;
-        return !this.openActiveColorPicker ? (null) : <SketchPicker onChange={this.switchActive}
-            presetColors={['#D0021B', '#F5A623', '#F8E71C', '#8B572A', '#7ED321', '#417505',
-                '#9013FE', '#4A90E2', '#50E3C2', '#B8E986', '#000000', '#4A4A4A', '#9B9B9B',
-                '#FFFFFF', '#f1efeb', 'transparent']}
-            color={StrCast(targetDoc["pres-text-color"])} />;
-    }
-
-    @computed get viewedColorPicker() {
-        const activeItem: Doc = this.activeItem;
-        const targetDoc: Doc = this.targetDoc;
-        return !this.openViewedColorPicker ? (null) : <SketchPicker onChange={this.switchPresented}
-            presetColors={['#D0021B', '#F5A623', '#F8E71C', '#8B572A', '#7ED321', '#417505',
-                '#9013FE', '#4A90E2', '#50E3C2', '#B8E986', '#000000', '#4A4A4A', '#9B9B9B',
-                '#FFFFFF', '#f1efeb', 'transparent']}
-            color={StrCast(targetDoc["pres-text-viewed-color"])} />;
-    }
-
-    @action
-    turnOffEdit = (paths?: boolean) => {
-        // Turn off paths
-        if (paths) {
-            const srcContext = Cast(this.rootDoc.presCollection, Doc, null);
-            if (srcContext) this.togglePath(srcContext, true);
-        }
-        // Turn off the progressivize editors for each document
-        this.childDocs.forEach((doc) => {
-            doc.editSnapZoomProgressivize = false;
-            doc.editZoomProgressivize = false;
-            const targetDoc = Cast(doc.presentationTargetDoc, Doc, null);
-            if (targetDoc) {
-                targetDoc.editZoomProgressivize = false;
-                // targetDoc.editScrollProgressivize = false;
-            }
-        });
-    }
-
-    //Toggle whether the user edits or not
-    @action
-    editZoomProgressivize = (e: React.MouseEvent) => {
-        const activeItem: Doc = this.activeItem;
-        const targetDoc: Doc = this.targetDoc;
-        if (!targetDoc.editZoomProgressivize) {
-            if (!activeItem.zoomProgressivize) activeItem.zoomProgressivize = true; targetDoc.zoomProgressivize = true;
-            targetDoc.editZoomProgressivize = true;
-            activeItem.editZoomProgressivize = true;
-        } else {
-            targetDoc.editZoomProgressivize = false;
-            activeItem.editZoomProgressivize = false;
-        }
-    }
-
-    //Toggle whether the user edits or not
-    @action
-    editScrollProgressivize = (e: React.MouseEvent) => {
-        const activeItem: Doc = this.activeItem;
-        const targetDoc: Doc = this.targetDoc;
-        if (!targetDoc.editScrollProgressivize) {
-            if (!targetDoc.scrollProgressivize) { targetDoc.scrollProgressivize = true; activeItem.scrollProgressivize = true; }
-            targetDoc.editScrollProgressivize = true;
-        } else {
-            targetDoc.editScrollProgressivize = false;
-        }
-    }
-
-    //Progressivize Zoom
-    @action
-    progressivizeScroll = (e: React.MouseEvent) => {
-        e.stopPropagation();
-        const activeItem: Doc = this.activeItem;
-        activeItem.scrollProgressivize = !activeItem.scrollProgressivize;
-        const targetDoc: Doc = this.targetDoc;
-        targetDoc.scrollProgressivize = !targetDoc.scrollProgressivize;
-        // CollectionFreeFormDocumentView.setupScroll(targetDoc, NumCast(targetDoc._currentFrame));
-        if (targetDoc.editScrollProgressivize) {
-            targetDoc.editScrollProgressivize = false;
-            targetDoc._currentFrame = 0;
-            targetDoc.lastFrame = 0;
-        }
-    }
-
-    //Progressivize Zoom
-    @action
-    progressivizeZoom = (e: React.MouseEvent) => {
-        e.stopPropagation();
-        const activeItem: Doc = this.activeItem;
-        activeItem.zoomProgressivize = !activeItem.zoomProgressivize;
-        const targetDoc: Doc = this.targetDoc;
-        targetDoc.zoomProgressivize = !targetDoc.zoomProgressivize;
-        CollectionFreeFormDocumentView.setupZoom(activeItem, targetDoc);
-        if (activeItem.editZoomProgressivize) {
-            activeItem.editZoomProgressivize = false;
-            targetDoc._currentFrame = 0;
-            targetDoc.lastFrame = 0;
-        }
-    }
-
-    //Progressivize Child Docs
-    @action
-    editProgressivize = (e: React.MouseEvent) => {
-        const activeItem: Doc = this.activeItem;
-        const targetDoc: Doc = this.targetDoc;
-        targetDoc._currentFrame = targetDoc.lastFrame;
-        if (!targetDoc.editProgressivize) {
-            if (!activeItem.presProgressivize) { activeItem.presProgressivize = true; targetDoc.presProgressivize = true; }
-            targetDoc.editProgressivize = true;
-        } else {
-            targetDoc.editProgressivize = false;
-        }
-    }
-
-    @action
-    progressivizeChild = (e: React.MouseEvent) => {
-        e.stopPropagation();
-        const activeItem: Doc = this.activeItem;
-        const targetDoc: Doc = this.targetDoc;
-        const docs = DocListCast(targetDoc[Doc.LayoutFieldKey(targetDoc)]);
-        if (!activeItem.presProgressivize) {
-            targetDoc.keyFrameEditing = false;
-            activeItem.presProgressivize = true;
-            targetDoc.presProgressivize = true;
-            targetDoc._currentFrame = 0;
-            docs.forEach((doc, i) => CollectionFreeFormDocumentView.setupKeyframes([doc], i, true));
-            targetDoc.lastFrame = targetDoc.lastFrame ? NumCast(targetDoc.lastFrame) : docs.length - 1;
-        } else {
-            // targetDoc.editProgressivize = false;
-            activeItem.presProgressivize = false;
-            targetDoc.presProgressivize = false;
-            targetDoc._currentFrame = 0;
-            targetDoc.keyFrameEditing = true;
-        }
-    }
-
-    @action
-    checkMovementLists = (doc: Doc, xlist: any, ylist: any) => {
-        const x: List<number> = xlist;
-        const y: List<number> = ylist;
-        const tags: JSX.Element[] = [];
-        let pathPoints = ""; //List of all of the pathpoints that need to be added
-        for (let i = 0; i < x.length - 1; i++) {
-            if (y[i] || x[i]) {
-                if (i === 0) pathPoints = (x[i] - 11) + "," + (y[i] + 33);
-                else pathPoints = pathPoints + " " + (x[i] - 11) + "," + (y[i] + 33);
-                tags.push(<div className="progressivizeMove-frame" style={{ position: 'absolute', top: y[i], left: x[i] }}>{i}</div>);
-            }
-        }
-        tags.push(<svg style={{ overflow: 'visible', position: 'absolute' }}><polyline
-            points={pathPoints}
-            style={{
-                position: 'absolute',
-                opacity: 1,
-                stroke: "#000000",
-                strokeWidth: 2,
-                strokeDasharray: '10 5',
-            }}
-            fill="none"
-        /></svg>);
-        return tags;
-    }
-
-    @observable
-    toggleDisplayMovement = (doc: Doc) => {
-        if (doc.displayMovement) doc.displayMovement = false;
-        else doc.displayMovement = true;
-    }
-
-    @action
-    checkList = (doc: Doc, list: any): number => {
-        const x: List<number> = list;
-        if (x && x.length >= NumCast(doc._currentFrame) + 1) {
-            return x[NumCast(doc._currentFrame)];
-        } else if (x) {
-            x.length = NumCast(doc._currentFrame) + 1;
-            x[NumCast(doc._currentFrame)] = x[NumCast(doc._currentFrame) - 1];
-            return x[NumCast(doc._currentFrame)];
-        } else return 100;
-    }
-
-    @computed get progressivizeChildDocs() {
-        const targetDoc: Doc = this.targetDoc;
-        const docs = DocListCast(targetDoc[Doc.LayoutFieldKey(targetDoc)]);
-        const tags: JSX.Element[] = [];
-        docs.forEach((doc, index) => {
-            if (doc["x-indexed"] && doc["y-indexed"]) {
-                tags.push(<div style={{ position: 'absolute', display: doc.displayMovement ? "block" : "none" }}>{this.checkMovementLists(doc, doc["x-indexed"], doc["y-indexed"])}</div>);
-            }
-            tags.push(
-                <div className="progressivizeButton" key={index} onPointerLeave={() => { if (NumCast(targetDoc._currentFrame) < NumCast(doc.appearFrame)) doc.opacity = 0; }} onPointerOver={() => { if (NumCast(targetDoc._currentFrame) < NumCast(doc.appearFrame)) doc.opacity = 0.5; }} onClick={e => { this.toggleDisplayMovement(doc); e.stopPropagation(); }} style={{ backgroundColor: doc.displayMovement ? PresColor.LightBlue : "#c8c8c8", top: NumCast(doc.y), left: NumCast(doc.x) }}>
-                    <div className="progressivizeButton-prev"><FontAwesomeIcon icon={"caret-left"} size={"lg"} onClick={e => { e.stopPropagation(); this.prevAppearFrame(doc, index); }} /></div>
-                    <div className="progressivizeButton-frame">{doc.appearFrame}</div>
-                    <div className="progressivizeButton-next"><FontAwesomeIcon icon={"caret-right"} size={"lg"} onClick={e => { e.stopPropagation(); this.nextAppearFrame(doc, index); }} /></div>
-                </div>);
-        });
-        return tags;
-    }
-
-    @action
-    nextAppearFrame = (doc: Doc, i: number): void => {
-        // const activeItem = Cast(this.childDocs[this.itemIndex], Doc, null);
-        // const targetDoc = Cast(activeItem?.presentationTargetDoc, Doc, null);
-        const appearFrame = Cast(doc.appearFrame, "number", null);
-        if (appearFrame === undefined) {
-            doc.appearFrame = 0;
-        }
-        doc.appearFrame = appearFrame + 1;
-        this.updateOpacityList(doc["opacity-indexed"], NumCast(doc.appearFrame));
-    }
-
-    @action
-    prevAppearFrame = (doc: Doc, i: number): void => {
-        // const activeItem = Cast(this.childDocs[this.itemIndex], Doc, null);
-        // const targetDoc = Cast(activeItem?.presentationTargetDoc, Doc, null);
-        const appearFrame = Cast(doc.appearFrame, "number", null);
-        if (appearFrame === undefined) {
-            doc.appearFrame = 0;
-        }
-        doc.appearFrame = Math.max(0, appearFrame - 1);
-        this.updateOpacityList(doc["opacity-indexed"], NumCast(doc.appearFrame));
-    }
-
-    @action
-    updateOpacityList = (list: any, frame: number) => {
-        const x: List<number> = list;
-        if (x && x.length >= frame) {
-            for (let i = 0; i < x.length; i++) {
-                if (i < frame) {
-                    x[i] = 0;
-                } else if (i >= frame) {
-                    x[i] = 1;
-                }
-            }
-            list = x;
-        } else {
-            x.length = frame + 1;
-            for (let i = 0; i < x.length; i++) {
-                if (i < frame) {
-                    x[i] = 0;
-                } else if (i >= frame) {
-                    x[i] = 1;
-                }
-            }
-            list = x;
-        }
-    }
-
-    @computed get moreInfoDropdown() {
-        return (<div></div>);
-    }
-
-    @computed
-    get toolbarWidth(): number {
-        const width = this.props.PanelWidth();
-        return width;
-    }
-
-    @action
-    toggleProperties = () => {
-        if (CurrentUserUtils.propertiesWidth > 0) {
-            CurrentUserUtils.propertiesWidth = 0;
-        } else {
-            CurrentUserUtils.propertiesWidth = 250;
-        }
-    }
-
-    @computed get toolbar() {
-        const propIcon = CurrentUserUtils.propertiesWidth > 0 ? "angle-double-right" : "angle-double-left";
-        const propTitle = CurrentUserUtils.propertiesWidth > 0 ? "Close Presentation Panel" : "Open Presentation Panel";
-        const mode = StrCast(this.rootDoc._viewType) as CollectionViewType;
-        const isMini: boolean = this.toolbarWidth <= 100;
-        const presKeyEvents: boolean = (this.isPres && this._presKeyEventsActive && this.rootDoc === Doc.UserDoc().activePresentation);
-        return (mode === CollectionViewType.Carousel3D) ? (null) : (
-            <div id="toolbarContainer" className={'presBox-toolbar'}>
-                {/* <Tooltip title={<><div className="dash-tooltip">{"Add new slide"}</div></>}><div className={`toolbar-button ${this.newDocumentTools ? "active" : ""}`} onClick={action(() => this.newDocumentTools = !this.newDocumentTools)}>
-                    <FontAwesomeIcon icon={"plus"} />
-                    <FontAwesomeIcon className={`dropdown ${this.newDocumentTools ? "active" : ""}`} icon={"angle-down"} />
-                </div></Tooltip> */}
-                <Tooltip title={<><div className="dash-tooltip">{"View paths"}</div></>}>
-                    <div style={{ opacity: this.childDocs.length > 1 && this.layoutDoc.presCollection ? 1 : 0.3, color: this._pathBoolean ? PresColor.DarkBlue : 'white', width: isMini ? "100%" : undefined }} className={"toolbar-button"} onClick={this.childDocs.length > 1 && this.layoutDoc.presCollection ? this.viewPaths : undefined}>
-                        <FontAwesomeIcon icon={"exchange-alt"} />
-                    </div>
-                </Tooltip>
-                {isMini ? (null) :
-                    <>
-                        <div className="toolbar-divider" />
-                        {/* <Tooltip title={<><div className="dash-tooltip">{this._expandBoolean ? "Minimize all" : "Expand all"}</div></>}>
-                            <div className={"toolbar-button"}
-                                style={{ color: this._expandBoolean ? PresColors.DarkBlue : 'white' }}
-                                onClick={this.toggleExpandMode}>
-                                <FontAwesomeIcon icon={"eye"} />
-                            </div>
-                        </Tooltip>
-                        <div className="toolbar-divider" /> */}
-                        <Tooltip title={<><div className="dash-tooltip">{presKeyEvents ? "Keys are active" : "Keys are not active - click anywhere on the presentation trail to activate keys"}</div></>}>
-                            <div className="toolbar-button" style={{ cursor: presKeyEvents ? 'default' : 'pointer', position: 'absolute', right: 30, fontSize: 16 }}>
-                                <FontAwesomeIcon className={"toolbar-thumbtack"} icon={"keyboard"} style={{ color: presKeyEvents ? PresColor.DarkBlue : 'white' }} />
-                            </div>
-                        </Tooltip>
-                        <Tooltip title={<><div className="dash-tooltip">{propTitle}</div></>}>
-                            <div className="toolbar-button" style={{ position: 'absolute', right: 4, fontSize: 16 }} onClick={this.toggleProperties}>
-                                <FontAwesomeIcon className={"toolbar-thumbtack"} icon={propIcon} style={{ color: CurrentUserUtils.propertiesWidth > 0 ? PresColor.DarkBlue : 'white' }} />
-                            </div>
-                        </Tooltip>
-                    </>
-                }
-            </div>
-        );
-    }
-
-    /**
-     * Top panel containes:
-     * viewPicker: The option to choose between List and Slides view for the presentaiton trail
-     * presentPanel: The button to start the presentation / open minimized view of the presentation
-     */
-    @computed get topPanel() {
-        const mode = StrCast(this.rootDoc._viewType) as CollectionViewType;
-        const isMini: boolean = this.toolbarWidth <= 100;
-        return (
-            <div className="presBox-buttons" style={{ display: !this.rootDoc._chromeHidden ? "none" : undefined }}>
-                {isMini ? (null) : <select className="presBox-viewPicker"
-                    style={{ display: this.layoutDoc.presStatus === "edit" ? "block" : "none" }}
-                    onPointerDown={e => e.stopPropagation()}
-                    onChange={this.viewChanged}
-                    value={mode}>
-                    <option onPointerDown={e => e.stopPropagation()} value={CollectionViewType.Stacking}>List</option>
-                    <option onPointerDown={e => e.stopPropagation()} value={CollectionViewType.Carousel3D}>3D Carousel</option>
-                </select>}
-                <div className="presBox-presentPanel" style={{ opacity: this.childDocs.length ? 1 : 0.3 }}>
-                    <span className={`presBox-button ${this.layoutDoc.presStatus === "edit" ? "present" : ""}`}>
-                        <div className="presBox-button-left"
-                            onClick={undoBatch(() => {
-                                if (this.childDocs.length) {
-                                    this.layoutDoc.presStatus = "manual";
-                                    this.gotoDocument(this.itemIndex, this.activeItem);
-                                }
-                            })}>
-                            <FontAwesomeIcon icon={"play-circle"} />
-                            <div style={{ display: this.props.PanelWidth() > 200 ? "inline-flex" : "none" }}>&nbsp; Present</div>
-                        </div>
-                        {(mode === CollectionViewType.Carousel3D || isMini) ? (null) : <div className={`presBox-button-right ${this.presentTools ? "active" : ""}`}
-                            onClick={(action(() => {
-                                if (this.childDocs.length) this.presentTools = !this.presentTools;
-                            }))}>
-                            <FontAwesomeIcon className="dropdown" style={{ margin: 0, transform: this.presentTools ? 'rotate(180deg)' : 'rotate(0deg)' }} icon={"angle-down"} />
-                            {this.presentDropdown}
-                        </div>}
-                    </span>
-                    {this.playButtons}
-                </div>
-            </div>
-        );
-    }
-
-    @action
-    getList = (list: any): List<number> => {
-        const x: List<number> = list;
-        return x;
-    }
-
-    @action
-    updateList = (list: any): List<number> => {
-        const targetDoc: Doc = this.targetDoc;
-        const x: List<number> = list;
-        x.length + 1;
-        x[x.length - 1] = NumCast(targetDoc._scrollY);
-        return x;
-    }
-
-    @action
-    newFrame = () => {
-        const activeItem: Doc = this.activeItem;
-        const targetDoc: Doc = this.targetDoc;
-        const type: string = StrCast(targetDoc.type);
-        if (!activeItem.frameList) activeItem.frameList = new List<number>();
-        switch (type) {
-            case (DocumentType.PDF || DocumentType.RTF || DocumentType.WEB):
-                this.updateList(activeItem.frameList);
-                break;
-            case DocumentType.COL:
-                break;
-            default:
-                break;
-        }
-    }
-
-    @computed get frameListHeader() {
-        return (<div className="frameList-header">
-            &nbsp; Frames {this.panable ? <i>Panable</i> : this.scrollable ? <i>Scrollable</i> : (null)}
-            <div className={"frameList-headerButtons"}>
-                <Tooltip title={<><div className="dash-tooltip">{"Add frame by example"}</div></>}><div className={"headerButton"} onClick={e => { e.stopPropagation(); this.newFrame(); }}>
-                    <FontAwesomeIcon icon={"plus"} onPointerDown={e => e.stopPropagation()} />
-                </div></Tooltip>
-                <Tooltip title={<><div className="dash-tooltip">{"Edit in collection"}</div></>}><div className={"headerButton"} onClick={e => { e.stopPropagation(); console.log('New frame'); }}>
-                    <FontAwesomeIcon icon={"edit"} onPointerDown={e => e.stopPropagation()} />
-                </div></Tooltip>
-            </div>
-        </div>);
-    }
-
-    @computed get frameList() {
-        const activeItem: Doc = this.activeItem;
-        const targetDoc: Doc = this.targetDoc;
-        const frameList: List<number> = this.getList(activeItem.frameList);
-        if (frameList) {
-            const frameItems = frameList.map((value) =>
-                <div className="framList-item">
-
-                </div>
-            );
-            return (
-
-                <div className="frameList-container">
-                    {frameItems}
-                </div>
-            );
-        } else return (null);
-
-    }
-
-    @computed get playButtonFrames() {
-        const targetDoc: Doc = this.targetDoc;
-        return (
-            <>
-                {this.targetDoc ? <div className="presPanel-button-frame" style={{ display: targetDoc.lastFrame !== undefined && targetDoc.lastFrame >= 0 ? "inline-flex" : "none" }}>
-                    <div>{targetDoc._currentFrame}</div>
-                    <div className="presPanel-divider" style={{ border: 'solid 0.5px white', height: '60%' }}></div>
-                    <div>{targetDoc.lastFrame}</div>
-                </div> : null}
-            </>
-        );
-    }
-
-    @computed get playButtons() {
-        const presEnd: boolean = !this.layoutDoc.presLoop && (this.itemIndex === this.childDocs.length - 1);
-        const presStart: boolean = !this.layoutDoc.presLoop && (this.itemIndex === 0);
-        // Case 1: There are still other frames and should go through all frames before going to next slide
-        return (<div className="presPanelOverlay" style={{ display: this.layoutDoc.presStatus !== "edit" ? "inline-flex" : "none" }}>
-            <Tooltip title={<><div className="dash-tooltip">{"Loop"}</div></>}><div className="presPanel-button" style={{ color: this.layoutDoc.presLoop ? PresColor.DarkBlue : 'white' }} onClick={() => this.layoutDoc.presLoop = !this.layoutDoc.presLoop}><FontAwesomeIcon icon={"redo-alt"} /></div></Tooltip>
-            <div className="presPanel-divider"></div>
-            <div className="presPanel-button" style={{ opacity: presStart ? 0.4 : 1 }} onClick={() => { this.back(); if (this._presTimer) { clearTimeout(this._presTimer); this.layoutDoc.presStatus = PresStatus.Manual; } }}><FontAwesomeIcon icon={"arrow-left"} /></div>
-            <Tooltip title={<><div className="dash-tooltip">{this.layoutDoc.presStatus === PresStatus.Autoplay ? "Pause" : "Autoplay"}</div></>}><div className="presPanel-button" onClick={this.startOrPause}><FontAwesomeIcon icon={this.layoutDoc.presStatus === PresStatus.Autoplay ? "pause" : "play"} /></div></Tooltip>
-            <div className="presPanel-button" style={{ opacity: presEnd ? 0.4 : 1 }} onClick={() => { this.next(); if (this._presTimer) { clearTimeout(this._presTimer); this.layoutDoc.presStatus = PresStatus.Manual; } }}><FontAwesomeIcon icon={"arrow-right"} /></div>
-            <div className="presPanel-divider"></div>
-            <Tooltip title={<><div className="dash-tooltip">{"Click to return to 1st slide"}</div></>}><div className="presPanel-button" style={{ border: 'solid 1px white' }} onClick={() => this.gotoDocument(0, this.activeItem)}><b>1</b></div></Tooltip>
-            <div
-                className="presPanel-button-text"
-                onClick={() => this.gotoDocument(0, this.activeItem)}
-                style={{ display: this.props.PanelWidth() > 250 ? "inline-flex" : "none" }}>
-                Slide {this.itemIndex + 1} / {this.childDocs.length}
-                {this.playButtonFrames}
-            </div>
-            <div className="presPanel-divider"></div>
-            {this.props.PanelWidth() > 250 ? <div className="presPanel-button-text" onClick={undoBatch(action(() => { this.layoutDoc.presStatus = "edit"; clearTimeout(this._presTimer); }))}>EXIT</div>
-                : <div className="presPanel-button" onClick={undoBatch(action(() => this.layoutDoc.presStatus = "edit"))}>
-                    <FontAwesomeIcon icon={"times"} />
-                </div>}
-        </div>);
-    }
-
-    @action
-    startOrPause = () => {
-        if (this.layoutDoc.presStatus === PresStatus.Manual || this.layoutDoc.presStatus === PresStatus.Edit) this.startAutoPres(this.itemIndex);
-        else this.pauseAutoPres();
-    }
-
-    render() {
-        // calling this method for keyEvents
-        this.isPres;
-        // needed to ensure that the childDocs are loaded for looking up fields
-        this.childDocs.slice();
-        const mode = StrCast(this.rootDoc._viewType) as CollectionViewType;
-        const presKeyEvents: boolean = (this.isPres && this._presKeyEventsActive && this.rootDoc === Doc.UserDoc().activePresentation);
-        const presEnd: boolean = !this.layoutDoc.presLoop && (this.itemIndex === this.childDocs.length - 1);
-        const presStart: boolean = !this.layoutDoc.presLoop && (this.itemIndex === 0);
-        return CurrentUserUtils.OverlayDocs.includes(this.rootDoc) ?
-            <div className="miniPres">
-                <div className="presPanelOverlay" style={{ display: "inline-flex", height: 30, background: '#323232', top: 0, zIndex: 3000000, boxShadow: presKeyEvents ? '0 0 0px 3px ' + PresColor.DarkBlue : undefined }}>
-                    <Tooltip title={<><div className="dash-tooltip">{"Loop"}</div></>}><div className="presPanel-button" style={{ color: this.layoutDoc.presLoop ? PresColor.DarkBlue : undefined }} onClick={() => this.layoutDoc.presLoop = !this.layoutDoc.presLoop}><FontAwesomeIcon icon={"redo-alt"} /></div></Tooltip>
-                    <div className="presPanel-divider"></div>
-                    <div className="presPanel-button" style={{ opacity: presStart ? 0.4 : 1 }} onClick={() => { this.back(); if (this._presTimer) { clearTimeout(this._presTimer); this.layoutDoc.presStatus = PresStatus.Manual; } }}><FontAwesomeIcon icon={"arrow-left"} /></div>
-                    <Tooltip title={<><div className="dash-tooltip">{this.layoutDoc.presStatus === PresStatus.Autoplay ? "Pause" : "Autoplay"}</div></>}><div className="presPanel-button" onClick={this.startOrPause}><FontAwesomeIcon icon={this.layoutDoc.presStatus === "auto" ? "pause" : "play"} /></div></Tooltip>
-                    <div className="presPanel-button" style={{ opacity: presEnd ? 0.4 : 1 }} onClick={() => { this.next(); if (this._presTimer) { clearTimeout(this._presTimer); this.layoutDoc.presStatus = PresStatus.Manual; } }}><FontAwesomeIcon icon={"arrow-right"} /></div>
-                    <div className="presPanel-divider"></div>
-                    <Tooltip title={<><div className="dash-tooltip">{"Click to return to 1st slide"}</div></>}><div className="presPanel-button" style={{ border: 'solid 1px white' }} onClick={() => this.gotoDocument(0, this.activeItem)}><b>1</b></div></Tooltip>
-                    <div className="presPanel-button-text">
-                        Slide {this.itemIndex + 1} / {this.childDocs.length}
-                        {this.playButtonFrames}
-                    </div>
-                    <div className="presPanel-divider"></div>
-                    <div className="presPanel-button-text" onClick={undoBatch(action(() => { this.updateMinimize(); this.layoutDoc.presStatus = PresStatus.Edit; clearTimeout(this._presTimer); }))}>EXIT</div>
-                </div>
-            </div>
-            :
-            <div className="presBox-cont" style={{ minWidth: CurrentUserUtils.OverlayDocs.includes(this.layoutDoc) ? 240 : undefined }} >
-                {this.topPanel}
-                {this.toolbar}
-                {this.newDocumentToolbarDropdown}
-                <div className="presBox-listCont">
-                    {mode !== CollectionViewType.Invalid ?
-                        <CollectionView {...this.props}
-                            ContainingCollectionDoc={this.props.Document}
-                            PanelWidth={this.props.PanelWidth}
-                            PanelHeight={this.panelHeight}
-                            childIgnoreNativeSize={true}
-                            moveDocument={returnFalse}
-                            childFitWidth={returnTrue}
-                            childOpacity={returnOne}
-                            childLayoutTemplate={this.childLayoutTemplate}
-                            filterAddDocument={this.addDocumentFilter}
-                            removeDocument={returnFalse}
-                            dontRegisterView={true}
-                            focus={this.selectElement}
-                            ScreenToLocalTransform={this.getTransform}
-                        />
-                        : (null)
-                    }
-                </div>
-            </div>;
-    }
-}
-Scripting.addGlobal(function lookupPresBoxField(container: Doc, field: string, data: Doc) {
-    if (field === 'indexInPres') return DocListCast(container[StrCast(container.presentationFieldKey)]).indexOf(data);
-    if (field === 'presCollapsedHeight') return container._viewType === CollectionViewType.Stacking ? 35 : 31;
-    if (field === 'presStatus') return container.presStatus;
-    if (field === '_itemIndex') return container._itemIndex;
-    if (field === 'presBox') return container;
-    return undefined;
-});
\ No newline at end of file
diff --git a/src/client/views/nodes/formattedText/RichTextMenu.tsx b/src/client/views/nodes/formattedText/RichTextMenu.tsx
index 59b2d3753..d1c91cbb9 100644
--- a/src/client/views/nodes/formattedText/RichTextMenu.tsx
+++ b/src/client/views/nodes/formattedText/RichTextMenu.tsx
@@ -963,7 +963,7 @@ export class RichTextMenu extends AntimodeMenu<AntimodeMenuProps>   {
             this.createHighlighterButton(),
             this.createLinkButton(),
             this.createBrushButton(),
-            <div className="richTextMenu-divider" key="divider 2" />,
+            <div className="collectionMenu-divider" key="divider 2" />,
             this.createButton("align-left", "Align Left", this.activeAlignment === "left", this.alignLeft),
             this.createButton("align-center", "Align Center", this.activeAlignment === "center", this.alignCenter),
             this.createButton("align-right", "Align Right", this.activeAlignment === "right", this.alignRight),
@@ -976,7 +976,7 @@ export class RichTextMenu extends AntimodeMenu<AntimodeMenuProps>   {
         const row2 = <div className="antimodeMenu-row row-2" key="row2">
             {this.collapsed ? this.getDragger() : (null)}
             <div key="row 2" style={{ display: this.collapsed ? "none" : undefined }}>
-                <div className="richTextMenu-divider" key="divider 3" />
+                <div className="collectionMenu-divider" key="divider 3" />
                 {[this.createMarksDropdown(this.activeFontSize, this.fontSizeOptions, "font size", action((val: string) => {
                     this.activeFontSize = val;
                     SelectionManager.Views().map(dv => dv.props.Document._fontSize = val);
@@ -985,12 +985,12 @@ export class RichTextMenu extends AntimodeMenu<AntimodeMenuProps>   {
                     this.activeFontFamily = val;
                     SelectionManager.Views().map(dv => dv.props.Document._fontFamily = val);
                 })),
-                <div className="richTextMenu-divider" key="divider 4" />,
+                <div className="collectionMenu-divider" key="divider 4" />,
                 this.createNodesDropdown(this.activeListType, this.listTypeOptions, "list type", () => ({})),
                 this.createButton("sort-amount-down", "Summarize", undefined, this.insertSummarizer),
                 this.createButton("quote-left", "Blockquote", undefined, this.insertBlockquote),
-                this.createButton("minus", "Horizontal Rule", undefined, this.insertHorizontalRule),
-                <div className="richTextMenu-divider" key="divider 5" />,]}
+                this.createButton("minus", "Horizontal Rule", undefined, this.insertHorizontalRule)
+                ]}
             </div>
             {/* <div key="collapser">
                 {<div key="collapser">
diff --git a/src/client/views/nodes/trails/PresBox.scss b/src/client/views/nodes/trails/PresBox.scss
new file mode 100644
index 000000000..06932d145
--- /dev/null
+++ b/src/client/views/nodes/trails/PresBox.scss
@@ -0,0 +1,1243 @@
+@import "../../global/globalCssVariables";
+
+.presBox-cont {
+    cursor: auto;
+    position: absolute;
+    display: block;
+    pointer-events: inherit;
+    z-index: 2;
+    font-family: Roboto;
+    width: 100%;
+    min-width: 20px;
+    height: 100%;
+    min-height: 35px;
+    letter-spacing: 2px;
+    overflow: hidden;
+    transition: 0.7s opacity ease;
+
+    .presBox-listCont {
+        position: relative;
+        height: calc(100% - 67px);
+        width: 100%;
+    }
+
+    .presBox-toolbar-dropdown {
+        border-radius: 5px;
+        background-color: white;
+        transform: translate(8px, -5px);
+        box-shadow: 1px 1px 4px 4px rgba(0, 0, 0, 0.25);
+        z-index: 1000;
+        width: calc(100% - 50px);
+        height: max-content;
+        justify-self: center;
+        letter-spacing: normal;
+        height: max-content;
+        font-weight: 500;
+        position: relative;
+        font-size: 13;
+    }
+
+    .presBox-toolbar {
+        position: relative;
+        display: inline-flex;
+        align-items: center;
+        height: 30px;
+        width: 100%;
+        color: $white;
+        background-color: $dark-gray;
+
+        .toolbar-button {
+            cursor: pointer;
+            margin-left: 10px;
+            margin-right: 10px;
+            letter-spacing: 0;
+            display: flex;
+            align-items: center;
+            justify-content: center;
+            transition: 0.5s;
+        }
+
+        .toolbar-button.active {
+            color: $light-blue;
+            background-color: white;
+            border-radius: 100%;
+        }
+
+        .toolbar-transitionButtons {
+            display: block;
+
+            .toolbar-transition {
+                display: flex;
+                font-size: 10;
+                width: 100;
+                background-color: rgba(0, 0, 0, 0);
+                min-width: max-content;
+
+                .toolbar-icon {
+                    margin-right: 5px;
+                }
+            }
+        }
+    }
+
+    .toolbar-moreInfo {
+        position: absolute;
+        right: 5px;
+        display: flex;
+        width: max-content;
+        height: 25px;
+        justify-content: center;
+        transform: rotate(90deg);
+        align-items: center;
+        transition: 0.7s ease;
+
+        .toolbar-moreInfoBall {
+            width: 4px;
+            height: 4px;
+            border-radius: 100%;
+            background-color: white;
+            margin: 1px;
+            position: relative;
+        }
+    }
+
+    .toolbar-moreInfo.active {
+        transform: rotate(0deg);
+    }
+
+    .toolbar-divider {
+        border-left: solid $medium-gray 0.5px;
+        height: 20px;
+    }
+}
+
+.dropdown {
+    font-size: 10;
+    margin-left: 5px;
+    color: $medium-gray;
+    transition: 0.5s ease;
+}
+
+.dropdown.active {
+    transform: rotate(180deg);
+    color: $light-blue;
+    opacity: 0.8;
+}
+
+.presBox-radioButtons {
+    font-size: 10px;
+    font-weight: 200;
+    // background-color: rgba(0, 0, 0, 0.1);
+
+    .checkbox-container {
+        margin-left: 10px;
+        display: inline-flex;
+        width: 100%;
+        height: 20px;
+        align-items: center;
+    }
+
+    .checkbox-dropdown {
+        display: flex;
+        width: 100%;
+        align-items: flex-end;
+        gap: 5px;
+
+        .presBox-viewPicker {
+            width: calc(100% - 120px);
+            min-width: 30px;
+        }
+    }
+}
+
+.presBox-ribbon {
+    position: relative;
+    display: inline;
+    font-family: Roboto;
+    z-index: 100;
+    transition: 0.7s;
+
+    .ribbon-doubleButton {
+        display: inline-flex;
+    }
+
+    .presBox-reactiveGrid {
+        display: grid;
+        justify-content: flex-start;
+        align-items: center;
+        grid-template-columns: repeat(auto-fit, 70px);
+    }
+
+    .ribbon-colorBox {
+        cursor: pointer;
+        border: solid 1px $black;
+        display: flex;
+        margin-left: 5px;
+        margin-top: 5px;
+        margin-bottom: 5px;
+        justify-content: center;
+        align-items: center;
+        height: 15px;
+        width: 15px;
+        padding: 0px;
+        transform: translate(2px, 3px);
+    }
+
+    .ribbon-property {
+        font-size: 11;
+        font-weight: 200;
+        height: 20;
+        background-color: $white;
+        color: $black;
+        border: solid 1px $black;
+        display: flex;
+        margin-left: 5px;
+        margin-top: 5px;
+        margin-bottom: 5px;
+        width: max-content;
+        justify-content: center;
+        align-items: center;
+        padding-right: 10px;
+        padding-left: 10px;
+    }
+
+    .ribbon-propertyUpDown {
+        height: 20;
+        width: 20;
+        margin-top: 5px;
+        display: grid;
+        grid-template-rows: 10px 10px;
+
+        .ribbon-propertyUpDownItem {
+            cursor: pointer;
+            color: white;
+            display: flex;
+            justify-content: center;
+            align-items: center;
+            height: 100%;
+            width: 100%;
+            background: $black;
+        }
+
+        .ribbon-propertyUpDownItem:hover {
+            background: $medium-gray;
+            transform: scale(1.05);
+        }
+    }
+
+    .presBox-subheading {
+        font-size: 11;
+        font-weight: 400;
+        margin-top: 10px;
+    }
+
+    @media screen and (-webkit-min-device-pixel-ratio:0) {
+
+        .multiThumb-slider {
+            display: grid;
+            background-color: $white;
+            height: 10px;
+            border-radius: 10px;
+            overflow: hidden;
+
+            .toolbar-slider {
+                margin-top: 0px;
+                background: none;
+                -webkit-appearance: none;
+                pointer-events: none;
+            }
+
+            .toolbar-slider.start::-webkit-slider-thumb {
+                width: 10px;
+                pointer-events: auto;
+                -webkit-appearance: none;
+                height: 10px;
+                cursor: ew-resize;
+                background: $medium-blue;
+                box-shadow: -100vw 0 0 100vw $white;
+            }
+
+            .toolbar-slider.end::-webkit-slider-thumb {
+                width: 10px;
+                pointer-events: auto;
+                -webkit-appearance: none;
+                height: 10px;
+                cursor: ew-resize;
+                background: $medium-blue;
+                box-shadow: -100vw 0 0 100vw $light-blue;
+            }
+        }
+
+        .toolbar-slider {
+            margin-top: 5px;
+            position: relative;
+            align-self: center;
+            justify-self: left;
+            overflow: hidden;
+            width: 100%;
+            height: 10px;
+            border-radius: 10px;
+            -webkit-appearance: none;
+            background-color: $white;
+        }
+
+        .toolbar-slider:focus {
+            outline: none;
+        }
+
+        .toolbar-slider::-webkit-slider-runnable-track {
+            height: 10px;
+            -webkit-appearance: none;
+            margin-top: -1px;
+        }
+
+        .toolbar-slider::-webkit-slider-thumb {
+            width: 10px;
+            pointer-events: auto;
+            -webkit-appearance: none;
+            height: 10px;
+            cursor: ew-resize;
+            background: $medium-blue;
+            box-shadow: -100vw 0 0 100vw $light-blue;
+        }
+
+        .presBox-checkbox {
+            -webkit-appearance: none;
+            -webkit-user-select: none;
+            -moz-user-select: none;
+            -ms-user-select: none;
+            user-select: none;
+            margin: 0;
+            margin-right: 3px;
+            border-radius: 100%;
+            height: 15px;
+            width: 15px;
+            min-width: 15px;
+            cursor: pointer;
+            background: $white;
+        }
+
+        .presBox-checkbox:focus {
+            outline: none;
+        }
+
+        .presBox-checkbox:hover {
+            background: $light-gray;
+        }
+
+        .presBox-checkbox:checked {
+            background: $light-blue;
+        }
+    }
+
+
+
+    .slider-headers {
+        position: relative;
+        display: grid;
+        justify-content: space-between;
+        width: 100%;
+        height: max-content;
+        grid-template-columns: auto auto auto;
+        grid-template-rows: max-content;
+        font-weight: 100;
+        margin-top: 3px;
+        font-size: 10px;
+
+        .slider-block {
+            width: 63px;
+            border-radius: 5px;
+            text-align: center;
+            margin-bottom: 8px;
+            margin-top: 8px;
+        }
+
+        .slider-number {
+            border-radius: 3px;
+            width: 30px;
+            margin: auto;
+        }
+    }
+
+    .slider-value {
+        top: -20;
+        color: #2f86a2;
+        position: absolute;
+    }
+
+    .slider-value.none,
+    .slider-headers.none,
+    .toolbar-slider.none {
+        display: none;
+    }
+
+    .dropdown-header {
+        padding-bottom: 10px;
+        font-weight: 800;
+        text-align: center;
+        font-size: 16;
+        width: 90%;
+        color: $black;
+        transform: translate(5%, 0px);
+        border-bottom: solid 2px $medium-gray;
+    }
+
+
+    .ribbon-textInput {
+        border-radius: 2px;
+        height: 20px;
+        font-size: 11.5;
+        font-weight: 100;
+        align-self: center;
+        justify-self: left;
+        margin-top: 5px;
+        padding-left: 10px;
+        background-color: $white;
+        border: solid 1px $black;
+        min-width: 80px;
+        max-width: 200px;
+        width: 100%;
+    }
+
+    .presBox-input {
+        width: 30;
+        height: 100%;
+        background: none;
+        border: none;
+        text-align: right;
+    }
+
+    .presBox-input:focus {
+        outline: none;
+    }
+
+    .ribbon-frameSelector {
+        border: $black solid 1px;
+        width: 60px;
+        height: 20px;
+        margin-top: 5px;
+        display: grid;
+        grid-template-columns: auto 27px auto;
+        position: relative;
+        border-radius: 5px;
+        overflow: hidden;
+        align-items: center;
+        justify-self: left;
+
+        .fwdKeyframe,
+        .backKeyframe {
+            cursor: pointer;
+            position: relative;
+            height: 100%;
+            background: $white;
+            display: flex;
+            align-items: center;
+            justify-content: center;
+            text-align: center;
+            color: $black;
+        }
+
+        .numKeyframe {
+            cursor: pointer;
+            font-size: 10;
+            font-weight: 600;
+            position: relative;
+            color: $black;
+            display: flex;
+            width: 100%;
+            height: 100%;
+            text-align: center;
+            align-items: center;
+            justify-content: center;
+        }
+    }
+
+    .ribbon-final-box {
+        align-self: flex-start;
+        justify-self: center;
+        display: grid;
+        margin-top: 10px;
+        grid-template-rows: auto auto;
+        /* padding-left: 10px; */
+        /* padding-right: 10px; */
+        letter-spacing: normal;
+        min-width: max-content;
+        width: 100%;
+        font-size: 13;
+        font-weight: 500;
+        position: relative;
+
+
+        .ribbon-final-button {
+            cursor: pointer;
+            position: relative;
+            font-size: 11;
+            font-weight: normal;
+            letter-spacing: normal;
+            display: flex;
+            justify-content: center;
+            align-items: center;
+            margin-bottom: 5px;
+            height: 25px;
+            color: white;
+            width: 100%;
+            max-width: 120;
+            padding-left: 10;
+            padding-right: 10;
+            border-radius: 10px;
+            background-color: $medium-gray;
+        }
+
+        .ribbon-final-button:hover {
+            transform: scale(1.05);
+            transition: all 0.4s;
+        }
+
+        .ribbon-final-button-hidden {
+            cursor: pointer;
+            position: relative;
+            font-size: 11;
+            font-weight: normal;
+            letter-spacing: normal;
+            display: flex;
+            justify-content: center;
+            align-items: center;
+            margin-bottom: 5px;
+            height: 25px;
+            color: $light-gray;
+            width: 100%;
+            max-width: 120;
+            padding-left: 10;
+            padding-right: 10;
+            border-radius: 10px;
+            background-color: $black;
+        }
+
+        .ribbon-final-button-hidden:hover {
+            transform: scale(1.05);
+            transition: all 0.4s;
+        }
+
+        .ribbon-frameList {
+            width: calc(100% - 5px);
+            height: 50px;
+            background-color: $white;
+            border: 1px solid $medium-gray;
+            grid-template-rows: max-content;
+
+            .frameList-header {
+                display: grid;
+                width: 100%;
+                height: 20px;
+                background-color: $medium-gray;
+
+                .frameList-headerButtons {
+                    display: flex;
+                    grid-column: 7;
+                    width: 60px;
+                    justify-self: right;
+                    justify-content: flex-end;
+
+                    .headerButton {
+                        cursor: pointer;
+                        position: relative;
+                        border-radius: 100%;
+                        z-index: 300;
+                        width: 15px;
+                        height: 15px;
+                        display: flex;
+                        font-size: 10px;
+                        justify-self: center;
+                        align-self: center;
+                        background-color: rgba(0, 0, 0, 0.5);
+                        color: white;
+                        justify-content: center;
+                        align-items: center;
+                        transition: 0.2s;
+                        margin-right: 3px;
+                    }
+
+                    .headerButton:hover {
+                        background-color: rgba(0, 0, 0, 1);
+                        transform: scale(1.15);
+                    }
+                }
+            }
+        }
+    }
+
+    .selectedList {
+        display: block;
+        min-width: 50;
+        max-width: 120;
+        height: 70;
+        overflow-y: scroll;
+
+        .selectedList-items {
+            font-size: 7;
+            font-weight: normal;
+        }
+    }
+
+    .ribbon-button {
+        cursor: pointer;
+        font-size: 10.5;
+        font-weight: 300;
+        height: 20;
+        background-color: $medium-gray;
+        color: white;
+        display: flex;
+        margin-top: 5px;
+        margin-bottom: 5px;
+        border-radius: 5px;
+        margin-right: 5px;
+        width: max-content;
+        justify-content: center;
+        align-items: center;
+        padding-right: 10px;
+        padding-left: 10px;
+    }
+
+    .ribbon-button:hover {
+        transform: scale(1.03);
+        transition: all 0.4s;
+        font-weight: 400;
+        opacity: 1;
+        color: $white;
+        background-color: $black;
+    }
+
+    .ribbon-toggle {
+        cursor: pointer;
+        font-size: 10.5;
+        font-weight: 200;
+        height: 20;
+        background-color: $white;
+        border: solid 1px rgba(0, 0, 0, 0.5);
+        display: flex;
+        color: $black;
+        margin-top: 5px;
+        margin-bottom: 5px;
+        border-radius: 5px;
+        margin-right: 5px;
+        width: max-content;
+        justify-content: center;
+        align-items: center;
+        padding-right: 10px;
+        padding-left: 10px;
+    }
+
+    .ribbon-toggle.active {
+        background-color: #aedef8;
+    }
+
+    .ribbon-toggle:hover {
+        transform: scale(1.03);
+        transition: all 0.4s;
+        border: solid 1px rgba(0, 0, 0, 0.75);
+    }
+
+    svg.svg-inline--fa.fa-thumbtack.fa-w-12.toolbar-thumbtack {
+        right: 40;
+        position: absolute;
+        transform: rotate(45deg);
+    }
+
+    .ribbon-box {
+        display: grid;
+        grid-template-rows: max-content auto;
+        justify-self: center;
+        margin-top: 10px;
+        padding-right: 10px;
+        letter-spacing: normal;
+        width: 100%;
+        height: max-content;
+        font-weight: 500;
+        position: relative;
+        font-size: 13;
+        padding-bottom: 10px;
+        border-bottom: solid 1px $dark-gray;
+
+        .presBox-dropdown:hover {
+            border: solid 1px $medium-blue;
+
+            .presBox-dropdownIcon {
+                color: $medium-blue;
+            }
+        }
+
+        .presBox-dropdown {
+            cursor: pointer;
+            display: grid;
+            grid-template-columns: auto 20%;
+            position: relative;
+            border: solid 1px $black;
+            background-color: $light-gray;
+            border-radius: 5px;
+            font-size: 10;
+            height: 25;
+            color: $black;
+            padding-left: 5px;
+            align-items: center;
+            margin-top: 5px;
+            margin-bottom: 5px;
+            font-weight: 200;
+            width: 100%;
+            min-width: max-content;
+            max-width: 200px;
+            overflow: visible;
+
+
+            .presBox-dropdownOption {
+                cursor: pointer;
+                font-size: 11;
+                display: block;
+                padding-left: 10px;
+                padding-right: 5px;
+                padding-top: 3;
+                padding-bottom: 3;
+            }
+
+            .presBox-dropdownOption:hover {
+                position: relative;
+                background-color: lightgrey;
+            }
+
+            .presBox-dropdownOption.active {
+                position: relative;
+                background-color: $light-blue;
+            }
+
+            .presBox-dropdownOptions {
+                position: absolute;
+                top: 23px;
+                left: -2px;
+                z-index: 200;
+                width: 85%;
+                min-width: max-content;
+                display: block;
+                background: #FFFFFF;
+                border: 0.5px solid #979797;
+                box-sizing: border-box;
+                box-shadow: 0px 4px 4px rgba(0, 0, 0, 0.25);
+            }
+
+            .presBox-dropdownIcon {
+                position: relative;
+                color: black;
+                align-self: center;
+                justify-self: center;
+                margin-right: 2px;
+            }
+        }
+    }
+}
+
+.presBox-ribbon.active {
+    display: grid;
+    grid-template-columns: auto auto auto auto auto;
+    grid-template-rows: 100%;
+    height: 100px;
+    padding-top: 5px;
+    padding-bottom: 5px;
+    border: solid 1px $black;
+    // overflow: auto; 
+
+    ::-webkit-scrollbar {
+        -webkit-appearance: none;
+        height: 3px;
+        width: 8px;
+    }
+
+    ::-webkit-scrollbar-thumb {
+        border-radius: 2px;
+    }
+}
+
+.dropdown-play-button {
+    cursor: pointer;
+    font-size: 12;
+    padding-left: 5px;
+    padding-right: 5px;
+    padding-top: 5px;
+    padding-bottom: 5px;
+    text-align: left;
+    justify-content: left;
+}
+
+.dropdown-play-button:hover {
+    background-color: lightgrey;
+}
+
+.presBox-button-left {
+    cursor: pointer;
+    position: relative;
+    align-self: flex-start;
+    justify-self: flex-start;
+    width: 100%;
+    height: 100%;
+    display: flex;
+    align-items: center;
+    justify-content: center;
+    border-radius: 4px;
+    padding-left: 7px;
+    padding-right: 7px;
+    border-bottom-right-radius: 0;
+    border-top-right-radius: 0;
+}
+
+.presBox-button-right {
+    cursor: pointer;
+    position: relative;
+    text-align: center;
+    border-left: solid 1px $medium-gray;
+    width: 20%;
+    height: 100%;
+    display: flex;
+    align-items: center;
+    justify-content: center;
+    border-radius: 4px;
+    padding-left: 7px;
+    padding-right: 7px;
+    border-bottom-left-radius: 0;
+    border-top-left-radius: 0;
+}
+
+.presBox-button-right.active {
+    background-color: #223063;
+    border: #aedcf6 solid 1px;
+    box-shadow: 0px 4px 10px rgba(0, 0, 0, 0.8);
+}
+
+.dropdown-play {
+    cursor: pointer;
+    right: 0px;
+    top: calc(100% + 2px);
+    display: none;
+    border-radius: 5px;
+    width: max-content;
+    min-height: 20px;
+    height: max-content;
+    box-shadow: 0px 4px 10px rgba(0, 0, 0, 0.8);
+    z-index: 200;
+    background-color: white;
+    color: $black;
+    position: absolute;
+    overflow: hidden;
+}
+
+.dropdown-play.active {
+    display: block;
+}
+
+.open-layout {
+    cursor: pointer;
+    position: relative;
+    display: flex;
+    align-items: center;
+    justify-content: center;
+    transform: translate(0px, -1px);
+    background-color: $white;
+    width: 40px;
+    height: 15px;
+    align-self: center;
+    justify-self: center;
+    border: solid 1px $black;
+    border-top: 0px;
+    border-bottom-right-radius: 7px;
+    border-bottom-left-radius: 7px;
+}
+
+.layout-container {
+    padding: 5px;
+    display: grid;
+    background-color: $white;
+    grid-template-columns: repeat(auto-fit, minmax(90px, 100px));
+    width: 100%;
+    border: solid 1px $black;
+    min-width: 100px;
+    overflow: hidden;
+
+    .layout:hover {
+        border: solid 2px $medium-blue;
+    }
+
+    .layout {
+        cursor: pointer;
+        align-self: center;
+        justify-self: center;
+        margin-top: 5;
+        margin-bottom: 5;
+        position: relative;
+        height: 55px;
+        min-width: 90px;
+        width: 90px;
+        overflow: hidden;
+        background-color: white;
+        border: solid $medium-gray 1px;
+        display: grid;
+        grid-template-rows: auto;
+        align-items: center;
+        text-align: center;
+
+        .title {
+            position: relative;
+            align-self: end;
+            padding-left: 3px;
+            margin-left: 3px;
+            margin-right: 3px;
+            height: 13;
+            font-size: 12;
+            display: flex;
+            background-color: $white;
+        }
+
+        .subtitle {
+            align-self: flex-start;
+            position: relative;
+            padding-left: 3px;
+            margin-left: 3px;
+            margin-right: 3px;
+            font-weight: 400;
+            height: 13;
+            font-size: 9;
+            display: flex;
+            background-color: $white;
+        }
+
+        .content {
+            position: relative;
+            font-weight: 200;
+            align-self: flex-start;
+            padding-left: 3px;
+            margin-left: 3px;
+            margin-right: 3px;
+            height: 13;
+            font-size: 10;
+            display: flex;
+            background-color: $white;
+            height: 33;
+            text-align: left;
+            font-size: 8px;
+        }
+    }
+}
+
+.presBox-buttons {
+    position: relative;
+    width: 100%;
+    background: $medium-gray;
+    min-height: 35px;
+    padding-top: 5px;
+    padding-bottom: 5px;
+    display: grid;
+    grid-template-columns: auto auto;
+
+    .presBox-viewPicker {
+        cursor: pointer;
+        height: 25;
+        position: relative;
+        display: inline-block;
+        grid-column: 1;
+        border-radius: 5px;
+        min-width: 15px;
+        max-width: 100px;
+        left: 8px;
+    }
+
+    .presBox-presentPanel {
+        display: flex;
+        justify-self: end;
+        width: 100%;
+        max-width: 300px;
+        min-width: 150px;
+    }
+
+
+
+    select {
+        background: $dark-gray;
+        color: $white;
+    }
+
+    .presBox-button {
+        cursor: pointer;
+        height: 25px;
+        border-radius: 5px;
+        display: none;
+        justify-content: center;
+        align-content: center;
+        align-items: center;
+        text-align: center;
+        letter-spacing: normal;
+        width: inherit;
+        background: $dark-gray;
+        color: $white;
+    }
+
+    .presBox-button.active {
+        display: flex;
+    }
+
+    .presBox-button.active:hover {
+        background-color: $medium-blue;
+    }
+
+    .presBox-button.edit {
+        display: flex;
+        max-width: 25px;
+    }
+
+    .presBox-button.present {
+        display: flex;
+        width: max-content;
+        position: absolute;
+        right: 10px;
+
+        .present-icon {
+            margin-right: 7px;
+        }
+    }
+
+
+
+    .collectionViewBaseChrome-viewPicker {
+        min-width: 50;
+        width: 5%;
+        height: 25;
+        position: relative;
+        display: inline-block;
+        left: 8px;
+    }
+}
+
+.presBox-backward,
+.presBox-forward {
+    width: 25px;
+    border-radius: 5px;
+    top: 50%;
+    position: absolute;
+    display: inline-block;
+}
+
+.presBox-backward {
+    left: 5;
+}
+
+.presBox-forward {
+    right: 5;
+}
+
+// CSS adjusted for mobile devices
+@media only screen and (max-device-width: 480px) {
+    .presBox-cont .presBox-buttons {
+        position: absolute;
+        top: 70%;
+        left: 50%;
+        transform: translate(-50%, 0);
+        width: max-content;
+        height: 15%;
+        z-index: 2;
+        align-items: center;
+        background: rgba(0, 0, 0, 0);
+        display: inline-flex;
+
+        .presBox-button {
+            margin-top: 5%;
+            height: 250;
+            width: 300;
+            font-size: 100;
+            display: flex;
+            align-items: center;
+            background: $dark-gray;
+            color: $white;
+        }
+
+        .presBox-viewPicker {
+            top: -70;
+            left: 2.5%;
+            height: 50;
+            width: 95%;
+            font-size: 30px;
+            position: absolute;
+            min-width: 50px;
+        }
+    }
+
+    .presBox-cont .presBox-listCont {
+        top: 50;
+        height: calc(100% - 80px);
+    }
+
+    .input,
+    .select {
+        font-size: 100%;
+    }
+}
+
+.miniPres {
+    cursor: grab;
+    position: absolute;
+    right: 10;
+    top: 10;
+    opacity: 0.1;
+    transition: all 0.4s;
+    color: $white;
+}
+
+.miniPres:hover {
+    opacity: 1;
+}
+
+.presPanelOverlay {
+    background-color: $dark-gray;
+    color: $white;
+    border-radius: 5px;
+    grid-template-rows: 100%;
+    height: 25;
+    width: max-content;
+    min-width: max-content;
+    justify-content: space-evenly;
+    align-items: center;
+    display: flex;
+    position: absolute;
+    right: 10px;
+    transition: all 0.2s;
+
+    .presPanel-button-text {
+        cursor: pointer;
+        display: flex;
+        height: 20;
+        width: max-content;
+        font-family: Roboto;
+        font-weight: 400;
+        margin-left: 3px;
+        margin-right: 3px;
+        padding-right: 3px;
+        padding-left: 3px;
+        letter-spacing: normal;
+        border-radius: 5px;
+        align-items: center;
+        justify-content: center;
+        transition: all 0.3s;
+    }
+
+    .presPanel-divider {
+        width: 0.5px;
+        height: 80%;
+        border-right: solid 1px $medium-gray;
+    }
+
+    .presPanel-button-frame {
+        justify-self: center;
+        align-self: center;
+        align-items: center;
+        display: grid;
+        grid-template-columns: auto auto auto;
+        justify-content: space-around;
+        font-size: 11;
+        margin-left: 7;
+        width: 30;
+        height: 85%;
+        background-color: rgba(91, 157, 221, 0.4);
+        border-radius: 5px;
+    }
+
+    .presPanel-button {
+        cursor: pointer;
+        display: flex;
+        height: 20;
+        min-width: 20;
+        margin-left: 3px;
+        margin-right: 3px;
+        border-radius: 100%;
+        align-items: center;
+        justify-content: center;
+        transition: all 0.3s;
+    }
+
+    .presPanel-button:hover {
+        background-color: $medium-gray;
+        transform: scale(1.2);
+    }
+
+    .presPanel-button-text:hover {
+        background-color: $medium-gray;
+    }
+
+
+}
+
+// .miniPres {
+//     cursor: grab;
+//     position: absolute;
+//     overflow: hidden;
+//     right: 10;
+//     top: 10;
+//     opacity: 0.1;
+//     transition: all 0.4s;
+//     /* border: solid 1px; */
+//     color: white;
+//     /* box-shadow: black 0.4vw 0.4vw 0.8vw; */
+
+//     .miniPresOverlay {
+//         display: grid;
+//         grid-template-columns: auto auto auto auto auto auto auto auto auto auto;
+//         grid-template-rows: 100%;
+//         height: 100%;
+//         justify-items: center;
+//         align-items: center;
+
+//         .miniPres-button-text {
+//             cursor: pointer;
+//             display: flex;
+//             height: 20;
+//             font-weight: 400;
+//             min-width: 100%;
+//             border-radius: 5px;
+//             align-items: center;
+//             justify-content: center;
+//             transition: all 0.3s;
+//         }
+
+//         .miniPres-button-frame {
+//             justify-self: center;
+//             align-self: center;
+//             align-items: center;
+//             display: grid;
+//             grid-template-columns: auto auto auto;
+//             justify-content: space-around;
+//             font-size: 11;
+//             margin-left: 7;
+//             width: 30;
+//             height: 85%;
+//             background-color: rgba(91, 157, 221, 0.4);
+//             border-radius: 5px;
+//         }
+
+//         .miniPres-divider {
+//             width: 0.5px;
+//             height: 80%;
+//             border-right: solid 2px #5a5a5a;
+//         }
+
+//         .miniPres-button {
+//             cursor: pointer;
+//             display: flex;
+//             height: 20;
+//             min-width: 20;
+//             border-radius: 100%;
+//             align-items: center;
+//             justify-content: center;
+//             transition: all 0.3s;
+//         }
+
+//         .miniPres-button:hover {
+//             background-color: #5a5a5a;
+//         }
+
+//         .miniPres-button-text:hover {
+//             background-color: #5a5a5a;
+//         }
+//     }
+// }
\ No newline at end of file
diff --git a/src/client/views/nodes/trails/PresBox.tsx b/src/client/views/nodes/trails/PresBox.tsx
new file mode 100644
index 000000000..5cb9866f8
--- /dev/null
+++ b/src/client/views/nodes/trails/PresBox.tsx
@@ -0,0 +1,2440 @@
+import React = require("react");
+import { FontAwesomeIcon } from "@fortawesome/react-fontawesome";
+import { Tooltip } from "@material-ui/core";
+import { action, computed, IReactionDisposer, observable, ObservableMap, reaction, runInAction } from "mobx";
+import { observer } from "mobx-react";
+import { ColorState, SketchPicker } from "react-color";
+import { Bounce, Fade, Flip, LightSpeed, Roll, Rotate, Zoom } from 'react-reveal';
+import { Doc, DocListCast, DocListCastAsync, FieldResult } from "../../../../fields/Doc";
+import { documentSchema } from "../../../../fields/documentSchemas";
+import { InkTool } from "../../../../fields/InkField";
+import { List } from "../../../../fields/List";
+import { PrefetchProxy } from "../../../../fields/Proxy";
+import { listSpec, makeInterface } from "../../../../fields/Schema";
+import { ScriptField } from "../../../../fields/ScriptField";
+import { BoolCast, Cast, NumCast, StrCast } from "../../../../fields/Types";
+import { emptyFunction, returnFalse, returnOne, returnTrue } from '../../../../Utils';
+import { Docs } from "../../../documents/Documents";
+import { DocumentType } from "../../../documents/DocumentTypes";
+import { CurrentUserUtils } from "../../../util/CurrentUserUtils";
+import { DocumentManager } from "../../../util/DocumentManager";
+import { Scripting } from "../../../util/Scripting";
+import { SelectionManager } from "../../../util/SelectionManager";
+import { undoBatch, UndoManager } from "../../../util/UndoManager";
+import { CollectionDockingView } from "../../collections/CollectionDockingView";
+import { CollectionView, CollectionViewType } from "../../collections/CollectionView";
+import { TabDocView } from "../../collections/TabDocView";
+import { ViewBoxBaseComponent } from "../../DocComponent";
+import { Colors } from "../../global/globalEnums";
+import { LightboxView } from "../../LightboxView";
+import { CollectionFreeFormDocumentView } from "../CollectionFreeFormDocumentView";
+import { FieldView, FieldViewProps } from '../FieldView';
+import "./PresBox.scss";
+import Color = require("color");
+import { PresEffect, PresStatus, PresMovement } from "./PresEnums";
+
+export class PinProps {
+    audioRange?: boolean;
+    unpin?: boolean;
+    setPosition?: boolean;
+    hidePresBox?: boolean;
+}
+
+type PresBoxSchema = makeInterface<[typeof documentSchema]>;
+const PresBoxDocument = makeInterface(documentSchema);
+
+@observer
+export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>(PresBoxDocument) {
+    public static LayoutString(fieldKey: string) { return FieldView.LayoutString(PresBox, fieldKey); }
+
+    static renderEffectsDoc(renderDoc: any, layoutDoc: Doc) {
+        const effectProps = {
+            left: layoutDoc.presEffectDirection === PresEffect.Left,
+            right: layoutDoc.presEffectDirection === PresEffect.Right,
+            top: layoutDoc.presEffectDirection === PresEffect.Top,
+            bottom: layoutDoc.presEffectDirection === PresEffect.Bottom,
+            opposite: true,
+            delay: layoutDoc.presTransition,
+            // when: this.layoutDoc === PresBox.Instance.childDocs[PresBox.Instance.itemIndex]?.presentationTargetDoc,
+        };
+        switch (layoutDoc.presEffect) {
+            case PresEffect.Zoom: return (<Zoom {...effectProps}>{renderDoc}</Zoom>);
+            case PresEffect.Fade: return (<Fade {...effectProps}>{renderDoc}</Fade>);
+            case PresEffect.Flip: return (<Flip {...effectProps}>{renderDoc}</Flip>);
+            case PresEffect.Rotate: return (<Rotate {...effectProps}>{renderDoc}</Rotate>);
+            case PresEffect.Bounce: return (<Bounce {...effectProps}>{renderDoc}</Bounce>);
+            case PresEffect.Roll: return (<Roll {...effectProps}>{renderDoc}</Roll>);
+            case PresEffect.Lightspeed: return (<LightSpeed {...effectProps}>{renderDoc}</LightSpeed>);
+            case PresEffect.None:
+            default: return renderDoc;
+        }
+    }
+    public static EffectsProvider(layoutDoc: Doc, renderDoc: any) {
+        return PresBox.Instance && layoutDoc === PresBox.Instance.childDocs[PresBox.Instance.itemIndex]?.presentationTargetDoc ?
+            PresBox.renderEffectsDoc(renderDoc, layoutDoc)
+            :
+            renderDoc;
+    }
+
+    @observable public static Instance: PresBox;
+
+    @observable _isChildActive = false;
+    @observable _moveOnFromAudio: boolean = true;
+    @observable _presTimer!: NodeJS.Timeout;
+    @observable _presKeyEventsActive: boolean = false;
+
+    @observable _selectedArray: ObservableMap = new ObservableMap<Doc, any>();
+    @observable _eleArray: HTMLElement[] = [];
+    @observable _dragArray: HTMLElement[] = [];
+    @observable _pathBoolean: boolean = false;
+    @observable _expandBoolean: boolean = false;
+
+    private _disposers: { [name: string]: IReactionDisposer } = {};
+    @observable private transitionTools: boolean = false;
+    @observable private newDocumentTools: boolean = false;
+    @observable private progressivizeTools: boolean = false;
+    @observable private openMovementDropdown: boolean = false;
+    @observable private openEffectDropdown: boolean = false;
+    @observable private presentTools: boolean = false;
+    @computed get childDocs() { return DocListCast(this.dataDoc[this.fieldKey]); }
+    @computed get tagDocs() {
+        const tagDocs: Doc[] = [];
+        for (const doc of this.childDocs) {
+            const tagDoc = Cast(doc.presentationTargetDoc, Doc, null);
+            tagDocs.push(tagDoc);
+        }
+        return tagDocs;
+    }
+    @computed get itemIndex() { return NumCast(this.rootDoc._itemIndex); }
+    @computed get activeItem() { return Cast(this.childDocs[NumCast(this.rootDoc._itemIndex)], Doc, null); }
+    @computed get targetDoc() { return Cast(this.activeItem?.presentationTargetDoc, Doc, null); }
+    @computed get scrollable(): boolean {
+        if (this.targetDoc.type === DocumentType.PDF || this.targetDoc.type === DocumentType.WEB || this.targetDoc.type === DocumentType.RTF || this.targetDoc._viewType === CollectionViewType.Stacking) return true;
+        else return false;
+    }
+    @computed get panable(): boolean {
+        if ((this.targetDoc.type === DocumentType.COL && this.targetDoc._viewType === CollectionViewType.Freeform) || this.targetDoc.type === DocumentType.IMG) return true;
+        else return false;
+    }
+    @computed get presElement() { return Cast(Doc.UserDoc().presElement, Doc, null); }
+    constructor(props: any) {
+        super(props);
+        if (Doc.UserDoc().activePresentation = this.rootDoc) runInAction(() => PresBox.Instance = this);
+        if (!this.presElement) { // create exactly one presElmentBox template to use by any and all presentations.
+            Doc.UserDoc().presElement = new PrefetchProxy(Docs.Create.PresElementBoxDocument({
+                title: "pres element template", type: DocumentType.PRESELEMENT, _xMargin: 0, isTemplateDoc: true, isTemplateForField: "data"
+            }));
+            // this script will be called by each presElement to get rendering-specific info that the PresBox knows about but which isn't written to the PresElement
+            // this is a design choice -- we could write this data to the presElements which would require a reaction to keep it up to date, and it would prevent
+            // the preselement docs from being part of multiple presentations since they would all have the same field, or we'd have to keep per-presentation data
+            // stored on each pres element.
+            (this.presElement as Doc).lookupField = ScriptField.MakeFunction("lookupPresBoxField(container, field, data)",
+                { field: "string", data: Doc.name, container: Doc.name });
+        }
+        this.props.Document.presentationFieldKey = this.fieldKey; // provide info to the presElement script so that it can look up rendering information about the presBox
+    }
+    @computed get selectedDocumentView() {
+        if (SelectionManager.Views().length) return SelectionManager.Views()[0];
+        if (this._selectedArray.size) return DocumentManager.Instance.getDocumentView(this.rootDoc);
+    }
+    @computed get isPres(): boolean {
+        document.removeEventListener("keydown", PresBox.keyEventsWrapper, true);
+        if (this.selectedDoc?.type === DocumentType.PRES) {
+            document.removeEventListener("keydown", PresBox.keyEventsWrapper, true);
+            document.addEventListener("keydown", PresBox.keyEventsWrapper, true);
+            return true;
+        }
+        return false;
+    }
+    @computed get selectedDoc() { return this.selectedDocumentView?.rootDoc; }
+
+    @action
+    componentWillUnmount() {
+        document.removeEventListener("keydown", PresBox.keyEventsWrapper, true);
+        this._presKeyEventsActive = false;
+        this.resetPresentation();
+        // Turn of progressivize editors
+        this.turnOffEdit(true);
+        Object.values(this._disposers).forEach(disposer => disposer?.());
+    }
+
+    @action
+    componentDidMount() {
+        this.rootDoc.presBox = this.rootDoc;
+        this.rootDoc._forceRenderEngine = "timeline";
+        this.layoutDoc.presStatus = PresStatus.Edit;
+        this.layoutDoc._gridGap = 0;
+        this.layoutDoc._yMargin = 0;
+        this.turnOffEdit(true);
+        DocListCastAsync((Doc.UserDoc().myPresentations as Doc).data).then(pres =>
+            !pres?.includes(this.rootDoc) && Doc.AddDocToList(Doc.UserDoc().myPresentations as Doc, "data", this.rootDoc));
+        this._disposers.selection = reaction(() => SelectionManager.Views(),
+            views => views.some(view => view.props.Document === this.rootDoc) && this.updateCurrentPresentation());
+    }
+
+    @action
+    updateCurrentPresentation = (pres?: Doc) => {
+        if (pres) Doc.UserDoc().activePresentation = pres;
+        else Doc.UserDoc().activePresentation = this.rootDoc;
+        document.removeEventListener("keydown", PresBox.keyEventsWrapper, true);
+        document.addEventListener("keydown", PresBox.keyEventsWrapper, true);
+        this._presKeyEventsActive = true;
+        PresBox.Instance = this;
+    }
+
+    // There are still other internal frames and should go through all frames before going to next slide
+    nextInternalFrame = (targetDoc: Doc, activeItem: Doc) => {
+        const currentFrame = Cast(targetDoc?._currentFrame, "number", null);
+        const childDocs = DocListCast(targetDoc[Doc.LayoutFieldKey(targetDoc)]);
+        targetDoc._viewTransition = "all 1s";
+        setTimeout(() => targetDoc._viewTransition = undefined, 1010);
+        this.nextKeyframe(targetDoc, activeItem);
+        if (activeItem.presProgressivize) CollectionFreeFormDocumentView.updateKeyframe(childDocs, currentFrame || 0, targetDoc);
+        else targetDoc.keyFrameEditing = true;
+    }
+
+    _mediaTimer!: [NodeJS.Timeout, Doc];
+    // 'Play on next' for audio or video therefore first navigate to the audio/video before it should be played
+    startTempMedia = (targetDoc: Doc, activeItem: Doc) => {
+        const duration: number = NumCast(activeItem.presEndTime) - NumCast(activeItem.presStartTime);
+        if ([DocumentType.VID, DocumentType.AUDIO].includes(targetDoc.type as any)) {
+            const targMedia = DocumentManager.Instance.getDocumentView(targetDoc);
+            targMedia?.ComponentView?.playFrom?.(NumCast(activeItem.presStartTime), NumCast(activeItem.presStartTime) + duration);
+        }
+        // if (targetDoc.type === DocumentType.AUDIO) {
+        //     if (this._mediaTimer && this._mediaTimer[1] === targetDoc) clearTimeout(this._mediaTimer[0]);
+        //     targetDoc._triggerAudio = NumCast(activeItem.presStartTime);
+        //     this._mediaTimer = [setTimeout(() => targetDoc._audioStop = true, duration * 1000), targetDoc];
+        // } else if (targetDoc.type === DocumentType.VID) {
+        //     targetDoc._triggerVideoStop = true;
+        //     setTimeout(() => targetDoc._currentTimecode = NumCast(activeItem.presStartTime), 10);
+        //     setTimeout(() => targetDoc._triggerVideo = true, 20);
+        //     this._mediaTimer = [setTimeout(() => targetDoc._triggerVideoStop = true, (duration * 1000) + 20), targetDoc];
+        // }
+    }
+
+    stopTempMedia = (targetDocField: FieldResult) => {
+        const targetDoc = Cast(targetDocField, Doc, null);
+        if (targetDoc?.type === DocumentType.AUDIO) {
+            if (this._mediaTimer && this._mediaTimer[1] === targetDoc) clearTimeout(this._mediaTimer[0]);
+            targetDoc._audioStop = true;
+        } else if (targetDoc?.type === DocumentType.VID) {
+            if (this._mediaTimer && this._mediaTimer[1] === targetDoc) clearTimeout(this._mediaTimer[0]);
+            targetDoc._triggerVideoStop = true;
+        }
+    }
+
+    // No more frames in current doc and next slide is defined, therefore move to next slide 
+    nextSlide = (activeNext: Doc) => {
+        const targetNext = Cast(activeNext.presentationTargetDoc, Doc, null);
+        let nextSelected = this.itemIndex + 1;
+        this.gotoDocument(nextSelected, this.activeItem);
+        for (nextSelected = nextSelected + 1; nextSelected < this.childDocs.length; nextSelected++) {
+            if (!this.childDocs[nextSelected].groupWithUp) {
+                break;
+            } else {
+                console.log("Title: " + this.childDocs[nextSelected].title);
+                this.gotoDocument(nextSelected, this.activeItem, true);
+            }
+        }
+    }
+
+    // Called when the user activates 'next' - to move to the next part of the pres. trail
+    @action
+    next = () => {
+        const activeNext = Cast(this.childDocs[this.itemIndex + 1], Doc, null);
+        const activeItem: Doc = this.activeItem;
+        const targetDoc: Doc = this.targetDoc;
+        const lastFrame = Cast(targetDoc?.lastFrame, "number", null);
+        const curFrame = NumCast(targetDoc?._currentFrame);
+        let internalFrames: boolean = false;
+        if (activeItem.presProgressivize || activeItem.zoomProgressivize || targetDoc.scrollProgressivize) internalFrames = true;
+        if (internalFrames && lastFrame !== undefined && curFrame < lastFrame) {
+            // Case 1: There are still other frames and should go through all frames before going to next slide
+            this.nextInternalFrame(targetDoc, activeItem);
+        } else if (this.childDocs[this.itemIndex + 1] !== undefined) {
+            // Case 2: No more frames in current doc and next slide is defined, therefore move to next slide 
+            this.nextSlide(activeNext);
+        } else if (this.childDocs[this.itemIndex + 1] === undefined && (this.layoutDoc.presLoop || this.layoutDoc.presStatus === PresStatus.Edit)) {
+            // Case 3: Last slide and presLoop is toggled ON or it is in Edit mode
+            this.gotoDocument(0, this.activeItem);
+        }
+    }
+
+    // Called when the user activates 'back' - to move to the previous part of the pres. trail
+    @action
+    back = () => {
+        const activeItem: Doc = this.activeItem;
+        const targetDoc: Doc = this.targetDoc;
+        const prevItem = Cast(this.childDocs[Math.max(0, this.itemIndex - 1)], Doc, null);
+        const prevTargetDoc = Cast(prevItem.presentationTargetDoc, Doc, null);
+        const lastFrame = Cast(targetDoc.lastFrame, "number", null);
+        const curFrame = NumCast(targetDoc._currentFrame);
+        let prevSelected = this.itemIndex;
+        // Functionality for group with up
+        let didZoom = activeItem.presMovement;
+        for (; !didZoom && prevSelected > 0 && this.childDocs[prevSelected].groupButton; prevSelected--) {
+            didZoom = this.childDocs[prevSelected].presMovement;
+        }
+        if (lastFrame !== undefined && curFrame >= 1) {
+            // Case 1: There are still other frames and should go through all frames before going to previous slide
+            this.prevKeyframe(targetDoc, activeItem);
+        } else if (activeItem && this.childDocs[this.itemIndex - 1] !== undefined) {
+            // Case 2: There are no other frames so it should go to the previous slide
+            prevSelected = Math.max(0, prevSelected - 1);
+            this.gotoDocument(prevSelected, activeItem);
+            if (NumCast(prevTargetDoc.lastFrame) > 0) prevTargetDoc._currentFrame = NumCast(prevTargetDoc.lastFrame);
+        } else if (this.childDocs[this.itemIndex - 1] === undefined && this.layoutDoc.presLoop) {
+            // Case 3: Pres loop is on so it should go to the last slide
+            this.gotoDocument(this.childDocs.length - 1, activeItem);
+        }
+    }
+
+    //The function that is called when a document is clicked or reached through next or back.
+    //it'll also execute the necessary actions if presentation is playing.
+    public gotoDocument = action((index: number, from?: Doc, group?: boolean) => {
+        Doc.UnBrushAllDocs();
+        if (index >= 0 && index < this.childDocs.length) {
+            this.rootDoc._itemIndex = index;
+            const activeItem: Doc = this.activeItem;
+            const targetDoc: Doc = this.targetDoc;
+            if (from?.mediaStopTriggerList && this.layoutDoc.presStatus !== PresStatus.Edit) {
+                DocListCast(from.mediaStopTriggerList).forEach(this.stopTempMedia);
+            }
+            if (from?.mediaStop === "auto" && this.layoutDoc.presStatus !== PresStatus.Edit) {
+                this.stopTempMedia(from.presentationTargetDoc);
+            }
+            // If next slide is audio / video 'Play automatically' then the next slide should be played
+            if (this.layoutDoc.presStatus !== PresStatus.Edit && (targetDoc.type === DocumentType.AUDIO || targetDoc.type === DocumentType.VID) && (activeItem.mediaStart === "auto")) {
+                this.startTempMedia(targetDoc, activeItem);
+            }
+            if (targetDoc) {
+                targetDoc && runInAction(() => {
+                    if (activeItem.presMovement === PresMovement.Jump) targetDoc.focusSpeed = 0;
+                    else targetDoc.focusSpeed = activeItem.presTransition ? activeItem.presTransition : 500;
+                });
+                setTimeout(() => targetDoc.focusSpeed = 500, this.activeItem.presTransition ? NumCast(this.activeItem.presTransition) + 10 : 510);
+            }
+            if (targetDoc?.lastFrame !== undefined) {
+                targetDoc._currentFrame = 0;
+            }
+            if (!group) this._selectedArray.clear();
+            this.childDocs[index] && this._selectedArray.set(this.childDocs[index], undefined); //Update selected array
+            if (this.layoutDoc._viewType === "stacking" && !group) this.navigateToElement(this.childDocs[index]); //Handles movement to element only when presTrail is list
+            this.onHideDocument(); //Handles hide after/before
+        }
+    });
+
+    _navTimer!: NodeJS.Timeout;
+    navigateToView = (targetDoc: Doc, activeItem: Doc) => {
+        clearTimeout(this._navTimer);
+        const bestTarget = DocumentManager.Instance.getFirstDocumentView(targetDoc)?.props.Document;
+        bestTarget && runInAction(() => {
+            if (bestTarget.type === DocumentType.PDF || bestTarget.type === DocumentType.WEB || bestTarget.type === DocumentType.RTF || bestTarget._viewType === CollectionViewType.Stacking) {
+                bestTarget._viewTransition = activeItem.presTransition ? `transform ${activeItem.presTransition}ms` : 'all 0.5s';
+                bestTarget._scrollTop = activeItem.presPinViewScroll;
+            } else if (bestTarget.type === DocumentType.COMPARISON) {
+                bestTarget._clipWidth = activeItem.presPinClipWidth;
+            } else if (bestTarget.type === DocumentType.VID) {
+                bestTarget._currentTimecode = activeItem.presPinTimecode;
+            } else {
+                bestTarget._viewTransition = activeItem.presTransition ? `transform ${activeItem.presTransition}ms` : 'all 0.5s';
+                bestTarget._panX = activeItem.presPinViewX;
+                bestTarget._panY = activeItem.presPinViewY;
+                bestTarget._viewScale = activeItem.presPinViewScale;
+            }
+            this._navTimer = setTimeout(() => bestTarget._viewTransition = undefined, activeItem.presTransition ? NumCast(activeItem.presTransition) + 10 : 510);
+        });
+    }
+
+    /**
+     * This method makes sure that cursor navigates to the element that
+     * has the option open and last in the group. 
+     * Design choice: If the next document is not in presCollection or 
+     * presCollection itself then if there is a presCollection it will add
+     * a new tab. If presCollection is undefined it will open the document
+     * on the right. 
+     */
+    navigateToElement = async (curDoc: Doc) => {
+        const activeItem: Doc = this.activeItem;
+        const targetDoc: Doc = this.targetDoc;
+        const srcContext = Cast(targetDoc.context, Doc, null);
+        const presCollection = Cast(this.layoutDoc.presCollection, Doc, null);
+        const collectionDocView = presCollection ? DocumentManager.Instance.getDocumentView(presCollection) : undefined;
+        const includesDoc: boolean = DocListCast(presCollection?.data).includes(targetDoc);
+        const tab = Array.from(CollectionDockingView.Instance.tabMap).find(tab => tab.DashDoc === srcContext);
+        this.turnOffEdit();
+        // Handles the setting of presCollection
+        if (includesDoc) {
+            //Case 1: Pres collection should not change as it is already the same
+        } else if (tab !== undefined) {
+            // Case 2: Pres collection should update
+            this.layoutDoc.presCollection = srcContext;
+        }
+        const presStatus = this.rootDoc.presStatus;
+        const selViewCache = Array.from(this._selectedArray.keys());
+        const dragViewCache = Array.from(this._dragArray);
+        const eleViewCache = Array.from(this._eleArray);
+        const self = this;
+        const resetSelection = action(() => {
+            const presDocView = DocumentManager.Instance.getDocumentView(self.rootDoc);
+            if (presDocView) SelectionManager.SelectView(presDocView, false);
+            self.rootDoc.presStatus = presStatus;
+            self._selectedArray.clear();
+            selViewCache.forEach(doc => self._selectedArray.set(doc, undefined));
+            self._dragArray.splice(0, self._dragArray.length, ...dragViewCache);
+            self._eleArray.splice(0, self._eleArray.length, ...eleViewCache);
+        });
+        const openInTab = (doc: Doc, finished?: () => void) => {
+            collectionDocView ? collectionDocView.props.addDocTab(doc, "") : this.props.addDocTab(doc, ":left");
+            this.layoutDoc.presCollection = targetDoc;
+            // this still needs some fixing
+            setTimeout(resetSelection, 500);
+            if (doc !== targetDoc) {
+                setTimeout(finished ?? emptyFunction, 100); /// give it some time to create the targetDoc if we're opening up its context
+            } else {
+                finished?.();
+            }
+        };
+        // If openDocument is selected then it should open the document for the user
+        if (activeItem.openDocument) {
+            LightboxView.SetLightboxDoc(targetDoc);
+        } else if (curDoc.presMovement === PresMovement.Pan && targetDoc) {
+            LightboxView.SetLightboxDoc(undefined);
+            await DocumentManager.Instance.jumpToDocument(targetDoc, false, openInTab, srcContext, undefined, undefined, undefined, includesDoc || tab ? undefined : resetSelection); // documents open in new tab instead of on right
+        } else if ((curDoc.presMovement === PresMovement.Zoom || curDoc.presMovement === PresMovement.Jump) && targetDoc) {
+            LightboxView.SetLightboxDoc(undefined);
+            //awaiting jump so that new scale can be found, since jumping is async     
+            await DocumentManager.Instance.jumpToDocument(targetDoc, true, openInTab, srcContext, undefined, undefined, undefined, includesDoc || tab ? undefined : resetSelection); // documents open in new tab instead of on right    
+        }
+        // After navigating to the document, if it is added as a presPinView then it will
+        // adjust the pan and scale to that of the pinView when it was added.
+        if (activeItem.presPinView) {
+            // if targetDoc is not displayed but one of its aliases is, then we need to modify that alias, not the original target
+            this.navigateToView(targetDoc, activeItem);
+        }
+        // TODO: Add progressivize for navigating web (storing websites for given frames)
+
+    }
+
+    /**
+     * Uses the viewfinder to progressivize through the different views of a single collection.
+     * @param presTargetDoc: document for which internal zoom is used
+     */
+    zoomProgressivizeNext = (activeItem: Doc) => {
+        const targetDoc: Doc = this.targetDoc;
+        const srcContext = Cast(targetDoc?.context, Doc, null);
+        const docView = DocumentManager.Instance.getDocumentView(targetDoc);
+        const vfLeft = this.checkList(targetDoc, activeItem["viewfinder-left-indexed"]);
+        const vfWidth = this.checkList(targetDoc, activeItem["viewfinder-width-indexed"]);
+        const vfTop = this.checkList(targetDoc, activeItem["viewfinder-top-indexed"]);
+        const vfHeight = this.checkList(targetDoc, activeItem["viewfinder-height-indexed"]);
+        // Case 1: document that is not a Golden Layout tab
+        if (srcContext) {
+            const srcDocView = DocumentManager.Instance.getDocumentView(srcContext);
+            if (srcDocView) {
+                const layoutdoc = Doc.Layout(targetDoc);
+                const panelWidth: number = srcDocView.props.PanelWidth();
+                const panelHeight: number = srcDocView.props.PanelHeight();
+                const newPanX = NumCast(targetDoc.x) + NumCast(layoutdoc._width) / 2;
+                const newPanY = NumCast(targetDoc.y) + NumCast(layoutdoc._height) / 2;
+                const newScale = 0.9 * Math.min(Number(panelWidth) / vfWidth, Number(panelHeight) / vfHeight);
+                srcContext._panX = newPanX + (vfLeft + (vfWidth / 2));
+                srcContext._panY = newPanY + (vfTop + (vfHeight / 2));
+                srcContext._viewScale = newScale;
+            }
+        }
+        // Case 2: document is the containing collection
+        if (docView && !srcContext) {
+            const panelWidth: number = docView.props.PanelWidth();
+            const panelHeight: number = docView.props.PanelHeight();
+            const newScale = 0.9 * Math.min(Number(panelWidth) / vfWidth, Number(panelHeight) / vfHeight);
+            targetDoc._panX = vfLeft + (vfWidth / 2);
+            targetDoc._panY = vfTop + (vfWidth / 2);
+            targetDoc._viewScale = newScale;
+        }
+        const resize = document.getElementById('resizable');
+        if (resize) {
+            resize.style.width = vfWidth + 'px';
+            resize.style.height = vfHeight + 'px';
+            resize.style.top = vfTop + 'px';
+            resize.style.left = vfLeft + 'px';
+        }
+    }
+
+    /**
+     * For 'Hide Before' and 'Hide After' buttons making sure that
+     * they are hidden each time the presentation is updated.
+     */
+    @action
+    onHideDocument = () => {
+        this.childDocs.forEach((doc, index) => {
+            const curDoc = Cast(doc, Doc, null);
+            const tagDoc = Cast(curDoc.presentationTargetDoc, Doc, null);
+            if (tagDoc) tagDoc.opacity = 1;
+            const itemIndexes: number[] = this.getAllIndexes(this.tagDocs, tagDoc);
+            const curInd: number = itemIndexes.indexOf(index);
+            if (tagDoc === this.layoutDoc.presCollection) { tagDoc.opacity = 1; }
+            else {
+                if (itemIndexes.length > 1 && curDoc.presHideBefore && curInd !== 0) { }
+                else if (curDoc.presHideBefore) {
+                    if (index > this.itemIndex) {
+                        tagDoc.opacity = 0;
+                    } else if (!curDoc.presHideAfter) {
+                        tagDoc.opacity = 1;
+                    }
+                }
+                if (itemIndexes.length > 1 && curDoc.presHideAfter && curInd !== (itemIndexes.length - 1)) { }
+                else if (curDoc.presHideAfter) {
+                    if (index < this.itemIndex) {
+                        tagDoc.opacity = 0;
+                    } else if (!curDoc.presHideBefore) {
+                        tagDoc.opacity = 1;
+                    }
+                }
+            }
+        });
+    }
+
+
+
+    //The function that starts or resets presentaton functionally, depending on presStatus of the layoutDoc
+    @action
+    startAutoPres = (startSlide: number) => {
+        this.updateCurrentPresentation();
+        let activeItem: Doc = this.activeItem;
+        let targetDoc: Doc = this.targetDoc;
+        let duration = NumCast(activeItem.presDuration) + NumCast(activeItem.presTransition);
+        const timer = (ms: number) => new Promise(res => this._presTimer = setTimeout(res, ms));
+        const load = async () => { // Wrap the loop into an async function for this to work
+            for (var i = startSlide; i < this.childDocs.length; i++) {
+                activeItem = Cast(this.childDocs[this.itemIndex], Doc, null);
+                targetDoc = Cast(activeItem.presentationTargetDoc, Doc, null);
+                duration = NumCast(activeItem.presDuration) + NumCast(activeItem.presTransition);
+                if (duration < 100) { duration = 2500; }
+                if (NumCast(targetDoc.lastFrame) > 0) {
+                    for (var f = 0; f < NumCast(targetDoc.lastFrame); f++) {
+                        await timer(duration / NumCast(targetDoc.lastFrame));
+                        this.next();
+                    }
+                }
+
+                await timer(duration); this.next(); // then the created Promise can be awaited
+                if (i === this.childDocs.length - 1) {
+                    setTimeout(() => {
+                        clearTimeout(this._presTimer);
+                        if (this.layoutDoc.presStatus === 'auto' && !this.layoutDoc.presLoop) this.layoutDoc.presStatus = PresStatus.Manual;
+                        else if (this.layoutDoc.presLoop) this.startAutoPres(0);
+                    }, duration);
+                }
+            }
+        };
+        this.layoutDoc.presStatus = PresStatus.Autoplay;
+        this.startPresentation(startSlide);
+        this.gotoDocument(startSlide, activeItem);
+        load();
+    }
+
+    @action
+    pauseAutoPres = () => {
+        if (this.layoutDoc.presStatus === PresStatus.Autoplay) {
+            if (this._presTimer) clearTimeout(this._presTimer);
+            this.layoutDoc.presStatus = PresStatus.Manual;
+            this.layoutDoc.presLoop = false;
+            this.childDocs.forEach(this.stopTempMedia);
+        }
+    }
+
+    //The function that resets the presentation by removing every action done by it. It also
+    //stops the presentaton.
+    resetPresentation = () => {
+        this.rootDoc._itemIndex = 0;
+        this.childDocs.map(doc => Cast(doc.presentationTargetDoc, Doc, null)).filter(doc => doc instanceof Doc).forEach(doc => {
+            try {
+                doc.opacity = 1;
+            } catch (e) {
+                console.log("Reset presentation error: ", e);
+            }
+        });
+    }
+
+    @action togglePath = (srcContext: Doc, off?: boolean) => {
+        if (off) {
+            this._pathBoolean = false;
+            srcContext.presPathView = false;
+        } else {
+            runInAction(() => this._pathBoolean = !this._pathBoolean);
+            srcContext.presPathView = this._pathBoolean;
+        }
+    }
+
+    @action toggleExpandMode = () => {
+        runInAction(() => this._expandBoolean = !this._expandBoolean);
+        this.rootDoc.expandBoolean = this._expandBoolean;
+        this.childDocs.forEach((doc) => {
+            doc.presExpandInlineButton = this._expandBoolean;
+        });
+    }
+
+    /**
+     * The function that starts the presentation at the given index, also checking if actions should be applied
+     * directly at start.
+     * @param startIndex: index that the presentation will start at
+     */
+    startPresentation = (startIndex: number) => {
+        this.updateCurrentPresentation();
+        this.childDocs.map(doc => {
+            const tagDoc = doc.presentationTargetDoc as Doc;
+            if (doc.presHideBefore && this.childDocs.indexOf(doc) > startIndex) {
+                tagDoc.opacity = 0;
+            }
+            if (doc.presHideAfter && this.childDocs.indexOf(doc) < startIndex) {
+                tagDoc.opacity = 0;
+            }
+        });
+    }
+
+    /**
+     * The method called to open the presentation as a minimized view
+     */
+    @action
+    updateMinimize = () => {
+        const docView = DocumentManager.Instance.getDocumentView(this.layoutDoc);
+        if (CurrentUserUtils.OverlayDocs.includes(this.layoutDoc)) {
+            console.log("case 1");
+            this.layoutDoc.presStatus = PresStatus.Edit;
+            Doc.RemoveDocFromList((Doc.UserDoc().myOverlayDocs as Doc), undefined, this.rootDoc);
+            CollectionDockingView.AddSplit(this.rootDoc, "right");
+        } else if (this.layoutDoc.context && docView) {
+            console.log("case 2");
+            this.layoutDoc.presStatus = PresStatus.Edit;
+            clearTimeout(this._presTimer);
+            const pt = this.props.ScreenToLocalTransform().inverse().transformPoint(0, 0);
+            this.rootDoc.x = pt[0] + (this.props.PanelWidth() - 250);
+            this.rootDoc.y = pt[1] + 10;
+            this.rootDoc._height = 35;
+            this.rootDoc._width = 250;
+            docView.props.removeDocument?.(this.layoutDoc);
+            Doc.AddDocToList((Doc.UserDoc().myOverlayDocs as Doc), undefined, this.rootDoc);
+        } else {
+            console.log("case 3");
+            // TODO glr: fix this case
+        }
+    }
+
+    /**
+     * Called when the user changes the view type
+     * Either 'List' (stacking) or 'Slides' (carousel)
+     */
+    // @undoBatch
+    viewChanged = action((e: React.ChangeEvent) => {
+        //@ts-ignore
+        const viewType = e.target.selectedOptions[0].value as CollectionViewType;
+        // pivot field may be set by the user in timeline view (or some other way) -- need to reset it here
+        viewType === CollectionViewType.Stacking && (this.rootDoc._pivotField = undefined);
+        this.rootDoc._viewType = viewType;
+        if (viewType === CollectionViewType.Stacking) this.layoutDoc._gridGap = 0;
+    });
+
+    /**
+     * Called when the user changes the view type
+     * Either 'List' (stacking) or 'Slides' (carousel)
+     */
+    // @undoBatch
+    mediaStopChanged = action((e: React.ChangeEvent) => {
+        const activeItem: Doc = this.activeItem;
+        //@ts-ignore
+        const stopDoc = e.target.selectedOptions[0].value as string;
+        const stopDocIndex: number = Number(stopDoc[0]);
+        activeItem.mediaStopDoc = stopDocIndex;
+        if (this.childDocs[stopDocIndex - 1].mediaStopTriggerList) {
+            const list = DocListCast(this.childDocs[stopDocIndex - 1].mediaStopTriggerList);
+            list.push(activeItem);
+            // this.childDocs[stopDocIndex - 1].mediaStopTriggerList = list;
+            console.log(list);
+        } else {
+            this.childDocs[stopDocIndex - 1].mediaStopTriggerList = new List<Doc>();
+            const list = DocListCast(this.childDocs[stopDocIndex - 1].mediaStopTriggerList);
+            list.push(activeItem);
+            // this.childDocs[stopDocIndex - 1].mediaStopTriggerList = list;
+            console.log(list);
+        }
+    });
+
+
+    setMovementName = action((movement: any, activeItem: Doc): string => {
+        let output: string = 'none';
+        switch (movement) {
+            case PresMovement.Zoom: output = 'Pan & Zoom'; break; //Pan and zoom
+            case PresMovement.Pan: output = 'Pan'; break; //Pan
+            case PresMovement.Jump: output = 'Jump cut'; break; //Jump Cut
+            case PresMovement.None: output = 'None'; break; //None
+            default: output = 'Zoom'; activeItem.presMovement = 'zoom'; break; //default set as zoom
+        }
+        return output;
+    });
+
+    whenChildContentsActiveChanged = action((isActive: boolean) => this.props.whenChildContentsActiveChanged(this._isChildActive = isActive));
+    // For dragging documents into the presentation trail
+    addDocumentFilter = (docs: Doc[]) => {
+        docs.forEach((doc, i) => {
+            if (doc.presentationTargetDoc) return true;
+            if (doc.type === DocumentType.LABEL) {
+                const audio = Cast(doc.annotationOn, Doc, null);
+                if (audio) {
+                    audio.mediaStart = "manual";
+                    audio.mediaStop = "manual";
+                    audio.presStartTime = NumCast(doc._timecodeToShow /* audioStart */, NumCast(doc._timecodeToShow /* videoStart */));
+                    audio.presEndTime = NumCast(doc._timecodeToHide /* audioEnd */, NumCast(doc._timecodeToHide /* videoEnd */));
+                    audio.presDuration = audio.presStartTime - audio.presEndTime;
+                    TabDocView.PinDoc(audio, { audioRange: true });
+                    setTimeout(() => this.removeDocument(doc), 0);
+                    return false;
+                }
+            } else {
+                if (!doc.aliasOf) {
+                    const original = Doc.MakeAlias(doc);
+                    TabDocView.PinDoc(original);
+                    setTimeout(() => this.removeDocument(doc), 0);
+                    return false;
+                } else {
+                    if (!doc.presentationTargetDoc) doc.title = doc.title + " - Slide";
+                    doc.aliasOf instanceof Doc && (doc.presentationTargetDoc = doc.aliasOf);
+                    doc.presMovement = PresMovement.Zoom;
+                    if (this._expandBoolean) doc.presExpandInlineButton = true;
+                }
+            }
+        });
+        return true;
+    }
+    childLayoutTemplate = () => this.rootDoc._viewType !== CollectionViewType.Stacking ? undefined : this.presElement;
+    removeDocument = (doc: Doc) => Doc.RemoveDocFromList(this.dataDoc, this.fieldKey, doc);
+    getTransform = () => this.props.ScreenToLocalTransform().translate(-5, -65);// listBox padding-left and pres-box-cont minHeight
+    panelHeight = () => this.props.PanelHeight() - 40;
+    isContentActive = (outsideReaction?: boolean) => ((CurrentUserUtils.SelectedTool === InkTool.None && this.props.layerProvider?.(this.layoutDoc) !== false) &&
+        (this.layoutDoc.forceActive || this.props.isSelected(outsideReaction) || this._isChildActive || this.props.renderDepth === 0) ? true : false)
+
+    /**
+     * For sorting the array so that the order is maintained when it is dropped.
+     */
+    @action
+    sortArray = (): Doc[] => {
+        return this.childDocs.filter(doc => this._selectedArray.has(doc));
+    }
+
+    /**
+     * Method to get the list of selected items in the order in which they have been selected
+     */
+    @computed get listOfSelected() {
+        const list = Array.from(this._selectedArray.keys()).map((doc: Doc, index: any) => {
+            const curDoc = Cast(doc, Doc, null);
+            const tagDoc = Cast(curDoc.presentationTargetDoc, Doc, null);
+            if (curDoc && curDoc === this.activeItem) return <div key={index} className="selectedList-items"><b>{index + 1}.  {curDoc.title}</b></div>;
+            else if (tagDoc) return <div key={index} className="selectedList-items">{index + 1}.  {curDoc.title}</div>;
+            else if (curDoc) return <div key={index} className="selectedList-items">{index + 1}.  {curDoc.title}</div>;
+        });
+        return list;
+    }
+
+    @action
+    selectPres = () => {
+        const presDocView = DocumentManager.Instance.getDocumentView(this.rootDoc);
+        presDocView && SelectionManager.SelectView(presDocView, false);
+    }
+
+    //Regular click
+    @action
+    selectElement = async (doc: Doc) => {
+        const context = Cast(doc.context, Doc, null);
+        this.gotoDocument(this.childDocs.indexOf(doc), this.activeItem);
+        if (doc.presPinView || doc.presentationTargetDoc === this.layoutDoc.presCollection) setTimeout(() => this.updateCurrentPresentation(context), 0);
+        else this.updateCurrentPresentation(context);
+
+        if (this.activeItem.setPosition &&
+            this.activeItem.y !== undefined &&
+            this.activeItem.x !== undefined &&
+            this.targetDoc.x !== undefined &&
+            this.targetDoc.y !== undefined) {
+            const timer = (ms: number) => new Promise(res => this._presTimer = setTimeout(res, ms));
+            const time = 10;
+            const ydiff = NumCast(this.activeItem.y) - NumCast(this.targetDoc.y);
+            const xdiff = NumCast(this.activeItem.x) - NumCast(this.targetDoc.x);
+
+            for (let i = 0; i < time; i++) {
+                this.targetDoc.x = NumCast(this.targetDoc.x) + xdiff / time;
+                this.targetDoc.y = NumCast(this.targetDoc.y) + ydiff / time;
+                await timer(0.1);
+            }
+        }
+    }
+
+    //Command click
+    @action
+    multiSelect = (doc: Doc, ref: HTMLElement, drag: HTMLElement) => {
+        if (!this._selectedArray.has(doc)) {
+            this._selectedArray.set(doc, undefined);
+            this._eleArray.push(ref);
+            this._dragArray.push(drag);
+        } else {
+            this._selectedArray.delete(doc);
+            this.removeFromArray(this._eleArray, doc);
+            this.removeFromArray(this._dragArray, doc);
+        }
+        this.selectPres();
+    }
+
+    removeFromArray = (arr: any[], val: any) => {
+        const index: number = arr.indexOf(val);
+        const ret: any[] = arr.splice(index, 1);
+        arr = ret;
+    }
+
+    //Shift click
+    @action
+    shiftSelect = (doc: Doc, ref: HTMLElement, drag: HTMLElement) => {
+        this._selectedArray.clear();
+        // const activeItem = Cast(this.childDocs[this.itemIndex], Doc, null);
+        if (this.activeItem) {
+            for (let i = Math.min(this.itemIndex, this.childDocs.indexOf(doc)); i <= Math.max(this.itemIndex, this.childDocs.indexOf(doc)); i++) {
+                this._selectedArray.set(this.childDocs[i], undefined);
+                this._eleArray.push(ref);
+                this._dragArray.push(drag);
+            }
+        }
+        this.selectPres();
+    }
+
+    //regular click
+    @action
+    regularSelect = (doc: Doc, ref: HTMLElement, drag: HTMLElement, focus: boolean) => {
+        this._selectedArray.clear();
+        this._selectedArray.set(doc, undefined);
+        this._eleArray.splice(0, this._eleArray.length, ref);
+        this._dragArray.splice(0, this._dragArray.length, drag);
+        focus && this.selectElement(doc);
+        this.selectPres();
+    }
+
+    modifierSelect = (doc: Doc, ref: HTMLElement, drag: HTMLElement, focus: boolean, cmdClick: boolean, shiftClick: boolean) => {
+        if (cmdClick) this.multiSelect(doc, ref, drag);
+        else if (shiftClick) this.shiftSelect(doc, ref, drag);
+        else this.regularSelect(doc, ref, drag, focus);
+    }
+
+    static keyEventsWrapper = (e: KeyboardEvent) => {
+        PresBox.Instance.keyEvents(e);
+    }
+
+    // Key for when the presentaiton is active
+    @action
+    keyEvents = (e: KeyboardEvent) => {
+        if (e.target instanceof HTMLInputElement) return;
+        let handled = false;
+        const anchorNode = document.activeElement as HTMLDivElement;
+        if (anchorNode && anchorNode.className?.includes("lm_title")) return;
+        switch (e.key) {
+            case "Backspace":
+                if (this.layoutDoc.presStatus === "edit") {
+                    undoBatch(action(() => {
+                        for (const doc of Array.from(this._selectedArray.keys())) {
+                            this.removeDocument(doc);
+                        }
+                        this._selectedArray.clear();
+                        this._eleArray.length = 0;
+                        this._dragArray.length = 0;
+                    }))();
+                    handled = true;
+                }
+                break;
+            case "Escape":
+                if (CurrentUserUtils.OverlayDocs.includes(this.layoutDoc)) { this.updateMinimize(); }
+                else if (this.layoutDoc.presStatus === "edit") { this._selectedArray.clear(); this._eleArray.length = this._dragArray.length = 0; }
+                else this.layoutDoc.presStatus = "edit";
+                if (this._presTimer) clearTimeout(this._presTimer);
+                handled = true;
+                break;
+            case "Down": case "ArrowDown":
+            case "Right": case "ArrowRight":
+                if (e.shiftKey && this.itemIndex < this.childDocs.length - 1) { // TODO: update to work properly
+                    this.rootDoc._itemIndex = NumCast(this.rootDoc._itemIndex) + 1;
+                    this._selectedArray.set(this.childDocs[this.rootDoc._itemIndex], undefined);
+                } else {
+                    this.next();
+                    if (this._presTimer) { clearTimeout(this._presTimer); this.layoutDoc.presStatus = PresStatus.Manual; }
+                }
+                handled = true;
+                break;
+            case "Up": case "ArrowUp":
+            case "Left": case "ArrowLeft":
+                if (e.shiftKey && this.itemIndex !== 0) { // TODO: update to work properly
+                    this.rootDoc._itemIndex = NumCast(this.rootDoc._itemIndex) - 1;
+                    this._selectedArray.set(this.childDocs[this.rootDoc._itemIndex], undefined);
+                } else {
+                    this.back();
+                    if (this._presTimer) { clearTimeout(this._presTimer); this.layoutDoc.presStatus = PresStatus.Manual; }
+                }
+                handled = true;
+                break;
+            case "Spacebar": case " ":
+                if (this.layoutDoc.presStatus === PresStatus.Manual) this.startAutoPres(this.itemIndex);
+                else if (this.layoutDoc.presStatus === PresStatus.Autoplay) if (this._presTimer) clearTimeout(this._presTimer);
+                handled = true;
+                break;
+            case "a":
+                if ((e.metaKey || e.altKey) && this.layoutDoc.presStatus === "edit") {
+                    this._selectedArray.clear();
+                    this.childDocs.forEach(doc => this._selectedArray.set(doc, undefined));
+                    handled = true;
+                }
+            default:
+                break;
+        }
+        if (handled) {
+            e.stopPropagation();
+            e.preventDefault();
+        }
+    }
+
+    /**
+     * 
+     */
+    @action
+    viewPaths = () => {
+        const srcContext = Cast(this.rootDoc.presCollection, Doc, null);
+        if (srcContext) {
+            this.togglePath(srcContext);
+        }
+    }
+
+    getAllIndexes = (arr: Doc[], val: Doc): number[] => {
+        const indexes = [];
+        for (let i = 0; i < arr.length; i++) {
+            arr[i] === val && indexes.push(i);
+        }
+        return indexes;
+    }
+
+    // Adds the index in the pres path graphically
+    @computed get order() {
+        const order: JSX.Element[] = [];
+        const docs: Doc[] = [];
+        const presCollection = Cast(this.rootDoc.presCollection, Doc, null);
+        const dv = DocumentManager.Instance.getDocumentView(presCollection);
+        this.childDocs.filter(doc => Cast(doc.presentationTargetDoc, Doc, null)).forEach((doc, index) => {
+            const tagDoc = Cast(doc.presentationTargetDoc, Doc, null);
+            const srcContext = Cast(tagDoc.context, Doc, null);
+            const width = NumCast(tagDoc._width) / 10;
+            const height = Math.max(NumCast(tagDoc._height) / 10, 15);
+            const edge = Math.max(width, height);
+            const fontSize = edge * 0.8;
+            const gap = 2;
+            if (presCollection === srcContext) {
+                // Case A: Document is contained within the collection
+                if (docs.includes(tagDoc)) {
+                    const prevOccurances: number = this.getAllIndexes(docs, tagDoc).length;
+                    docs.push(tagDoc);
+                    order.push(
+                        <div className="pathOrder"
+                            key={tagDoc.id + 'pres' + index}
+                            style={{ top: NumCast(tagDoc.y) + (prevOccurances * (edge + gap) - (edge / 2)), left: NumCast(tagDoc.x) - (edge / 2), width: edge, height: edge, fontSize: fontSize }}
+                            onClick={() => this.selectElement(doc)}>
+                            <div className="pathOrder-frame">{index + 1}</div>
+                        </div>);
+                } else {
+                    docs.push(tagDoc);
+                    order.push(
+                        <div className="pathOrder"
+                            key={tagDoc.id + 'pres' + index}
+                            style={{ top: NumCast(tagDoc.y) - (edge / 2), left: NumCast(tagDoc.x) - (edge / 2), width: edge, height: edge, fontSize: fontSize }}
+                            onClick={() => this.selectElement(doc)}>
+                            <div className="pathOrder-frame">{index + 1}</div>
+                        </div>);
+                }
+            } else if (doc.presPinView && presCollection === tagDoc && dv) {
+                // Case B: Document is presPinView and is presCollection
+                const scale: number = 1 / NumCast(doc.presPinViewScale);
+                const height: number = dv.props.PanelHeight() * scale;
+                const width: number = dv.props.PanelWidth() * scale;
+                const indWidth = width / 10;
+                const indHeight = Math.max(height / 10, 15);
+                const indEdge = Math.max(indWidth, indHeight);
+                const indFontSize = indEdge * 0.8;
+                const xLoc: number = NumCast(doc.presPinViewX) - (width / 2);
+                const yLoc: number = NumCast(doc.presPinViewY) - (height / 2);
+                docs.push(tagDoc);
+                order.push(
+                    <>
+                        <div className="pathOrder"
+                            key={tagDoc.id + 'pres' + index}
+                            style={{ top: yLoc - (indEdge / 2), left: xLoc - (indEdge / 2), width: indEdge, height: indEdge, fontSize: indFontSize }}
+                            onClick={() => this.selectElement(doc)}
+                        >
+                            <div className="pathOrder-frame">{index + 1}</div>
+                        </div>
+                        <div className="pathOrder-presPinView" style={{ top: yLoc, left: xLoc, width: width, height: height, borderWidth: indEdge / 10 }}></div>
+                    </>);
+            }
+        });
+        return order;
+    }
+
+    /**
+     * Method called for viewing paths which adds a single line with
+     * points at the center of each document added.
+     * Design choice: When this is called it sets _fitToBox as true so the
+     * user can have an overview of all of the documents in the collection.
+     * (Design needed for when documents in presentation trail are in another
+     * collection)
+     */
+    @computed get paths() {
+        let pathPoints = "";
+        const presCollection = Cast(this.rootDoc.presCollection, Doc, null);
+        this.childDocs.forEach((doc, index) => {
+            const tagDoc = Cast(doc.presentationTargetDoc, Doc, null);
+            const srcContext = Cast(tagDoc?.context, Doc, null);
+            if (tagDoc && presCollection === srcContext) {
+                const n1x = NumCast(tagDoc.x) + (NumCast(tagDoc._width) / 2);
+                const n1y = NumCast(tagDoc.y) + (NumCast(tagDoc._height) / 2);
+                if (index = 0) pathPoints = n1x + "," + n1y;
+                else pathPoints = pathPoints + " " + n1x + "," + n1y;
+            } else if (doc.presPinView && presCollection === tagDoc) {
+                const n1x = NumCast(doc.presPinViewX);
+                const n1y = NumCast(doc.presPinViewY);
+                if (index = 0) pathPoints = n1x + "," + n1y;
+                else pathPoints = pathPoints + " " + n1x + "," + n1y;
+            }
+        });
+        return (<polyline
+            points={pathPoints}
+            style={{
+                opacity: 1,
+                stroke: "#69a6db",
+                strokeWidth: 5,
+                strokeDasharray: '10 5',
+                boxShadow: '0px 4px 4px rgba(0, 0, 0, 0.25)',
+            }}
+            fill="none"
+            markerStart="url(#markerArrow)"
+            markerMid="url(#markerSquare)"
+            markerEnd="url(#markerSquareFilled)"
+        />);
+    }
+
+    // Converts seconds to ms and updates presTransition
+    setTransitionTime = (number: String, change?: number) => {
+        let timeInMS = Number(number) * 1000;
+        if (change) timeInMS += change;
+        if (timeInMS < 100) timeInMS = 100;
+        if (timeInMS > 10000) timeInMS = 10000;
+        Array.from(this._selectedArray.keys()).forEach((doc) => doc.presTransition = timeInMS);
+    }
+
+    // Converts seconds to ms and updates presDuration
+    setDurationTime = (number: String, change?: number) => {
+        let timeInMS = Number(number) * 1000;
+        if (change) timeInMS += change;
+        if (timeInMS < 100) timeInMS = 100;
+        if (timeInMS > 20000) timeInMS = 20000;
+        Array.from(this._selectedArray.keys()).forEach((doc) => doc.presDuration = timeInMS);
+    }
+
+    /**
+     * When the movement dropdown is changes
+     */
+    @undoBatch
+    updateMovement = action((movement: any, all?: boolean) => {
+        const array: any[] = all ? this.childDocs : Array.from(this._selectedArray.keys());
+        array.forEach((doc) => {
+            switch (movement) {
+                case PresMovement.Zoom: //Pan and zoom
+                    doc.presMovement = PresMovement.Zoom;
+                    break;
+                case PresMovement.Pan: //Pan
+                    doc.presMovement = PresMovement.Pan;
+                    break;
+                case PresMovement.Jump: //Jump Cut
+                    doc.presJump = true;
+                    doc.presMovement = PresMovement.Jump;
+                    break;
+                case PresMovement.None: default:
+                    doc.presMovement = PresMovement.None;
+                    break;
+            }
+        });
+    });
+
+    @undoBatch
+    @action
+    updateHideBefore = (activeItem: Doc) => {
+        activeItem.presHideBefore = !activeItem.presHideBefore;
+        Array.from(this._selectedArray.keys()).forEach((doc) => doc.presHideBefore = activeItem.presHideBefore);
+    }
+
+    @undoBatch
+    @action
+    updateHideAfter = (activeItem: Doc) => {
+        activeItem.presHideAfter = !activeItem.presHideAfter;
+        Array.from(this._selectedArray.keys()).forEach((doc) => doc.presHideAfter = activeItem.presHideAfter);
+    }
+
+    @undoBatch
+    @action
+    updateOpenDoc = (activeItem: Doc) => {
+        activeItem.openDocument = !activeItem.openDocument;
+        Array.from(this._selectedArray.keys()).forEach((doc) => {
+            doc.openDocument = activeItem.openDocument;
+        });
+    }
+
+    @undoBatch
+    @action
+    updateEffectDirection = (effect: any, all?: boolean) => {
+        const array: any[] = all ? this.childDocs : Array.from(this._selectedArray.keys());
+        array.forEach((doc) => {
+            const tagDoc = Cast(doc.presentationTargetDoc, Doc, null);
+            switch (effect) {
+                case PresEffect.Left:
+                    tagDoc.presEffectDirection = PresEffect.Left;
+                    break;
+                case PresEffect.Right:
+                    tagDoc.presEffectDirection = PresEffect.Right;
+                    break;
+                case PresEffect.Top:
+                    tagDoc.presEffectDirection = PresEffect.Top;
+                    break;
+                case PresEffect.Bottom:
+                    tagDoc.presEffectDirection = PresEffect.Bottom;
+                    break;
+                case PresEffect.Center: default:
+                    tagDoc.presEffectDirection = PresEffect.Center;
+                    break;
+            }
+        });
+    }
+
+    @undoBatch
+    @action
+    updateEffect = (effect: any, all?: boolean) => {
+        const array: any[] = all ? this.childDocs : Array.from(this._selectedArray.keys());
+        array.forEach((doc) => {
+            const tagDoc = Cast(doc.presentationTargetDoc, Doc, null);
+            switch (effect) {
+                case PresEffect.Bounce:
+                    tagDoc.presEffect = PresEffect.Bounce;
+                    break;
+                case PresEffect.Fade:
+                    tagDoc.presEffect = PresEffect.Fade;
+                    break;
+                case PresEffect.Flip:
+                    tagDoc.presEffect = PresEffect.Flip;
+                    break;
+                case PresEffect.Roll:
+                    tagDoc.presEffect = PresEffect.Roll;
+                    break;
+                case PresEffect.Rotate:
+                    tagDoc.presEffect = PresEffect.Rotate;
+                    break;
+                case PresEffect.None: default:
+                    tagDoc.presEffect = PresEffect.None;
+                    break;
+            }
+        });
+    }
+
+    _batch: UndoManager.Batch | undefined = undefined;
+
+    @computed get transitionDropdown() {
+        const activeItem: Doc = this.activeItem;
+        const targetDoc: Doc = this.targetDoc;
+        const type = targetDoc.type;
+        const isPresCollection: boolean = (targetDoc === this.layoutDoc.presCollection);
+        const isPinWithView: boolean = BoolCast(activeItem.presPinView);
+        if (activeItem && targetDoc) {
+            const transitionSpeed = activeItem.presTransition ? NumCast(activeItem.presTransition) / 1000 : 0.5;
+            let duration = activeItem.presDuration ? NumCast(activeItem.presDuration) / 1000 : 2;
+            if (activeItem.type === DocumentType.AUDIO) duration = NumCast(activeItem.duration);
+            const effect = targetDoc.presEffect ? targetDoc.presEffect : 'None';
+            activeItem.presMovement = activeItem.presMovement ? activeItem.presMovement : 'Zoom';
+            return (
+                <div className={`presBox-ribbon ${this.transitionTools && this.layoutDoc.presStatus === PresStatus.Edit ? "active" : ""}`} onPointerDown={e => e.stopPropagation()} onPointerUp={e => e.stopPropagation()} onClick={action(e => { e.stopPropagation(); this.openMovementDropdown = false; this.openEffectDropdown = false; })}>
+                    <div className="ribbon-box">
+                        Movement
+                        {isPresCollection || (isPresCollection && isPinWithView) ?
+                            <div className="ribbon-property" style={{ marginLeft: 0, height: 25, textAlign: 'left', paddingLeft: 5, paddingRight: 5, fontSize: 10 }}>
+                                {this.scrollable ? "Scroll to pinned view" : !isPinWithView ? "No movement" : "Pan & Zoom to pinned view"}
+                            </div>
+                            :
+                            <div className="presBox-dropdown" onClick={action(e => { e.stopPropagation(); this.openMovementDropdown = !this.openMovementDropdown; })} style={{ borderBottomLeftRadius: this.openMovementDropdown ? 0 : 5, border: this.openMovementDropdown ? `solid 2px ${Colors.MEDIUM_BLUE}` : 'solid 1px black' }}>
+                                {this.setMovementName(activeItem.presMovement, activeItem)}
+                                <FontAwesomeIcon className='presBox-dropdownIcon' style={{ gridColumn: 2, color: this.openMovementDropdown ? Colors.MEDIUM_BLUE : 'black' }} icon={"angle-down"} />
+                                <div className={'presBox-dropdownOptions'} id={'presBoxMovementDropdown'} onPointerDown={e => e.stopPropagation()} style={{ display: this.openMovementDropdown ? "grid" : "none" }}>
+                                    <div className={`presBox-dropdownOption ${activeItem.presMovement === PresMovement.None ? "active" : ""}`} onPointerDown={e => e.stopPropagation()} onClick={() => this.updateMovement(PresMovement.None)}>None</div>
+                                    <div className={`presBox-dropdownOption ${activeItem.presMovement === PresMovement.Zoom ? "active" : ""}`} onPointerDown={e => e.stopPropagation()} onClick={() => this.updateMovement(PresMovement.Zoom)}>Pan {"&"} Zoom</div>
+                                    <div className={`presBox-dropdownOption ${activeItem.presMovement === PresMovement.Pan ? "active" : ""}`} onPointerDown={e => e.stopPropagation()} onClick={() => this.updateMovement(PresMovement.Pan)}>Pan</div>
+                                    <div className={`presBox-dropdownOption ${activeItem.presMovement === PresMovement.Jump ? "active" : ""}`} onPointerDown={e => e.stopPropagation()} onClick={() => this.updateMovement(PresMovement.Jump)}>Jump cut</div>
+                                </div>
+                            </div>
+                        }
+                        <div className="ribbon-doubleButton" style={{ display: activeItem.presMovement === PresMovement.Pan || activeItem.presMovement === PresMovement.Zoom ? "inline-flex" : "none" }}>
+                            <div className="presBox-subheading">Movement Speed</div>
+                            <div className="ribbon-property">
+                                <input className="presBox-input"
+                                    type="number" value={transitionSpeed}
+                                    onChange={action((e) => this.setTransitionTime(e.target.value))} /> s
+                            </div>
+                            <div className="ribbon-propertyUpDown">
+                                <div className="ribbon-propertyUpDownItem" onClick={undoBatch(() => this.setTransitionTime(String(transitionSpeed), 1000))}>
+                                    <FontAwesomeIcon icon={"caret-up"} />
+                                </div>
+                                <div className="ribbon-propertyUpDownItem" onClick={undoBatch(() => this.setTransitionTime(String(transitionSpeed), -1000))}>
+                                    <FontAwesomeIcon icon={"caret-down"} />
+                                </div>
+                            </div>
+                        </div>
+                        <input type="range" step="0.1" min="0.1" max="10" value={transitionSpeed}
+                            className={`toolbar-slider ${activeItem.presMovement === PresMovement.Pan || activeItem.presMovement === PresMovement.Zoom ? "" : "none"}`}
+                            id="toolbar-slider"
+                            onPointerDown={() => this._batch = UndoManager.StartBatch("presTransition")}
+                            onPointerUp={() => this._batch?.end()}
+                            onChange={(e: React.ChangeEvent<HTMLInputElement>) => {
+                                e.stopPropagation();
+                                this.setTransitionTime(e.target.value);
+                            }} />
+                        <div className={`slider-headers ${activeItem.presMovement === PresMovement.Pan || activeItem.presMovement === PresMovement.Zoom ? "" : "none"}`}>
+                            <div className="slider-text">Fast</div>
+                            <div className="slider-text">Medium</div>
+                            <div className="slider-text">Slow</div>
+                        </div>
+                    </div>
+                    <div className="ribbon-box">
+                        Visibility {"&"} Duration
+                        <div className="ribbon-doubleButton">
+                            {isPresCollection ? (null) : <Tooltip title={<><div className="dash-tooltip">{"Hide before presented"}</div></>}><div className={`ribbon-toggle ${activeItem.presHideBefore ? "active" : ""}`} onClick={() => this.updateHideBefore(activeItem)}>Hide before</div></Tooltip>}
+                            {isPresCollection ? (null) : <Tooltip title={<><div className="dash-tooltip">{"Hide after presented"}</div></>}><div className={`ribbon-toggle ${activeItem.presHideAfter ? "active" : ""}`} onClick={() => this.updateHideAfter(activeItem)}>Hide after</div></Tooltip>}
+                            <Tooltip title={<><div className="dash-tooltip">{"Open in lightbox view"}</div></>}><div className="ribbon-toggle" style={{ backgroundColor: activeItem.openDocument ? Colors.LIGHT_BLUE : "" }} onClick={() => this.updateOpenDoc(activeItem)}>Lightbox</div></Tooltip>
+                        </div>
+                        {(type === DocumentType.AUDIO || type === DocumentType.VID) ? (null) : <>
+                            <div className="ribbon-doubleButton" >
+                                <div className="presBox-subheading">Slide Duration</div>
+                                <div className="ribbon-property">
+                                    <input className="presBox-input"
+                                        type="number" value={duration}
+                                        onChange={action((e) => this.setDurationTime(e.target.value))} /> s
+                            </div>
+                                <div className="ribbon-propertyUpDown">
+                                    <div className="ribbon-propertyUpDownItem" onClick={undoBatch(() => this.setDurationTime(String(duration), 1000))}>
+                                        <FontAwesomeIcon icon={"caret-up"} />
+                                    </div>
+                                    <div className="ribbon-propertyUpDownItem" onClick={undoBatch(() => this.setDurationTime(String(duration), -1000))}>
+                                        <FontAwesomeIcon icon={"caret-down"} />
+                                    </div>
+                                </div>
+                            </div>
+                            <input type="range" step="0.1" min="0.1" max="20" value={duration}
+                                style={{ display: targetDoc.type === DocumentType.AUDIO ? "none" : "block" }}
+                                className={"toolbar-slider"} id="duration-slider"
+                                onPointerDown={() => { this._batch = UndoManager.StartBatch("presDuration"); }}
+                                onPointerUp={() => { if (this._batch) this._batch.end(); }}
+                                onChange={(e: React.ChangeEvent<HTMLInputElement>) => { e.stopPropagation(); this.setDurationTime(e.target.value); }}
+                            />
+                            <div className={"slider-headers"} style={{ display: targetDoc.type === DocumentType.AUDIO ? "none" : "grid" }}>
+                                <div className="slider-text">Short</div>
+                                <div className="slider-text">Medium</div>
+                                <div className="slider-text">Long</div>
+                            </div>
+                        </>}
+                    </div>
+                    {isPresCollection ? (null) : <div className="ribbon-box">
+                        Effects
+                        <div className="presBox-dropdown" onClick={action(e => { e.stopPropagation(); this.openEffectDropdown = !this.openEffectDropdown; })} style={{ borderBottomLeftRadius: this.openEffectDropdown ? 0 : 5, border: this.openEffectDropdown ? `solid 2px ${Colors.MEDIUM_BLUE}` : 'solid 1px black' }}>
+                            {effect}
+                            <FontAwesomeIcon className='presBox-dropdownIcon' style={{ gridColumn: 2, color: this.openEffectDropdown ? Colors.MEDIUM_BLUE : 'black' }} icon={"angle-down"} />
+                            <div className={'presBox-dropdownOptions'} id={'presBoxMovementDropdown'} style={{ display: this.openEffectDropdown ? "grid" : "none" }} onPointerDown={e => e.stopPropagation()}>
+                                <div className={`presBox-dropdownOption ${targetDoc.presEffect === PresEffect.None || !targetDoc.presEffect ? "active" : ""}`} onPointerDown={e => e.stopPropagation()} onClick={() => this.updateEffect(PresEffect.None)}>None</div>
+                                <div className={`presBox-dropdownOption ${targetDoc.presEffect === PresEffect.Fade ? "active" : ""}`} onPointerDown={e => e.stopPropagation()} onClick={() => this.updateEffect(PresEffect.Fade)}>Fade In</div>
+                                <div className={`presBox-dropdownOption ${targetDoc.presEffect === PresEffect.Flip ? "active" : ""}`} onPointerDown={e => e.stopPropagation()} onClick={() => this.updateEffect(PresEffect.Flip)}>Flip</div>
+                                <div className={`presBox-dropdownOption ${targetDoc.presEffect === PresEffect.Rotate ? "active" : ""}`} onPointerDown={e => e.stopPropagation()} onClick={() => this.updateEffect(PresEffect.Rotate)}>Rotate</div>
+                                <div className={`presBox-dropdownOption ${targetDoc.presEffect === PresEffect.Bounce ? "active" : ""}`} onPointerDown={e => e.stopPropagation()} onClick={() => this.updateEffect(PresEffect.Bounce)}>Bounce</div>
+                                <div className={`presBox-dropdownOption ${targetDoc.presEffect === PresEffect.Roll ? "active" : ""}`} onPointerDown={e => e.stopPropagation()} onClick={() => this.updateEffect(PresEffect.Roll)}>Roll</div>
+                            </div>
+                        </div>
+                        <div className="ribbon-doubleButton" style={{ display: effect === 'None' ? "none" : "inline-flex" }}>
+                            <div className="presBox-subheading" >Effect direction</div>
+                            <div className="ribbon-property">
+                                {this.effectDirection}
+                            </div>
+                        </div>
+                        <div className="effectDirection" style={{ display: effect === 'None' ? "none" : "grid", width: 40 }}>
+                            <Tooltip title={<><div className="dash-tooltip">{"Enter from left"}</div></>}><div style={{ gridColumn: 1, gridRow: 2, justifySelf: 'center', color: targetDoc.presEffectDirection === PresEffect.Left ? Colors.LIGHT_BLUE : "black", cursor: "pointer" }} onClick={() => this.updateEffectDirection(PresEffect.Left)}><FontAwesomeIcon icon={"angle-right"} /></div></Tooltip>
+                            <Tooltip title={<><div className="dash-tooltip">{"Enter from right"}</div></>}><div style={{ gridColumn: 3, gridRow: 2, justifySelf: 'center', color: targetDoc.presEffectDirection === PresEffect.Right ? Colors.LIGHT_BLUE : "black", cursor: "pointer" }} onClick={() => this.updateEffectDirection(PresEffect.Right)}><FontAwesomeIcon icon={"angle-left"} /></div></Tooltip>
+                            <Tooltip title={<><div className="dash-tooltip">{"Enter from top"}</div></>}><div style={{ gridColumn: 2, gridRow: 1, justifySelf: 'center', color: targetDoc.presEffectDirection === PresEffect.Top ? Colors.LIGHT_BLUE : "black", cursor: "pointer" }} onClick={() => this.updateEffectDirection(PresEffect.Top)}><FontAwesomeIcon icon={"angle-down"} /></div></Tooltip>
+                            <Tooltip title={<><div className="dash-tooltip">{"Enter from bottom"}</div></>}><div style={{ gridColumn: 2, gridRow: 3, justifySelf: 'center', color: targetDoc.presEffectDirection === PresEffect.Bottom ? Colors.LIGHT_BLUE : "black", cursor: "pointer" }} onClick={() => this.updateEffectDirection(PresEffect.Bottom)}><FontAwesomeIcon icon={"angle-up"} /></div></Tooltip>
+                            <Tooltip title={<><div className="dash-tooltip">{"Enter from center"}</div></>}><div style={{ gridColumn: 2, gridRow: 2, width: 10, height: 10, alignSelf: 'center', justifySelf: 'center', border: targetDoc.presEffectDirection === PresEffect.Center || !targetDoc.presEffectDirection ? `solid 2px ${Colors.LIGHT_BLUE}` : "solid 2px black", borderRadius: "100%", cursor: "pointer" }} onClick={() => this.updateEffectDirection(PresEffect.Center)}></div></Tooltip>
+                        </div>
+                    </div>}
+                    <div className="ribbon-final-box">
+                        <div className="ribbon-final-button-hidden" onClick={() => this.applyTo(this.childDocs)}>
+                            Apply to all
+                        </div>
+                    </div>
+                </div >
+            );
+        }
+    }
+
+    @computed get effectDirection(): string {
+        let effect = '';
+        switch (this.targetDoc.presEffectDirection) {
+            case 'left': effect = "Enter from left"; break;
+            case 'right': effect = "Enter from right"; break;
+            case 'top': effect = "Enter from top"; break;
+            case 'bottom': effect = "Enter from bottom"; break;
+            default: effect = "Enter from center"; break;
+        }
+        return effect;
+    }
+
+    @undoBatch
+    @action
+    applyTo = (array: Doc[]) => {
+        const activeItem: Doc = this.activeItem;
+        const targetDoc: Doc = this.targetDoc;
+        this.updateMovement(activeItem.presMovement, true);
+        this.updateEffect(targetDoc.presEffect, true);
+        this.updateEffectDirection(targetDoc.presEffectDirection, true);
+        array.forEach((doc) => {
+            const curDoc = Cast(doc, Doc, null);
+            const tagDoc = Cast(curDoc.presentationTargetDoc, Doc, null);
+            if (tagDoc && targetDoc) {
+                curDoc.presTransition = activeItem.presTransition;
+                curDoc.presDuration = activeItem.presDuration;
+                curDoc.presHideBefore = activeItem.presHideBefore;
+                curDoc.presHideAfter = activeItem.presHideAfter;
+            }
+        });
+    }
+
+    @computed get presPinViewOptionsDropdown() {
+        const activeItem: Doc = this.activeItem;
+        const targetDoc: Doc = this.targetDoc;
+        const presPinWithViewIcon = <img src="/assets/pinWithView.png" style={{ margin: "auto", width: 16, filter: 'invert(1)' }} />;
+        return (
+            <>
+                {this.panable || this.scrollable || this.targetDoc.type === DocumentType.COMPARISON ? 'Pinned view' : (null)}
+                <div className="ribbon-doubleButton">
+                    <Tooltip title={<><div className="dash-tooltip">{activeItem.presPinView ? "Turn off pin with view" : "Turn on pin with view"}</div></>}><div className="ribbon-toggle" style={{ width: 20, padding: 0, backgroundColor: activeItem.presPinView ? Colors.LIGHT_BLUE : "" }}
+                        onClick={() => {
+                            activeItem.presPinView = !activeItem.presPinView;
+                            targetDoc.presPinView = activeItem.presPinView;
+                            if (activeItem.presPinView) {
+                                if (targetDoc.type === DocumentType.PDF || targetDoc.type === DocumentType.RTF || targetDoc.type === DocumentType.WEB || targetDoc._viewType === CollectionViewType.Stacking) {
+                                    const scroll = targetDoc._scrollTop;
+                                    activeItem.presPinView = true;
+                                    activeItem.presPinViewScroll = scroll;
+                                } else if (targetDoc.type === DocumentType.VID) {
+                                    activeItem.presPinTimecode = targetDoc._currentTimecode;
+                                } else if ((targetDoc.type === DocumentType.COL && targetDoc._viewType === CollectionViewType.Freeform) || targetDoc.type === DocumentType.IMG) {
+                                    const x = targetDoc._panX;
+                                    const y = targetDoc._panY;
+                                    const scale = targetDoc._viewScale;
+                                    activeItem.presPinView = true;
+                                    activeItem.presPinViewX = x;
+                                    activeItem.presPinViewY = y;
+                                    activeItem.presPinViewScale = scale;
+                                } else if (targetDoc.type === DocumentType.COMPARISON) {
+                                    const width = targetDoc._clipWidth;
+                                    activeItem.presPinClipWidth = width;
+                                    activeItem.presPinView = true;
+                                }
+                            }
+                        }}>{presPinWithViewIcon}</div></Tooltip>
+                    {activeItem.presPinView ? <Tooltip title={<><div className="dash-tooltip">{"Update the pinned view with the view of the selected document"}</div></>}><div className="ribbon-button"
+                        onClick={() => {
+                            if (targetDoc.type === DocumentType.PDF || targetDoc.type === DocumentType.WEB || targetDoc.type === DocumentType.RTF) {
+                                const scroll = targetDoc._scrollTop;
+                                activeItem.presPinViewScroll = scroll;
+                            } else if (targetDoc.type === DocumentType.VID) {
+                                activeItem.presPinTimecode = targetDoc._currentTimecode;
+                            } else if (targetDoc.type === DocumentType.COMPARISON) {
+                                const clipWidth = targetDoc._clipWidth;
+                                activeItem.presPinClipWidth = clipWidth;
+                            } else {
+                                const x = targetDoc._panX;
+                                const y = targetDoc._panY;
+                                const scale = targetDoc._viewScale;
+                                activeItem.presPinViewX = x;
+                                activeItem.presPinViewY = y;
+                                activeItem.presPinViewScale = scale;
+                            }
+                        }}>Update</div></Tooltip> : (null)}
+                </div>
+            </>
+        );
+    }
+
+    @computed get panOptionsDropdown() {
+        const activeItem: Doc = this.activeItem;
+        const targetDoc: Doc = this.targetDoc;
+        return (
+            <>
+                {this.panable ? <div style={{ display: activeItem.presPinView ? "block" : "none" }}>
+                    <div className="ribbon-doubleButton" style={{ marginRight: 10 }}>
+                        <div className="presBox-subheading">Pan X</div>
+                        <div className="ribbon-property" style={{ paddingRight: 0, paddingLeft: 0 }}>
+                            <input className="presBox-input"
+                                style={{ textAlign: 'left', width: 50 }}
+                                type="number" value={NumCast(activeItem.presPinViewX)}
+                                onChange={action((e: React.ChangeEvent<HTMLInputElement>) => { const val = e.target.value; activeItem.presPinViewX = Number(val); })} />
+                        </div>
+                    </div>
+                    <div className="ribbon-doubleButton" style={{ marginRight: 10 }}>
+                        <div className="presBox-subheading">Pan Y</div>
+                        <div className="ribbon-property" style={{ paddingRight: 0, paddingLeft: 0 }}>
+                            <input className="presBox-input"
+                                style={{ textAlign: 'left', width: 50 }}
+                                type="number" value={NumCast(activeItem.presPinViewY)}
+                                onChange={action((e: React.ChangeEvent<HTMLInputElement>) => { const val = e.target.value; activeItem.presPinViewY = Number(val); })} />
+                        </div>
+                    </div>
+                    <div className="ribbon-doubleButton" style={{ marginRight: 10 }}>
+                        <div className="presBox-subheading">Scale</div>
+                        <div className="ribbon-property" style={{ paddingRight: 0, paddingLeft: 0 }}>
+                            <input className="presBox-input"
+                                style={{ textAlign: 'left', width: 50 }}
+                                type="number" value={NumCast(activeItem.presPinViewScale)}
+                                onChange={action((e: React.ChangeEvent<HTMLInputElement>) => { const val = e.target.value; activeItem.presPinViewScale = Number(val); })} />
+                        </div>
+                    </div>
+                </div> : (null)}
+            </>
+        );
+    }
+
+    @computed get scrollOptionsDropdown() {
+        const activeItem: Doc = this.activeItem;
+        const targetDoc: Doc = this.targetDoc;
+        return (
+            <>
+                {this.scrollable ? <div style={{ display: activeItem.presPinView ? "block" : "none" }}>
+                    <div className="ribbon-doubleButton" style={{ marginRight: 10 }}>
+                        <div className="presBox-subheading">Scroll</div>
+                        <div className="ribbon-property" style={{ paddingRight: 0, paddingLeft: 0 }}>
+                            <input className="presBox-input"
+                                style={{ textAlign: 'left', width: 50 }}
+                                type="number" value={NumCast(activeItem.presPinViewScroll)}
+                                onChange={action((e: React.ChangeEvent<HTMLInputElement>) => { const val = e.target.value; activeItem.presPinViewScroll = Number(val); })} />
+                        </div>
+                    </div>
+                </div> : (null)}
+            </>
+        );
+    }
+
+    @computed get mediaStopSlides() {
+        const activeItem: Doc = this.activeItem;
+        const list = this.childDocs.map((doc, i) => {
+            if (i > this.itemIndex) {
+                return (
+                    <option>{i + 1}. {doc.title}</option>
+                );
+            }
+        });
+        return (
+            list
+        );
+    }
+
+    @computed get mediaOptionsDropdown() {
+        const activeItem: Doc = this.activeItem;
+        const targetDoc: Doc = this.targetDoc;
+        const duration = Math.round(NumCast(activeItem[`${Doc.LayoutFieldKey(activeItem)}-duration`]) * 10);
+        const mediaStopDocInd: number = NumCast(activeItem.mediaStopDoc);
+        const mediaStopDocStr: string = mediaStopDocInd ? mediaStopDocInd + ". " + this.childDocs[mediaStopDocInd - 1].title : "";
+        if (activeItem && targetDoc) {
+            return (
+                <div>
+                    <div className={'presBox-ribbon'} onClick={e => e.stopPropagation()} onPointerUp={e => e.stopPropagation()} onPointerDown={e => e.stopPropagation()}>
+                        <div>
+                            <div className="ribbon-box">
+                                Start {"&"} End Time
+                                <div className={"slider-headers"}>
+                                    <div className="slider-block" >
+                                        <div className="slider-text" style={{ fontWeight: 500 }}>
+                                            Start time (s)
+                                        </div>
+                                        <div id={"startTime"} className="slider-number" style={{ backgroundColor: Colors.LIGHT_GRAY }}>
+                                            <input className="presBox-input"
+                                                style={{ textAlign: 'center', width: 30, height: 15, fontSize: 10 }}
+                                                type="number" value={NumCast(activeItem.presStartTime)}
+                                                onChange={action((e: React.ChangeEvent<HTMLInputElement>) => { activeItem.presStartTime = Number(e.target.value); })}
+                                            />
+                                        </div>
+                                    </div>
+                                    <div className="slider-block">
+                                        <div className="slider-text" style={{ fontWeight: 500 }}>
+                                            Duration (s)
+                                        </div>
+                                        <div className="slider-number" style={{ backgroundColor: Colors.LIGHT_BLUE }}>
+                                            {Math.round((NumCast(activeItem.presEndTime) - NumCast(activeItem.presStartTime)) * 10) / 10}
+                                        </div>
+                                    </div>
+                                    <div className="slider-block">
+                                        <div className="slider-text" style={{ fontWeight: 500 }}>
+                                            End time (s)
+                                        </div>
+                                        <div id={"endTime"} className="slider-number" style={{ backgroundColor: Colors.LIGHT_GRAY }}>
+                                            <input className="presBox-input"
+                                                style={{ textAlign: 'center', width: 30, height: 15, fontSize: 10 }}
+                                                type="number" value={NumCast(activeItem.presEndTime)}
+                                                onChange={action((e: React.ChangeEvent<HTMLInputElement>) => { activeItem.presEndTime = Number(e.target.value); })}
+                                            />
+                                        </div>
+                                    </div>
+                                </div>
+                                <div className="multiThumb-slider">
+                                    <input type="range" step="0.1" min="0" max={duration / 10} value={NumCast(activeItem.presEndTime)}
+                                        style={{ gridColumn: 1, gridRow: 1 }}
+                                        className={`toolbar-slider ${"end"}`}
+                                        id="toolbar-slider"
+                                        onPointerDown={() => {
+                                            this._batch = UndoManager.StartBatch("presEndTime");
+                                            const endBlock = document.getElementById("endTime");
+                                            if (endBlock) {
+                                                endBlock.style.color = Colors.LIGHT_GRAY;
+                                                endBlock.style.backgroundColor = Colors.MEDIUM_BLUE;
+                                            }
+                                        }}
+                                        onPointerUp={() => {
+                                            this._batch?.end();
+                                            const endBlock = document.getElementById("endTime");
+                                            if (endBlock) {
+                                                endBlock.style.color = Colors.BLACK;
+                                                endBlock.style.backgroundColor = Colors.LIGHT_GRAY;
+                                            }
+                                        }}
+                                        onChange={(e: React.ChangeEvent<HTMLInputElement>) => {
+                                            e.stopPropagation();
+                                            activeItem.presEndTime = Number(e.target.value);
+                                        }} />
+                                    <input type="range" step="0.1" min="0" max={duration / 10} value={NumCast(activeItem.presStartTime)}
+                                        style={{ gridColumn: 1, gridRow: 1 }}
+                                        className={`toolbar-slider ${"start"}`}
+                                        id="toolbar-slider"
+                                        onPointerDown={() => {
+                                            this._batch = UndoManager.StartBatch("presStartTime");
+                                            const startBlock = document.getElementById("startTime");
+                                            if (startBlock) {
+                                                startBlock.style.color = Colors.LIGHT_GRAY;
+                                                startBlock.style.backgroundColor = Colors.MEDIUM_BLUE;
+                                            }
+                                        }}
+                                        onPointerUp={() => {
+                                            this._batch?.end();
+                                            const startBlock = document.getElementById("startTime");
+                                            if (startBlock) {
+                                                startBlock.style.color = Colors.BLACK;
+                                                startBlock.style.backgroundColor = Colors.LIGHT_GRAY;
+                                            }
+                                        }}
+                                        onChange={(e: React.ChangeEvent<HTMLInputElement>) => {
+                                            e.stopPropagation();
+                                            activeItem.presStartTime = Number(e.target.value);
+                                        }} />
+                                </div>
+                                <div className={`slider-headers ${activeItem.presMovement === PresMovement.Pan || activeItem.presMovement === PresMovement.Zoom ? "" : "none"}`}>
+                                    <div className="slider-text">0 s</div>
+                                    <div className="slider-text"></div>
+                                    <div className="slider-text">{duration / 10} s</div>
+                                </div>
+                            </div>
+                            <div className="ribbon-final-box">
+                                Playback
+                                <div className="presBox-subheading">Start playing:</div>
+                                <div className="presBox-radioButtons">
+                                    <div className="checkbox-container">
+                                        <input className="presBox-checkbox"
+                                            type="checkbox"
+                                            onChange={() => activeItem.mediaStart = "manual"}
+                                            checked={activeItem.mediaStart === "manual"}
+                                        />
+                                        <div>On click</div>
+                                    </div>
+                                    <div className="checkbox-container">
+                                        <input className="presBox-checkbox"
+                                            type="checkbox"
+                                            onChange={() => activeItem.mediaStart = "auto"}
+                                            checked={activeItem.mediaStart === "auto"}
+                                        />
+                                        <div>Automatically</div>
+                                    </div>
+                                </div>
+                                <div className="presBox-subheading">Stop playing:</div>
+                                <div className="presBox-radioButtons">
+                                    <div className="checkbox-container">
+                                        <input className="presBox-checkbox"
+                                            type="checkbox"
+                                            onChange={() => activeItem.mediaStop = "manual"}
+                                            checked={activeItem.mediaStop === "manual"}
+                                        />
+                                        <div>At audio end time</div>
+                                    </div>
+                                    <div className="checkbox-container">
+                                        <input className="presBox-checkbox"
+                                            type="checkbox"
+                                            onChange={() => activeItem.mediaStop = "auto"}
+                                            checked={activeItem.mediaStop === "auto"}
+                                        />
+                                        <div>On slide change</div>
+                                    </div>
+                                    {/* <div className="checkbox-container">
+                                    <input className="presBox-checkbox"
+                                        type="checkbox"
+                                        onChange={() => activeItem.mediaStop = "afterSlide"}
+                                        checked={activeItem.mediaStop === "afterSlide"}
+                                    />
+                                    <div className="checkbox-dropdown">
+                                        After chosen slide
+                                        <select className="presBox-viewPicker"
+                                            style={{ opacity: activeItem.mediaStop === "afterSlide" && this.itemIndex !== this.childDocs.length - 1 ? 1 : 0.3 }}
+                                            onPointerDown={e => e.stopPropagation()}
+                                            onChange={this.mediaStopChanged}
+                                            value={mediaStopDocStr}>
+                                            {this.mediaStopSlides}
+                                        </select>
+                                    </div>
+                                </div> */}
+                                </div>
+                            </div>
+                        </div>
+                    </div>
+                </div >
+            );
+        }
+    }
+
+    @computed get newDocumentToolbarDropdown() {
+        return (
+            <div>
+                <div className={'presBox-toolbar-dropdown'} style={{ display: this.newDocumentTools && this.layoutDoc.presStatus === "edit" ? "inline-flex" : "none" }} onClick={e => e.stopPropagation()} onPointerUp={e => e.stopPropagation()} onPointerDown={e => e.stopPropagation()}>
+                    <div className="layout-container" style={{ height: 'max-content' }}>
+                        <div className="layout" style={{ border: this.layout === 'blank' ? `solid 2px ${Colors.MEDIUM_BLUE}` : '' }} onClick={action(() => { this.layout = 'blank'; this.createNewSlide(this.layout); })} />
+                        <div className="layout" style={{ border: this.layout === 'title' ? `solid 2px ${Colors.MEDIUM_BLUE}` : '' }} onClick={action(() => { this.layout = 'title'; this.createNewSlide(this.layout); })}>
+                            <div className="title">Title</div>
+                            <div className="subtitle">Subtitle</div>
+                        </div>
+                        <div className="layout" style={{ border: this.layout === 'header' ? `solid 2px ${Colors.MEDIUM_BLUE}` : '' }} onClick={action(() => { this.layout = 'header'; this.createNewSlide(this.layout); })}>
+                            <div className="title" style={{ alignSelf: 'center', fontSize: 10 }}>Section header</div>
+                        </div>
+                        <div className="layout" style={{ border: this.layout === 'content' ? `solid 2px ${Colors.MEDIUM_BLUE}` : '' }} onClick={action(() => { this.layout = 'content'; this.createNewSlide(this.layout); })}>
+                            <div className="title" style={{ alignSelf: 'center' }}>Title</div>
+                            <div className="content">Text goes here</div>
+                        </div>
+                    </div>
+                </div>
+            </div >
+        );
+    }
+
+    @observable openLayouts: boolean = false;
+    @observable addFreeform: boolean = true;
+    @observable layout: string = "";
+    @observable title: string = "";
+
+    @computed get newDocumentDropdown() {
+        return (
+            <div>
+                <div className={"presBox-ribbon"} onClick={e => e.stopPropagation()} onPointerDown={e => e.stopPropagation()}>
+                    <div className="ribbon-box">
+                        Slide Title: <br></br>
+                        <input className="ribbon-textInput" placeholder="..." type="text" name="fname"
+                            onChange={(e) => {
+                                e.stopPropagation();
+                                e.preventDefault();
+                                runInAction(() => this.title = e.target.value);
+                            }}>
+                        </input>
+                    </div>
+                    <div className="ribbon-box">
+                        Choose type:
+                        <div className="ribbon-doubleButton">
+                            <div title="Text" className={'ribbon-toggle'} style={{ background: this.addFreeform ? "" : Colors.LIGHT_BLUE }} onClick={action(() => this.addFreeform = !this.addFreeform)}>Text</div>
+                            <div title="Freeform" className={'ribbon-toggle'} style={{ background: this.addFreeform ? Colors.LIGHT_BLUE : "" }} onClick={action(() => this.addFreeform = !this.addFreeform)}>Freeform</div>
+                        </div>
+                    </div>
+                    <div className="ribbon-box" style={{ display: this.addFreeform ? "grid" : "none" }}>
+                        Preset layouts:
+                        <div className="layout-container" style={{ height: this.openLayouts ? 'max-content' : '75px' }}>
+                            <div className="layout" style={{ border: this.layout === 'blank' ? `solid 2px ${Colors.MEDIUM_BLUE}` : '' }} onClick={action(() => this.layout = 'blank')} />
+                            <div className="layout" style={{ border: this.layout === 'title' ? `solid 2px ${Colors.MEDIUM_BLUE}` : '' }} onClick={action(() => this.layout = 'title')}>
+                                <div className="title">Title</div>
+                                <div className="subtitle">Subtitle</div>
+                            </div>
+                            <div className="layout" style={{ border: this.layout === 'header' ? `solid 2px ${Colors.MEDIUM_BLUE}` : '' }} onClick={action(() => this.layout = 'header')}>
+                                <div className="title" style={{ alignSelf: 'center', fontSize: 10 }}>Section header</div>
+                            </div>
+                            <div className="layout" style={{ border: this.layout === 'content' ? `solid 2px ${Colors.MEDIUM_BLUE}` : '' }} onClick={action(() => this.layout = 'content')}>
+                                <div className="title" style={{ alignSelf: 'center' }}>Title</div>
+                                <div className="content">Text goes here</div>
+                            </div>
+                            <div className="layout" style={{ border: this.layout === 'twoColumns' ? `solid 2px ${Colors.MEDIUM_BLUE}` : '' }} onClick={action(() => this.layout = 'twoColumns')}>
+                                <div className="title" style={{ alignSelf: 'center', gridColumn: '1/3' }}>Title</div>
+                                <div className="content" style={{ gridColumn: 1, gridRow: 2 }}>Column one text</div>
+                                <div className="content" style={{ gridColumn: 2, gridRow: 2 }}>Column two text</div>
+                            </div>
+                        </div>
+                        <div className="open-layout" onClick={action(() => this.openLayouts = !this.openLayouts)}>
+                            <FontAwesomeIcon style={{ transition: 'all 0.3s', transform: this.openLayouts ? 'rotate(180deg)' : 'rotate(0deg)' }} icon={"caret-down"} size={"lg"} />
+                        </div>
+                    </div>
+                    <div className="ribbon-final-box">
+                        <div className={this.title !== "" && (this.addFreeform && this.layout !== "" || !this.addFreeform) ? "ribbon-final-button-hidden" : "ribbon-final-button"} onClick={() => this.createNewSlide(this.layout, this.title, this.addFreeform)}>
+                            Create New Slide
+                        </div>
+                    </div>
+                </div>
+            </div >
+        );
+    }
+
+    createNewSlide = (layout?: string, title?: string, freeform?: boolean) => {
+        let doc = undefined;
+        if (layout) doc = this.createTemplate(layout);
+        if (freeform && layout) doc = this.createTemplate(layout, title);
+        if (!freeform && !layout) doc = Docs.Create.TextDocument("", { _nativeWidth: 400, _width: 225, title: title });
+        if (doc) {
+            const presCollection = Cast(this.layoutDoc.presCollection, Doc, null);
+            const data = Cast(presCollection?.data, listSpec(Doc));
+            const presData = Cast(this.rootDoc.data, listSpec(Doc));
+            if (data && presData) {
+                data.push(doc);
+                TabDocView.PinDoc(doc);
+                this.gotoDocument(this.childDocs.length, this.activeItem);
+            } else {
+                this.props.addDocTab(doc, "add:right");
+            }
+        }
+    }
+
+    createTemplate = (layout: string, input?: string) => {
+        const activeItem: Doc = this.activeItem;
+        const targetDoc: Doc = this.targetDoc;
+        let x = 0;
+        let y = 0;
+        if (activeItem && targetDoc) {
+            x = NumCast(targetDoc.x);
+            y = NumCast(targetDoc.y) + NumCast(targetDoc._height) + 20;
+        }
+        let doc = undefined;
+        const title = Docs.Create.TextDocument("Click to change title", { title: "Slide title", _width: 380, _height: 60, x: 10, y: 58, _fontSize: "24pt", });
+        const subtitle = Docs.Create.TextDocument("Click to change subtitle", { title: "Slide subtitle", _width: 380, _height: 50, x: 10, y: 118, _fontSize: "16pt" });
+        const header = Docs.Create.TextDocument("Click to change header", { title: "Slide header", _width: 380, _height: 65, x: 10, y: 80, _fontSize: "20pt" });
+        const contentTitle = Docs.Create.TextDocument("Click to change title", { title: "Slide title", _width: 380, _height: 60, x: 10, y: 10, _fontSize: "24pt" });
+        const content = Docs.Create.TextDocument("Click to change text", { title: "Slide text", _width: 380, _height: 145, x: 10, y: 70, _fontSize: "14pt" });
+        const content1 = Docs.Create.TextDocument("Click to change text", { title: "Column 1", _width: 185, _height: 140, x: 10, y: 80, _fontSize: "14pt" });
+        const content2 = Docs.Create.TextDocument("Click to change text", { title: "Column 2", _width: 185, _height: 140, x: 205, y: 80, _fontSize: "14pt" });
+        switch (layout) {
+            case 'blank':
+                doc = Docs.Create.FreeformDocument([], { title: input ? input : "Blank slide", _width: 400, _height: 225, x: x, y: y });
+                break;
+            case 'title':
+                doc = Docs.Create.FreeformDocument([title, subtitle], { title: input ? input : "Title slide", _width: 400, _height: 225, _fitToBox: true, x: x, y: y });
+                break;
+            case 'header':
+                doc = Docs.Create.FreeformDocument([header], { title: input ? input : "Section header", _width: 400, _height: 225, _fitToBox: true, x: x, y: y });
+                break;
+            case 'content':
+                doc = Docs.Create.FreeformDocument([contentTitle, content], { title: input ? input : "Title and content", _width: 400, _height: 225, _fitToBox: true, x: x, y: y });
+                break;
+            case 'twoColumns':
+                doc = Docs.Create.FreeformDocument([contentTitle, content1, content2], { title: input ? input : "Title and two columns", _width: 400, _height: 225, _fitToBox: true, x: x, y: y });
+                break;
+            default:
+                break;
+        }
+        return doc;
+    }
+
+    // Dropdown that appears when the user wants to begin presenting (either minimize or sidebar view)
+    @computed get presentDropdown() {
+        return (
+            <div className={`dropdown-play ${this.presentTools ? "active" : ""}`} onClick={e => e.stopPropagation()} onPointerUp={e => e.stopPropagation()} onPointerDown={e => e.stopPropagation()}>
+                <div className="dropdown-play-button" onClick={undoBatch(action(() => { this.updateMinimize(); this.turnOffEdit(true); this.gotoDocument(this.itemIndex, this.activeItem); }))}>
+                    Mini-player
+                </div>
+                <div className="dropdown-play-button" onClick={undoBatch(action(() => { this.layoutDoc.presStatus = "manual"; this.turnOffEdit(true); this.gotoDocument(this.itemIndex, this.activeItem); }))}>
+                    Sidebar player
+                </div>
+            </div>
+        );
+    }
+
+    // Case in which the document has keyframes to navigate to next key frame
+    @action
+    nextKeyframe = (tagDoc: Doc, curDoc: Doc): void => {
+        const childDocs = DocListCast(tagDoc[Doc.LayoutFieldKey(tagDoc)]);
+        const currentFrame = Cast(tagDoc._currentFrame, "number", null);
+        if (currentFrame === undefined) {
+            tagDoc._currentFrame = 0;
+            // CollectionFreeFormDocumentView.setupScroll(tagDoc, 0);
+            // CollectionFreeFormDocumentView.setupKeyframes(childDocs, 0);
+        }
+        // if (tagDoc.editScrollProgressivize) CollectionFreeFormDocumentView.updateScrollframe(tagDoc, currentFrame);
+        CollectionFreeFormDocumentView.updateKeyframe(childDocs, currentFrame || 0, tagDoc);
+        tagDoc._currentFrame = Math.max(0, (currentFrame || 0) + 1);
+        tagDoc.lastFrame = Math.max(NumCast(tagDoc._currentFrame), NumCast(tagDoc.lastFrame));
+    }
+
+    @action
+    prevKeyframe = (tagDoc: Doc, actItem: Doc): void => {
+        const childDocs = DocListCast(tagDoc[Doc.LayoutFieldKey(tagDoc)]);
+        const currentFrame = Cast(tagDoc._currentFrame, "number", null);
+        if (currentFrame === undefined) {
+            tagDoc._currentFrame = 0;
+            // CollectionFreeFormDocumentView.setupKeyframes(childDocs, 0);
+        }
+        CollectionFreeFormDocumentView.gotoKeyframe(childDocs.slice());
+        tagDoc._currentFrame = Math.max(0, (currentFrame || 0) - 1);
+    }
+
+    /**
+     * Returns the collection type as a string for headers
+     */
+    @computed get stringType(): string {
+        const activeItem: Doc = this.activeItem;
+        const targetDoc: Doc = this.targetDoc;
+        let type: string = '';
+        if (activeItem) {
+            switch (targetDoc.type) {
+                case DocumentType.PDF: type = "PDF"; break;
+                case DocumentType.RTF: type = "Text node"; break;
+                case DocumentType.COL: type = "Collection"; break;
+                case DocumentType.AUDIO: type = "Audio"; break;
+                case DocumentType.VID: type = "Video"; break;
+                case DocumentType.IMG: type = "Image"; break;
+                case DocumentType.WEB: type = "Web page"; break;
+                default: type = "Other node"; break;
+            }
+        }
+        return type;
+    }
+
+    @observable private openActiveColorPicker: boolean = false;
+    @observable private openViewedColorPicker: boolean = false;
+
+
+
+    @computed get progressivizeDropdown() {
+        const activeItem: Doc = this.activeItem;
+        const targetDoc: Doc = this.targetDoc;
+        if (activeItem && targetDoc) {
+            const activeFontColor = targetDoc["pres-text-color"] ? StrCast(targetDoc["pres-text-color"]) : "Black";
+            const viewedFontColor = targetDoc["pres-text-viewed-color"] ? StrCast(targetDoc["pres-text-viewed-color"]) : "Black";
+            return (
+                <div>
+                    <div className={`presBox-ribbon ${this.progressivizeTools && this.layoutDoc.presStatus === "edit" ? "active" : ""}`} onClick={e => e.stopPropagation()} onPointerUp={e => e.stopPropagation()} onPointerDown={e => e.stopPropagation()}>
+                        <div className="ribbon-box">
+                            {this.stringType} selected
+                            <div className="ribbon-doubleButton" style={{ borderTop: 'solid 1px darkgrey', display: (targetDoc.type === DocumentType.COL && targetDoc._viewType === 'freeform') || targetDoc.type === DocumentType.IMG || targetDoc.type === DocumentType.RTF ? "inline-flex" : "none" }}>
+                                <div className="ribbon-toggle" style={{ backgroundColor: activeItem.presProgressivize ? Colors.LIGHT_BLUE : "" }} onClick={this.progressivizeChild}>Contents</div>
+                                <div className="ribbon-toggle" style={{ opacity: activeItem.presProgressivize ? 1 : 0.4, backgroundColor: targetDoc.editProgressivize ? Colors.LIGHT_BLUE : "" }} onClick={this.editProgressivize}>Edit</div>
+                            </div>
+                            <div className="ribbon-doubleButton" style={{ display: activeItem.presProgressivize ? "inline-flex" : "none" }}>
+                                <div className="presBox-subheading">Active text color</div>
+                                <div className="ribbon-colorBox" style={{ backgroundColor: activeFontColor, height: 15, width: 15 }} onClick={action(() => { this.openActiveColorPicker = !this.openActiveColorPicker; })}>
+                                </div>
+                            </div>
+                            {this.activeColorPicker}
+                            <div className="ribbon-doubleButton" style={{ display: activeItem.presProgressivize ? "inline-flex" : "none" }}>
+                                <div className="presBox-subheading">Viewed font color</div>
+                                <div className="ribbon-colorBox" style={{ backgroundColor: viewedFontColor, height: 15, width: 15 }} onClick={action(() => this.openViewedColorPicker = !this.openViewedColorPicker)}>
+                                </div>
+                            </div>
+                            {this.viewedColorPicker}
+                            <div className="ribbon-doubleButton" style={{ borderTop: 'solid 1px darkgrey', display: (targetDoc.type === DocumentType.COL && targetDoc._viewType === 'freeform') || targetDoc.type === DocumentType.IMG ? "inline-flex" : "none" }}>
+                                <div className="ribbon-toggle" style={{ backgroundColor: activeItem.zoomProgressivize ? Colors.LIGHT_BLUE : "" }} onClick={this.progressivizeZoom}>Zoom</div>
+                                <div className="ribbon-toggle" style={{ opacity: activeItem.zoomProgressivize ? 1 : 0.4, backgroundColor: activeItem.editZoomProgressivize ? Colors.LIGHT_BLUE : "" }} onClick={this.editZoomProgressivize}>Edit</div>
+                            </div>
+                            <div className="ribbon-doubleButton" style={{ borderTop: 'solid 1px darkgrey', display: targetDoc._viewType === "stacking" || targetDoc.type === DocumentType.PDF || targetDoc.type === DocumentType.WEB || targetDoc.type === DocumentType.RTF ? "inline-flex" : "none" }}>
+                                <div className="ribbon-toggle" style={{ backgroundColor: activeItem.scrollProgressivize ? Colors.LIGHT_BLUE : "" }} onClick={this.progressivizeScroll}>Scroll</div>
+                                <div className="ribbon-toggle" style={{ opacity: activeItem.scrollProgressivize ? 1 : 0.4, backgroundColor: targetDoc.editScrollProgressivize ? Colors.LIGHT_BLUE : "" }} onClick={this.editScrollProgressivize}>Edit</div>
+                            </div>
+                        </div>
+                        <div className="ribbon-final-box">
+                            Frames
+                            <div className="ribbon-doubleButton">
+                                <div className="ribbon-frameSelector">
+                                    <div key="back" title="back frame" className="backKeyframe" onClick={e => { e.stopPropagation(); this.prevKeyframe(targetDoc, activeItem); }}>
+                                        <FontAwesomeIcon icon={"caret-left"} size={"lg"} />
+                                    </div>
+                                    <div key="num" title="toggle view all" className="numKeyframe" style={{ color: targetDoc.keyFrameEditing ? "white" : "black", backgroundColor: targetDoc.keyFrameEditing ? Colors.MEDIUM_BLUE : Colors.LIGHT_BLUE }}
+                                        onClick={action(() => targetDoc.keyFrameEditing = !targetDoc.keyFrameEditing)} >
+                                        {NumCast(targetDoc._currentFrame)}
+                                    </div>
+                                    <div key="fwd" title="forward frame" className="fwdKeyframe" onClick={e => { e.stopPropagation(); this.nextKeyframe(targetDoc, activeItem); }}>
+                                        <FontAwesomeIcon icon={"caret-right"} size={"lg"} />
+                                    </div>
+                                </div>
+                                <Tooltip title={<><div className="dash-tooltip">{"Last frame"}</div></>}><div className="ribbon-property">{NumCast(targetDoc.lastFrame)}</div></Tooltip>
+                            </div>
+                            <div className="ribbon-frameList">
+                                {this.frameListHeader}
+                                {this.frameList}
+                            </div>
+                            <div className="ribbon-toggle" style={{ height: 20, backgroundColor: Colors.LIGHT_BLUE }} onClick={() => console.log(" TODO: play frames")}>Play</div>
+                        </div>
+                    </div>
+                </div>
+            );
+        }
+    }
+
+    @undoBatch
+    @action
+    switchActive = (color: ColorState) => {
+        const activeItem: Doc = this.activeItem;
+        const targetDoc: Doc = this.targetDoc;
+        const val = String(color.hex);
+        targetDoc["pres-text-color"] = val;
+        return true;
+    }
+    @undoBatch
+    @action
+    switchPresented = (color: ColorState) => {
+        const activeItem: Doc = this.activeItem;
+        const targetDoc: Doc = this.targetDoc;
+        const val = String(color.hex);
+        targetDoc["pres-text-viewed-color"] = val;
+        return true;
+    }
+
+    @computed get activeColorPicker() {
+        const activeItem: Doc = this.activeItem;
+        const targetDoc: Doc = this.targetDoc;
+        return !this.openActiveColorPicker ? (null) : <SketchPicker onChange={this.switchActive}
+            presetColors={['#D0021B', '#F5A623', '#F8E71C', '#8B572A', '#7ED321', '#417505',
+                '#9013FE', '#4A90E2', '#50E3C2', '#B8E986', '#000000', '#4A4A4A', '#9B9B9B',
+                '#FFFFFF', '#f1efeb', 'transparent']}
+            color={StrCast(targetDoc["pres-text-color"])} />;
+    }
+
+    @computed get viewedColorPicker() {
+        const activeItem: Doc = this.activeItem;
+        const targetDoc: Doc = this.targetDoc;
+        return !this.openViewedColorPicker ? (null) : <SketchPicker onChange={this.switchPresented}
+            presetColors={['#D0021B', '#F5A623', '#F8E71C', '#8B572A', '#7ED321', '#417505',
+                '#9013FE', '#4A90E2', '#50E3C2', '#B8E986', '#000000', '#4A4A4A', '#9B9B9B',
+                '#FFFFFF', '#f1efeb', 'transparent']}
+            color={StrCast(targetDoc["pres-text-viewed-color"])} />;
+    }
+
+    @action
+    turnOffEdit = (paths?: boolean) => {
+        // Turn off paths
+        if (paths) {
+            const srcContext = Cast(this.rootDoc.presCollection, Doc, null);
+            if (srcContext) this.togglePath(srcContext, true);
+        }
+        // Turn off the progressivize editors for each document
+        this.childDocs.forEach((doc) => {
+            doc.editSnapZoomProgressivize = false;
+            doc.editZoomProgressivize = false;
+            const targetDoc = Cast(doc.presentationTargetDoc, Doc, null);
+            if (targetDoc) {
+                targetDoc.editZoomProgressivize = false;
+                // targetDoc.editScrollProgressivize = false;
+            }
+        });
+    }
+
+    //Toggle whether the user edits or not
+    @action
+    editZoomProgressivize = (e: React.MouseEvent) => {
+        const activeItem: Doc = this.activeItem;
+        const targetDoc: Doc = this.targetDoc;
+        if (!targetDoc.editZoomProgressivize) {
+            if (!activeItem.zoomProgressivize) activeItem.zoomProgressivize = true; targetDoc.zoomProgressivize = true;
+            targetDoc.editZoomProgressivize = true;
+            activeItem.editZoomProgressivize = true;
+        } else {
+            targetDoc.editZoomProgressivize = false;
+            activeItem.editZoomProgressivize = false;
+        }
+    }
+
+    //Toggle whether the user edits or not
+    @action
+    editScrollProgressivize = (e: React.MouseEvent) => {
+        const activeItem: Doc = this.activeItem;
+        const targetDoc: Doc = this.targetDoc;
+        if (!targetDoc.editScrollProgressivize) {
+            if (!targetDoc.scrollProgressivize) { targetDoc.scrollProgressivize = true; activeItem.scrollProgressivize = true; }
+            targetDoc.editScrollProgressivize = true;
+        } else {
+            targetDoc.editScrollProgressivize = false;
+        }
+    }
+
+    //Progressivize Zoom
+    @action
+    progressivizeScroll = (e: React.MouseEvent) => {
+        e.stopPropagation();
+        const activeItem: Doc = this.activeItem;
+        activeItem.scrollProgressivize = !activeItem.scrollProgressivize;
+        const targetDoc: Doc = this.targetDoc;
+        targetDoc.scrollProgressivize = !targetDoc.scrollProgressivize;
+        // CollectionFreeFormDocumentView.setupScroll(targetDoc, NumCast(targetDoc._currentFrame));
+        if (targetDoc.editScrollProgressivize) {
+            targetDoc.editScrollProgressivize = false;
+            targetDoc._currentFrame = 0;
+            targetDoc.lastFrame = 0;
+        }
+    }
+
+    //Progressivize Zoom
+    @action
+    progressivizeZoom = (e: React.MouseEvent) => {
+        e.stopPropagation();
+        const activeItem: Doc = this.activeItem;
+        activeItem.zoomProgressivize = !activeItem.zoomProgressivize;
+        const targetDoc: Doc = this.targetDoc;
+        targetDoc.zoomProgressivize = !targetDoc.zoomProgressivize;
+        CollectionFreeFormDocumentView.setupZoom(activeItem, targetDoc);
+        if (activeItem.editZoomProgressivize) {
+            activeItem.editZoomProgressivize = false;
+            targetDoc._currentFrame = 0;
+            targetDoc.lastFrame = 0;
+        }
+    }
+
+    //Progressivize Child Docs
+    @action
+    editProgressivize = (e: React.MouseEvent) => {
+        const activeItem: Doc = this.activeItem;
+        const targetDoc: Doc = this.targetDoc;
+        targetDoc._currentFrame = targetDoc.lastFrame;
+        if (!targetDoc.editProgressivize) {
+            if (!activeItem.presProgressivize) { activeItem.presProgressivize = true; targetDoc.presProgressivize = true; }
+            targetDoc.editProgressivize = true;
+        } else {
+            targetDoc.editProgressivize = false;
+        }
+    }
+
+    @action
+    progressivizeChild = (e: React.MouseEvent) => {
+        e.stopPropagation();
+        const activeItem: Doc = this.activeItem;
+        const targetDoc: Doc = this.targetDoc;
+        const docs = DocListCast(targetDoc[Doc.LayoutFieldKey(targetDoc)]);
+        if (!activeItem.presProgressivize) {
+            targetDoc.keyFrameEditing = false;
+            activeItem.presProgressivize = true;
+            targetDoc.presProgressivize = true;
+            targetDoc._currentFrame = 0;
+            docs.forEach((doc, i) => CollectionFreeFormDocumentView.setupKeyframes([doc], i, true));
+            targetDoc.lastFrame = targetDoc.lastFrame ? NumCast(targetDoc.lastFrame) : docs.length - 1;
+        } else {
+            // targetDoc.editProgressivize = false;
+            activeItem.presProgressivize = false;
+            targetDoc.presProgressivize = false;
+            targetDoc._currentFrame = 0;
+            targetDoc.keyFrameEditing = true;
+        }
+    }
+
+    @action
+    checkMovementLists = (doc: Doc, xlist: any, ylist: any) => {
+        const x: List<number> = xlist;
+        const y: List<number> = ylist;
+        const tags: JSX.Element[] = [];
+        let pathPoints = ""; //List of all of the pathpoints that need to be added
+        for (let i = 0; i < x.length - 1; i++) {
+            if (y[i] || x[i]) {
+                if (i === 0) pathPoints = (x[i] - 11) + "," + (y[i] + 33);
+                else pathPoints = pathPoints + " " + (x[i] - 11) + "," + (y[i] + 33);
+                tags.push(<div className="progressivizeMove-frame" style={{ position: 'absolute', top: y[i], left: x[i] }}>{i}</div>);
+            }
+        }
+        tags.push(<svg style={{ overflow: 'visible', position: 'absolute' }}><polyline
+            points={pathPoints}
+            style={{
+                position: 'absolute',
+                opacity: 1,
+                stroke: "#000000",
+                strokeWidth: 2,
+                strokeDasharray: '10 5',
+            }}
+            fill="none"
+        /></svg>);
+        return tags;
+    }
+
+    @observable
+    toggleDisplayMovement = (doc: Doc) => {
+        if (doc.displayMovement) doc.displayMovement = false;
+        else doc.displayMovement = true;
+    }
+
+    @action
+    checkList = (doc: Doc, list: any): number => {
+        const x: List<number> = list;
+        if (x && x.length >= NumCast(doc._currentFrame) + 1) {
+            return x[NumCast(doc._currentFrame)];
+        } else if (x) {
+            x.length = NumCast(doc._currentFrame) + 1;
+            x[NumCast(doc._currentFrame)] = x[NumCast(doc._currentFrame) - 1];
+            return x[NumCast(doc._currentFrame)];
+        } else return 100;
+    }
+
+    @computed get progressivizeChildDocs() {
+        const targetDoc: Doc = this.targetDoc;
+        const docs = DocListCast(targetDoc[Doc.LayoutFieldKey(targetDoc)]);
+        const tags: JSX.Element[] = [];
+        docs.forEach((doc, index) => {
+            if (doc["x-indexed"] && doc["y-indexed"]) {
+                tags.push(<div style={{ position: 'absolute', display: doc.displayMovement ? "block" : "none" }}>{this.checkMovementLists(doc, doc["x-indexed"], doc["y-indexed"])}</div>);
+            }
+            tags.push(
+                <div className="progressivizeButton" key={index} onPointerLeave={() => { if (NumCast(targetDoc._currentFrame) < NumCast(doc.appearFrame)) doc.opacity = 0; }} onPointerOver={() => { if (NumCast(targetDoc._currentFrame) < NumCast(doc.appearFrame)) doc.opacity = 0.5; }} onClick={e => { this.toggleDisplayMovement(doc); e.stopPropagation(); }} style={{ backgroundColor: doc.displayMovement ? Colors.LIGHT_BLUE : "#c8c8c8", top: NumCast(doc.y), left: NumCast(doc.x) }}>
+                    <div className="progressivizeButton-prev"><FontAwesomeIcon icon={"caret-left"} size={"lg"} onClick={e => { e.stopPropagation(); this.prevAppearFrame(doc, index); }} /></div>
+                    <div className="progressivizeButton-frame">{doc.appearFrame}</div>
+                    <div className="progressivizeButton-next"><FontAwesomeIcon icon={"caret-right"} size={"lg"} onClick={e => { e.stopPropagation(); this.nextAppearFrame(doc, index); }} /></div>
+                </div>);
+        });
+        return tags;
+    }
+
+    @action
+    nextAppearFrame = (doc: Doc, i: number): void => {
+        // const activeItem = Cast(this.childDocs[this.itemIndex], Doc, null);
+        // const targetDoc = Cast(activeItem?.presentationTargetDoc, Doc, null);
+        const appearFrame = Cast(doc.appearFrame, "number", null);
+        if (appearFrame === undefined) {
+            doc.appearFrame = 0;
+        }
+        doc.appearFrame = appearFrame + 1;
+        this.updateOpacityList(doc["opacity-indexed"], NumCast(doc.appearFrame));
+    }
+
+    @action
+    prevAppearFrame = (doc: Doc, i: number): void => {
+        // const activeItem = Cast(this.childDocs[this.itemIndex], Doc, null);
+        // const targetDoc = Cast(activeItem?.presentationTargetDoc, Doc, null);
+        const appearFrame = Cast(doc.appearFrame, "number", null);
+        if (appearFrame === undefined) {
+            doc.appearFrame = 0;
+        }
+        doc.appearFrame = Math.max(0, appearFrame - 1);
+        this.updateOpacityList(doc["opacity-indexed"], NumCast(doc.appearFrame));
+    }
+
+    @action
+    updateOpacityList = (list: any, frame: number) => {
+        const x: List<number> = list;
+        if (x && x.length >= frame) {
+            for (let i = 0; i < x.length; i++) {
+                if (i < frame) {
+                    x[i] = 0;
+                } else if (i >= frame) {
+                    x[i] = 1;
+                }
+            }
+            list = x;
+        } else {
+            x.length = frame + 1;
+            for (let i = 0; i < x.length; i++) {
+                if (i < frame) {
+                    x[i] = 0;
+                } else if (i >= frame) {
+                    x[i] = 1;
+                }
+            }
+            list = x;
+        }
+    }
+
+    @computed get moreInfoDropdown() {
+        return (<div></div>);
+    }
+
+    @computed
+    get toolbarWidth(): number {
+        const width = this.props.PanelWidth();
+        return width;
+    }
+
+    @action
+    toggleProperties = () => {
+        if (CurrentUserUtils.propertiesWidth > 0) {
+            CurrentUserUtils.propertiesWidth = 0;
+        } else {
+            CurrentUserUtils.propertiesWidth = 250;
+        }
+    }
+
+    @computed get toolbar() {
+        const propIcon = CurrentUserUtils.propertiesWidth > 0 ? "angle-double-right" : "angle-double-left";
+        const propTitle = CurrentUserUtils.propertiesWidth > 0 ? "Close Presentation Panel" : "Open Presentation Panel";
+        const mode = StrCast(this.rootDoc._viewType) as CollectionViewType;
+        const isMini: boolean = this.toolbarWidth <= 100;
+        const presKeyEvents: boolean = (this.isPres && this._presKeyEventsActive && this.rootDoc === Doc.UserDoc().activePresentation);
+        const activeColor = Colors.LIGHT_BLUE;
+        const inactiveColor = Colors.WHITE;
+        return (mode === CollectionViewType.Carousel3D) ? (null) : (
+            <div id="toolbarContainer" className={'presBox-toolbar'}>
+                {/* <Tooltip title={<><div className="dash-tooltip">{"Add new slide"}</div></>}><div className={`toolbar-button ${this.newDocumentTools ? "active" : ""}`} onClick={action(() => this.newDocumentTools = !this.newDocumentTools)}>
+                    <FontAwesomeIcon icon={"plus"} />
+                    <FontAwesomeIcon className={`dropdown ${this.newDocumentTools ? "active" : ""}`} icon={"angle-down"} />
+                </div></Tooltip> */}
+                <Tooltip title={<><div className="dash-tooltip">{"View paths"}</div></>}>
+                    <div style={{ opacity: this.childDocs.length > 1 && this.layoutDoc.presCollection ? 1 : 0.3, color: this._pathBoolean ? Colors.MEDIUM_BLUE : 'white', width: isMini ? "100%" : undefined }} className={"toolbar-button"} onClick={this.childDocs.length > 1 && this.layoutDoc.presCollection ? this.viewPaths : undefined}>
+                        <FontAwesomeIcon icon={"exchange-alt"} />
+                    </div>
+                </Tooltip>
+                {isMini ? (null) :
+                    <>
+                        <div className="toolbar-divider" />
+                        {/* <Tooltip title={<><div className="dash-tooltip">{this._expandBoolean ? "Minimize all" : "Expand all"}</div></>}>
+                            <div className={"toolbar-button"}
+                                style={{ color: this._expandBoolean ? Colors.MEDIUM_BLUE : 'white' }}
+                                onClick={this.toggleExpandMode}>
+                                <FontAwesomeIcon icon={"eye"} />
+                            </div>
+                        </Tooltip>
+                        <div className="toolbar-divider" /> */}
+                        <Tooltip title={<><div className="dash-tooltip">{presKeyEvents ? "Keys are active" : "Keys are not active - click anywhere on the presentation trail to activate keys"}</div></>}>
+                            <div className="toolbar-button" style={{ cursor: presKeyEvents ? 'default' : 'pointer', position: 'absolute', right: 30, fontSize: 16 }}>
+                                <FontAwesomeIcon className={"toolbar-thumbtack"} icon={"keyboard"} style={{ color: presKeyEvents ? activeColor : inactiveColor }} />
+                            </div>
+                        </Tooltip>
+                        <Tooltip title={<><div className="dash-tooltip">{propTitle}</div></>}>
+                            <div className="toolbar-button" style={{ position: 'absolute', right: 4, fontSize: 16 }} onClick={this.toggleProperties}>
+                                <FontAwesomeIcon className={"toolbar-thumbtack"} icon={propIcon} style={{ color: CurrentUserUtils.propertiesWidth > 0 ? activeColor : inactiveColor }} />
+                            </div>
+                        </Tooltip>
+                    </>
+                }
+            </div>
+        );
+    }
+
+    /**
+     * Top panel containes:
+     * viewPicker: The option to choose between List and Slides view for the presentaiton trail
+     * presentPanel: The button to start the presentation / open minimized view of the presentation
+     */
+    @computed get topPanel() {
+        const mode = StrCast(this.rootDoc._viewType) as CollectionViewType;
+        const isMini: boolean = this.toolbarWidth <= 100;
+        return (
+            <div className="presBox-buttons" style={{ display: !this.rootDoc._chromeHidden ? "none" : undefined }}>
+                {isMini ? (null) : <select className="presBox-viewPicker"
+                    style={{ display: this.layoutDoc.presStatus === "edit" ? "block" : "none" }}
+                    onPointerDown={e => e.stopPropagation()}
+                    onChange={this.viewChanged}
+                    value={mode}>
+                    <option onPointerDown={e => e.stopPropagation()} value={CollectionViewType.Stacking}>List</option>
+                    <option onPointerDown={e => e.stopPropagation()} value={CollectionViewType.Carousel3D}>3D Carousel</option>
+                </select>}
+                <div className="presBox-presentPanel" style={{ opacity: this.childDocs.length ? 1 : 0.3 }}>
+                    <span className={`presBox-button ${this.layoutDoc.presStatus === "edit" ? "present" : ""}`}>
+                        <div className="presBox-button-left"
+                            onClick={undoBatch(() => {
+                                if (this.childDocs.length) {
+                                    this.layoutDoc.presStatus = "manual";
+                                    this.gotoDocument(this.itemIndex, this.activeItem);
+                                }
+                            })}>
+                            <FontAwesomeIcon icon={"play-circle"} />
+                            <div style={{ display: this.props.PanelWidth() > 200 ? "inline-flex" : "none" }}>&nbsp; Present</div>
+                        </div>
+                        {(mode === CollectionViewType.Carousel3D || isMini) ? (null) : <div className={`presBox-button-right ${this.presentTools ? "active" : ""}`}
+                            onClick={(action(() => {
+                                if (this.childDocs.length) this.presentTools = !this.presentTools;
+                            }))}>
+                            <FontAwesomeIcon className="dropdown" style={{ margin: 0, transform: this.presentTools ? 'rotate(180deg)' : 'rotate(0deg)' }} icon={"angle-down"} />
+                            {this.presentDropdown}
+                        </div>}
+                    </span>
+                    {this.playButtons}
+                </div>
+            </div>
+        );
+    }
+
+    @action
+    getList = (list: any): List<number> => {
+        const x: List<number> = list;
+        return x;
+    }
+
+    @action
+    updateList = (list: any): List<number> => {
+        const targetDoc: Doc = this.targetDoc;
+        const x: List<number> = list;
+        x.length + 1;
+        x[x.length - 1] = NumCast(targetDoc._scrollY);
+        return x;
+    }
+
+    @action
+    newFrame = () => {
+        const activeItem: Doc = this.activeItem;
+        const targetDoc: Doc = this.targetDoc;
+        const type: string = StrCast(targetDoc.type);
+        if (!activeItem.frameList) activeItem.frameList = new List<number>();
+        switch (type) {
+            case (DocumentType.PDF || DocumentType.RTF || DocumentType.WEB):
+                this.updateList(activeItem.frameList);
+                break;
+            case DocumentType.COL:
+                break;
+            default:
+                break;
+        }
+    }
+
+    @computed get frameListHeader() {
+        return (<div className="frameList-header">
+            &nbsp; Frames {this.panable ? <i>Panable</i> : this.scrollable ? <i>Scrollable</i> : (null)}
+            <div className={"frameList-headerButtons"}>
+                <Tooltip title={<><div className="dash-tooltip">{"Add frame by example"}</div></>}><div className={"headerButton"} onClick={e => { e.stopPropagation(); this.newFrame(); }}>
+                    <FontAwesomeIcon icon={"plus"} onPointerDown={e => e.stopPropagation()} />
+                </div></Tooltip>
+                <Tooltip title={<><div className="dash-tooltip">{"Edit in collection"}</div></>}><div className={"headerButton"} onClick={e => { e.stopPropagation(); console.log('New frame'); }}>
+                    <FontAwesomeIcon icon={"edit"} onPointerDown={e => e.stopPropagation()} />
+                </div></Tooltip>
+            </div>
+        </div>);
+    }
+
+    @computed get frameList() {
+        const activeItem: Doc = this.activeItem;
+        const targetDoc: Doc = this.targetDoc;
+        const frameList: List<number> = this.getList(activeItem.frameList);
+        if (frameList) {
+            const frameItems = frameList.map((value) =>
+                <div className="framList-item">
+
+                </div>
+            );
+            return (
+
+                <div className="frameList-container">
+                    {frameItems}
+                </div>
+            );
+        } else return (null);
+
+    }
+
+    @computed get playButtonFrames() {
+        const targetDoc: Doc = this.targetDoc;
+        return (
+            <>
+                {this.targetDoc ? <div className="presPanel-button-frame" style={{ display: targetDoc.lastFrame !== undefined && targetDoc.lastFrame >= 0 ? "inline-flex" : "none" }}>
+                    <div>{targetDoc._currentFrame}</div>
+                    <div className="presPanel-divider" style={{ border: 'solid 0.5px white', height: '60%' }}></div>
+                    <div>{targetDoc.lastFrame}</div>
+                </div> : null}
+            </>
+        );
+    }
+
+    @computed get playButtons() {
+        const presEnd: boolean = !this.layoutDoc.presLoop && (this.itemIndex === this.childDocs.length - 1);
+        const presStart: boolean = !this.layoutDoc.presLoop && (this.itemIndex === 0);
+        // Case 1: There are still other frames and should go through all frames before going to next slide
+        return (<div className="presPanelOverlay" style={{ display: this.layoutDoc.presStatus !== "edit" ? "inline-flex" : "none" }}>
+            <Tooltip title={<><div className="dash-tooltip">{"Loop"}</div></>}><div className="presPanel-button" style={{ color: this.layoutDoc.presLoop ? Colors.MEDIUM_BLUE : 'white' }} onClick={() => this.layoutDoc.presLoop = !this.layoutDoc.presLoop}><FontAwesomeIcon icon={"redo-alt"} /></div></Tooltip>
+            <div className="presPanel-divider"></div>
+            <div className="presPanel-button" style={{ opacity: presStart ? 0.4 : 1 }} onClick={() => { this.back(); if (this._presTimer) { clearTimeout(this._presTimer); this.layoutDoc.presStatus = PresStatus.Manual; } }}><FontAwesomeIcon icon={"arrow-left"} /></div>
+            <Tooltip title={<><div className="dash-tooltip">{this.layoutDoc.presStatus === PresStatus.Autoplay ? "Pause" : "Autoplay"}</div></>}><div className="presPanel-button" onClick={this.startOrPause}><FontAwesomeIcon icon={this.layoutDoc.presStatus === PresStatus.Autoplay ? "pause" : "play"} /></div></Tooltip>
+            <div className="presPanel-button" style={{ opacity: presEnd ? 0.4 : 1 }} onClick={() => { this.next(); if (this._presTimer) { clearTimeout(this._presTimer); this.layoutDoc.presStatus = PresStatus.Manual; } }}><FontAwesomeIcon icon={"arrow-right"} /></div>
+            <div className="presPanel-divider"></div>
+            <Tooltip title={<><div className="dash-tooltip">{"Click to return to 1st slide"}</div></>}><div className="presPanel-button" style={{ border: 'solid 1px white' }} onClick={() => this.gotoDocument(0, this.activeItem)}><b>1</b></div></Tooltip>
+            <div
+                className="presPanel-button-text"
+                onClick={() => this.gotoDocument(0, this.activeItem)}
+                style={{ display: this.props.PanelWidth() > 250 ? "inline-flex" : "none" }}>
+                Slide {this.itemIndex + 1} / {this.childDocs.length}
+                {this.playButtonFrames}
+            </div>
+            <div className="presPanel-divider"></div>
+            {this.props.PanelWidth() > 250 ? <div className="presPanel-button-text" onClick={undoBatch(action(() => { this.layoutDoc.presStatus = "edit"; clearTimeout(this._presTimer); }))}>EXIT</div>
+                : <div className="presPanel-button" onClick={undoBatch(action(() => this.layoutDoc.presStatus = "edit"))}>
+                    <FontAwesomeIcon icon={"times"} />
+                </div>}
+        </div>);
+    }
+
+    @action
+    startOrPause = () => {
+        if (this.layoutDoc.presStatus === PresStatus.Manual || this.layoutDoc.presStatus === PresStatus.Edit) this.startAutoPres(this.itemIndex);
+        else this.pauseAutoPres();
+    }
+
+    render() {
+        // calling this method for keyEvents
+        this.isPres;
+        // needed to ensure that the childDocs are loaded for looking up fields
+        this.childDocs.slice();
+        const mode = StrCast(this.rootDoc._viewType) as CollectionViewType;
+        const presKeyEvents: boolean = (this.isPres && this._presKeyEventsActive && this.rootDoc === Doc.UserDoc().activePresentation);
+        const presEnd: boolean = !this.layoutDoc.presLoop && (this.itemIndex === this.childDocs.length - 1);
+        const presStart: boolean = !this.layoutDoc.presLoop && (this.itemIndex === 0);
+        return CurrentUserUtils.OverlayDocs.includes(this.rootDoc) ?
+            <div className="miniPres">
+                <div className="presPanelOverlay" style={{ display: "inline-flex", height: 30, background: '#323232', top: 0, zIndex: 3000000, boxShadow: presKeyEvents ? '0 0 0px 3px ' + Colors.MEDIUM_BLUE : undefined }}>
+                    <Tooltip title={<><div className="dash-tooltip">{"Loop"}</div></>}><div className="presPanel-button" style={{ color: this.layoutDoc.presLoop ? Colors.MEDIUM_BLUE : undefined }} onClick={() => this.layoutDoc.presLoop = !this.layoutDoc.presLoop}><FontAwesomeIcon icon={"redo-alt"} /></div></Tooltip>
+                    <div className="presPanel-divider"></div>
+                    <div className="presPanel-button" style={{ opacity: presStart ? 0.4 : 1 }} onClick={() => { this.back(); if (this._presTimer) { clearTimeout(this._presTimer); this.layoutDoc.presStatus = PresStatus.Manual; } }}><FontAwesomeIcon icon={"arrow-left"} /></div>
+                    <Tooltip title={<><div className="dash-tooltip">{this.layoutDoc.presStatus === PresStatus.Autoplay ? "Pause" : "Autoplay"}</div></>}><div className="presPanel-button" onClick={this.startOrPause}><FontAwesomeIcon icon={this.layoutDoc.presStatus === "auto" ? "pause" : "play"} /></div></Tooltip>
+                    <div className="presPanel-button" style={{ opacity: presEnd ? 0.4 : 1 }} onClick={() => { this.next(); if (this._presTimer) { clearTimeout(this._presTimer); this.layoutDoc.presStatus = PresStatus.Manual; } }}><FontAwesomeIcon icon={"arrow-right"} /></div>
+                    <div className="presPanel-divider"></div>
+                    <Tooltip title={<><div className="dash-tooltip">{"Click to return to 1st slide"}</div></>}><div className="presPanel-button" style={{ border: 'solid 1px white' }} onClick={() => this.gotoDocument(0, this.activeItem)}><b>1</b></div></Tooltip>
+                    <div className="presPanel-button-text">
+                        Slide {this.itemIndex + 1} / {this.childDocs.length}
+                        {this.playButtonFrames}
+                    </div>
+                    <div className="presPanel-divider"></div>
+                    <div className="presPanel-button-text" onClick={undoBatch(action(() => { this.updateMinimize(); this.layoutDoc.presStatus = PresStatus.Edit; clearTimeout(this._presTimer); }))}>EXIT</div>
+                </div>
+            </div>
+            :
+            <div className="presBox-cont" style={{ minWidth: CurrentUserUtils.OverlayDocs.includes(this.layoutDoc) ? 240 : undefined }} >
+                {this.topPanel}
+                {this.toolbar}
+                {this.newDocumentToolbarDropdown}
+                <div className="presBox-listCont">
+                    {mode !== CollectionViewType.Invalid ?
+                        <CollectionView {...this.props}
+                            ContainingCollectionDoc={this.props.Document}
+                            PanelWidth={this.props.PanelWidth}
+                            PanelHeight={this.panelHeight}
+                            childIgnoreNativeSize={true}
+                            moveDocument={returnFalse}
+                            childFitWidth={returnTrue}
+                            childOpacity={returnOne}
+                            childLayoutTemplate={this.childLayoutTemplate}
+                            filterAddDocument={this.addDocumentFilter}
+                            removeDocument={returnFalse}
+                            dontRegisterView={true}
+                            focus={this.selectElement}
+                            ScreenToLocalTransform={this.getTransform}
+                        />
+                        : (null)
+                    }
+                </div>
+            </div>;
+    }
+}
+Scripting.addGlobal(function lookupPresBoxField(container: Doc, field: string, data: Doc) {
+    if (field === 'indexInPres') return DocListCast(container[StrCast(container.presentationFieldKey)]).indexOf(data);
+    if (field === 'presCollapsedHeight') return container._viewType === CollectionViewType.Stacking ? 35 : 31;
+    if (field === 'presStatus') return container.presStatus;
+    if (field === '_itemIndex') return container._itemIndex;
+    if (field === 'presBox') return container;
+    return undefined;
+});
\ No newline at end of file
diff --git a/src/client/views/nodes/trails/PresElementBox.scss b/src/client/views/nodes/trails/PresElementBox.scss
new file mode 100644
index 000000000..1ad4b820e
--- /dev/null
+++ b/src/client/views/nodes/trails/PresElementBox.scss
@@ -0,0 +1,235 @@
+$light-blue: #AEDDF8;
+$dark-blue: #5B9FDD;
+$light-background: #ececec;
+$slide-background: #d5dce2;
+$slide-active: #5B9FDD;
+
+.presItem-container {
+    cursor: grab;
+    display: grid;
+    grid-template-columns: 20px auto;
+    font-family: Roboto;
+    letter-spacing: normal;
+    position: relative;
+    pointer-events: all;
+    width: 100%;
+    height: 100%;
+    font-weight: 400;
+    -webkit-touch-callout: none;
+    -webkit-user-select: none;
+    -khtml-user-select: none;
+    -moz-user-select: none;
+    -ms-user-select: none;
+    user-select: none;
+    align-items: center;
+
+    .presItem-number {
+        margin-top: 3.5px;
+        font-size: 12px;
+        font-weight: 700;
+        text-align: center;
+        justify-self: center;
+        align-self: flex-start;
+        position: relative;
+        display: inline-block;
+        overflow: hidden;
+    }
+
+}
+
+.presItem-slide {
+    position: relative;
+    background-color: #d5dce2;
+    border-radius: 5px;
+    height: calc(100% - 7px);
+    width: calc(100% - 15px);
+    display: grid;
+    grid-template-rows: 16px 10px auto;
+    grid-template-columns: max-content max-content max-content max-content auto;
+
+    .presItem-name {
+        min-width: 20px;
+        z-index: 300;
+        top: 2px;
+        align-self: center;
+        font-size: 11px;
+        font-family: Roboto;
+        font-weight: 500;
+        position: relative;
+        padding-left: 10px;
+        padding-right: 10px;
+        letter-spacing: normal;
+        width: max-content;
+        text-overflow: ellipsis;
+        overflow: hidden;
+        white-space: pre;
+    }
+
+    .presItem-docName {
+        min-width: 20px;
+        z-index: 300;
+        align-self: center;
+        font-size: 9px;
+        font-family: Roboto;
+        font-weight: 300;
+        position: relative;
+        padding-left: 10px;
+        padding-right: 10px;
+        letter-spacing: normal;
+        width: max-content;
+        text-overflow: ellipsis;
+        overflow: hidden;
+        white-space: pre;
+        grid-row: 2;
+        grid-column: 1/6;
+    }
+
+    .presItem-time {
+        align-self: center;
+        position: relative;
+        padding-right: 10px;
+        top: 1px;
+        font-size: 10;
+        font-weight: 300;
+        font-family: Roboto;
+        z-index: 300;
+        letter-spacing: normal;
+    }
+
+    .presItem-embedded {
+        overflow: hidden;
+        grid-row: 3;
+        grid-column: 1/8;
+        position: relative;
+        display: flex;
+        width: auto;
+        justify-content: center;
+        margin: auto;
+        margin-bottom: 2px;
+        border-bottom-left-radius: 5px;
+        border-bottom-right-radius: 5px;
+    }
+
+    .presItem-embeddedMask {
+        width: 100%;
+        height: 100%;
+        position: absolute;
+        border-radius: 3px;
+        top: 0;
+        left: 0;
+        z-index: 1;
+        overflow: hidden;
+    }
+
+
+    .presItem-slideButtons {
+        display: flex;
+        grid-column: 7;
+        grid-row: 1/3;
+        width: max-content;
+        justify-self: right;
+        justify-content: flex-end;
+
+        .slideButton {
+            cursor: pointer;
+            position: relative;
+            border-radius: 100px;
+            z-index: 300;
+            width: 18px;
+            height: 18px;
+            display: flex;
+            font-size: 12px;
+            justify-self: center;
+            align-self: center;
+            background-color: rgba(0, 0, 0, 0.5);
+            color: white;
+            justify-content: center;
+            align-items: center;
+            transition: 0.2s;
+            margin-right: 3px;
+        }
+
+        .slideButton:hover {
+            background-color: rgba(0, 0, 0, 1);
+            transform: scale(1.2);
+        }
+    }
+}
+
+// .presItem-slide:hover {
+//     .presItem-slideButtons {
+//         display: flex;
+//         grid-column: 7;
+//         grid-row: 1/3;
+//         width: max-content;
+//         justify-self: right;
+//         justify-content: flex-end;
+
+//         .slideButton {
+//             cursor: pointer;
+//             position: relative;
+//             border-radius: 100px;
+//             z-index: 300;
+//             width: 18px;
+//             height: 18px;
+//             display: flex;
+//             font-size: 12px;
+//             justify-self: center;
+//             align-self: center;
+//             background-color: rgba(0, 0, 0, 0.5);
+//             color: white;
+//             justify-content: center;
+//             align-items: center;
+//             transition: 0.2s;
+//             margin-right: 3px;
+//         }
+
+//         .slideButton:hover {
+//             background-color: rgba(0, 0, 0, 1);
+//             transform: scale(1.2);
+//         }
+//     }
+// }
+
+.presItem-slide.active {
+    box-shadow: 0 0 0px 1.5px $dark-blue;
+}
+
+.presItem-multiDrag {
+    font-family: Roboto;
+    font-weight: 600;
+    color: white;
+    text-align: center;
+    justify-content: center;
+    align-content: center;
+    width: 100px;
+    height: 30px;
+    position: absolute;
+    background-color: $dark-blue;
+    z-index: 4000;
+    border-radius: 10px;
+    box-shadow: black 0.4vw 0.4vw 0.8vw;
+    line-height: 30px;
+}
+
+.presItem-miniSlide {
+    font-weight: 700;
+    font-size: 12;
+    grid-column: 1/8;
+    align-self: center;
+    justify-self: center;
+    background-color: #d5dce2;
+    width: 26px;
+    text-align: center;
+    height: 26px;
+    line-height: 28px;
+    border-radius: 100%;
+}
+
+.presItem-miniSlide.active {
+    box-shadow: 0 0 0px 1.5px $dark-blue;
+}
+
+// .presItem-slide:hover {
+//     background: $slide-hover;
+// }
\ No newline at end of file
diff --git a/src/client/views/nodes/trails/PresElementBox.tsx b/src/client/views/nodes/trails/PresElementBox.tsx
new file mode 100644
index 000000000..5e713c3cf
--- /dev/null
+++ b/src/client/views/nodes/trails/PresElementBox.tsx
@@ -0,0 +1,388 @@
+import { FontAwesomeIcon } from "@fortawesome/react-fontawesome";
+import { Tooltip } from "@material-ui/core";
+import { action, computed, IReactionDisposer, observable, reaction } from "mobx";
+import { observer } from "mobx-react";
+import { DataSym, Doc, Opt } from "../../../../fields/Doc";
+import { documentSchema } from '../../../../fields/documentSchemas';
+import { Id } from "../../../../fields/FieldSymbols";
+import { createSchema, makeInterface } from '../../../../fields/Schema';
+import { Cast, NumCast, StrCast } from "../../../../fields/Types";
+import { emptyFunction, returnFalse, returnTrue, setupMoveUpEvents, emptyPath, returnEmptyDoclist } from "../../../../Utils";
+import { DocumentType } from "../../../documents/DocumentTypes";
+import { CurrentUserUtils } from "../../../util/CurrentUserUtils";
+import { DocumentManager } from "../../../util/DocumentManager";
+import { DragManager } from "../../../util/DragManager";
+import { Transform } from "../../../util/Transform";
+import { undoBatch } from "../../../util/UndoManager";
+import { ViewBoxBaseComponent } from '../../DocComponent';
+import { EditableView } from "../../EditableView";
+import { DocumentView, DocumentViewProps } from "../../nodes/DocumentView";
+import { FieldView, FieldViewProps } from '../../nodes/FieldView';
+import { PresBox } from "./PresBox";
+import { Colors } from "../../global/globalEnums";
+import { StyleProp } from "../../StyleProvider";
+import "./PresElementBox.scss";
+import React = require("react");
+import { DocUtils } from "../../../documents/Documents";
+import { PresMovement } from "./PresEnums";
+
+export const presSchema = createSchema({
+    presentationTargetDoc: Doc,
+    presBox: Doc,
+    presZoomButton: "boolean",
+    presNavButton: "boolean",
+    presHideTillShownButton: "boolean",
+    presFadeButton: "boolean",
+    presHideAfterButton: "boolean",
+    presGroupButton: "boolean",
+    presExpandInlineButton: "boolean"
+});
+
+type PresDocument = makeInterface<[typeof presSchema, typeof documentSchema]>;
+const PresDocument = makeInterface(presSchema, documentSchema);
+/**
+ * This class models the view a document added to presentation will have in the presentation.
+ * It involves some functionality for its buttons and options.
+ */
+@observer
+export class PresElementBox extends ViewBoxBaseComponent<FieldViewProps, PresDocument>(PresDocument) {
+    public static LayoutString(fieldKey: string) { return FieldView.LayoutString(PresElementBox, fieldKey); }
+    _heightDisposer: IReactionDisposer | undefined;
+
+    @observable _dragging = false;
+    // these fields are conditionally computed fields on the layout document that take this document as a parameter
+    @computed get indexInPres() { return Number(this.lookupField("indexInPres")); }  // the index field is where this document is in the presBox display list (since this value is different for each presentation element, the value can't be stored on the layout template which is used by all display elements)
+    @computed get collapsedHeight() { return Number(this.lookupField("presCollapsedHeight")); } // the collapsed height changes depending on the state of the presBox.  We could store this on the presentation element template if it's used by only one presentation - but if it's shared by multiple, then this value must be looked up
+    @computed get presStatus() { return StrCast(this.lookupField("presStatus")); }
+    @computed get itemIndex() { return NumCast(this.lookupField("_itemIndex")); }
+    @computed get presBox() { return Cast(this.lookupField("presBox"), Doc, null); }
+    @computed get targetDoc() { return Cast(this.rootDoc.presentationTargetDoc, Doc, null) || this.rootDoc; }
+
+    componentDidMount() {
+        this.layoutDoc.hideLinkButton = true;
+        this._heightDisposer = reaction(() => [this.rootDoc.presExpandInlineButton, this.collapsedHeight],
+            params => this.layoutDoc._height = NumCast(params[1]) + (Number(params[0]) ? 100 : 0), { fireImmediately: true });
+    }
+    componentWillUnmount() {
+        this._heightDisposer?.();
+    }
+
+    /**
+     * Returns a local transformed coordinate array for given coordinates.
+     */
+    ScreenToLocalListTransform = (xCord: number, yCord: number) => [xCord, yCord];
+
+    @action
+    presExpandDocumentClick = () => {
+        this.rootDoc.presExpandInlineButton = !this.rootDoc.presExpandInlineButton;
+    }
+
+    embedHeight = (): number => 97;
+    // embedWidth = () => this.props.PanelWidth();
+    // embedHeight = () => Math.min(this.props.PanelWidth() - 20, this.props.PanelHeight() - this.collapsedHeight);
+    embedWidth = (): number => this.props.PanelWidth() - 35;
+    styleProvider = (doc: (Doc | undefined), props: Opt<DocumentViewProps>, property: string): any => {
+        if (property === StyleProp.Opacity) return 1;
+        return this.props.styleProvider?.(doc, props, property);
+    }
+    /**
+     * The function that is responsible for rendering a preview or not for this
+     * presentation element.
+     */
+    @computed get renderEmbeddedInline() {
+        return !this.rootDoc.presExpandInlineButton || !this.targetDoc ? (null) :
+            <div className="presItem-embedded" style={{ height: this.embedHeight(), width: this.embedWidth() }}>
+                <DocumentView
+                    Document={this.targetDoc}
+                    DataDoc={this.targetDoc[DataSym] !== this.targetDoc && this.targetDoc[DataSym]}
+                    styleProvider={this.styleProvider}
+                    layerProvider={this.props.layerProvider}
+                    docViewPath={returnEmptyDoclist}
+                    rootSelected={returnTrue}
+                    addDocument={returnFalse}
+                    removeDocument={returnFalse}
+                    isContentActive={this.props.isContentActive}
+                    addDocTab={returnFalse}
+                    pinToPres={returnFalse}
+                    PanelWidth={this.embedWidth}
+                    PanelHeight={this.embedHeight}
+                    ScreenToLocalTransform={Transform.Identity}
+                    moveDocument={this.props.moveDocument!}
+                    renderDepth={this.props.renderDepth + 1}
+                    focus={DocUtils.DefaultFocus}
+                    whenChildContentsActiveChanged={returnFalse}
+                    bringToFront={returnFalse}
+                    docFilters={this.props.docFilters}
+                    docRangeFilters={this.props.docRangeFilters}
+                    searchFilterDocs={this.props.searchFilterDocs}
+                    ContainingCollectionView={undefined}
+                    ContainingCollectionDoc={undefined}
+                    hideLinkButton={true}
+                />
+                <div className="presItem-embeddedMask" />
+            </div>;
+    }
+
+    @computed get duration() {
+        let durationInS: number;
+        if (this.rootDoc.type === DocumentType.AUDIO || this.rootDoc.type === DocumentType.VID) { durationInS = NumCast(this.rootDoc.presEndTime) - NumCast(this.rootDoc.presStartTime); durationInS = Math.round(durationInS * 10) / 10; }
+        else if (this.rootDoc.presDuration) durationInS = NumCast(this.rootDoc.presDuration) / 1000;
+        else durationInS = 2;
+        return "D: " + durationInS + "s";
+    }
+
+    @computed get transition() {
+        let transitionInS: number;
+        if (this.rootDoc.presTransition) transitionInS = NumCast(this.rootDoc.presTransition) / 1000;
+        else transitionInS = 0.5;
+        return this.rootDoc.presMovement === PresMovement.Jump || this.rootDoc.presMovement === PresMovement.None ? (null) : "M: " + transitionInS + "s";
+    }
+
+    private _itemRef: React.RefObject<HTMLDivElement> = React.createRef();
+    private _dragRef: React.RefObject<HTMLDivElement> = React.createRef();
+    private _titleRef: React.RefObject<EditableView> = React.createRef();
+
+
+    @action
+    headerDown = (e: React.PointerEvent<HTMLDivElement>) => {
+        const element = e.target as any;
+        e.stopPropagation();
+        e.preventDefault();
+        if (element && !(e.ctrlKey || e.metaKey)) {
+            if (PresBox.Instance._selectedArray.has(this.rootDoc)) {
+                PresBox.Instance._selectedArray.size === 1 && PresBox.Instance.regularSelect(this.rootDoc, this._itemRef.current!, this._dragRef.current!, false);
+                setupMoveUpEvents(this, e, this.startDrag, emptyFunction, emptyFunction);
+            } else {
+                setupMoveUpEvents(this, e, ((e: PointerEvent) => {
+                    PresBox.Instance.regularSelect(this.rootDoc, this._itemRef.current!, this._dragRef.current!, false);
+                    return this.startDrag(e);
+                }), emptyFunction, emptyFunction);
+            }
+        }
+    }
+
+    headerUp = (e: React.PointerEvent<HTMLDivElement>) => {
+        e.stopPropagation();
+        e.preventDefault();
+    }
+
+    startDrag = (e: PointerEvent) => {
+        const miniView: boolean = this.toolbarWidth <= 100;
+        const activeItem = this.rootDoc;
+        const dragArray = PresBox.Instance._dragArray;
+        const dragData = new DragManager.DocumentDragData(PresBox.Instance.sortArray());
+        const dragItem: HTMLElement[] = [];
+        if (dragArray.length === 1) {
+            const doc = dragArray[0];
+            doc.className = miniView ? "presItem-miniSlide" : "presItem-slide";
+            dragItem.push(doc);
+        } else if (dragArray.length >= 1) {
+            const doc = document.createElement('div');
+            doc.className = "presItem-multiDrag";
+            doc.innerText = "Move " + PresBox.Instance._selectedArray.size + " slides";
+            doc.style.position = 'absolute';
+            doc.style.top = (e.clientY) + 'px';
+            doc.style.left = (e.clientX - 50) + 'px';
+            dragItem.push(doc);
+        }
+
+        // const dropEvent = () => runInAction(() => this._dragging = false);
+        if (activeItem) {
+            DragManager.StartDocumentDrag(dragItem.map(ele => ele), dragData, e.clientX, e.clientY, undefined);
+            // runInAction(() => this._dragging = true);
+            return true;
+        }
+        return false;
+    }
+
+    onPointerOver = (e: any) => {
+        document.removeEventListener("pointermove", this.onPointerMove);
+        document.addEventListener("pointermove", this.onPointerMove);
+    }
+
+    onPointerMove = (e: PointerEvent) => {
+        const slide = this._itemRef.current!;
+        let dragIsPresItem: boolean = DragManager.docsBeingDragged.length > 0 ? true : false;
+        for (const doc of DragManager.docsBeingDragged) {
+            if (!doc.presentationTargetDoc) dragIsPresItem = false;
+        }
+        if (slide && dragIsPresItem) {
+            const rect = slide.getBoundingClientRect();
+            const y = e.clientY - rect.top;  //y position within the element.
+            const height = slide.clientHeight;
+            const halfLine = height / 2;
+            if (y <= halfLine) {
+                slide.style.borderTop = `solid 2px ${Colors.MEDIUM_BLUE}`;
+                slide.style.borderBottom = "0px";
+            } else if (y > halfLine) {
+                slide.style.borderTop = "0px";
+                slide.style.borderBottom = `solid 2px ${Colors.MEDIUM_BLUE}`;
+            }
+        }
+        document.removeEventListener("pointermove", this.onPointerMove);
+    }
+
+    onPointerLeave = (e: any) => {
+        this._itemRef.current!.style.borderTop = "0px";
+        this._itemRef.current!.style.borderBottom = "0px";
+        document.removeEventListener("pointermove", this.onPointerMove);
+    }
+
+    @action
+    toggleProperties = () => {
+        if (CurrentUserUtils.propertiesWidth < 5) {
+            action(() => (CurrentUserUtils.propertiesWidth = 250));
+        }
+    }
+
+    @undoBatch
+    removeItem = action((e: React.MouseEvent) => {
+        this.props.removeDocument?.(this.rootDoc);
+        if (PresBox.Instance._selectedArray.has(this.rootDoc)) {
+            PresBox.Instance._selectedArray.delete(this.rootDoc);
+        }
+        e.stopPropagation();
+    });
+
+    @undoBatch
+    @action
+    onSetValue = (value: string) => {
+        this.rootDoc.title = !value.trim().length ? "-untitled-" : value;
+        return true;
+    }
+
+    /**
+     * Method called for updating the view of the currently selected document
+     * 
+     * @param targetDoc 
+     * @param activeItem 
+     */
+    @undoBatch
+    @action
+    updateView = (targetDoc: Doc, activeItem: Doc) => {
+        if (targetDoc.type === DocumentType.PDF || targetDoc.type === DocumentType.WEB || targetDoc.type === DocumentType.RTF) {
+            const scroll = targetDoc._scrollTop;
+            activeItem.presPinViewScroll = scroll;
+        } else if (targetDoc.type === DocumentType.VID) {
+            activeItem.presPinTimecode = targetDoc._currentTimecode;
+        } else if (targetDoc.type === DocumentType.COMPARISON) {
+            const clipWidth = targetDoc._clipWidth;
+            activeItem.presPinClipWidth = clipWidth;
+        } else {
+            const x = targetDoc._panX;
+            const y = targetDoc._panY;
+            const scale = targetDoc._viewScale;
+            activeItem.presPinViewX = x;
+            activeItem.presPinViewY = y;
+            activeItem.presPinViewScale = scale;
+        }
+    }
+
+    @computed
+    get toolbarWidth(): number {
+        const presBoxDocView = DocumentManager.Instance.getDocumentView(this.presBox);
+        let width: number = NumCast(this.presBox._width);
+        if (presBoxDocView) width = presBoxDocView.props.PanelWidth();
+        if (width === 0) width = 300;
+        return width;
+    }
+
+    @computed get mainItem() {
+        const isSelected: boolean = PresBox.Instance._selectedArray.has(this.rootDoc);
+        const toolbarWidth: number = this.toolbarWidth;
+        const showMore: boolean = this.toolbarWidth >= 300;
+        const miniView: boolean = this.toolbarWidth <= 110;
+        const presBox: Doc = this.presBox; //presBox
+        const presBoxColor: string = StrCast(presBox._backgroundColor);
+        const presColorBool: boolean = presBoxColor ? (presBoxColor !== Colors.WHITE && presBoxColor !== "transparent") : false;
+        const targetDoc: Doc = this.targetDoc;
+        const activeItem: Doc = this.rootDoc;
+        return (
+            <div className={`presItem-container`}
+                key={this.props.Document[Id] + this.indexInPres}
+                ref={this._itemRef}
+                style={{
+                    backgroundColor: presColorBool ? isSelected ? "rgba(250,250,250,0.3)" : "transparent" : isSelected ? Colors.LIGHT_BLUE : "transparent",
+                    opacity: this._dragging ? 0.3 : 1
+                }}
+                onClick={e => {
+                    e.stopPropagation();
+                    e.preventDefault();
+                    PresBox.Instance.modifierSelect(this.rootDoc, this._itemRef.current!, this._dragRef.current!, !e.shiftKey && !e.ctrlKey && !e.metaKey, e.ctrlKey || e.metaKey, e.shiftKey);
+                }}
+                onDoubleClick={action(e => {
+                    this.toggleProperties();
+                    PresBox.Instance.regularSelect(this.rootDoc, this._itemRef.current!, this._dragRef.current!, true);
+                })}
+                onPointerOver={this.onPointerOver}
+                onPointerLeave={this.onPointerLeave}
+                onPointerDown={this.headerDown}
+                onPointerUp={this.headerUp}
+            >
+                {miniView ?
+                    // when width is LESS than 110 px 
+                    <div className={`presItem-miniSlide ${isSelected ? "active" : ""}`} ref={miniView ? this._dragRef : null}>
+                        {`${this.indexInPres + 1}.`}
+                    </div>
+                    :
+                    // when width is MORE than 110 px 
+                    <div className="presItem-number">
+                        {`${this.indexInPres + 1}.`}
+                    </div>}
+                {miniView ? (null) : <div ref={miniView ? null : this._dragRef} className={`presItem-slide ${isSelected ? "active" : ""}`}
+                    style={{
+                        backgroundColor: this.props.styleProvider?.(this.layoutDoc, this.props, StyleProp.BackgroundColor),
+                        boxShadow: presBoxColor && presBoxColor !== "white" && presBoxColor !== "transparent" ? isSelected ? "0 0 0px 1.5px" + presBoxColor : undefined : undefined
+                    }}>
+                    <div className="presItem-name" style={{ maxWidth: showMore ? (toolbarWidth - 195) : toolbarWidth - 105, cursor: isSelected ? 'text' : 'grab' }}>
+                        <EditableView
+                            ref={this._titleRef}
+                            editing={!isSelected ? false : undefined}
+                            contents={activeItem.title}
+                            overflow={'ellipsis'}
+                            GetValue={() => StrCast(activeItem.title)}
+                            SetValue={this.onSetValue}
+                        />
+                    </div>
+                    <Tooltip title={<><div className="dash-tooltip">{"Movement speed"}</div></>}><div className="presItem-time" style={{ display: showMore ? "block" : "none" }}>{this.transition}</div></Tooltip>
+                    <Tooltip title={<><div className="dash-tooltip">{"Duration"}</div></>}><div className="presItem-time" style={{ display: showMore ? "block" : "none" }}>{this.duration}</div></Tooltip>
+                    <div className={"presItem-slideButtons"}>
+                        <Tooltip title={<><div className="dash-tooltip">{"Update view"}</div></>}>
+                            <div className="slideButton"
+                                onClick={() => this.updateView(targetDoc, activeItem)}
+                                style={{ fontWeight: 700, display: activeItem.presPinView ? "flex" : "none" }}>V</div>
+                        </Tooltip>
+                        {this.indexInPres === 0 ? (null) : <Tooltip title={<><div className="dash-tooltip">{activeItem.groupWithUp ? "Ungroup" : "Group with up"}</div></>}>
+                            <div className="slideButton"
+                                onClick={() => activeItem.groupWithUp = !activeItem.groupWithUp}
+                                style={{
+                                    zIndex: 1000 - this.indexInPres,
+                                    fontWeight: 700,
+                                    backgroundColor: activeItem.groupWithUp ? presColorBool ? presBoxColor : Colors.MEDIUM_BLUE : undefined,
+                                    height: activeItem.groupWithUp ? 53 : 18,
+                                    transform: activeItem.groupWithUp ? "translate(0, -17px)" : undefined
+                                }}>
+                                <div style={{ transform: activeItem.groupWithUp ? "rotate(180deg) translate(0, -17.5px)" : "rotate(0deg)" }}>
+                                    <FontAwesomeIcon icon={"arrow-up"} onPointerDown={e => e.stopPropagation()} />
+                                </div>
+                            </div>
+                        </Tooltip>}
+                        <Tooltip title={<><div className="dash-tooltip">{this.rootDoc.presExpandInlineButton ? "Minimize" : "Expand"}</div></>}><div className={"slideButton"} onClick={e => { e.stopPropagation(); this.presExpandDocumentClick(); }}>
+                            <FontAwesomeIcon icon={this.rootDoc.presExpandInlineButton ? "eye-slash" : "eye"} onPointerDown={e => e.stopPropagation()} />
+                        </div></Tooltip>
+                        <Tooltip title={<><div className="dash-tooltip">{"Remove from presentation"}</div></>}><div
+                            className={"slideButton"}
+                            onClick={this.removeItem}>
+                            <FontAwesomeIcon icon={"trash"} onPointerDown={e => e.stopPropagation()} />
+                        </div></Tooltip>
+                    </div>
+                    <div className="presItem-docName" style={{ maxWidth: showMore ? (toolbarWidth - 195) : toolbarWidth - 105 }}>{activeItem.presPinView ? (<><i>View of </i> {targetDoc.title}</>) : targetDoc.title}</div>
+                    {this.renderEmbeddedInline}
+                </div>}
+            </div >);
+    }
+
+    render() {
+        return !(this.rootDoc instanceof Doc) || this.targetDoc instanceof Promise ? (null) : this.mainItem;
+    }
+}
\ No newline at end of file
diff --git a/src/client/views/nodes/trails/PresEnums.ts b/src/client/views/nodes/trails/PresEnums.ts
new file mode 100644
index 000000000..93ab323fb
--- /dev/null
+++ b/src/client/views/nodes/trails/PresEnums.ts
@@ -0,0 +1,28 @@
+export enum PresMovement {
+    Zoom = "zoom",
+    Pan = "pan",
+    Jump = "jump",
+    None = "none",
+}
+
+export enum PresEffect {
+    Zoom = "Zoom",
+    Lightspeed = "Lightspeed",
+    Fade = "Fade in",
+    Flip = "Flip",
+    Rotate = "Rotate",
+    Bounce = "Bounce",
+    Roll = "Roll",
+    None = "None",
+    Left = "left",
+    Right = "right",
+    Center = "center",
+    Top = "top",
+    Bottom = "bottom"
+}
+
+export enum PresStatus {
+    Autoplay = "auto",
+    Manual = "manual",
+    Edit = "edit"
+}
\ No newline at end of file
diff --git a/src/client/views/nodes/trails/index.ts b/src/client/views/nodes/trails/index.ts
new file mode 100644
index 000000000..8f3f7b03a
--- /dev/null
+++ b/src/client/views/nodes/trails/index.ts
@@ -0,0 +1,3 @@
+export * from "./PresBox";
+export * from "./PresElementBox";
+export * from "./PresEnums";
\ No newline at end of file
diff --git a/src/client/views/presentationview/PresElementBox.scss b/src/client/views/presentationview/PresElementBox.scss
deleted file mode 100644
index 1ad4b820e..000000000
--- a/src/client/views/presentationview/PresElementBox.scss
+++ /dev/null
@@ -1,235 +0,0 @@
-$light-blue: #AEDDF8;
-$dark-blue: #5B9FDD;
-$light-background: #ececec;
-$slide-background: #d5dce2;
-$slide-active: #5B9FDD;
-
-.presItem-container {
-    cursor: grab;
-    display: grid;
-    grid-template-columns: 20px auto;
-    font-family: Roboto;
-    letter-spacing: normal;
-    position: relative;
-    pointer-events: all;
-    width: 100%;
-    height: 100%;
-    font-weight: 400;
-    -webkit-touch-callout: none;
-    -webkit-user-select: none;
-    -khtml-user-select: none;
-    -moz-user-select: none;
-    -ms-user-select: none;
-    user-select: none;
-    align-items: center;
-
-    .presItem-number {
-        margin-top: 3.5px;
-        font-size: 12px;
-        font-weight: 700;
-        text-align: center;
-        justify-self: center;
-        align-self: flex-start;
-        position: relative;
-        display: inline-block;
-        overflow: hidden;
-    }
-
-}
-
-.presItem-slide {
-    position: relative;
-    background-color: #d5dce2;
-    border-radius: 5px;
-    height: calc(100% - 7px);
-    width: calc(100% - 15px);
-    display: grid;
-    grid-template-rows: 16px 10px auto;
-    grid-template-columns: max-content max-content max-content max-content auto;
-
-    .presItem-name {
-        min-width: 20px;
-        z-index: 300;
-        top: 2px;
-        align-self: center;
-        font-size: 11px;
-        font-family: Roboto;
-        font-weight: 500;
-        position: relative;
-        padding-left: 10px;
-        padding-right: 10px;
-        letter-spacing: normal;
-        width: max-content;
-        text-overflow: ellipsis;
-        overflow: hidden;
-        white-space: pre;
-    }
-
-    .presItem-docName {
-        min-width: 20px;
-        z-index: 300;
-        align-self: center;
-        font-size: 9px;
-        font-family: Roboto;
-        font-weight: 300;
-        position: relative;
-        padding-left: 10px;
-        padding-right: 10px;
-        letter-spacing: normal;
-        width: max-content;
-        text-overflow: ellipsis;
-        overflow: hidden;
-        white-space: pre;
-        grid-row: 2;
-        grid-column: 1/6;
-    }
-
-    .presItem-time {
-        align-self: center;
-        position: relative;
-        padding-right: 10px;
-        top: 1px;
-        font-size: 10;
-        font-weight: 300;
-        font-family: Roboto;
-        z-index: 300;
-        letter-spacing: normal;
-    }
-
-    .presItem-embedded {
-        overflow: hidden;
-        grid-row: 3;
-        grid-column: 1/8;
-        position: relative;
-        display: flex;
-        width: auto;
-        justify-content: center;
-        margin: auto;
-        margin-bottom: 2px;
-        border-bottom-left-radius: 5px;
-        border-bottom-right-radius: 5px;
-    }
-
-    .presItem-embeddedMask {
-        width: 100%;
-        height: 100%;
-        position: absolute;
-        border-radius: 3px;
-        top: 0;
-        left: 0;
-        z-index: 1;
-        overflow: hidden;
-    }
-
-
-    .presItem-slideButtons {
-        display: flex;
-        grid-column: 7;
-        grid-row: 1/3;
-        width: max-content;
-        justify-self: right;
-        justify-content: flex-end;
-
-        .slideButton {
-            cursor: pointer;
-            position: relative;
-            border-radius: 100px;
-            z-index: 300;
-            width: 18px;
-            height: 18px;
-            display: flex;
-            font-size: 12px;
-            justify-self: center;
-            align-self: center;
-            background-color: rgba(0, 0, 0, 0.5);
-            color: white;
-            justify-content: center;
-            align-items: center;
-            transition: 0.2s;
-            margin-right: 3px;
-        }
-
-        .slideButton:hover {
-            background-color: rgba(0, 0, 0, 1);
-            transform: scale(1.2);
-        }
-    }
-}
-
-// .presItem-slide:hover {
-//     .presItem-slideButtons {
-//         display: flex;
-//         grid-column: 7;
-//         grid-row: 1/3;
-//         width: max-content;
-//         justify-self: right;
-//         justify-content: flex-end;
-
-//         .slideButton {
-//             cursor: pointer;
-//             position: relative;
-//             border-radius: 100px;
-//             z-index: 300;
-//             width: 18px;
-//             height: 18px;
-//             display: flex;
-//             font-size: 12px;
-//             justify-self: center;
-//             align-self: center;
-//             background-color: rgba(0, 0, 0, 0.5);
-//             color: white;
-//             justify-content: center;
-//             align-items: center;
-//             transition: 0.2s;
-//             margin-right: 3px;
-//         }
-
-//         .slideButton:hover {
-//             background-color: rgba(0, 0, 0, 1);
-//             transform: scale(1.2);
-//         }
-//     }
-// }
-
-.presItem-slide.active {
-    box-shadow: 0 0 0px 1.5px $dark-blue;
-}
-
-.presItem-multiDrag {
-    font-family: Roboto;
-    font-weight: 600;
-    color: white;
-    text-align: center;
-    justify-content: center;
-    align-content: center;
-    width: 100px;
-    height: 30px;
-    position: absolute;
-    background-color: $dark-blue;
-    z-index: 4000;
-    border-radius: 10px;
-    box-shadow: black 0.4vw 0.4vw 0.8vw;
-    line-height: 30px;
-}
-
-.presItem-miniSlide {
-    font-weight: 700;
-    font-size: 12;
-    grid-column: 1/8;
-    align-self: center;
-    justify-self: center;
-    background-color: #d5dce2;
-    width: 26px;
-    text-align: center;
-    height: 26px;
-    line-height: 28px;
-    border-radius: 100%;
-}
-
-.presItem-miniSlide.active {
-    box-shadow: 0 0 0px 1.5px $dark-blue;
-}
-
-// .presItem-slide:hover {
-//     background: $slide-hover;
-// }
\ No newline at end of file
diff --git a/src/client/views/presentationview/PresElementBox.tsx b/src/client/views/presentationview/PresElementBox.tsx
deleted file mode 100644
index f15d51764..000000000
--- a/src/client/views/presentationview/PresElementBox.tsx
+++ /dev/null
@@ -1,386 +0,0 @@
-import { FontAwesomeIcon } from "@fortawesome/react-fontawesome";
-import { Tooltip } from "@material-ui/core";
-import { action, computed, IReactionDisposer, observable, reaction } from "mobx";
-import { observer } from "mobx-react";
-import { DataSym, Doc, Opt } from "../../../fields/Doc";
-import { documentSchema } from '../../../fields/documentSchemas';
-import { Id } from "../../../fields/FieldSymbols";
-import { createSchema, makeInterface } from '../../../fields/Schema';
-import { Cast, NumCast, StrCast } from "../../../fields/Types";
-import { emptyFunction, returnFalse, returnTrue, setupMoveUpEvents, emptyPath, returnEmptyDoclist } from "../../../Utils";
-import { DocumentType } from "../../documents/DocumentTypes";
-import { CurrentUserUtils } from "../../util/CurrentUserUtils";
-import { DocumentManager } from "../../util/DocumentManager";
-import { DragManager } from "../../util/DragManager";
-import { Transform } from "../../util/Transform";
-import { undoBatch } from "../../util/UndoManager";
-import { ViewBoxBaseComponent } from '../DocComponent';
-import { EditableView } from "../EditableView";
-import { DocumentView, DocumentViewProps } from "../nodes/DocumentView";
-import { FieldView, FieldViewProps } from '../nodes/FieldView';
-import { PresBox, PresColor, PresMovement } from "../nodes/PresBox";
-import { StyleProp } from "../StyleProvider";
-import "./PresElementBox.scss";
-import React = require("react");
-import { DocUtils } from "../../documents/Documents";
-
-export const presSchema = createSchema({
-    presentationTargetDoc: Doc,
-    presBox: Doc,
-    presZoomButton: "boolean",
-    presNavButton: "boolean",
-    presHideTillShownButton: "boolean",
-    presFadeButton: "boolean",
-    presHideAfterButton: "boolean",
-    presGroupButton: "boolean",
-    presExpandInlineButton: "boolean"
-});
-
-type PresDocument = makeInterface<[typeof presSchema, typeof documentSchema]>;
-const PresDocument = makeInterface(presSchema, documentSchema);
-/**
- * This class models the view a document added to presentation will have in the presentation.
- * It involves some functionality for its buttons and options.
- */
-@observer
-export class PresElementBox extends ViewBoxBaseComponent<FieldViewProps, PresDocument>(PresDocument) {
-    public static LayoutString(fieldKey: string) { return FieldView.LayoutString(PresElementBox, fieldKey); }
-    _heightDisposer: IReactionDisposer | undefined;
-
-    @observable _dragging = false;
-    // these fields are conditionally computed fields on the layout document that take this document as a parameter
-    @computed get indexInPres() { return Number(this.lookupField("indexInPres")); }  // the index field is where this document is in the presBox display list (since this value is different for each presentation element, the value can't be stored on the layout template which is used by all display elements)
-    @computed get collapsedHeight() { return Number(this.lookupField("presCollapsedHeight")); } // the collapsed height changes depending on the state of the presBox.  We could store this on the presentation element template if it's used by only one presentation - but if it's shared by multiple, then this value must be looked up
-    @computed get presStatus() { return StrCast(this.lookupField("presStatus")); }
-    @computed get itemIndex() { return NumCast(this.lookupField("_itemIndex")); }
-    @computed get presBox() { return Cast(this.lookupField("presBox"), Doc, null); }
-    @computed get targetDoc() { return Cast(this.rootDoc.presentationTargetDoc, Doc, null) || this.rootDoc; }
-
-    componentDidMount() {
-        this.layoutDoc.hideLinkButton = true;
-        this._heightDisposer = reaction(() => [this.rootDoc.presExpandInlineButton, this.collapsedHeight],
-            params => this.layoutDoc._height = NumCast(params[1]) + (Number(params[0]) ? 100 : 0), { fireImmediately: true });
-    }
-    componentWillUnmount() {
-        this._heightDisposer?.();
-    }
-
-    /**
-     * Returns a local transformed coordinate array for given coordinates.
-     */
-    ScreenToLocalListTransform = (xCord: number, yCord: number) => [xCord, yCord];
-
-    @action
-    presExpandDocumentClick = () => {
-        this.rootDoc.presExpandInlineButton = !this.rootDoc.presExpandInlineButton;
-    }
-
-    embedHeight = (): number => 97;
-    // embedWidth = () => this.props.PanelWidth();
-    // embedHeight = () => Math.min(this.props.PanelWidth() - 20, this.props.PanelHeight() - this.collapsedHeight);
-    embedWidth = (): number => this.props.PanelWidth() - 35;
-    styleProvider = (doc: (Doc | undefined), props: Opt<DocumentViewProps>, property: string): any => {
-        if (property === StyleProp.Opacity) return 1;
-        return this.props.styleProvider?.(doc, props, property);
-    }
-    /**
-     * The function that is responsible for rendering a preview or not for this
-     * presentation element.
-     */
-    @computed get renderEmbeddedInline() {
-        return !this.rootDoc.presExpandInlineButton || !this.targetDoc ? (null) :
-            <div className="presItem-embedded" style={{ height: this.embedHeight(), width: this.embedWidth() }}>
-                <DocumentView
-                    Document={this.targetDoc}
-                    DataDoc={this.targetDoc[DataSym] !== this.targetDoc && this.targetDoc[DataSym]}
-                    styleProvider={this.styleProvider}
-                    layerProvider={this.props.layerProvider}
-                    docViewPath={returnEmptyDoclist}
-                    rootSelected={returnTrue}
-                    addDocument={returnFalse}
-                    removeDocument={returnFalse}
-                    isContentActive={this.props.isContentActive}
-                    addDocTab={returnFalse}
-                    pinToPres={returnFalse}
-                    PanelWidth={this.embedWidth}
-                    PanelHeight={this.embedHeight}
-                    ScreenToLocalTransform={Transform.Identity}
-                    moveDocument={this.props.moveDocument!}
-                    renderDepth={this.props.renderDepth + 1}
-                    focus={DocUtils.DefaultFocus}
-                    whenChildContentsActiveChanged={returnFalse}
-                    bringToFront={returnFalse}
-                    docFilters={this.props.docFilters}
-                    docRangeFilters={this.props.docRangeFilters}
-                    searchFilterDocs={this.props.searchFilterDocs}
-                    ContainingCollectionView={undefined}
-                    ContainingCollectionDoc={undefined}
-                    hideLinkButton={true}
-                />
-                <div className="presItem-embeddedMask" />
-            </div>;
-    }
-
-    @computed get duration() {
-        let durationInS: number;
-        if (this.rootDoc.type === DocumentType.AUDIO || this.rootDoc.type === DocumentType.VID) { durationInS = NumCast(this.rootDoc.presEndTime) - NumCast(this.rootDoc.presStartTime); durationInS = Math.round(durationInS * 10) / 10; }
-        else if (this.rootDoc.presDuration) durationInS = NumCast(this.rootDoc.presDuration) / 1000;
-        else durationInS = 2;
-        return "D: " + durationInS + "s";
-    }
-
-    @computed get transition() {
-        let transitionInS: number;
-        if (this.rootDoc.presTransition) transitionInS = NumCast(this.rootDoc.presTransition) / 1000;
-        else transitionInS = 0.5;
-        return this.rootDoc.presMovement === PresMovement.Jump || this.rootDoc.presMovement === PresMovement.None ? (null) : "M: " + transitionInS + "s";
-    }
-
-    private _itemRef: React.RefObject<HTMLDivElement> = React.createRef();
-    private _dragRef: React.RefObject<HTMLDivElement> = React.createRef();
-    private _titleRef: React.RefObject<EditableView> = React.createRef();
-
-
-    @action
-    headerDown = (e: React.PointerEvent<HTMLDivElement>) => {
-        const element = e.target as any;
-        e.stopPropagation();
-        e.preventDefault();
-        if (element && !(e.ctrlKey || e.metaKey)) {
-            if (PresBox.Instance._selectedArray.has(this.rootDoc)) {
-                PresBox.Instance._selectedArray.size === 1 && PresBox.Instance.regularSelect(this.rootDoc, this._itemRef.current!, this._dragRef.current!, false);
-                setupMoveUpEvents(this, e, this.startDrag, emptyFunction, emptyFunction);
-            } else {
-                setupMoveUpEvents(this, e, ((e: PointerEvent) => {
-                    PresBox.Instance.regularSelect(this.rootDoc, this._itemRef.current!, this._dragRef.current!, false);
-                    return this.startDrag(e);
-                }), emptyFunction, emptyFunction);
-            }
-        }
-    }
-
-    headerUp = (e: React.PointerEvent<HTMLDivElement>) => {
-        e.stopPropagation();
-        e.preventDefault();
-    }
-
-    startDrag = (e: PointerEvent) => {
-        const miniView: boolean = this.toolbarWidth <= 100;
-        const activeItem = this.rootDoc;
-        const dragArray = PresBox.Instance._dragArray;
-        const dragData = new DragManager.DocumentDragData(PresBox.Instance.sortArray());
-        const dragItem: HTMLElement[] = [];
-        if (dragArray.length === 1) {
-            const doc = dragArray[0];
-            doc.className = miniView ? "presItem-miniSlide" : "presItem-slide";
-            dragItem.push(doc);
-        } else if (dragArray.length >= 1) {
-            const doc = document.createElement('div');
-            doc.className = "presItem-multiDrag";
-            doc.innerText = "Move " + PresBox.Instance._selectedArray.size + " slides";
-            doc.style.position = 'absolute';
-            doc.style.top = (e.clientY) + 'px';
-            doc.style.left = (e.clientX - 50) + 'px';
-            dragItem.push(doc);
-        }
-
-        // const dropEvent = () => runInAction(() => this._dragging = false);
-        if (activeItem) {
-            DragManager.StartDocumentDrag(dragItem.map(ele => ele), dragData, e.clientX, e.clientY, undefined);
-            // runInAction(() => this._dragging = true);
-            return true;
-        }
-        return false;
-    }
-
-    onPointerOver = (e: any) => {
-        document.removeEventListener("pointermove", this.onPointerMove);
-        document.addEventListener("pointermove", this.onPointerMove);
-    }
-
-    onPointerMove = (e: PointerEvent) => {
-        const slide = this._itemRef.current!;
-        let dragIsPresItem: boolean = DragManager.docsBeingDragged.length > 0 ? true : false;
-        for (const doc of DragManager.docsBeingDragged) {
-            if (!doc.presentationTargetDoc) dragIsPresItem = false;
-        }
-        if (slide && dragIsPresItem) {
-            const rect = slide.getBoundingClientRect();
-            const y = e.clientY - rect.top;  //y position within the element.
-            const height = slide.clientHeight;
-            const halfLine = height / 2;
-            if (y <= halfLine) {
-                slide.style.borderTop = "solid 2px #5B9FDD";
-                slide.style.borderBottom = "0px";
-            } else if (y > halfLine) {
-                slide.style.borderTop = "0px";
-                slide.style.borderBottom = "solid 2px #5B9FDD";
-            }
-        }
-        document.removeEventListener("pointermove", this.onPointerMove);
-    }
-
-    onPointerLeave = (e: any) => {
-        this._itemRef.current!.style.borderTop = "0px";
-        this._itemRef.current!.style.borderBottom = "0px";
-        document.removeEventListener("pointermove", this.onPointerMove);
-    }
-
-    @action
-    toggleProperties = () => {
-        if (CurrentUserUtils.propertiesWidth < 5) {
-            action(() => (CurrentUserUtils.propertiesWidth = 250));
-        }
-    }
-
-    @undoBatch
-    removeItem = action((e: React.MouseEvent) => {
-        this.props.removeDocument?.(this.rootDoc);
-        if (PresBox.Instance._selectedArray.has(this.rootDoc)) {
-            PresBox.Instance._selectedArray.delete(this.rootDoc);
-        }
-        e.stopPropagation();
-    });
-
-    @undoBatch
-    @action
-    onSetValue = (value: string) => {
-        this.rootDoc.title = !value.trim().length ? "-untitled-" : value;
-        return true;
-    }
-
-    /**
-     * Method called for updating the view of the currently selected document
-     * 
-     * @param targetDoc 
-     * @param activeItem 
-     */
-    @undoBatch
-    @action
-    updateView = (targetDoc: Doc, activeItem: Doc) => {
-        if (targetDoc.type === DocumentType.PDF || targetDoc.type === DocumentType.WEB || targetDoc.type === DocumentType.RTF) {
-            const scroll = targetDoc._scrollTop;
-            activeItem.presPinViewScroll = scroll;
-        } else if (targetDoc.type === DocumentType.VID) {
-            activeItem.presPinTimecode = targetDoc._currentTimecode;
-        } else if (targetDoc.type === DocumentType.COMPARISON) {
-            const clipWidth = targetDoc._clipWidth;
-            activeItem.presPinClipWidth = clipWidth;
-        } else {
-            const x = targetDoc._panX;
-            const y = targetDoc._panY;
-            const scale = targetDoc._viewScale;
-            activeItem.presPinViewX = x;
-            activeItem.presPinViewY = y;
-            activeItem.presPinViewScale = scale;
-        }
-    }
-
-    @computed
-    get toolbarWidth(): number {
-        const presBoxDocView = DocumentManager.Instance.getDocumentView(this.presBox);
-        let width: number = NumCast(this.presBox._width);
-        if (presBoxDocView) width = presBoxDocView.props.PanelWidth();
-        if (width === 0) width = 300;
-        return width;
-    }
-
-    @computed get mainItem() {
-        const isSelected: boolean = PresBox.Instance._selectedArray.has(this.rootDoc);
-        const toolbarWidth: number = this.toolbarWidth;
-        const showMore: boolean = this.toolbarWidth >= 300;
-        const miniView: boolean = this.toolbarWidth <= 110;
-        const presBox: Doc = this.presBox; //presBox
-        const presBoxColor: string = StrCast(presBox._backgroundColor);
-        const presColorBool: boolean = presBoxColor ? (presBoxColor !== "white" && presBoxColor !== "transparent") : false;
-        const targetDoc: Doc = this.targetDoc;
-        const activeItem: Doc = this.rootDoc;
-        return (
-            <div className={`presItem-container`}
-                key={this.props.Document[Id] + this.indexInPres}
-                ref={this._itemRef}
-                style={{
-                    backgroundColor: presColorBool ? isSelected ? "rgba(250,250,250,0.3)" : "transparent" : isSelected ? "#AEDDF8" : "transparent",
-                    opacity: this._dragging ? 0.3 : 1
-                }}
-                onClick={e => {
-                    e.stopPropagation();
-                    e.preventDefault();
-                    PresBox.Instance.modifierSelect(this.rootDoc, this._itemRef.current!, this._dragRef.current!, !e.shiftKey && !e.ctrlKey && !e.metaKey, e.ctrlKey || e.metaKey, e.shiftKey);
-                }}
-                onDoubleClick={action(e => {
-                    this.toggleProperties();
-                    PresBox.Instance.regularSelect(this.rootDoc, this._itemRef.current!, this._dragRef.current!, true);
-                })}
-                onPointerOver={this.onPointerOver}
-                onPointerLeave={this.onPointerLeave}
-                onPointerDown={this.headerDown}
-                onPointerUp={this.headerUp}
-            >
-                {miniView ?
-                    // when width is LESS than 110 px 
-                    <div className={`presItem-miniSlide ${isSelected ? "active" : ""}`} ref={miniView ? this._dragRef : null}>
-                        {`${this.indexInPres + 1}.`}
-                    </div>
-                    :
-                    // when width is MORE than 110 px 
-                    <div className="presItem-number">
-                        {`${this.indexInPres + 1}.`}
-                    </div>}
-                {miniView ? (null) : <div ref={miniView ? null : this._dragRef} className={`presItem-slide ${isSelected ? "active" : ""}`}
-                    style={{
-                        backgroundColor: this.props.styleProvider?.(this.layoutDoc, this.props, StyleProp.BackgroundColor),
-                        boxShadow: presBoxColor && presBoxColor !== "white" && presBoxColor !== "transparent" ? isSelected ? "0 0 0px 1.5px" + presBoxColor : undefined : undefined
-                    }}>
-                    <div className="presItem-name" style={{ maxWidth: showMore ? (toolbarWidth - 195) : toolbarWidth - 105, cursor: isSelected ? 'text' : 'grab' }}>
-                        <EditableView
-                            ref={this._titleRef}
-                            editing={!isSelected ? false : undefined}
-                            contents={activeItem.title}
-                            overflow={'ellipsis'}
-                            GetValue={() => StrCast(activeItem.title)}
-                            SetValue={this.onSetValue}
-                        />
-                    </div>
-                    <Tooltip title={<><div className="dash-tooltip">{"Movement speed"}</div></>}><div className="presItem-time" style={{ display: showMore ? "block" : "none" }}>{this.transition}</div></Tooltip>
-                    <Tooltip title={<><div className="dash-tooltip">{"Duration"}</div></>}><div className="presItem-time" style={{ display: showMore ? "block" : "none" }}>{this.duration}</div></Tooltip>
-                    <div className={"presItem-slideButtons"}>
-                        <Tooltip title={<><div className="dash-tooltip">{"Update view"}</div></>}>
-                            <div className="slideButton"
-                                onClick={() => this.updateView(targetDoc, activeItem)}
-                                style={{ fontWeight: 700, display: activeItem.presPinView ? "flex" : "none" }}>V</div>
-                        </Tooltip>
-                        {this.indexInPres === 0 ? (null) : <Tooltip title={<><div className="dash-tooltip">{activeItem.groupWithUp ? "Ungroup" : "Group with up"}</div></>}>
-                            <div className="slideButton"
-                                onClick={() => activeItem.groupWithUp = !activeItem.groupWithUp}
-                                style={{
-                                    zIndex: 1000 - this.indexInPres,
-                                    fontWeight: 700,
-                                    backgroundColor: activeItem.groupWithUp ? presColorBool ? presBoxColor : PresColor.DarkBlue : undefined,
-                                    height: activeItem.groupWithUp ? 53 : 18,
-                                    transform: activeItem.groupWithUp ? "translate(0, -17px)" : undefined
-                                }}>
-                                <div style={{ transform: activeItem.groupWithUp ? "rotate(180deg) translate(0, -17.5px)" : "rotate(0deg)" }}>
-                                    <FontAwesomeIcon icon={"arrow-up"} onPointerDown={e => e.stopPropagation()} />
-                                </div>
-                            </div>
-                        </Tooltip>}
-                        <Tooltip title={<><div className="dash-tooltip">{this.rootDoc.presExpandInlineButton ? "Minimize" : "Expand"}</div></>}><div className={"slideButton"} onClick={e => { e.stopPropagation(); this.presExpandDocumentClick(); }}>
-                            <FontAwesomeIcon icon={this.rootDoc.presExpandInlineButton ? "eye-slash" : "eye"} onPointerDown={e => e.stopPropagation()} />
-                        </div></Tooltip>
-                        <Tooltip title={<><div className="dash-tooltip">{"Remove from presentation"}</div></>}><div
-                            className={"slideButton"}
-                            onClick={this.removeItem}>
-                            <FontAwesomeIcon icon={"trash"} onPointerDown={e => e.stopPropagation()} />
-                        </div></Tooltip>
-                    </div>
-                    <div className="presItem-docName" style={{ maxWidth: showMore ? (toolbarWidth - 195) : toolbarWidth - 105 }}>{activeItem.presPinView ? (<><i>View of </i> {targetDoc.title}</>) : targetDoc.title}</div>
-                    {this.renderEmbeddedInline}
-                </div>}
-            </div >);
-    }
-
-    render() {
-        return !(this.rootDoc instanceof Doc) || this.targetDoc instanceof Promise ? (null) : this.mainItem;
-    }
-}
\ No newline at end of file
diff --git a/src/client/views/topbar/TopBar.scss b/src/client/views/topbar/TopBar.scss
index 324b96dbd..e2d27d5a6 100644
--- a/src/client/views/topbar/TopBar.scss
+++ b/src/client/views/topbar/TopBar.scss
@@ -30,7 +30,7 @@
                 display: flex;
 
                 .topbar-dashboards {
-                    display: none;
+                    display: inline-flex;
                 }
 
                 .topbar-dashSelect {
@@ -46,12 +46,6 @@
                     }
                 }
             }
-
-            .topbar-lozenge-dashboard:hover {
-                .topbar-dashboards {
-                    display: inline-flex;
-                }
-            }
         }
 
         .topBar-icon {
@@ -85,7 +79,7 @@
             .topbar-lozenge {
                 height: 23;
                 font-size: 12;
-                color: black;
+                color: white;
                 font-family: 'Roboto';
                 font-weight: 400;
                 padding: 4px;
@@ -93,7 +87,7 @@
                 margin-right: 7px;
                 display: flex;
                 align-items: center;
-                border: black 1px solid;
+                border: white 1px solid;
 
                 .topbar-logoff {
                     border-radius: 3px;
diff --git a/src/client/views/topbar/TopBar.tsx b/src/client/views/topbar/TopBar.tsx
index 79239d4ea..65da717f8 100644
--- a/src/client/views/topbar/TopBar.tsx
+++ b/src/client/views/topbar/TopBar.tsx
@@ -1,58 +1,67 @@
 import { FontAwesomeIcon } from "@fortawesome/react-fontawesome";
+import { observer } from "mobx-react";
 import * as React from 'react';
 import { Doc, DocListCast } from '../../../fields/Doc';
 import { Id } from '../../../fields/FieldSymbols';
 import { StrCast } from '../../../fields/Types';
 import { Utils } from '../../../Utils';
 import { CurrentUserUtils } from "../../util/CurrentUserUtils";
-import { ColorScheme, SettingsManager } from "../../util/SettingsManager";
+import { SettingsManager } from "../../util/SettingsManager";
 import { undoBatch } from "../../util/UndoManager";
+import { Borders, Colors } from "../global/globalEnums";
 import "./TopBar.scss";
-import { Colors, Borders } from "../global/globalEnums";
 
-export const TopBar = () => {
-
-    const myDashboards = DocListCast(CurrentUserUtils.MyDashboards.data);
-    return (
-        <div style={{ pointerEvents: "all" }} className="topbar-container">
-            <div className="topbar-bar" style={{ background: Doc.UserDoc().colorScheme === ColorScheme.Dark ? Colors.DARK_GRAY : Colors.LIGHT_GRAY, borderBottom: Borders.STANDARD }}>
-                <div className="topbar-center" >
-                    <div className="topbar-lozenge-dashboard">
-                        <select className="topbar-dashSelect" onChange={e => CurrentUserUtils.openDashboard(Doc.UserDoc(), myDashboards[Number(e.target.value)])}
-                            value={myDashboards.indexOf(CurrentUserUtils.ActiveDashboard)}
-                            style={{ color: Doc.UserDoc().colorScheme === ColorScheme.Dark ? "white" : "black" }}>
-                            {myDashboards.map((dash, i) => <option key={dash[Id]} value={i}> {StrCast(dash.title)} </option>)}
-                        </select>
-                        <div className="topbar-dashboards">
-                            <div className="topbar-icon" onClick={undoBatch(() => CurrentUserUtils.createNewDashboard(Doc.UserDoc()))}
-                                style={{ color: Doc.UserDoc().colorScheme === ColorScheme.Dark ? "white" : "black" }}>
-                                <FontAwesomeIcon icon="plus"></FontAwesomeIcon>
-                            </div>
-                            <div className="topbar-icon" onClick={undoBatch(() => CurrentUserUtils.snapshotDashboard(Doc.UserDoc()))}
-                                style={{ color: Doc.UserDoc().colorScheme === ColorScheme.Dark ? "white" : "black" }}>
-                                <FontAwesomeIcon icon="camera"></FontAwesomeIcon>
+/**
+ * REACT TYPE: FUNCTIONAL
+ * ABOUT: This is the topbar in Dash, which included the current Dashboard as well as access to information on the user
+ * and settings and help buttons. Future scope for this bar is to include the collaborators that are on the same Dashboard. 
+ */
+@observer
+export class TopBar extends React.Component {
+    render() {
+        const myDashboards = DocListCast(CurrentUserUtils.MyDashboards.data);
+        return (
+            //TODO:glr Add support for light / dark mode
+            <div style={{ pointerEvents: "all" }} className="topbar-container">
+                <div className="topbar-bar" style={{ background: Colors.DARK_GRAY, borderBottom: Borders.STANDARD }}>
+                    <div className="topbar-center" >
+                        <div className="topbar-lozenge-dashboard">
+                            <select className="topbar-dashSelect" onChange={e => CurrentUserUtils.openDashboard(Doc.UserDoc(), myDashboards[Number(e.target.value)])}
+                                value={myDashboards.indexOf(CurrentUserUtils.ActiveDashboard)}
+                                style={{ color: Colors.WHITE }}>
+                                {myDashboards.map((dash, i) => <option key={dash[Id]} value={i}> {StrCast(dash.title)} </option>)}
+                            </select>
+                            <div className="topbar-dashboards">
+                                <div className="topbar-icon" onClick={undoBatch(() => CurrentUserUtils.createNewDashboard(Doc.UserDoc()))}
+                                    style={{ color: Colors.WHITE }}>
+                                    <FontAwesomeIcon icon="plus"></FontAwesomeIcon>
+                                </div>
+                                <div className="topbar-icon" onClick={undoBatch(() => CurrentUserUtils.snapshotDashboard(Doc.UserDoc()))}
+                                    style={{ color: Colors.WHITE }}>
+                                    <FontAwesomeIcon icon="camera"></FontAwesomeIcon>
+                                </div>
                             </div>
                         </div>
                     </div>
-                </div>
-                <div className="topbar-right" >
-                    <div className="topbar-icon"
-                        style={{ color: Doc.UserDoc().colorScheme === ColorScheme.Dark ? "white" : "black" }}>
-                        <FontAwesomeIcon icon="question-circle"></FontAwesomeIcon>
-                    </div>
-                    <div className="topbar-icon" onClick={() => SettingsManager.Instance.open()}
-                        style={{ color: Doc.UserDoc().colorScheme === ColorScheme.Dark ? "white" : "black" }}>
-                        <FontAwesomeIcon icon="cog"></FontAwesomeIcon>
-                    </div>
-                    <div className="topbar-lozenge-user">
-                        {`${Doc.CurrentUserEmail}`}
-                        <div className="topbar-logoff" onClick={() => window.location.assign(Utils.prepend("/logout"))}>
-                            Logoff
+                    <div className="topbar-right" >
+                        <div className="topbar-icon"
+                            style={{ color: Colors.WHITE }}>
+                            <FontAwesomeIcon icon="question-circle"></FontAwesomeIcon>
+                        </div>
+                        <div className="topbar-icon" onClick={() => SettingsManager.Instance.open()}
+                            style={{ color: Colors.WHITE }}>
+                            <FontAwesomeIcon icon="cog"></FontAwesomeIcon>
+                        </div>
+                        <div className="topbar-lozenge-user">
+                            {`${Doc.CurrentUserEmail}`}
+                            <div className="topbar-logoff" onClick={() => window.location.assign(Utils.prepend("/logout"))}>
+                                Logoff
+                        </div>
                         </div>
                     </div>
-                </div>
 
+                </div >
             </div >
-        </div >
-    );
+        );
+    }
 }
\ No newline at end of file
diff --git a/tslint.json b/tslint.json
index 0056f4266..83255a798 100644
--- a/tslint.json
+++ b/tslint.json
@@ -1,6 +1,9 @@
 {
     "linterOptions": {
-        "exclude": ["./src/client/northstar/**", "**/*.js"]
+        "exclude": [
+            "./src/client/northstar/**",
+            "**/*.js"
+        ]
     },
     "rules": {
         "no-return-await": true,
@@ -23,41 +26,7 @@
         ],
         "no-tautology-expression": true,
         "unnecessary-constructor": true
-        // "trailing-comma": [
-        //     true,
-        //     {
-        //         "multiline": "always",
-        //         "singleline": "never"
-        //     }
-        // ],
-        // "ordered-imports": true
-        // "quotemark": [
-        //     true,
-        //     "double",
-        //     "jsx-double",
-        //     "avoid-template",
-        //     "avoid-escape"
-        // ],
-        // "object-literal-shorthand": true,
-        // "object-literal-sort-keys": true,
-        // "align": [
-        //     true,
-        //     "parameters",
-        //     "arguments",
-        //     "statements",
-        //     "members",
-        //     "elements"
-        // ],
-        // "no-void-expression": [
-        //     true,
-        //     "ignore-arrow-function-shorthand"
-        // ],
-        // "no-non-null-assertion": true,
-        // "no-var-keyword": true,
-        // "no-var-requires": true,
     },
     "defaultSeverity": "warning",
-    "jsRules": {
-
-    }
+    "jsRules": {}
 }
\ No newline at end of file
-- 
cgit v1.2.3-70-g09d2


From 2ec093982c06965086326df73d365e1b54f6a2a2 Mon Sep 17 00:00:00 2001
From: dg314 <david_grossman@brown.edu>
Date: Wed, 4 Aug 2021 03:19:16 -0400
Subject: search panel updates

---
 src/client/util/CurrentUserUtils.ts    | 27 ++++++-----
 src/client/views/GlobalKeyHandler.ts   |  7 ++-
 src/client/views/MainView.tsx          | 37 --------------
 src/client/views/search/SearchBox.scss | 19 ++++++--
 src/client/views/search/SearchBox.tsx  | 89 +++++++++++++++++-----------------
 5 files changed, 81 insertions(+), 98 deletions(-)

(limited to 'src/client/util/CurrentUserUtils.ts')

diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts
index 31384da3b..734b96b1e 100644
--- a/src/client/util/CurrentUserUtils.ts
+++ b/src/client/util/CurrentUserUtils.ts
@@ -46,6 +46,7 @@ export class CurrentUserUtils {
     //TODO tfs: these should be temporary...
     private static mainDocId: string | undefined;
 
+    public static searchBtn: Doc;
     public static get id() { return this.curr_id; }
     public static get MainDocId() { return this.mainDocId; }
     public static set MainDocId(id: string | undefined) { this.mainDocId = id; }
@@ -533,15 +534,6 @@ export class CurrentUserUtils {
         ];
     }
 
-    /*static setupSearchPanel(doc: Doc) {
-        if (doc.mySearchPanelDoc === undefined) {
-            doc.mySearchPanelDoc = new PrefetchProxy(Docs.Create.SearchDocument({
-                _width: 500, _height: 300, backgroundColor: "dimGray", ignoreClick: true, _searchDoc: true,
-                childDropAction: "alias", _lockedPosition: true, _viewType: CollectionViewType.Schema, title: "sidebar search stack", system: true
-            })) as any as Doc;
-        }
-    }*/
-
     static async setupMenuPanel(doc: Doc, sharingDocumentId: string, linkDatabaseId: string) {
         if (doc.menuStack === undefined) {
             await this.setupSharingSidebar(doc, sharingDocumentId, linkDatabaseId);  // sets up the right sidebar collection for mobile upload documents and sharing
@@ -562,10 +554,23 @@ export class CurrentUserUtils {
                     _height: 60,
                     watchedDocuments,
                     onClick: ScriptField.MakeScript(click, { scriptContext: "any" })
-                }));
+                })
+            );
+
+            menuBtns.forEach(menuBtn => {
+                if (menuBtn.title == "Search") {
+                    this.searchBtn = menuBtn;
+                }
+            });
             // hack -- last button is assumed to be the userDoc
             menuBtns[menuBtns.length - 1].hidden = ComputedField.MakeFunction("IsNoviceMode()");
 
+            menuBtns.forEach(menuBtn => {
+                if (menuBtn.title == "Search") {
+                    doc.searchBtn = menuBtn
+                }
+            })
+
             doc.menuStack = new PrefetchProxy(Docs.Create.StackingDocument(menuBtns, {
                 title: "menuItemPanel",
                 childDropAction: "alias",
@@ -950,7 +955,7 @@ export class CurrentUserUtils {
         if (doc.mySearchPanel === undefined) {
             doc.mySearchPanel = new PrefetchProxy(Docs.Create.SearchDocument({
                 backgroundColor: "dimGray", ignoreClick: true, _searchDoc: true,
-                childDropAction: "alias", _lockedPosition: true, _viewType: CollectionViewType.Schema, title: "sidebar search stack", system: true
+                childDropAction: "alias", _lockedPosition: true, _viewType: CollectionViewType.Schema, title: "Search Sidebar", system: true
             })) as any as Doc;
         }
     }
diff --git a/src/client/views/GlobalKeyHandler.ts b/src/client/views/GlobalKeyHandler.ts
index d92cba3eb..2a3cb36c7 100644
--- a/src/client/views/GlobalKeyHandler.ts
+++ b/src/client/views/GlobalKeyHandler.ts
@@ -27,7 +27,6 @@ import { LightboxView } from "./LightboxView";
 import { MainView } from "./MainView";
 import { DocumentLinksButton } from "./nodes/DocumentLinksButton";
 import { AnchorMenu } from "./pdf/AnchorMenu";
-import { SearchBox } from "./search/SearchBox";
 import { CurrentUserUtils } from "../util/CurrentUserUtils";
 import { SettingsManager } from "../util/SettingsManager";
 
@@ -225,7 +224,11 @@ export class KeyManager {
                 PromiseValue(Cast(Doc.UserDoc()["tabs-button-tools"], Doc)).then(pv => pv && (pv.onClick as ScriptField).script.run({ this: pv }));
                 break;
             case "f":
-                SearchBox.Instance.enter(undefined);
+                const searchBtn = Doc.UserDoc().searchBtn as Doc;
+
+                if (searchBtn) {
+                    MainView.Instance.selectMenu(searchBtn);
+                }
                 break;
             case "o":
                 const target = SelectionManager.Views()[0];
diff --git a/src/client/views/MainView.tsx b/src/client/views/MainView.tsx
index 0d957518b..35222e91f 100644
--- a/src/client/views/MainView.tsx
+++ b/src/client/views/MainView.tsx
@@ -387,9 +387,6 @@ export class MainView extends React.Component {
                 case "Settings":
                     SettingsManager.Instance.open();
                     break;
-                case "Catalog":
-                    SearchBox.Instance.enter(undefined);
-                    break;
                 case "Help":
                     break;
                 default:
@@ -522,40 +519,6 @@ export class MainView extends React.Component {
         </svg>;
     }
 
-    /*@computed get search() {
-        TraceMobx();
-        return <div className="mainView-searchPanel">
-            <SearchBox Document={CurrentUserUtils.MySearchPanelDoc}
-                DataDoc={CurrentUserUtils.MySearchPanelDoc}
-                fieldKey="data"
-                dropAction="move"
-                isSelected={returnTrue}
-                isContentActive={returnTrue}
-                select={returnTrue}
-                setHeight={returnFalse}
-                addDocument={undefined}
-                addDocTab={this.addDocTabFunc}
-                pinToPres={emptyFunction}
-                rootSelected={returnTrue}
-                styleProvider={DefaultStyleProvider}
-                layerProvider={undefined}
-                removeDocument={undefined}
-                ScreenToLocalTransform={Transform.Identity}
-                PanelWidth={this.getPWidth}
-                PanelHeight={this.getPHeight}
-                renderDepth={0}
-                focus={DocUtils.DefaultFocus}
-                docViewPath={returnEmptyDoclist}
-                whenChildContentsActiveChanged={emptyFunction}
-                bringToFront={emptyFunction}
-                docFilters={returnEmptyFilter}
-                docRangeFilters={returnEmptyFilter}
-                searchFilterDocs={returnEmptyDoclist}
-                ContainingCollectionView={undefined}
-                ContainingCollectionDoc={undefined} />
-        </div>;
-    }*/
-
     @computed get invisibleWebBox() { // see note under the makeLink method in HypothesisUtils.ts
         return !DocumentLinksButton.invisibleWebDoc ? null :
             <div className="mainView-invisibleWebRef" ref={DocumentLinksButton.invisibleWebRef}>
diff --git a/src/client/views/search/SearchBox.scss b/src/client/views/search/SearchBox.scss
index f8e994da7..e4d1ac6a3 100644
--- a/src/client/views/search/SearchBox.scss
+++ b/src/client/views/search/SearchBox.scss
@@ -22,17 +22,18 @@
 
         .searchBox-type {
             display: block;
-            width: 50px;
+            width: 55px;
             outline: none;
             padding: 1px 5px 1px 5px;
             color: black;
             height: 25px;
             border: 1px solid black;
+            border-right: 0px;
         }
 
         .searchBox-input {
             display: block;
-            width: calc(100% - 50px);
+            width: calc(100% - 55px);
             outline: none;
             padding: 1px 5px 1px 5px;
             color: black;
@@ -74,10 +75,20 @@
                     background: gray;
                 }
 
-                .titletitle {
+                .searchBox-result-title {
                     display: relative;
                     float: left;
-                    left: 50px;
+                    width: calc(100% - 60px);
+                    text-align: left;
+                }
+
+                .searchBox-result-type {
+                    font-size: 12px;
+                    display: relative;
+                    float: right;
+                    width: 60px;
+                    text-align: right;
+                    color: #333;
                 }
             }
         }
diff --git a/src/client/views/search/SearchBox.tsx b/src/client/views/search/SearchBox.tsx
index 374a754bf..3cbb4b3b1 100644
--- a/src/client/views/search/SearchBox.tsx
+++ b/src/client/views/search/SearchBox.tsx
@@ -35,29 +35,30 @@ export const searchSchema = createSchema({ Document: Doc });
 type SearchBoxDocument = makeInterface<[typeof documentSchema, typeof searchSchema]>;
 const SearchBoxDocument = makeInterface(documentSchema, searchSchema);
 
+const selectValues = ["all", "rtf", "image", "pdf", "web", "video", "audio", "collection"]
+
 @observer
 export class SearchBox extends ViewBoxBaseComponent<FieldViewProps, SearchBoxDocument>(SearchBoxDocument) {
     public static LayoutString(fieldKey: string) { return FieldView.LayoutString(SearchBox, fieldKey); }
     public static Instance: SearchBox;
 
-    private _allIcons: string[] = [DocumentType.INK, DocumentType.AUDIO, DocumentType.COL, DocumentType.IMG, DocumentType.LINK, DocumentType.PDF, DocumentType.RTF, DocumentType.VID, DocumentType.WEB];
     private _resultsSet = new Map<Doc, number>();
     private _inputRef = React.createRef<HTMLInputElement>();
-    private _disposers: { [name: string]: IReactionDisposer } = {};
-    private _blockedTypes = [DocumentType.PRESELEMENT, DocumentType.KVP, DocumentType.FILTER, DocumentType.SEARCH, DocumentType.SEARCHITEM, DocumentType.FONTICON, DocumentType.BUTTON, DocumentType.SCRIPTING];
 
     @observable _searchString = "";
     @observable _docTypeString = "all";
-    @observable _icons: string[] = this._allIcons;
     @observable _results: [Doc, string[], string[]][] = [];
     @observable _selectedResult: Doc | undefined = undefined;
     @observable _deletedDocsStatus: boolean = false;
     @observable _onlyAliases: boolean = true;
-    @computed get filter() { return this._results?.length && (this.currentSelectedCollection?.props.Document._searchFilterDocs || this.currentSelectedCollection?.props.Document._docFilters); }
 
     constructor(props: any) {
         super(props);
         SearchBox.Instance = this;
+        this._searchString = "reset_search";
+        this.submitSearch();
+        this._searchString = "";
+        this.submitSearch();
     }
 
     componentDidMount = action(() => {
@@ -67,11 +68,9 @@ export class SearchBox extends ViewBoxBaseComponent<FieldViewProps, SearchBoxDoc
     });
 
     componentWillUnmount() {
-        Object.values(this._disposers).forEach(disposer => disposer?.());
+        this.resetSearch;
     }
 
-    @computed get currentSelectedCollection() { return CollectionDockingView.Instance; }
-
     onInputChange = action((e: React.ChangeEvent<HTMLInputElement>) => {
         this._searchString = e.target.value;
         this.submitSearch();
@@ -79,32 +78,13 @@ export class SearchBox extends ViewBoxBaseComponent<FieldViewProps, SearchBoxDoc
 
     onSelectChange = action((e: React.ChangeEvent<HTMLSelectElement>) => {
         this._docTypeString = e.target.value;
-        this.submitSearch();
     });
 
-    /*enter = action((e: React.KeyboardEvent | undefined) => {
-        if (!e || e.key === "Enter") {
-            this.submitSearch();
-        }
-    });*/
-
     onResultClick = action((doc: Doc) => {
         this.selectElement(doc);
         this._selectedResult = doc;
     });
 
-    @action
-    filterDocsByType(docs: Doc[]) {
-        const finalDocs: Doc[] = [];
-        docs.forEach(doc => {
-            const layoutresult = StrCast(doc.type, "string") as DocumentType;
-            if (layoutresult && !this._blockedTypes.includes(layoutresult) && this._icons.includes(layoutresult)) {
-                finalDocs.push(doc);
-            }
-        });
-        return finalDocs;
-    }
-
     static foreachRecursiveDoc(docs: Doc[], func: (doc: Doc) => void) {
         let newarray: Doc[] = [];
         while (docs.length > 0) {
@@ -120,23 +100,39 @@ export class SearchBox extends ViewBoxBaseComponent<FieldViewProps, SearchBoxDoc
         }
     }
 
+    static formatType(type: String): String {
+        if (type == "pdf") {
+            return "PDF";
+        }
+        else if (type == "image") {
+            return "Img";
+        }
+
+        return type.charAt(0).toUpperCase() + type.substring(1, 3);
+    }
+
     @action
     searchCollection(query: string) {
-        const selectedCollection = this.currentSelectedCollection;//SelectionManager.SelectedDocuments()[0];
+        const selectedCollection = CollectionDockingView.Instance;
+        const blockedTypes = [DocumentType.PRESELEMENT, DocumentType.KVP, DocumentType.FILTER, DocumentType.SEARCH, DocumentType.SEARCHITEM, DocumentType.FONTICON, DocumentType.BUTTON, DocumentType.SCRIPTING];
         query = query.toLowerCase();
 
+        this._results = []
+
         if (selectedCollection !== undefined) {
-            // this._currentSelectedCollection = selectedCollection;
             const docs = DocListCast(selectedCollection.dataDoc[Doc.LayoutFieldKey(selectedCollection.dataDoc)]);
-            const found: [Doc, string[], string[]][] = [];
             SearchBox.foreachRecursiveDoc(docs, (doc: Doc) => {
-                const hlights = new Set<string>();
-                SearchBox.documentKeys(doc).forEach(key => Field.toString(doc[key] as Field).toLowerCase().includes(query) && hlights.add(key));
-                Array.from(hlights.keys()).length > 0 && found.push([doc, Array.from(hlights.keys()), []]);
+                const dtype = StrCast(doc.type, "string") as DocumentType;
+                if (dtype && !blockedTypes.includes(dtype)) {
+                    const hlights = new Set<string>();
+                    SearchBox.documentKeys(doc).forEach(key => Field.toString(doc[key] as Field).toLowerCase().includes(query) && hlights.add(key));
+                    Array.from(hlights.keys()).length > 0 && this._results.push([doc, Array.from(hlights.keys()), []]);
+                }
             });
-
-            this._results = found;
         }
+
+        this._results = Array.from(new Set(this._results))
+        this._selectedResult = undefined
     }
 
     static documentKeys(doc: Doc) {
@@ -155,7 +151,7 @@ export class SearchBox extends ViewBoxBaseComponent<FieldViewProps, SearchBoxDoc
     submitSearch = async () => {
         this.resetSearch();
 
-        this.dataDoc[this.fieldKey] = new List<Doc>([]);
+        //this.dataDoc[this.fieldKey] = new List<Doc>([]);
         let query = StrCast(this._searchString);
         Doc.SetSearchQuery(query);
         this._results = [];
@@ -169,6 +165,7 @@ export class SearchBox extends ViewBoxBaseComponent<FieldViewProps, SearchBoxDoc
     resetSearch = action(() => {
         this._results.forEach(result => {
             Doc.UnBrushDoc(result[0]);
+            Doc.UnHighlightDoc(result[0]);
             Doc.ClearSearchMatches();
         });
     });
@@ -178,6 +175,8 @@ export class SearchBox extends ViewBoxBaseComponent<FieldViewProps, SearchBoxDoc
     }
 
     render() {
+        var validResults = 0;
+
         const results = this._results.map(result => {
             var className = "searchBox-results-scroll-view-result";
 
@@ -186,28 +185,30 @@ export class SearchBox extends ViewBoxBaseComponent<FieldViewProps, SearchBoxDoc
             }
 
             if (this._docTypeString == "all" || this._docTypeString == result[0].type) {
-                return (<div key={result[0][Id]} onClick={() => this.onResultClick(result[0])} className={className}><div className="titletitle">{result[0].title}</div></div>)
+                validResults++;
+                return (<div key={result[0][Id]} onClick={() => this.onResultClick(result[0])} className={className}><div className="searchBox-result-title">{result[0].title}</div><div className="searchBox-result-type">{SearchBox.formatType(StrCast(result[0].type))}</div></div>)
             }
 
             return null;
         })
 
-        results.filter(result => result)
+        results.filter(result => result);
+
+        const selectOptions = selectValues.map(value => {
+            return <option key={value} value={value}>{SearchBox.formatType(value)}</option>
+        })
 
         return (
             <div style={{ pointerEvents: "all" }} className="searchBox-container">
                 <div className="searchBox-bar">
                     <select name="type" id="searchBox-type" className="searchBox-type" onChange={this.onSelectChange}>
-                        <option value="all">All</option>
-                        <option value="rtf">Text</option>
-                        <option value="img">Image</option>
-                        <option value="pdf">PDF</option>
+                        {selectOptions}
                     </select>
-                    <input defaultValue={""} autoComplete="off" onChange={this.onInputChange} type="text" placeholder="Search..." id="search-input" ref={this._inputRef} className="searchBox-input" />
+                    <input defaultValue={""} autoComplete="off" onChange={this.onInputChange} type="text" placeholder="Search..." id="search-input" className="searchBox-input" ref={this._inputRef} />
                 </div >
                 <div className="searchBox-results-container">
                     <div className="searchBox-results-count">
-                        {`${results.length}` + " result" + (results.length == 1 ? "" : "s")}
+                        {`${validResults}` + " result" + (validResults == 1 ? "" : "s")}
                     </div>
                     <div className="searchBox-results-scroll-view">
                         {results}
-- 
cgit v1.2.3-70-g09d2


From b9d72dd3ed3b800ef9bd1f6695ac37e14d21f675 Mon Sep 17 00:00:00 2001
From: geireann <geireann.lindfield@gmail.com>
Date: Thu, 5 Aug 2021 15:18:00 -0400
Subject: removed drop shadow from MyTools sidebar

---
 src/client/util/CurrentUserUtils.ts | 2 +-
 1 file changed, 1 insertion(+), 1 deletion(-)

(limited to 'src/client/util/CurrentUserUtils.ts')

diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts
index 66f9d060f..e1cbaf125 100644
--- a/src/client/util/CurrentUserUtils.ts
+++ b/src/client/util/CurrentUserUtils.ts
@@ -748,7 +748,7 @@ export class CurrentUserUtils {
         if (doc.myTools === undefined) {
             const toolsStack = new PrefetchProxy(Docs.Create.StackingDocument([doc.myCreators as Doc, doc.myColorPicker as Doc], {
                 title: "My Tools", _width: 500, _yMargin: 20, ignoreClick: true, _lockedPosition: true, _forceActive: true,
-                system: true, _stayInCollection: true, _hideContextMenu: true, _chromeHidden: true,
+                system: true, _stayInCollection: true, _hideContextMenu: true, _chromeHidden: true, boxShadow: "0 0",
             })) as any as Doc;
 
             doc.myTools = toolsStack;
-- 
cgit v1.2.3-70-g09d2


From d7eedddcba42017c4609d81f3a47b2f35a48ecea Mon Sep 17 00:00:00 2001
From: bobzel <zzzman@gmail.com>
Date: Thu, 5 Aug 2021 23:30:55 -0400
Subject: fixed creating webpages from toolbar / :webpage to not use templates

---
 src/client/util/CurrentUserUtils.ts | 2 +-
 src/client/views/nodes/WebBox.tsx   | 2 +-
 2 files changed, 2 insertions(+), 2 deletions(-)

(limited to 'src/client/util/CurrentUserUtils.ts')

diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts
index e1cbaf125..1af6607a7 100644
--- a/src/client/util/CurrentUserUtils.ts
+++ b/src/client/util/CurrentUserUtils.ts
@@ -459,7 +459,7 @@ export class CurrentUserUtils {
             ((doc.emptyButton as Doc).proto as Doc)["dragFactory-count"] = 0;
         }
         if (doc.emptyWebpage === undefined) {
-            doc.emptyWebpage = Docs.Create.WebDocument("", { title: "webpage", _nativeWidth: 850, isTemplateDoc: true, _height: 512, _width: 400, useCors: true, system: true, cloneFieldFilter: new List<string>(["system"]) });
+            doc.emptyWebpage = Docs.Create.WebDocument("", { title: "webpage", _nativeWidth: 850, _height: 512, _width: 400, useCors: true, system: true, cloneFieldFilter: new List<string>(["system"]) });
         }
         if (doc.activeMobileMenu === undefined) {
             this.setupActiveMobileMenu(doc);
diff --git a/src/client/views/nodes/WebBox.tsx b/src/client/views/nodes/WebBox.tsx
index d2c806df6..7b2fafaa9 100644
--- a/src/client/views/nodes/WebBox.tsx
+++ b/src/client/views/nodes/WebBox.tsx
@@ -68,7 +68,7 @@ export class WebBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps
 
     constructor(props: any) {
         super(props);
-        if (this.webField) {
+        if (true) {// his.webField) {
             Doc.SetNativeWidth(this.dataDoc, Doc.NativeWidth(this.dataDoc) || 850);
             Doc.SetNativeHeight(this.dataDoc, Doc.NativeHeight(this.dataDoc) || this.Document[HeightSym]() / this.Document[WidthSym]() * 850);
         }
-- 
cgit v1.2.3-70-g09d2


From e7bbdd3b489fea1c508af53345cd0d1f31685cb9 Mon Sep 17 00:00:00 2001
From: bobzel <zzzman@gmail.com>
Date: Fri, 6 Aug 2021 18:03:38 -0400
Subject: collabortion fixes: added new acl for allowing people to edit their
 own text within the same note, fixed playground fields to write to the server
 without updating other clients.

---
 src/client/DocServer.ts                            |  5 +-
 src/client/documents/Documents.ts                  | 10 ++--
 src/client/util/CurrentUserUtils.ts                |  6 +-
 src/client/util/SharingManager.tsx                 | 13 ++--
 src/client/views/DocComponent.tsx                  |  6 +-
 src/client/views/MainView.tsx                      |  2 +-
 src/client/views/MarqueeAnnotator.tsx              |  4 +-
 src/client/views/PropertiesView.tsx                | 14 ++---
 .../collections/collectionFreeForm/MarqueeView.tsx |  4 +-
 .../views/nodes/formattedText/FormattedTextBox.tsx | 12 +++-
 .../formattedText/ProsemirrorExampleTransfer.ts    | 70 ++++++++++++++--------
 src/fields/Doc.ts                                  |  6 +-
 src/fields/util.ts                                 | 22 ++++---
 13 files changed, 105 insertions(+), 69 deletions(-)

(limited to 'src/client/util/CurrentUserUtils.ts')

diff --git a/src/client/DocServer.ts b/src/client/DocServer.ts
index 59278d2af..d9ae7d64c 100644
--- a/src/client/DocServer.ts
+++ b/src/client/DocServer.ts
@@ -59,7 +59,10 @@ export namespace DocServer {
     export var PlaygroundFields: string[];
     export function setPlaygroundFields(livePlaygroundFields: string[]) {
         DocServer.PlaygroundFields = livePlaygroundFields;
-        livePlaygroundFields.forEach(f => DocServer.setFieldWriteMode(f, DocServer.WriteMode.Playground));
+        livePlaygroundFields.forEach(f => DocServer.setFieldWriteMode(f, DocServer.WriteMode.LivePlayground));
+    }
+    export function IsPlaygroundField(field: string) {
+        return DocServer.PlaygroundFields?.includes(field.replace(/^_/, ""));
     }
 
     export function setFieldWriteMode(field: string, writeMode: WriteMode) {
diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts
index 24f777e88..93f0880a4 100644
--- a/src/client/documents/Documents.ts
+++ b/src/client/documents/Documents.ts
@@ -577,7 +577,7 @@ export namespace Docs {
             dataProps.creationDate = new DateField;
             dataProps[`${fieldKey}-lastModified`] = new DateField;
             dataProps["acl-Override"] = "None";
-            dataProps["acl-Public"] = Doc.UserDoc()?.defaultAclPrivate ? SharingPermissions.None : SharingPermissions.Add;
+            dataProps["acl-Public"] = Doc.UserDoc()?.defaultAclPrivate ? SharingPermissions.None : SharingPermissions.Augment;
 
             dataProps[fieldKey] = data;
 
@@ -588,7 +588,7 @@ export namespace Docs {
 
             viewProps.author = Doc.CurrentUserEmail;
             viewProps["acl-Override"] = "None";
-            viewProps["acl-Public"] = Doc.UserDoc()?.defaultAclPrivate ? SharingPermissions.None : SharingPermissions.Add;
+            viewProps["acl-Public"] = Doc.UserDoc()?.defaultAclPrivate ? SharingPermissions.None : SharingPermissions.Augment;
             const viewDoc = Doc.assign(Doc.MakeDelegate(dataDoc, delegId), viewProps, true, true);
             ![DocumentType.LINK, DocumentType.MARKER, DocumentType.LABEL].includes(viewDoc.type as any) && DocUtils.MakeLinkToActiveAudio(() => viewDoc);
 
@@ -699,7 +699,7 @@ export namespace Docs {
             I.author = Doc.CurrentUserEmail;
             I.rotation = 0;
             I.data = new InkField(points);
-            I["acl-Public"] = Doc.UserDoc()?.defaultAclPrivate ? SharingPermissions.None : SharingPermissions.Add;
+            I["acl-Public"] = Doc.UserDoc()?.defaultAclPrivate ? SharingPermissions.None : SharingPermissions.Augment;
             I["acl-Override"] = "None";
             I[Initializing] = false;
             return I;
@@ -1038,8 +1038,8 @@ export namespace DocUtils {
             title: ComputedField.MakeFunction("generateLinkTitle(self)") as any,
             "anchor1-useLinkSmallAnchor": source.doc.useLinkSmallAnchor ? true : undefined,
             "anchor2-useLinkSmallAnchor": target.doc.useLinkSmallAnchor ? true : undefined,
-            "acl-Public": SharingPermissions.Add,
-            "_acl-Public": SharingPermissions.Add,
+            "acl-Public": SharingPermissions.Augment,
+            "_acl-Public": SharingPermissions.Augment,
             layout_linkView: Cast(Cast(Doc.UserDoc()["template-button-link"], Doc, null).dragFactory, Doc, null),
             linkDisplay: true, hidden: true,
             linkRelationship,
diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts
index 1af6607a7..14c43fb1c 100644
--- a/src/client/util/CurrentUserUtils.ts
+++ b/src/client/util/CurrentUserUtils.ts
@@ -917,7 +917,7 @@ export class CurrentUserUtils {
                 linkDocs = new Doc(linkDatabaseId, true);
                 (linkDocs as Doc).author = Doc.CurrentUserEmail;
                 (linkDocs as Doc).data = new List<Doc>([]);
-                (linkDocs as Doc)["acl-Public"] = SharingPermissions.Add;
+                (linkDocs as Doc)["acl-Public"] = SharingPermissions.Augment;
             }
             doc.myLinkDatabase = new PrefetchProxy(linkDocs);
         }
@@ -926,10 +926,10 @@ export class CurrentUserUtils {
             if (!sharedDocs) {
                 sharedDocs = Docs.Create.TreeDocument([], {
                     title: "My SharedDocs", childDropAction: "alias", system: true, contentPointerEvents: "all", childLimitHeight: 0, _yMargin: 50, _gridGap: 15,
-                    _showTitle: "title", ignoreClick: true, _lockedPosition: true, "acl-Public": SharingPermissions.Add, "_acl-Public": SharingPermissions.Add,
+                    _showTitle: "title", ignoreClick: true, _lockedPosition: true, "acl-Public": SharingPermissions.Augment, "_acl-Public": SharingPermissions.Augment,
                     _chromeHidden: true, boxShadow: "0 0",
                 }, sharingDocumentId + "outer", sharingDocumentId);
-                (sharedDocs as Doc)["acl-Public"] = (sharedDocs as Doc)[DataSym]["acl-Public"] = SharingPermissions.Add;
+                (sharedDocs as Doc)["acl-Public"] = (sharedDocs as Doc)[DataSym]["acl-Public"] = SharingPermissions.Augment;
             }
             if (sharedDocs instanceof Doc) {
                 Doc.GetProto(sharedDocs).userColor = sharedDocs.userColor || "rgb(202, 202, 202)";
diff --git a/src/client/util/SharingManager.tsx b/src/client/util/SharingManager.tsx
index d283510b7..a8972b988 100644
--- a/src/client/util/SharingManager.tsx
+++ b/src/client/util/SharingManager.tsx
@@ -5,7 +5,7 @@ import { observer } from "mobx-react";
 import * as React from "react";
 import Select from "react-select";
 import * as RequestPromise from "request-promise";
-import { AclAddonly, AclAdmin, AclEdit, AclPrivate, AclReadonly, AclSym, AclUnset, DataSym, Doc, DocListCast, DocListCastAsync, Opt } from "../../fields/Doc";
+import { AclAugment, AclAdmin, AclEdit, AclPrivate, AclReadonly, AclSym, AclUnset, DataSym, Doc, DocListCast, DocListCastAsync, Opt, AclSelfEdit } from "../../fields/Doc";
 import { List } from "../../fields/List";
 import { Cast, NumCast, StrCast } from "../../fields/Types";
 import { distributeAcls, GetEffectiveAcl, normalizeEmail, SharingPermissions, TraceMobx } from "../../fields/util";
@@ -85,7 +85,8 @@ export class SharingManager extends React.Component<{}> {
     private AclMap = new Map<symbol, string>([
         [AclPrivate, SharingPermissions.None],
         [AclReadonly, SharingPermissions.View],
-        [AclAddonly, SharingPermissions.Add],
+        [AclAugment, SharingPermissions.Augment],
+        [AclSelfEdit, SharingPermissions.SelfEdit],
         [AclEdit, SharingPermissions.Edit],
         [AclAdmin, SharingPermissions.Admin]
     ]);
@@ -101,7 +102,7 @@ export class SharingManager extends React.Component<{}> {
             this.targetDoc = target_doc || target?.props.Document;
             DictationOverlay.Instance.hasActiveModal = true;
             this.isOpen = this.targetDoc !== undefined;
-            this.permissions = SharingPermissions.Add;
+            this.permissions = SharingPermissions.Augment;
         });
     }
 
@@ -366,10 +367,10 @@ export class SharingManager extends React.Component<{}> {
         const dropdownValues: string[] = Object.values(SharingPermissions);
         if (!uniform) dropdownValues.unshift("-multiple-");
         if (override) dropdownValues.unshift("None");
-        return dropdownValues.filter(permission => permission !== SharingPermissions.View).map(permission =>
+        return dropdownValues.filter(permission => !Doc.UserDoc().noviceMode || ![SharingPermissions.View, SharingPermissions.SelfEdit].includes(permission as any)).map(permission =>
             (
                 <option key={permission} value={permission}>
-                    {permission === SharingPermissions.Add ? "Can Augment" : permission}
+                    {permission}
                 </option>
             )
         );
@@ -546,7 +547,7 @@ export class SharingManager extends React.Component<{}> {
                             </select>
                         ) : (
                                 <div className={"permissions-dropdown"}>
-                                    {permissions === SharingPermissions.Add ? "Can Augment" : permissions}
+                                    {permissions}
                                 </div>
                             )}
                     </div>
diff --git a/src/client/views/DocComponent.tsx b/src/client/views/DocComponent.tsx
index fc36c7e43..99c695a4a 100644
--- a/src/client/views/DocComponent.tsx
+++ b/src/client/views/DocComponent.tsx
@@ -1,4 +1,4 @@
-import { Doc, Opt, DataSym, AclReadonly, AclAddonly, AclPrivate, AclEdit, AclSym, DocListCastAsync, DocListCast, AclAdmin } from '../../fields/Doc';
+import { Doc, Opt, DataSym, AclReadonly, AclAugment, AclPrivate, AclEdit, AclSym, DocListCast, AclAdmin, AclSelfEdit } from '../../fields/Doc';
 import { Touchable } from './Touchable';
 import { computed, action, observable } from 'mobx';
 import { Cast, BoolCast, ScriptCast } from '../../fields/Types';
@@ -131,7 +131,7 @@ export function ViewBoxAnnotatableComponent<P extends ViewBoxAnnotatableProps, T
         removeDocument(doc: Doc | Doc[], annotationKey?: string, leavePushpin?: boolean): boolean {
             const effectiveAcl = GetEffectiveAcl(this.dataDoc);
             const indocs = doc instanceof Doc ? [doc] : doc;
-            const docs = indocs.filter(doc => effectiveAcl === AclEdit || effectiveAcl === AclAdmin || GetEffectiveAcl(doc) === AclAdmin);
+            const docs = indocs.filter(doc => [AclEdit, AclAdmin].includes(effectiveAcl) || GetEffectiveAcl(doc) === AclAdmin);
             if (docs.length) {
                 setTimeout(() => docs.map(doc => { // this allows 'addDocument' to see the annotationOn field in order to create a pushin
                     Doc.SetInPlace(doc, "isPushpin", undefined, true);
@@ -199,7 +199,7 @@ export function ViewBoxAnnotatableComponent<P extends ViewBoxAnnotatableProps, T
                         });
                     }
 
-                    if (effectiveAcl === AclAddonly) {
+                    if (effectiveAcl === AclAugment) {
                         added.map(doc => {
                             if ([AclAdmin, AclEdit].includes(GetEffectiveAcl(doc))) inheritParentAcls(CurrentUserUtils.ActiveDashboard, doc);
                             doc.context = this.props.Document;
diff --git a/src/client/views/MainView.tsx b/src/client/views/MainView.tsx
index 005e46836..8f37172a0 100644
--- a/src/client/views/MainView.tsx
+++ b/src/client/views/MainView.tsx
@@ -107,7 +107,7 @@ export class MainView extends React.Component {
         new InkStrokeProperties();
         this._sidebarContent.proto = undefined;
         if (!MainView.Live) {
-            DocServer.setPlaygroundFields(["x", "y", "dataTransition", "_autoHeight", "_showSidebar", "showSidebar", "_sidebarWidthPercent", "_width", "_height", "width", "height", "_viewTransition", "_panX", "_panY", "_viewScale", "_scrollTop", "hidden", "_curPage", "_viewType", "_chromeHidden", "nativeWidth", "_nativeWidth"]); // can play with these fields on someone else's
+            DocServer.setPlaygroundFields(["dataTransition", "autoHeight", "showSidebar", "sidebarWidthPercent", "viewTransition", "panX", "panY", "viewScale", "scrollTop", "hidden", "curPage", "viewType", "chromeHidden", "nativeWidth"]); // can play with these fields on someone else's
         }
         DocServer.GetRefField("rtfProto").then(proto => (proto instanceof Doc) && reaction(() => StrCast(proto.BROADCAST_MESSAGE), msg => msg && alert(msg)));
 
diff --git a/src/client/views/MarqueeAnnotator.tsx b/src/client/views/MarqueeAnnotator.tsx
index 805cda95c..a3a3bce56 100644
--- a/src/client/views/MarqueeAnnotator.tsx
+++ b/src/client/views/MarqueeAnnotator.tsx
@@ -1,6 +1,6 @@
 import { action, observable, ObservableMap, runInAction } from "mobx";
 import { observer } from "mobx-react";
-import { AclAddonly, AclAdmin, AclEdit, DataSym, Doc, Opt } from "../../fields/Doc";
+import { AclAugment, AclAdmin, AclEdit, DataSym, Doc, Opt, AclSelfEdit } from "../../fields/Doc";
 import { Id } from "../../fields/FieldSymbols";
 import { List } from "../../fields/List";
 import { NumCast } from "../../fields/Types";
@@ -156,7 +156,7 @@ export class MarqueeAnnotator extends React.Component<MarqueeAnnotatorProps> {
     highlight = (color: string, isLinkButton: boolean, savedAnnotations?: ObservableMap<number, HTMLDivElement[]>) => {
         // creates annotation documents for current highlights
         const effectiveAcl = GetEffectiveAcl(this.props.rootDoc[DataSym]);
-        const annotationDoc = [AclAddonly, AclEdit, AclAdmin].includes(effectiveAcl) && this.makeAnnotationDocument(color, isLinkButton, savedAnnotations);
+        const annotationDoc = [AclAugment, AclSelfEdit, AclEdit, AclAdmin].includes(effectiveAcl) && this.makeAnnotationDocument(color, isLinkButton, savedAnnotations);
         !savedAnnotations && annotationDoc && this.props.addDocument(annotationDoc);
         return annotationDoc as Doc ?? undefined;
     }
diff --git a/src/client/views/PropertiesView.tsx b/src/client/views/PropertiesView.tsx
index 8136edf04..de437e1df 100644
--- a/src/client/views/PropertiesView.tsx
+++ b/src/client/views/PropertiesView.tsx
@@ -5,7 +5,7 @@ import { intersection } from "lodash";
 import { action, autorun, computed, Lambda, observable, reaction, runInAction } from "mobx";
 import { observer } from "mobx-react";
 import { ColorState, SketchPicker } from "react-color";
-import { AclAddonly, AclAdmin, AclEdit, AclPrivate, AclReadonly, AclSym, AclUnset, DataSym, Doc, Field, HeightSym, Opt, WidthSym } from "../../fields/Doc";
+import { AclAugment, AclAdmin, AclEdit, AclPrivate, AclReadonly, AclSym, AclUnset, DataSym, Doc, Field, HeightSym, Opt, WidthSym, AclSelfEdit } from "../../fields/Doc";
 import { Id } from "../../fields/FieldSymbols";
 import { InkField } from "../../fields/InkField";
 import { ComputedField } from "../../fields/ScriptField";
@@ -342,12 +342,9 @@ export class PropertiesView extends React.Component<PropertiesViewProps> {
         return <select className="permissions-select"
             value={permission}
             onChange={e => this.changePermissions(e, user)}>
-            {dropdownValues.filter(permission => permission !== SharingPermissions.View).map(permission => {
-                return (
-                    <option key={permission} value={permission}>
-                        {permission === SharingPermissions.Add ? "Can Augment" : permission}
-                    </option>);
-            })}
+            {dropdownValues.filter(permission =>
+                !Doc.UserDoc().noviceMode || ![SharingPermissions.View, SharingPermissions.SelfEdit].includes(permission as any)).map(permission =>
+                    <option key={permission} value={permission}>  {permission}  </option>)}
         </select>;
     }
 
@@ -402,7 +399,8 @@ export class PropertiesView extends React.Component<PropertiesViewProps> {
             [AclUnset, "None"],
             [AclPrivate, SharingPermissions.None],
             [AclReadonly, SharingPermissions.View],
-            [AclAddonly, SharingPermissions.Add],
+            [AclAugment, SharingPermissions.Augment],
+            [AclSelfEdit, SharingPermissions.SelfEdit],
             [AclEdit, SharingPermissions.Edit],
             [AclAdmin, SharingPermissions.Admin]
         ]);
diff --git a/src/client/views/collections/collectionFreeForm/MarqueeView.tsx b/src/client/views/collections/collectionFreeForm/MarqueeView.tsx
index 846d28214..19da7ea00 100644
--- a/src/client/views/collections/collectionFreeForm/MarqueeView.tsx
+++ b/src/client/views/collections/collectionFreeForm/MarqueeView.tsx
@@ -1,6 +1,6 @@
 import { action, computed, observable } from "mobx";
 import { observer } from "mobx-react";
-import { AclAddonly, AclAdmin, AclEdit, DataSym, Doc, Opt } from "../../../../fields/Doc";
+import { AclAugment, AclAdmin, AclEdit, DataSym, Doc, Opt } from "../../../../fields/Doc";
 import { Id } from "../../../../fields/FieldSymbols";
 import { InkData, InkField, InkTool } from "../../../../fields/InkField";
 import { List } from "../../../../fields/List";
@@ -298,7 +298,7 @@ export class MarqueeView extends React.Component<SubCollectionViewProps & Marque
             this._downX = x;
             this._downY = y;
             const effectiveAcl = GetEffectiveAcl(this.props.Document[DataSym]);
-            if ([AclAdmin, AclEdit, AclAddonly].includes(effectiveAcl)) {
+            if ([AclAdmin, AclEdit, AclAugment].includes(effectiveAcl)) {
                 PreviewCursor.Show(x, y, this.onKeyPress, this.props.addLiveTextDocument, this.props.getTransform, this.props.addDocument, this.props.nudge);
             }
             this.clearSelection();
diff --git a/src/client/views/nodes/formattedText/FormattedTextBox.tsx b/src/client/views/nodes/formattedText/FormattedTextBox.tsx
index edd7177de..f7bed2fa1 100644
--- a/src/client/views/nodes/formattedText/FormattedTextBox.tsx
+++ b/src/client/views/nodes/formattedText/FormattedTextBox.tsx
@@ -11,7 +11,7 @@ import { ReplaceStep } from 'prosemirror-transform';
 import { EditorState, NodeSelection, Plugin, TextSelection, Transaction } from "prosemirror-state";
 import { EditorView } from "prosemirror-view";
 import { DateField } from '../../../../fields/DateField';
-import { AclAdmin, AclEdit, DataSym, Doc, DocListCast, DocListCastAsync, Field, ForceServerWrite, HeightSym, Opt, UpdatingFromServer, WidthSym } from "../../../../fields/Doc";
+import { AclAdmin, AclEdit, AclSelfEdit, DataSym, Doc, DocListCast, DocListCastAsync, Field, ForceServerWrite, HeightSym, Opt, UpdatingFromServer, WidthSym, AclAugment } from "../../../../fields/Doc";
 import { documentSchema } from '../../../../fields/documentSchemas';
 import { Id } from '../../../../fields/FieldSymbols';
 import { InkTool } from '../../../../fields/InkField';
@@ -253,7 +253,7 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
             const removeSelection = (json: string | undefined) => json?.indexOf("\"storedMarks\"") === -1 ?
                 json?.replace(/"selection":.*/, "") : json?.replace(/"selection":"\"storedMarks\""/, "\"storedMarks\"");
 
-            if (effectiveAcl === AclEdit || effectiveAcl === AclAdmin) {
+            if (effectiveAcl === AclEdit || effectiveAcl === AclAdmin || effectiveAcl === AclSelfEdit) {
                 const accumTags = [] as string[];
                 state.tr.doc.nodesBetween(0, state.doc.content.size, (node: any, pos: number, parent: any) => {
                     if (node.type === schema.nodes.dashField && node.attrs.fieldKey.startsWith("#")) {
@@ -1401,6 +1401,14 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
             this._rules!.EnteringStyle = false;
         }
         e.stopPropagation();
+        for (var i = state.selection.from; i < state.selection.to; i++) {
+            const node = state.doc.resolve(i);
+            if (node?.marks?.().some(mark => mark.type === schema.marks.user_mark &&
+                mark.attrs.userid !== Doc.CurrentUserEmail) &&
+                [AclAugment, AclSelfEdit].includes(GetEffectiveAcl(this.rootDoc))) {
+                e.preventDefault();
+            }
+        }
         switch (e.key) {
             case "Escape":
                 this._editorView!.dispatch(state.tr.setSelection(TextSelection.create(state.doc, state.selection.from, state.selection.from)));
diff --git a/src/client/views/nodes/formattedText/ProsemirrorExampleTransfer.ts b/src/client/views/nodes/formattedText/ProsemirrorExampleTransfer.ts
index d5c77786c..1f78b2204 100644
--- a/src/client/views/nodes/formattedText/ProsemirrorExampleTransfer.ts
+++ b/src/client/views/nodes/formattedText/ProsemirrorExampleTransfer.ts
@@ -7,13 +7,14 @@ import { splitListItem, wrapInList, } from "prosemirror-schema-list";
 import { EditorState, Transaction, TextSelection } from "prosemirror-state";
 import { SelectionManager } from "../../../util/SelectionManager";
 import { NumCast, BoolCast, Cast, StrCast } from "../../../../fields/Types";
-import { Doc, DataSym, DocListCast } from "../../../../fields/Doc";
+import { Doc, DataSym, DocListCast, AclAugment } from "../../../../fields/Doc";
 import { FormattedTextBox } from "./FormattedTextBox";
 import { Id } from "../../../../fields/FieldSymbols";
 import { Docs } from "../../../documents/Documents";
 import { Utils } from "../../../../Utils";
 import { listSpec } from "../../../../fields/Schema";
 import { List } from "../../../../fields/List";
+import { GetEffectiveAcl } from "../../../../fields/util";
 
 const mac = typeof navigator !== "undefined" ? /Mac/.test(navigator.platform) : false;
 
@@ -70,25 +71,39 @@ export function buildKeymap<S extends Schema<any>>(schema: S, props: any, mapKey
         return false;
     };
 
+    const canEdit = (state: any) => {
+        for (var i = state.selection.from; i < state.selection.to; i++) {
+            const node = state.doc.resolve(i);
+            if (node?.marks?.().some((mark: any) => mark.type === schema.marks.user_mark &&
+                mark.attrs.userid !== Doc.CurrentUserEmail) &&
+                GetEffectiveAcl(props.Document) === AclAugment) {
+                return false;
+            }
+        }
+        return true;
+    }
+
+    const toggleEditableMark = (mark: any) => (state: EditorState<S>, dispatch: (tx: Transaction<S>) => void) => canEdit(state) && toggleMark(mark)(state, dispatch);
+
     //History commands
     bind("Mod-z", undo);
     bind("Shift-Mod-z", redo);
     !mac && bind("Mod-y", redo);
 
     //Commands to modify Mark
-    bind("Mod-b", toggleMark(schema.marks.strong));
-    bind("Mod-B", toggleMark(schema.marks.strong));
+    bind("Mod-b", toggleEditableMark(schema.marks.strong));
+    bind("Mod-B", toggleEditableMark(schema.marks.strong));
 
-    bind("Mod-e", toggleMark(schema.marks.em));
-    bind("Mod-E", toggleMark(schema.marks.em));
+    bind("Mod-e", toggleEditableMark(schema.marks.em));
+    bind("Mod-E", toggleEditableMark(schema.marks.em));
 
-    bind("Mod-*", toggleMark(schema.marks.code));
+    bind("Mod-*", toggleEditableMark(schema.marks.code));
 
-    bind("Mod-u", toggleMark(schema.marks.underline));
-    bind("Mod-U", toggleMark(schema.marks.underline));
+    bind("Mod-u", toggleEditableMark(schema.marks.underline));
+    bind("Mod-U", toggleEditableMark(schema.marks.underline));
 
     //Commands for lists
-    bind("Ctrl-i", wrapInList(schema.nodes.ordered_list));
+    bind("Ctrl-i", (state: EditorState<S>, dispatch: (tx: Transaction<S>) => void) => canEdit(state) && wrapInList(schema.nodes.ordered_list)(state, dispatch as any));
 
     bind("Tab", (state: EditorState<S>, dispatch: (tx: Transaction<S>) => void) => {
         /// bcz; Argh!!  replace layotuTEmpalteString with a onTab prop conditionally handles Tab);
@@ -96,6 +111,7 @@ export function buildKeymap<S extends Schema<any>>(schema: S, props: any, mapKey
             if (!props.LayoutTemplateString) return addTextBox(false, true);
             return true;
         }
+        if (!canEdit(state)) return true;
         const ref = state.selection;
         const range = ref.$from.blockRange(ref.$to);
         const marks = state.storedMarks || (state.selection.$to.parentOffset && state.selection.$from.marks());
@@ -121,6 +137,7 @@ export function buildKeymap<S extends Schema<any>>(schema: S, props: any, mapKey
     bind("Shift-Tab", (state: EditorState<S>, dispatch: (tx: Transaction<S>) => void) => {
         /// bcz; Argh!!  replace with a onShiftTab prop conditionally handles Tab);
         if (props.Document._singleLine) return true;
+        if (!canEdit(state)) return true;
         const marks = state.storedMarks || (state.selection.$to.parentOffset && state.selection.$from.marks());
 
         if (!liftListItem(schema.nodes.list_item)(state.tr, (tx2: Transaction) => {
@@ -140,24 +157,19 @@ export function buildKeymap<S extends Schema<any>>(schema: S, props: any, mapKey
     });
 
     //Commands to modify BlockType
-    bind("Ctrl->", wrapIn(schema.nodes.blockquote));
-    bind("Alt-\\", setBlockType(schema.nodes.paragraph));
-    bind("Shift-Ctrl-\\", setBlockType(schema.nodes.code_block));
+    bind("Ctrl->", (state: EditorState<S>, dispatch: (tx: Transaction<S>) => void) => canEdit((state) && wrapIn(schema.nodes.blockquote)(state, dispatch as any)));
+    bind("Alt-\\", (state: EditorState<S>, dispatch: (tx: Transaction<S>) => void) => canEdit(state) && setBlockType(schema.nodes.paragraph)(state, dispatch as any));
+    bind("Shift-Ctrl-\\", (state: EditorState<S>, dispatch: (tx: Transaction<S>) => void) => canEdit(state) && setBlockType(schema.nodes.code_block)(state, dispatch as any));
 
-    bind("Ctrl-m", (state: EditorState<S>, dispatch: (tx: Transaction<S>) => void) => {
-        dispatch(state.tr.replaceSelectionWith(schema.nodes.equation.create({ fieldKey: "math" + Utils.GenerateGuid() })));
-    });
+    bind("Ctrl-m", (state: EditorState<S>, dispatch: (tx: Transaction<S>) => void) => canEdit(state) && dispatch(state.tr.replaceSelectionWith(schema.nodes.equation.create({ fieldKey: "math" + Utils.GenerateGuid() }))));
 
     for (let i = 1; i <= 6; i++) {
-        bind("Shift-Ctrl-" + i, setBlockType(schema.nodes.heading, { level: i }));
+        bind("Shift-Ctrl-" + i, (state: EditorState<S>, dispatch: (tx: Transaction<S>) => void) => canEdit(state) && setBlockType(schema.nodes.heading, { level: i })(state, dispatch as any));
     }
 
     //Command to create a horizontal break line
     const hr = schema.nodes.horizontal_rule;
-    bind("Mod-_", (state: EditorState<S>, dispatch: (tx: Transaction<S>) => void) => {
-        dispatch(state.tr.replaceSelectionWith(hr.create()).scrollIntoView());
-        return true;
-    });
+    bind("Mod-_", (state: EditorState<S>, dispatch: (tx: Transaction<S>) => void) => canEdit(state) && dispatch(state.tr.replaceSelectionWith(hr.create()).scrollIntoView()));
 
     //Command to unselect all
     bind("Escape", (state: EditorState<S>, dispatch: (tx: Transaction<S>) => void) => {
@@ -173,13 +185,15 @@ export function buildKeymap<S extends Schema<any>>(schema: S, props: any, mapKey
     };
 
     //Command to create a text document to the right of the selected textbox
-    bind("Alt-Enter", (state: EditorState<S>, dispatch: (tx: Transaction<Schema<any, any>>) => void) => addTextBox(false, true));
+    bind("Alt-Enter", () => addTextBox(false, true));
 
     //Command to create a text document to the bottom of the selected textbox
-    bind("Ctrl-Enter", (state: EditorState<S>, dispatch: (tx: Transaction<S>) => void) => addTextBox(true, true));
+    bind("Ctrl-Enter", () => addTextBox(true, true));
 
     // backspace = chainCommands(deleteSelection, joinBackward, selectNodeBackward);
     bind("Backspace", (state: EditorState<S>, dispatch: (tx: Transaction<Schema<any, any>>) => void) => {
+        if (!canEdit(state)) return true;
+
         if (!deleteSelection(state, (tx: Transaction<Schema<any, any>>) => {
             dispatch(updateBullets(tx, schema));
         })) {
@@ -200,6 +214,9 @@ export function buildKeymap<S extends Schema<any>>(schema: S, props: any, mapKey
     //command to break line
     bind("Enter", (state: EditorState<S>, dispatch: (tx: Transaction<Schema<any, any>>) => void) => {
         if (addTextBox(true, false)) return true;
+
+        if (!canEdit(state)) return true;
+
         const trange = state.selection.$from.blockRange(state.selection.$to);
         const path = (state.selection.$from as any).path;
         const depth = trange ? liftTarget(trange) : undefined;
@@ -238,18 +255,19 @@ export function buildKeymap<S extends Schema<any>>(schema: S, props: any, mapKey
 
     //Command to create a blank space
     bind("Space", (state: EditorState<S>, dispatch: (tx: Transaction<S>) => void) => {
+        if (!canEdit(state)) return true;
         const marks = state.storedMarks || (state.selection.$to.parentOffset && state.selection.$from.marks());
         dispatch(splitMetadata(marks, state.tr));
         return false;
     });
 
-    bind("Alt-ArrowUp", joinUp);
-    bind("Alt-ArrowDown", joinDown);
-    bind("Mod-BracketLeft", lift);
+    bind("Alt-ArrowUp", (state: EditorState<S>, dispatch: (tx: Transaction<S>) => void) => canEdit(state) && joinUp(state, dispatch as any));
+    bind("Alt-ArrowDown", (state: EditorState<S>, dispatch: (tx: Transaction<S>) => void) => canEdit(state) && joinDown(state, dispatch as any));
+    bind("Mod-BracketLeft", (state: EditorState<S>, dispatch: (tx: Transaction<S>) => void) => canEdit(state) && lift(state, dispatch as any));
 
     const cmd = chainCommands(exitCode, (state, dispatch) => {
         if (dispatch) {
-            dispatch(state.tr.replaceSelectionWith(schema.nodes.hard_break.create()).scrollIntoView());
+            canEdit(state) && dispatch(state.tr.replaceSelectionWith(schema.nodes.hard_break.create()).scrollIntoView());
             return true;
         }
         return false;
diff --git a/src/fields/Doc.ts b/src/fields/Doc.ts
index 0cbfaf067..85ea3cfa9 100644
--- a/src/fields/Doc.ts
+++ b/src/fields/Doc.ts
@@ -90,7 +90,8 @@ export const DirectLinksSym = Symbol("DirectLinks");
 export const AclUnset = Symbol("AclUnset");
 export const AclPrivate = Symbol("AclOwnerOnly");
 export const AclReadonly = Symbol("AclReadOnly");
-export const AclAddonly = Symbol("AclAddonly");
+export const AclAugment = Symbol("AclAugment");
+export const AclSelfEdit = Symbol("AclSelfEdit");
 export const AclEdit = Symbol("AclEdit");
 export const AclAdmin = Symbol("AclAdmin");
 export const UpdatingFromServer = Symbol("UpdatingFromServer");
@@ -102,7 +103,8 @@ const AclMap = new Map<string, symbol>([
     ["None", AclUnset],
     [SharingPermissions.None, AclPrivate],
     [SharingPermissions.View, AclReadonly],
-    [SharingPermissions.Add, AclAddonly],
+    [SharingPermissions.Augment, AclAugment],
+    [SharingPermissions.SelfEdit, AclSelfEdit],
     [SharingPermissions.Edit, AclEdit],
     [SharingPermissions.Admin, AclAdmin]
 ]);
diff --git a/src/fields/util.ts b/src/fields/util.ts
index 526e5af72..2bb6b45c2 100644
--- a/src/fields/util.ts
+++ b/src/fields/util.ts
@@ -1,5 +1,5 @@
 import { UndoManager } from "../client/util/UndoManager";
-import { Doc, FieldResult, UpdatingFromServer, LayoutSym, AclPrivate, AclEdit, AclReadonly, AclAddonly, AclSym, DataSym, DocListCast, AclAdmin, HeightSym, WidthSym, updateCachedAcls, AclUnset, DocListCastAsync, ForceServerWrite, Initializing } from "./Doc";
+import { Doc, FieldResult, UpdatingFromServer, LayoutSym, AclPrivate, AclEdit, AclReadonly, AclAugment, AclSym, DataSym, DocListCast, AclAdmin, HeightSym, WidthSym, updateCachedAcls, AclUnset, DocListCastAsync, ForceServerWrite, Initializing, AclSelfEdit } from "./Doc";
 import { SerializationHelper } from "../client/util/SerializationHelper";
 import { ProxyField, PrefetchProxy } from "./Proxy";
 import { RefField } from "./RefField";
@@ -14,6 +14,7 @@ import CursorField from "./CursorField";
 import { List } from "./List";
 import { SnappingManager } from "../client/util/SnappingManager";
 import { computedFn } from "mobx-utils";
+import { RichTextField } from "./RichTextField";
 
 function _readOnlySetter(): never {
     throw new Error("Documents can't be modified in read-only mode");
@@ -77,7 +78,9 @@ const _setterImpl = action(function (target: any, prop: string | symbol | number
     const fromServer = target[UpdatingFromServer];
     const sameAuthor = fromServer || (receiver.author === Doc.CurrentUserEmail);
     const writeToDoc = sameAuthor || effectiveAcl === AclEdit || effectiveAcl === AclAdmin || (writeMode !== DocServer.WriteMode.LiveReadonly);
-    const writeToServer = (sameAuthor || effectiveAcl === AclEdit || effectiveAcl === AclAdmin || writeMode === DocServer.WriteMode.Default) && !DocServer.Control.isReadOnly();// && !playgroundMode;
+    const writeToServer =
+        (sameAuthor || effectiveAcl === AclEdit || effectiveAcl === AclAdmin || (effectiveAcl === AclSelfEdit && (value instanceof RichTextField))) &&
+        !DocServer.Control.isReadOnly();
 
     if (writeToDoc) {
         if (value === undefined) {
@@ -157,9 +160,10 @@ export function inheritParentAcls(parent: Doc, child: Doc) {
  */
 export enum SharingPermissions {
     Admin = "Admin",
-    Edit = "Can Edit",
-    Add = "Can Augment",
-    View = "Can View",
+    Edit = "Edit",
+    SelfEdit = "Self Edit",
+    Augment = "Augment",
+    View = "View",
     None = "Not Shared"
 }
 
@@ -176,7 +180,7 @@ export function GetEffectiveAcl(target: any, user?: string): symbol {
 
 function getPropAcl(target: any, prop: string | symbol | number) {
     if (prop === UpdatingFromServer || prop === Initializing || target[UpdatingFromServer] || prop === AclSym) return AclAdmin;  // requesting the UpdatingFromServer prop or AclSym must always go through to keep the local DB consistent
-    if (prop && DocServer.PlaygroundFields?.includes(prop.toString())) return AclEdit; // playground props are always editable
+    if (prop && DocServer.IsPlaygroundField(prop.toString())) return AclEdit; // playground props are always editable
     return GetEffectiveAcl(target);
 }
 
@@ -192,7 +196,8 @@ function getEffectiveAcl(target: any, user?: string): symbol {
         HierarchyMapping = HierarchyMapping || new Map<symbol, number>([
             [AclPrivate, 0],
             [AclReadonly, 1],
-            [AclAddonly, 2],
+            [AclAugment, 2],
+            [AclSelfEdit, 2.5],
             [AclEdit, 3],
             [AclAdmin, 4]
         ]);
@@ -235,6 +240,7 @@ export function distributeAcls(key: string, acl: SharingPermissions, target: Doc
         ["Not Shared", 0],
         ["Can View", 1],
         ["Can Augment", 2],
+        ["Self Edit", 2.5],
         ["Can Edit", 3],
         ["Admin", 4]
     ]);
@@ -294,7 +300,7 @@ export function distributeAcls(key: string, acl: SharingPermissions, target: Doc
 export function setter(target: any, in_prop: string | symbol | number, value: any, receiver: any): boolean {
     let prop = in_prop;
     const effectiveAcl = getPropAcl(target, prop);
-    if (effectiveAcl !== AclEdit && effectiveAcl !== AclAdmin) return true;
+    if (effectiveAcl !== AclEdit && effectiveAcl !== AclAdmin && !(effectiveAcl === AclSelfEdit && value instanceof RichTextField)) return true;
     // if you're trying to change an acl but don't have Admin access / you're trying to change it to something that isn't an acceptable acl, you can't
     if (typeof prop === "string" && prop.startsWith("acl") && (effectiveAcl !== AclAdmin || ![...Object.values(SharingPermissions), undefined, "None"].includes(value))) return true;
     // if (typeof prop === "string" && prop.startsWith("acl") && !["Can Edit", "Can Augment", "Can View", "Not Shared", undefined].includes(value)) return true;
-- 
cgit v1.2.3-70-g09d2


From 81ae5175aebf7e14a781a73d4a7cbaec0b8f3e4a Mon Sep 17 00:00:00 2001
From: bobzel <zzzman@gmail.com>
Date: Mon, 9 Aug 2021 14:26:14 -0400
Subject: fixed augment only text to resize correctly with autoheight. fixed
 acls to cache correctly for new documents. fixed links to be shared across
 users.  fixed links to always default to public.

---
 src/client/DocServer.ts                            |  2 +-
 src/client/documents/Documents.ts                  |  8 ++-
 src/client/util/CurrentUserUtils.ts                | 16 +++---
 src/client/util/LinkManager.ts                     | 67 ++++++++++++++--------
 src/client/util/SettingsManager.tsx                |  3 +-
 src/client/util/SharingManager.tsx                 |  4 +-
 src/client/views/MainView.tsx                      |  2 +-
 .../views/nodes/formattedText/FormattedTextBox.tsx | 20 ++++---
 src/fields/util.ts                                 |  4 +-
 9 files changed, 79 insertions(+), 47 deletions(-)

(limited to 'src/client/util/CurrentUserUtils.ts')

diff --git a/src/client/DocServer.ts b/src/client/DocServer.ts
index 5712a1d64..f4e3a22cf 100644
--- a/src/client/DocServer.ts
+++ b/src/client/DocServer.ts
@@ -1,6 +1,6 @@
 import * as io from 'socket.io-client';
 import { MessageStore, YoutubeQueryTypes, GestureContent, MobileInkOverlayContent, UpdateMobileInkOverlayPositionContent, MobileDocumentUploadContent } from "./../server/Message";
-import { Opt, Doc, UpdatingFromServer } from '../fields/Doc';
+import { Opt, Doc, UpdatingFromServer, updateCachedAcls } from '../fields/Doc';
 import { Utils, emptyFunction } from '../Utils';
 import { SerializationHelper } from './util/SerializationHelper';
 import { RefField } from '../fields/RefField';
diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts
index 93f0880a4..48886aa3b 100644
--- a/src/client/documents/Documents.ts
+++ b/src/client/documents/Documents.ts
@@ -1,7 +1,7 @@
 import { action, runInAction } from "mobx";
 import { basename, extname } from "path";
 import { DateField } from "../../fields/DateField";
-import { Doc, DocListCast, DocListCastAsync, Field, HeightSym, Opt, WidthSym, Initializing } from "../../fields/Doc";
+import { Doc, DocListCast, DocListCastAsync, Field, HeightSym, Opt, WidthSym, Initializing, updateCachedAcls } from "../../fields/Doc";
 import { Id } from "../../fields/FieldSymbols";
 import { HtmlField } from "../../fields/HtmlField";
 import { InkField } from "../../fields/InkField";
@@ -577,7 +577,7 @@ export namespace Docs {
             dataProps.creationDate = new DateField;
             dataProps[`${fieldKey}-lastModified`] = new DateField;
             dataProps["acl-Override"] = "None";
-            dataProps["acl-Public"] = Doc.UserDoc()?.defaultAclPrivate ? SharingPermissions.None : SharingPermissions.Augment;
+            dataProps["acl-Public"] = options["acl-Public"] ? options["acl-Public"] : Doc.UserDoc()?.defaultAclPrivate ? SharingPermissions.None : SharingPermissions.Augment;
 
             dataProps[fieldKey] = data;
 
@@ -588,13 +588,15 @@ export namespace Docs {
 
             viewProps.author = Doc.CurrentUserEmail;
             viewProps["acl-Override"] = "None";
-            viewProps["acl-Public"] = Doc.UserDoc()?.defaultAclPrivate ? SharingPermissions.None : SharingPermissions.Augment;
+            viewProps["acl-Public"] = options["_acl-Public"] ? options["_acl-Public"] : Doc.UserDoc()?.defaultAclPrivate ? SharingPermissions.None : SharingPermissions.Augment;
             const viewDoc = Doc.assign(Doc.MakeDelegate(dataDoc, delegId), viewProps, true, true);
             ![DocumentType.LINK, DocumentType.MARKER, DocumentType.LABEL].includes(viewDoc.type as any) && DocUtils.MakeLinkToActiveAudio(() => viewDoc);
 
             !Doc.IsSystem(dataDoc) && ![DocumentType.MARKER, DocumentType.KVP, DocumentType.LINK, DocumentType.LINKANCHOR].includes(proto.type as any) &&
                 !dataDoc.isFolder && !dataProps.annotationOn && Doc.AddDocToList(Cast(Doc.UserDoc().myFileOrphans, Doc, null), "data", dataDoc);
 
+            updateCachedAcls(dataDoc);
+            updateCachedAcls(viewDoc);
             return viewDoc;
         }
 
diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts
index 14c43fb1c..34990e121 100644
--- a/src/client/util/CurrentUserUtils.ts
+++ b/src/client/util/CurrentUserUtils.ts
@@ -2,13 +2,14 @@ import { computed, observable, reaction } from "mobx";
 import * as rp from 'request-promise';
 import { DataSym, Doc, DocListCast, DocListCastAsync } from "../../fields/Doc";
 import { Id } from "../../fields/FieldSymbols";
+import { InkTool } from "../../fields/InkField";
 import { List } from "../../fields/List";
 import { PrefetchProxy } from "../../fields/Proxy";
 import { RichTextField } from "../../fields/RichTextField";
 import { listSpec } from "../../fields/Schema";
 import { SchemaHeaderField } from "../../fields/SchemaHeaderField";
 import { ComputedField, ScriptField } from "../../fields/ScriptField";
-import { BoolCast, Cast, NumCast, PromiseValue, StrCast, DateCast } from "../../fields/Types";
+import { BoolCast, Cast, DateCast, NumCast, PromiseValue, StrCast } from "../../fields/Types";
 import { nullAudio } from "../../fields/URLField";
 import { SharingPermissions } from "../../fields/util";
 import { Utils } from "../../Utils";
@@ -19,6 +20,7 @@ import { Networking } from "../Network";
 import { CollectionDockingView } from "../views/collections/CollectionDockingView";
 import { DimUnit } from "../views/collections/collectionMulticolumn/CollectionMulticolumnView";
 import { CollectionView, CollectionViewType } from "../views/collections/CollectionView";
+import { Colors } from "../views/global/globalEnums";
 import { MainView } from "../views/MainView";
 import { FormattedTextBox } from "../views/nodes/formattedText/FormattedTextBox";
 import { LabelBox } from "../views/nodes/LabelBox";
@@ -31,13 +33,10 @@ import { LinkManager } from "./LinkManager";
 import { Scripting } from "./Scripting";
 import { SearchUtil } from "./SearchUtil";
 import { SelectionManager } from "./SelectionManager";
-import { UndoManager } from "./UndoManager";
-import { SnappingManager } from "./SnappingManager";
-import { InkTool } from "../../fields/InkField";
-import { SharingManager } from "./SharingManager";
-import { computedFn } from "mobx-utils";
 import { ColorScheme } from "./SettingsManager";
-import { Colors } from "../views/global/globalEnums";
+import { SharingManager } from "./SharingManager";
+import { SnappingManager } from "./SnappingManager";
+import { UndoManager } from "./UndoManager";
 
 
 export let resolvedPorts: { server: number, socket: number };
@@ -915,6 +914,7 @@ export class CurrentUserUtils {
             let linkDocs = Docs.newAccount ? undefined : await DocServer.GetRefField(linkDatabaseId);
             if (!linkDocs) {
                 linkDocs = new Doc(linkDatabaseId, true);
+                (linkDocs as Doc).title = "LINK DATABASE: " + Doc.CurrentUserEmail;
                 (linkDocs as Doc).author = Doc.CurrentUserEmail;
                 (linkDocs as Doc).data = new List<Doc>([]);
                 (linkDocs as Doc)["acl-Public"] = SharingPermissions.Augment;
@@ -1029,7 +1029,7 @@ export class CurrentUserUtils {
         doc.fontFamily = StrCast(doc.fontFamily, "Arial");
         doc.fontColor = StrCast(doc.fontColor, "black");
         doc.fontHighlight = StrCast(doc.fontHighlight, "");
-        doc.defaultAclPrivate = BoolCast(doc.defaultAclPrivate, true);
+        doc.defaultAclPrivate = BoolCast(doc.defaultAclPrivate, false);
         doc.activeCollectionBackground = StrCast(doc.activeCollectionBackground, "white");
         doc.activeCollectionNestedBackground = Cast(doc.activeCollectionNestedBackground, "string", null);
         doc.noviceMode = BoolCast(doc.noviceMode, true);
diff --git a/src/client/util/LinkManager.ts b/src/client/util/LinkManager.ts
index 8abfd740c..933b98a8c 100644
--- a/src/client/util/LinkManager.ts
+++ b/src/client/util/LinkManager.ts
@@ -1,4 +1,4 @@
-import { observable, observe, action } from "mobx";
+import { observable, observe, action, reaction, computed } from "mobx";
 import { computedFn } from "mobx-utils";
 import { DirectLinksSym, Doc, DocListCast, Field, Opt } from "../../fields/Doc";
 import { List } from "../../fields/List";
@@ -26,36 +26,41 @@ type CreateViewFunc = (doc: Doc, followLinkLocation: string, finished?: () => vo
 export class LinkManager {
 
     @observable static _instance: LinkManager;
-    @observable static userDocs: Doc[] = [];
+    @observable static userLinkDBs: Doc[] = [];
     public static currentLink: Opt<Doc>;
     public static get Instance() { return LinkManager._instance; }
+    public static addLinkDB = (linkDb: any) => LinkManager.userLinkDBs.push(linkDb);
+    static links: Doc[] = [];
     constructor() {
         LinkManager._instance = this;
         setTimeout(() => {
-            LinkManager.userDocs = [Doc.LinkDBDoc().data as Doc, ...SharingManager.Instance.users.map(user => user.linkDatabase)];
-            const addLinkToDoc = action((link: Doc): any => {
+            LinkManager.userLinkDBs = [];
+            const addLinkToDoc = (link: Doc) => {
                 const a1 = link?.anchor1;
                 const a2 = link?.anchor2;
-                if (a1 instanceof Promise || a2 instanceof Promise) return PromiseValue(a1).then(a1 => PromiseValue(a2).then(a2 => addLinkToDoc(link)));
-                if (a1 instanceof Doc && a2 instanceof Doc && ((a1.author !== undefined && a2.author !== undefined) || link.author === Doc.CurrentUserEmail)) {
-                    Doc.GetProto(a1)[DirectLinksSym].add(link);
-                    Doc.GetProto(a2)[DirectLinksSym].add(link);
-                    Doc.GetProto(link)[DirectLinksSym].add(link);
-                }
-            });
-            const remLinkFromDoc = action((link: Doc): any => {
+                Promise.all([a1, a2]).then(action(() => {
+                    if (a1 instanceof Doc && a2 instanceof Doc && ((a1.author !== undefined && a2.author !== undefined) || link.author === Doc.CurrentUserEmail)) {
+                        Doc.GetProto(a1)[DirectLinksSym].add(link);
+                        Doc.GetProto(a2)[DirectLinksSym].add(link);
+                        Doc.GetProto(link)[DirectLinksSym].add(link);
+                    }
+                }));
+            }
+            const remLinkFromDoc = (link: Doc) => {
                 const a1 = link?.anchor1;
                 const a2 = link?.anchor2;
-                if (a1 instanceof Promise || a2 instanceof Promise) return PromiseValue(a1).then(a1 => PromiseValue(a2).then(a2 => remLinkFromDoc(link)));
-                if (a1 instanceof Doc && a2 instanceof Doc && ((a1.author !== undefined && a2.author !== undefined) || link.author === Doc.CurrentUserEmail)) {
-                    Doc.GetProto(a1)[DirectLinksSym].delete(link);
-                    Doc.GetProto(a2)[DirectLinksSym].delete(link);
-                    Doc.GetProto(link)[DirectLinksSym].delete(link);
-                }
-            });
-            const watchUserLinks = (userLinks: List<Doc>) => {
+                Promise.all([a1, a2]).then(action(() => {
+                    if (a1 instanceof Doc && a2 instanceof Doc && ((a1.author !== undefined && a2.author !== undefined) || link.author === Doc.CurrentUserEmail)) {
+                        Doc.GetProto(a1)[DirectLinksSym].delete(link);
+                        Doc.GetProto(a2)[DirectLinksSym].delete(link);
+                        Doc.GetProto(link)[DirectLinksSym].delete(link);
+                    }
+                }));
+            }
+            const watchUserLinkDB = (userLinkDBDoc: Doc) => {
+                LinkManager.links.push(...DocListCast(userLinkDBDoc.data));
                 const toRealField = (field: Field) => field instanceof ProxyField ? field.value() : field;  // see List.ts.  data structure is not a simple list of Docs, but a list of ProxyField/Fields
-                observe(userLinks, change => {
+                observe(userLinkDBDoc.data as Doc, change => {  // observe pushes/splices on a user link DB 'data' field (should only happen for local changes)
                     switch (change.type as any) {
                         case "splice":
                             (change as any).added.forEach((link: any) => addLinkToDoc(toRealField(link)));
@@ -64,13 +69,29 @@ export class LinkManager {
                         case "update": //let oldValue = change.oldValue;
                     }
                 }, true);
+                observe(userLinkDBDoc, "data",  // obsever when a new array of links is assigned as the link DB 'data' field (should happen whenever a remote user adds/removes a link)
+                    change => {
+                        switch (change.type as any) {
+                            case "update":
+                                Promise.all([...(change.oldValue as any as Doc[] || []), ...(change.newValue as any as Doc[] || [])]).then(doclist => {
+                                    const oldDocs = doclist.slice(0, (change.oldValue as any as Doc[] || []).length);
+                                    const newDocs = doclist.slice((change.oldValue as any as Doc[] || []).length, doclist.length);
+
+                                    const added = newDocs?.filter(link => !(oldDocs || []).includes(link));
+                                    const removed = oldDocs?.filter(link => !(newDocs || []).includes(link));
+                                    added?.forEach((link: any) => addLinkToDoc(toRealField(link)));
+                                    removed?.forEach((link: any) => remLinkFromDoc(toRealField(link)));
+                                });
+                        }
+                    }, true);
             };
-            observe(LinkManager.userDocs, change => {
+            observe(LinkManager.userLinkDBs, change => {
                 switch (change.type as any) {
-                    case "splice": (change as any).added.forEach(watchUserLinks); break;
+                    case "splice": (change as any).added.forEach(watchUserLinkDB); break;
                     case "update": //let oldValue = change.oldValue;
                 }
             }, true);
+            LinkManager.addLinkDB(Doc.LinkDBDoc());
         });
     }
 
diff --git a/src/client/util/SettingsManager.tsx b/src/client/util/SettingsManager.tsx
index 3987497b8..bd91db779 100644
--- a/src/client/util/SettingsManager.tsx
+++ b/src/client/util/SettingsManager.tsx
@@ -268,7 +268,8 @@ export class SettingsManager extends React.Component<{}> {
                 <div className="tab-column-content">
                     <button onClick={() => GroupManager.Instance?.open()}>Manage groups</button>
                     <div className="default-acl">
-                        <input className="acl-check" type="checkbox" checked={BoolCast(Doc.UserDoc()?.defaultAclPrivate)} onChange={action(() => Doc.UserDoc().defaultAclPrivate = !Doc.UserDoc().defaultAclPrivate)} />
+                        <input className="acl-check" type="checkbox" checked={BoolCast(Doc.UserDoc()?.defaultAclPrivate)}
+                            onChange={action(() => Doc.UserDoc().defaultAclPrivate = !Doc.UserDoc().defaultAclPrivate)} />
                         <div className="acl-text">Default access private</div>
                     </div>
                 </div>
diff --git a/src/client/util/SharingManager.tsx b/src/client/util/SharingManager.tsx
index a8972b988..6c4556250 100644
--- a/src/client/util/SharingManager.tsx
+++ b/src/client/util/SharingManager.tsx
@@ -23,6 +23,7 @@ import { GroupManager, UserOptions } from "./GroupManager";
 import { GroupMemberView } from "./GroupMemberView";
 import { SelectionManager } from "./SelectionManager";
 import "./SharingManager.scss";
+import { LinkManager } from "./LinkManager";
 
 export interface User {
     email: string;
@@ -154,10 +155,11 @@ export class SharingManager extends React.Component<{}> {
                 }
             });
             return Promise.all(evaluating).then(() => {
-                runInAction(() => {
+                runInAction(async () => {
                     for (const sharer of sharingDocs) {
                         if (!this.users.find(user => user.user.email === sharer.user.email)) {
                             this.users.push(sharer);
+                            LinkManager.addLinkDB(sharer.linkDatabase);
                         }
                     }
                 });
diff --git a/src/client/views/MainView.tsx b/src/client/views/MainView.tsx
index 2be3c3135..3d7446cbe 100644
--- a/src/client/views/MainView.tsx
+++ b/src/client/views/MainView.tsx
@@ -108,7 +108,7 @@ export class MainView extends React.Component {
         this._sidebarContent.proto = undefined;
         if (!MainView.Live) {
             DocServer.setPlaygroundFields(["dataTransition", "autoHeight", "showSidebar", "sidebarWidthPercent", "viewTransition",
-                "panX", "panY", "width", "height", "nativeWidth", "nativeHeight",
+                "panX", "panY", "width", "height", "nativeWidth", "nativeHeight", "text-scrollHeight", "text-height",
                 "viewScale", "scrollTop", "hidden", "curPage", "viewType", "chromeHidden", "nativeWidth"]); // can play with these fields on someone else's
         }
         DocServer.GetRefField("rtfProto").then(proto => (proto instanceof Doc) && reaction(() => StrCast(proto.BROADCAST_MESSAGE), msg => msg && alert(msg)));
diff --git a/src/client/views/nodes/formattedText/FormattedTextBox.tsx b/src/client/views/nodes/formattedText/FormattedTextBox.tsx
index f7bed2fa1..9bba15b28 100644
--- a/src/client/views/nodes/formattedText/FormattedTextBox.tsx
+++ b/src/client/views/nodes/formattedText/FormattedTextBox.tsx
@@ -431,6 +431,7 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
         this.ProseRef = ele;
         this._dropDisposer?.();
         ele && (this._dropDisposer = DragManager.MakeDropTarget(ele, this.drop.bind(this), this.layoutDoc));
+        // if (this.autoHeight) this.tryUpdateScrollHeight(); 
     }
 
     @undoBatch
@@ -1438,16 +1439,19 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
             }
         }
     }
-    tryUpdateScrollHeight() {
+    tryUpdateScrollHeight = () => {
         if (!LightboxView.LightboxDoc || LightboxView.IsLightboxDocView(this.props.docViewPath())) {
             const margins = 2 * NumCast(this.layoutDoc._yMargin, this.props.yPadding || 0);
-            const proseHeight = !this.ProseRef ? 0 : Array.from(this.ProseRef.children[0].children).reduce((p, child) => p + Number(getComputedStyle(child).height.replace("px", "")), margins);
-            const scrollHeight = this.ProseRef && Math.min(NumCast(this.layoutDoc.docMaxAutoHeight, proseHeight), proseHeight);
-            if (scrollHeight && this.props.renderDepth && !this.props.dontRegisterView) {  // if top === 0, then the text box is growing upward (as the overlay caption) which doesn't contribute to the height computation
-                const setScrollHeight = () => this.rootDoc[this.fieldKey + "-scrollHeight"] = scrollHeight;
-                if (this.rootDoc === this.layoutDoc.doc || this.layoutDoc.resolvedDataDoc) {
-                    setScrollHeight();
-                } else setTimeout(setScrollHeight, 10); // if we have a template that hasn't been resolved yet, we can't set the height or we'd be setting it on the unresolved template.  So set a timeout and hope its arrived...
+            const children = this.ProseRef?.children.length ? Array.from(this.ProseRef.children[0].children) : undefined;
+            if (children) {
+                const proseHeight = !this.ProseRef ? 0 : children.reduce((p, child) => p + Number(getComputedStyle(child).height.replace("px", "")), margins);
+                const scrollHeight = this.ProseRef && Math.min(NumCast(this.layoutDoc.docMaxAutoHeight, proseHeight), proseHeight);
+                if (scrollHeight && this.props.renderDepth && !this.props.dontRegisterView) {  // if top === 0, then the text box is growing upward (as the overlay caption) which doesn't contribute to the height computation
+                    const setScrollHeight = () => this.rootDoc[this.fieldKey + "-scrollHeight"] = scrollHeight;
+                    if (this.rootDoc === this.layoutDoc.doc || this.layoutDoc.resolvedDataDoc) {
+                        setScrollHeight();
+                    } else setTimeout(setScrollHeight, 10); // if we have a template that hasn't been resolved yet, we can't set the height or we'd be setting it on the unresolved template.  So set a timeout and hope its arrived...
+                }
             }
         }
     }
diff --git a/src/fields/util.ts b/src/fields/util.ts
index 2bb6b45c2..439c4d333 100644
--- a/src/fields/util.ts
+++ b/src/fields/util.ts
@@ -141,7 +141,9 @@ export function denormalizeEmail(email: string) {
 export function inheritParentAcls(parent: Doc, child: Doc) {
     const dataDoc = parent[DataSym];
     for (const key of Object.keys(dataDoc)) {
-        key.startsWith("acl") && distributeAcls(key, dataDoc[key], child);
+        // if the default acl mode is private, then don't inherit the acl-Public permission, but set it to private.
+        const permission = (key === "acl-Public" && Doc.UserDoc().defaultAclPrivate) ? AclPrivate : dataDoc[key];
+        key.startsWith("acl") && distributeAcls(key, permission, child);
     }
 }
 
-- 
cgit v1.2.3-70-g09d2


From 4d21696c1b49c2c383adcd01974c18461123b83c Mon Sep 17 00:00:00 2001
From: bobzel <zzzman@gmail.com>
Date: Tue, 17 Aug 2021 16:55:15 -0400
Subject: made dashboard context menu items context sensitive to whether
 they're called from MyDashboards, MySharedDocs or elsewhere.  Made
 treeViewOpen a playground field so that users don't interfere with each
 other.   Made Docking views not generate alias of their tabs when shared.

---
 src/client/util/CurrentUserUtils.ts                | 35 +++++++++++-----------
 src/client/views/MainView.tsx                      |  2 +-
 .../views/collections/CollectionDockingView.tsx    |  2 +-
 .../views/collections/CollectionTreeView.tsx       | 13 ++++++--
 src/client/views/collections/CollectionView.tsx    | 24 +++++++++------
 src/client/views/collections/TreeView.tsx          | 25 +++++++++++-----
 src/client/views/nodes/DocumentView.tsx            |  2 +-
 7 files changed, 63 insertions(+), 40 deletions(-)

(limited to 'src/client/util/CurrentUserUtils.ts')

diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts
index 34990e121..85762a73f 100644
--- a/src/client/util/CurrentUserUtils.ts
+++ b/src/client/util/CurrentUserUtils.ts
@@ -765,8 +765,13 @@ export class CurrentUserUtils {
                 _lockedPosition: true, boxShadow: "0 0", childDontRegisterViews: true, targetDropAction: "same", treeViewType: "fileSystem", isFolder: true, system: true
             }));
             const newDashboard = ScriptField.MakeScript(`createNewDashboard(Doc.UserDoc())`);
-            (doc.myDashboards as any as Doc).contextMenuScripts = new List<ScriptField>([newDashboard!]);
-            (doc.myDashboards as any as Doc).contextMenuLabels = new List<string>(["Create New Dashboard"]);
+            const toggleTheme = ScriptField.MakeScript(`Doc.UserDoc().darkScheme = !Doc.UserDoc().darkScheme`);
+            const toggleComic = ScriptField.MakeScript(`toggleComicMode()`);
+            const snapshotDashboard = ScriptField.MakeScript(`snapshotDashboard()`);
+            const shareDashboard = ScriptField.MakeScript(`shareDashboard(self)`);
+            const removeDashboard = ScriptField.MakeScript('removeDashboard(self)');
+            (doc.myDashboards as any as Doc).childContextMenuScripts = new List<ScriptField>([newDashboard!, toggleTheme!, toggleComic!, snapshotDashboard!, shareDashboard!, removeDashboard!]);
+            (doc.myDashboards as any as Doc).childContextMenuLabels = new List<string>(["Create New Dashboard", "Toggle Theme Colors", "Toggle Comic Mode", "Snapshot Dashboard", "Share Dashboard", "Remove Dashboard"]);
         }
         return doc.myDashboards as any as Doc;
     }
@@ -933,6 +938,11 @@ export class CurrentUserUtils {
             }
             if (sharedDocs instanceof Doc) {
                 Doc.GetProto(sharedDocs).userColor = sharedDocs.userColor || "rgb(202, 202, 202)";
+                const addToDashboards = ScriptField.MakeScript(`addToDashboards(self)`);
+                const dashboardFilter = ScriptField.MakeFunction(`doc._viewType === '${CollectionViewType.Docking}'`, { doc: Doc.name });
+                sharedDocs.childContextMenuFilters = new List<ScriptField>([dashboardFilter!,]);
+                sharedDocs.childContextMenuScripts = new List<ScriptField>([addToDashboards!,]);
+                sharedDocs.childContextMenuLabels = new List<string>(["Add to Dashboards",]);
             }
             doc.mySharedDocs = new PrefetchProxy(sharedDocs);
         }
@@ -1228,15 +1238,6 @@ export class CurrentUserUtils {
 
         Doc.AddDocToList(myPresentations, "data", presentation);
         userDoc.activePresentation = presentation;
-        const toggleTheme = ScriptField.MakeScript(`Doc.UserDoc().darkScheme = !Doc.UserDoc().darkScheme`);
-        const toggleComic = ScriptField.MakeScript(`toggleComicMode()`);
-        const snapshotDashboard = ScriptField.MakeScript(`snapshotDashboard()`);
-        const createDashboard = ScriptField.MakeScript(`createNewDashboard()`);
-        const shareDashboard = ScriptField.MakeScript(`shareDashboard(self)`);
-        const addToDashboards = ScriptField.MakeScript(`addToDashboards(self)`);
-        const removeDashboard = ScriptField.MakeScript('removeDashboard(self)');
-        dashboardDoc.contextMenuScripts = new List<ScriptField>([toggleTheme!, toggleComic!, snapshotDashboard!, createDashboard!, shareDashboard!, addToDashboards!, removeDashboard!]);
-        dashboardDoc.contextMenuLabels = new List<string>(["Toggle Theme Colors", "Toggle Comic Mode", "Snapshot Dashboard", "Create Dashboard", "Share Dashboard", "Add to Dashboards", "Remove Dashboard"]);
 
         Doc.AddDocToList(dashboards, "data", dashboardDoc);
         CurrentUserUtils.openDashboard(userDoc, dashboardDoc);
@@ -1306,17 +1307,15 @@ Scripting.addGlobal(async function addToDashboards(dashboard: Doc) {
     const allDocs = await DocListCastAsync(dashboard[DataSym]["data-all"]);
 
     // moves the data-all field from the datadoc to the layoutdoc, necessary for off screen docs tab to function properly
-    dashboard["data-all"] = new List<Doc>(allDocs);
-    dashboardAlias["data-all"] = new List<Doc>((allDocs || []).map(doc => Doc.MakeAlias(doc)));
-
-    const dockingConfig = JSON.parse(StrCast(dashboardAlias.dockingConfig));
-    dockingConfig.content = [];
-    dashboardAlias.dockingConfig = JSON.stringify(dockingConfig);
+    // dashboard["data-all"] = new List<Doc>(allDocs);
+    // dashboardAlias["data-all"] = new List<Doc>((allDocs || []).map(doc => Doc.MakeAlias(doc)));
 
+    // const dockingConfig = JSON.parse(StrCast(dashboardAlias.dockingConfig));
+    // dashboardAlias.dockingConfig = JSON.stringify(dockingConfig);
 
     dashboardAlias.data = new List<Doc>(DocListCast(dashboard.data).map(tabFolder => Doc.MakeAlias(tabFolder)));
     DocListCast(dashboardAlias.data).forEach(doc => doc.dashboard = dashboardAlias);
-    DocListCast(dashboardAlias.data)[0].data = new List<Doc>();
+    //new List<Doc>();
     DocListCast(dashboardAlias.data)[1].data = ComputedField.MakeFunction(`dynamicOffScreenDocs(self.dashboard)`) as any;
     Doc.AddDocToList(CurrentUserUtils.MyDashboards, "data", dashboardAlias);
     CurrentUserUtils.openDashboard(Doc.UserDoc(), dashboardAlias);
diff --git a/src/client/views/MainView.tsx b/src/client/views/MainView.tsx
index b0b8d7f41..4d2a0a4c4 100644
--- a/src/client/views/MainView.tsx
+++ b/src/client/views/MainView.tsx
@@ -107,7 +107,7 @@ export class MainView extends React.Component {
         new InkStrokeProperties();
         this._sidebarContent.proto = undefined;
         if (!MainView.Live) {
-            DocServer.setPlaygroundFields(["dataTransition", "autoHeight", "showSidebar", "sidebarWidthPercent", "viewTransition",
+            DocServer.setPlaygroundFields(["dataTransition", "treeViewOpen", "autoHeight", "showSidebar", "sidebarWidthPercent", "viewTransition",
                 "panX", "panY", "width", "height", "nativeWidth", "nativeHeight", "text-scrollHeight", "text-height", "hideMinimap",
                 "viewScale", "scrollTop", "hidden", "curPage", "viewType", "chromeHidden", "nativeWidth"]); // can play with these fields on someone else's
         }
diff --git a/src/client/views/collections/CollectionDockingView.tsx b/src/client/views/collections/CollectionDockingView.tsx
index c0d39b2a2..cae08e1f4 100644
--- a/src/client/views/collections/CollectionDockingView.tsx
+++ b/src/client/views/collections/CollectionDockingView.tsx
@@ -170,7 +170,7 @@ export class CollectionDockingView extends CollectionSubView(doc => doc) {
                 const aliasDocList = DocListCast(alias["data-all"]);
                 // if aliasDocList contains the alias, don't do anything
                 // otherwise add the original or an alias depending on whether the doc you're looking at is the current doc or a different alias
-                !DocListCast(document.aliases).some(a => aliasDocList.includes(a)) && Doc.AddDocToList(alias, "data-all", alias !== instance.props.Document ? Doc.MakeAlias(document) : document);
+                !DocListCast(document.aliases).some(a => aliasDocList.includes(a)) && Doc.AddDocToList(alias, "data-all", document);//alias !== instance.props.Document ? Doc.MakeAlias(document) : document);
             });
         }
         const docContentConfig = CollectionDockingView.makeDocumentConfig(document, panelName);
diff --git a/src/client/views/collections/CollectionTreeView.tsx b/src/client/views/collections/CollectionTreeView.tsx
index 3eece0086..c0553ca60 100644
--- a/src/client/views/collections/CollectionTreeView.tsx
+++ b/src/client/views/collections/CollectionTreeView.tsx
@@ -1,10 +1,10 @@
 import { FontAwesomeIcon } from '@fortawesome/react-fontawesome';
 import { action, computed, reaction, IReactionDisposer, observable } from "mobx";
 import { observer } from "mobx-react";
-import { DataSym, Doc, DocListCast, HeightSym, Opt, WidthSym } from '../../../fields/Doc';
+import { DataSym, Doc, DocListCast, HeightSym, Opt, WidthSym, StrListCast } from '../../../fields/Doc';
 import { Id } from '../../../fields/FieldSymbols';
 import { List } from '../../../fields/List';
-import { Document } from '../../../fields/Schema';
+import { Document, listSpec } from '../../../fields/Schema';
 import { ScriptField } from '../../../fields/ScriptField';
 import { BoolCast, Cast, NumCast, ScriptCast, StrCast } from '../../../fields/Types';
 import { TraceMobx } from '../../../fields/util';
@@ -215,6 +215,11 @@ export class CollectionTreeView extends CollectionSubView<Document, Partial<coll
             />
         </div>;
     }
+    childContextMenuItems = () => {
+        const customScripts = Cast(this.doc.childContextMenuScripts, listSpec(ScriptField), []);
+        const filterScripts = Cast(this.doc.childContextMenuFilters, listSpec(ScriptField), []);
+        return StrListCast(this.doc.childContextMenuLabels).map((label, i) => ({ script: customScripts[i], filter: filterScripts[i], label }));
+    }
     @computed get treeViewElements() {
         TraceMobx();
         const dropAction = StrCast(this.doc.childDropAction) as dropActionType;
@@ -247,7 +252,9 @@ export class CollectionTreeView extends CollectionSubView<Document, Partial<coll
             this.whenChildContentsActiveChanged,
             this.props.dontRegisterView || Cast(this.props.Document.childDontRegisterViews, "boolean", null),
             this.observerHeight,
-            this.unobserveHeight);
+            this.unobserveHeight,
+            this.childContextMenuItems()
+        );
     }
     @computed get titleBar() {
         const hideTitle = this.props.treeViewHideTitle || this.doc.treeViewHideTitle;
diff --git a/src/client/views/collections/CollectionView.tsx b/src/client/views/collections/CollectionView.tsx
index e65ebf075..a82128e47 100644
--- a/src/client/views/collections/CollectionView.tsx
+++ b/src/client/views/collections/CollectionView.tsx
@@ -70,6 +70,7 @@ export interface CollectionViewProps extends FieldViewProps {
     childDocumentsActive?: () => boolean;// whether child documents can be dragged if collection can be dragged (eg., in a when a Pile document is in startburst mode)
     childFitWidth?: () => boolean;
     childOpacity?: () => number;
+    childContextMenuItems?: () => { script: ScriptField, label: string }[];
     childHideTitle?: () => boolean; // whether to hide the documentdecorations title for children
     childHideDecorationTitle?: () => boolean;
     childLayoutTemplate?: () => (Doc | undefined);// specify a layout Doc template to use for children of the collection
@@ -186,15 +187,20 @@ export class CollectionView extends ViewBoxAnnotatableComponent<ViewBoxAnnotatab
             }
             !Doc.UserDoc().noviceMode && optionItems.push({ description: `${this.rootDoc.isInPlaceContainer ? "Unset" : "Set"} inPlace Container`, event: () => this.rootDoc.isInPlaceContainer = !this.rootDoc.isInPlaceContainer, icon: "project-diagram" });
 
-            optionItems.push({
-                description: "Create Branch", event: async () => this.props.addDocTab(await BranchCreate(this.rootDoc), "add:right"), icon: "project-diagram"
-            });
-            optionItems.push({
-                description: "Pull Master", event: () => BranchTask(this.rootDoc, "pull"), icon: "project-diagram"
-            });
-            optionItems.push({
-                description: "Merge Branches", event: () => BranchTask(this.rootDoc, "merge"), icon: "project-diagram"
-            });
+            if (!Doc.UserDoc().noviceMode) {
+                optionItems.push({
+                    description: "Create Branch", event: async () => this.props.addDocTab(await BranchCreate(this.rootDoc), "add:right"), icon: "project-diagram"
+                });
+                optionItems.push({
+                    description: "Pull Master", event: () => BranchTask(this.rootDoc, "pull"), icon: "project-diagram"
+                });
+                optionItems.push({
+                    description: "Merge Branches", event: () => BranchTask(this.rootDoc, "merge"), icon: "project-diagram"
+                });
+            }
+            if (this.Document._viewType === CollectionViewType.Docking) {
+                optionItems.push({ description: "Create Dashboard", event: () => CurrentUserUtils.createNewDashboard(Doc.UserDoc()), icon: "project-diagram" });
+            }
 
             !options && cm.addItem({ description: "Options...", subitems: optionItems, icon: "hand-point-right" });
 
diff --git a/src/client/views/collections/TreeView.tsx b/src/client/views/collections/TreeView.tsx
index 206e48aac..0598be49b 100644
--- a/src/client/views/collections/TreeView.tsx
+++ b/src/client/views/collections/TreeView.tsx
@@ -1,7 +1,7 @@
 import { FontAwesomeIcon } from '@fortawesome/react-fontawesome';
 import { action, computed, IReactionDisposer, observable, reaction } from "mobx";
 import { observer } from "mobx-react";
-import { DataSym, Doc, DocListCast, DocListCastOrNull, Field, HeightSym, Opt, WidthSym } from '../../../fields/Doc';
+import { DataSym, Doc, DocListCast, DocListCastOrNull, Field, HeightSym, Opt, WidthSym, StrListCast } from '../../../fields/Doc';
 import { Id } from '../../../fields/FieldSymbols';
 import { List } from '../../../fields/List';
 import { RichTextField } from '../../../fields/RichTextField';
@@ -54,6 +54,7 @@ export interface TreeViewProps {
     indentDocument?: (editTitle: boolean) => void;
     outdentDocument?: (editTitle: boolean) => void;
     ScreenToLocalTransform: () => Transform;
+    contextMenuItems: { script: ScriptField, filter: ScriptField, label: string }[];
     dontRegisterView?: boolean;
     styleProvider?: StyleProviderFunc | undefined;
     treeViewHideHeaderFields: () => boolean;
@@ -336,7 +337,7 @@ export class TreeView extends React.Component<TreeViewProps> {
                     this.props.dropAction, this.props.addDocTab, this.titleStyleProvider, this.props.ScreenToLocalTransform, this.props.isContentActive,
                     this.props.panelWidth, this.props.renderDepth, this.props.treeViewHideHeaderFields,
                     [...this.props.renderedIds, doc[Id]], this.props.onCheckedClick, this.props.onChildClick, this.props.skipFields, false, this.props.whenChildContentsActiveChanged,
-                    this.props.dontRegisterView, emptyFunction, emptyFunction);
+                    this.props.dontRegisterView, emptyFunction, emptyFunction, this.childContextMenuItems());
             } else {
                 contentElement = <EditableView key="editableView"
                     contents={contents !== undefined ? Field.toString(contents as Field) : "null"}
@@ -418,7 +419,7 @@ export class TreeView extends React.Component<TreeViewProps> {
                         StrCast(this.doc.childDropAction, this.props.dropAction) as dropActionType, this.props.addDocTab, this.titleStyleProvider, this.props.ScreenToLocalTransform,
                         this.props.isContentActive, this.props.panelWidth, this.props.renderDepth, this.props.treeViewHideHeaderFields,
                         [...this.props.renderedIds, this.doc[Id]], this.props.onCheckedClick, this.props.onChildClick, this.props.skipFields, false, this.props.whenChildContentsActiveChanged,
-                        this.props.dontRegisterView, emptyFunction, emptyFunction)}
+                        this.props.dontRegisterView, emptyFunction, emptyFunction, this.childContextMenuItems())}
             </ul >;
         } else if (this.treeViewExpandedView === "fields") {
             return <ul key={this.doc[Id] + this.doc.title}>
@@ -507,11 +508,19 @@ export class TreeView extends React.Component<TreeViewProps> {
     }
     contextMenuItems = () => {
         const makeFolder = { script: ScriptField.MakeFunction(`scriptContext.makeFolder()`, { scriptContext: "any" })!, label: "New Folder" };
-        return this.doc.isFolder ? [makeFolder] :
+        const openAlias = { script: ScriptField.MakeFunction(`openOnRight(getAlias(self))`)!, label: "Open Alias" };
+        const focusDoc = { script: ScriptField.MakeFunction(`DocFocusOrOpen(self)`)!, label: "Focus or Open" };
+        return [...this.props.contextMenuItems.filter(mi => !mi.filter ? true : mi.filter.script.run({ doc: this.doc })?.result), ... (this.doc.isFolder ? [makeFolder] :
             Doc.IsSystem(this.doc) ? [] :
                 this.props.treeView.fileSysMode && this.doc === Doc.GetProto(this.doc) ?
-                    [{ script: ScriptField.MakeFunction(`openOnRight(getAlias(self))`)!, label: "Open Alias" }, makeFolder] :
-                    [{ script: ScriptField.MakeFunction(`openOnRight(getAlias(self))`)!, label: "Open Alias" }, { script: ScriptField.MakeFunction(`DocFocusOrOpen(self)`)!, label: "Focus or Open" }];
+                    [openAlias, makeFolder] :
+                    this.doc.viewType === CollectionViewType.Docking ? [] :
+                        [openAlias, focusDoc])];
+    }
+    childContextMenuItems = () => {
+        const customScripts = Cast(this.doc.childContextMenuScripts, listSpec(ScriptField), []);
+        const customFilters = Cast(this.doc.childContextMenuFilters, listSpec(ScriptField), []);
+        return StrListCast(this.doc.childContextMenuLabels).map((label, i) => ({ script: customScripts[i], filter: customFilters[i], label }));
     }
     onChildClick = () => this.props.onChildClick?.() ?? (this._editTitleScript?.() || ScriptCast(this.doc.treeChildClick));
 
@@ -817,7 +826,8 @@ export class TreeView extends React.Component<TreeViewProps> {
         whenChildContentsActiveChanged: (isActive: boolean) => void,
         dontRegisterView: boolean | undefined,
         observerHeight: (ref: any) => void,
-        unobserveHeight: (ref: any) => void
+        unobserveHeight: (ref: any) => void,
+        contextMenuItems: ({ script: ScriptField, filter: ScriptField, label: string }[])
     ) {
         const viewSpecScript = Cast(conainerCollection.viewSpecScript, ScriptField);
         if (viewSpecScript) {
@@ -882,6 +892,7 @@ export class TreeView extends React.Component<TreeViewProps> {
                 parentTreeView={parentTreeView}
                 observeHeight={observerHeight}
                 unobserveHeight={unobserveHeight}
+                contextMenuItems={contextMenuItems}
             />;
         });
     }
diff --git a/src/client/views/nodes/DocumentView.tsx b/src/client/views/nodes/DocumentView.tsx
index 745d58656..a29f2f662 100644
--- a/src/client/views/nodes/DocumentView.tsx
+++ b/src/client/views/nodes/DocumentView.tsx
@@ -664,7 +664,7 @@ export class DocumentViewInternal extends DocComponent<DocumentViewInternalProps
         if (!cm || (e as any)?.nativeEvent?.SchemaHandled) return;
 
         const customScripts = Cast(this.props.Document.contextMenuScripts, listSpec(ScriptField), []);
-        Cast(this.props.Document.contextMenuLabels, listSpec("string"), []).forEach((label, i) =>
+        StrListCast(this.Document.contextMenuLabels).forEach((label, i) =>
             cm.addItem({ description: label, event: () => customScripts[i]?.script.run({ documentView: this, this: this.layoutDoc, scriptContext: this.props.scriptContext, self: this.rootDoc }), icon: "sticky-note" }));
         this.props.contextMenuItems?.().forEach(item =>
             item.label && cm.addItem({ description: item.label, event: () => item.script.script.run({ this: this.layoutDoc, scriptContext: this.props.scriptContext, self: this.rootDoc }), icon: "sticky-note" }));
-- 
cgit v1.2.3-70-g09d2


From 3051d9a16dff8efbf4d32465812093cae7508c74 Mon Sep 17 00:00:00 2001
From: bobzel <zzzman@gmail.com>
Date: Thu, 19 Aug 2021 18:42:46 -0400
Subject: fixed errors and warnings

---
 src/client/util/CurrentUserUtils.ts                               | 8 ++++----
 src/client/util/LinkManager.ts                                    | 4 ++--
 src/client/util/SharingManager.tsx                                | 2 +-
 src/client/views/nodes/FilterBox.tsx                              | 4 ++--
 src/client/views/nodes/ScreenshotBox.tsx                          | 2 +-
 .../views/nodes/formattedText/ProsemirrorExampleTransfer.ts       | 2 +-
 src/fields/Doc.ts                                                 | 2 +-
 7 files changed, 12 insertions(+), 12 deletions(-)

(limited to 'src/client/util/CurrentUserUtils.ts')

diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts
index e446e3752..1f37163d7 100644
--- a/src/client/util/CurrentUserUtils.ts
+++ b/src/client/util/CurrentUserUtils.ts
@@ -567,7 +567,7 @@ export class CurrentUserUtils {
             );
 
             menuBtns.forEach(menuBtn => {
-                if (menuBtn.title == "Search") {
+                if (menuBtn.title === "Search") {
                     this.searchBtn = menuBtn;
                 }
             });
@@ -575,10 +575,10 @@ export class CurrentUserUtils {
             menuBtns[menuBtns.length - 1].hidden = ComputedField.MakeFunction("IsNoviceMode()");
 
             menuBtns.forEach(menuBtn => {
-                if (menuBtn.title == "Search") {
-                    doc.searchBtn = menuBtn
+                if (menuBtn.title === "Search") {
+                    doc.searchBtn = menuBtn;
                 }
-            })
+            });
 
             doc.menuStack = new PrefetchProxy(Docs.Create.StackingDocument(menuBtns, {
                 title: "menuItemPanel",
diff --git a/src/client/util/LinkManager.ts b/src/client/util/LinkManager.ts
index c33dff8d1..3579083e4 100644
--- a/src/client/util/LinkManager.ts
+++ b/src/client/util/LinkManager.ts
@@ -47,7 +47,7 @@ export class LinkManager {
                         Doc.GetProto(link)[DirectLinksSym].add(link);
                     }
                 }));
-            }
+            };
             const remLinkFromDoc = (link: Doc) => {
                 const a1 = link?.anchor1;
                 const a2 = link?.anchor2;
@@ -58,7 +58,7 @@ export class LinkManager {
                         Doc.GetProto(link)[DirectLinksSym].delete(link);
                     }
                 }));
-            }
+            };
             const watchUserLinkDB = (userLinkDBDoc: Doc) => {
                 LinkManager.links.push(...DocListCast(userLinkDBDoc.data));
                 const toRealField = (field: Field) => field instanceof ProxyField ? field.value() : field;  // see List.ts.  data structure is not a simple list of Docs, but a list of ProxyField/Fields
diff --git a/src/client/util/SharingManager.tsx b/src/client/util/SharingManager.tsx
index 6c4556250..6d7f7e8df 100644
--- a/src/client/util/SharingManager.tsx
+++ b/src/client/util/SharingManager.tsx
@@ -513,7 +513,7 @@ export class SharingManager extends React.Component<{}> {
 
         if (this.myDocAcls) {
             const newDocs: Doc[] = [];
-            SearchBox.foreachRecursiveDoc(docs, doc => newDocs.push(doc));
+            SearchBox.foreachRecursiveDoc(docs, (depth, doc) => newDocs.push(doc));
             docs = newDocs.filter(doc => GetEffectiveAcl(doc) === AclAdmin);
         }
 
diff --git a/src/client/views/nodes/FilterBox.tsx b/src/client/views/nodes/FilterBox.tsx
index c892a9f6c..beefc4a82 100644
--- a/src/client/views/nodes/FilterBox.tsx
+++ b/src/client/views/nodes/FilterBox.tsx
@@ -101,7 +101,7 @@ export class FilterBox extends ViewBoxBaseComponent<FieldViewProps, FilterBoxDoc
         if (this._loaded && targetDoc) {
             const allDocs = new Set<Doc>();
             const activeTabs = DocListCast(targetDoc.data);
-            SearchBox.foreachRecursiveDoc(activeTabs, (doc: Doc) => allDocs.add(doc));
+            SearchBox.foreachRecursiveDoc(activeTabs, (depth, doc) => allDocs.add(doc));
             setTimeout(action(() => this._allDocs = Array.from(allDocs)));
         }
         return this._allDocs;
@@ -482,7 +482,7 @@ Scripting.addGlobal(function determineCheckedState(layoutDoc: Doc, facetHeader:
 Scripting.addGlobal(function readFacetData(layoutDoc: Doc, facetHeader: string) {
     const allCollectionDocs = new Set<Doc>();
     const activeTabs = DocListCast(layoutDoc.data);
-    SearchBox.foreachRecursiveDoc(activeTabs, (doc: Doc) => allCollectionDocs.add(doc));
+    SearchBox.foreachRecursiveDoc(activeTabs, (depth: number, doc: Doc) => allCollectionDocs.add(doc));
     const set = new Set<string>();
     if (facetHeader === "tags") allCollectionDocs.forEach(child => Field.toString(child[facetHeader] as Field).split(":").forEach(key => set.add(key)));
     else allCollectionDocs.forEach(child => set.add(Field.toString(child[facetHeader] as Field)));
diff --git a/src/client/views/nodes/ScreenshotBox.tsx b/src/client/views/nodes/ScreenshotBox.tsx
index 68ab3193b..f0db0b594 100644
--- a/src/client/views/nodes/ScreenshotBox.tsx
+++ b/src/client/views/nodes/ScreenshotBox.tsx
@@ -265,7 +265,7 @@ export class ScreenshotBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatabl
 
             CaptureManager.Instance.open(this.rootDoc);
         }
-    };
+    }
 
     setupDictation = () => {
         if (this.dataDoc[this.fieldKey + "-dictation"]) return;
diff --git a/src/client/views/nodes/formattedText/ProsemirrorExampleTransfer.ts b/src/client/views/nodes/formattedText/ProsemirrorExampleTransfer.ts
index eff400a98..76a5675de 100644
--- a/src/client/views/nodes/formattedText/ProsemirrorExampleTransfer.ts
+++ b/src/client/views/nodes/formattedText/ProsemirrorExampleTransfer.ts
@@ -84,7 +84,7 @@ export function buildKeymap<S extends Schema<any>>(schema: S, props: any, mapKey
                 break;
         }
         return true;
-    }
+    };
 
     const toggleEditableMark = (mark: any) => (state: EditorState<S>, dispatch: (tx: Transaction<S>) => void) => canEdit(state) && toggleMark(mark)(state, dispatch);
 
diff --git a/src/fields/Doc.ts b/src/fields/Doc.ts
index 1eeadeedc..e4087cf43 100644
--- a/src/fields/Doc.ts
+++ b/src/fields/Doc.ts
@@ -257,7 +257,7 @@ export class Doc extends RefField {
                         DocServer.GetRefField(this[Id], true);
                     }
                 };
-                const writeMode = DocServer.getFieldWriteMode(fKey as string);
+                const writeMode = DocServer.getFieldWriteMode(fKey);
                 if (fKey.startsWith("acl") || writeMode !== DocServer.WriteMode.Playground) {
                     delete this[CachedUpdates][fKey];
                     await fn();
-- 
cgit v1.2.3-70-g09d2


From b7cc1b5df65cc6d0777069602678afebef7f17b0 Mon Sep 17 00:00:00 2001
From: bobzel <zzzman@gmail.com>
Date: Thu, 26 Aug 2021 10:05:19 -0400
Subject: fixed slide doc to allow for dynamic title height

---
 src/client/util/CurrentUserUtils.ts                |  2 +-
 .../views/collections/CollectionTreeView.tsx       | 27 +++++++++++-----------
 2 files changed, 14 insertions(+), 15 deletions(-)

(limited to 'src/client/util/CurrentUserUtils.ts')

diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts
index 1f37163d7..185b8ac51 100644
--- a/src/client/util/CurrentUserUtils.ts
+++ b/src/client/util/CurrentUserUtils.ts
@@ -384,7 +384,7 @@ export class CurrentUserUtils {
             ((doc.emptyPane as Doc).proto as Doc)["dragFactory-count"] = 0;
         }
         if (doc.emptySlide === undefined) {
-            const textDoc = Docs.Create.TreeDocument([], { title: "Slide", _viewType: CollectionViewType.Tree, _fontSize: "20px", treeViewType: "outline", _xMargin: 0, _yMargin: 0, _width: 300, _height: 200, _singleLine: true, backgroundColor: "transparent", system: true, cloneFieldFilter: new List<string>(["system"]) });
+            const textDoc = Docs.Create.TreeDocument([], { title: "Slide", _viewType: CollectionViewType.Tree, _fontSize: "20px", _autoHeight: true, treeViewType: "outline", _xMargin: 0, _yMargin: 0, _width: 300, _height: 200, _singleLine: true, backgroundColor: "transparent", system: true, cloneFieldFilter: new List<string>(["system"]) });
             Doc.GetProto(textDoc).title = ComputedField.MakeFunction('self.text?.Text');
             FormattedTextBox.SelectOnLoad = textDoc[Id];
             doc.emptySlide = textDoc;
diff --git a/src/client/views/collections/CollectionTreeView.tsx b/src/client/views/collections/CollectionTreeView.tsx
index 640412343..e36835893 100644
--- a/src/client/views/collections/CollectionTreeView.tsx
+++ b/src/client/views/collections/CollectionTreeView.tsx
@@ -1,15 +1,16 @@
 import { FontAwesomeIcon } from '@fortawesome/react-fontawesome';
-import { action, computed, reaction, IReactionDisposer, observable } from "mobx";
+import { action, computed, IReactionDisposer, observable, reaction } from "mobx";
 import { observer } from "mobx-react";
-import { DataSym, Doc, DocListCast, HeightSym, Opt, WidthSym, StrListCast } from '../../../fields/Doc';
+import { DataSym, Doc, DocListCast, HeightSym, Opt, StrListCast, WidthSym } from '../../../fields/Doc';
 import { Id } from '../../../fields/FieldSymbols';
-import { List } from '../../../fields/List';
+import { InkTool } from '../../../fields/InkField';
 import { Document, listSpec } from '../../../fields/Schema';
 import { ScriptField } from '../../../fields/ScriptField';
 import { BoolCast, Cast, NumCast, ScriptCast, StrCast } from '../../../fields/Types';
 import { TraceMobx } from '../../../fields/util';
 import { returnEmptyDoclist, returnEmptyFilter, returnFalse, returnTrue } from '../../../Utils';
 import { DocUtils } from '../../documents/Documents';
+import { CurrentUserUtils } from '../../util/CurrentUserUtils';
 import { DocumentManager } from '../../util/DocumentManager';
 import { DragManager, dropActionType } from "../../util/DragManager";
 import { SelectionManager } from '../../util/SelectionManager';
@@ -25,9 +26,6 @@ import { CollectionSubView } from "./CollectionSubView";
 import "./CollectionTreeView.scss";
 import { TreeView } from "./TreeView";
 import React = require("react");
-import { InkTool } from '../../../fields/InkField';
-import { CurrentUserUtils } from '../../util/CurrentUserUtils';
-import { CollectionView, CollectionViewType } from './CollectionView';
 const _global = (window /* browser */ || global /* node */) as any;
 
 export type collectionTreeViewProps = {
@@ -78,15 +76,15 @@ export class CollectionTreeView extends CollectionSubView<Document, Partial<coll
     refList: Set<any> = new Set();
     observer: any;
     computeHeight = () => {
-        const hgt = this.paddingTop() + 26/* bcz: ugh: title bar height hack ... get ref and compute instead */ +
-            Array.from(this.refList).reduce((p, r) => p + Number(getComputedStyle(r).height.replace("px", "")), 0);
-        this.props.setHeight(hgt);
+        const bodyHeight = Array.from(this.refList).reduce((p, r) => p + Number(getComputedStyle(r).height.replace("px", "")), this.paddingTop() + this.paddingBot());
+        this.layoutDoc._autoHeightMargins = bodyHeight;
+        this.props.setHeight(this.documentTitleHeight() + bodyHeight);
     }
     unobserveHeight = (ref: any) => {
         this.refList.delete(ref);
         this.rootDoc.autoHeight && this.computeHeight();
     }
-    observerHeight = (ref: any) => {
+    observeHeight = (ref: any) => {
         if (ref) {
             this.refList.add(ref);
             this.observer = new _global.ResizeObserver(action((entries: any) => {
@@ -254,14 +252,14 @@ export class CollectionTreeView extends CollectionSubView<Document, Partial<coll
             true,
             this.whenChildContentsActiveChanged,
             this.props.dontRegisterView || Cast(this.props.Document.childDontRegisterViews, "boolean", null),
-            this.observerHeight,
+            this.observeHeight,
             this.unobserveHeight,
             this.childContextMenuItems()
         );
     }
     @computed get titleBar() {
         const hideTitle = this.props.treeViewHideTitle || this.doc.treeViewHideTitle;
-        return hideTitle ? (null) : (this.doc.treeViewType === "outline" ? this.documentTitle : this.editableTitle)(this.treeChildren);
+        return hideTitle ? (null) : (this.outlineMode ? this.documentTitle : this.editableTitle)(this.treeChildren);
     }
 
     @computed get renderClearButton() {
@@ -274,8 +272,9 @@ export class CollectionTreeView extends CollectionSubView<Document, Partial<coll
 
     paddingX = () => NumCast(this.doc._xPadding, 15);
     paddingTop = () => NumCast(this.doc._yPadding, 20);
+    paddingBot = () => NumCast(this.doc._yPadding, 20);
     documentTitleWidth = () => Math.min(this.layoutDoc?.[WidthSym](), this.panelWidth());
-    documentTitleHeight = () => Math.min(this.layoutDoc?.[HeightSym](), (StrCast(this.layoutDoc?._fontSize) ? Number(StrCast(this.layoutDoc?._fontSize, "32px").replace("px", "")) : NumCast(this.layoutDoc?._fontSize)) * 2);
+    documentTitleHeight = () => (this.layoutDoc?.[HeightSym]() || 0) - NumCast(this.layoutDoc.autoHeightMargins);
     titleTransform = () => this.props.ScreenToLocalTransform().translate(-NumCast(this.doc._xPadding, 10), -NumCast(this.doc._yPadding, 20));
     truncateTitleWidth = () => this.treeViewtruncateTitleWidth;
     onChildClick = () => this.props.onChildClick?.() || ScriptCast(this.doc.onChildClick);
@@ -288,7 +287,7 @@ export class CollectionTreeView extends CollectionSubView<Document, Partial<coll
         return !(this.doc instanceof Doc) || !this.treeChildren ? (null) :
             <div className="collectionTreeView-container" onContextMenu={this.onContextMenu}>
                 <div className="collectionTreeView-dropTarget"
-                    style={{ background: background(), paddingLeft: `${this.paddingX()}px`, paddingRight: `${this.paddingX()}px`, paddingTop: `${this.paddingTop()}px`, pointerEvents: pointerEvents() }}
+                    style={{ background: background(), paddingLeft: `${this.paddingX()}px`, paddingRight: `${this.paddingX()}px`, paddingBottom: `${this.paddingBot()}px`, paddingTop: `${this.paddingTop()}px`, pointerEvents: pointerEvents() }}
                     onWheel={e => e.stopPropagation()}
                     onDrop={this.onTreeDrop}
                     ref={this.createTreeDropTarget}>
-- 
cgit v1.2.3-70-g09d2