From 065a29e87c771b5cd9301b0468fb036e070cad17 Mon Sep 17 00:00:00 2001 From: yunahi <60233430+yunahi@users.noreply.github.com> Date: Fri, 10 Jul 2020 05:08:53 +0900 Subject: added format shape --- src/client/util/SelectionManager.ts | 5 +++++ 1 file changed, 5 insertions(+) (limited to 'src/client/util/SelectionManager.ts') diff --git a/src/client/util/SelectionManager.ts b/src/client/util/SelectionManager.ts index 024532f90..aea2c542b 100644 --- a/src/client/util/SelectionManager.ts +++ b/src/client/util/SelectionManager.ts @@ -5,6 +5,7 @@ import { computedFn } from "mobx-utils"; import { List } from "../../fields/List"; import { Scripting } from "./Scripting"; import { DocumentManager } from "./DocumentManager"; +import FormatShapePane from "../views/collections/collectionFreeForm/FormatShapePane"; export namespace SelectionManager { @@ -14,6 +15,8 @@ export namespace SelectionManager { SelectedDocuments: ObservableMap = new ObservableMap(); @action SelectDoc(docView: DocumentView, ctrlPressed: boolean): void { + console.log("select" + ); // if doc is not in SelectedDocuments, add it if (!manager.SelectedDocuments.get(docView)) { if (!ctrlPressed) { @@ -29,6 +32,8 @@ export namespace SelectionManager { manager.SelectedDocuments.set(docView, true); } Doc.UserDoc().activeSelection = new List(SelectionManager.SelectedDocuments().map(dv => dv.props.Document)); + FormatShapePane.Instance.selected(); + } @action DeselectDoc(docView: DocumentView): void { -- cgit v1.2.3-70-g09d2 From c8454d675a3081a83c56cf598b1b3637479b0459 Mon Sep 17 00:00:00 2001 From: yunahi <60233430+yunahi@users.noreply.github.com> Date: Fri, 10 Jul 2020 05:22:06 +0900 Subject: added format shape --- src/client/util/SelectionManager.ts | 3 +- .../collectionFreeForm/FormatShapePane.tsx | 137 ++++----------------- 2 files changed, 24 insertions(+), 116 deletions(-) (limited to 'src/client/util/SelectionManager.ts') diff --git a/src/client/util/SelectionManager.ts b/src/client/util/SelectionManager.ts index aea2c542b..af2f320d3 100644 --- a/src/client/util/SelectionManager.ts +++ b/src/client/util/SelectionManager.ts @@ -15,8 +15,7 @@ export namespace SelectionManager { SelectedDocuments: ObservableMap = new ObservableMap(); @action SelectDoc(docView: DocumentView, ctrlPressed: boolean): void { - console.log("select" - ); + // if doc is not in SelectedDocuments, add it if (!manager.SelectedDocuments.get(docView)) { if (!ctrlPressed) { diff --git a/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx b/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx index 7b47b7ca4..37ba805b6 100644 --- a/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx +++ b/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx @@ -3,12 +3,9 @@ import AntimodeMenu from "../../AntimodeMenu"; import { observer } from "mobx-react"; import { observable, action, computed } from "mobx"; import "./FormatShapePane.scss"; -import { ActiveInkColor, ActiveInkBezierApprox, ActiveFillColor, ActiveArrowStart, ActiveArrowEnd, SetActiveInkWidth, SetActiveInkColor, SetActiveBezierApprox, SetActiveFillColor, SetActiveArrowStart, SetActiveArrowEnd, ActiveDash, SetActiveDash } from "../../InkingStroke"; +import { SetActiveInkWidth } from "../../InkingStroke"; import { Scripting } from "../../../util/Scripting"; -import { InkTool, InkField } from "../../../../fields/InkField"; -import { ColorState } from "react-color"; -import { Utils } from "../../../../Utils"; -import GestureOverlay from "../../GestureOverlay"; +import { InkField } from "../../../../fields/InkField"; import { Doc } from "../../../../fields/Doc"; import { SelectionManager } from "../../../util/SelectionManager"; import { DocumentView } from "../../../views/nodes/DocumentView"; @@ -19,9 +16,6 @@ import { IconProp, library } from '@fortawesome/fontawesome-svg-core'; import { faRulerCombined, faFillDrip, faPenNib } from "@fortawesome/free-solid-svg-icons"; import { Cast, StrCast, BoolCast, NumCast } from "../../../../fields/Types"; import e = require("express"); -import { ChangeEvent } from "mongodb"; -import { black } from "colors"; - library.add(faRulerCombined, faFillDrip, faPenNib); @@ -33,63 +27,42 @@ export default class FormatShapePane extends AntimodeMenu { private _width = ["1", "5", "10", "100"]; private _mode = ["fill-drip", "ruler-combined"]; private _subMenu = ["fill", "line", "size", "position"]; - private _headIcon = ["⎯", "←"]; - private _endIcon = ["⎯", "→"]; - private _head = ["none", "arrowHead"]; - private _end = ["none", "arrowEnd"]; - @observable private _subOpen = [false, false, false, false]; - @observable private collapsed: boolean = false; @observable private currMode: string = "fill-drip"; @observable _fillBtn = false; @observable _lineBtn = false; - @observable _selectDoc: DocumentView[] = []; - @observable _noFill = false; @observable _solidFill = false; @observable _noLine = false; @observable _solidLine = false; @observable _dashLine = false; @observable _lock = false; - @observable _multiple = false; - @observable _widthBtn = false; - - @observable _currWidth = "10"; - @observable _single = false; - @observable _currFill = "#D0021B"; - @observable _currColor = "#D0021B"; - @observable _arrowHead = false; @observable _arrowEnd = false; - - @observable _currSizeHeight = "10"; @observable _currSizeWidth = "10"; @observable _currRotation = "10"; - @observable _currPositionHorizontal = "10"; @observable _currPositionVertical = "10"; - + @observable _currWidth = "10"; + @observable _currFill = "#D0021B"; + @observable _currColor = "#D0021B"; constructor(props: Readonly<{}>) { super(props); FormatShapePane.Instance = this; - this._canFade = false; // don't let the inking menu fade away + this._canFade = false; this.Pinned = BoolCast(Doc.UserDoc()["formatShapePane-pinned"]); - } @action toggleMenuPin = (e: React.MouseEvent) => { Doc.UserDoc()["formatShapePane-pinned"] = this.Pinned = !this.Pinned; - if (!this.Pinned) { - // this.fadeOut(true); - } } @action @@ -105,9 +78,9 @@ export default class FormatShapePane extends AntimodeMenu { closePane = () => { this.jumpTo(-300, -300); this.Pinned = false; - } + //if multiple inks are selected and do not share the same prop, leave blank @action checkSame = () => { const docs = SelectionManager.SelectedDocuments(); @@ -117,18 +90,6 @@ export default class FormatShapePane extends AntimodeMenu { inks.push(docs[i]); } } - const firstWidth = Document(inks[0].rootDoc).strokeWidth; - const firstColor = Document(inks[0].rootDoc).color; - const firstFill = Document(inks[0].rootDoc).fillColor; - // const firstBezier - const firstRotation = Document(inks[0].rootDoc).rotation; - const firstArrowStart = Document(inks[0].rootDoc).arrowStart; - const firstArrowEnd = Document(inks[0].rootDoc).arrowEnd; - const firstDash = Document(inks[0].rootDoc).dash; - const firstWidthSize = Document(inks[0].rootDoc)._width; - const firstHeightSize = Document(inks[0].rootDoc)._height; - const firstHorizontal = Document(inks[0].rootDoc).x; - const firstVertical = Document(inks[0].rootDoc).y; this._noFill = Document(inks[0].rootDoc).fillColor === "none" ? true : false; this._solidFill = Document(inks[0].rootDoc).fillColor === "none" ? false : true; this._noLine = Document(inks[0].rootDoc).color === "none" ? true : false; @@ -142,11 +103,7 @@ export default class FormatShapePane extends AntimodeMenu { } } - // this._solidLine = (Document(inks[0].rootDoc).color === "none") ? false : Document(inks[0].rootDoc).dash === 0 ? true : false; - // this._dashLine = (Document(inks[0].rootDoc).color === "none") ? false : Document(inks[0].rootDoc).dash !== 0 ? true : false; - // // this._widthBtn = false; this._currWidth = String(Document(inks[0].rootDoc).strokeWidth); - // this._single = false; this._currFill = String(Document(inks[0].rootDoc).fillColor); this._currColor = String(Document(inks[0].rootDoc).color); this._arrowHead = Document(inks[0].rootDoc).arrowStart === "none" ? false : true; @@ -157,45 +114,43 @@ export default class FormatShapePane extends AntimodeMenu { this._currPositionHorizontal = String(Document(inks[0].rootDoc).x); this._currPositionVertical = String(Document(inks[0].rootDoc).y); for (var i = 0; i < inks.length; i++) { - if (Document(inks[i].rootDoc).strokeWidth !== firstWidth) { + if (Document(inks[i].rootDoc).strokeWidth !== Document(inks[0].rootDoc).strokeWidth) { this._currWidth = ""; } - if (Document(inks[i].rootDoc).color !== firstColor) { + if (Document(inks[i].rootDoc).color !== Document(inks[0].rootDoc).color) { this._noLine = false; this._solidLine = false; this._dashLine = false; } - if (Document(inks[i].rootDoc).fillColor !== firstFill) { + if (Document(inks[i].rootDoc).fillColor !== Document(inks[0].rootDoc).fillColor) { this._solidFill = false; this._noFill = false; } - if (Document(inks[i].rootDoc).arrowStart !== firstArrowStart) { + if (Document(inks[i].rootDoc).arrowStart !== Document(inks[0].rootDoc).arrowStart) { this._arrowHead = false; } - if (Document(inks[i].rootDoc).arrowEnd !== firstArrowEnd) { + if (Document(inks[i].rootDoc).arrowEnd !== Document(inks[0].rootDoc).arrowEnd) { this._arrowEnd = false; } - if (Document(inks[i].rootDoc).x !== firstHorizontal) { + if (Document(inks[i].rootDoc).x !== Document(inks[0].rootDoc).x) { this._currPositionHorizontal = ""; } - if (Document(inks[i].rootDoc).y !== firstVertical) { + if (Document(inks[i].rootDoc).y !== Document(inks[0].rootDoc).y) { this._currPositionVertical = ""; } - if (Document(inks[i].rootDoc)._width !== firstWidthSize) { + if (Document(inks[i].rootDoc)._width !== Document(inks[0].rootDoc)._width) { this._currSizeWidth = ""; } - if (Document(inks[i].rootDoc)._height !== firstHeightSize) { + if (Document(inks[i].rootDoc)._height !== Document(inks[0].rootDoc)._height) { this._currSizeHeight = ""; } - if (Document(inks[i].rootDoc).rotation !== firstRotation) { + if (Document(inks[i].rootDoc).rotation !== Document(inks[0].rootDoc).rotation) { this._currRotation = ""; } } - - - } + @action upDownButtons = (dirs: string, field: string) => { SelectionManager.SelectedDocuments().forEach(action((element: DocumentView) => { @@ -206,14 +161,12 @@ export default class FormatShapePane extends AntimodeMenu { if (doc.strokeWidth) { doc.strokeWidth = dirs === "up" ? doc.strokeWidth + 1 : doc.strokeWidth - 1; SetActiveInkWidth(String(doc.strokeWidth)); - } break; case "sizeWidth": if (doc._width && doc._height) { const oldWidth = doc._width; const oldHeight = doc._height; - doc._width = dirs === "up" ? doc._width + 10 : doc._width - 10; if (this._lock) { doc._height = (doc._width * oldHeight) / oldWidth; @@ -240,19 +193,17 @@ export default class FormatShapePane extends AntimodeMenu { doc.y = dirs === "up" ? doc.y + 10 : doc.y - 10; } case "rotation": - this.rotate(dirs === "up" ? Number(doc.rotation) + Number(0.1) : Number(doc.rotation) - Number(0.1)); - break; default: break; } this.selected(); - } })); } + @action editProperties = (value: any, field: string) => { SelectionManager.SelectedDocuments().forEach(action((element: DocumentView) => { @@ -270,7 +221,6 @@ export default class FormatShapePane extends AntimodeMenu { doc.fillColor = String(value); break; case "bezier": - // doc.strokeBezier === 300 ? doc.strokeBezier = 0 : doc.strokeBezier = 300; break; case "arrowStart": doc.arrowStart = String(value); @@ -285,7 +235,6 @@ export default class FormatShapePane extends AntimodeMenu { if (doc._width && doc._height) { const oldWidth = doc._width; const oldHeight = doc._height; - doc._width = Number(value); if (this._lock) { doc._height = (doc._width * oldHeight) / oldWidth; @@ -296,7 +245,6 @@ export default class FormatShapePane extends AntimodeMenu { if (doc._width && doc._height) { const oldWidth = doc._width; const oldHeight = doc._height; - doc._height = Number(value); if (this._lock) { doc._width = (doc._height * oldWidth) / oldHeight; @@ -308,7 +256,6 @@ export default class FormatShapePane extends AntimodeMenu { break; case "vertical": doc.y = Number(value); - break; default: break; @@ -331,13 +278,14 @@ export default class FormatShapePane extends AntimodeMenu { return close; } + //select either coor&fill or size&position @computed get modes() { const modes =
{this._mode.map(mode => { return ; @@ -346,6 +294,7 @@ export default class FormatShapePane extends AntimodeMenu { return modes; } + //detects currently selected document and change value in pane @action selected = () => { this._selectDoc = SelectionManager.SelectedDocuments(); @@ -353,7 +302,6 @@ export default class FormatShapePane extends AntimodeMenu { this._single = true; const doc = Document(this._selectDoc[0].rootDoc); if (doc.type === DocumentType.INK) { - console.log(doc.fillColor); if (doc.fillColor === "none") { this._noFill = true; this._solidFill = false; @@ -382,11 +330,8 @@ export default class FormatShapePane extends AntimodeMenu { this._arrowHead = doc.arrowStart === "none" ? false : true; this._arrowEnd = doc.arrowEnd === "none" ? false : true; - - this._currPositionHorizontal = String(doc.x); this._currPositionVertical = String(doc.y); - console.log(doc.rotation); this._currRotation = String(doc.rotation); this._currSizeHeight = String(doc._height); this._currSizeWidth = String(doc._width); @@ -418,8 +363,6 @@ export default class FormatShapePane extends AntimodeMenu { SelectionManager.SelectedDocuments().forEach(action((element: DocumentView) => { const doc = Document(element.rootDoc); if (doc.type === DocumentType.INK && doc.x && doc.y && doc._width && doc._height && doc.data) { - // doc.rotation = (Number(doc.rotation) + (Number(angle) * 180 / Math.PI)); - // console.log(doc.rotation); const angle = Number(degrees) - Number(doc.rotation); doc.rotation = Number(degrees); const ink = Cast(doc.data, InkField)?.inkData; @@ -446,10 +389,8 @@ export default class FormatShapePane extends AntimodeMenu { const top2 = Math.min(...ys2); const right2 = Math.max(...xs2); const bottom2 = Math.max(...ys2); - doc._height = (bottom2 - top2) * element.props.ScreenToLocalTransform().Scale; doc._width = (right2 - left2) * element.props.ScreenToLocalTransform().Scale; - } } })); @@ -854,14 +795,11 @@ export default class FormatShapePane extends AntimodeMenu { return positionVerticalInput; } - + //change inputs @action onChange = (val: string, property: string): void => { if (!Number.isNaN(Number(val)) && Number(val) !== null && val !== " ") { - // if (val === "") { - // val = "0"; - // } switch (property) { case "width": this._currWidth = val; @@ -912,35 +850,6 @@ export default class FormatShapePane extends AntimodeMenu { } - - - // @action - // changeWidth = (event: React.ChangeEvent) => { - // console.log(event.target.value); - // this._currWidth = NumCast(event.target.value); - - // } - - @computed get upDown() { - const upDown =
- -

- -
; - return upDown; - } - - @computed get widthPicker() { var widthPicker = + return <> +

-

; - return fillButton; +

+ ; } @computed get fillPicker() { - const fillPicker =
+ return
{this._palette.map(color => { return
; - return fillPicker; } @computed get lineButton() { - const lineButton = <> -

-

; - return lineButton; + return <> + +
+
+ ; } @computed get linePicker() { - const linePicker =
+ return
{this._palette.map(color => { return
; - return linePicker; } @computed get widthInput() { const widthInput = <> this.onChange(e.target.value, "width")} - autoFocus>
@@ -672,8 +494,8 @@ export default class FormatShapePane extends AntimodeMenu { this.onChange(e.target.value, "sizeHeight")} - autoFocus> + onChange={e => this._currSizeHeight = e.target.value} + autoFocus /> -

+
-

+
+

+ -

- ; - return positionHorizontalInput; + ; } @computed get positionVerticalInput() { - const positionVerticalInput = - <> + this.onChange(e.target.value, "positionVertical")} + onChange={e => this._currPositionVertical = e.target.value} autoFocus> - -

- ; - return positionVerticalInput; - } - - //change inputs - @action - onChange = (val: string, property: string): void => { - if (!Number.isNaN(Number(val)) && Number(val) !== null && val !== " ") { - - switch (property) { - case "width": - this._currWidth = val; - if (val !== "") { - this.editProperties(this._currWidth, "width"); - } - break; - case "sizeHeight": - this._currSizeHeight = val; - if (val !== "") { - this.editProperties(this._currSizeHeight, "heightSize"); - } - break; - case "sizeWidth": - this._currSizeWidth = val; - if (val !== "") { - - this.editProperties(this._currSizeWidth, "widthSize"); - } - break; - case "rotation": - - this._currRotation = val; - if (val !== "") { - - this.rotate(Number(val)); - } - break; - case "positionHorizontal": - this._currPositionHorizontal = val; if (val !== "") { - - this.editProperties(this._currPositionHorizontal, "horizontal"); - } - - break; - case "positionVertical": - this._currPositionVertical = val; - if (val !== "") { - - this.editProperties(this._currPositionVertical, "vertical"); - } - - break; - default: - break; - } - } - } - - - @computed get widthPicker() { - var widthPicker = ; - if (this._widthBtn) { - widthPicker =
- {widthPicker} - {this._width.map(wid => { - return ; - })} -
; - } - return widthPicker; +

+ + ; } - - render() { const buttons = [ diff --git a/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx b/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx index e4f3248d0..0866db2be 100644 --- a/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx +++ b/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx @@ -25,19 +25,19 @@ library.add(faBold, faItalic, faChevronLeft, faUnderline, faStrikethrough, faSup export default class InkOptionsMenu extends AntimodeMenu { static Instance: InkOptionsMenu; - private _palette = ["#D0021B", "#F5A623", "#F8E71C", "#8B572A", "#7ED321", "#417505", "#9013FE", "#4A90E2", "#50E3C2", "#B8E986", "#000000", "#4A4A4A", "#9B9B9B", "#FFFFFF", "none"]; + private _palette = ["#D0021B", "#F5A623", "#F8E71C", "#8B572A", "#7ED321", "#417505", "#9013FE", "#4A90E2", "#50E3C2", "#B8E986", "#000000", "#4A4A4A", "#9B9B9B", "#FFFFFF", ""]; private _width = ["1", "5", "10", "100"]; // private _buttons = ["circle", "triangle", "rectangle", "arrow", "line"]; // private _icons = ["O", "∆", "ロ", "➜", "-"]; // private _buttons = ["circle", "triangle", "rectangle", "line", "noRec", "",]; // private _icons = ["O", "∆", "ロ", "⎯⎯⎯", "✖︎", " "]; //arrowStart and arrowEnd must match and defs must exist in Inking Stroke - // private _arrowStart = ["arrowHead", "arrowHead", "dot", "dot", "none"]; + // private _arrowStart = ["arrowStart", "arrowStart", "dot", "dot", "none"]; // private _arrowEnd = ["none", "arrowEnd", "none", "dot", "none"]; // private _arrowIcons = ["→", "↔︎", "•", "••", " "]; private _draw = ["⎯", "→", "↔︎", "∿", "↝", "↭", "ロ", "O", "∆"]; - private _head = ["none", "none", "arrowHead", "none", "none", "arrowHead", "none", "none", "none"]; - private _end = ["none", "arrowEnd", "arrowEnd", "none", "arrowEnd", "arrowEnd", "none", "none", "none"]; + private _head = ["", "", "arrow", "", "", "arrow", "", "", ""]; + private _end = ["", "arrow", "arrow", "", "arrow", "arrow", "", "", ""]; private _shape = ["", "", "", "", "", "", "rectangle", "circle", "triangle"]; @observable _shapesNum = this._shape.length; @@ -122,12 +122,6 @@ export default class InkOptionsMenu extends AntimodeMenu { case "bezier": // doc.strokeBezier === 300 ? doc.strokeBezier = 0 : doc.strokeBezier = 300; break; - case "arrowStart": - doc.arrowStart = String(value); - break; - case "arrowEnd": - doc.arrowEnd = String(value); - break; case "dash": doc.dash = Number(value); default: @@ -165,13 +159,12 @@ export default class InkOptionsMenu extends AntimodeMenu { SetActiveArrowEnd(this._end[i]); SetActiveBezierApprox("300"); - // this.editProperties(this._head[i], "arrowStart"), this.editProperties(this._end[i], "arrowEnd"); GestureOverlay.Instance.InkShape = this._shape[i]; } else { this._selected = this._shapesNum; Doc.SetSelectedTool(InkTool.None); - SetActiveArrowStart("none"); - SetActiveArrowEnd("none"); + SetActiveArrowStart(""); + SetActiveArrowEnd(""); GestureOverlay.Instance.InkShape = ""; SetActiveBezierApprox("0"); @@ -189,13 +182,12 @@ export default class InkOptionsMenu extends AntimodeMenu { SetActiveArrowEnd(this._end[i]); SetActiveBezierApprox("300"); - // this.editProperties(this._head[i], "arrowStart"), this.editProperties(this._end[i], "arrowEnd"); GestureOverlay.Instance.InkShape = this._shape[i]; } else { this._selected = this._shapesNum; Doc.SetSelectedTool(InkTool.None); - SetActiveArrowStart("none"); - SetActiveArrowEnd("none"); + SetActiveArrowStart(""); + SetActiveArrowEnd(""); GestureOverlay.Instance.InkShape = ""; SetActiveBezierApprox("0"); diff --git a/src/client/views/nodes/ColorBox.tsx b/src/client/views/nodes/ColorBox.tsx index 137b387c0..31c5a8b13 100644 --- a/src/client/views/nodes/ColorBox.tsx +++ b/src/client/views/nodes/ColorBox.tsx @@ -14,7 +14,6 @@ import { ViewBoxBaseComponent } from "../DocComponent"; import { ActiveInkPen, ActiveInkWidth, ActiveInkBezierApprox, SetActiveInkColor, SetActiveInkWidth, SetActiveBezierApprox } from "../InkingStroke"; import "./ColorBox.scss"; import { FieldView, FieldViewProps } from './FieldView'; -import { FormattedTextBox } from "./formattedText/FormattedTextBox"; type ColorDocument = makeInterface<[typeof documentSchema]>; const ColorDocument = makeInterface(documentSchema); -- cgit v1.2.3-70-g09d2 From 3bcc0e3a8ce4ab67dff4b3d62191c346764aa351 Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Thu, 23 Jul 2020 11:56:05 -0400 Subject: got rid of lots of console.logs(). fixed fonticon box to show a 'label' if defined otherwise 'title'. if neither, then it shows no tooltip. --- src/client/ClientRecommender.tsx | 2 -- src/client/apis/IBM_Recommender.ts | 2 -- .../apis/google_docs/GooglePhotosClientUtils.ts | 2 -- src/client/cognitive_services/CognitiveServices.ts | 2 -- src/client/documents/Documents.ts | 3 ++- src/client/util/CurrentUserUtils.ts | 1 - src/client/util/DictationManager.ts | 2 +- src/client/util/InteractionUtils.tsx | 2 -- src/client/util/ScriptManager.ts | 10 --------- src/client/util/SearchUtil.ts | 1 - src/client/util/SelectionManager.ts | 1 - src/client/views/EditableView.tsx | 1 - src/client/views/GestureOverlay.tsx | 1 - src/client/views/KeyphraseQueryView.tsx | 1 - src/client/views/ScriptBox.tsx | 2 +- src/client/views/SearchDocBox.tsx | 9 -------- src/client/views/Touchable.tsx | 3 --- src/client/views/animationtimeline/Keyframe.tsx | 4 ---- src/client/views/animationtimeline/Timeline.tsx | 1 - src/client/views/animationtimeline/Track.tsx | 4 ---- .../views/collections/CollectionCarousel3DView.tsx | 3 --- .../views/collections/CollectionCarouselView.tsx | 2 -- .../collections/CollectionMasonryViewFieldRow.tsx | 1 - src/client/views/collections/CollectionMenu.tsx | 2 +- .../views/collections/CollectionSchemaCells.tsx | 12 ----------- .../views/collections/CollectionSchemaView.tsx | 1 - src/client/views/collections/CollectionSubView.tsx | 2 -- .../views/collections/CollectionTreeView.tsx | 4 ---- src/client/views/collections/CollectionView.tsx | 2 +- src/client/views/collections/SchemaTable.tsx | 3 +-- .../collectionFreeForm/CollectionFreeFormView.tsx | 2 -- .../collections/collectionFreeForm/MarqueeView.tsx | 3 --- src/client/views/linking/LinkMenu.tsx | 1 - src/client/views/linking/LinkMenuItem.tsx | 5 ----- src/client/views/nodes/DocumentContentsView.tsx | 2 +- src/client/views/nodes/DocumentLinksButton.tsx | 2 -- src/client/views/nodes/DocumentView.tsx | 1 - src/client/views/nodes/FontIconBox.tsx | 24 ++++++++++++---------- src/client/views/nodes/PresBox.tsx | 1 - src/client/views/nodes/RadialMenu.tsx | 1 - src/client/views/nodes/ScreenshotBox.tsx | 2 +- src/client/views/nodes/ScriptingBox.tsx | 1 - src/client/views/nodes/VideoBox.tsx | 2 +- src/client/views/nodes/WebBox.tsx | 2 +- .../views/nodes/formattedText/DashDocView.tsx | 2 +- .../views/nodes/formattedText/RichTextSchema.tsx | 2 +- src/client/views/search/FilterBox.tsx | 1 - src/client/views/search/SearchBox.tsx | 5 +---- src/client/views/search/ToggleBar.tsx | 1 - src/fields/Doc.ts | 1 - src/fields/ScriptField.ts | 1 - src/fields/util.ts | 1 - src/server/Recommender.ts | 4 ---- src/server/downsize.ts | 2 +- 54 files changed, 28 insertions(+), 127 deletions(-) (limited to 'src/client/util/SelectionManager.ts') diff --git a/src/client/ClientRecommender.tsx b/src/client/ClientRecommender.tsx index d18669b02..3f875057e 100644 --- a/src/client/ClientRecommender.tsx +++ b/src/client/ClientRecommender.tsx @@ -50,7 +50,6 @@ export class ClientRecommender extends React.Component { @observable private corr_matrix = [[0, 0], [0, 0]]; // for testing constructor(props: RecommenderProps) { - //console.log("creating client recommender..."); super(props); if (!ClientRecommender.Instance) ClientRecommender.Instance = this; ClientRecommender.Instance.docVectors = new Set(); @@ -383,7 +382,6 @@ export class ClientRecommender extends React.Component { case 200: const title_vals: string[] = []; const url_vals: string[] = []; - //console.log(result); if (xml) { const titles = xml.getElementsByTagName("title"); let counter = 1; diff --git a/src/client/apis/IBM_Recommender.ts b/src/client/apis/IBM_Recommender.ts index 480b9cb1c..e6265fcb5 100644 --- a/src/client/apis/IBM_Recommender.ts +++ b/src/client/apis/IBM_Recommender.ts @@ -29,10 +29,8 @@ // export const analyze = async (_parameters: any): Promise> => { // try { // const response = await naturalLanguageUnderstanding.analyze(_parameters); -// console.log(response); // return (JSON.stringify(response, null, 2)); // } catch (err) { -// console.log('error: ', err); // return undefined; // } // }; diff --git a/src/client/apis/google_docs/GooglePhotosClientUtils.ts b/src/client/apis/google_docs/GooglePhotosClientUtils.ts index 13bfb3a91..92eaf2e73 100644 --- a/src/client/apis/google_docs/GooglePhotosClientUtils.ts +++ b/src/client/apis/google_docs/GooglePhotosClientUtils.ts @@ -156,8 +156,6 @@ export namespace GooglePhotos { const values = Object.values(ContentCategories).filter(value => value !== ContentCategories.NONE); for (const value of values) { const searched = (await ContentSearch({ included: [value] }))?.mediaItems?.map(({ id }) => id); - console.log("Searching " + value); - console.log(searched); searched?.forEach(async id => { const image = await Cast(idMapping[id], Doc); if (image) { diff --git a/src/client/cognitive_services/CognitiveServices.ts b/src/client/cognitive_services/CognitiveServices.ts index 6b0b3e029..80961af14 100644 --- a/src/client/cognitive_services/CognitiveServices.ts +++ b/src/client/cognitive_services/CognitiveServices.ts @@ -377,7 +377,6 @@ export namespace CognitiveServices { console.log("successful vectorization!"); const vectorValues = new List(); indices.forEach((ind: any) => { - //console.log(wordvec.word); vectorValues.push(wordvecs[ind]); }); ClientRecommender.Instance.processVector(vectorValues, dataDoc, mainDoc); @@ -385,7 +384,6 @@ export namespace CognitiveServices { else { console.log("unsuccessful :( word(s) not in vocabulary"); } - //console.log(vectorValues.size); } ); } diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts index e2569ec70..cd2792226 100644 --- a/src/client/documents/Documents.ts +++ b/src/client/documents/Documents.ts @@ -92,6 +92,7 @@ export interface DocumentOptions { layoutKey?: string; type?: string; title?: string; + label?: string; toolTip?: string; // tooltip to display on hover style?: string; page?: number; @@ -494,7 +495,7 @@ export namespace Docs { Doc.Get.FromJson({ data: device, appendToExisting: { targetDoc: Doc.GetProto(doc) } }); Doc.AddDocToList(parentProto, "data", doc); } else if (errors) { - console.log(errors); + console.log("Documents:" + errors); } else { alert("A Buxton document import was completely empty (??)"); } diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts index 23b8f09de..b47cfb33a 100644 --- a/src/client/util/CurrentUserUtils.ts +++ b/src/client/util/CurrentUserUtils.ts @@ -487,7 +487,6 @@ export class CurrentUserUtils { // Sets up mobile menu if it is undefined creates a new one, otherwise returns existing menu static setupActiveMobileMenu(doc: Doc) { if (doc.activeMobileMenu === undefined) { - console.log("undefined"); doc.activeMobileMenu = this.setupMobileMenu(); } return doc.activeMobileMenu as Doc; diff --git a/src/client/util/DictationManager.ts b/src/client/util/DictationManager.ts index 28b1ca6cf..540540642 100644 --- a/src/client/util/DictationManager.ts +++ b/src/client/util/DictationManager.ts @@ -121,7 +121,7 @@ export namespace DictationManager { const listenImpl = (options?: Partial) => { if (!recognizer) { - console.log(unsupported); + console.log("DictationManager:" + unsupported); return unsupported; } if (isListening) { diff --git a/src/client/util/InteractionUtils.tsx b/src/client/util/InteractionUtils.tsx index 473d4a263..8b3614ea7 100644 --- a/src/client/util/InteractionUtils.tsx +++ b/src/client/util/InteractionUtils.tsx @@ -161,7 +161,6 @@ export namespace InteractionUtils { // return ( // InkOptionsMenu.Instance.getColors().map(color => { // const id1 = "arrowStartTest" + color; - // console.log(color); // // // ; @@ -383,7 +382,6 @@ export namespace InteractionUtils { // let dist12 = TwoPointEuclidist(pt1, pt2); // let dist23 = TwoPointEuclidist(pt2, pt3); // let dist13 = TwoPointEuclidist(pt1, pt3); - // console.log(`distances: ${dist12}, ${dist23}, ${dist13}`); // let dist12close = dist12 < leniency; // let dist23close = dist23 < leniency; // let dist13close = dist13 < leniency; diff --git a/src/client/util/ScriptManager.ts b/src/client/util/ScriptManager.ts index 785e63d9a..94806a7ba 100644 --- a/src/client/util/ScriptManager.ts +++ b/src/client/util/ScriptManager.ts @@ -32,24 +32,17 @@ export class ScriptManager { } public addScript(scriptDoc: Doc): boolean { - - console.log("in add script method"); - const scriptList = this.getAllScripts(); scriptList.push(scriptDoc); if (ScriptManager.Instance.ScriptManagerDoc) { ScriptManager.Instance.ScriptManagerDoc.data = new List(scriptList); ScriptManager.addScriptToGlobals(scriptDoc); - console.log("script added"); return true; } return false; } public deleteScript(scriptDoc: Doc): boolean { - - console.log("in delete script method"); - if (scriptDoc.name) { Scripting.removeGlobal(StrCast(scriptDoc.name)); } @@ -70,7 +63,6 @@ export class ScriptManager { Scripting.removeGlobal(StrCast(scriptDoc.name)); const params = Cast(scriptDoc["data-params"], listSpec("string"), []); - console.log(params); const paramNames = params.reduce((o: string, p: string) => { if (params.indexOf(p) === params.length - 1) { o = o + p.split(":")[0].trim(); @@ -82,8 +74,6 @@ export class ScriptManager { const f = new Function(paramNames, StrCast(scriptDoc.script)); - console.log(scriptDoc.script); - Object.defineProperty(f, 'name', { value: StrCast(scriptDoc.name), writable: false }); let parameters = "("; diff --git a/src/client/util/SearchUtil.ts b/src/client/util/SearchUtil.ts index 1ac68480e..0a01d8ac7 100644 --- a/src/client/util/SearchUtil.ts +++ b/src/client/util/SearchUtil.ts @@ -128,7 +128,6 @@ export namespace SearchUtil { }); const result: IdSearchResult = JSON.parse(response); const { ids, numFound, highlighting } = result; - //console.log(ids.length); const docMap = await DocServer.GetRefFields(ids); const docs: Doc[] = []; for (const id of ids) { diff --git a/src/client/util/SelectionManager.ts b/src/client/util/SelectionManager.ts index 9a968aeda..20d881961 100644 --- a/src/client/util/SelectionManager.ts +++ b/src/client/util/SelectionManager.ts @@ -22,7 +22,6 @@ export namespace SelectionManager { } manager.SelectedDocuments.set(docView, true); - // console.log(manager.SelectedDocuments); docView.props.whenActiveChanged(true); } else if (!ctrlPressed && Array.from(manager.SelectedDocuments.entries()).length > 1) { Array.from(manager.SelectedDocuments.keys()).map(dv => dv !== docView && dv.props.whenActiveChanged(false)); diff --git a/src/client/views/EditableView.tsx b/src/client/views/EditableView.tsx index 25a87ab56..ad61d3f91 100644 --- a/src/client/views/EditableView.tsx +++ b/src/client/views/EditableView.tsx @@ -73,7 +73,6 @@ export class EditableView extends React.Component { // // this is done because when autosuggest is turned on, the suggestions are passed in as a prop, // // so when the suggestions are passed in, and no editing prop is passed in, it used to set it // // to false. this will no longer do so -syip - // console.log("props editing = " + nextProps.editing); // if (nextProps.editing && nextProps.editing !== this._editing) { // this._editing = nextProps.editing; // EditableView.loadId = ""; diff --git a/src/client/views/GestureOverlay.tsx b/src/client/views/GestureOverlay.tsx index b0b0d72b1..2e588ceb5 100644 --- a/src/client/views/GestureOverlay.tsx +++ b/src/client/views/GestureOverlay.tsx @@ -160,7 +160,6 @@ export default class GestureOverlay extends Touchable { if (nts.nt.length === 1) { // -- radial menu code -- this._holdTimer = setTimeout(() => { - console.log("hold"); const target = document.elementFromPoint(te.changedTouches?.item(0).clientX, te.changedTouches?.item(0).clientY); const pt: any = te.touches[te.touches?.length - 1]; if (nts.nt.length === 1 && pt.radiusX > 1 && pt.radiusY > 1) { diff --git a/src/client/views/KeyphraseQueryView.tsx b/src/client/views/KeyphraseQueryView.tsx index 1dc156968..13d52db88 100644 --- a/src/client/views/KeyphraseQueryView.tsx +++ b/src/client/views/KeyphraseQueryView.tsx @@ -11,7 +11,6 @@ export interface KP_Props { export class KeyphraseQueryView extends React.Component{ constructor(props: KP_Props) { super(props); - console.log("FIRST KEY PHRASE: ", props.keyphrases[0]); } render() { diff --git a/src/client/views/ScriptBox.tsx b/src/client/views/ScriptBox.tsx index 888f84dfa..2c185be86 100644 --- a/src/client/views/ScriptBox.tsx +++ b/src/client/views/ScriptBox.tsx @@ -39,7 +39,7 @@ export class ScriptBox extends React.Component { @action onError = (error: string) => { - console.log(error); + console.log("ScriptBox: " + error); } overlayDisposer?: () => void; diff --git a/src/client/views/SearchDocBox.tsx b/src/client/views/SearchDocBox.tsx index e038d8213..084f952a3 100644 --- a/src/client/views/SearchDocBox.tsx +++ b/src/client/views/SearchDocBox.tsx @@ -60,8 +60,6 @@ export class SearchDocBox extends React.Component { componentDidMount() { runInAction(() => { - console.log("didit" - ); this.query = StrCast(this.props.Document.searchText); this.content = (Docs.Create.TreeDocument(DocListCast(Doc.GetProto(this.props.Document).data), { _width: 200, _height: 400, _chromeStatus: "disabled", title: `Search Docs:` + this.query })); @@ -83,12 +81,9 @@ export class SearchDocBox extends React.Component { if (newKey.length > 1) { const newdocs = await this.getAllResults(this.query); const things = newdocs.docs; - console.log(things); - console.log(this.content); runInAction(() => { this.content = Docs.Create.TreeDocument(things, { _width: 200, _height: 400, _chromeStatus: "disabled", title: `Search Docs:` + this.query }); }); - console.log(this.content); } @@ -150,12 +145,9 @@ export class SearchDocBox extends React.Component { } enter = async (e: React.KeyboardEvent) => { - console.log(e.key); if (e.key === "Enter") { const newdocs = await this.getAllResults(this.query); - console.log(newdocs.docs); this.content = Docs.Create.TreeDocument(newdocs.docs, { _width: 200, _height: 400, _chromeStatus: "disabled", title: `Search Docs: "Results"` }); - } } @@ -256,7 +248,6 @@ export class SearchDocBox extends React.Component { startDragCollection = async () => { const res = await this.getAllResults(FilterBox.Instance.getFinalQuery(this._searchString)); const filtered = FilterBox.Instance.filterDocsByType(res.docs); - // console.log(this._results) const docs = filtered.map(doc => { const isProto = Doc.GetT(doc, "isPrototype", "boolean", true); if (isProto) { diff --git a/src/client/views/Touchable.tsx b/src/client/views/Touchable.tsx index 5e48d5ffb..c4cae7e8d 100644 --- a/src/client/views/Touchable.tsx +++ b/src/client/views/Touchable.tsx @@ -54,7 +54,6 @@ export abstract class Touchable extends React.Component { } }); - // console.log(ptsToDelete.length); ptsToDelete.forEach(pt => this.prevPoints.delete(pt)); if (this.prevPoints.size) { @@ -86,7 +85,6 @@ export abstract class Touchable extends React.Component { // if we're not actually moving a lot, don't consider it as dragging yet if (!InteractionUtils.IsDragging(this.prevPoints, myTouches, 5) && !this._touchDrag) return; this._touchDrag = true; - // console.log(myTouches.length); switch (myTouches.length) { case 1: this.handle1PointerMove(te, me); @@ -107,7 +105,6 @@ export abstract class Touchable extends React.Component { @action protected onTouchEnd = (e: Event, me: InteractionUtils.MultiTouchEvent): void => { - // console.log(InteractionUtils.GetMyTargetTouches(e, this.prevPoints).length + " up"); // remove all the touches associated with the event const te = me.touchEvent; for (const pt of me.changedTouches) { diff --git a/src/client/views/animationtimeline/Keyframe.tsx b/src/client/views/animationtimeline/Keyframe.tsx index 3a7182a94..1b81c544a 100644 --- a/src/client/views/animationtimeline/Keyframe.tsx +++ b/src/client/views/animationtimeline/Keyframe.tsx @@ -527,10 +527,6 @@ export class Keyframe extends React.Component { */ //154, 206, 223 render() { - trace(); - console.log(this.props.RegionData.position); - console.log(this.regiondata.position); - console.log(this.pixelPosition); return (
{ //TODO: remove undefineds and duplicates } }); - // console.log(longestTime); return longestTime; } diff --git a/src/client/views/animationtimeline/Track.tsx b/src/client/views/animationtimeline/Track.tsx index 4987006e7..25c2e68e7 100644 --- a/src/client/views/animationtimeline/Track.tsx +++ b/src/client/views/animationtimeline/Track.tsx @@ -134,7 +134,6 @@ export class Track extends React.Component { autoCreateKeyframe = () => { const objects = this.objectWhitelist.map(key => this.props.node[key]); intercept(this.props.node, change => { - console.log(change); return change; }); return reaction(() => { @@ -174,7 +173,6 @@ export class Track extends React.Component { if (regiondata) { this.props.node.hidden = false; // if (!this._autoKfReaction) { - // // console.log("creating another reaction"); // // this._autoKfReaction = this.autoCreateKeyframe(); // } this.timeChange(); @@ -204,7 +202,6 @@ export class Track extends React.Component { } }); } else { - console.log("reverting state"); //this.revertState(); } }); @@ -229,7 +226,6 @@ export class Track extends React.Component { const rightkf: (Doc | undefined) = await KeyframeFunc.calcMinRight(regiondata, this.time); //right keyframe, if it exists const currentkf: (Doc | undefined) = await this.calcCurrent(regiondata); //if the scrubber is on top of the keyframe if (currentkf) { - console.log("is current"); await this.applyKeys(currentkf); this.saveStateKf = currentkf; this.saveStateRegion = regiondata; diff --git a/src/client/views/collections/CollectionCarousel3DView.tsx b/src/client/views/collections/CollectionCarousel3DView.tsx index 8e9970ada..0f3b6f212 100644 --- a/src/client/views/collections/CollectionCarousel3DView.tsx +++ b/src/client/views/collections/CollectionCarousel3DView.tsx @@ -86,7 +86,6 @@ export class CollectionCarousel3DView extends CollectionSubView(Carousel3DDocume interval?: number; startAutoScroll = (direction: number) => { this.interval = window.setInterval(() => { - console.log(this.interval, this.scrollSpeed); this.changeSlide(direction); }, this.scrollSpeed); } @@ -113,13 +112,11 @@ export class CollectionCarousel3DView extends CollectionSubView(Carousel3DDocume onPointerDown = (e: React.PointerEvent) => { this._downX = e.clientX; this._downY = e.clientY; - console.log("CAROUSEL down"); document.addEventListener("pointerup", this.onpointerup); } private _lastTap: number = 0; private _doubleTap = false; onpointerup = (e: PointerEvent) => { - console.log("CAROUSEL up"); this._doubleTap = (Date.now() - this._lastTap < 300 && e.button === 0 && Math.abs(e.clientX - this._downX) < 2 && Math.abs(e.clientY - this._downY) < 2); this._lastTap = Date.now(); } diff --git a/src/client/views/collections/CollectionCarouselView.tsx b/src/client/views/collections/CollectionCarouselView.tsx index 404dc0daa..27aea4b99 100644 --- a/src/client/views/collections/CollectionCarouselView.tsx +++ b/src/client/views/collections/CollectionCarouselView.tsx @@ -91,13 +91,11 @@ export class CollectionCarouselView extends CollectionSubView(CarouselDocument) onPointerDown = (e: React.PointerEvent) => { this._downX = e.clientX; this._downY = e.clientY; - console.log("CAROUSEL down"); document.addEventListener("pointerup", this.onpointerup); } private _lastTap: number = 0; private _doubleTap = false; onpointerup = (e: PointerEvent) => { - console.log("CAROUSEL up"); this._doubleTap = (Date.now() - this._lastTap < 300 && e.button === 0 && Math.abs(e.clientX - this._downX) < 2 && Math.abs(e.clientY - this._downY) < 2); this._lastTap = Date.now(); } diff --git a/src/client/views/collections/CollectionMasonryViewFieldRow.tsx b/src/client/views/collections/CollectionMasonryViewFieldRow.tsx index 627b22417..9a7ea2c93 100644 --- a/src/client/views/collections/CollectionMasonryViewFieldRow.tsx +++ b/src/client/views/collections/CollectionMasonryViewFieldRow.tsx @@ -84,7 +84,6 @@ export class CollectionMasonryViewFieldRow extends React.Component { - console.log("masronry row drop"); this._createAliasSelected = false; if (de.complete.docDragData) { (this.props.parent.Document.dropConverter instanceof ScriptField) && diff --git a/src/client/views/collections/CollectionMenu.tsx b/src/client/views/collections/CollectionMenu.tsx index 5d95b214a..992c1f600 100644 --- a/src/client/views/collections/CollectionMenu.tsx +++ b/src/client/views/collections/CollectionMenu.tsx @@ -462,7 +462,7 @@ export class CollectionFreeFormViewChrome extends React.Component -
+
diff --git a/src/client/views/collections/CollectionSchemaCells.tsx b/src/client/views/collections/CollectionSchemaCells.tsx index d76b6d204..eecaf7672 100644 --- a/src/client/views/collections/CollectionSchemaCells.tsx +++ b/src/client/views/collections/CollectionSchemaCells.tsx @@ -151,7 +151,6 @@ export class CollectionSchemaCell extends React.Component { // let field = this.props.rowProps.original[this.props.rowProps.column.id as string]; // let doc = FieldValue(Cast(field, Doc)); - // console.log("Expanding doc", StrCast(doc!.title)); // this.props.setPreviewDoc(doc!); // // this.props.changeFocusedCellByIndex(this.props.row, this.props.col); @@ -265,7 +264,6 @@ export class CollectionSchemaCell extends React.Component { return "0"; } else { const cfield = ComputedField.WithoutComputed(() => FieldValue(props.Document[props.fieldKey])); - console.log(cfield); if (type === "number") { return StrCast(cfield); } @@ -286,7 +284,6 @@ export class CollectionSchemaCell extends React.Component { const script = CompileScript(value, { requiredType: type, typecheck: false, editable: true, addReturn: true, params: { this: Doc.name, $r: "number", $c: "number", $: "any" } }); if (script.compiled) { retVal = this.applyToDoc(props.Document, this.props.row, this.props.col, script.run); - console.log("compiled"); } } @@ -350,17 +347,13 @@ export class CollectionSchemaDateCell extends CollectionSchemaCell { @action handleChange = (date: any) => { - console.log(date); this._date = date; // const script = CompileScript(date.toString(), { requiredType: "Date", addReturn: true, params: { this: Doc.name } }); // if (script.compiled) { - // console.log("scripting"); // this.applyToDoc(this._document, this.props.row, this.props.col, script.run); // } else { - console.log(DateCast(date)); // ^ DateCast is always undefined for some reason, but that is what the field should be set to this._document[this.props.rowProps.column.id as string] = date as Date; - console.log(this._document[this.props.rowProps.column.id as string]); //} } @@ -425,8 +418,6 @@ export class CollectionSchemaDocCell extends CollectionSchemaCell { const results = script.compiled && script.run(); if (results && results.success) { - - console.log(results.result); this._doc = results.result; this._document[this.prop.fieldKey] = results.result; this._docTitle = this._doc?.title; @@ -457,10 +448,8 @@ export class CollectionSchemaDocCell extends CollectionSchemaCell { this._preview = false; } else { if (bool) { - console.log("show doc"); this.props.showDoc(this._doc, this.prop.DataDoc, e.clientX, e.clientY); } else { - console.log("no doc"); this.props.showDoc(undefined); } } @@ -675,7 +664,6 @@ export class CollectionSchemaListCell extends CollectionSchemaCell { @action toggleOpened(open: boolean) { - console.log("open: " + open); this._opened = open; } diff --git a/src/client/views/collections/CollectionSchemaView.tsx b/src/client/views/collections/CollectionSchemaView.tsx index 3c42a2f1c..5553bbbb7 100644 --- a/src/client/views/collections/CollectionSchemaView.tsx +++ b/src/client/views/collections/CollectionSchemaView.tsx @@ -332,7 +332,6 @@ export class CollectionSchemaView extends CollectionSubView(doc => doc) { @action openHeader = (col: any, screenx: number, screeny: number) => { - console.log("header opening"); this._col = col; this._headerOpen = !this._headerOpen; this._pointerX = screenx; diff --git a/src/client/views/collections/CollectionSubView.tsx b/src/client/views/collections/CollectionSubView.tsx index a147b06a3..8480a56cc 100644 --- a/src/client/views/collections/CollectionSubView.tsx +++ b/src/client/views/collections/CollectionSubView.tsx @@ -340,7 +340,6 @@ export function CollectionSubView(schemaCtor: (doc: Doc) => T, moreProps?: // if ((matches = /(https:\/\/)?photos\.google\.com\/(u\/3\/)?album\/([^\\]+)/g.exec(text)) !== null) { // const albumId = matches[3]; // const mediaItems = await GooglePhotos.Query.AlbumSearch(albumId); - // console.log(mediaItems); // return; // } } @@ -381,7 +380,6 @@ export function CollectionSubView(schemaCtor: (doc: Doc) => T, moreProps?: file?.type && files.push(file); file?.type === "application/json" && Utils.readUploadedFileAsText(file).then(result => { - console.log(result); const json = JSON.parse(result as string); this.addDocument(Docs.Create.TreeDocument( json["rectangular-puzzle"].crossword.clues[0].clue.map((c: any) => { diff --git a/src/client/views/collections/CollectionTreeView.tsx b/src/client/views/collections/CollectionTreeView.tsx index 96a2e23c9..651357e5d 100644 --- a/src/client/views/collections/CollectionTreeView.tsx +++ b/src/client/views/collections/CollectionTreeView.tsx @@ -796,9 +796,6 @@ export class CollectionTreeView extends CollectionSubView; } - onKeyPress = (e: React.KeyboardEvent) => { - console.log(e); - } onChildClick = () => { return this.props.onChildClick?.() || ScriptCast(this.doc.onChildClick); } @@ -819,7 +816,6 @@ export class CollectionTreeView extends CollectionSubView this._mainEle && this._mainEle.scrollHeight > this._mainEle.clientHeight && e.stopPropagation()} onDrop={this.onTreeDrop} ref={this.createTreeDropTarget}> diff --git a/src/client/views/collections/CollectionView.tsx b/src/client/views/collections/CollectionView.tsx index 53fd83f26..e2f78d6f9 100644 --- a/src/client/views/collections/CollectionView.tsx +++ b/src/client/views/collections/CollectionView.tsx @@ -167,7 +167,7 @@ export class CollectionView extends Touchable { @action changeSorting = (col: any) => { - console.log(col.heading); if (col.desc === undefined) { // no sorting this.props.changeColumnSort(col, true); @@ -149,7 +148,7 @@ export class SchemaTable extends React.Component { } @action - changeTitleMode = () => { console.log("header clicked"); this._showTitleDropdown = !this._showTitleDropdown; } + changeTitleMode = () => this._showTitleDropdown = !this._showTitleDropdown; @computed get borderWidth() { return Number(COLLECTION_BORDER_WIDTH); } @computed get tableColumns(): Column[] { diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx index 3b19a2ab8..979b21321 100644 --- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx +++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx @@ -497,10 +497,8 @@ export class CollectionFreeFormView extends CollectionSubView p.X)), Math.min(...ge.points.map(p => p.Y))); this._inkToTextStartX = start[0]; this._inkToTextStartY = start[1]; - console.log("start"); break; case GestureUtils.Gestures.EndBracket: - console.log("end"); if (this._inkToTextStartX && this._inkToTextStartY) { const end = this.getTransform().transformPoint(Math.max(...ge.points.map(p => p.X)), Math.max(...ge.points.map(p => p.Y))); const setDocs = this.getActiveDocuments().filter(s => s.proto?.type === "rtf" && s.color); diff --git a/src/client/views/collections/collectionFreeForm/MarqueeView.tsx b/src/client/views/collections/collectionFreeForm/MarqueeView.tsx index 84719b2c9..aa9a3b4ae 100644 --- a/src/client/views/collections/collectionFreeForm/MarqueeView.tsx +++ b/src/client/views/collections/collectionFreeForm/MarqueeView.tsx @@ -434,8 +434,6 @@ export class MarqueeView extends React.Component { // const wordResults = results.filter((r: any) => r.category === "inkWord"); - // console.log(wordResults); - // console.log(results); // for (const word of wordResults) { // const indices: number[] = word.strokeIds; // indices.forEach(i => { @@ -476,7 +474,6 @@ export class MarqueeView extends React.Component r.category === "line"); - console.log(lines); const text = lines.map((l: any) => l.recognizedText).join("\r\n"); this.props.addDocument(Docs.Create.TextDocument(text, { _width: this.Bounds.width, _height: this.Bounds.height, x: this.Bounds.left + this.Bounds.width, y: this.Bounds.top, title: text })); }); diff --git a/src/client/views/linking/LinkMenu.tsx b/src/client/views/linking/LinkMenu.tsx index 2d151e9bc..7b5fb0127 100644 --- a/src/client/views/linking/LinkMenu.tsx +++ b/src/client/views/linking/LinkMenu.tsx @@ -46,7 +46,6 @@ export class LinkMenu extends React.Component { if (this._linkMenuRef && !this._linkMenuRef.current?.contains(e.target as any)) { if (this._editorRef && !this._editorRef.current?.contains(e.target as any)) { - console.log("outside click"); DocumentLinksButton.EditLink = undefined; } } diff --git a/src/client/views/linking/LinkMenuItem.tsx b/src/client/views/linking/LinkMenuItem.tsx index d8ba39f09..d1c839c3b 100644 --- a/src/client/views/linking/LinkMenuItem.tsx +++ b/src/client/views/linking/LinkMenuItem.tsx @@ -81,10 +81,7 @@ export class LinkMenuItem extends React.Component { @action toggleShowMore(e: React.PointerEvent) { e.stopPropagation(); this._showMore = !this._showMore; } onEdit = (e: React.PointerEvent): void => { - - console.log("Edit"); LinkManager.currentLink = this.props.linkDoc; - console.log(this.props.linkDoc); setupMoveUpEvents(this, e, this.editMoved, emptyFunction, () => this.props.showEditor(this.props.linkDoc)); } @@ -119,7 +116,6 @@ export class LinkMenuItem extends React.Component { document.addEventListener("pointerup", this.onLinkButtonUp); if (this._buttonRef && !!!this._buttonRef.current?.contains(e.target as any)) { - console.log("outside click"); LinkDocPreview.LinkInfo = undefined; } } @@ -153,7 +149,6 @@ export class LinkMenuItem extends React.Component { @action.bound async followDefault() { - console.log("FOLLOWWW"); DocumentLinksButton.EditLink = undefined; LinkDocPreview.LinkInfo = undefined; diff --git a/src/client/views/nodes/DocumentContentsView.tsx b/src/client/views/nodes/DocumentContentsView.tsx index f2f8ada68..47dc0a773 100644 --- a/src/client/views/nodes/DocumentContentsView.tsx +++ b/src/client/views/nodes/DocumentContentsView.tsx @@ -200,7 +200,7 @@ export class DocumentContentsView extends React.Component { console.log(test); }} + onError={(test: any) => { console.log("DocumentContentsView:" + test); }} />; } } \ No newline at end of file diff --git a/src/client/views/nodes/DocumentLinksButton.tsx b/src/client/views/nodes/DocumentLinksButton.tsx index 13bec5d7f..b17accfd6 100644 --- a/src/client/views/nodes/DocumentLinksButton.tsx +++ b/src/client/views/nodes/DocumentLinksButton.tsx @@ -68,8 +68,6 @@ export class DocumentLinksButton extends React.Component Doc.BrushDoc(this.props.View.Document)); DocumentLinksButton.StartLink = this.props.View; } else if (!this.props.InMenu) { - console.log("editing"); - this.props.View ? console.log("view") : null; DocumentLinksButton.EditLink = this.props.View; DocumentLinksButton.EditLinkLoc = [e.clientX + 10, e.clientY]; } diff --git a/src/client/views/nodes/DocumentView.tsx b/src/client/views/nodes/DocumentView.tsx index 9e492650b..998c6798e 100644 --- a/src/client/views/nodes/DocumentView.tsx +++ b/src/client/views/nodes/DocumentView.tsx @@ -910,7 +910,6 @@ export class DocumentView extends DocComponent(Docu if (!ClientRecommender.Instance) new ClientRecommender({ title: "Client Recommender" }); const documents: Doc[] = []; const allDocs = await SearchUtil.GetAllDocs(); - // allDocs.forEach(doc => console.log(doc.title)); // clears internal representation of documents as vectors ClientRecommender.Instance.reset_docs(); //ClientRecommender.Instance.arxivrequest("electrons"); diff --git a/src/client/views/nodes/FontIconBox.tsx b/src/client/views/nodes/FontIconBox.tsx index a4d16fe0e..ab34e13b0 100644 --- a/src/client/views/nodes/FontIconBox.tsx +++ b/src/client/views/nodes/FontIconBox.tsx @@ -61,16 +61,18 @@ export class FontIconBox extends DocComponent( render() { const referenceDoc = (this.layoutDoc.dragFactory instanceof Doc ? this.layoutDoc.dragFactory : this.layoutDoc); const refLayout = Doc.Layout(referenceDoc); - return {StrCast(this.layoutDoc.toolTip)}
}> - - ; + const button = ; + return !this.layoutDoc.toolTip ? button : + {StrCast(this.layoutDoc.toolTip)}
}> + {button} + ; } } \ No newline at end of file diff --git a/src/client/views/nodes/PresBox.tsx b/src/client/views/nodes/PresBox.tsx index 8818d375e..a304ced18 100644 --- a/src/client/views/nodes/PresBox.tsx +++ b/src/client/views/nodes/PresBox.tsx @@ -297,7 +297,6 @@ export class PresBox extends ViewBoxBaseComponent (this.layoutDoc.forceActive || this.props.isSelected(outsideReaction) || this._isChildActive || this.props.renderDepth === 0) ? true : false) render() { - // console.log("render = " + this.layoutDoc.title + " " + this.layoutDoc.presStatus); // const presOrderedDocs = DocListCast(this.rootDoc.presOrderedDocs); // if (presOrderedDocs.length != this.childDocs.length || presOrderedDocs.some((pd, i) => pd !== this.childDocs[i])) { // this.rootDoc.presOrderedDocs = new List(this.childDocs.slice()); diff --git a/src/client/views/nodes/RadialMenu.tsx b/src/client/views/nodes/RadialMenu.tsx index a3ac09a11..7f0956e51 100644 --- a/src/client/views/nodes/RadialMenu.tsx +++ b/src/client/views/nodes/RadialMenu.tsx @@ -89,7 +89,6 @@ export class RadialMenu extends React.Component { @action componentDidMount = () => { - console.log(this._pageX); document.addEventListener("pointerdown", this.onPointerDown); document.addEventListener("pointerup", this.onPointerUp); this.previewcircle(); diff --git a/src/client/views/nodes/ScreenshotBox.tsx b/src/client/views/nodes/ScreenshotBox.tsx index f7dee0896..1cd29d795 100644 --- a/src/client/views/nodes/ScreenshotBox.tsx +++ b/src/client/views/nodes/ScreenshotBox.tsx @@ -112,7 +112,7 @@ export class ScreenshotBox extends ViewBoxBaseComponent([]); } catch (e) { - console.log("Error in URL :" + this._url); + console.log("WebBox URL error:" + this._url); } } diff --git a/src/client/views/nodes/formattedText/DashDocView.tsx b/src/client/views/nodes/formattedText/DashDocView.tsx index 5c3f3dcc9..212da3f3d 100644 --- a/src/client/views/nodes/formattedText/DashDocView.tsx +++ b/src/client/views/nodes/formattedText/DashDocView.tsx @@ -209,7 +209,7 @@ export class DashDocView extends React.Component { try { // bcz: an exception will be thrown if two aliases are open at the same time when a doc view comment is made view.dispatch(view.state.tr.setNodeMarkup(getPos(), null, { ...node.attrs, width: dashDoc._width + "px", height: dashDoc._height + "px" })); } catch (e) { - console.log(e); + console.log("DashDocView:" + e); } } diff --git a/src/client/views/nodes/formattedText/RichTextSchema.tsx b/src/client/views/nodes/formattedText/RichTextSchema.tsx index 7a50ec3af..33a080fe4 100644 --- a/src/client/views/nodes/formattedText/RichTextSchema.tsx +++ b/src/client/views/nodes/formattedText/RichTextSchema.tsx @@ -170,7 +170,7 @@ export class DashDocView { } } } catch (e) { - console.log(e); + console.log("RichTextSchema: " + e); } } }; diff --git a/src/client/views/search/FilterBox.tsx b/src/client/views/search/FilterBox.tsx index 4b53963a5..eb61f9a14 100644 --- a/src/client/views/search/FilterBox.tsx +++ b/src/client/views/search/FilterBox.tsx @@ -352,7 +352,6 @@ export class FilterBox extends React.Component { getDataStatus() { return this._deletedDocsStatus; } getActiveFilters() { - console.log(this._authorFieldStatus, this._titleFieldStatus, this._dataFieldStatus); return (
{!this._basicWordStatus ?
diff --git a/src/client/views/search/SearchBox.tsx b/src/client/views/search/SearchBox.tsx index c9d29e485..99fa6da21 100644 --- a/src/client/views/search/SearchBox.tsx +++ b/src/client/views/search/SearchBox.tsx @@ -125,7 +125,7 @@ export class SearchBox extends React.Component { return returnedUri; } catch (e) { - console.log(e); + console.log("SearchBox:" + e); } } @@ -582,7 +582,6 @@ export class SearchBox extends React.Component { } expandSection(thing: string) { - console.log("expand"); const element = document.getElementById(thing)!; // get the height of the element's inner content, regardless of its actual size const sectionHeight = element.scrollHeight; @@ -593,7 +592,6 @@ export class SearchBox extends React.Component { // when the next css transition finishes (which should be the one we just triggered) element.addEventListener('transitionend', function handler(e) { // remove this event listener so it only gets triggered once - console.log("autoset"); element.removeEventListener('transitionend', handler); // remove "height" from the element's inline styles, so it can return to its initial value @@ -608,7 +606,6 @@ export class SearchBox extends React.Component { autoset(thing: string) { const element = document.getElementById(thing)!; - console.log("autoset"); element.removeEventListener('transitionend', function (e) { }); // remove "height" from the element's inline styles, so it can return to its initial value diff --git a/src/client/views/search/ToggleBar.tsx b/src/client/views/search/ToggleBar.tsx index e4d7f2fd5..466822eba 100644 --- a/src/client/views/search/ToggleBar.tsx +++ b/src/client/views/search/ToggleBar.tsx @@ -58,7 +58,6 @@ export class ToggleBar extends React.Component{ this._forwardTimeline.play(); this._forwardTimeline.reverse(); this.props.handleChange(); - console.log(this.props.getStatus()); } @action.bound diff --git a/src/fields/Doc.ts b/src/fields/Doc.ts index 917a6853c..7e91a7761 100644 --- a/src/fields/Doc.ts +++ b/src/fields/Doc.ts @@ -566,7 +566,6 @@ export namespace Doc { export async function Zip(doc: Doc) { const { clone, map } = await Doc.MakeClone(doc, true); function replacer(key: any, value: any) { - console.log("Checkin: " + key); if (["cloneOf", "context", "cursors"].includes(key)) return undefined; else if (value instanceof Doc) { if (key !== "field" && Number.isNaN(Number(key))) { diff --git a/src/fields/ScriptField.ts b/src/fields/ScriptField.ts index 4604a2132..bd08b2f32 100644 --- a/src/fields/ScriptField.ts +++ b/src/fields/ScriptField.ts @@ -53,7 +53,6 @@ async function deserializeScript(script: ScriptField) { if (script.script.originalScript === 'convertToButtons(dragData)') { return (script as any).script = (ScriptField.ConvertToButtons ?? (ScriptField.ConvertToButtons = ComputedField.MakeFunction('convertToButtons(dragData)', { dragData: "DocumentDragData" })))?.script; } - console.log(script.script.originalScript); const captures: ProxyField = (script as any).captures; if (captures) { const doc = (await captures.value())!; diff --git a/src/fields/util.ts b/src/fields/util.ts index 20b072786..ef66d9633 100644 --- a/src/fields/util.ts +++ b/src/fields/util.ts @@ -35,7 +35,6 @@ export namespace Plugins { } const _setterImpl = action(function (target: any, prop: string | symbol | number, value: any, receiver: any): boolean { - //console.log("-set " + target[SelfProxy].title + "(" + target[SelfProxy][prop] + ")." + prop.toString() + " = " + value); if (SerializationHelper.IsSerializing()) { target[prop] = value; return true; diff --git a/src/server/Recommender.ts b/src/server/Recommender.ts index 423ce9b46..935ec3871 100644 --- a/src/server/Recommender.ts +++ b/src/server/Recommender.ts @@ -21,7 +21,6 @@ // private choice: string = ""; // Tensorflow or Word2Vec // constructor() { -// console.log("creating recommender..."); // Recommender.Instance = this; // } @@ -70,7 +69,6 @@ // if (this._model) { // if (this.choice === "WV") { // let similarity = this._model.similarity('father', 'mother'); -// console.log(similarity); // } // else if (this.choice === "TF") { // const model = this._model as use.UniversalSentenceEncoder; @@ -119,7 +117,6 @@ // } // // public async trainModel() { -// // console.log("phrasing..."); // // w2v.word2vec("./node_modules/word2vec/examples/eng_news-typical_2016_1M-sentences.txt", './node_modules/word2vec/examples/my_phrases.txt', { // // cbow: 1, // // size: 200, @@ -131,7 +128,6 @@ // // iter: 200, // // minCount: 2 // // }); -// // console.log("phrased!!!"); // // } // } diff --git a/src/server/downsize.ts b/src/server/downsize.ts index cd0d83812..5cd709fa3 100644 --- a/src/server/downsize.ts +++ b/src/server/downsize.ts @@ -7,7 +7,7 @@ const jpgTypes = ["jpg", "JPG", "jpeg", "JPEG"]; const smallResizer = sharp().resize(100); fs.readdir(folder, async (err, files) => { if (err) { - console.log(err); + console.log("readdir:" + err); return; } // files.forEach(file => { -- cgit v1.2.3-70-g09d2