From 632dec95b9fccccef13b50cb41fc598613a9df1e Mon Sep 17 00:00:00 2001 From: yunahi <60233430+yunahi@users.noreply.github.com> Date: Mon, 8 Jun 2020 10:56:36 +0900 Subject: added ink options menu --- src/client/util/InteractionUtils.tsx | 139 ++++++++++++++++++++++++++++++++++- 1 file changed, 137 insertions(+), 2 deletions(-) (limited to 'src/client/util') diff --git a/src/client/util/InteractionUtils.tsx b/src/client/util/InteractionUtils.tsx index 3a5345c80..ab1ccb25a 100644 --- a/src/client/util/InteractionUtils.tsx +++ b/src/client/util/InteractionUtils.tsx @@ -1,4 +1,7 @@ import React = require("react"); +import * as beziercurve from 'bezier-curve'; +import * as fitCurve from 'fit-curve'; +import InkOptionsMenu from "../views/collections/collectionFreeForm/InkOptionsMenu"; export namespace InteractionUtils { export const MOUSETYPE = "mouse"; @@ -87,8 +90,45 @@ export namespace InteractionUtils { return myTouches; } - export function CreatePolyline(points: { X: number, Y: number }[], left: number, top: number, color: string, width: string) { - const pts = points.reduce((acc: string, pt: { X: number, Y: number }) => acc + `${pt.X - left},${pt.Y - top} `, ""); + export function CreatePolyline(points: { X: number, Y: number }[], left: number, top: number, color: string, width: string, bezier: string) { + var pts = ""; + var shape = ""; + if (InkOptionsMenu.Instance._circle) { + shape = "circle"; + } else if (InkOptionsMenu.Instance._rectangle) { + shape = "rectangle"; + } else if (InkOptionsMenu.Instance._triangle) { + shape = "triangle"; + } else if (InkOptionsMenu.Instance._arrow) { + shape = "arrow"; + } else if (InkOptionsMenu.Instance._line) { + shape = "line"; + } + if (shape !== "") { + //if any of the shape are true + const shapePts = makePolygon(shape, points); + pts = shapePts.reduce((acc: string, pt: { X: number, Y: number }) => acc + `${pt.X - left},${pt.Y - top} `, ""); + } + else if (points.length > 1 && points[points.length - 1].X === points[0].X && points[points.length - 1].Y === points[0].Y) { + //pointer is up (first and last points are the same) + const newPoints: number[][] = []; + const newPts: { X: number; Y: number; }[] = []; + //convert to [][] for fitcurve module + for (var i = 0; i < points.length - 1; i++) { + newPoints.push([points[i].X, points[i].Y]); + } + const bezierCurves = fitCurve(newPoints, parseInt(bezier)); + for (var i = 0; i < bezierCurves.length; i++) { + for (var t = 0; t < 1; t += 0.01) { + const point = beziercurve(t, bezierCurves[i]); + newPts.push({ X: point[0], Y: point[1] }); + } + } + pts = newPts.reduce((acc: string, pt: { X: number, Y: number }) => acc + `${pt.X - left},${pt.Y - top} `, ""); + } else { + //in the middle of drawing + pts = points.reduce((acc: string, pt: { X: number, Y: number }) => acc + `${pt.X - left},${pt.Y - top} `, ""); + } return ( 1 && points[points.length - 1].X === points[0].X && points[points.length - 1].Y + 1 === points[0].Y) { + //pointer is up (first and last points are the same) + if (shape === "arrow" || shape === "line") { + //if arrow or line, the two end points should be the starting and the ending point + var left = points[0].X; + var top = points[0].Y; + var right = points[1].X; + var bottom = points[1].Y; + } else { + //otherwise take max and min + const xs = points.map(p => p.X); + const ys = points.map(p => p.Y); + right = Math.max(...xs); + left = Math.min(...xs); + bottom = Math.max(...ys); + top = Math.min(...ys); + } + } else { + //if in the middle of drawing + //take first and last points + right = points[points.length - 1].X; + left = points[0].X; + bottom = points[points.length - 1].Y; + top = points[0].Y; + if (shape !== "arrow" && shape !== "line") { + //switch left/right and top/bottom if needed + if (left > right) { + const temp = right; + right = left; + left = temp; + } + if (top > bottom) { + const temp = top; + top = bottom; + bottom = temp; + } + } + } + points = []; + switch (shape) { + case "rectangle": + points.push({ X: left, Y: top }); + points.push({ X: right, Y: top }); + points.push({ X: right, Y: bottom }); + points.push({ X: left, Y: bottom }); + points.push({ X: left, Y: top }); + return points; + case "triangle": + points.push({ X: left, Y: bottom }); + points.push({ X: right, Y: bottom }); + points.push({ X: (right + left) / 2, Y: top }); + points.push({ X: left, Y: bottom }); + return points; + case "circle": + const centerX = (right + left) / 2; + const centerY = (bottom + top) / 2; + const radius = bottom - centerY; + for (var y = top; y < bottom; y++) { + const x = Math.sqrt(Math.pow(radius, 2) - (Math.pow((y - centerY), 2))) + centerX; + points.push({ X: x, Y: y }); + } + for (var y = bottom; y > top; y--) { + const x = Math.sqrt(Math.pow(radius, 2) - (Math.pow((y - centerY), 2))) + centerX; + const newX = centerX - (x - centerX); + points.push({ X: newX, Y: y }); + } + points.push({ X: Math.sqrt(Math.pow(radius, 2) - (Math.pow((top - centerY), 2))) + centerX, Y: top }); + return points; + case "arrow": + const x1 = left; + const y1 = top; + const x2 = right; + const y2 = bottom; + const L1 = Math.sqrt(Math.pow(Math.abs(x1 - x2), 2) + (Math.pow(Math.abs(y1 - y2), 2))); + const L2 = L1 / 5; + const angle = 0.785398; + const x3 = x2 + (L2 / L1) * ((x1 - x2) * Math.cos(angle) + (y1 - y2) * Math.sin(angle)); + const y3 = y2 + (L2 / L1) * ((y1 - y2) * Math.cos(angle) - (x1 - x2) * Math.sin(angle)); + const x4 = x2 + (L2 / L1) * ((x1 - x2) * Math.cos(angle) - (y1 - y2) * Math.sin(angle)); + const y4 = y2 + (L2 / L1) * ((y1 - y2) * Math.cos(angle) + (x1 - x2) * Math.sin(angle)); + points.push({ X: x1, Y: y1 }); + points.push({ X: x2, Y: y2 }); + points.push({ X: x3, Y: y3 }); + points.push({ X: x4, Y: y4 }); + points.push({ X: x2, Y: y2 }); + return points; + case "line": + points.push({ X: left, Y: top }); + points.push({ X: right, Y: bottom }); + return points; + default: + return points; + } + } /** * Returns whether or not the pointer event passed in is of the type passed in * @param e - pointer event. this event could be from a mouse, a pen, or a finger -- cgit v1.2.3-70-g09d2 From 3dea269077151542bc2450bccd749ede87681556 Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Mon, 8 Jun 2020 14:18:11 -0400 Subject: a bunch of cleanup to fix import order and to organize/restructure ink things in the right places. --- package-lock.json | 46 +- src/client/apis/youtube/YoutubeBox.tsx | 7 +- src/client/cognitive_services/CognitiveServices.ts | 3 +- src/client/documents/Documents.ts | 495 +++++++++++---------- src/client/util/CurrentUserUtils.ts | 8 +- src/client/util/DragManager.ts | 2 +- .../util/Import & Export/DirectoryImportBox.tsx | 4 +- src/client/util/Import & Export/ImageUtils.ts | 2 +- src/client/util/InteractionUtils.tsx | 23 +- src/client/views/AntimodeMenu.tsx | 1 - src/client/views/DocComponent.tsx | 8 +- src/client/views/GestureOverlay.tsx | 83 ++-- src/client/views/InkingControl.tsx | 109 +---- src/client/views/InkingStroke.tsx | 45 +- src/client/views/PreviewCursor.tsx | 4 +- src/client/views/Touchable.tsx | 2 - src/client/views/collections/CollectionMapView.tsx | 2 +- src/client/views/collections/CollectionSubView.tsx | 25 +- .../views/collections/CollectionTreeView.tsx | 2 +- src/client/views/collections/CollectionView.tsx | 42 +- .../collectionFreeForm/CollectionFreeFormView.tsx | 17 +- .../collectionFreeForm/InkOptionsMenu.tsx | 283 +++--------- src/client/views/nodes/ColorBox.tsx | 50 ++- src/client/views/nodes/DocumentView.tsx | 13 +- src/client/views/nodes/ImageBox.tsx | 2 +- src/client/views/nodes/PresBox.tsx | 4 +- src/client/views/nodes/ScreenshotBox.tsx | 12 +- src/client/views/nodes/VideoBox.tsx | 7 +- src/client/views/nodes/WebBox.tsx | 3 +- .../views/nodes/formattedText/FormattedTextBox.tsx | 12 +- src/client/views/pdf/PDFViewer.tsx | 6 +- src/client/views/webcam/DashWebRTCVideo.tsx | 4 +- src/fields/Doc.ts | 322 ++++++-------- src/pen-gestures/GestureUtils.ts | 10 +- 34 files changed, 701 insertions(+), 957 deletions(-) (limited to 'src/client/util') diff --git a/package-lock.json b/package-lock.json index b3fb00ab6..c956fd3e9 100644 --- a/package-lock.json +++ b/package-lock.json @@ -2832,8 +2832,7 @@ }, "ansi-regex": { "version": "2.1.1", - "bundled": true, - "optional": true + "bundled": true }, "aproba": { "version": "1.2.0", @@ -2851,13 +2850,11 @@ }, "balanced-match": { "version": "1.0.0", - "bundled": true, - "optional": true + "bundled": true }, "brace-expansion": { "version": "1.1.11", "bundled": true, - "optional": true, "requires": { "balanced-match": "^1.0.0", "concat-map": "0.0.1" @@ -2870,18 +2867,15 @@ }, "code-point-at": { "version": "1.1.0", - "bundled": true, - "optional": true + "bundled": true }, "concat-map": { "version": "0.0.1", - "bundled": true, - "optional": true + "bundled": true }, "console-control-strings": { "version": "1.1.0", - "bundled": true, - "optional": true + "bundled": true }, "core-util-is": { "version": "1.0.2", @@ -2984,8 +2978,7 @@ }, "inherits": { "version": "2.0.4", - "bundled": true, - "optional": true + "bundled": true }, "ini": { "version": "1.3.5", @@ -2995,7 +2988,6 @@ "is-fullwidth-code-point": { "version": "1.0.0", "bundled": true, - "optional": true, "requires": { "number-is-nan": "^1.0.0" } @@ -3008,20 +3000,17 @@ "minimatch": { "version": "3.0.4", "bundled": true, - "optional": true, "requires": { "brace-expansion": "^1.1.7" } }, "minimist": { "version": "1.2.5", - "bundled": true, - "optional": true + "bundled": true }, "minipass": { "version": "2.9.0", "bundled": true, - "optional": true, "requires": { "safe-buffer": "^5.1.2", "yallist": "^3.0.0" @@ -3038,7 +3027,6 @@ "mkdirp": { "version": "0.5.3", "bundled": true, - "optional": true, "requires": { "minimist": "^1.2.5" } @@ -3094,8 +3082,7 @@ }, "npm-normalize-package-bin": { "version": "1.0.1", - "bundled": true, - "optional": true + "bundled": true }, "npm-packlist": { "version": "1.4.8", @@ -3120,8 +3107,7 @@ }, "number-is-nan": { "version": "1.0.1", - "bundled": true, - "optional": true + "bundled": true }, "object-assign": { "version": "4.1.1", @@ -3131,7 +3117,6 @@ "once": { "version": "1.4.0", "bundled": true, - "optional": true, "requires": { "wrappy": "1" } @@ -3200,8 +3185,7 @@ }, "safe-buffer": { "version": "5.1.2", - "bundled": true, - "optional": true + "bundled": true }, "safer-buffer": { "version": "2.1.2", @@ -3231,7 +3215,6 @@ "string-width": { "version": "1.0.2", "bundled": true, - "optional": true, "requires": { "code-point-at": "^1.0.0", "is-fullwidth-code-point": "^1.0.0", @@ -3249,7 +3232,6 @@ "strip-ansi": { "version": "3.0.1", "bundled": true, - "optional": true, "requires": { "ansi-regex": "^2.0.0" } @@ -3288,13 +3270,11 @@ }, "wrappy": { "version": "1.0.2", - "bundled": true, - "optional": true + "bundled": true }, "yallist": { "version": "3.1.1", - "bundled": true, - "optional": true + "bundled": true } } } @@ -18074,4 +18054,4 @@ } } } -} \ No newline at end of file +} diff --git a/src/client/apis/youtube/YoutubeBox.tsx b/src/client/apis/youtube/YoutubeBox.tsx index ce7f49e64..a7045ccb7 100644 --- a/src/client/apis/youtube/YoutubeBox.tsx +++ b/src/client/apis/youtube/YoutubeBox.tsx @@ -6,7 +6,6 @@ import { Utils } from "../../../Utils"; import { DocServer } from "../../DocServer"; import { Docs } from "../../documents/Documents"; import { DocumentDecorations } from "../../views/DocumentDecorations"; -import { InkingControl } from "../../views/InkingControl"; import { FieldView, FieldViewProps } from "../../views/nodes/FieldView"; import "../../views/nodes/WebBox.scss"; import "./YoutubeBox.scss"; @@ -156,14 +155,14 @@ export class YoutubeBox extends React.Component { @action processVideoDetails = (videoDetails: any[]) => { this.videoDetails = videoDetails; - this.props.Document.cachedDetails = Docs.Get.FromJson({ data: videoDetails, title: "detailBackUp" }); + this.props.Document.cachedDetails = Doc.Get.FromJson({ data: videoDetails, title: "detailBackUp" }); } /** * The function that stores the search results in the props document. */ backUpSearchResults = (videos: any[]) => { - this.props.Document.cachedSearchResults = Docs.Get.FromJson({ data: videos, title: "videosBackUp" }); + this.props.Document.cachedSearchResults = Doc.Get.FromJson({ data: videos, title: "videosBackUp" }); } /** @@ -350,7 +349,7 @@ export class YoutubeBox extends React.Component { const frozen = !this.props.isSelected() || DocumentDecorations.Instance.Interacting; - const classname = "webBox-cont" + (this.props.isSelected() && !InkingControl.Instance.selectedTool && !DocumentDecorations.Instance.Interacting ? "-interactive" : ""); + const classname = "webBox-cont" + (this.props.isSelected() && !Doc.selectedTool && !DocumentDecorations.Instance.Interacting ? "-interactive" : ""); return ( <>
diff --git a/src/client/cognitive_services/CognitiveServices.ts b/src/client/cognitive_services/CognitiveServices.ts index b816d1617..6b0b3e029 100644 --- a/src/client/cognitive_services/CognitiveServices.ts +++ b/src/client/cognitive_services/CognitiveServices.ts @@ -1,7 +1,6 @@ import * as request from "request-promise"; import { Doc, Field } from "../../fields/Doc"; import { Cast } from "../../fields/Types"; -import { Docs } from "../documents/Documents"; import { Utils } from "../../Utils"; import { InkData } from "../../fields/InkField"; import { UndoManager } from "../util/UndoManager"; @@ -195,7 +194,7 @@ export namespace CognitiveServices { let results = await ExecuteQuery(Service.Handwriting, Manager, inkData); if (results) { results.recognitionUnits && (results = results.recognitionUnits); - target[keys[0]] = Docs.Get.FromJson({ data: results, title: "Ink Analysis" }); + target[keys[0]] = Doc.Get.FromJson({ data: results, title: "Ink Analysis" }); const recognizedText = results.map((item: any) => item.recognizedText); const recognizedObjects = results.map((item: any) => item.recognizedObject); const individualWords = recognizedText.filter((text: string) => text && text.split(" ").length === 1); diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts index 71bf8a516..994f8a147 100644 --- a/src/client/documents/Documents.ts +++ b/src/client/documents/Documents.ts @@ -9,11 +9,11 @@ import { ScriptingBox } from "../views/nodes/ScriptingBox"; import { VideoBox } from "../views/nodes/VideoBox"; import { WebBox } from "../views/nodes/WebBox"; import { OmitKeys, JSONUtils, Utils } from "../../Utils"; -import { Field, Doc, Opt, DocListCastAsync, FieldResult, DocListCast } from "../../fields/Doc"; +import { Field, Doc, Opt, DocListCastAsync, FieldResult, DocListCast, HeightSym, WidthSym } from "../../fields/Doc"; import { ImageField, VideoField, AudioField, PdfField, WebField, YoutubeField } from "../../fields/URLField"; import { HtmlField } from "../../fields/HtmlField"; import { List } from "../../fields/List"; -import { Cast, NumCast, StrCast } from "../../fields/Types"; +import { Cast, NumCast, StrCast, FieldValue } from "../../fields/Types"; import { DocServer } from "../DocServer"; import { dropActionType } from "../util/DragManager"; import { DateField } from "../../fields/DateField"; @@ -36,11 +36,9 @@ import { PresElementBox } from "../views/presentationview/PresElementBox"; import { DashWebRTCVideo } from "../views/webcam/DashWebRTCVideo"; import { QueryBox } from "../views/nodes/QueryBox"; import { ColorBox } from "../views/nodes/ColorBox"; -import { LinkAnchorBox } from "../views/nodes/LinkAnchorBox"; import { DocHolderBox } from "../views/nodes/DocHolderBox"; import { InkingStroke } from "../views/InkingStroke"; import { InkField } from "../../fields/InkField"; -import { InkingControl } from "../views/InkingControl"; import { RichTextField } from "../../fields/RichTextField"; import { extname } from "path"; import { MessageStore } from "../../server/Message"; @@ -49,6 +47,12 @@ import { ContextMenu } from "../views/ContextMenu"; import { LinkBox } from "../views/nodes/LinkBox"; import { ScreenshotBox } from "../views/nodes/ScreenshotBox"; import { ComparisonBox } from "../views/nodes/ComparisonBox"; +import { Id } from "../../fields/FieldSymbols"; +import { listSpec } from "../../fields/Schema"; +import { ObjectField } from "../../fields/ObjectField"; +import { RefField } from "../../fields/RefField"; +import { runInAction } from "mobx"; +import { UndoManager } from "../util/UndoManager"; const path = require('path'); export interface DocumentOptions { @@ -455,7 +459,7 @@ export namespace Docs { const doc = StackingDocument(deviceImages, { title, _LODdisable: true, hero: new ImageField(constructed[0].url) }); doc.nameAliases = new List([title.toLowerCase()]); // add the parsed attributes to this main document - Docs.Get.FromJson({ data: device, appendToExisting: { targetDoc: Doc.GetProto(doc) } }); + Doc.Get.FromJson({ data: device, appendToExisting: { targetDoc: Doc.GetProto(doc) } }); Doc.AddDocToList(parentProto, "data", doc); } else if (errors) { console.log(errors); @@ -777,225 +781,6 @@ export namespace Docs { return InstanceFromProto(proto, undefined, options); } } - - export namespace Get { - - const primitives = ["string", "number", "boolean"]; - - export interface JsonConversionOpts { - data: any; - title?: string; - appendToExisting?: { targetDoc: Doc, fieldKey?: string }; - excludeEmptyObjects?: boolean; - } - - const defaultKey = "json"; - - /** - * This function takes any valid JSON(-like) data, i.e. parsed or unparsed, and at arbitrarily - * deep levels of nesting, converts the data and structure into nested documents with the appropriate fields. - * - * After building a hierarchy within / below a top-level document, it then returns that top-level parent. - * - * If we've received a string, treat it like valid JSON and try to parse it into an object. If this fails, the - * string is invalid JSON, so we should assume that the input is the result of a JSON.parse() - * call that returned a regular string value to be stored as a Field. - * - * If we've received something other than a string, since the caller might also pass in the results of a - * JSON.parse() call, valid input might be an object, an array (still typeof object), a boolean or a number. - * Anything else (like a function, etc. passed in naively as any) is meaningless for this operation. - * - * All TS/JS objects get converted directly to documents, directly preserving the key value structure. Everything else, - * lacking the key value structure, gets stored as a field in a wrapper document. - * - * @param data for convenience and flexibility, either a valid JSON string to be parsed, - * or the result of any JSON.parse() call. - * @param title an optional title to give to the highest parent document in the hierarchy. - * If whether this function creates a new document or appendToExisting is specified and that document already has a title, - * because this title field can be left undefined for the opposite behavior, including a title will overwrite the existing title. - * @param appendToExisting **if specified**, there are two cases, both of which return the target document: - * - * 1) the json to be converted can be represented as a document, in which case the target document will act as the root - * of the tree and receive all the conversion results as new fields on itself - * 2) the json can't be represented as a document, in which case the function will assign the field-level conversion - * results to either the specified key on the target document, or to its "json" key by default. - * - * If not specified, the function creates and returns a new entirely generic document (different from the Doc.Create calls) - * to act as the root of the tree. - * - * One might choose to specify this field if you want to write to a document returned from a Document.Create function call, - * say a TreeView document that will be rendered, not just an untyped, identityless doc that would otherwise be created - * from a default call to new Doc. - * - * @param excludeEmptyObjects whether non-primitive objects (TypeScript objects and arrays) should be converted even - * if they contain no data. By default, empty objects and arrays are ignored. - */ - export function FromJson({ data, title, appendToExisting, excludeEmptyObjects }: JsonConversionOpts): Opt { - if (excludeEmptyObjects === undefined) { - excludeEmptyObjects = true; - } - if (data === undefined || data === null || ![...primitives, "object"].includes(typeof data)) { - return undefined; - } - let resolved: any; - try { - resolved = JSON.parse(typeof data === "string" ? data : JSON.stringify(data)); - } catch (e) { - return undefined; - } - let output: Opt; - if (typeof resolved === "object" && !(resolved instanceof Array)) { - output = convertObject(resolved, excludeEmptyObjects, title, appendToExisting?.targetDoc); - } else { - const result = toField(resolved, excludeEmptyObjects); - if (appendToExisting) { - (output = appendToExisting.targetDoc)[appendToExisting.fieldKey || defaultKey] = result; - } else { - (output = new Doc).json = result; - } - } - title && output && (output.title = title); - return output; - } - - /** - * For each value of the object, recursively convert it to its appropriate field value - * and store the field at the appropriate key in the document if it is not undefined - * @param object the object to convert - * @returns the object mapped from JSON to field values, where each mapping - * might involve arbitrary recursion (since toField might itself call convertObject) - */ - const convertObject = (object: any, excludeEmptyObjects: boolean, title?: string, target?: Doc): Opt => { - const hasEntries = Object.keys(object).length; - if (hasEntries || !excludeEmptyObjects) { - const resolved = target ?? new Doc; - if (hasEntries) { - let result: Opt; - Object.keys(object).map(key => { - // if excludeEmptyObjects is true, any qualifying conversions from toField will - // be undefined, and thus the results that would have - // otherwise been empty (List or Doc)s will just not be written - if (result = toField(object[key], excludeEmptyObjects, key)) { - resolved[key] = result; - } - }); - } - title && (resolved.title = title); - return resolved; - } - }; - - /** - * For each element in the list, recursively convert it to a document or other field - * and push the field to the list if it is not undefined - * @param list the list to convert - * @returns the list mapped from JSON to field values, where each mapping - * might involve arbitrary recursion (since toField might itself call convertList) - */ - const convertList = (list: Array, excludeEmptyObjects: boolean): Opt> => { - const target = new List(); - let result: Opt; - // if excludeEmptyObjects is true, any qualifying conversions from toField will - // be undefined, and thus the results that would have - // otherwise been empty (List or Doc)s will just not be written - list.map(item => (result = toField(item, excludeEmptyObjects)) && target.push(result)); - if (target.length || !excludeEmptyObjects) { - return target; - } - }; - - const toField = (data: any, excludeEmptyObjects: boolean, title?: string): Opt => { - if (data === null || data === undefined) { - return undefined; - } - if (primitives.includes(typeof data)) { - return data; - } - if (typeof data === "object") { - return data instanceof Array ? convertList(data, excludeEmptyObjects) : convertObject(data, excludeEmptyObjects, title, undefined); - } - throw new Error(`How did ${data} of type ${typeof data} end up in JSON?`); - }; - - export function DocumentFromField(target: Doc, fieldKey: string, proto?: Doc, options?: DocumentOptions): Doc | undefined { - let created: Doc | undefined; - let layout: ((fieldKey: string) => string) | undefined; - const field = target[fieldKey]; - const resolved = options || {}; - if (field instanceof ImageField) { - created = Docs.Create.ImageDocument((field).url.href, resolved); - layout = ImageBox.LayoutString; - } else if (field instanceof Doc) { - created = field; - } else if (field instanceof VideoField) { - created = Docs.Create.VideoDocument((field).url.href, resolved); - layout = VideoBox.LayoutString; - } else if (field instanceof PdfField) { - created = Docs.Create.PdfDocument((field).url.href, resolved); - layout = PDFBox.LayoutString; - } else if (field instanceof AudioField) { - created = Docs.Create.AudioDocument((field).url.href, resolved); - layout = AudioBox.LayoutString; - } else if (field instanceof InkField) { - const { selectedColor, selectedWidth, selectedTool, selectedBezier } = InkingControl.Instance; - created = Docs.Create.InkDocument(selectedColor, selectedTool, selectedWidth, selectedBezier, (field).inkData, resolved); - layout = InkingStroke.LayoutString; - } else if (field instanceof List && field[0] instanceof Doc) { - created = Docs.Create.StackingDocument(DocListCast(field), resolved); - layout = CollectionView.LayoutString; - } else { - created = Docs.Create.TextDocument("", { ...{ _width: 200, _height: 25, _autoHeight: true }, ...resolved }); - layout = FormattedTextBox.LayoutString; - } - if (created) { - created.layout = layout?.(fieldKey); - created.title = fieldKey; - proto && created.proto && (created.proto = Doc.GetProto(proto)); - } - return created; - } - - export async function DocumentFromType(type: string, path: string, options: DocumentOptions): Promise> { - let ctor: ((path: string, options: DocumentOptions) => (Doc | Promise)) | undefined = undefined; - if (type.indexOf("image") !== -1) { - ctor = Docs.Create.ImageDocument; - if (!options._width) options._width = 300; - } - if (type.indexOf("video") !== -1) { - ctor = Docs.Create.VideoDocument; - if (!options._width) options._width = 600; - if (!options._height) options._height = options._width * 2 / 3; - } - if (type.indexOf("audio") !== -1) { - ctor = Docs.Create.AudioDocument; - } - if (type.indexOf("pdf") !== -1) { - ctor = Docs.Create.PdfDocument; - if (!options._width) options._width = 400; - if (!options._height) options._height = options._width * 1200 / 927; - } - if (type.indexOf("html") !== -1) { - if (path.includes(window.location.hostname)) { - const s = path.split('/'); - const id = s[s.length - 1]; - return DocServer.GetRefField(id).then(field => { - if (field instanceof Doc) { - const alias = Doc.MakeAlias(field); - alias.x = options.x || 0; - alias.y = options.y || 0; - alias._width = options._width || 300; - alias._height = options._height || options._width || 300; - return alias; - } - return undefined; - }); - } - ctor = Docs.Create.WebDocument; - options = { ...options, _nativeWidth: 850, _nativeHeight: 962, _width: 500, _height: 566, title: path, }; - } - return ctor ? ctor(path, options) : undefined; - } - } } export namespace DocUtils { @@ -1049,6 +834,155 @@ export namespace DocUtils { return linkDoc; } + + export function DocumentFromField(target: Doc, fieldKey: string, proto?: Doc, options?: DocumentOptions): Doc | undefined { + let created: Doc | undefined; + let layout: ((fieldKey: string) => string) | undefined; + const field = target[fieldKey]; + const resolved = options || {}; + if (field instanceof ImageField) { + created = Docs.Create.ImageDocument((field).url.href, resolved); + layout = ImageBox.LayoutString; + } else if (field instanceof Doc) { + created = field; + } else if (field instanceof VideoField) { + created = Docs.Create.VideoDocument((field).url.href, resolved); + layout = VideoBox.LayoutString; + } else if (field instanceof PdfField) { + created = Docs.Create.PdfDocument((field).url.href, resolved); + layout = PDFBox.LayoutString; + } else if (field instanceof AudioField) { + created = Docs.Create.AudioDocument((field).url.href, resolved); + layout = AudioBox.LayoutString; + } else if (field instanceof InkField) { + created = Docs.Create.InkDocument(InkingStroke.InkColor, Doc.selectedTool, InkingStroke.InkWidth, InkingStroke.InkBezierApprox, (field).inkData, resolved); + layout = InkingStroke.LayoutString; + } else if (field instanceof List && field[0] instanceof Doc) { + created = Docs.Create.StackingDocument(DocListCast(field), resolved); + layout = CollectionView.LayoutString; + } else { + created = Docs.Create.TextDocument("", { ...{ _width: 200, _height: 25, _autoHeight: true }, ...resolved }); + layout = FormattedTextBox.LayoutString; + } + if (created) { + created.layout = layout?.(fieldKey); + created.title = fieldKey; + proto && created.proto && (created.proto = Doc.GetProto(proto)); + } + return created; + } + + export async function DocumentFromType(type: string, path: string, options: DocumentOptions): Promise> { + let ctor: ((path: string, options: DocumentOptions) => (Doc | Promise)) | undefined = undefined; + if (type.indexOf("image") !== -1) { + ctor = Docs.Create.ImageDocument; + if (!options._width) options._width = 300; + } + if (type.indexOf("video") !== -1) { + ctor = Docs.Create.VideoDocument; + if (!options._width) options._width = 600; + if (!options._height) options._height = options._width * 2 / 3; + } + if (type.indexOf("audio") !== -1) { + ctor = Docs.Create.AudioDocument; + } + if (type.indexOf("pdf") !== -1) { + ctor = Docs.Create.PdfDocument; + if (!options._width) options._width = 400; + if (!options._height) options._height = options._width * 1200 / 927; + } + if (type.indexOf("html") !== -1) { + if (path.includes(window.location.hostname)) { + const s = path.split('/'); + const id = s[s.length - 1]; + return DocServer.GetRefField(id).then(field => { + if (field instanceof Doc) { + const alias = Doc.MakeAlias(field); + alias.x = options.x || 0; + alias.y = options.y || 0; + alias._width = options._width || 300; + alias._height = options._height || options._width || 300; + return alias; + } + return undefined; + }); + } + ctor = Docs.Create.WebDocument; + options = { ...options, _nativeWidth: 850, _nativeHeight: 962, _width: 500, _height: 566, title: path, }; + } + return ctor ? ctor(path, options) : undefined; + } + + export function makeClone(doc: Doc, cloneMap: Map, rtfs: { copy: Doc, key: string, field: RichTextField }[]): Doc { + if (Doc.IsBaseProto(doc)) return doc; + if (cloneMap.get(doc[Id])) return cloneMap.get(doc[Id])!; + const copy = new Doc(undefined, true); + cloneMap.set(doc[Id], copy); + if (LinkManager.Instance.getAllLinks().includes(doc) && LinkManager.Instance.getAllLinks().indexOf(copy) === -1) LinkManager.Instance.addLink(copy); + const exclude = Cast(doc.excludeFields, listSpec("string"), []); + Object.keys(doc).forEach(key => { + if (exclude.includes(key)) return; + const cfield = ComputedField.WithoutComputed(() => FieldValue(doc[key])); + const field = ProxyField.WithoutProxy(() => doc[key]); + const copyObjectField = (field: ObjectField) => { + const list = Cast(doc[key], listSpec(Doc)); + if (list !== undefined && !(list instanceof Promise)) { + copy[key] = new List(list.filter(d => d instanceof Doc).map(d => DocUtils.makeClone(d as Doc, cloneMap, rtfs))); + } else if (doc[key] instanceof Doc) { + copy[key] = key.includes("layout[") ? undefined : DocUtils.makeClone(doc[key] as Doc, cloneMap, rtfs); // reference documents except copy documents that are expanded teplate fields + } else { + copy[key] = ObjectField.MakeCopy(field); + if (field instanceof RichTextField) { + if (field.Data.includes('"docid":') || field.Data.includes('"targetId":') || field.Data.includes('"linkId":')) { + rtfs.push({ copy, key, field }); + } + } + } + }; + if (key === "proto") { + if (doc[key] instanceof Doc) { + copy[key] = DocUtils.makeClone(doc[key]!, cloneMap, rtfs); + } + } else { + if (field instanceof RefField) { + copy[key] = field; + } else if (cfield instanceof ComputedField) { + copy[key] = ComputedField.MakeFunction(cfield.script.originalScript); + (key === "links" && field instanceof ObjectField) && copyObjectField(field); + } else if (field instanceof ObjectField) { + copyObjectField(field); + } else if (field instanceof Promise) { + debugger; //This shouldn't happend... + } else { + copy[key] = field; + } + } + }); + Doc.SetInPlace(copy, "title", "CLONE: " + doc.title, true); + copy.cloneOf = doc; + cloneMap.set(doc[Id], copy); + return copy; + } + export function MakeClone(doc: Doc): Doc { + const cloneMap = new Map(); + const rtfMap: { copy: Doc, key: string, field: RichTextField }[] = []; + const copy = DocUtils.makeClone(doc, cloneMap, rtfMap); + rtfMap.map(({ copy, key, field }) => { + const replacer = (match: any, attr: string, id: string, offset: any, string: any) => { + const mapped = cloneMap.get(id); + return attr + "\"" + (mapped ? mapped[Id] : id) + "\""; + }; + const replacer2 = (match: any, href: string, id: string, offset: any, string: any) => { + const mapped = cloneMap.get(id); + return href + (mapped ? mapped[Id] : id); + }; + const regex = `(${Utils.prepend("/doc/")})([^"]*)`; + const re = new RegExp(regex, "g"); + copy[key] = new RichTextField(field.Data.replace(/("docid":|"targetId":|"linkId":)"([^"]+)"/g, replacer).replace(re, replacer2), field.Text); + }); + return copy; + } + export function addDocumentCreatorMenuItems(docTextAdder: (d: Doc) => void, docAdder: (d: Doc) => void, x: number, y: number): void { ContextMenu.Instance.addItem({ description: "Add Note ...", @@ -1083,6 +1017,119 @@ export namespace DocUtils { })) as ContextMenuProps[], icon: "eye" }); + }// applies a custom template to a document. the template is identified by it's short name (e.g, slideView not layout_slideView) + export function makeCustomViewClicked(doc: Doc, creator: Opt<(documents: Array, options: DocumentOptions, id?: string) => Doc>, templateSignature: string = "custom", docLayoutTemplate?: Doc) { + const batch = UndoManager.StartBatch("makeCustomViewClicked"); + runInAction(() => { + doc.layoutKey = "layout_" + templateSignature; + if (doc[doc.layoutKey] === undefined) { + createCustomView(doc, creator, templateSignature, docLayoutTemplate); + } + }); + batch.end(); + } + export function findTemplate(templateName: string, type: string, signature: string) { + let docLayoutTemplate: Opt; + const iconViews = DocListCast(Cast(Doc.UserDoc()["template-icons"], Doc, null)?.data); + const templBtns = DocListCast(Cast(Doc.UserDoc()["template-buttons"], Doc, null)?.data); + const noteTypes = DocListCast(Cast(Doc.UserDoc()["template-notes"], Doc, null)?.data); + const clickFuncs = DocListCast(Cast(Doc.UserDoc().clickFuncs, Doc, null)?.data); + const allTemplates = iconViews.concat(templBtns).concat(noteTypes).concat(clickFuncs).map(btnDoc => (btnDoc.dragFactory as Doc) || btnDoc).filter(doc => doc.isTemplateDoc); + // bcz: this is hacky -- want to have different templates be applied depending on the "type" of a document. but type is not reliable and there could be other types of template searches so this should be generalized + // first try to find a template that matches the specific document type (_). otherwise, fallback to a general match on + !docLayoutTemplate && allTemplates.forEach(tempDoc => StrCast(tempDoc.title) === templateName + "_" + type && (docLayoutTemplate = tempDoc)); + !docLayoutTemplate && allTemplates.forEach(tempDoc => StrCast(tempDoc.title) === templateName && (docLayoutTemplate = tempDoc)); + return docLayoutTemplate; + } + export function createCustomView(doc: Doc, creator: Opt<(documents: Array, options: DocumentOptions, id?: string) => Doc>, templateSignature: string = "custom", docLayoutTemplate?: Doc) { + const templateName = templateSignature.replace(/\(.*\)/, ""); + docLayoutTemplate = docLayoutTemplate || findTemplate(templateName, StrCast(doc.type), templateSignature); + + const customName = "layout_" + templateSignature; + const _width = NumCast(doc._width); + const _height = NumCast(doc._height); + const options = { title: "data", backgroundColor: StrCast(doc.backgroundColor), _autoHeight: true, _width, x: -_width / 2, y: - _height / 2, _showSidebar: false }; + + let fieldTemplate: Opt; + if (doc.data instanceof RichTextField || typeof (doc.data) === "string") { + fieldTemplate = Docs.Create.TextDocument("", options); + } else if (doc.data instanceof PdfField) { + fieldTemplate = Docs.Create.PdfDocument("http://www.msn.com", options); + } else if (doc.data instanceof VideoField) { + fieldTemplate = Docs.Create.VideoDocument("http://www.cs.brown.edu", options); + } else if (doc.data instanceof AudioField) { + fieldTemplate = Docs.Create.AudioDocument("http://www.cs.brown.edu", options); + } else if (doc.data instanceof ImageField) { + fieldTemplate = Docs.Create.ImageDocument("http://www.cs.brown.edu", options); + } + const docTemplate = docLayoutTemplate || creator?.(fieldTemplate ? [fieldTemplate] : [], { title: customName + "(" + doc.title + ")", isTemplateDoc: true, _width: _width + 20, _height: Math.max(100, _height + 45) }); + + fieldTemplate && Doc.MakeMetadataFieldTemplate(fieldTemplate, docTemplate ? Doc.GetProto(docTemplate) : docTemplate); + docTemplate && Doc.ApplyTemplateTo(docTemplate, doc, customName, undefined); + } + export function makeCustomView(doc: Doc, custom: boolean, layout: string) { + Doc.setNativeView(doc); + if (custom) { + makeCustomViewClicked(doc, Docs.Create.StackingDocument, layout, undefined); + } + } + export function iconify(doc: Doc) { + const layoutKey = Cast(doc.layoutKey, "string", null); + DocUtils.makeCustomViewClicked(doc, Docs.Create.StackingDocument, "icon", undefined); + if (layoutKey && layoutKey !== "layout" && layoutKey !== "layout_icon") doc.deiconifyLayout = layoutKey.replace("layout_", ""); + } + + export function pileup(docList: Doc[], x?: number, y?: number) { + let w = 0, h = 0; + runInAction(() => { + docList.forEach(d => { + DocUtils.iconify(d); + w = Math.max(d[WidthSym](), w); + h = Math.max(d[HeightSym](), h); + }); + h = Math.max(h, w * 4 / 3); // converting to an icon does not update the height right away. so this is a fallback hack to try to do something reasonable + docList.forEach((d, i) => { + d.x = Math.cos(Math.PI * 2 * i / docList.length) * 10 - w / 2; + d.y = Math.sin(Math.PI * 2 * i / docList.length) * 10 - h / 2; + d.displayTimecode = undefined; // bcz: this should be automatic somehow.. along with any other properties that were logically associated with the original collection + }); + }); + if (x !== undefined && y !== undefined) { + const newCollection = Docs.Create.PileDocument(docList, { title: "pileup", x: x - 55, y: y - 55, _width: 110, _height: 100, _LODdisable: true }); + newCollection.x = NumCast(newCollection.x) + NumCast(newCollection._width) / 2 - 55; + newCollection.y = NumCast(newCollection.y) + NumCast(newCollection._height) / 2 - 55; + newCollection._width = newCollection._height = 110; + //newCollection.borderRounding = "40px"; + newCollection._jitterRotation = 10; + newCollection._backgroundColor = "gray"; + newCollection._overflow = "visible"; + return newCollection; + } + } + + + export async function addFieldEnumerations(doc: Opt, enumeratedFieldKey: string, enumerations: { title: string, _backgroundColor?: string, color?: string }[]) { + let optionsCollection = await DocServer.GetRefField(enumeratedFieldKey); + if (!(optionsCollection instanceof Doc)) { + optionsCollection = Docs.Create.StackingDocument([], { title: `${enumeratedFieldKey} field set` }, enumeratedFieldKey); + Doc.AddDocToList((Doc.UserDoc().fieldTypes as Doc), "data", optionsCollection as Doc); + } + const options = optionsCollection as Doc; + const targetDoc = doc && Doc.GetProto(Cast(doc.rootDocument, Doc, null) || doc); + const docFind = `options.data.find(doc => doc.title === (this.rootDocument||this)["${enumeratedFieldKey}"])?`; + targetDoc && (targetDoc.backgroundColor = ComputedField.MakeFunction(docFind + `._backgroundColor || "white"`, undefined, { options })); + targetDoc && (targetDoc.color = ComputedField.MakeFunction(docFind + `.color || "black"`, undefined, { options })); + targetDoc && (targetDoc.borderRounding = ComputedField.MakeFunction(docFind + `.borderRounding`, undefined, { options })); + enumerations.map(enumeration => { + const found = DocListCast(options.data).find(d => d.title === enumeration.title); + if (found) { + found._backgroundColor = enumeration._backgroundColor || found._backgroundColor; + found._color = enumeration.color || found._color; + } else { + Doc.AddDocToList(options, "data", Docs.Create.TextDocument(enumeration.title, enumeration)); + } + }); + return optionsCollection; } } diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts index 496099557..d2614a898 100644 --- a/src/client/util/CurrentUserUtils.ts +++ b/src/client/util/CurrentUserUtils.ts @@ -2,7 +2,7 @@ import { computed, observable, reaction } from "mobx"; import * as rp from 'request-promise'; import { Utils } from "../../Utils"; import { DocServer } from "../DocServer"; -import { Docs, DocumentOptions } from "../documents/Documents"; +import { Docs, DocumentOptions, DocUtils } from "../documents/Documents"; import { UndoManager } from "./UndoManager"; import { Doc, DocListCast, DocListCastAsync } from "../../fields/Doc"; import { List } from "../../fields/List"; @@ -221,7 +221,7 @@ export class CurrentUserUtils { ]; if (doc.fieldTypes === undefined) { doc.fieldTypes = Docs.Create.TreeDocument([], { title: "field enumerations" }); - Doc.addFieldEnumerations(Doc.GetProto(doc["template-note-Todo"] as any as Doc), "taskStatus", taskStatusValues); + DocUtils.addFieldEnumerations(Doc.GetProto(doc["template-note-Todo"] as any as Doc), "taskStatus", taskStatusValues); } if (doc["template-notes"] === undefined) { @@ -612,7 +612,7 @@ export class CurrentUserUtils { static setupDockedButtons(doc: Doc) { if (doc["dockedBtn-pen"] === undefined) { doc["dockedBtn-pen"] = CurrentUserUtils.ficon({ - onClick: ScriptField.MakeScript("activatePen(this.activePen.inkPen = sameDocs(this.activePen.inkPen, this) ? undefined : this, this.inkWidth, this.backgroundColor)"), + onClick: ScriptField.MakeScript("activatePen(this.activePen.inkPen = sameDocs(this.activePen.inkPen, this) ? undefined : this)"), author: "systemTemplates", title: "ink mode", icon: "pen-nib", ischecked: ComputedField.MakeFunction(`sameDocs(this.activePen.inkPen, this)`), activePen: doc }); } @@ -692,6 +692,8 @@ export class CurrentUserUtils { doc.title = Doc.CurrentUserEmail; doc.activePen = doc; doc.inkColor = StrCast(doc.backgroundColor, "rgb(0, 0, 0)"); + doc.inkWidth = StrCast(doc.inkWidth, "1"); + doc.inkBezier = StrCast(doc.inkBezier, ""); doc.fontSize = NumCast(doc.fontSize, 12); doc["constants-snapThreshold"] = NumCast(doc["constants-snapThreshold"], 10); // doc["constants-dragThreshold"] = NumCast(doc["constants-dragThreshold"], 4); // diff --git a/src/client/util/DragManager.ts b/src/client/util/DragManager.ts index 2a9c1633a..e7a14f9c5 100644 --- a/src/client/util/DragManager.ts +++ b/src/client/util/DragManager.ts @@ -210,7 +210,7 @@ export namespace DragManager { e.docDragData && (e.docDragData.droppedDocuments = dragData.draggedDocuments.map(d => !dragData.isSelectionMove && !dragData.userDropAction && ScriptCast(d.onDragStart) ? addAudioTag(ScriptCast(d.onDragStart).script.run({ this: d }).result) : dragData.userDropAction === "alias" || (!dragData.userDropAction && dragData.dropAction === "alias") ? Doc.MakeAlias(d) : - dragData.userDropAction === "copy" || (!dragData.userDropAction && dragData.dropAction === "copy") ? Doc.MakeClone(d) : d) + dragData.userDropAction === "copy" || (!dragData.userDropAction && dragData.dropAction === "copy") ? Doc.MakeDelegate(d) : d) ); e.docDragData?.droppedDocuments.forEach((drop: Doc, i: number) => (dragData?.removeDropProperties || []).concat(Cast(dragData.draggedDocuments[i].removeDropProperties, listSpec("string"), [])).map(prop => drop[prop] = undefined) diff --git a/src/client/util/Import & Export/DirectoryImportBox.tsx b/src/client/util/Import & Export/DirectoryImportBox.tsx index 1e8f07049..4e5cde558 100644 --- a/src/client/util/Import & Export/DirectoryImportBox.tsx +++ b/src/client/util/Import & Export/DirectoryImportBox.tsx @@ -123,10 +123,10 @@ export default class DirectoryImportBox extends React.Component } const { accessPaths, exifData } = result; const path = Utils.prepend(accessPaths.agnostic.client); - const document = await Docs.Get.DocumentFromType(type, path, { _width: 300, title: name }); + const document = await Doc.Get.DocumentFromType(type, path, { _width: 300, title: name }); const { data, error } = exifData; if (document) { - Doc.GetProto(document).exif = error || Docs.Get.FromJson({ data }); + Doc.GetProto(document).exif = error || Doc.Get.FromJson({ data }); docs.push(document); } })); diff --git a/src/client/util/Import & Export/ImageUtils.ts b/src/client/util/Import & Export/ImageUtils.ts index 072e5f58a..0d12b39b8 100644 --- a/src/client/util/Import & Export/ImageUtils.ts +++ b/src/client/util/Import & Export/ImageUtils.ts @@ -20,7 +20,7 @@ export namespace ImageUtils { nativeHeight, exifData: { error, data } } = await Networking.PostToServer("/inspectImage", { source }); - document.exif = error || Docs.Get.FromJson({ data }); + document.exif = error || Doc.Get.FromJson({ data }); const proto = Doc.GetProto(document); proto["data-nativeWidth"] = nativeWidth; proto["data-nativeHeight"] = nativeHeight; diff --git a/src/client/util/InteractionUtils.tsx b/src/client/util/InteractionUtils.tsx index ab1ccb25a..3948611f0 100644 --- a/src/client/util/InteractionUtils.tsx +++ b/src/client/util/InteractionUtils.tsx @@ -1,7 +1,6 @@ import React = require("react"); import * as beziercurve from 'bezier-curve'; import * as fitCurve from 'fit-curve'; -import InkOptionsMenu from "../views/collections/collectionFreeForm/InkOptionsMenu"; export namespace InteractionUtils { export const MOUSETYPE = "mouse"; @@ -90,24 +89,12 @@ export namespace InteractionUtils { return myTouches; } - export function CreatePolyline(points: { X: number, Y: number }[], left: number, top: number, color: string, width: string, bezier: string) { + export function CreatePolyline(points: { X: number, Y: number }[], left: number, top: number, color: string, width: string, bezier: string, scalex: number, scaley: number, shape: string) { var pts = ""; - var shape = ""; - if (InkOptionsMenu.Instance._circle) { - shape = "circle"; - } else if (InkOptionsMenu.Instance._rectangle) { - shape = "rectangle"; - } else if (InkOptionsMenu.Instance._triangle) { - shape = "triangle"; - } else if (InkOptionsMenu.Instance._arrow) { - shape = "arrow"; - } else if (InkOptionsMenu.Instance._line) { - shape = "line"; - } - if (shape !== "") { + if (shape) { //if any of the shape are true const shapePts = makePolygon(shape, points); - pts = shapePts.reduce((acc: string, pt: { X: number, Y: number }) => acc + `${pt.X - left},${pt.Y - top} `, ""); + pts = shapePts.reduce((acc: string, pt: { X: number, Y: number }) => acc + `${pt.X * scalex - left * scalex},${pt.Y * scaley - top * scaley} `, ""); } else if (points.length > 1 && points[points.length - 1].X === points[0].X && points[points.length - 1].Y === points[0].Y) { //pointer is up (first and last points are the same) @@ -124,10 +111,10 @@ export namespace InteractionUtils { newPts.push({ X: point[0], Y: point[1] }); } } - pts = newPts.reduce((acc: string, pt: { X: number, Y: number }) => acc + `${pt.X - left},${pt.Y - top} `, ""); + pts = newPts.reduce((acc: string, pt: { X: number, Y: number }) => acc + `${pt.X * scalex - left * scalex},${pt.Y * scaley - top * scaley} `, ""); } else { //in the middle of drawing - pts = points.reduce((acc: string, pt: { X: number, Y: number }) => acc + `${pt.X - left},${pt.Y - top} `, ""); + pts = points.reduce((acc: string, pt: { X: number, Y: number }) => acc + `${pt.X * scalex - left * scalex},${pt.Y * scaley - top * scaley} `, ""); } return ( (schemaCtor: lookupField = (field: string) => ScriptCast(this.layoutDoc.lookupField)?.script.run({ self: this.layoutDoc, data: this.rootDoc, field: field, container: this.props.ContainingCollectionDoc }).result; - active = (outsideReaction?: boolean) => !this.props.Document.isBackground && (this.props.rootSelected(outsideReaction) || this.props.isSelected(outsideReaction) || this.props.renderDepth === 0 || this.layoutDoc.forceActive);// && !InkingControl.Instance.selectedTool; // bcz: inking state shouldn't affect static tools + active = (outsideReaction?: boolean) => !this.props.Document.isBackground && (this.props.rootSelected(outsideReaction) || this.props.isSelected(outsideReaction) || this.props.renderDepth === 0 || this.layoutDoc.forceActive);// && !Doc.selectedTool; // bcz: inking state shouldn't affect static tools protected multiTouchDisposer?: InteractionUtils.MultiTouchEventDisposer; } return Component; @@ -148,9 +146,9 @@ export function ViewBoxAnnotatableComponent

this.props.whenActiveChanged(this._isChildActive = isActive)); - active = (outsideReaction?: boolean) => ((InkingControl.Instance.selectedTool === InkTool.None && !this.props.Document.isBackground) && + active = (outsideReaction?: boolean) => ((Doc.selectedTool === InkTool.None && !this.props.Document.isBackground) && (this.props.rootSelected(outsideReaction) || this.props.isSelected(outsideReaction) || this._isChildActive || this.props.renderDepth === 0 || BoolCast((this.layoutDoc as any).forceActive)) ? true : false) - annotationsActive = (outsideReaction?: boolean) => (InkingControl.Instance.selectedTool !== InkTool.None || (this.props.Document.isBackground && this.props.active()) || + annotationsActive = (outsideReaction?: boolean) => (Doc.selectedTool !== InkTool.None || (this.props.Document.isBackground && this.props.active()) || (this.props.Document.forceActive || this.props.isSelected(outsideReaction) || this._isChildActive || this.props.renderDepth === 0) ? true : false) } return Component; diff --git a/src/client/views/GestureOverlay.tsx b/src/client/views/GestureOverlay.tsx index 5714970c1..4ea75d7d7 100644 --- a/src/client/views/GestureOverlay.tsx +++ b/src/client/views/GestureOverlay.tsx @@ -1,38 +1,30 @@ import React = require("react"); -import { Touchable } from "./Touchable"; +import { action, computed, observable, runInAction } from "mobx"; import { observer } from "mobx-react"; -import "./GestureOverlay.scss"; -import { computed, observable, action, runInAction, IReactionDisposer, reaction, flow, trace } from "mobx"; +import { Doc } from "../../fields/Doc"; +import { InkData, InkTool } from "../../fields/InkField"; +import { Cast, FieldValue, NumCast } from "../../fields/Types"; +import MobileInkOverlay from "../../mobile/MobileInkOverlay"; +import MobileInterface from "../../mobile/MobileInterface"; import { GestureUtils } from "../../pen-gestures/GestureUtils"; +import { MobileInkOverlayContent } from "../../server/Message"; +import { emptyFunction, emptyPath, returnEmptyString, returnFalse, returnOne, returnTrue, returnZero } from "../../Utils"; +import { CognitiveServices } from "../cognitive_services/CognitiveServices"; +import { DocServer } from "../DocServer"; +import { DocUtils } from "../documents/Documents"; +import { CurrentUserUtils } from "../util/CurrentUserUtils"; import { InteractionUtils } from "../util/InteractionUtils"; -import { InkingControl } from "./InkingControl"; -import { InkTool, InkData } from "../../fields/InkField"; -import { Doc } from "../../fields/Doc"; import { LinkManager } from "../util/LinkManager"; -import { DocUtils, Docs } from "../documents/Documents"; -import { undoBatch } from "../util/UndoManager"; import { Scripting } from "../util/Scripting"; -import { FieldValue, Cast, NumCast, BoolCast } from "../../fields/Types"; -import { CurrentUserUtils } from "../util/CurrentUserUtils"; -import HorizontalPalette from "./Palette"; -import { Utils, emptyPath, emptyFunction, returnFalse, returnOne, returnEmptyString, returnTrue, numberRange, returnZero } from "../../Utils"; -import { DocumentView } from "./nodes/DocumentView"; import { Transform } from "../util/Transform"; -import { DocumentContentsView } from "./nodes/DocumentContentsView"; -import { CognitiveServices } from "../cognitive_services/CognitiveServices"; -import { DocServer } from "../DocServer"; -import htmlToImage from "html-to-image"; -import { ScriptField } from "../../fields/ScriptField"; -import { listSpec } from "../../fields/Schema"; -import { List } from "../../fields/List"; -import { CollectionViewType } from "./collections/CollectionView"; -import TouchScrollableMenu, { TouchScrollableMenuItem } from "./TouchScrollableMenu"; -import MobileInterface from "../../mobile/MobileInterface"; -import { MobileInkOverlayContent } from "../../server/Message"; -import MobileInkOverlay from "../../mobile/MobileInkOverlay"; +import "./GestureOverlay.scss"; +import { InkingControl } from "./InkingControl"; +import { DocumentView } from "./nodes/DocumentView"; import { RadialMenu } from "./nodes/RadialMenu"; -import { SelectionManager } from "../util/SelectionManager"; -import InkOptionsMenu from "./collections/collectionFreeForm/InkOptionsMenu"; +import HorizontalPalette from "./Palette"; +import { Touchable } from "./Touchable"; +import TouchScrollableMenu, { TouchScrollableMenuItem } from "./TouchScrollableMenu"; +import { InkingStroke } from "./InkingStroke"; @observer @@ -500,7 +492,7 @@ export default class GestureOverlay extends Touchable { @action onPointerDown = (e: React.PointerEvent) => { - if (InteractionUtils.IsType(e, InteractionUtils.PENTYPE) || (InkingControl.Instance.selectedTool === InkTool.Highlighter || InkingControl.Instance.selectedTool === InkTool.Pen)) { + if (InteractionUtils.IsType(e, InteractionUtils.PENTYPE) || (Doc.selectedTool === InkTool.Highlighter || Doc.selectedTool === InkTool.Pen)) { this._points.push({ X: e.clientX, Y: e.clientY }); e.stopPropagation(); e.preventDefault(); @@ -514,7 +506,7 @@ export default class GestureOverlay extends Touchable { @action onPointerMove = (e: PointerEvent) => { - if (InteractionUtils.IsType(e, InteractionUtils.PENTYPE) || (InkingControl.Instance.selectedTool === InkTool.Highlighter || InkingControl.Instance.selectedTool === InkTool.Pen)) { + if (InteractionUtils.IsType(e, InteractionUtils.PENTYPE) || (Doc.selectedTool === InkTool.Highlighter || Doc.selectedTool === InkTool.Pen)) { this._points.push({ X: e.clientX, Y: e.clientY }); e.stopPropagation(); e.preventDefault(); @@ -585,12 +577,11 @@ export default class GestureOverlay extends Touchable { //push first points to so interactionUtil knows pointer is up this._points.push({ X: this._points[0].X, Y: this._points[0].Y }); if (MobileInterface.Instance && MobileInterface.Instance.drawingInk) { - const { selectedColor, selectedWidth } = InkingControl.Instance; DocServer.Mobile.dispatchGesturePoints({ points: this._points, bounds: B, - color: selectedColor, - width: selectedWidth + color: InkingStroke.InkColor, + width: InkingStroke.InkWidth }); } @@ -633,21 +624,11 @@ export default class GestureOverlay extends Touchable { } } //if any of the shape is activated in the InkOptionsMenu - else if (InkOptionsMenu.Instance._circle || InkOptionsMenu.Instance._triangle || InkOptionsMenu.Instance._rectangle || InkOptionsMenu.Instance._line || InkOptionsMenu.Instance._arrow) { - if (InkOptionsMenu.Instance._circle) { - this.makePolygon("circle", false); - } else if (InkOptionsMenu.Instance._triangle) { - this.makePolygon("triangle", false); - } else if (InkOptionsMenu.Instance._rectangle) { - this.makePolygon("rectangle", false); - } else if (InkOptionsMenu.Instance._line) { - this.makePolygon("line", false); - } else if (InkOptionsMenu.Instance._arrow) { - this.makePolygon("arrow", false); - } + else if (InkingStroke.InkShape) { + this.makePolygon(InkingStroke.InkShape, false); this.dispatchGesture(GestureUtils.Gestures.Stroke); this._points = []; - InkOptionsMenu.Instance.allFalse(); + InkingStroke.InkShape = ""; } // if we're not drawing in a toolglass try to recognize as gesture else { @@ -827,11 +808,11 @@ export default class GestureOverlay extends Touchable { [this._strokes.map(l => { const b = this.getBounds(l); return - {InteractionUtils.CreatePolyline(l, b.left, b.top, InkingControl.Instance.selectedColor, InkingControl.Instance.selectedWidth, InkingControl.Instance.selectedBezier)} + {InteractionUtils.CreatePolyline(l, b.left, b.top, InkingStroke.InkColor, InkingStroke.InkWidth, InkingStroke.InkBezierApprox, 1, 1, InkingStroke.InkShape)} ; }), this._points.length <= 1 ? (null) : - {InteractionUtils.CreatePolyline(this._points, B.left, B.top, InkingControl.Instance.selectedColor, InkingControl.Instance.selectedWidth, InkingControl.Instance.selectedBezier)} + {InteractionUtils.CreatePolyline(this._points, B.left, B.top, InkingStroke.InkColor, InkingStroke.InkWidth, InkingStroke.InkBezierApprox, 1, 1, InkingStroke.InkShape)} ] ]; } @@ -921,15 +902,15 @@ Scripting.addGlobal(function setToolglass(tool: any) { }); Scripting.addGlobal(function setPen(width: any, color: any) { runInAction(() => { - GestureOverlay.Instance.SavedColor = InkingControl.Instance.selectedColor; - InkingControl.Instance.updateSelectedColor(color); - GestureOverlay.Instance.SavedWidth = InkingControl.Instance.selectedWidth; + GestureOverlay.Instance.SavedColor = InkingStroke.InkColor; + InkingControl.Instance.switchColor(color); + GestureOverlay.Instance.SavedWidth = InkingStroke.InkWidth; InkingControl.Instance.switchWidth(width); }); }); Scripting.addGlobal(function resetPen() { runInAction(() => { - InkingControl.Instance.updateSelectedColor(GestureOverlay.Instance.SavedColor ?? "rgb(0, 0, 0)"); + InkingControl.Instance.switchColor(GestureOverlay.Instance.SavedColor ?? "rgb(0, 0, 0)"); InkingControl.Instance.switchWidth(GestureOverlay.Instance.SavedWidth ?? "2"); }); }); diff --git a/src/client/views/InkingControl.tsx b/src/client/views/InkingControl.tsx index 83109db1c..349bc6ffc 100644 --- a/src/client/views/InkingControl.tsx +++ b/src/client/views/InkingControl.tsx @@ -1,22 +1,12 @@ -import { action, computed, observable } from "mobx"; -import { ColorState } from 'react-color'; +import { action, observable } from "mobx"; import { Doc } from "../../fields/Doc"; import { InkTool } from "../../fields/InkField"; -import { FieldValue, NumCast, StrCast } from "../../fields/Types"; import { CurrentUserUtils } from "../util/CurrentUserUtils"; import { Scripting } from "../util/Scripting"; -import { SelectionManager } from "../util/SelectionManager"; -import { undoBatch } from "../util/UndoManager"; -import GestureOverlay from "./GestureOverlay"; -import { FormattedTextBox } from "./nodes/formattedText/FormattedTextBox"; -import InkOptionsMenu from "./collections/collectionFreeForm/InkOptionsMenu"; +import { InkingStroke } from "./InkingStroke"; export class InkingControl { @observable static Instance: InkingControl; - @computed private get _selectedTool(): InkTool { return FieldValue(NumCast(Doc.UserDoc().inkTool)) ?? InkTool.None; } - @computed private get _selectedColor(): string { return CurrentUserUtils.ActivePen ? FieldValue(StrCast(CurrentUserUtils.ActivePen.backgroundColor)) ?? "rgb(0, 0, 0)" : "rgb(0, 0, 0)"; } - @computed private get _selectedWidth(): string { return FieldValue(StrCast(Doc.UserDoc().inkWidth)) ?? "2"; } - @computed private get _selectedBezier(): string { return FieldValue(StrCast(Doc.UserDoc().inkBezier)) ?? "2"; } @observable public _open: boolean = false; constructor() { InkingControl.Instance = this; @@ -26,110 +16,27 @@ export class InkingControl { // this._selectedTool = tool; Doc.UserDoc().inkTool = tool; }); - decimalToHexString(number: number) { - if (number < 0) { - number = 0xFFFFFFFF + number + 1; - } - return (number < 16 ? "0" : "") + number.toString(16).toUpperCase(); - } - @action - inkOptionsMenuChangeColor = (color: string) => { - const col: ColorState = { - hex: color, hsl: { a: 0, h: 0, s: 0, l: 0, source: "" }, hsv: { a: 0, h: 0, s: 0, v: 0, source: "" }, - rgb: { a: 0, r: 0, b: 0, g: 0, source: "" }, oldHue: 0, source: "", - }; - this.switchColor(col); - InkOptionsMenu.Instance._colorBt = false; - } - - @undoBatch - switchColor = action((color: ColorState): void => { - Doc.UserDoc().backgroundColor = color.hex.startsWith("#") ? - color.hex + (color.rgb.a ? this.decimalToHexString(Math.round(color.rgb.a * 255)) : "ff") : color.hex; - InkOptionsMenu.Instance._color = StrCast(Doc.UserDoc().backgroundColor); - CurrentUserUtils.ActivePen && (CurrentUserUtils.ActivePen.backgroundColor = color.hex); - - if (InkingControl.Instance.selectedTool === InkTool.None) { - const selected = SelectionManager.SelectedDocuments(); - selected.map(view => { - const targetDoc = view.props.Document.dragFactory instanceof Doc ? view.props.Document.dragFactory : - view.props.Document.layout instanceof Doc ? view.props.Document.layout : - view.props.Document.isTemplateForField ? view.props.Document : Doc.GetProto(view.props.Document); - if (targetDoc) { - if (StrCast(Doc.Layout(view.props.Document).layout).indexOf("FormattedTextBox") !== -1 && FormattedTextBox.HadSelection) { - Doc.Layout(view.props.Document).color = Doc.UserDoc().bacgroundColor; - } else { - Doc.Layout(view.props.Document)._backgroundColor = Doc.UserDoc().backgroundColor; // '_backgroundColor' is template specific. 'backgroundColor' would apply to all templates, but has no UI at the moment - } - } - }); - } - }); @action switchWidth = (width: string): void => { - // this._selectedWidth = width; if (!isNaN(parseInt(width))) { - Doc.UserDoc().inkWidth = width; + CurrentUserUtils.ActivePen && (CurrentUserUtils.ActivePen.inkWidth = InkingStroke.InkWidth = width); } - InkOptionsMenu.Instance._widthBt = false; } @action switchBezier = (bezier: string): void => { - if (!isNaN(parseInt(bezier))) { - Doc.UserDoc().inkBezier = bezier; - } + CurrentUserUtils.ActivePen && (CurrentUserUtils.ActivePen.inkBezier = InkingStroke.InkBezierApprox = isNaN(parseInt(bezier)) ? "" : bezier); } @action - inkOptionsMenuChangeBezier = (e: React.PointerEvent): void => { - if (InkOptionsMenu.Instance._bezierBt === true) { - Doc.UserDoc().inkBezier = "300"; - } else { - Doc.UserDoc().inkBezier = "0"; - } - } - - @computed - get selectedTool() { - return this._selectedTool; - } - - @computed - get selectedColor() { - return this._selectedColor; - } - - @action - updateSelectedColor(value: string) { - // this._selectedColor = value; - Doc.UserDoc().inkColor = value; - } - - @computed - get selectedWidth() { - return this._selectedWidth; - } - - @computed - get selectedBezier() { - return this._selectedBezier; + switchColor(value: string) { + CurrentUserUtils.ActivePen && (CurrentUserUtils.ActivePen.inkColor = InkingStroke.InkColor = value); } } -Scripting.addGlobal(function activatePen(pen: any, width: any, color: any) { - InkingControl.Instance.switchTool(pen ? InkTool.Pen : InkTool.None); InkingControl.Instance.switchWidth(width); InkingControl.Instance.updateSelectedColor(color); - //setup InkOptionsMenu(change jumpto value if necessary.Currenlty hardcoded to 300,300) - pen ? InkOptionsMenu.Instance.jumpTo(300, 300) : InkOptionsMenu.Instance.fadeOut(true); - InkOptionsMenu.Instance.changeColor = InkingControl.Instance.inkOptionsMenuChangeColor; - InkOptionsMenu.Instance.changeBezier = InkingControl.Instance.inkOptionsMenuChangeBezier; - InkOptionsMenu.Instance.changeWidth = InkingControl.Instance.switchWidth; - InkOptionsMenu.Instance._widthSelected = width; - InkOptionsMenu.Instance._color = color; -}); -Scripting.addGlobal(function activateBrush(pen: any, width: any, color: any) { InkingControl.Instance.switchTool(pen ? InkTool.Highlighter : InkTool.None); InkingControl.Instance.switchWidth(width); InkingControl.Instance.updateSelectedColor(color); }); +Scripting.addGlobal(function activateBrush(pen: any, width: any, color: any) { InkingControl.Instance.switchTool(pen ? InkTool.Highlighter : InkTool.None); InkingControl.Instance.switchWidth(width); InkingControl.Instance.switchColor(color); }); Scripting.addGlobal(function activateEraser(pen: any) { return InkingControl.Instance.switchTool(pen ? InkTool.Eraser : InkTool.None); }); Scripting.addGlobal(function activateStamp(pen: any) { return InkingControl.Instance.switchTool(pen ? InkTool.Stamp : InkTool.None); }); Scripting.addGlobal(function deactivateInk() { return InkingControl.Instance.switchTool(InkTool.None); }); Scripting.addGlobal(function setInkWidth(width: any) { return InkingControl.Instance.switchWidth(width); }); -Scripting.addGlobal(function setInkColor(color: any) { return InkingControl.Instance.updateSelectedColor(color); }); \ No newline at end of file +Scripting.addGlobal(function setInkColor(color: any) { return InkingControl.Instance.switchColor(color); }); \ No newline at end of file diff --git a/src/client/views/InkingStroke.tsx b/src/client/views/InkingStroke.tsx index 3dc0a5b20..78d729eee 100644 --- a/src/client/views/InkingStroke.tsx +++ b/src/client/views/InkingStroke.tsx @@ -1,19 +1,19 @@ +import { library } from "@fortawesome/fontawesome-svg-core"; +import { faPaintBrush } from "@fortawesome/free-solid-svg-icons"; +import { observable, runInAction } from "mobx"; import { observer } from "mobx-react"; import { documentSchema } from "../../fields/documentSchemas"; import { InkData, InkField, InkTool } from "../../fields/InkField"; import { makeInterface } from "../../fields/Schema"; -import { Cast, StrCast, NumCast } from "../../fields/Types"; +import { Cast, StrCast } from "../../fields/Types"; +import { TraceMobx } from "../../fields/util"; +import { CognitiveServices } from "../cognitive_services/CognitiveServices"; +import { InteractionUtils } from "../util/InteractionUtils"; +import { ContextMenu } from "./ContextMenu"; import { ViewBoxBaseComponent } from "./DocComponent"; -import { InkingControl } from "./InkingControl"; import "./InkingStroke.scss"; import { FieldView, FieldViewProps } from "./nodes/FieldView"; import React = require("react"); -import { TraceMobx } from "../../fields/util"; -import { InteractionUtils } from "../util/InteractionUtils"; -import { ContextMenu } from "./ContextMenu"; -import { CognitiveServices } from "../cognitive_services/CognitiveServices"; -import { faPaintBrush } from "@fortawesome/free-solid-svg-icons"; -import { library } from "@fortawesome/fontawesome-svg-core"; library.add(faPaintBrush); @@ -23,6 +23,22 @@ const InkDocument = makeInterface(documentSchema); @observer export class InkingStroke extends ViewBoxBaseComponent(InkDocument) { public static LayoutString(fieldStr: string) { return FieldView.LayoutString(InkingStroke, fieldStr); } + @observable public static InkColor: string; + @observable public static InkWidth: string; + @observable public static InkBezierApprox: string; + @observable public static InkShape: string; + + constructor(props: any) { + super(props); + if (InkingStroke.InkBezierApprox === undefined) { + runInAction(() => { + InkingStroke.InkBezierApprox = ""; + InkingStroke.InkWidth = "1"; + InkingStroke.InkColor = "black"; + InkingStroke.InkShape = ""; + }); + } + } private analyzeStrokes = () => { const data: InkData = Cast(this.dataDoc[this.fieldKey], InkField)?.inkData ?? []; @@ -38,22 +54,19 @@ export class InkingStroke extends ViewBoxBaseComponent { ContextMenu.Instance.addItem({ description: "Analyze Stroke", diff --git a/src/client/views/PreviewCursor.tsx b/src/client/views/PreviewCursor.tsx index dd65681d4..33150ab7c 100644 --- a/src/client/views/PreviewCursor.tsx +++ b/src/client/views/PreviewCursor.tsx @@ -3,7 +3,7 @@ import { observer } from 'mobx-react'; import "normalize.css"; import * as React from 'react'; import "./PreviewCursor.scss"; -import { Docs } from '../documents/Documents'; +import { Docs, DocUtils } from '../documents/Documents'; import { Doc } from '../../fields/Doc'; import { Transform } from "../util/Transform"; import { DocServer } from '../DocServer'; @@ -65,7 +65,7 @@ export class PreviewCursor extends React.Component<{}> { count++; if (doc instanceof Doc) { i === 1 && (first = doc); - const alias = Doc.MakeClone(doc); + const alias = DocUtils.MakeClone(doc); const deltaX = NumCast(doc.x) - NumCast(first!.x) - ptx; const deltaY = NumCast(doc.y) - NumCast(first!.y) - pty; alias.x = newPoint[0] + deltaX; diff --git a/src/client/views/Touchable.tsx b/src/client/views/Touchable.tsx index 10d023d83..5e48d5ffb 100644 --- a/src/client/views/Touchable.tsx +++ b/src/client/views/Touchable.tsx @@ -1,8 +1,6 @@ import * as React from 'react'; import { action } from 'mobx'; import { InteractionUtils } from '../util/InteractionUtils'; -import { SelectionManager } from '../util/SelectionManager'; -import { RadialMenu } from './nodes/RadialMenu'; const HOLD_DURATION = 1000; diff --git a/src/client/views/collections/CollectionMapView.tsx b/src/client/views/collections/CollectionMapView.tsx index a0b7cd8a8..cfec3a6bc 100644 --- a/src/client/views/collections/CollectionMapView.tsx +++ b/src/client/views/collections/CollectionMapView.tsx @@ -42,7 +42,7 @@ const query = async (data: string | google.maps.LatLngLiteral) => { }; @observer -class CollectionMapView extends CollectionSubView & { google: any }>(MapSchema) { +export class CollectionMapView extends CollectionSubView & { google: any }>(MapSchema) { private _cancelAddrReq = new Map(); private _cancelLocReq = new Map(); diff --git a/src/client/views/collections/CollectionSubView.tsx b/src/client/views/collections/CollectionSubView.tsx index 423eb1d90..b60419258 100644 --- a/src/client/views/collections/CollectionSubView.tsx +++ b/src/client/views/collections/CollectionSubView.tsx @@ -6,27 +6,19 @@ import { Id } from "../../../fields/FieldSymbols"; import { List } from "../../../fields/List"; import { listSpec } from "../../../fields/Schema"; import { ScriptField } from "../../../fields/ScriptField"; +import { WebField } from "../../../fields/URLField"; import { Cast, ScriptCast, NumCast } from "../../../fields/Types"; import { GestureUtils } from "../../../pen-gestures/GestureUtils"; -import { CurrentUserUtils } from "../../util/CurrentUserUtils"; import { Upload } from "../../../server/SharedMediaTypes"; import { Utils } from "../../../Utils"; -import { GooglePhotos } from "../../apis/google_docs/GooglePhotosClientUtils"; import { DocServer } from "../../DocServer"; -import { Docs, DocumentOptions, DocUtils } from "../../documents/Documents"; -import { DocumentType } from "../../documents/DocumentTypes"; import { Networking } from "../../Network"; -import { DragManager, dropActionType } from "../../util/DragManager"; import { ImageUtils } from "../../util/Import & Export/ImageUtils"; import { InteractionUtils } from "../../util/InteractionUtils"; import { undoBatch, UndoManager } from "../../util/UndoManager"; import { DocComponent } from "../DocComponent"; import { FieldViewProps } from "../nodes/FieldView"; -import { FormattedTextBox, GoogleRef } from "../nodes/formattedText/FormattedTextBox"; -import { CollectionView } from "./CollectionView"; import React = require("react"); -import { SelectionManager } from "../../util/SelectionManager"; -import { WebField } from "../../../fields/URLField"; export interface CollectionViewProps extends FieldViewProps { addDocument: (document: Doc | Doc[]) => boolean; @@ -405,7 +397,7 @@ export function CollectionSubView(schemaCtor: (doc: Doc) => T, moreProps?: const stringContents = await new Promise(resolve => item.getAsString(resolve)); const type = "html";// (await rp.head(Utils.CorsProxy(stringContents)))["content-type"]; if (type) { - const doc = await Docs.Get.DocumentFromType(type, stringContents, options); + const doc = await DocUtils.DocumentFromType(type, stringContents, options); doc && generatedDocuments.push(doc); } } @@ -435,7 +427,7 @@ export function CollectionSubView(schemaCtor: (doc: Doc) => T, moreProps?: } const full = { ...options, _width: 400, title: name }; const pathname = Utils.prepend(result.accessPaths.agnostic.client); - const doc = await Docs.Get.DocumentFromType(type, pathname, full); + const doc = await DocUtils.DocumentFromType(type, pathname, full); if (!doc) { continue; } @@ -450,9 +442,9 @@ export function CollectionSubView(schemaCtor: (doc: Doc) => T, moreProps?: generatedDocuments.push(doc); } if (generatedDocuments.length) { - const set = generatedDocuments.length > 1 && generatedDocuments.map(d => Doc.iconify(d)); + const set = generatedDocuments.length > 1 && generatedDocuments.map(d => DocUtils.iconify(d)); if (set) { - addDocument(Doc.pileup(generatedDocuments, options.x!, options.y!)!); + addDocument(DocUtils.pileup(generatedDocuments, options.x!, options.y!)!); } else { generatedDocuments.forEach(addDocument); } @@ -469,3 +461,10 @@ export function CollectionSubView(schemaCtor: (doc: Doc) => T, moreProps?: return CollectionSubView; } +import { DragManager, dropActionType } from "../../util/DragManager"; +import { Docs, DocumentOptions, DocUtils } from "../../documents/Documents"; +import { CurrentUserUtils } from "../../util/CurrentUserUtils"; +import { DocumentType } from "../../documents/DocumentTypes"; +import { FormattedTextBox, GoogleRef } from "../nodes/formattedText/FormattedTextBox"; +import { CollectionView } from "./CollectionView"; +import { SelectionManager } from "../../util/SelectionManager"; diff --git a/src/client/views/collections/CollectionTreeView.tsx b/src/client/views/collections/CollectionTreeView.tsx index b2e1c0f73..e891c4274 100644 --- a/src/client/views/collections/CollectionTreeView.tsx +++ b/src/client/views/collections/CollectionTreeView.tsx @@ -757,7 +757,7 @@ export class CollectionTreeView extends CollectionSubView UndoManager.RunInBatch(() => Doc.makeCustomViewClicked(this.props.Document, undefined, "onCheckedClick"), "edit onCheckedClick"), icon: "edit" + description: "Edit onChecked Script", event: () => UndoManager.RunInBatch(() => DocUtils.makeCustomViewClicked(this.props.Document, undefined, "onCheckedClick"), "edit onCheckedClick"), icon: "edit" }); !existingOnClick && ContextMenu.Instance.addItem({ description: "OnClick...", subitems: onClicks, icon: "hand-point-right" }); } diff --git a/src/client/views/collections/CollectionView.tsx b/src/client/views/collections/CollectionView.tsx index fecba32c5..873f61331 100644 --- a/src/client/views/collections/CollectionView.tsx +++ b/src/client/views/collections/CollectionView.tsx @@ -14,36 +14,16 @@ import { BoolCast, Cast, NumCast, StrCast, ScriptCast } from '../../../fields/Ty import { ImageField } from '../../../fields/URLField'; import { TraceMobx } from '../../../fields/util'; import { Utils, setupMoveUpEvents, returnFalse, returnZero, emptyPath, emptyFunction, returnOne } from '../../../Utils'; -import { DocumentType } from '../../documents/DocumentTypes'; import { ImageUtils } from '../../util/Import & Export/ImageUtils'; import { ContextMenu } from "../ContextMenu"; import { FieldView, FieldViewProps } from '../nodes/FieldView'; import { ScriptBox } from '../ScriptBox'; import { Touchable } from '../Touchable'; -import { CollectionCarouselView } from './CollectionCarouselView'; -import { CollectionDockingView } from "./CollectionDockingView"; -import { AddCustomFreeFormLayout } from './collectionFreeForm/CollectionFreeFormLayoutEngines'; -import { CollectionFreeFormView } from './collectionFreeForm/CollectionFreeFormView'; -import { CollectionLinearView } from './CollectionLinearView'; -import { CollectionMulticolumnView } from './collectionMulticolumn/CollectionMulticolumnView'; -import { CollectionMultirowView } from './collectionMulticolumn/CollectionMultirowView'; -import { CollectionSchemaView } from "./CollectionSchemaView"; -import { CollectionStackingView } from './CollectionStackingView'; -import { CollectionStaffView } from './CollectionStaffView'; -import { SubCollectionViewProps } from './CollectionSubView'; -import { CollectionTimeView } from './CollectionTimeView'; -import { CollectionTreeView } from "./CollectionTreeView"; -import './CollectionView.scss'; -import { CollectionViewBaseChrome } from './CollectionViewChromes'; -import { CurrentUserUtils } from '../../util/CurrentUserUtils'; import { Id } from '../../../fields/FieldSymbols'; import { listSpec } from '../../../fields/Schema'; -import { Docs } from '../../documents/Documents'; import { ScriptField, ComputedField } from '../../../fields/ScriptField'; import { InteractionUtils } from '../../util/InteractionUtils'; import { ObjectField } from '../../../fields/ObjectField'; -import CollectionMapView from './CollectionMapView'; -import { CollectionPileView } from './CollectionPileView'; const higflyout = require("@hig/flyout"); export const { anchorPoints } = higflyout; export const Flyout = higflyout.default; @@ -519,4 +499,24 @@ export class CollectionView extends Touchable); } -} \ No newline at end of file +} +import { SubCollectionViewProps } from './CollectionSubView'; +import { CollectionCarouselView } from './CollectionCarouselView'; +import { CollectionDockingView } from "./CollectionDockingView"; +import { AddCustomFreeFormLayout } from './collectionFreeForm/CollectionFreeFormLayoutEngines'; +import { CollectionFreeFormView } from './collectionFreeForm/CollectionFreeFormView'; +import { CollectionLinearView } from './CollectionLinearView'; +import { CollectionMulticolumnView } from './collectionMulticolumn/CollectionMulticolumnView'; +import { CollectionMultirowView } from './collectionMulticolumn/CollectionMultirowView'; +import { CollectionSchemaView } from "./CollectionSchemaView"; +import { CollectionStackingView } from './CollectionStackingView'; +import { CollectionStaffView } from './CollectionStaffView'; +import { CollectionTimeView } from './CollectionTimeView'; +import { CollectionTreeView } from "./CollectionTreeView"; +import { CollectionMapView } from './CollectionMapView'; +import { CollectionPileView } from './CollectionPileView'; +import './CollectionView.scss'; +import { CollectionViewBaseChrome } from './CollectionViewChromes'; +import { CurrentUserUtils } from '../../util/CurrentUserUtils'; +import { DocumentType } from '../../documents/DocumentTypes'; +import { Docs } from '../../documents/Documents'; \ No newline at end of file diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx index fb7784b58..576c0c560 100644 --- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx +++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx @@ -29,7 +29,6 @@ import { undoBatch, UndoManager } from "../../../util/UndoManager"; import { COLLECTION_BORDER_WIDTH } from "../../../views/globalCssVariables.scss"; import { ContextMenu } from "../../ContextMenu"; import { ContextMenuProps } from "../../ContextMenuItem"; -import { InkingControl } from "../../InkingControl"; import { CollectionFreeFormDocumentView } from "../../nodes/CollectionFreeFormDocumentView"; import { DocumentViewProps, DocumentView } from "../../nodes/DocumentView"; import { FormattedTextBox } from "../../nodes/formattedText/FormattedTextBox"; @@ -46,7 +45,7 @@ import React = require("react"); import { CollectionViewType } from "../CollectionView"; import { Timeline } from "../../animationtimeline/Timeline"; import { SnappingManager } from "../../../util/SnappingManager"; -import { FontAwesomeIcon } from "@fortawesome/react-fontawesome"; +import { InkingStroke } from "../../InkingStroke"; library.add(faEye as any, faTable, faPaintBrush, faExpandArrowsAlt, faCompressArrowsAlt, faCompass, faUpload, faBraille, faChalkboard, faFileUpload); @@ -391,7 +390,7 @@ export class CollectionFreeFormView extends CollectionSubView { - if (e.nativeEvent.cancelBubble || InteractionUtils.IsType(e, InteractionUtils.TOUCHTYPE) || InteractionUtils.IsType(e, InteractionUtils.PENTYPE) || (InkingControl.Instance.selectedTool === InkTool.Highlighter || InkingControl.Instance.selectedTool === InkTool.Pen)) { + if (e.nativeEvent.cancelBubble || InteractionUtils.IsType(e, InteractionUtils.TOUCHTYPE) || InteractionUtils.IsType(e, InteractionUtils.PENTYPE) || (Doc.selectedTool === InkTool.Highlighter || Doc.selectedTool === InkTool.Pen)) { return; } this._hitCluster = this.props.Document.useClusters ? this.pickCluster(this.getTransform().transformPoint(e.clientX, e.clientY)) !== -1 : false; @@ -408,7 +407,7 @@ export class CollectionFreeFormView extends CollectionSubView void = unimplementedFunction; - public changeBezier: (e: React.PointerEvent) => void = unimplementedFunction; - public changeWidth: (color: string) => void = unimplementedFunction; - - private _palette: (string)[]; - private _width: (string)[]; - - - public _circle: boolean; - public _triangle: boolean; - public _rectangle: boolean; - public _arrow: boolean; - public _line: boolean; - public _widthSelected: string; - - @observable public _circleBt: boolean; - @observable public _triangleBt: boolean; - @observable public _rectangleBt: boolean; - @observable public _arrowBt: boolean; - @observable public _lineBt: boolean; - @observable public _colorBt: boolean; - @observable public _color: string; - @observable public _bezierBt: boolean; - @observable public _widthBt: boolean; + private _palette = ["D0021B", "F5A623", "F8E71C", "8B572A", "7ED321", "417505", "9013FE", "4A90E2", "50E3C2", "B8E986", "000000", "4A4A4A", "9B9B9B", "FFFFFF"]; + private _width = ["1", "5", "10", "100", "200", "300"]; + private _buttons = ["circle", "triangle", "rectangle", "arrow", "line"]; + private _icons = ["O", "∆", "ロ", "➜", "-"]; + @observable _colorBtn = false; + @observable _widthBtn = false; constructor(props: Readonly<{}>) { super(props); InkOptionsMenu.Instance = this; - this._canFade = false; - - this._circle = false; - this._triangle = false; - this._rectangle = false; - this._arrow = false; - this._line = false; - this._circleBt = false; - this._triangleBt = false; - this._rectangleBt = false; - this._arrowBt = false; - this._lineBt = false; - this._colorBt = false; - this._bezierBt = false; - this._widthBt = false; - - this._color = ""; - this._widthSelected = ""; - - - this._palette = [ - "D0021B", "F5A623", "F8E71C", "8B572A", "7ED321", "417505", "9013FE", "4A90E2", "50E3C2", "B8E986", "000000", "4A4A4A", "9B9B9B", "FFFFFF", - ]; - - this._width = [ - "1", "5", "10", "100", "200", "300" - ]; - - } - - - - drag = (e: React.PointerEvent) => { - this.dragStart(e); + this._canFade = false; // don't let the inking menu fade away } - - - - - @action - toggleCircle = (e: React.PointerEvent) => { - const curr = this._circle; - this.allFalse(); - curr ? this._circle = false : this._circle = true; - this._circleBt = this._circle; - } - @action - toggleTriangle = (e: React.PointerEvent) => { - const curr = this._triangle; - this.allFalse(); - curr ? this._triangle = false : this._triangle = true; - this._triangleBt = this._triangle; - } - @action - toggleRectangle = (e: React.PointerEvent) => { - const curr = this._rectangle; - this.allFalse(); - curr ? this._rectangle = false : this._rectangle = true; - this._rectangleBt = this._rectangle; - } - @action - toggleArrow = (e: React.PointerEvent) => { - const curr = this._arrow; - this.allFalse(); - curr ? this._arrow = false : this._arrow = true; - this._arrowBt = this._arrow; - } @action - toggleLine = (e: React.PointerEvent) => { - const curr = this._line; - this.allFalse(); - curr ? this._line = false : this._line = true; - this._lineBt = this._line; + changeColor = (color: string) => { + const col: ColorState = { + hex: color, hsl: { a: 0, h: 0, s: 0, l: 0, source: "" }, hsv: { a: 0, h: 0, s: 0, v: 0, source: "" }, + rgb: { a: 0, r: 0, b: 0, g: 0, source: "" }, oldHue: 0, source: "", + }; + ColorBox.switchColor(col); } @action - changeBezierClick = (e: React.PointerEvent) => { - const curr = this._bezierBt; - this.allFalse(); - curr ? this._bezierBt = false : this._bezierBt = true; - this.changeBezier(e); - } - - @action - changeWidthClick = (e: React.PointerEvent) => { - this._widthBt ? this._widthBt = false : this._widthBt = true; - } - @action - changeColorClick = (e: React.PointerEvent) => { - this._colorBt ? this._colorBt = false : this._colorBt = true; - } - - allFalse = () => { - this._circle = false; - this._triangle = false; - this._rectangle = false; - this._arrow = false; - this._line = false; - this._circleBt = false; - this._triangleBt = false; - this._rectangleBt = false; - this._arrowBt = false; - this._lineBt = false; - this._bezierBt = false; + changeBezier = (e: React.PointerEvent): void => { + InkingControl.Instance.switchBezier(!InkingStroke.InkBezierApprox ? "300" : ""); } render() { - var widthPicker; - if (this._widthBt) { + var widthPicker = ; + if (this._widthBtn) { widthPicker =

- + {widthPicker} {this._width.map(wid => { return ; - })}
; - } else { - widthPicker = ; } - var colorPicker; - if (this._colorBt) { + var colorPicker = ; + if (this._colorBtn) { colorPicker =
- + {colorPicker} {this._palette.map(color => { return ; })}
; - } else { - colorPicker = ; } - const buttons = [ - , - , - , - , - , - , + <> + {this._buttons.map((btn, i) => )}, + , , widthPicker, @@ -271,4 +119,15 @@ export default class InkOptionsMenu extends AntimodeMenu { ]; return this.getElement(buttons); } -} \ No newline at end of file +} +Scripting.addGlobal(function activatePen(pen: any) { + InkingControl.Instance.switchTool(pen ? InkTool.Pen : InkTool.None); + if (pen) { + InkingControl.Instance.switchWidth(StrCast(pen.inkWidth, "1")); + InkingControl.Instance.switchColor(StrCast(pen.inkColor, "black")); + InkingControl.Instance.switchBezier(StrCast(pen.inkBezier, "")); + InkOptionsMenu.Instance.jumpTo(300, 300); + } else { + InkOptionsMenu.Instance.fadeOut(true); + } +}); \ No newline at end of file diff --git a/src/client/views/nodes/ColorBox.tsx b/src/client/views/nodes/ColorBox.tsx index 2ddf2c74a..762c57ae9 100644 --- a/src/client/views/nodes/ColorBox.tsx +++ b/src/client/views/nodes/ColorBox.tsx @@ -1,6 +1,6 @@ import React = require("react"); import { observer } from "mobx-react"; -import { SketchPicker } from 'react-color'; +import { SketchPicker, ColorState } from 'react-color'; import { documentSchema } from "../../../fields/documentSchemas"; import { makeInterface } from "../../../fields/Schema"; import { StrCast } from "../../../fields/Types"; @@ -10,6 +10,12 @@ import { ViewBoxBaseComponent } from "../DocComponent"; import { InkingControl } from "../InkingControl"; import "./ColorBox.scss"; import { FieldView, FieldViewProps } from './FieldView'; +import { InkingStroke } from "../InkingStroke"; +import { Doc } from "../../../fields/Doc"; +import { InkTool } from "../../../fields/InkField"; +import { undoBatch } from "../../util/UndoManager"; +import { action } from "mobx"; +import { FormattedTextBox } from "./formattedText/FormattedTextBox"; type ColorDocument = makeInterface<[typeof documentSchema]>; const ColorDocument = makeInterface(documentSchema); @@ -18,20 +24,52 @@ const ColorDocument = makeInterface(documentSchema); export class ColorBox extends ViewBoxBaseComponent(ColorDocument) { public static LayoutString(fieldKey: string) { return FieldView.LayoutString(ColorBox, fieldKey); } + static decimalToHexString(number: number) { + if (number < 0) { + number = 0xFFFFFFFF + number + 1; + } + return (number < 16 ? "0" : "") + number.toString(16).toUpperCase(); + } + + @undoBatch + @action + static switchColor(color: ColorState) { + Doc.UserDoc().backgroundColor = color.hex.startsWith("#") ? + color.hex + (color.rgb.a ? ColorBox.decimalToHexString(Math.round(color.rgb.a * 255)) : "ff") : color.hex; + InkingStroke.InkColor = StrCast(Doc.UserDoc().backgroundColor); + CurrentUserUtils.ActivePen && (CurrentUserUtils.ActivePen.inkColor = color.hex); + + if (Doc.selectedTool === InkTool.None) { + const selected = SelectionManager.SelectedDocuments(); + selected.map(view => { + const targetDoc = view.props.Document.dragFactory instanceof Doc ? view.props.Document.dragFactory : + view.props.Document.layout instanceof Doc ? view.props.Document.layout : + view.props.Document.isTemplateForField ? view.props.Document : Doc.GetProto(view.props.Document); + if (targetDoc) { + if (StrCast(Doc.Layout(view.props.Document).layout).indexOf("FormattedTextBox") !== -1 && FormattedTextBox.HadSelection) { + Doc.Layout(view.props.Document).color = Doc.UserDoc().bacgroundColor; + } else { + Doc.Layout(view.props.Document)._backgroundColor = Doc.UserDoc().backgroundColor; // '_backgroundColor' is template specific. 'backgroundColor' would apply to all templates, but has no UI at the moment + } + } + }); + } + } + render() { const selDoc = SelectionManager.SelectedDocuments()?.[0]?.rootDoc; return
e.button === 0 && !e.ctrlKey && e.stopPropagation()} style={{ transform: `scale(${this.props.ContentScaling()})`, width: `${100 / this.props.ContentScaling()}%`, height: `${100 / this.props.ContentScaling()}%` }} > -
-
{InkingControl.Instance.selectedWidth ?? 2}
- ) => InkingControl.Instance.switchWidth(e.target.value)} /> -
{InkingControl.Instance.selectedBezier ?? 2}
- ) => InkingControl.Instance.switchBezier(e.target.value)} /> +
{InkingStroke.InkWidth ?? 2}
+ ) => InkingControl.Instance.switchWidth(e.target.value)} /> +
{InkingStroke.InkBezierApprox ?? 2}
+ ) => InkingControl.Instance.switchBezier(e.target.value)} />

diff --git a/src/client/views/nodes/DocumentView.tsx b/src/client/views/nodes/DocumentView.tsx index e245e045c..196e61a31 100644 --- a/src/client/views/nodes/DocumentView.tsx +++ b/src/client/views/nodes/DocumentView.tsx @@ -37,7 +37,6 @@ import { ContextMenu } from "../ContextMenu"; import { ContextMenuProps } from '../ContextMenuItem'; import { DocComponent } from "../DocComponent"; import { EditableView } from '../EditableView'; -import { InkingControl } from '../InkingControl'; import { KeyphraseQueryView } from '../KeyphraseQueryView'; import { DocumentContentsView } from "./DocumentContentsView"; import "./DocumentView.scss"; @@ -330,7 +329,7 @@ export class DocumentView extends DocComponent(Docu } else func(); } else if (this.Document["onClick-rawScript"] && !StrCast(Doc.LayoutField(this.layoutDoc))?.includes("ScriptingBox")) {// bcz: hack? don't edit a script if you're clicking on a scripting box itself const alias = Doc.MakeAlias(this.props.Document); - Doc.makeCustomViewClicked(alias, undefined, "onClick"); + DocUtils.makeCustomViewClicked(alias, undefined, "onClick"); this.props.addDocTab(alias, "onRight"); // UndoManager.RunInBatch(() => Doc.makeCustomViewClicked(this.props.Document, undefined, "onClick"), "edit onClick"); //ScriptBox.EditButtonScript("On Button Clicked ...", this.props.Document, "onClick", e.clientX, e.clientY), "on button click"); @@ -513,7 +512,7 @@ export class DocumentView extends DocComponent(Docu // console.log(e.button) // console.log(e.nativeEvent) // continue if the event hasn't been canceled AND we are using a moues or this is has an onClick or onDragStart function (meaning it is a button document) - if (!(InteractionUtils.IsType(e, InteractionUtils.MOUSETYPE) || InkingControl.Instance.selectedTool === InkTool.Highlighter || InkingControl.Instance.selectedTool === InkTool.Pen)) { + if (!(InteractionUtils.IsType(e, InteractionUtils.MOUSETYPE) || Doc.selectedTool === InkTool.Highlighter || Doc.selectedTool === InkTool.Pen)) { if (!InteractionUtils.IsType(e, InteractionUtils.PENTYPE)) { e.stopPropagation(); // TODO: check here for panning/inking @@ -544,7 +543,7 @@ export class DocumentView extends DocComponent(Docu onPointerMove = (e: PointerEvent): void => { if ((e as any).formattedHandled) { e.stopPropagation(); return; } - if ((InteractionUtils.IsType(e, InteractionUtils.PENTYPE) || InkingControl.Instance.selectedTool === InkTool.Highlighter || InkingControl.Instance.selectedTool === InkTool.Pen)) return; + if ((InteractionUtils.IsType(e, InteractionUtils.PENTYPE) || Doc.selectedTool === InkTool.Highlighter || Doc.selectedTool === InkTool.Pen)) return; if (e.cancelBubble && this.active) { document.removeEventListener("pointermove", this.onPointerMove); // stop listening to pointerMove if something else has stopPropagated it (e.g., the MarqueeView) } @@ -728,7 +727,7 @@ export class DocumentView extends DocComponent(Docu onClicks.push({ description: this.Document.isLinkButton ? "Remove Follow Behavior" : "Follow Link in Place", event: this.toggleFollowInPlace, icon: "concierge-bell" }); onClicks.push({ description: this.Document.isLinkButton ? "Remove Follow Behavior" : "Follow Link on Right", event: this.toggleFollowOnRight, icon: "concierge-bell" }); onClicks.push({ description: this.Document.isLinkButton || this.Document.onClick ? "Remove Click Behavior" : "Follow Link", event: this.toggleLinkButtonBehavior, icon: "concierge-bell" }); - onClicks.push({ description: "Edit onClick Script", event: () => UndoManager.RunInBatch(() => Doc.makeCustomViewClicked(this.props.Document, undefined, "onClick"), "edit onClick"), icon: "edit" }); + onClicks.push({ description: "Edit onClick Script", event: () => UndoManager.RunInBatch(() => DocUtils.makeCustomViewClicked(this.props.Document, undefined, "onClick"), "edit onClick"), icon: "edit" }); !existingOnClick && cm.addItem({ description: "OnClick...", subitems: onClicks, icon: "hand-point-right" }); @@ -1091,14 +1090,14 @@ export class DocumentView extends DocComponent(Docu @computed get ignorePointerEvents() { return this.props.pointerEvents === false || (this.Document.isBackground && !this.isSelected() && !SnappingManager.GetIsDragging()) || - (this.Document.type === DocumentType.INK && InkingControl.Instance.selectedTool !== InkTool.None); + (this.Document.type === DocumentType.INK && Doc.selectedTool !== InkTool.None); } @undoBatch @action setCustomView = (custom: boolean, layout: string): void => { Doc.setNativeView(this.props.Document); if (custom) { - Doc.makeCustomViewClicked(this.props.Document, Docs.Create.StackingDocument, layout, undefined); + DocUtils.makeCustomViewClicked(this.props.Document, Docs.Create.StackingDocument, layout, undefined); } } @observable _animateScalingTo = 0; diff --git a/src/client/views/nodes/ImageBox.tsx b/src/client/views/nodes/ImageBox.tsx index 6913dfbc7..cabf30c13 100644 --- a/src/client/views/nodes/ImageBox.tsx +++ b/src/client/views/nodes/ImageBox.tsx @@ -192,7 +192,7 @@ export class ImageBox extends ViewBoxAnnotatableComponent { const converter = (results: any) => { - return results.map((face: CognitiveServices.Image.Face) => Docs.Get.FromJson({ data: face, title: `Face: ${face.faceId}` })!); + return results.map((face: CognitiveServices.Image.Face) => Doc.Get.FromJson({ data: face, title: `Face: ${face.faceId}` })!); }; this.url && CognitiveServices.Image.Appliers.ProcessImage(this.dataDoc, [this.fieldKey + "-faces"], this.url, Service.Face, converter); } diff --git a/src/client/views/nodes/PresBox.tsx b/src/client/views/nodes/PresBox.tsx index 9f1e99c77..81669dc2a 100644 --- a/src/client/views/nodes/PresBox.tsx +++ b/src/client/views/nodes/PresBox.tsx @@ -11,7 +11,6 @@ import { DocumentManager } from "../../util/DocumentManager"; import { undoBatch } from "../../util/UndoManager"; import { CollectionDockingView } from "../collections/CollectionDockingView"; import { CollectionView, CollectionViewType } from "../collections/CollectionView"; -import { InkingControl } from "../InkingControl"; import { FieldView, FieldViewProps } from './FieldView'; import "./PresBox.scss"; import { ViewBoxBaseComponent } from "../DocComponent"; @@ -20,6 +19,7 @@ import { Docs } from "../../documents/Documents"; import { PrefetchProxy } from "../../../fields/Proxy"; import { ScriptField } from "../../../fields/ScriptField"; import { Scripting } from "../../util/Scripting"; +import { InkingStroke } from "../InkingStroke"; type PresBoxSchema = makeInterface<[typeof documentSchema]>; const PresBoxDocument = makeInterface(documentSchema); @@ -293,7 +293,7 @@ export class PresBox extends ViewBoxBaseComponent selectElement = (doc: Doc) => this.gotoDocument(this.childDocs.indexOf(doc), NumCast(this.itemIndex)); getTransform = () => this.props.ScreenToLocalTransform().translate(-5, -65);// listBox padding-left and pres-box-cont minHeight panelHeight = () => this.props.PanelHeight() - 20; - active = (outsideReaction?: boolean) => ((InkingControl.Instance.selectedTool === InkTool.None && !this.layoutDoc.isBackground) && + active = (outsideReaction?: boolean) => ((Doc.selectedTool === InkTool.None && !this.layoutDoc.isBackground) && (this.layoutDoc.forceActive || this.props.isSelected(outsideReaction) || this._isChildActive || this.props.renderDepth === 0) ? true : false) render() { diff --git a/src/client/views/nodes/ScreenshotBox.tsx b/src/client/views/nodes/ScreenshotBox.tsx index 29e3c008a..1184f32f1 100644 --- a/src/client/views/nodes/ScreenshotBox.tsx +++ b/src/client/views/nodes/ScreenshotBox.tsx @@ -5,21 +5,19 @@ import { FontAwesomeIcon } from "@fortawesome/react-fontawesome"; import { action, computed, IReactionDisposer, observable, runInAction } from "mobx"; import { observer } from "mobx-react"; import * as rp from 'request-promise'; +import { Doc } from "../../../fields/Doc"; import { documentSchema } from "../../../fields/documentSchemas"; -import { makeInterface, listSpec } from "../../../fields/Schema"; +import { listSpec, makeInterface } from "../../../fields/Schema"; import { Cast, NumCast } from "../../../fields/Types"; import { VideoField } from "../../../fields/URLField"; -import { emptyFunction, returnFalse, returnOne, Utils, returnZero } from "../../../Utils"; -import { Docs, DocUtils } from "../../documents/Documents"; +import { emptyFunction, returnFalse, returnOne, returnZero, Utils } from "../../../Utils"; +import { Docs } from "../../documents/Documents"; import { CollectionFreeFormView } from "../collections/collectionFreeForm/CollectionFreeFormView"; import { ContextMenu } from "../ContextMenu"; import { ContextMenuProps } from "../ContextMenuItem"; import { ViewBoxBaseComponent } from "../DocComponent"; -import { InkingControl } from "../InkingControl"; import { FieldView, FieldViewProps } from './FieldView'; import "./ScreenshotBox.scss"; -import { Doc, WidthSym, HeightSym } from "../../../fields/Doc"; -import { OverlayView } from "../OverlayView"; const path = require('path'); type ScreenshotDocument = makeInterface<[typeof documentSchema]>; @@ -134,7 +132,7 @@ export class ScreenshotBox extends ViewBoxBaseComponentLoading
:
{!this.layoutDoc._showSidebar ? (null) : this.sidebarWidthPercent === "0%" ?
: -
([clipDoc]); clipDoc.rootDocument = targetDoc; - Doc.makeCustomViewClicked(targetDoc, Docs.Create.StackingDocument, "slideView", undefined); + DocUtils.makeCustomViewClicked(targetDoc, Docs.Create.StackingDocument, "slideView", undefined); targetDoc.layoutKey = "layout"; // const targetDoc = Docs.Create.TextDocument("", { _width: 200, _height: 200, title: "Note linked to " + this.props.Document.title }); // Doc.GetProto(targetDoc).snipped = this.dataDoc[this.props.fieldKey][Copy](); @@ -652,7 +650,7 @@ export class PDFViewer extends ViewBoxAnnotatableComponent (this.Document.scrollHeight || this.Document._nativeHeight || 0); panelHeight = () => this._pageSizes.length && this._pageSizes[0] ? this._pageSizes[0].width : (this.Document._nativeWidth || 0); @computed get overlayLayer() { - return
; const frozen = !this.props.isSelected() || DocumentDecorations.Instance.Interacting; - const classname = "webBox-cont" + (this.props.isSelected() && !InkingControl.Instance.selectedTool && !DocumentDecorations.Instance.Interacting ? "-interactive" : ""); + const classname = "webBox-cont" + (this.props.isSelected() && !Doc.selectedTool && !DocumentDecorations.Instance.Interacting ? "-interactive" : ""); return ( diff --git a/src/fields/Doc.ts b/src/fields/Doc.ts index 6891bf652..d635836bb 100644 --- a/src/fields/Doc.ts +++ b/src/fields/Doc.ts @@ -6,20 +6,18 @@ import { DocumentType } from "../client/documents/DocumentTypes"; import { Scripting, scriptingGlobal } from "../client/util/Scripting"; import { afterDocDeserialize, autoObject, Deserializable, SerializationHelper } from "../client/util/SerializationHelper"; import { UndoManager } from "../client/util/UndoManager"; -import { intersectRect, Utils } from "../Utils"; -import { HandleUpdate, Id, OnUpdate, Parent, Self, SelfProxy, ToScriptString, ToString, Update, Copy } from "./FieldSymbols"; +import { intersectRect } from "../Utils"; +import { Copy, HandleUpdate, Id, OnUpdate, Parent, Self, SelfProxy, ToScriptString, ToString, Update } from "./FieldSymbols"; +import { InkTool } from "./InkField"; import { List } from "./List"; import { ObjectField } from "./ObjectField"; import { PrefetchProxy, ProxyField } from "./Proxy"; import { FieldId, RefField } from "./RefField"; import { RichTextField } from "./RichTextField"; import { listSpec } from "./Schema"; -import { ComputedField, ScriptField } from "./ScriptField"; -import { Cast, FieldValue, NumCast, StrCast, ToConstructor, ScriptCast } from "./Types"; +import { ComputedField } from "./ScriptField"; +import { Cast, FieldValue, NumCast, StrCast, ToConstructor } from "./Types"; import { deleteProperty, getField, getter, makeEditable, makeReadOnly, setter, updateFunction } from "./util"; -import { Docs, DocumentOptions } from "../client/documents/Documents"; -import { PdfField, VideoField, AudioField, ImageField } from "./URLField"; -import { LinkManager } from "../client/util/LinkManager"; export namespace Field { export function toKeyValueString(doc: Doc, key: string): string { @@ -134,6 +132,7 @@ function fetchProto(doc: Doc) { @scriptingGlobal @Deserializable("Doc", fetchProto).withFields(["id"]) export class Doc extends RefField { + @computed public static get selectedTool(): InkTool { return FieldValue(NumCast(Doc.UserDoc().inkTool)) ?? InkTool.None; } constructor(id?: FieldId, forceSave?: boolean) { super(id); const doc = new Proxy(this, { @@ -618,76 +617,6 @@ export namespace Doc { return copy; } - export function MakeClone(doc: Doc): Doc { - const cloneMap = new Map(); - const rtfMap: { copy: Doc, key: string, field: RichTextField }[] = []; - const copy = Doc.makeClone(doc, cloneMap, rtfMap); - rtfMap.map(({ copy, key, field }) => { - const replacer = (match: any, attr: string, id: string, offset: any, string: any) => { - const mapped = cloneMap.get(id); - return attr + "\"" + (mapped ? mapped[Id] : id) + "\""; - }; - const replacer2 = (match: any, href: string, id: string, offset: any, string: any) => { - const mapped = cloneMap.get(id); - return href + (mapped ? mapped[Id] : id); - }; - const regex = `(${Utils.prepend("/doc/")})([^"]*)`; - const re = new RegExp(regex, "g"); - copy[key] = new RichTextField(field.Data.replace(/("docid":|"targetId":|"linkId":)"([^"]+)"/g, replacer).replace(re, replacer2), field.Text); - }); - return copy; - } - - export function makeClone(doc: Doc, cloneMap: Map, rtfs: { copy: Doc, key: string, field: RichTextField }[]): Doc { - if (Doc.IsBaseProto(doc)) return doc; - if (cloneMap.get(doc[Id])) return cloneMap.get(doc[Id])!; - const copy = new Doc(undefined, true); - cloneMap.set(doc[Id], copy); - if (LinkManager.Instance.getAllLinks().includes(doc) && LinkManager.Instance.getAllLinks().indexOf(copy) === -1) LinkManager.Instance.addLink(copy); - const exclude = Cast(doc.excludeFields, listSpec("string"), []); - Object.keys(doc).forEach(key => { - if (exclude.includes(key)) return; - const cfield = ComputedField.WithoutComputed(() => FieldValue(doc[key])); - const field = ProxyField.WithoutProxy(() => doc[key]); - const copyObjectField = (field: ObjectField) => { - const list = Cast(doc[key], listSpec(Doc)); - if (list !== undefined && !(list instanceof Promise)) { - copy[key] = new List(list.filter(d => d instanceof Doc).map(d => Doc.makeClone(d as Doc, cloneMap, rtfs))); - } else if (doc[key] instanceof Doc) { - copy[key] = key.includes("layout[") ? undefined : Doc.makeClone(doc[key] as Doc, cloneMap, rtfs); // reference documents except copy documents that are expanded teplate fields - } else { - copy[key] = ObjectField.MakeCopy(field); - if (field instanceof RichTextField) { - if (field.Data.includes('"docid":') || field.Data.includes('"targetId":') || field.Data.includes('"linkId":')) { - rtfs.push({ copy, key, field }); - } - } - } - }; - if (key === "proto") { - if (doc[key] instanceof Doc) { - copy[key] = Doc.makeClone(doc[key]!, cloneMap, rtfs); - } - } else { - if (field instanceof RefField) { - copy[key] = field; - } else if (cfield instanceof ComputedField) { - copy[key] = ComputedField.MakeFunction(cfield.script.originalScript); - (key === "links" && field instanceof ObjectField) && copyObjectField(field); - } else if (field instanceof ObjectField) { - copyObjectField(field); - } else if (field instanceof Promise) { - debugger; //This shouldn't happend... - } else { - copy[key] = field; - } - } - }); - Doc.SetInPlace(copy, "title", "CLONE: " + doc.title, true); - copy.cloneOf = doc; - cloneMap.set(doc[Id], copy); - return copy; - } export function MakeDelegate(doc: Doc, id?: string, title?: string): Doc; export function MakeDelegate(doc: Opt, id?: string, title?: string): Opt; @@ -998,120 +927,147 @@ export namespace Doc { return false; } - // applies a custom template to a document. the template is identified by it's short name (e.g, slideView not layout_slideView) - export function makeCustomViewClicked(doc: Doc, creator: Opt<(documents: Array, options: DocumentOptions, id?: string) => Doc>, templateSignature: string = "custom", docLayoutTemplate?: Doc) { - const batch = UndoManager.StartBatch("makeCustomViewClicked"); - runInAction(() => { - doc.layoutKey = "layout_" + templateSignature; - if (doc[doc.layoutKey] === undefined) { - createCustomView(doc, creator, templateSignature, docLayoutTemplate); - } - }); - batch.end(); - } - export function findTemplate(templateName: string, type: string, signature: string) { - let docLayoutTemplate: Opt; - const iconViews = DocListCast(Cast(Doc.UserDoc()["template-icons"], Doc, null)?.data); - const templBtns = DocListCast(Cast(Doc.UserDoc()["template-buttons"], Doc, null)?.data); - const noteTypes = DocListCast(Cast(Doc.UserDoc()["template-notes"], Doc, null)?.data); - const clickFuncs = DocListCast(Cast(Doc.UserDoc().clickFuncs, Doc, null)?.data); - const allTemplates = iconViews.concat(templBtns).concat(noteTypes).concat(clickFuncs).map(btnDoc => (btnDoc.dragFactory as Doc) || btnDoc).filter(doc => doc.isTemplateDoc); - // bcz: this is hacky -- want to have different templates be applied depending on the "type" of a document. but type is not reliable and there could be other types of template searches so this should be generalized - // first try to find a template that matches the specific document type (_). otherwise, fallback to a general match on - !docLayoutTemplate && allTemplates.forEach(tempDoc => StrCast(tempDoc.title) === templateName + "_" + type && (docLayoutTemplate = tempDoc)); - !docLayoutTemplate && allTemplates.forEach(tempDoc => StrCast(tempDoc.title) === templateName && (docLayoutTemplate = tempDoc)); - return docLayoutTemplate; - } - export function createCustomView(doc: Doc, creator: Opt<(documents: Array, options: DocumentOptions, id?: string) => Doc>, templateSignature: string = "custom", docLayoutTemplate?: Doc) { - const templateName = templateSignature.replace(/\(.*\)/, ""); - docLayoutTemplate = docLayoutTemplate || findTemplate(templateName, StrCast(doc.type), templateSignature); - - const customName = "layout_" + templateSignature; - const _width = NumCast(doc._width); - const _height = NumCast(doc._height); - const options = { title: "data", backgroundColor: StrCast(doc.backgroundColor), _autoHeight: true, _width, x: -_width / 2, y: - _height / 2, _showSidebar: false }; - - let fieldTemplate: Opt; - if (doc.data instanceof RichTextField || typeof (doc.data) === "string") { - fieldTemplate = Docs.Create.TextDocument("", options); - } else if (doc.data instanceof PdfField) { - fieldTemplate = Docs.Create.PdfDocument("http://www.msn.com", options); - } else if (doc.data instanceof VideoField) { - fieldTemplate = Docs.Create.VideoDocument("http://www.cs.brown.edu", options); - } else if (doc.data instanceof AudioField) { - fieldTemplate = Docs.Create.AudioDocument("http://www.cs.brown.edu", options); - } else if (doc.data instanceof ImageField) { - fieldTemplate = Docs.Create.ImageDocument("http://www.cs.brown.edu", options); - } - const docTemplate = docLayoutTemplate || creator?.(fieldTemplate ? [fieldTemplate] : [], { title: customName + "(" + doc.title + ")", isTemplateDoc: true, _width: _width + 20, _height: Math.max(100, _height + 45) }); - fieldTemplate && Doc.MakeMetadataFieldTemplate(fieldTemplate, docTemplate ? Doc.GetProto(docTemplate) : docTemplate); - docTemplate && Doc.ApplyTemplateTo(docTemplate, doc, customName, undefined); - } - export function makeCustomView(doc: Doc, custom: boolean, layout: string) { - Doc.setNativeView(doc); - if (custom) { - makeCustomViewClicked(doc, Docs.Create.StackingDocument, layout, undefined); + export namespace Get { + + const primitives = ["string", "number", "boolean"]; + + export interface JsonConversionOpts { + data: any; + title?: string; + appendToExisting?: { targetDoc: Doc, fieldKey?: string }; + excludeEmptyObjects?: boolean; } - } - export function iconify(doc: Doc) { - const layoutKey = Cast(doc.layoutKey, "string", null); - Doc.makeCustomViewClicked(doc, Docs.Create.StackingDocument, "icon", undefined); - if (layoutKey && layoutKey !== "layout" && layoutKey !== "layout_icon") doc.deiconifyLayout = layoutKey.replace("layout_", ""); - } - export function pileup(docList: Doc[], x?: number, y?: number) { - let w = 0, h = 0; - runInAction(() => { - docList.forEach(d => { - Doc.iconify(d); - w = Math.max(d[WidthSym](), w); - h = Math.max(d[HeightSym](), h); - }); - h = Math.max(h, w * 4 / 3); // converting to an icon does not update the height right away. so this is a fallback hack to try to do something reasonable - docList.forEach((d, i) => { - d.x = Math.cos(Math.PI * 2 * i / docList.length) * 10 - w / 2; - d.y = Math.sin(Math.PI * 2 * i / docList.length) * 10 - h / 2; - d.displayTimecode = undefined; // bcz: this should be automatic somehow.. along with any other properties that were logically associated with the original collection - }); - }); - if (x !== undefined && y !== undefined) { - const newCollection = Docs.Create.PileDocument(docList, { title: "pileup", x: x - 55, y: y - 55, _width: 110, _height: 100, _LODdisable: true }); - newCollection.x = NumCast(newCollection.x) + NumCast(newCollection._width) / 2 - 55; - newCollection.y = NumCast(newCollection.y) + NumCast(newCollection._height) / 2 - 55; - newCollection._width = newCollection._height = 110; - //newCollection.borderRounding = "40px"; - newCollection._jitterRotation = 10; - newCollection._backgroundColor = "gray"; - newCollection._overflow = "visible"; - return newCollection; + const defaultKey = "json"; + + /** + * This function takes any valid JSON(-like) data, i.e. parsed or unparsed, and at arbitrarily + * deep levels of nesting, converts the data and structure into nested documents with the appropriate fields. + * + * After building a hierarchy within / below a top-level document, it then returns that top-level parent. + * + * If we've received a string, treat it like valid JSON and try to parse it into an object. If this fails, the + * string is invalid JSON, so we should assume that the input is the result of a JSON.parse() + * call that returned a regular string value to be stored as a Field. + * + * If we've received something other than a string, since the caller might also pass in the results of a + * JSON.parse() call, valid input might be an object, an array (still typeof object), a boolean or a number. + * Anything else (like a function, etc. passed in naively as any) is meaningless for this operation. + * + * All TS/JS objects get converted directly to documents, directly preserving the key value structure. Everything else, + * lacking the key value structure, gets stored as a field in a wrapper document. + * + * @param data for convenience and flexibility, either a valid JSON string to be parsed, + * or the result of any JSON.parse() call. + * @param title an optional title to give to the highest parent document in the hierarchy. + * If whether this function creates a new document or appendToExisting is specified and that document already has a title, + * because this title field can be left undefined for the opposite behavior, including a title will overwrite the existing title. + * @param appendToExisting **if specified**, there are two cases, both of which return the target document: + * + * 1) the json to be converted can be represented as a document, in which case the target document will act as the root + * of the tree and receive all the conversion results as new fields on itself + * 2) the json can't be represented as a document, in which case the function will assign the field-level conversion + * results to either the specified key on the target document, or to its "json" key by default. + * + * If not specified, the function creates and returns a new entirely generic document (different from the Doc.Create calls) + * to act as the root of the tree. + * + * One might choose to specify this field if you want to write to a document returned from a Document.Create function call, + * say a TreeView document that will be rendered, not just an untyped, identityless doc that would otherwise be created + * from a default call to new Doc. + * + * @param excludeEmptyObjects whether non-primitive objects (TypeScript objects and arrays) should be converted even + * if they contain no data. By default, empty objects and arrays are ignored. + */ + export function FromJson({ data, title, appendToExisting, excludeEmptyObjects }: JsonConversionOpts): Opt { + if (excludeEmptyObjects === undefined) { + excludeEmptyObjects = true; + } + if (data === undefined || data === null || ![...primitives, "object"].includes(typeof data)) { + return undefined; + } + let resolved: any; + try { + resolved = JSON.parse(typeof data === "string" ? data : JSON.stringify(data)); + } catch (e) { + return undefined; + } + let output: Opt; + if (typeof resolved === "object" && !(resolved instanceof Array)) { + output = convertObject(resolved, excludeEmptyObjects, title, appendToExisting?.targetDoc); + } else { + const result = toField(resolved, excludeEmptyObjects); + if (appendToExisting) { + (output = appendToExisting.targetDoc)[appendToExisting.fieldKey || defaultKey] = result; + } else { + (output = new Doc).json = result; + } + } + title && output && (output.title = title); + return output; } - } + /** + * For each value of the object, recursively convert it to its appropriate field value + * and store the field at the appropriate key in the document if it is not undefined + * @param object the object to convert + * @returns the object mapped from JSON to field values, where each mapping + * might involve arbitrary recursion (since toField might itself call convertObject) + */ + const convertObject = (object: any, excludeEmptyObjects: boolean, title?: string, target?: Doc): Opt => { + const hasEntries = Object.keys(object).length; + if (hasEntries || !excludeEmptyObjects) { + const resolved = target ?? new Doc; + if (hasEntries) { + let result: Opt; + Object.keys(object).map(key => { + // if excludeEmptyObjects is true, any qualifying conversions from toField will + // be undefined, and thus the results that would have + // otherwise been empty (List or Doc)s will just not be written + if (result = toField(object[key], excludeEmptyObjects, key)) { + resolved[key] = result; + } + }); + } + title && (resolved.title = title); + return resolved; + } + }; - export async function addFieldEnumerations(doc: Opt, enumeratedFieldKey: string, enumerations: { title: string, _backgroundColor?: string, color?: string }[]) { - let optionsCollection = await DocServer.GetRefField(enumeratedFieldKey); - if (!(optionsCollection instanceof Doc)) { - optionsCollection = Docs.Create.StackingDocument([], { title: `${enumeratedFieldKey} field set` }, enumeratedFieldKey); - Doc.AddDocToList((Doc.UserDoc().fieldTypes as Doc), "data", optionsCollection as Doc); - } - const options = optionsCollection as Doc; - const targetDoc = doc && Doc.GetProto(Cast(doc.rootDocument, Doc, null) || doc); - const docFind = `options.data.find(doc => doc.title === (this.rootDocument||this)["${enumeratedFieldKey}"])?`; - targetDoc && (targetDoc.backgroundColor = ComputedField.MakeFunction(docFind + `._backgroundColor || "white"`, undefined, { options })); - targetDoc && (targetDoc.color = ComputedField.MakeFunction(docFind + `.color || "black"`, undefined, { options })); - targetDoc && (targetDoc.borderRounding = ComputedField.MakeFunction(docFind + `.borderRounding`, undefined, { options })); - enumerations.map(enumeration => { - const found = DocListCast(options.data).find(d => d.title === enumeration.title); - if (found) { - found._backgroundColor = enumeration._backgroundColor || found._backgroundColor; - found._color = enumeration.color || found._color; - } else { - Doc.AddDocToList(options, "data", Docs.Create.TextDocument(enumeration.title, enumeration)); + /** + * For each element in the list, recursively convert it to a document or other field + * and push the field to the list if it is not undefined + * @param list the list to convert + * @returns the list mapped from JSON to field values, where each mapping + * might involve arbitrary recursion (since toField might itself call convertList) + */ + const convertList = (list: Array, excludeEmptyObjects: boolean): Opt> => { + const target = new List(); + let result: Opt; + // if excludeEmptyObjects is true, any qualifying conversions from toField will + // be undefined, and thus the results that would have + // otherwise been empty (List or Doc)s will just not be written + list.map(item => (result = toField(item, excludeEmptyObjects)) && target.push(result)); + if (target.length || !excludeEmptyObjects) { + return target; } - }); - return optionsCollection; + }; + + const toField = (data: any, excludeEmptyObjects: boolean, title?: string): Opt => { + if (data === null || data === undefined) { + return undefined; + } + if (primitives.includes(typeof data)) { + return data; + } + if (typeof data === "object") { + return data instanceof Array ? convertList(data, excludeEmptyObjects) : convertObject(data, excludeEmptyObjects, title, undefined); + } + throw new Error(`How did ${data} of type ${typeof data} end up in JSON?`); + }; } + } Scripting.addGlobal(function renameAlias(doc: any, n: any) { return StrCast(Doc.GetProto(doc).title).replace(/\([0-9]*\)/, "") + `(${n})`; }); diff --git a/src/pen-gestures/GestureUtils.ts b/src/pen-gestures/GestureUtils.ts index a50cca2b0..20e14a68d 100644 --- a/src/pen-gestures/GestureUtils.ts +++ b/src/pen-gestures/GestureUtils.ts @@ -1,12 +1,6 @@ -import { NDollarRecognizer } from "./ndollar"; -import { Type } from "typescript"; -import { InkField, PointData } from "../fields/InkField"; -import { Docs } from "../client/documents/Documents"; -import { Doc, WidthSym, HeightSym } from "../fields/Doc"; -import { NumCast } from "../fields/Types"; -import { CollectionFreeFormView } from "../client/views/collections/collectionFreeForm/CollectionFreeFormView"; import { Rect } from "react-measure"; -import { Scripting } from "../client/util/Scripting"; +import { PointData } from "../fields/InkField"; +import { NDollarRecognizer } from "./ndollar"; export namespace GestureUtils { export class GestureEvent { -- cgit v1.2.3-70-g09d2 From 4cc9c6ae9a2735266994c62c01818de4bdc25ac6 Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Mon, 8 Jun 2020 20:45:38 -0400 Subject: final cleanup of ink related stuff so that things are more structured and we avoid input cycles --- src/Utils.ts | 13 ++ .../apis/google_docs/GooglePhotosClientUtils.ts | 4 +- src/client/apis/youtube/YoutubeBox.tsx | 2 +- src/client/documents/Documents.ts | 81 +------------ src/client/util/CurrentUserUtils.ts | 59 +++++----- src/client/util/LinkManager.ts | 10 +- src/client/views/DocComponent.tsx | 6 +- src/client/views/GestureOverlay.tsx | 35 +++--- src/client/views/GlobalKeyHandler.ts | 37 +++--- src/client/views/InkingControl.scss | 131 --------------------- src/client/views/InkingControl.tsx | 42 ------- src/client/views/InkingStroke.tsx | 47 ++++---- src/client/views/PreviewCursor.tsx | 4 +- src/client/views/collections/CollectionView.tsx | 33 ++++-- .../collectionFreeForm/CollectionFreeFormView.tsx | 16 +-- .../collectionFreeForm/InkOptionsMenu.tsx | 95 ++++++++------- src/client/views/nodes/ColorBox.tsx | 43 +++---- src/client/views/nodes/DocumentView.tsx | 6 +- src/client/views/nodes/PresBox.tsx | 2 +- src/client/views/nodes/ScreenshotBox.tsx | 2 +- src/client/views/nodes/VideoBox.tsx | 6 +- src/client/views/nodes/WebBox.tsx | 2 +- .../views/nodes/formattedText/FormattedTextBox.tsx | 4 +- src/client/views/pdf/PDFViewer.tsx | 2 +- src/client/views/webcam/DashWebRTCVideo.tsx | 4 +- src/fields/Doc.ts | 79 ++++++++++++- src/fields/InkField.ts | 10 +- src/mobile/MobileInterface.tsx | 7 +- 28 files changed, 312 insertions(+), 470 deletions(-) delete mode 100644 src/client/views/InkingControl.scss delete mode 100644 src/client/views/InkingControl.tsx (limited to 'src/client/util') diff --git a/src/Utils.ts b/src/Utils.ts index ef5002bec..e527634fd 100644 --- a/src/Utils.ts +++ b/src/Utils.ts @@ -2,6 +2,7 @@ import v4 = require('uuid/v4'); import v5 = require("uuid/v5"); import { Socket, Room } from 'socket.io'; import { Message } from './server/Message'; +import { ColorState } from 'react-color'; export namespace Utils { export let DRAG_THRESHOLD = 4; @@ -75,6 +76,18 @@ export namespace Utils { document.body.removeChild(textArea); } + export function decimalToHexString(number: number) { + if (number < 0) { + number = 0xFFFFFFFF + number + 1; + } + return (number < 16 ? "0" : "") + number.toString(16).toUpperCase(); + } + + export function colorString(color: ColorState) { + return color.hex.startsWith("#") ? + color.hex + (color.rgb.a ? decimalToHexString(Math.round(color.rgb.a * 255)) : "ff") : color.hex; + } + export function fromRGBAstr(rgba: string) { const rm = rgba.match(/rgb[a]?\(([ 0-9]+)/); const r = rm ? Number(rm[1]) : 0; diff --git a/src/client/apis/google_docs/GooglePhotosClientUtils.ts b/src/client/apis/google_docs/GooglePhotosClientUtils.ts index fef71ffeb..a604c7de1 100644 --- a/src/client/apis/google_docs/GooglePhotosClientUtils.ts +++ b/src/client/apis/google_docs/GooglePhotosClientUtils.ts @@ -8,7 +8,7 @@ import { Cast, StrCast } from "../../../fields/Types"; import { ImageField } from "../../../fields/URLField"; import { MediaItem, NewMediaItemResult } from "../../../server/apis/google/SharedTypes"; import { Utils } from "../../../Utils"; -import { Docs, DocumentOptions } from "../../documents/Documents"; +import { Docs, DocumentOptions, DocUtils } from "../../documents/Documents"; import { Networking } from "../../Network"; import { FormattedTextBox } from "../../views/nodes/formattedText/FormattedTextBox"; import GoogleAuthenticationManager from "../GoogleAuthenticationManager"; @@ -332,7 +332,7 @@ export namespace GooglePhotos { const url = data.url.href; const target = Doc.MakeAlias(source); const description = parseDescription(target, descriptionKey); - await Doc.makeCustomViewClicked(target, Docs.Create.FreeformDocument); + await DocUtils.makeCustomViewClicked(target, Docs.Create.FreeformDocument); media.push({ url, description }); } if (media.length) { diff --git a/src/client/apis/youtube/YoutubeBox.tsx b/src/client/apis/youtube/YoutubeBox.tsx index a7045ccb7..748d571c0 100644 --- a/src/client/apis/youtube/YoutubeBox.tsx +++ b/src/client/apis/youtube/YoutubeBox.tsx @@ -349,7 +349,7 @@ export class YoutubeBox extends React.Component { const frozen = !this.props.isSelected() || DocumentDecorations.Instance.Interacting; - const classname = "webBox-cont" + (this.props.isSelected() && !Doc.selectedTool && !DocumentDecorations.Instance.Interacting ? "-interactive" : ""); + const classname = "webBox-cont" + (this.props.isSelected() && !Doc.GetSelectedTool() && !DocumentDecorations.Instance.Interacting ? "-interactive" : ""); return ( <>
diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts index 994f8a147..9c807eff2 100644 --- a/src/client/documents/Documents.ts +++ b/src/client/documents/Documents.ts @@ -37,7 +37,7 @@ import { DashWebRTCVideo } from "../views/webcam/DashWebRTCVideo"; import { QueryBox } from "../views/nodes/QueryBox"; import { ColorBox } from "../views/nodes/ColorBox"; import { DocHolderBox } from "../views/nodes/DocHolderBox"; -import { InkingStroke } from "../views/InkingStroke"; +import { InkingStroke, ActiveInkColor, ActiveInkWidth, ActiveInkBezierApprox } from "../views/InkingStroke"; import { InkField } from "../../fields/InkField"; import { RichTextField } from "../../fields/RichTextField"; import { extname } from "path"; @@ -47,10 +47,6 @@ import { ContextMenu } from "../views/ContextMenu"; import { LinkBox } from "../views/nodes/LinkBox"; import { ScreenshotBox } from "../views/nodes/ScreenshotBox"; import { ComparisonBox } from "../views/nodes/ComparisonBox"; -import { Id } from "../../fields/FieldSymbols"; -import { listSpec } from "../../fields/Schema"; -import { ObjectField } from "../../fields/ObjectField"; -import { RefField } from "../../fields/RefField"; import { runInAction } from "mobx"; import { UndoManager } from "../util/UndoManager"; const path = require('path'); @@ -149,7 +145,7 @@ export interface DocumentOptions { dbDoc?: Doc; linkRelationship?: string; // type of relatinoship a link represents ischecked?: ScriptField; // returns whether a font icon box is checked - activePen?: Doc; // which pen document is currently active (used as the radio button state for the 'unhecked' pen tool scripts) + activeInkPen?: Doc; // which pen document is currently active (used as the radio button state for the 'unhecked' pen tool scripts) onClick?: ScriptField; onDoubleClick?: ScriptField; onChildClick?: ScriptField; // script given to children of a collection to execute when they are clicked @@ -855,7 +851,7 @@ export namespace DocUtils { created = Docs.Create.AudioDocument((field).url.href, resolved); layout = AudioBox.LayoutString; } else if (field instanceof InkField) { - created = Docs.Create.InkDocument(InkingStroke.InkColor, Doc.selectedTool, InkingStroke.InkWidth, InkingStroke.InkBezierApprox, (field).inkData, resolved); + created = Docs.Create.InkDocument(ActiveInkColor(), Doc.GetSelectedTool(), ActiveInkWidth(), ActiveInkBezierApprox(), (field).inkData, resolved); layout = InkingStroke.LayoutString; } else if (field instanceof List && field[0] instanceof Doc) { created = Docs.Create.StackingDocument(DocListCast(field), resolved); @@ -913,76 +909,6 @@ export namespace DocUtils { return ctor ? ctor(path, options) : undefined; } - export function makeClone(doc: Doc, cloneMap: Map, rtfs: { copy: Doc, key: string, field: RichTextField }[]): Doc { - if (Doc.IsBaseProto(doc)) return doc; - if (cloneMap.get(doc[Id])) return cloneMap.get(doc[Id])!; - const copy = new Doc(undefined, true); - cloneMap.set(doc[Id], copy); - if (LinkManager.Instance.getAllLinks().includes(doc) && LinkManager.Instance.getAllLinks().indexOf(copy) === -1) LinkManager.Instance.addLink(copy); - const exclude = Cast(doc.excludeFields, listSpec("string"), []); - Object.keys(doc).forEach(key => { - if (exclude.includes(key)) return; - const cfield = ComputedField.WithoutComputed(() => FieldValue(doc[key])); - const field = ProxyField.WithoutProxy(() => doc[key]); - const copyObjectField = (field: ObjectField) => { - const list = Cast(doc[key], listSpec(Doc)); - if (list !== undefined && !(list instanceof Promise)) { - copy[key] = new List(list.filter(d => d instanceof Doc).map(d => DocUtils.makeClone(d as Doc, cloneMap, rtfs))); - } else if (doc[key] instanceof Doc) { - copy[key] = key.includes("layout[") ? undefined : DocUtils.makeClone(doc[key] as Doc, cloneMap, rtfs); // reference documents except copy documents that are expanded teplate fields - } else { - copy[key] = ObjectField.MakeCopy(field); - if (field instanceof RichTextField) { - if (field.Data.includes('"docid":') || field.Data.includes('"targetId":') || field.Data.includes('"linkId":')) { - rtfs.push({ copy, key, field }); - } - } - } - }; - if (key === "proto") { - if (doc[key] instanceof Doc) { - copy[key] = DocUtils.makeClone(doc[key]!, cloneMap, rtfs); - } - } else { - if (field instanceof RefField) { - copy[key] = field; - } else if (cfield instanceof ComputedField) { - copy[key] = ComputedField.MakeFunction(cfield.script.originalScript); - (key === "links" && field instanceof ObjectField) && copyObjectField(field); - } else if (field instanceof ObjectField) { - copyObjectField(field); - } else if (field instanceof Promise) { - debugger; //This shouldn't happend... - } else { - copy[key] = field; - } - } - }); - Doc.SetInPlace(copy, "title", "CLONE: " + doc.title, true); - copy.cloneOf = doc; - cloneMap.set(doc[Id], copy); - return copy; - } - export function MakeClone(doc: Doc): Doc { - const cloneMap = new Map(); - const rtfMap: { copy: Doc, key: string, field: RichTextField }[] = []; - const copy = DocUtils.makeClone(doc, cloneMap, rtfMap); - rtfMap.map(({ copy, key, field }) => { - const replacer = (match: any, attr: string, id: string, offset: any, string: any) => { - const mapped = cloneMap.get(id); - return attr + "\"" + (mapped ? mapped[Id] : id) + "\""; - }; - const replacer2 = (match: any, href: string, id: string, offset: any, string: any) => { - const mapped = cloneMap.get(id); - return href + (mapped ? mapped[Id] : id); - }; - const regex = `(${Utils.prepend("/doc/")})([^"]*)`; - const re = new RegExp(regex, "g"); - copy[key] = new RichTextField(field.Data.replace(/("docid":|"targetId":|"linkId":)"([^"]+)"/g, replacer).replace(re, replacer2), field.Text); - }); - return copy; - } - export function addDocumentCreatorMenuItems(docTextAdder: (d: Doc) => void, docAdder: (d: Doc) => void, x: number, y: number): void { ContextMenu.Instance.addItem({ description: "Add Note ...", @@ -1107,7 +1033,6 @@ export namespace DocUtils { } } - export async function addFieldEnumerations(doc: Opt, enumeratedFieldKey: string, enumerations: { title: string, _backgroundColor?: string, color?: string }[]) { let optionsCollection = await DocServer.GetRefField(enumeratedFieldKey); if (!(optionsCollection instanceof Doc)) { diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts index d2614a898..b0cea9947 100644 --- a/src/client/util/CurrentUserUtils.ts +++ b/src/client/util/CurrentUserUtils.ts @@ -11,7 +11,6 @@ import { ScriptField, ComputedField } from "../../fields/ScriptField"; import { Cast, PromiseValue, StrCast, NumCast } from "../../fields/Types"; import { nullAudio } from "../../fields/URLField"; import { DragManager } from "./DragManager"; -import { InkingControl } from "../views/InkingControl"; import { Scripting } from "./Scripting"; import { CollectionViewType } from "../views/collections/CollectionView"; import { makeTemplate } from "./DropConverter"; @@ -32,7 +31,6 @@ export class CurrentUserUtils { public static get MainDocId() { return this.mainDocId; } public static set MainDocId(id: string | undefined) { this.mainDocId = id; } @computed public static get UserDocument() { return Doc.UserDoc(); } - @computed public static get ActivePen() { return Doc.UserDoc().activePen instanceof Doc && (Doc.UserDoc().activePen as Doc).inkPen as Doc; } @observable public static GuestTarget: Doc | undefined; @observable public static GuestWorkspace: Doc | undefined; @@ -301,7 +299,7 @@ export class CurrentUserUtils { static creatorBtnDescriptors(doc: Doc): { title: string, label: string, icon: string, drag?: string, ignoreClick?: boolean, - click?: string, ischecked?: string, activePen?: Doc, backgroundColor?: string, dragFactory?: Doc + click?: string, ischecked?: string, activeInkPen?: Doc, backgroundColor?: string, dragFactory?: Doc }[] { if (doc.emptyPresentation === undefined) { doc.emptyPresentation = Docs.Create.PresDocument(new List(), @@ -334,11 +332,11 @@ export class CurrentUserUtils { { title: "Drag an import folder", label: "Load", icon: "cloud-upload-alt", ignoreClick: true, drag: 'Docs.Create.DirectoryImportDocument({ title: "Directory Import", _width: 400, _height: 400 })' }, { title: "Drag a mobile view", label: "Phone", icon: "phone", ignoreClick: true, drag: 'Doc.UserDoc().activeMobile' }, { title: "Drag an instance of the device collection", label: "Buxton", icon: "globe-asia", ignoreClick: true, drag: 'Docs.Create.Buxton()' }, - // { title: "use pen", icon: "pen-nib", click: 'activatePen(this.activePen.inkPen = sameDocs(this.activePen.inkPen, this) ? undefined : this,2, this.backgroundColor)', backgroundColor: "blue", ischecked: `sameDocs(this.activePen.inkPen, this)`, activePen: doc }, - // { title: "use highlighter", icon: "highlighter", click: 'activateBrush(this.activePen.inkPen = sameDocs(this.activePen.inkPen, this) ? undefined : this,20,this.backgroundColor)', backgroundColor: "yellow", ischecked: `sameDocs(this.activePen.inkPen, this)`, activePen: doc }, - // { title: "use stamp", icon: "stamp", click: 'activateStamp(this.activePen.inkPen = sameDocs(this.activePen.inkPen, this) ? undefined : this)', backgroundColor: "orange", ischecked: `sameDocs(this.activePen.inkPen, this)`, activePen: doc }, - // { title: "use eraser", icon: "eraser", click: 'activateEraser(this.activePen.inkPen = sameDocs(this.activePen.inkPen, this) ? undefined : this);', ischecked: `sameDocs(this.activePen.inkPen, this)`, backgroundColor: "pink", activePen: doc }, - // { title: "use drag", icon: "mouse-pointer", click: 'deactivateInk();this.activePen.inkPen = this;', ischecked: `sameDocs(this.activePen.inkPen, this)`, backgroundColor: "white", activePen: doc }, + // { title: "use pen", icon: "pen-nib", click: 'activatePen(this.activeInkPen = sameDocs(this.activeInkPen, this) ? undefined : this)', backgroundColor: "blue", ischecked: `sameDocs(this.activeInkPen, this)`, activeInkPen: doc }, + // { title: "use highlighter", icon: "highlighter", click: 'activateBrush(this.activeInkPen = sameDocs(this.activeInkPen, this) ? undefined : this,20,this.backgroundColor)', backgroundColor: "yellow", ischecked: `sameDocs(this.activeInkPen, this)`, activeInkPen: doc }, + // { title: "use stamp", icon: "stamp", click: 'activateStamp(this.activeInkPen = sameDocs(this.activeInkPen, this) ? undefined : this)', backgroundColor: "orange", ischecked: `sameDocs(this.activeInkPen, this)`, activeInkPen: doc }, + // { title: "use eraser", icon: "eraser", click: 'activateEraser(this.activeInkPen = sameDocs(this.activeInkPen, this) ? undefined : this);', ischecked: `sameDocs(this.activeInkPen, this)`, backgroundColor: "pink", activeInkPen: doc }, + // { title: "use drag", icon: "mouse-pointer", click: 'deactivateInk();this.activeInkPen = this;', ischecked: `sameDocs(this.activeInkPen, this)`, backgroundColor: "white", activeInkPen: doc }, { title: "Drag a document previewer", label: "Prev", icon: "expand", click: 'openOnRight(getCopy(this.dragFactory, true))', drag: 'getCopy(this.dragFactory,true)', dragFactory: doc.emptyDocHolder as Doc }, { title: "Toggle a Calculator REPL", label: "repl", icon: "calculator", click: 'addOverlayWindow("ScriptingRepl", { x: 300, y: 100, width: 200, height: 200, title: "Scripting REPL" })' }, { title: "Connect a Google Account", label: "Google Account", icon: "external-link-alt", click: 'GoogleAuthenticationManager.Instance.fetchOrGenerateAccessToken(true)' }, @@ -358,7 +356,7 @@ export class CurrentUserUtils { } } const buttons = CurrentUserUtils.creatorBtnDescriptors(doc).filter(d => !alreadyCreatedButtons?.includes(d.title)); - const creatorBtns = buttons.map(({ title, label, icon, ignoreClick, drag, click, ischecked, activePen, backgroundColor, dragFactory }) => Docs.Create.FontIconDocument({ + const creatorBtns = buttons.map(({ title, label, icon, ignoreClick, drag, click, ischecked, activeInkPen, backgroundColor, dragFactory }) => Docs.Create.FontIconDocument({ _nativeWidth: 100, _nativeHeight: 100, _width: 100, _height: 100, icon, title, @@ -368,7 +366,7 @@ export class CurrentUserUtils { onDragStart: drag ? ScriptField.MakeFunction(drag) : undefined, onClick: click ? ScriptField.MakeScript(click) : undefined, ischecked: ischecked ? ComputedField.MakeFunction(ischecked) : undefined, - activePen, + activeInkPen, backgroundColor, removeDropProperties: new List(["dropAction"]), dragFactory, @@ -387,31 +385,31 @@ export class CurrentUserUtils { } static setupMobileButtons(doc: Doc, buttons?: string[]) { - const docProtoData: { title: string, icon: string, drag?: string, ignoreClick?: boolean, click?: string, ischecked?: string, activePen?: Doc, backgroundColor?: string, dragFactory?: Doc }[] = [ + const docProtoData: { title: string, icon: string, drag?: string, ignoreClick?: boolean, click?: string, ischecked?: string, activeInkPen?: Doc, backgroundColor?: string, dragFactory?: Doc }[] = [ { title: "record", icon: "microphone", ignoreClick: true, click: "FILL" }, - { title: "use pen", icon: "pen-nib", click: 'activatePen(this.activePen.inkPen = sameDocs(this.activePen.inkPen, this) ? undefined : this,2, this.backgroundColor)', backgroundColor: "blue", ischecked: `sameDocs(this.activePen.inkPen, this)`, activePen: doc }, - { title: "use highlighter", icon: "highlighter", click: 'activateBrush(this.activePen.inkPen = sameDocs(this.activePen.inkPen, this) ? undefined : this,20,this.backgroundColor)', backgroundColor: "yellow", ischecked: `sameDocs(this.activePen.inkPen, this)`, activePen: doc }, - { title: "use eraser", icon: "eraser", click: 'activateEraser(this.activePen.inkPen = sameDocs(this.activePen.inkPen, this) ? undefined : this);', ischecked: `sameDocs(this.activePen.inkPen, this)`, backgroundColor: "pink", activePen: doc }, - { title: "use drag", icon: "mouse-pointer", click: 'deactivateInk();this.activePen.inkPen = this;', ischecked: `sameDocs(this.activePen.inkPen, this)`, backgroundColor: "white", activePen: doc }, - // { title: "draw", icon: "pen-nib", click: 'switchMobileView(setupMobileInkingDoc, renderMobileInking, onSwitchMobileInking);', ischecked: `sameDocs(this.activePen.inkPen, this)`, backgroundColor: "red", activePen: doc }, + { title: "use pen", icon: "pen-nib", click: 'activatePen(this.activeInkPen = sameDocs(this.activeInkPen, this) ? undefined : this)', backgroundColor: "blue", ischecked: `sameDocs(this.activeInkPen, this)`, activeInkPen: doc }, + { title: "use highlighter", icon: "highlighter", click: 'activateBrush(this.activeInkPen = sameDocs(this.activeInkPen, this) ? undefined : this,20,this.backgroundColor)', backgroundColor: "yellow", ischecked: `sameDocs(this.activeInkPen, this)`, activeInkPen: doc }, + { title: "use eraser", icon: "eraser", click: 'activateEraser(this.activeInkPen = sameDocs(this.activeInkPen, this) ? undefined : this);', ischecked: `sameDocs(this.activeInkPen, this)`, backgroundColor: "pink", activeInkPen: doc }, + { title: "use drag", icon: "mouse-pointer", click: 'deactivateInk();this.activeInkPen = this;', ischecked: `sameDocs(this.activeInkPen, this)`, backgroundColor: "white", activeInkPen: doc }, + // { title: "draw", icon: "pen-nib", click: 'switchMobileView(setupMobileInkingDoc, renderMobileInking, onSwitchMobileInking);', ischecked: `sameDocs(this.activeInkPen, this)`, backgroundColor: "red", activeInkPen: doc }, { title: "upload", icon: "upload", click: 'switchMobileView(setupMobileUploadDoc, renderMobileUpload, onSwitchMobileUpload);', backgroundColor: "orange" }, // { title: "upload", icon: "upload", click: 'uploadImageMobile();', backgroundColor: "cyan" }, ]; return docProtoData.filter(d => !buttons || !buttons.includes(d.title)).map(data => Docs.Create.FontIconDocument({ _nativeWidth: 100, _nativeHeight: 100, _width: 100, _height: 100, dropAction: data.click ? "copy" : undefined, title: data.title, icon: data.icon, ignoreClick: data.ignoreClick, onDragStart: data.drag ? ScriptField.MakeFunction(data.drag) : undefined, onClick: data.click ? ScriptField.MakeScript(data.click) : undefined, - ischecked: data.ischecked ? ComputedField.MakeFunction(data.ischecked) : undefined, activePen: data.activePen, + ischecked: data.ischecked ? ComputedField.MakeFunction(data.ischecked) : undefined, activeInkPen: data.activeInkPen, backgroundColor: data.backgroundColor, removeDropProperties: new List(["dropAction"]), dragFactory: data.dragFactory, })); } static setupThumbButtons(doc: Doc) { - const docProtoData: { title: string, icon: string, drag?: string, ignoreClick?: boolean, pointerDown?: string, pointerUp?: string, ischecked?: string, clipboard?: Doc, activePen?: Doc, backgroundColor?: string, dragFactory?: Doc }[] = [ - { title: "use pen", icon: "pen-nib", pointerUp: "resetPen()", pointerDown: 'setPen(2, this.backgroundColor)', backgroundColor: "blue", ischecked: `sameDocs(this.activePen.inkPen, this)`, activePen: doc }, - { title: "use highlighter", icon: "highlighter", pointerUp: "resetPen()", pointerDown: 'setPen(20, this.backgroundColor)', backgroundColor: "yellow", ischecked: `sameDocs(this.activePen.inkPen, this)`, activePen: doc }, - { title: "notepad", icon: "clipboard", pointerUp: "GestureOverlay.Instance.closeFloatingDoc()", pointerDown: 'GestureOverlay.Instance.openFloatingDoc(this.clipboard)', clipboard: Docs.Create.FreeformDocument([], { _width: 300, _height: 300 }), backgroundColor: "orange", ischecked: `sameDocs(this.activePen.inkPen, this)`, activePen: doc }, - { title: "interpret text", icon: "font", pointerUp: "setToolglass('none')", pointerDown: "setToolglass('inktotext')", backgroundColor: "orange", ischecked: `sameDocs(this.activePen.inkPen, this)`, activePen: doc }, - { title: "ignore gestures", icon: "signature", pointerUp: "setToolglass('none')", pointerDown: "setToolglass('ignoregesture')", backgroundColor: "green", ischecked: `sameDocs(this.activePen.inkPen, this)`, activePen: doc }, + const docProtoData: { title: string, icon: string, drag?: string, ignoreClick?: boolean, pointerDown?: string, pointerUp?: string, ischecked?: string, clipboard?: Doc, activeInkPen?: Doc, backgroundColor?: string, dragFactory?: Doc }[] = [ + { title: "use pen", icon: "pen-nib", pointerUp: "resetPen()", pointerDown: 'setPen(2, this.backgroundColor)', backgroundColor: "blue", ischecked: `sameDocs(this.activeInkPen, this)`, activeInkPen: doc }, + { title: "use highlighter", icon: "highlighter", pointerUp: "resetPen()", pointerDown: 'setPen(20, this.backgroundColor)', backgroundColor: "yellow", ischecked: `sameDocs(this.activeInkPen, this)`, activeInkPen: doc }, + { title: "notepad", icon: "clipboard", pointerUp: "GestureOverlay.Instance.closeFloatingDoc()", pointerDown: 'GestureOverlay.Instance.openFloatingDoc(this.clipboard)', clipboard: Docs.Create.FreeformDocument([], { _width: 300, _height: 300 }), backgroundColor: "orange", ischecked: `sameDocs(this.activeInkPen, this)`, activeInkPen: doc }, + { title: "interpret text", icon: "font", pointerUp: "setToolglass('none')", pointerDown: "setToolglass('inktotext')", backgroundColor: "orange", ischecked: `sameDocs(this.activeInkPen, this)`, activeInkPen: doc }, + { title: "ignore gestures", icon: "signature", pointerUp: "setToolglass('none')", pointerDown: "setToolglass('ignoregesture')", backgroundColor: "green", ischecked: `sameDocs(this.activeInkPen, this)`, activeInkPen: doc }, ]; return docProtoData.map(data => Docs.Create.FontIconDocument({ _nativeWidth: 10, _nativeHeight: 10, _width: 10, _height: 10, title: data.title, icon: data.icon, @@ -419,7 +417,7 @@ export class CurrentUserUtils { onDragStart: data.drag ? ScriptField.MakeFunction(data.drag) : undefined, clipboard: data.clipboard, onPointerUp: data.pointerUp ? ScriptField.MakeScript(data.pointerUp) : undefined, onPointerDown: data.pointerDown ? ScriptField.MakeScript(data.pointerDown) : undefined, - ischecked: data.ischecked ? ComputedField.MakeFunction(data.ischecked) : undefined, activePen: data.activePen, pointerHack: true, + ischecked: data.ischecked ? ComputedField.MakeFunction(data.ischecked) : undefined, activeInkPen: data.activeInkPen, pointerHack: true, backgroundColor: data.backgroundColor, removeDropProperties: new List(["dropAction"]), dragFactory: data.dragFactory, })); } @@ -612,8 +610,8 @@ export class CurrentUserUtils { static setupDockedButtons(doc: Doc) { if (doc["dockedBtn-pen"] === undefined) { doc["dockedBtn-pen"] = CurrentUserUtils.ficon({ - onClick: ScriptField.MakeScript("activatePen(this.activePen.inkPen = sameDocs(this.activePen.inkPen, this) ? undefined : this)"), - author: "systemTemplates", title: "ink mode", icon: "pen-nib", ischecked: ComputedField.MakeFunction(`sameDocs(this.activePen.inkPen, this)`), activePen: doc + onClick: ScriptField.MakeScript("activatePen(this.activeInkPen = sameDocs(this.activeInkPen, this) ? undefined : this)"), + author: "systemTemplates", title: "ink mode", icon: "pen-nib", ischecked: ComputedField.MakeFunction(`sameDocs(this.activeInkPen, this)`), activeInkPen: doc }); } if (doc["dockedBtn-undo"] === undefined) { @@ -688,12 +686,11 @@ export class CurrentUserUtils { } static async updateUserDocument(doc: Doc) { - new InkingControl(); doc.title = Doc.CurrentUserEmail; - doc.activePen = doc; - doc.inkColor = StrCast(doc.backgroundColor, "rgb(0, 0, 0)"); - doc.inkWidth = StrCast(doc.inkWidth, "1"); - doc.inkBezier = StrCast(doc.inkBezier, ""); + doc.activeInkPen = doc; + doc.activeInkColor = StrCast(doc.activeInkColor, "rgb(0, 0, 0)"); + doc.activeInkWidth = StrCast(doc.activeInkWidth, "1"); + doc.activeInkBezier = StrCast(doc.activeInkBezier, ""); doc.fontSize = NumCast(doc.fontSize, 12); doc["constants-snapThreshold"] = NumCast(doc["constants-snapThreshold"], 10); // doc["constants-dragThreshold"] = NumCast(doc["constants-dragThreshold"], 4); // diff --git a/src/client/util/LinkManager.ts b/src/client/util/LinkManager.ts index 8e6ccf098..95528e25a 100644 --- a/src/client/util/LinkManager.ts +++ b/src/client/util/LinkManager.ts @@ -2,10 +2,8 @@ import { Doc, DocListCast } from "../../fields/Doc"; import { List } from "../../fields/List"; import { listSpec } from "../../fields/Schema"; import { Cast, StrCast } from "../../fields/Types"; -import { Docs } from "../documents/Documents"; import { Scripting } from "./Scripting"; - /* * link doc: * - anchor1: doc @@ -34,16 +32,12 @@ export class LinkManager { // the linkmanagerdoc stores a list of docs representing all linkdocs in 'allLinks' and a list of strings representing all group types in 'allGroupTypes' // lists of strings representing the metadata keys for each group type is stored under a key that is the same as the group type public get LinkManagerDoc(): Doc | undefined { - return Docs.Prototypes.MainLinkDocument(); + return Doc.UserDoc().globalLinkDatabase as Doc; } public getAllLinks(): Doc[] { const ldoc = LinkManager.Instance.LinkManagerDoc; - if (ldoc) { - const docs = DocListCast(ldoc.data); - return docs; - } - return []; + return ldoc ? DocListCast(ldoc.data) : []; } public addLink(linkDoc: Doc): boolean { diff --git a/src/client/views/DocComponent.tsx b/src/client/views/DocComponent.tsx index c398b2633..3af570f1e 100644 --- a/src/client/views/DocComponent.tsx +++ b/src/client/views/DocComponent.tsx @@ -57,7 +57,7 @@ export function ViewBoxBaseComponent

(schemaCtor: lookupField = (field: string) => ScriptCast(this.layoutDoc.lookupField)?.script.run({ self: this.layoutDoc, data: this.rootDoc, field: field, container: this.props.ContainingCollectionDoc }).result; - active = (outsideReaction?: boolean) => !this.props.Document.isBackground && (this.props.rootSelected(outsideReaction) || this.props.isSelected(outsideReaction) || this.props.renderDepth === 0 || this.layoutDoc.forceActive);// && !Doc.selectedTool; // bcz: inking state shouldn't affect static tools + active = (outsideReaction?: boolean) => !this.props.Document.isBackground && (this.props.rootSelected(outsideReaction) || this.props.isSelected(outsideReaction) || this.props.renderDepth === 0 || this.layoutDoc.forceActive);// && !Doc.SelectedTool(); // bcz: inking state shouldn't affect static tools protected multiTouchDisposer?: InteractionUtils.MultiTouchEventDisposer; } return Component; @@ -146,9 +146,9 @@ export function ViewBoxAnnotatableComponent

this.props.whenActiveChanged(this._isChildActive = isActive)); - active = (outsideReaction?: boolean) => ((Doc.selectedTool === InkTool.None && !this.props.Document.isBackground) && + active = (outsideReaction?: boolean) => ((Doc.GetSelectedTool() === InkTool.None && !this.props.Document.isBackground) && (this.props.rootSelected(outsideReaction) || this.props.isSelected(outsideReaction) || this._isChildActive || this.props.renderDepth === 0 || BoolCast((this.layoutDoc as any).forceActive)) ? true : false) - annotationsActive = (outsideReaction?: boolean) => (Doc.selectedTool !== InkTool.None || (this.props.Document.isBackground && this.props.active()) || + annotationsActive = (outsideReaction?: boolean) => (Doc.GetSelectedTool() !== InkTool.None || (this.props.Document.isBackground && this.props.active()) || (this.props.Document.forceActive || this.props.isSelected(outsideReaction) || this._isChildActive || this.props.renderDepth === 0) ? true : false) } return Component; diff --git a/src/client/views/GestureOverlay.tsx b/src/client/views/GestureOverlay.tsx index 4ea75d7d7..3384b5fce 100644 --- a/src/client/views/GestureOverlay.tsx +++ b/src/client/views/GestureOverlay.tsx @@ -18,19 +18,18 @@ import { LinkManager } from "../util/LinkManager"; import { Scripting } from "../util/Scripting"; import { Transform } from "../util/Transform"; import "./GestureOverlay.scss"; -import { InkingControl } from "./InkingControl"; +import { ActiveInkBezierApprox, ActiveInkColor, ActiveInkWidth, InkingStroke, SetActiveInkColor, SetActiveInkWidth } from "./InkingStroke"; import { DocumentView } from "./nodes/DocumentView"; import { RadialMenu } from "./nodes/RadialMenu"; import HorizontalPalette from "./Palette"; import { Touchable } from "./Touchable"; import TouchScrollableMenu, { TouchScrollableMenuItem } from "./TouchScrollableMenu"; -import { InkingStroke } from "./InkingStroke"; - @observer export default class GestureOverlay extends Touchable { static Instance: GestureOverlay; + @observable public InkShape: string = ""; @observable public SavedColor?: string; @observable public SavedWidth?: string; @observable public Tool: ToolglassTools = ToolglassTools.None; @@ -492,7 +491,7 @@ export default class GestureOverlay extends Touchable { @action onPointerDown = (e: React.PointerEvent) => { - if (InteractionUtils.IsType(e, InteractionUtils.PENTYPE) || (Doc.selectedTool === InkTool.Highlighter || Doc.selectedTool === InkTool.Pen)) { + if (InteractionUtils.IsType(e, InteractionUtils.PENTYPE) || (Doc.GetSelectedTool() === InkTool.Highlighter || Doc.GetSelectedTool() === InkTool.Pen)) { this._points.push({ X: e.clientX, Y: e.clientY }); e.stopPropagation(); e.preventDefault(); @@ -506,7 +505,7 @@ export default class GestureOverlay extends Touchable { @action onPointerMove = (e: PointerEvent) => { - if (InteractionUtils.IsType(e, InteractionUtils.PENTYPE) || (Doc.selectedTool === InkTool.Highlighter || Doc.selectedTool === InkTool.Pen)) { + if (InteractionUtils.IsType(e, InteractionUtils.PENTYPE) || (Doc.GetSelectedTool() === InkTool.Highlighter || Doc.GetSelectedTool() === InkTool.Pen)) { this._points.push({ X: e.clientX, Y: e.clientY }); e.stopPropagation(); e.preventDefault(); @@ -580,8 +579,8 @@ export default class GestureOverlay extends Touchable { DocServer.Mobile.dispatchGesturePoints({ points: this._points, bounds: B, - color: InkingStroke.InkColor, - width: InkingStroke.InkWidth + color: ActiveInkColor(), + width: ActiveInkWidth() }); } @@ -624,11 +623,11 @@ export default class GestureOverlay extends Touchable { } } //if any of the shape is activated in the InkOptionsMenu - else if (InkingStroke.InkShape) { - this.makePolygon(InkingStroke.InkShape, false); + else if (this.InkShape) { + this.makePolygon(this.InkShape, false); this.dispatchGesture(GestureUtils.Gestures.Stroke); this._points = []; - InkingStroke.InkShape = ""; + this.InkShape = ""; } // if we're not drawing in a toolglass try to recognize as gesture else { @@ -808,11 +807,11 @@ export default class GestureOverlay extends Touchable { [this._strokes.map(l => { const b = this.getBounds(l); return - {InteractionUtils.CreatePolyline(l, b.left, b.top, InkingStroke.InkColor, InkingStroke.InkWidth, InkingStroke.InkBezierApprox, 1, 1, InkingStroke.InkShape)} + {InteractionUtils.CreatePolyline(l, b.left, b.top, ActiveInkColor(), ActiveInkWidth(), ActiveInkBezierApprox(), 1, 1, this.InkShape)} ; }), this._points.length <= 1 ? (null) : - {InteractionUtils.CreatePolyline(this._points, B.left, B.top, InkingStroke.InkColor, InkingStroke.InkWidth, InkingStroke.InkBezierApprox, 1, 1, InkingStroke.InkShape)} + {InteractionUtils.CreatePolyline(this._points, B.left, B.top, ActiveInkColor(), ActiveInkWidth(), ActiveInkBezierApprox(), 1, 1, this.InkShape)} ] ]; } @@ -902,16 +901,16 @@ Scripting.addGlobal(function setToolglass(tool: any) { }); Scripting.addGlobal(function setPen(width: any, color: any) { runInAction(() => { - GestureOverlay.Instance.SavedColor = InkingStroke.InkColor; - InkingControl.Instance.switchColor(color); - GestureOverlay.Instance.SavedWidth = InkingStroke.InkWidth; - InkingControl.Instance.switchWidth(width); + GestureOverlay.Instance.SavedColor = ActiveInkColor(); + SetActiveInkColor(color); + GestureOverlay.Instance.SavedWidth = ActiveInkWidth(); + SetActiveInkWidth(width); }); }); Scripting.addGlobal(function resetPen() { runInAction(() => { - InkingControl.Instance.switchColor(GestureOverlay.Instance.SavedColor ?? "rgb(0, 0, 0)"); - InkingControl.Instance.switchWidth(GestureOverlay.Instance.SavedWidth ?? "2"); + SetActiveInkColor(GestureOverlay.Instance.SavedColor ?? "rgb(0, 0, 0)"); + SetActiveInkWidth(GestureOverlay.Instance.SavedWidth ?? "2"); }); }); Scripting.addGlobal(function createText(text: any, x: any, y: any) { diff --git a/src/client/views/GlobalKeyHandler.ts b/src/client/views/GlobalKeyHandler.ts index 255142771..2d5af5386 100644 --- a/src/client/views/GlobalKeyHandler.ts +++ b/src/client/views/GlobalKeyHandler.ts @@ -1,26 +1,25 @@ -import { UndoManager, undoBatch } from "../util/UndoManager"; -import { SelectionManager } from "../util/SelectionManager"; -import { CollectionDockingView } from "./collections/CollectionDockingView"; -import { MainView } from "./MainView"; -import { DragManager } from "../util/DragManager"; -import { action, runInAction } from "mobx"; +import { action } from "mobx"; +import { DateField } from "../../fields/DateField"; import { Doc, DocListCast } from "../../fields/Doc"; -import { DictationManager } from "../util/DictationManager"; -import SharingManager from "../util/SharingManager"; -import { Cast, PromiseValue, NumCast } from "../../fields/Types"; -import { ScriptField } from "../../fields/ScriptField"; -import { InkingControl } from "./InkingControl"; +import { Id } from "../../fields/FieldSymbols"; import { InkTool } from "../../fields/InkField"; -import { DocumentView } from "./nodes/DocumentView"; +import { List } from "../../fields/List"; +import { ScriptField } from "../../fields/ScriptField"; +import { Cast, PromiseValue } from "../../fields/Types"; import GoogleAuthenticationManager from "../apis/GoogleAuthenticationManager"; -import { CollectionFreeFormView } from "./collections/collectionFreeForm/CollectionFreeFormView"; +import { DocServer } from "../DocServer"; +import { DocumentType } from "../documents/DocumentTypes"; +import { DictationManager } from "../util/DictationManager"; +import { DragManager } from "../util/DragManager"; +import { SelectionManager } from "../util/SelectionManager"; +import SharingManager from "../util/SharingManager"; +import { undoBatch, UndoManager } from "../util/UndoManager"; +import { CollectionDockingView } from "./collections/CollectionDockingView"; import { MarqueeView } from "./collections/collectionFreeForm/MarqueeView"; -import { Id } from "../../fields/FieldSymbols"; import { DocumentDecorations } from "./DocumentDecorations"; -import { DocumentType } from "../documents/DocumentTypes"; -import { DocServer } from "../DocServer"; -import { List } from "../../fields/List"; -import { DateField } from "../../fields/DateField"; +import { InkingStroke } from "./InkingStroke"; +import { MainView } from "./MainView"; +import { DocumentView } from "./nodes/DocumentView"; const modifiers = ["control", "meta", "shift", "alt"]; type KeyHandler = (keycode: string, e: KeyboardEvent) => KeyControlInfo | Promise; @@ -78,7 +77,7 @@ export default class KeyManager { break; case "escape": const main = MainView.Instance; - InkingControl.Instance.switchTool(InkTool.None); + Doc.SetSelectedTool(InkTool.None); if (main.isPointerDown) { DragManager.AbortDrag(); } else { diff --git a/src/client/views/InkingControl.scss b/src/client/views/InkingControl.scss deleted file mode 100644 index 465e14d07..000000000 --- a/src/client/views/InkingControl.scss +++ /dev/null @@ -1,131 +0,0 @@ -@import "globalCssVariables"; -.inking-control { - bottom: 20px; - margin: 0; - padding: 0; - display: flex; - label, - input, - option { - font-size: 12px; - } - input[type="range"] { - -webkit-appearance: none; - background-color: transparent; - vertical-align: middle; - margin-top: 8px; - &:focus { - outline: none; - } - &::-webkit-slider-runnable-track { - width: 100%; - height: 3px; - border-radius: 1.5px; - cursor: pointer; - background: $intermediate-color; - } - &::-webkit-slider-thumb { - height: 12px; - width: 12px; - border: 1px solid $intermediate-color; - border-radius: 6px; - background: $light-color; - cursor: pointer; - -webkit-appearance: none; - margin-top: -4px; - } - &::-moz-range-track { - width: 100%; - height: 3px; - border-radius: 1.5px; - cursor: pointer; - background: $light-color; - } - &::-moz-range-thumb { - height: 12px; - width: 12px; - border: 1px solid $intermediate-color; - border-radius: 6px; - background: $light-color; - cursor: pointer; - -webkit-appearance: none; - margin-top: -4px; - } - } - input[type="text"] { - border: none; - padding: 0 0px; - background: transparent; - color: $dark-color; - font-size: 12px; - margin-top: 4px; - } - .ink-panel { - height: 24px; - vertical-align: middle; - line-height: 28px; - padding: 0 10px; - color: $intermediate-color; - &:first { - margin-top: 0; - } - } - .ink-tools { - display: flex; - background-color: transparent; - border-radius: 0; - padding: 0; - button { - height: 36px; - padding: 0px; - padding-bottom: 3px; - margin-left: 10px; - background-color: transparent; - color: $intermediate-color; - } - button:hover { - transform: scale(1.15); - } - } - .ink-size { - display: flex; - justify-content: space-between; - input[type="text"] { - width: 42px; - } - >* { - margin-right: 6px; - &:last-child { - margin-right: 0; - } - } - } - .ink-color { - display: flex; - position: relative; - padding-right: 0; - label { - margin-right: 6px; - } - .ink-color-display { - border-radius: 11px; - width: 22px; - height: 22px; - cursor: pointer; - text-align: center; // span { - // color: $light-color; - // font-size: 8px; - // user-select: none; - // } - } - .ink-color-picker { - background-color: $light-color; - border-radius: 5px; - padding: 12px; - position: absolute; - bottom: 36px; - left: -3px; - box-shadow: $intermediate-color 0.2vw 0.2vw 0.8vw; - } - } -} \ No newline at end of file diff --git a/src/client/views/InkingControl.tsx b/src/client/views/InkingControl.tsx deleted file mode 100644 index 349bc6ffc..000000000 --- a/src/client/views/InkingControl.tsx +++ /dev/null @@ -1,42 +0,0 @@ -import { action, observable } from "mobx"; -import { Doc } from "../../fields/Doc"; -import { InkTool } from "../../fields/InkField"; -import { CurrentUserUtils } from "../util/CurrentUserUtils"; -import { Scripting } from "../util/Scripting"; -import { InkingStroke } from "./InkingStroke"; - -export class InkingControl { - @observable static Instance: InkingControl; - @observable public _open: boolean = false; - constructor() { - InkingControl.Instance = this; - } - - switchTool = action((tool: InkTool): void => { - // this._selectedTool = tool; - Doc.UserDoc().inkTool = tool; - }); - - @action - switchWidth = (width: string): void => { - if (!isNaN(parseInt(width))) { - CurrentUserUtils.ActivePen && (CurrentUserUtils.ActivePen.inkWidth = InkingStroke.InkWidth = width); - } - } - - @action - switchBezier = (bezier: string): void => { - CurrentUserUtils.ActivePen && (CurrentUserUtils.ActivePen.inkBezier = InkingStroke.InkBezierApprox = isNaN(parseInt(bezier)) ? "" : bezier); - } - - @action - switchColor(value: string) { - CurrentUserUtils.ActivePen && (CurrentUserUtils.ActivePen.inkColor = InkingStroke.InkColor = value); - } -} -Scripting.addGlobal(function activateBrush(pen: any, width: any, color: any) { InkingControl.Instance.switchTool(pen ? InkTool.Highlighter : InkTool.None); InkingControl.Instance.switchWidth(width); InkingControl.Instance.switchColor(color); }); -Scripting.addGlobal(function activateEraser(pen: any) { return InkingControl.Instance.switchTool(pen ? InkTool.Eraser : InkTool.None); }); -Scripting.addGlobal(function activateStamp(pen: any) { return InkingControl.Instance.switchTool(pen ? InkTool.Stamp : InkTool.None); }); -Scripting.addGlobal(function deactivateInk() { return InkingControl.Instance.switchTool(InkTool.None); }); -Scripting.addGlobal(function setInkWidth(width: any) { return InkingControl.Instance.switchWidth(width); }); -Scripting.addGlobal(function setInkColor(color: any) { return InkingControl.Instance.switchColor(color); }); \ No newline at end of file diff --git a/src/client/views/InkingStroke.tsx b/src/client/views/InkingStroke.tsx index 78d729eee..b545ede54 100644 --- a/src/client/views/InkingStroke.tsx +++ b/src/client/views/InkingStroke.tsx @@ -1,6 +1,6 @@ import { library } from "@fortawesome/fontawesome-svg-core"; import { faPaintBrush } from "@fortawesome/free-solid-svg-icons"; -import { observable, runInAction } from "mobx"; +import { observable, runInAction, action } from "mobx"; import { observer } from "mobx-react"; import { documentSchema } from "../../fields/documentSchemas"; import { InkData, InkField, InkTool } from "../../fields/InkField"; @@ -14,6 +14,8 @@ import { ViewBoxBaseComponent } from "./DocComponent"; import "./InkingStroke.scss"; import { FieldView, FieldViewProps } from "./nodes/FieldView"; import React = require("react"); +import { Scripting } from "../util/Scripting"; +import { Doc } from "../../fields/Doc"; library.add(faPaintBrush); @@ -23,22 +25,6 @@ const InkDocument = makeInterface(documentSchema); @observer export class InkingStroke extends ViewBoxBaseComponent(InkDocument) { public static LayoutString(fieldStr: string) { return FieldView.LayoutString(InkingStroke, fieldStr); } - @observable public static InkColor: string; - @observable public static InkWidth: string; - @observable public static InkBezierApprox: string; - @observable public static InkShape: string; - - constructor(props: any) { - super(props); - if (InkingStroke.InkBezierApprox === undefined) { - runInAction(() => { - InkingStroke.InkBezierApprox = ""; - InkingStroke.InkWidth = "1"; - InkingStroke.InkColor = "black"; - InkingStroke.InkShape = ""; - }); - } - } private analyzeStrokes = () => { const data: InkData = Cast(this.dataDoc[this.fieldKey], InkField)?.inkData ?? []; @@ -59,9 +45,9 @@ export class InkingStroke extends ViewBoxBaseComponent ); } -} \ No newline at end of file +} + + +export function SetActiveInkWidth(width: string): void { !isNaN(parseInt(width)) && ActiveInkPen() && (ActiveInkPen().activeInkWidth = width); } +export function SetActiveBezierApprox(bezier: string): void { ActiveInkPen() && (ActiveInkPen().activeInkBezier = isNaN(parseInt(bezier)) ? "" : bezier); } +export function SetActiveInkColor(value: string) { ActiveInkPen() && (ActiveInkPen().activeInkColor = value); } +export function ActiveInkPen(): Doc { return Cast(Doc.UserDoc().activeInkPen, Doc, null); } +export function ActiveInkColor(): string { return StrCast(ActiveInkPen()?.activeInkColor, "black"); } +export function ActiveInkWidth(): string { return StrCast(ActiveInkPen()?.activeInkWidth, "1"); } +export function ActiveInkBezierApprox(): string { return StrCast(ActiveInkPen()?.activeInkBezier); } +Scripting.addGlobal(function activateBrush(pen: any, width: any, color: any) { + Doc.SetSelectedTool(pen ? InkTool.Highlighter : InkTool.None); + SetActiveInkWidth(width); + SetActiveInkColor(color); +}); +Scripting.addGlobal(function activateEraser(pen: any) { return Doc.SetSelectedTool(pen ? InkTool.Eraser : InkTool.None); }); +Scripting.addGlobal(function activateStamp(pen: any) { return Doc.SetSelectedTool(pen ? InkTool.Stamp : InkTool.None); }); +Scripting.addGlobal(function deactivateInk() { return Doc.SetSelectedTool(InkTool.None); }); +Scripting.addGlobal(function setInkWidth(width: any) { return Doc.SetSelectedTool(width); }); +Scripting.addGlobal(function setInkColor(color: any) { return Doc.SetSelectedTool(color); }); \ No newline at end of file diff --git a/src/client/views/PreviewCursor.tsx b/src/client/views/PreviewCursor.tsx index 33150ab7c..dd65681d4 100644 --- a/src/client/views/PreviewCursor.tsx +++ b/src/client/views/PreviewCursor.tsx @@ -3,7 +3,7 @@ import { observer } from 'mobx-react'; import "normalize.css"; import * as React from 'react'; import "./PreviewCursor.scss"; -import { Docs, DocUtils } from '../documents/Documents'; +import { Docs } from '../documents/Documents'; import { Doc } from '../../fields/Doc'; import { Transform } from "../util/Transform"; import { DocServer } from '../DocServer'; @@ -65,7 +65,7 @@ export class PreviewCursor extends React.Component<{}> { count++; if (doc instanceof Doc) { i === 1 && (first = doc); - const alias = DocUtils.MakeClone(doc); + const alias = Doc.MakeClone(doc); const deltaX = NumCast(doc.x) - NumCast(first!.x) - ptx; const deltaY = NumCast(doc.y) - NumCast(first!.y) - pty; alias.x = newPoint[0] + deltaX; diff --git a/src/client/views/collections/CollectionView.tsx b/src/client/views/collections/CollectionView.tsx index 873f61331..8a73565c8 100644 --- a/src/client/views/collections/CollectionView.tsx +++ b/src/client/views/collections/CollectionView.tsx @@ -1,34 +1,37 @@ import { library } from '@fortawesome/fontawesome-svg-core'; -import { faEye, faEdit } from '@fortawesome/free-regular-svg-icons'; +import { faEdit, faEye } from '@fortawesome/free-regular-svg-icons'; +import { faColumns, faCopy, faEllipsisV, faFingerprint, faGlobeAmericas, faImage, faProjectDiagram, faSignature, faSquare, faTh, faThList, faTree } from '@fortawesome/free-solid-svg-icons'; import { FontAwesomeIcon } from "@fortawesome/react-fontawesome"; -import { faColumns, faCopy, faEllipsisV, faFingerprint, faImage, faProjectDiagram, faSignature, faSquare, faTh, faThList, faTree, faGlobeAmericas } from '@fortawesome/free-solid-svg-icons'; -import { action, observable, computed } from 'mobx'; +import { action, computed, observable } from 'mobx'; import { observer } from "mobx-react"; import * as React from 'react'; import Lightbox from 'react-image-lightbox-with-rotate'; import 'react-image-lightbox-with-rotate/style.css'; // This only needs to be imported once in your app import { DateField } from '../../../fields/DateField'; -import { DataSym, Doc, DocListCast, Field, Opt, AclSym, AclAddonly, AclReadonly } from '../../../fields/Doc'; +import { AclAddonly, AclReadonly, AclSym, DataSym, Doc, DocListCast, Field, Opt } from '../../../fields/Doc'; +import { Id } from '../../../fields/FieldSymbols'; import { List } from '../../../fields/List'; -import { BoolCast, Cast, NumCast, StrCast, ScriptCast } from '../../../fields/Types'; +import { ObjectField } from '../../../fields/ObjectField'; +import { listSpec } from '../../../fields/Schema'; +import { ComputedField, ScriptField } from '../../../fields/ScriptField'; +import { BoolCast, Cast, NumCast, ScriptCast, StrCast } from '../../../fields/Types'; import { ImageField } from '../../../fields/URLField'; import { TraceMobx } from '../../../fields/util'; -import { Utils, setupMoveUpEvents, returnFalse, returnZero, emptyPath, emptyFunction, returnOne } from '../../../Utils'; +import { emptyFunction, emptyPath, returnFalse, returnOne, returnZero, setupMoveUpEvents, Utils } from '../../../Utils'; +import { DocumentType } from '../../documents/DocumentTypes'; import { ImageUtils } from '../../util/Import & Export/ImageUtils'; +import { InteractionUtils } from '../../util/InteractionUtils'; import { ContextMenu } from "../ContextMenu"; import { FieldView, FieldViewProps } from '../nodes/FieldView'; import { ScriptBox } from '../ScriptBox'; import { Touchable } from '../Touchable'; -import { Id } from '../../../fields/FieldSymbols'; -import { listSpec } from '../../../fields/Schema'; -import { ScriptField, ComputedField } from '../../../fields/ScriptField'; -import { InteractionUtils } from '../../util/InteractionUtils'; -import { ObjectField } from '../../../fields/ObjectField'; +import './CollectionView.scss'; const higflyout = require("@hig/flyout"); export const { anchorPoints } = higflyout; export const Flyout = higflyout.default; export const COLLECTION_BORDER_WIDTH = 2; const path = require('path'); + library.add(faTh, faTree, faSquare, faProjectDiagram, faSignature, faThList, faFingerprint, faColumns, faGlobeAmericas, faEllipsisV, faImage, faEye as any, faCopy); export enum CollectionViewType { @@ -500,6 +503,12 @@ export class CollectionView extends Touchable); } } + + + +// to avoid an import cycle that will cause runtime errors, +// we import all of the bindings needed within methods after the +// class has been defined. import { SubCollectionViewProps } from './CollectionSubView'; import { CollectionCarouselView } from './CollectionCarouselView'; import { CollectionDockingView } from "./CollectionDockingView"; @@ -515,8 +524,6 @@ import { CollectionTimeView } from './CollectionTimeView'; import { CollectionTreeView } from "./CollectionTreeView"; import { CollectionMapView } from './CollectionMapView'; import { CollectionPileView } from './CollectionPileView'; -import './CollectionView.scss'; import { CollectionViewBaseChrome } from './CollectionViewChromes'; import { CurrentUserUtils } from '../../util/CurrentUserUtils'; -import { DocumentType } from '../../documents/DocumentTypes'; import { Docs } from '../../documents/Documents'; \ No newline at end of file diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx index 576c0c560..9c0e5e917 100644 --- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx +++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx @@ -45,7 +45,7 @@ import React = require("react"); import { CollectionViewType } from "../CollectionView"; import { Timeline } from "../../animationtimeline/Timeline"; import { SnappingManager } from "../../../util/SnappingManager"; -import { InkingStroke } from "../../InkingStroke"; +import { InkingStroke, ActiveInkColor, ActiveInkWidth, ActiveInkBezierApprox } from "../../InkingStroke"; library.add(faEye as any, faTable, faPaintBrush, faExpandArrowsAlt, faCompressArrowsAlt, faCompass, faUpload, faBraille, faChalkboard, faFileUpload); @@ -390,7 +390,7 @@ export class CollectionFreeFormView extends CollectionSubView { - if (e.nativeEvent.cancelBubble || InteractionUtils.IsType(e, InteractionUtils.TOUCHTYPE) || InteractionUtils.IsType(e, InteractionUtils.PENTYPE) || (Doc.selectedTool === InkTool.Highlighter || Doc.selectedTool === InkTool.Pen)) { + if (e.nativeEvent.cancelBubble || InteractionUtils.IsType(e, InteractionUtils.TOUCHTYPE) || InteractionUtils.IsType(e, InteractionUtils.PENTYPE) || (Doc.GetSelectedTool() === InkTool.Highlighter || Doc.GetSelectedTool() === InkTool.Pen)) { return; } this._hitCluster = this.props.Document.useClusters ? this.pickCluster(this.getTransform().transformPoint(e.clientX, e.clientY)) !== -1 : false; @@ -407,7 +407,7 @@ export class CollectionFreeFormView extends CollectionSubView { - InkingControl.Instance.switchBezier(!InkingStroke.InkBezierApprox ? "300" : ""); + SetActiveBezierApprox(!ActiveInkBezierApprox() ? "300" : ""); } - render() { + @computed get widthPicker() { var widthPicker = ; })}

; } + return widthPicker; + } + @computed get colorPicker() { var colorPicker = ; if (this._colorBtn) { - colorPicker =
+ colorPicker =
{colorPicker} {this._palette.map(color => { return , - <> - {this._buttons.map((btn, i) => )}, - , - , - widthPicker, - colorPicker, + title={`Draw ${btn}`} + key={btn} + onPointerDown={action(e => GestureOverlay.Instance.InkShape = btn)} + style={{ backgroundColor: btn === GestureOverlay.Instance.InkShape ? "121212" : "" }}> + {this._icons[i]} + )}, + ; + } + + @computed get bezierButton() { + return ; + } + + render() { + const buttons = [ + , + this.shapeButtons, + this.bezierButton, + this.widthPicker, + this.colorPicker, ]; return this.getElement(buttons); } } -Scripting.addGlobal(function activatePen(pen: any) { - InkingControl.Instance.switchTool(pen ? InkTool.Pen : InkTool.None); - if (pen) { - InkingControl.Instance.switchWidth(StrCast(pen.inkWidth, "1")); - InkingControl.Instance.switchColor(StrCast(pen.inkColor, "black")); - InkingControl.Instance.switchBezier(StrCast(pen.inkBezier, "")); +Scripting.addGlobal(function activatePen(penBtn: any) { + if (penBtn) { + Doc.SetSelectedTool(InkTool.Pen); InkOptionsMenu.Instance.jumpTo(300, 300); } else { + Doc.SetSelectedTool(InkTool.None); InkOptionsMenu.Instance.fadeOut(true); } }); \ No newline at end of file diff --git a/src/client/views/nodes/ColorBox.tsx b/src/client/views/nodes/ColorBox.tsx index 762c57ae9..0d6258cf3 100644 --- a/src/client/views/nodes/ColorBox.tsx +++ b/src/client/views/nodes/ColorBox.tsx @@ -1,20 +1,19 @@ import React = require("react"); +import { action } from "mobx"; import { observer } from "mobx-react"; -import { SketchPicker, ColorState } from 'react-color'; +import { ColorState, SketchPicker } from 'react-color'; +import { Doc } from "../../../fields/Doc"; +import { Utils } from "../../../Utils"; import { documentSchema } from "../../../fields/documentSchemas"; +import { InkTool } from "../../../fields/InkField"; import { makeInterface } from "../../../fields/Schema"; import { StrCast } from "../../../fields/Types"; -import { CurrentUserUtils } from "../../util/CurrentUserUtils"; import { SelectionManager } from "../../util/SelectionManager"; +import { undoBatch } from "../../util/UndoManager"; import { ViewBoxBaseComponent } from "../DocComponent"; -import { InkingControl } from "../InkingControl"; +import { ActiveInkPen, ActiveInkWidth, ActiveInkBezierApprox, SetActiveInkColor, SetActiveInkWidth, SetActiveBezierApprox } from "../InkingStroke"; import "./ColorBox.scss"; import { FieldView, FieldViewProps } from './FieldView'; -import { InkingStroke } from "../InkingStroke"; -import { Doc } from "../../../fields/Doc"; -import { InkTool } from "../../../fields/InkField"; -import { undoBatch } from "../../util/UndoManager"; -import { action } from "mobx"; import { FormattedTextBox } from "./formattedText/FormattedTextBox"; type ColorDocument = makeInterface<[typeof documentSchema]>; @@ -24,22 +23,13 @@ const ColorDocument = makeInterface(documentSchema); export class ColorBox extends ViewBoxBaseComponent(ColorDocument) { public static LayoutString(fieldKey: string) { return FieldView.LayoutString(ColorBox, fieldKey); } - static decimalToHexString(number: number) { - if (number < 0) { - number = 0xFFFFFFFF + number + 1; - } - return (number < 16 ? "0" : "") + number.toString(16).toUpperCase(); - } - @undoBatch @action static switchColor(color: ColorState) { - Doc.UserDoc().backgroundColor = color.hex.startsWith("#") ? - color.hex + (color.rgb.a ? ColorBox.decimalToHexString(Math.round(color.rgb.a * 255)) : "ff") : color.hex; - InkingStroke.InkColor = StrCast(Doc.UserDoc().backgroundColor); - CurrentUserUtils.ActivePen && (CurrentUserUtils.ActivePen.inkColor = color.hex); + Doc.UserDoc().backgroundColor = Utils.colorString(color); + SetActiveInkColor(color.hex); - if (Doc.selectedTool === InkTool.None) { + if (Doc.GetSelectedTool() === InkTool.None) { const selected = SelectionManager.SelectedDocuments(); selected.map(view => { const targetDoc = view.props.Document.dragFactory instanceof Doc ? view.props.Document.dragFactory : @@ -56,6 +46,9 @@ export class ColorBox extends ViewBoxBaseComponent
-
{InkingStroke.InkWidth ?? 2}
- ) => InkingControl.Instance.switchWidth(e.target.value)} /> -
{InkingStroke.InkBezierApprox ?? 2}
- ) => InkingControl.Instance.switchBezier(e.target.value)} /> +
{ActiveInkWidth() ?? 2}
+ ) => SetActiveInkWidth(e.target.value)} /> +
{ActiveInkBezierApprox() ?? 2}
+ ) => SetActiveBezierApprox(e.target.value)} />

diff --git a/src/client/views/nodes/DocumentView.tsx b/src/client/views/nodes/DocumentView.tsx index 196e61a31..98be1adc0 100644 --- a/src/client/views/nodes/DocumentView.tsx +++ b/src/client/views/nodes/DocumentView.tsx @@ -512,7 +512,7 @@ export class DocumentView extends DocComponent(Docu // console.log(e.button) // console.log(e.nativeEvent) // continue if the event hasn't been canceled AND we are using a moues or this is has an onClick or onDragStart function (meaning it is a button document) - if (!(InteractionUtils.IsType(e, InteractionUtils.MOUSETYPE) || Doc.selectedTool === InkTool.Highlighter || Doc.selectedTool === InkTool.Pen)) { + if (!(InteractionUtils.IsType(e, InteractionUtils.MOUSETYPE) || Doc.GetSelectedTool() === InkTool.Highlighter || Doc.GetSelectedTool() === InkTool.Pen)) { if (!InteractionUtils.IsType(e, InteractionUtils.PENTYPE)) { e.stopPropagation(); // TODO: check here for panning/inking @@ -543,7 +543,7 @@ export class DocumentView extends DocComponent(Docu onPointerMove = (e: PointerEvent): void => { if ((e as any).formattedHandled) { e.stopPropagation(); return; } - if ((InteractionUtils.IsType(e, InteractionUtils.PENTYPE) || Doc.selectedTool === InkTool.Highlighter || Doc.selectedTool === InkTool.Pen)) return; + if ((InteractionUtils.IsType(e, InteractionUtils.PENTYPE) || Doc.GetSelectedTool() === InkTool.Highlighter || Doc.GetSelectedTool() === InkTool.Pen)) return; if (e.cancelBubble && this.active) { document.removeEventListener("pointermove", this.onPointerMove); // stop listening to pointerMove if something else has stopPropagated it (e.g., the MarqueeView) } @@ -1090,7 +1090,7 @@ export class DocumentView extends DocComponent(Docu @computed get ignorePointerEvents() { return this.props.pointerEvents === false || (this.Document.isBackground && !this.isSelected() && !SnappingManager.GetIsDragging()) || - (this.Document.type === DocumentType.INK && Doc.selectedTool !== InkTool.None); + (this.Document.type === DocumentType.INK && Doc.GetSelectedTool() !== InkTool.None); } @undoBatch @action diff --git a/src/client/views/nodes/PresBox.tsx b/src/client/views/nodes/PresBox.tsx index 81669dc2a..dbc879920 100644 --- a/src/client/views/nodes/PresBox.tsx +++ b/src/client/views/nodes/PresBox.tsx @@ -293,7 +293,7 @@ export class PresBox extends ViewBoxBaseComponent selectElement = (doc: Doc) => this.gotoDocument(this.childDocs.indexOf(doc), NumCast(this.itemIndex)); getTransform = () => this.props.ScreenToLocalTransform().translate(-5, -65);// listBox padding-left and pres-box-cont minHeight panelHeight = () => this.props.PanelHeight() - 20; - active = (outsideReaction?: boolean) => ((Doc.selectedTool === InkTool.None && !this.layoutDoc.isBackground) && + active = (outsideReaction?: boolean) => ((Doc.GetSelectedTool() === InkTool.None && !this.layoutDoc.isBackground) && (this.layoutDoc.forceActive || this.props.isSelected(outsideReaction) || this._isChildActive || this.props.renderDepth === 0) ? true : false) render() { diff --git a/src/client/views/nodes/ScreenshotBox.tsx b/src/client/views/nodes/ScreenshotBox.tsx index 1184f32f1..d75b864cf 100644 --- a/src/client/views/nodes/ScreenshotBox.tsx +++ b/src/client/views/nodes/ScreenshotBox.tsx @@ -132,7 +132,7 @@ export class ScreenshotBox extends ViewBoxBaseComponentLoading
:
{!this.layoutDoc._showSidebar ? (null) : this.sidebarWidthPercent === "0%" ?
: -
(this.Document.scrollHeight || this.Document._nativeHeight || 0); panelHeight = () => this._pageSizes.length && this._pageSizes[0] ? this._pageSizes[0].width : (this.Document._nativeWidth || 0); @computed get overlayLayer() { - return
; const frozen = !this.props.isSelected() || DocumentDecorations.Instance.Interacting; - const classname = "webBox-cont" + (this.props.isSelected() && !Doc.selectedTool && !DocumentDecorations.Instance.Interacting ? "-interactive" : ""); - + const classname = "webBox-cont" + (this.props.isSelected() && !Doc.GetSelectedTool() && !DocumentDecorations.Instance.Interacting ? "-interactive" : ""); return ( <> diff --git a/src/fields/Doc.ts b/src/fields/Doc.ts index d635836bb..981025483 100644 --- a/src/fields/Doc.ts +++ b/src/fields/Doc.ts @@ -6,7 +6,7 @@ import { DocumentType } from "../client/documents/DocumentTypes"; import { Scripting, scriptingGlobal } from "../client/util/Scripting"; import { afterDocDeserialize, autoObject, Deserializable, SerializationHelper } from "../client/util/SerializationHelper"; import { UndoManager } from "../client/util/UndoManager"; -import { intersectRect } from "../Utils"; +import { intersectRect, Utils } from "../Utils"; import { Copy, HandleUpdate, Id, OnUpdate, Parent, Self, SelfProxy, ToScriptString, ToString, Update } from "./FieldSymbols"; import { InkTool } from "./InkField"; import { List } from "./List"; @@ -18,6 +18,7 @@ import { listSpec } from "./Schema"; import { ComputedField } from "./ScriptField"; import { Cast, FieldValue, NumCast, StrCast, ToConstructor } from "./Types"; import { deleteProperty, getField, getter, makeEditable, makeReadOnly, setter, updateFunction } from "./util"; +import { LinkManager } from "../client/util/LinkManager"; export namespace Field { export function toKeyValueString(doc: Doc, key: string): string { @@ -132,7 +133,6 @@ function fetchProto(doc: Doc) { @scriptingGlobal @Deserializable("Doc", fetchProto).withFields(["id"]) export class Doc extends RefField { - @computed public static get selectedTool(): InkTool { return FieldValue(NumCast(Doc.UserDoc().inkTool)) ?? InkTool.None; } constructor(id?: FieldId, forceSave?: boolean) { super(id); const doc = new Proxy(this, { @@ -486,6 +486,78 @@ export namespace Doc { return alias; } + + + export function makeClone(doc: Doc, cloneMap: Map, rtfs: { copy: Doc, key: string, field: RichTextField }[]): Doc { + if (Doc.IsBaseProto(doc)) return doc; + if (cloneMap.get(doc[Id])) return cloneMap.get(doc[Id])!; + const copy = new Doc(undefined, true); + cloneMap.set(doc[Id], copy); + if (LinkManager.Instance.getAllLinks().includes(doc) && LinkManager.Instance.getAllLinks().indexOf(copy) === -1) LinkManager.Instance.addLink(copy); + const exclude = Cast(doc.excludeFields, listSpec("string"), []); + Object.keys(doc).forEach(key => { + if (exclude.includes(key)) return; + const cfield = ComputedField.WithoutComputed(() => FieldValue(doc[key])); + const field = ProxyField.WithoutProxy(() => doc[key]); + const copyObjectField = (field: ObjectField) => { + const list = Cast(doc[key], listSpec(Doc)); + if (list !== undefined && !(list instanceof Promise)) { + copy[key] = new List(list.filter(d => d instanceof Doc).map(d => Doc.makeClone(d as Doc, cloneMap, rtfs))); + } else if (doc[key] instanceof Doc) { + copy[key] = key.includes("layout[") ? undefined : Doc.makeClone(doc[key] as Doc, cloneMap, rtfs); // reference documents except copy documents that are expanded teplate fields + } else { + copy[key] = ObjectField.MakeCopy(field); + if (field instanceof RichTextField) { + if (field.Data.includes('"docid":') || field.Data.includes('"targetId":') || field.Data.includes('"linkId":')) { + rtfs.push({ copy, key, field }); + } + } + } + }; + if (key === "proto") { + if (doc[key] instanceof Doc) { + copy[key] = Doc.makeClone(doc[key]!, cloneMap, rtfs); + } + } else { + if (field instanceof RefField) { + copy[key] = field; + } else if (cfield instanceof ComputedField) { + copy[key] = ComputedField.MakeFunction(cfield.script.originalScript); + (key === "links" && field instanceof ObjectField) && copyObjectField(field); + } else if (field instanceof ObjectField) { + copyObjectField(field); + } else if (field instanceof Promise) { + debugger; //This shouldn't happend... + } else { + copy[key] = field; + } + } + }); + Doc.SetInPlace(copy, "title", "CLONE: " + doc.title, true); + copy.cloneOf = doc; + cloneMap.set(doc[Id], copy); + return copy; + } + export function MakeClone(doc: Doc): Doc { + const cloneMap = new Map(); + const rtfMap: { copy: Doc, key: string, field: RichTextField }[] = []; + const copy = Doc.makeClone(doc, cloneMap, rtfMap); + rtfMap.map(({ copy, key, field }) => { + const replacer = (match: any, attr: string, id: string, offset: any, string: any) => { + const mapped = cloneMap.get(id); + return attr + "\"" + (mapped ? mapped[Id] : id) + "\""; + }; + const replacer2 = (match: any, href: string, id: string, offset: any, string: any) => { + const mapped = cloneMap.get(id); + return href + (mapped ? mapped[Id] : id); + }; + const regex = `(${Utils.prepend("/doc/")})([^"]*)`; + const re = new RegExp(regex, "g"); + copy[key] = new RichTextField(field.Data.replace(/("docid":|"targetId":|"linkId":)"([^"]+)"/g, replacer).replace(re, replacer2), field.Text); + }); + return copy; + } + // // Determines whether the layout needs to be expanded (as a template). // template expansion is rquired when the layout is a template doc/field and there's a datadoc which isn't equal to the layout template @@ -743,6 +815,9 @@ export namespace Doc { export function SearchQuery(): string { return manager._searchQuery; } export function SetSearchQuery(query: string) { runInAction(() => manager._searchQuery = query); } export function UserDoc(): Doc { return manager._user_doc; } + + export function SetSelectedTool(tool: InkTool) { Doc.UserDoc().activeInkTool = tool; } + export function GetSelectedTool(): InkTool { return (FieldValue(StrCast(Doc.UserDoc().activeInkTool)) ?? InkTool.None) as InkTool; } export function SetUserDoc(doc: Doc) { manager._user_doc = doc; } export function IsBrushed(doc: Doc) { return computedFn(function IsBrushed(doc: Doc) { diff --git a/src/fields/InkField.ts b/src/fields/InkField.ts index bb93de5ac..51a5768bf 100644 --- a/src/fields/InkField.ts +++ b/src/fields/InkField.ts @@ -4,11 +4,11 @@ import { ObjectField } from "./ObjectField"; import { Copy, ToScriptString, ToString } from "./FieldSymbols"; export enum InkTool { - None, - Pen, - Highlighter, - Eraser, - Stamp + None = "none", + Pen = "pen", + Highlighter = "highlighter", + Eraser = "eraser", + Stamp = "stamp" } export interface PointData { diff --git a/src/mobile/MobileInterface.tsx b/src/mobile/MobileInterface.tsx index 6c2e797d6..da14ffc88 100644 --- a/src/mobile/MobileInterface.tsx +++ b/src/mobile/MobileInterface.tsx @@ -12,7 +12,6 @@ import { Scripting } from '../client/util/Scripting'; import { Transform } from '../client/util/Transform'; import { DocumentDecorations } from '../client/views/DocumentDecorations'; import GestureOverlay from '../client/views/GestureOverlay'; -import { InkingControl } from '../client/views/InkingControl'; import { DocumentView } from '../client/views/nodes/DocumentView'; import { RadialMenu } from '../client/views/nodes/RadialMenu'; import { PreviewCursor } from '../client/views/PreviewCursor'; @@ -26,6 +25,7 @@ import { CurrentUserUtils } from '../client/util/CurrentUserUtils'; import { emptyFunction, emptyPath, returnEmptyString, returnFalse, returnOne, returnTrue, returnZero } from '../Utils'; import "./MobileInterface.scss"; import { CollectionView } from '../client/views/collections/CollectionView'; +import { InkingStroke } from '../client/views/InkingStroke'; library.add(faLongArrowAltLeft); @@ -68,7 +68,7 @@ export default class MobileInterface extends React.Component { } onSwitchInking = () => { - InkingControl.Instance.switchTool(InkTool.Pen); + Doc.SetSelectedTool(InkTool.Pen); MobileInterface.Instance.drawingInk = true; DocServer.Mobile.dispatchOverlayTrigger({ @@ -134,7 +134,7 @@ export default class MobileInterface extends React.Component { onBack = (e: React.MouseEvent) => { this.switchCurrentView((userDoc: Doc) => this.mainDoc); - InkingControl.Instance.switchTool(InkTool.None); // TODO: switch to previous tool + Doc.SetSelectedTool(InkTool.None); // TODO: switch to previous tool DocServer.Mobile.dispatchOverlayTrigger({ enableOverlay: false, @@ -187,6 +187,7 @@ export default class MobileInterface extends React.Component { Document={this.mainContainer} DataDoc={undefined} LibraryPath={emptyPath} + filterAddDocument={returnTrue} fieldKey={""} dropAction={"alias"} bringToFront={emptyFunction} -- cgit v1.2.3-70-g09d2 From 747581ac65f706710becad034c5f5abff76b8e51 Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Tue, 9 Jun 2020 17:26:05 -0400 Subject: fixed lots of errors/warnings. added 'a' to be able embed documents on drop. added 'l' toggle to perist lasso/marquee mode. --- src/client/apis/youtube/YoutubeBox.tsx | 3 +- src/client/documents/Documents.ts | 2 +- src/client/util/DragManager.ts | 50 +++++++++++++++------- .../util/Import & Export/DirectoryImportBox.tsx | 4 +- src/client/views/DocumentDecorations.tsx | 2 +- src/client/views/GlobalKeyHandler.ts | 1 + src/client/views/InkingStroke.tsx | 4 +- src/client/views/TemplateMenu.tsx | 4 +- src/client/views/animationtimeline/Keyframe.tsx | 8 ++-- src/client/views/animationtimeline/Timeline.tsx | 2 +- .../views/animationtimeline/TimelineOverview.tsx | 4 +- .../views/collections/CollectionPileView.tsx | 7 +-- .../views/collections/CollectionStackingView.tsx | 3 +- .../CollectionStackingViewFieldColumn.tsx | 2 +- src/client/views/collections/CollectionSubView.tsx | 4 +- .../views/collections/CollectionTimeView.tsx | 3 +- src/client/views/collections/CollectionView.tsx | 2 +- .../views/collections/CollectionViewChromes.tsx | 2 +- .../collectionFreeForm/CollectionFreeFormView.tsx | 13 +++--- .../collectionFreeForm/MarqueeView.scss | 2 +- .../collections/collectionFreeForm/MarqueeView.tsx | 9 ++-- src/client/views/nodes/ScreenshotBox.tsx | 3 +- src/client/views/nodes/VideoBox.tsx | 2 +- .../views/nodes/formattedText/DashDocView.tsx | 4 +- .../views/nodes/formattedText/DashFieldView.tsx | 7 +-- .../views/nodes/formattedText/FormattedTextBox.tsx | 4 +- .../views/nodes/formattedText/RichTextSchema.tsx | 4 +- src/client/views/webcam/DashWebRTCVideo.tsx | 3 +- src/fields/Doc.ts | 4 +- src/fields/RichTextUtils.ts | 6 +-- src/server/ApiManagers/UploadManager.ts | 3 +- 31 files changed, 96 insertions(+), 75 deletions(-) (limited to 'src/client/util') diff --git a/src/client/apis/youtube/YoutubeBox.tsx b/src/client/apis/youtube/YoutubeBox.tsx index 748d571c0..2a1f55710 100644 --- a/src/client/apis/youtube/YoutubeBox.tsx +++ b/src/client/apis/youtube/YoutubeBox.tsx @@ -10,6 +10,7 @@ import { FieldView, FieldViewProps } from "../../views/nodes/FieldView"; import "../../views/nodes/WebBox.scss"; import "./YoutubeBox.scss"; import React = require("react"); +import { InkTool } from '../../../fields/InkField'; interface VideoTemplate { thumbnailUrl: string; @@ -349,7 +350,7 @@ export class YoutubeBox extends React.Component { const frozen = !this.props.isSelected() || DocumentDecorations.Instance.Interacting; - const classname = "webBox-cont" + (this.props.isSelected() && !Doc.GetSelectedTool() && !DocumentDecorations.Instance.Interacting ? "-interactive" : ""); + const classname = "webBox-cont" + (this.props.isSelected() && Doc.GetSelectedTool() === InkTool.None && !DocumentDecorations.Instance.Interacting ? "-interactive" : ""); return ( <>
diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts index 8d3e5a771..8d867348f 100644 --- a/src/client/documents/Documents.ts +++ b/src/client/documents/Documents.ts @@ -631,7 +631,7 @@ export namespace Docs { return doc; } - export function InkDocument(color: string, tool: number, strokeWidth: string, strokeBezier: string, points: { X: number, Y: number }[], options: DocumentOptions = {}) { + export function InkDocument(color: string, tool: string, strokeWidth: string, strokeBezier: string, points: { X: number, Y: number }[], options: DocumentOptions = {}) { const I = new Doc(); I.type = DocumentType.INK; I.layout = InkingStroke.LayoutString("data"); diff --git a/src/client/util/DragManager.ts b/src/client/util/DragManager.ts index e7a14f9c5..f1afaf734 100644 --- a/src/client/util/DragManager.ts +++ b/src/client/util/DragManager.ts @@ -67,6 +67,7 @@ export function SetupDrag( export namespace DragManager { let dragDiv: HTMLDivElement; + let dragLabel: HTMLDivElement; export let StartWindowDrag: Opt<((e: any, dragDocs: Doc[]) => void)> = undefined; export function Root() { @@ -97,7 +98,8 @@ export namespace DragManager { readonly shiftKey: boolean, readonly altKey: boolean, readonly metaKey: boolean, - readonly ctrlKey: boolean + readonly ctrlKey: boolean, + readonly embedKey: boolean, ) { } } @@ -309,14 +311,24 @@ export namespace DragManager { }; } export let docsBeingDragged: Doc[] = []; + export let CanEmbed = false; export function StartDrag(eles: HTMLElement[], dragData: { [id: string]: any }, downX: number, downY: number, options?: DragOptions, finishDrag?: (dropData: DragCompleteEvent) => void) { eles = eles.filter(e => e); + CanEmbed = false; if (!dragDiv) { dragDiv = document.createElement("div"); dragDiv.className = "dragManager-dragDiv"; dragDiv.style.pointerEvents = "none"; + dragLabel = document.createElement("div") as HTMLDivElement; + dragLabel.className = "dragManager-dragLabel"; + dragLabel.style.zIndex = "100001"; + dragLabel.style.fontSize = "10"; + dragLabel.style.position = "absolute"; + dragLabel.innerText = "press 'a' to embed on drop"; + dragDiv.appendChild(dragLabel); DragManager.Root().appendChild(dragDiv); } + dragLabel.style.display = ""; SnappingManager.SetIsDragging(true); const scaleXs: number[] = []; const scaleYs: number[] = []; @@ -358,6 +370,7 @@ export namespace DragManager { dragElement.style.transform = `translate(${rect.left + (options?.offsetX || 0)}px, ${rect.top + (options?.offsetY || 0)}px) scale(${scaleX}, ${scaleY})`; dragElement.style.width = `${rect.width / scaleX}px`; dragElement.style.height = `${rect.height / scaleY}px`; + dragLabel.style.transform = `translate(${rect.left + (options?.offsetX || 0)}px, ${rect.top + (options?.offsetY || 0) - 20}px)`; if (docsBeingDragged.length) { const pdfBox = dragElement.getElementsByTagName("canvas"); @@ -399,20 +412,21 @@ export namespace DragManager { if (dragData instanceof DocumentDragData) { dragData.userDropAction = e.ctrlKey && e.altKey ? "copy" : e.ctrlKey ? "alias" : undefined; } - if (e.shiftKey && dragData.droppedDocuments.length === 1) { - !dragData.dropAction && (dragData.dropAction = alias); - if (dragData.dropAction === "move") { - dragData.removeDocument?.(dragData.draggedDocuments[0]); + if (e) + if (e.shiftKey && dragData.droppedDocuments.length === 1) { + !dragData.dropAction && (dragData.dropAction = alias); + if (dragData.dropAction === "move") { + dragData.removeDocument?.(dragData.draggedDocuments[0]); + } + AbortDrag(); + finishDrag?.(new DragCompleteEvent(true, dragData)); + DragManager.StartWindowDrag?.({ + pageX: e.pageX, + pageY: e.pageY, + preventDefault: emptyFunction, + button: 0 + }, dragData.droppedDocuments); } - AbortDrag(); - finishDrag?.(new DragCompleteEvent(true, dragData)); - DragManager.StartWindowDrag?.({ - pageX: e.pageX, - pageY: e.pageY, - preventDefault: emptyFunction, - button: 0 - }, dragData.droppedDocuments); - } const { thisX, thisY } = snapDrag(e, xFromLeft, yFromTop, xFromRight, yFromBottom); @@ -421,12 +435,14 @@ export namespace DragManager { const moveY = thisY - lastY; lastX = thisX; lastY = thisY; + dragLabel.style.transform = `translate(${xs[0] + moveX + (options?.offsetX || 0)}px, ${ys[0] + moveY + (options?.offsetY || 0) - 20}px)`; dragElements.map((dragElement, i) => (dragElement.style.transform = `translate(${(xs[i] += moveX) + (options?.offsetX || 0)}px, ${(ys[i] += moveY) + (options?.offsetY || 0)}px) scale(${scaleXs[i]}, ${scaleYs[i]})`) ); }; const hideDragShowOriginalElements = () => { + dragLabel.style.display = "none"; dragElements.map(dragElement => dragElement.parentNode === dragDiv && dragDiv.removeChild(dragElement)); eles.map(ele => ele.parentElement && ele.parentElement?.className === dragData.dragDivName ? (ele.parentElement.hidden = false) : (ele.hidden = false)); }; @@ -481,7 +497,8 @@ export namespace DragManager { shiftKey: e.shiftKey, altKey: e.altKey, metaKey: e.metaKey, - ctrlKey: e.ctrlKey + ctrlKey: e.ctrlKey, + embedKey: CanEmbed } }) ); @@ -496,7 +513,8 @@ export namespace DragManager { shiftKey: e.shiftKey, altKey: e.altKey, metaKey: e.metaKey, - ctrlKey: e.ctrlKey + ctrlKey: e.ctrlKey, + embedKey: CanEmbed } }) ); diff --git a/src/client/util/Import & Export/DirectoryImportBox.tsx b/src/client/util/Import & Export/DirectoryImportBox.tsx index 4e5cde558..25c556697 100644 --- a/src/client/util/Import & Export/DirectoryImportBox.tsx +++ b/src/client/util/Import & Export/DirectoryImportBox.tsx @@ -7,7 +7,7 @@ import Measure, { ContentRect } from "react-measure"; import { library } from '@fortawesome/fontawesome-svg-core'; import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'; import { faTag, faPlus, faCloudUploadAlt } from '@fortawesome/free-solid-svg-icons'; -import { Docs, DocumentOptions } from "../../documents/Documents"; +import { Docs, DocumentOptions, DocUtils } from "../../documents/Documents"; import { observer } from "mobx-react"; import ImportMetadataEntry, { keyPlaceholder, valuePlaceholder } from "./ImportMetadataEntry"; import { Utils } from "../../../Utils"; @@ -123,7 +123,7 @@ export default class DirectoryImportBox extends React.Component } const { accessPaths, exifData } = result; const path = Utils.prepend(accessPaths.agnostic.client); - const document = await Doc.Get.DocumentFromType(type, path, { _width: 300, title: name }); + const document = await DocUtils.DocumentFromType(type, path, { _width: 300, title: name }); const { data, error } = exifData; if (document) { Doc.GetProto(document).exif = error || Doc.Get.FromJson({ data }); diff --git a/src/client/views/DocumentDecorations.tsx b/src/client/views/DocumentDecorations.tsx index e7a237e62..6ca7331d6 100644 --- a/src/client/views/DocumentDecorations.tsx +++ b/src/client/views/DocumentDecorations.tsx @@ -403,7 +403,7 @@ export class DocumentDecorations extends React.Component<{}, { value: string }> onPointerUp = (e: PointerEvent): void => { SelectionManager.SelectedDocuments().map(dv => { if (NumCast(dv.layoutDoc._delayAutoHeight) < this._dragHeights.get(dv.layoutDoc)!) { - dv.nativeWidth > 0 && Doc.toggleNativeDimensions(dv.layoutDoc, dv.props.ContentScaling(), dv.panelWidth(), dv.panelHeight()); + dv.nativeWidth > 0 && Doc.toggleNativeDimensions(dv.layoutDoc, dv.props.ContentScaling(), dv.props.PanelWidth(), dv.props.PanelHeight()); dv.layoutDoc._autoHeight = true; } dv.layoutDoc._delayAutoHeight = undefined; diff --git a/src/client/views/GlobalKeyHandler.ts b/src/client/views/GlobalKeyHandler.ts index 2d5af5386..772cb07b1 100644 --- a/src/client/views/GlobalKeyHandler.ts +++ b/src/client/views/GlobalKeyHandler.ts @@ -72,6 +72,7 @@ export default class KeyManager { private unmodified = action((keyname: string, e: KeyboardEvent) => { switch (keyname) { + case "a": DragManager.CanEmbed = true; case " ": MarqueeView.DragMarquee = !MarqueeView.DragMarquee; break; diff --git a/src/client/views/InkingStroke.tsx b/src/client/views/InkingStroke.tsx index 7dac2e3b5..7d73247af 100644 --- a/src/client/views/InkingStroke.tsx +++ b/src/client/views/InkingStroke.tsx @@ -92,5 +92,5 @@ Scripting.addGlobal(function activateBrush(pen: any, width: any, color: any) { Scripting.addGlobal(function activateEraser(pen: any) { return Doc.SetSelectedTool(pen ? InkTool.Eraser : InkTool.None); }); Scripting.addGlobal(function activateStamp(pen: any) { return Doc.SetSelectedTool(pen ? InkTool.Stamp : InkTool.None); }); Scripting.addGlobal(function deactivateInk() { return Doc.SetSelectedTool(InkTool.None); }); -Scripting.addGlobal(function setInkWidth(width: any) { return Doc.SetSelectedTool(width); }); -Scripting.addGlobal(function setInkColor(color: any) { return Doc.SetSelectedTool(color); }); \ No newline at end of file +Scripting.addGlobal(function setInkWidth(width: any) { return SetActiveInkWidth(width); }); +Scripting.addGlobal(function setInkColor(color: any) { return SetActiveInkColor(color); }); \ No newline at end of file diff --git a/src/client/views/TemplateMenu.tsx b/src/client/views/TemplateMenu.tsx index 77e6ebf44..f135823a8 100644 --- a/src/client/views/TemplateMenu.tsx +++ b/src/client/views/TemplateMenu.tsx @@ -7,7 +7,7 @@ import { DocumentView } from "./nodes/DocumentView"; import { Template } from "./Templates"; import React = require("react"); import { Doc, DocListCast } from "../../fields/Doc"; -import { Docs, } from "../documents/Documents"; +import { Docs, DocUtils, } from "../documents/Documents"; import { StrCast, Cast } from "../../fields/Types"; import { CollectionTreeView } from "./collections/CollectionTreeView"; import { returnTrue, emptyFunction, returnFalse, returnOne, emptyPath, returnZero } from "../../Utils"; @@ -176,5 +176,5 @@ Scripting.addGlobal(function switchView(doc: Doc, template: Doc | undefined) { template = Cast(template.dragFactory, Doc, null); } const templateTitle = StrCast(template?.title); - return templateTitle && Doc.makeCustomViewClicked(doc, Docs.Create.FreeformDocument, templateTitle, template); + return templateTitle && DocUtils.makeCustomViewClicked(doc, Docs.Create.FreeformDocument, templateTitle, template); }); diff --git a/src/client/views/animationtimeline/Keyframe.tsx b/src/client/views/animationtimeline/Keyframe.tsx index b562bd957..3a7182a94 100644 --- a/src/client/views/animationtimeline/Keyframe.tsx +++ b/src/client/views/animationtimeline/Keyframe.tsx @@ -180,10 +180,10 @@ export class Keyframe extends React.Component { const fadeIn = this.props.makeKeyData(this.regiondata, this.regiondata.position + this.regiondata.fadeIn, KeyframeFunc.KeyframeType.fade); const fadeOut = this.props.makeKeyData(this.regiondata, this.regiondata.position + this.regiondata.duration - this.regiondata.fadeOut, KeyframeFunc.KeyframeType.fade); const finish = this.props.makeKeyData(this.regiondata, this.regiondata.position + this.regiondata.duration, KeyframeFunc.KeyframeType.end); - (fadeIn as Doc).opacity = 1; - (fadeOut as Doc).opacity = 1; - (start as Doc).opacity = 0.1; - (finish as Doc).opacity = 0.1; + fadeIn.opacity = 1; + fadeOut.opacity = 1; + start.opacity = 0.1; + finish.opacity = 0.1; this.forceUpdate(); //not needed, if setTimeout is gone... }, 1000); } diff --git a/src/client/views/animationtimeline/Timeline.tsx b/src/client/views/animationtimeline/Timeline.tsx index 43f15a33f..ab984f727 100644 --- a/src/client/views/animationtimeline/Timeline.tsx +++ b/src/client/views/animationtimeline/Timeline.tsx @@ -445,7 +445,7 @@ export class Timeline extends React.Component { // @computed getCurrentTime = () => { - let current = KeyframeFunc.convertPixelTime(this._currentBarX, "mili", "time", this._tickSpacing, this._tickIncrement); + const current = KeyframeFunc.convertPixelTime(this._currentBarX, "mili", "time", this._tickSpacing, this._tickIncrement); return this.toReadTime(current > this._time ? this._time : current); } diff --git a/src/client/views/animationtimeline/TimelineOverview.tsx b/src/client/views/animationtimeline/TimelineOverview.tsx index 31e248823..81a5587e4 100644 --- a/src/client/views/animationtimeline/TimelineOverview.tsx +++ b/src/client/views/animationtimeline/TimelineOverview.tsx @@ -42,9 +42,9 @@ export class TimelineOverview extends React.Component{ this.setOverviewWidth(); this._authoringReaction = reaction( - () => this.props.parent._isAuthoring, + () => this.props.isAuthoring, () => { - if (!this.props.parent._isAuthoring) { + if (!this.props.isAuthoring) { runInAction(() => { this.setOverviewWidth(); }); diff --git a/src/client/views/collections/CollectionPileView.tsx b/src/client/views/collections/CollectionPileView.tsx index fc48e0327..22a3877ab 100644 --- a/src/client/views/collections/CollectionPileView.tsx +++ b/src/client/views/collections/CollectionPileView.tsx @@ -12,6 +12,7 @@ import { SelectionManager } from "../../util/SelectionManager"; import { UndoManager, undoBatch } from "../../util/UndoManager"; import { SnappingManager } from "../../util/SnappingManager"; import { DragManager } from "../../util/DragManager"; +import { DocUtils } from "../../documents/Documents"; @observer export class CollectionPileView extends CollectionSubView(doc => doc) { @@ -45,12 +46,12 @@ export class CollectionPileView extends CollectionSubView(doc => doc) { if (this.layoutEngine() === 'starburst') { const defaultSize = 110; this.layoutDoc._overflow = undefined; - this.childDocs.forEach(d => Doc.iconify(d)); + this.childDocs.forEach(d => DocUtils.iconify(d)); this.rootDoc.x = NumCast(this.rootDoc.x) + this.layoutDoc[WidthSym]() / 2 - NumCast(this.layoutDoc._starburstPileWidth, defaultSize) / 2; this.rootDoc.y = NumCast(this.rootDoc.y) + this.layoutDoc[HeightSym]() / 2 - NumCast(this.layoutDoc._starburstPileHeight, defaultSize) / 2; this.layoutDoc._width = NumCast(this.layoutDoc._starburstPileWidth, defaultSize); this.layoutDoc._height = NumCast(this.layoutDoc._starburstPileHeight, defaultSize); - Doc.pileup(this.childDocs); + DocUtils.pileup(this.childDocs); this.layoutDoc._panX = 0; this.layoutDoc._panY = -10; this.props.Document._pileLayoutEngine = 'pass'; @@ -76,7 +77,7 @@ export class CollectionPileView extends CollectionSubView(doc => doc) { onInternalDrop = (e: Event, de: DragManager.DropEvent) => { if (super.onInternalDrop(e, de)) { if (de.complete.docDragData) { - Doc.pileup(this.childDocs); + DocUtils.pileup(this.childDocs); } } return true; diff --git a/src/client/views/collections/CollectionStackingView.tsx b/src/client/views/collections/CollectionStackingView.tsx index bd48d1727..0a1b03522 100644 --- a/src/client/views/collections/CollectionStackingView.tsx +++ b/src/client/views/collections/CollectionStackingView.tsx @@ -27,6 +27,7 @@ import { CollectionSubView } from "./CollectionSubView"; import { CollectionViewType } from "./CollectionView"; import { SnappingManager } from "../../util/SnappingManager"; import { CollectionFreeFormDocumentView } from "../nodes/CollectionFreeFormDocumentView"; +import { DocUtils } from "../../documents/Documents"; const _global = (window /* browser */ || global /* node */) as any; type StackingDocument = makeInterface<[typeof collectionSchema, typeof documentSchema]>; @@ -412,7 +413,7 @@ export class CollectionStackingView extends CollectionSubView(StackingDocument) if (value && this.sectionHeaders) { const schemaHdrField = new SchemaHeaderField(value); this.sectionHeaders.push(schemaHdrField); - Doc.addFieldEnumerations(undefined, this.pivotField, [{ title: value, _backgroundColor: schemaHdrField.color }]); + DocUtils.addFieldEnumerations(undefined, this.pivotField, [{ title: value, _backgroundColor: schemaHdrField.color }]); return true; } return false; diff --git a/src/client/views/collections/CollectionStackingViewFieldColumn.tsx b/src/client/views/collections/CollectionStackingViewFieldColumn.tsx index a269b21f5..bcd55f0fe 100644 --- a/src/client/views/collections/CollectionStackingViewFieldColumn.tsx +++ b/src/client/views/collections/CollectionStackingViewFieldColumn.tsx @@ -235,7 +235,7 @@ export class CollectionStackingViewFieldColumn extends React.Component dataDoc[fieldKey] instanceof RichTextField || dataDoc[fieldKey] instanceof ImageField || typeof (dataDoc[fieldKey]) === "string").map(fieldKey => docItems.push({ description: ":" + fieldKey, event: () => { - const created = Docs.Get.DocumentFromField(dataDoc, fieldKey, Doc.GetProto(this.props.parent.props.Document)); + const created = DocUtils.DocumentFromField(dataDoc, fieldKey, Doc.GetProto(this.props.parent.props.Document)); if (created) { if (this.props.parent.Document.isTemplateDoc) { Doc.MakeMetadataFieldTemplate(created, this.props.parent.props.Document); diff --git a/src/client/views/collections/CollectionSubView.tsx b/src/client/views/collections/CollectionSubView.tsx index 47d571bcc..93d20c475 100644 --- a/src/client/views/collections/CollectionSubView.tsx +++ b/src/client/views/collections/CollectionSubView.tsx @@ -10,7 +10,7 @@ import { WebField } from "../../../fields/URLField"; import { Cast, ScriptCast, NumCast } from "../../../fields/Types"; import { GestureUtils } from "../../../pen-gestures/GestureUtils"; import { Upload } from "../../../server/SharedMediaTypes"; -import { Utils } from "../../../Utils"; +import { Utils, returnFalse } from "../../../Utils"; import { DocServer } from "../../DocServer"; import { Networking } from "../../Network"; import { ImageUtils } from "../../util/Import & Export/ImageUtils"; @@ -217,7 +217,7 @@ export function CollectionSubView(schemaCtor: (doc: Doc) => T, moreProps?: const movedDocs = docDragData.droppedDocuments.filter((d, i) => docDragData.draggedDocuments[i] === d); const addedDocs = docDragData.droppedDocuments.filter((d, i) => docDragData.draggedDocuments[i] !== d); const res = addedDocs.length ? this.addDocument(addedDocs) : true; - added = movedDocs.length ? docDragData.moveDocument(movedDocs, this.props.Document, this.addDocument) : res; + added = movedDocs.length ? docDragData.moveDocument(movedDocs, this.props.Document, de.embedKey || !this.props.isAnnotationOverlay ? this.addDocument : returnFalse) : res; } else { added = this.addDocument(docDragData.droppedDocuments); } diff --git a/src/client/views/collections/CollectionTimeView.tsx b/src/client/views/collections/CollectionTimeView.tsx index 15bc0bfd5..c2d682361 100644 --- a/src/client/views/collections/CollectionTimeView.tsx +++ b/src/client/views/collections/CollectionTimeView.tsx @@ -19,6 +19,7 @@ const higflyout = require("@hig/flyout"); export const { anchorPoints } = higflyout; export const Flyout = higflyout.default; import React = require("react"); +import { DocUtils } from "../../documents/Documents"; @observer export class CollectionTimeView extends CollectionSubView(doc => doc) { @@ -28,7 +29,7 @@ export class CollectionTimeView extends CollectionSubView(doc => doc) { @observable _childClickedScript: Opt; @observable _viewDefDivClick: Opt; async componentDidMount() { - const detailView = (await DocCastAsync(this.props.Document.childClickedOpenTemplateView)) || Doc.findTemplate("detailView", StrCast(this.props.Document.type), ""); + const detailView = (await DocCastAsync(this.props.Document.childClickedOpenTemplateView)) || DocUtils.findTemplate("detailView", StrCast(this.props.Document.type), ""); const childText = "const alias = getAlias(self); switchView(alias, detailView); alias.dropAction='alias'; alias.removeDropProperties=new List(['dropAction']); useRightSplit(alias, shiftKey); "; runInAction(() => { this._childClickedScript = ScriptField.MakeScript(childText, { this: Doc.name, shiftKey: "boolean" }, { detailView: detailView! }); diff --git a/src/client/views/collections/CollectionView.tsx b/src/client/views/collections/CollectionView.tsx index c3fc3a40a..7e5f427ba 100644 --- a/src/client/views/collections/CollectionView.tsx +++ b/src/client/views/collections/CollectionView.tsx @@ -164,7 +164,7 @@ export class CollectionView extends Touchable { diff --git a/src/client/views/collections/CollectionViewChromes.tsx b/src/client/views/collections/CollectionViewChromes.tsx index 29a3e559a..3dc740c25 100644 --- a/src/client/views/collections/CollectionViewChromes.tsx +++ b/src/client/views/collections/CollectionViewChromes.tsx @@ -93,7 +93,7 @@ export class CollectionViewBaseChrome extends React.Component { diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx index d512f815c..aa4fc48f3 100644 --- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx +++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx @@ -177,7 +177,7 @@ export class CollectionFreeFormView extends CollectionSubView { SelectionManager.DeselectAll(); @@ -251,11 +251,11 @@ export class CollectionFreeFormView extends CollectionSubView { // if (this.props.Document.isBackground) return false; const [xp, yp] = this.getTransform().transformPoint(de.x, de.y); - if (this.isAnnotationOverlay !== true && de.complete.linkDragData) + if (this.isAnnotationOverlay !== true && de.complete.linkDragData) { return this.internalLinkDrop(e, de, de.complete.linkDragData, xp, yp); - if (de.complete.annoDragData?.dropDocument && super.onInternalDrop(e, de)) + } else if (de.complete.annoDragData?.dropDocument && super.onInternalDrop(e, de)) { return this.internalPdfAnnoDrop(e, de.complete.annoDragData, xp, yp); - if (de.complete.docDragData?.droppedDocuments.length && this.internalDocDrop(e, de, de.complete.docDragData, xp, yp)) { + } else if (de.complete.docDragData?.droppedDocuments.length && this.internalDocDrop(e, de, de.complete.docDragData, xp, yp)) { return true; } else { UndoManager.Undo(); @@ -530,9 +530,7 @@ export class CollectionFreeFormView extends CollectionSubView { - console.log(results); const wordResults = results.filter((r: any) => r.category === "inkWord"); for (const word of wordResults) { const indices: number[] = word.strokeIds; @@ -617,8 +615,7 @@ export class CollectionFreeFormView extends CollectionSubView this.props.removeDocument(d)); - const newCollection = Doc.pileup(selected, this.Bounds.left + this.Bounds.width / 2, this.Bounds.top + this.Bounds.height / 2); + const newCollection = DocUtils.pileup(selected, this.Bounds.left + this.Bounds.width / 2, this.Bounds.top + this.Bounds.height / 2); this.props.addDocument(newCollection!); this.props.selectDocuments([newCollection!], []); MarqueeOptionsMenu.Instance.fadeOut(true); @@ -527,7 +526,7 @@ export class MarqueeView extends React.Component { - this._freeHand = x; + this._freeHand = !this._freeHand; } // @action // marqueeInkSelect(ink: Map) { @@ -697,7 +696,7 @@ export class MarqueeView extends React.Component - {/* */} +
; } else { diff --git a/src/client/views/nodes/ScreenshotBox.tsx b/src/client/views/nodes/ScreenshotBox.tsx index d75b864cf..f7dee0896 100644 --- a/src/client/views/nodes/ScreenshotBox.tsx +++ b/src/client/views/nodes/ScreenshotBox.tsx @@ -18,6 +18,7 @@ import { ContextMenuProps } from "../ContextMenuItem"; import { ViewBoxBaseComponent } from "../DocComponent"; import { FieldView, FieldViewProps } from './FieldView'; import "./ScreenshotBox.scss"; +import { InkTool } from "../../../fields/InkField"; const path = require('path'); type ScreenshotDocument = makeInterface<[typeof documentSchema]>; @@ -132,7 +133,7 @@ export class ScreenshotBox extends ViewBoxBaseComponentLoading
: