From 4fe24111c6eafc58927fcca9d8c46a5b92cc4078 Mon Sep 17 00:00:00 2001 From: Ashley Cai Date: Sat, 10 Jul 2021 00:17:09 -0700 Subject: Standardizing Colors, changing global CSS variables --- src/client/views/MainView.scss | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) (limited to 'src/client/views/MainView.scss') diff --git a/src/client/views/MainView.scss b/src/client/views/MainView.scss index 3f04a0f3a..d76458460 100644 --- a/src/client/views/MainView.scss +++ b/src/client/views/MainView.scss @@ -1,4 +1,4 @@ -@import "globalCssVariables"; +@import "global/globalCssVariables"; @import "nodeModuleOverrides"; -- cgit v1.2.3-70-g09d2 From 1a1fc27a66c95c947dc8d2a812484f37586133cd Mon Sep 17 00:00:00 2001 From: Ashley Cai Date: Thu, 15 Jul 2021 12:37:31 -0700 Subject: Starting Color consistency --- src/client/views/AntimodeMenu.scss | 2 +- src/client/views/ContextMenu.scss | 2 +- src/client/views/DocumentButtonBar.scss | 4 +- src/client/views/DocumentDecorations.scss | 8 +-- src/client/views/MainView.scss | 58 +++++++++++----------- src/client/views/PropertiesButtons.scss | 6 +-- src/client/views/StyleProvider.tsx | 31 ++++++------ src/client/views/_nodeModuleOverrides.scss | 2 +- src/client/views/animationtimeline/Timeline.scss | 2 +- .../views/animationtimeline/TimelineMenu.scss | 4 +- src/client/views/animationtimeline/Track.scss | 2 +- .../views/collections/CollectionDockingView.scss | 14 +++--- .../views/collections/CollectionLinearView.scss | 4 +- src/client/views/collections/CollectionMenu.scss | 2 +- .../views/collections/CollectionStackingView.scss | 6 +-- .../views/collections/CollectionStackingView.tsx | 2 +- src/client/views/global/globalCssVariables.scss | 18 ++++--- src/client/views/global/globalEnums.tsx | 17 ++++--- src/client/views/linking/LinkEditor.scss | 2 +- src/client/views/linking/LinkMenuItem.scss | 2 +- src/client/views/nodes/FontIconBox.scss | 13 +++-- src/client/views/search/CheckBox.scss | 2 +- src/client/views/search/IconButton.scss | 2 +- src/client/views/search/IconButton.tsx | 2 +- src/client/views/search/SearchBox.scss | 4 +- src/client/views/search/SelectorContextMenu.scss | 4 +- 26 files changed, 111 insertions(+), 104 deletions(-) (limited to 'src/client/views/MainView.scss') diff --git a/src/client/views/AntimodeMenu.scss b/src/client/views/AntimodeMenu.scss index 8670b1747..2bac03af4 100644 --- a/src/client/views/AntimodeMenu.scss +++ b/src/client/views/AntimodeMenu.scss @@ -5,7 +5,7 @@ position: absolute; z-index: 10001; height: $antimodemenu-height; - background: #323232; + background: $dark-gray; box-shadow: 3px 3px 3px rgba(0, 0, 0, 0.25); // border-radius: 0px 6px 6px 6px; z-index: 1001; diff --git a/src/client/views/ContextMenu.scss b/src/client/views/ContextMenu.scss index 2590e34c6..795529780 100644 --- a/src/client/views/ContextMenu.scss +++ b/src/client/views/ContextMenu.scss @@ -137,7 +137,7 @@ .contextMenu-item:hover { transition: all 0.1s ease; - background: $lighter-alt-accent; + background: $light-blue; } .contextMenu-description { diff --git a/src/client/views/DocumentButtonBar.scss b/src/client/views/DocumentButtonBar.scss index e816c52a3..2a0b494f5 100644 --- a/src/client/views/DocumentButtonBar.scss +++ b/src/client/views/DocumentButtonBar.scss @@ -25,7 +25,7 @@ $linkGap : 3px; border-radius: 50%; opacity: 0.9; pointer-events: auto; - background-color: $dark-color; + background-color: $dark-gray; color: $white; text-transform: uppercase; letter-spacing: 2px; @@ -64,7 +64,7 @@ $linkGap : 3px; text-align: center; border-radius: 50%; pointer-events: auto; - background-color: $dark-color; + background-color: $dark-gray; border: none; transition: 0.2s ease all; diff --git a/src/client/views/DocumentDecorations.scss b/src/client/views/DocumentDecorations.scss index 47a8326bb..1715f35e7 100644 --- a/src/client/views/DocumentDecorations.scss +++ b/src/client/views/DocumentDecorations.scss @@ -286,8 +286,8 @@ $linkGap : 3px; text-align: center; border-radius: 50%; pointer-events: auto; - color: $dark-color; - border: $dark-color 1px solid; + color: $dark-gray; + border: $dark-gray 1px solid; } .linkButton-linker:hover { @@ -302,7 +302,7 @@ $linkGap : 3px; border-radius: 50%; opacity: 0.9; pointer-events: auto; - background-color: $dark-color; + background-color: $dark-gray; color: $white; text-transform: uppercase; letter-spacing: 2px; @@ -343,7 +343,7 @@ $linkGap : 3px; border-radius: 50%; opacity: 0.9; font-size: 14; - background-color: $dark-color; + background-color: $dark-gray; color: $white; text-align: center; cursor: pointer; diff --git a/src/client/views/MainView.scss b/src/client/views/MainView.scss index d76458460..07ca0257c 100644 --- a/src/client/views/MainView.scss +++ b/src/client/views/MainView.scss @@ -56,50 +56,50 @@ touch-action: none; .searchBox-container { - background: lightgray; + background: $light-gray; } } .mainView-container { - color: black; + color: $dark-gray; .lm_title { - background: #cacaca; - color: black; + background: $light-gray; + color: $dark-gray; } } .mainView-container-dark { - color: lightgray; + color: $light-gray; .lm_goldenlayout { - background: dimgray; + background: $medium-gray; } .lm_title { - background: black; + background: $dark-gray; color: unset; } .marquee { - border-color: white; + border-color: $white; } #search-input { - background: lightgray; + background: $light-gray; } .searchBox-container { - background: rgb(45, 45, 45); + background: $dark-gray; } .contextMenu-cont, .contextMenu-item { - background: dimGray; + background: $medium-gray; } .contextMenu-item:hover { - background: gray; + background: $medium-gray; } } @@ -113,7 +113,7 @@ .mainView-propertiesDragger { //background-color: rgb(140, 139, 139); - background-color: lightgrey; + background-color: $light-gray; height: 55px; width: 17px; position: absolute; @@ -163,10 +163,10 @@ flex-direction: column; position: relative; height: 100%; - background: dimgray; + background: $medium-gray; .documentView-node-topmost { - background: lightgrey; + background: $light-gray; } } @@ -174,32 +174,32 @@ right: 0; position: absolute; z-index: 2; - background-color: rgb(159, 159, 159); + background-color: $medium-gray; .editable-title { - background-color: lightgrey; + background-color: $light-gray; } } } .mainView-libraryHandle { - background-color: lightgrey; + background-color: $light-gray; } .mainView-innerContent-dark { .propertiesView { background-color: #252525; input { - background-color: dimgrey; + background-color: $medium-gray; } .propertiesView-sharingTable { - background-color: dimgrey; + background-color: $medium-gray; } .editable-title { - background-color: dimgrey; + background-color: $medium-gray; } .propertiesView-field { - background-color: dimgrey; + background-color: $medium-gray; } } .mainView-propertiesDragger, @@ -209,17 +209,17 @@ } .mainView-container-dark { .contextMenu-cont { - background: dimgrey; - color: white; + background: $medium-gray; + color: $white; input::placeholder { - color:white; + color:$white; } } } .mainView-menuPanel { min-width: var(--menuPanelWidth); - background-color: #121721; + background-color: $dark-gray; .collectionStackingView { scrollbar-width: none; @@ -233,13 +233,13 @@ padding: 7px; padding-left: 7px; width: 100%; - background: black; + background: $dark-gray; .mainView-menuPanel-button-wrap { width: 45px; /* padding: 5px; */ touch-action: none; - background: black; + background: $dark-gray; transform-origin: top left; /* margin-bottom: 5px; */ margin-top: 5px; @@ -247,7 +247,7 @@ border-radius: 8px; &:hover { - background: rgb(61, 61, 61); + background: $black; cursor: pointer; } } diff --git a/src/client/views/PropertiesButtons.scss b/src/client/views/PropertiesButtons.scss index 4ef7763be..484522bc7 100644 --- a/src/client/views/PropertiesButtons.scss +++ b/src/client/views/PropertiesButtons.scss @@ -24,7 +24,7 @@ $linkGap : 3px; width: 29px; border-radius: 6px; pointer-events: auto; - background-color: $dark-color; + background-color: $dark-gray; color: #fcfbf7; text-transform: uppercase; letter-spacing: 2px; @@ -45,11 +45,11 @@ $linkGap : 3px; } .propertiesButtons-linkButton-empty.toggle-on { background-color: white; - color: $dark-color; + color: $dark-gray; } .propertiesButtons-linkButton-empty.toggle-hover { background-color: gray; - color: $dark-color; + color: $dark-gray; } .propertiesButtons-linkButton-empty.toggle-off { color: white; diff --git a/src/client/views/StyleProvider.tsx b/src/client/views/StyleProvider.tsx index 9e61351c4..1bf47f6ac 100644 --- a/src/client/views/StyleProvider.tsx +++ b/src/client/views/StyleProvider.tsx @@ -1,4 +1,5 @@ import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'; +import { Colors } from './global/globalEnums'; import { IconProp } from '@fortawesome/fontawesome-svg-core'; import 'golden-layout/src/css/goldenlayout-base.css'; import 'golden-layout/src/css/goldenlayout-dark-theme.css'; @@ -97,14 +98,14 @@ export function DefaultStyleProvider(doc: Opt, props: Opt = StrCast(doc?.[fieldKey + "color"], StrCast(doc?._color)); if (docColor) return docColor; - const backColor = backgroundCol();// || (darkScheme() ? "black" : "white"); + const backColor = backgroundCol(); if (!backColor) return undefined; const nonAlphaColor = backColor.startsWith("#") ? (backColor as string).substring(0, 7) : backColor.startsWith("rgba") ? backColor.replace(/,.[^,]*\)/, ")").replace("rgba", "rgb") : backColor const col = Color(nonAlphaColor).rgb(); const colsum = (col.red() + col.green() + col.blue()); - if (colsum / col.alpha() > 400 || col.alpha() < 0.25) return "black"; - return "white"; + if (colsum / col.alpha() > 400 || col.alpha() < 0.25) return Colors.DARK_GRAY; + return Colors.WHITE; case StyleProp.Hidden: return BoolCast(doc?._hidden); case StyleProp.BorderRounding: return StrCast(doc?.[fieldKey + "borderRounding"]); case StyleProp.TitleHeight: return 15; @@ -114,30 +115,30 @@ export function DefaultStyleProvider(doc: Opt, props: Opt = StrCast(doc?.[fieldKey + "backgroundColor"], StrCast(doc?._backgroundColor, isCaption ? "rgba(0,0,0,0.4)" : "")); - if (MainView.Instance.LastButton === doc) return darkScheme() ? "dimgrey" : "lightgrey"; + if (MainView.Instance.LastButton === doc) return darkScheme() ? Colors.MEDIUM_GRAY : Colors.LIGHT_GRAY; switch (doc?.type) { case DocumentType.PRESELEMENT: docColor = docColor || (darkScheme() ? "" : ""); break; - case DocumentType.PRES: docColor = docColor || (darkScheme() ? "#3e3e3e" : "white"); break; - case DocumentType.FONTICON: docColor = docColor || "black"; break; - case DocumentType.RTF: docColor = docColor || (darkScheme() ? "#2d2d2d" : "#f1efeb"); break; - case DocumentType.FILTER: docColor = docColor || (darkScheme() ? "#2d2d2d" : "rgba(105, 105, 105, 0.432)"); break; + case DocumentType.PRES: docColor = docColor || (darkScheme() ? Colors.DARK_GRAY : Colors.WHITE); break; + case DocumentType.FONTICON: docColor = docColor || Colors.DARK_GRAY; break; + case DocumentType.RTF: docColor = docColor || (darkScheme() ? Colors.DARK_GRAY : Colors.LIGHT_GRAY); break; + case DocumentType.FILTER: docColor = docColor || (darkScheme() ? Colors.DARK_GRAY : "rgba(105, 105, 105, 0.432)"); break; case DocumentType.INK: docColor = doc?.isInkMask ? "rgba(0,0,0,0.7)" : undefined; break; case DocumentType.SLIDER: break; case DocumentType.EQUATION: docColor = docColor || "transparent"; break; case DocumentType.LABEL: docColor = docColor || (doc.annotationOn !== undefined ? "rgba(128, 128, 128, 0.18)" : undefined); break; - case DocumentType.BUTTON: docColor = docColor || (darkScheme() ? "#2d2d2d" : "lightgray"); break; - case DocumentType.LINKANCHOR: docColor = isAnchor ? "lightblue" : "transparent"; break; + case DocumentType.BUTTON: docColor = docColor || (darkScheme() ? Colors.DARK_GRAY : Colors.LIGHT_GRAY); break; + case DocumentType.LINKANCHOR: docColor = isAnchor ? Colors.LIGHT_BLUE : "transparent"; break; case DocumentType.LINK: docColor = docColor || "transparent"; break; case DocumentType.IMG: case DocumentType.WEB: case DocumentType.PDF: case DocumentType.SCREENSHOT: - case DocumentType.VID: docColor = docColor || (darkScheme() ? "#2d2d2d" : "lightgray"); break; + case DocumentType.VID: docColor = docColor || (darkScheme() ? Colors.DARK_GRAY : Colors.LIGHT_GRAY); break; case DocumentType.COL: if (StrCast(Doc.LayoutField(doc)).includes("SliderBox")) break; - docColor = docColor ? docColor : + docColor = docColor ? Colors.DARK_GRAY : doc?._isGroup ? "#00000004" : // very faint highlight to show bounds of group - (Doc.IsSystem(doc) ? (darkScheme() ? "rgb(62,62,62)" : "lightgrey") : // system docs (seen in treeView) get a grayish background + (Doc.IsSystem(doc) ? (darkScheme() ? Colors.DARK_GRAY : Colors.LIGHT_GRAY) : // system docs (seen in treeView) get a grayish background isBackground() ? "cyan" : // ?? is there a good default for a background collection doc.annotationOn ? "#00000015" : // faint interior for collections on PDFs, images, etc StrCast((props?.renderDepth || 0) > 0 ? @@ -145,7 +146,7 @@ export function DefaultStyleProvider(doc: Opt, props: Opt, props: Optspan { - background: $dark-color; + background: $dark-gray; color: $white; border-radius: 18px; margin-right: 6px; @@ -63,7 +63,7 @@ >label { margin-top: "auto"; margin-bottom: "auto"; - background: $dark-color; + background: $dark-gray; color: $white; display: inline-block; border-radius: 18px; diff --git a/src/client/views/collections/CollectionMenu.scss b/src/client/views/collections/CollectionMenu.scss index 328d7c081..7e507d6b5 100644 --- a/src/client/views/collections/CollectionMenu.scss +++ b/src/client/views/collections/CollectionMenu.scss @@ -411,7 +411,7 @@ } .switchToText:hover { - color: $dark-color; + color: $dark-gray; } } diff --git a/src/client/views/collections/CollectionStackingView.scss b/src/client/views/collections/CollectionStackingView.scss index f103d9581..4b123c8b6 100644 --- a/src/client/views/collections/CollectionStackingView.scss +++ b/src/client/views/collections/CollectionStackingView.scss @@ -96,7 +96,7 @@ height: 2vw; width: 100%; font-family: $sans-serif; - background: $dark-color; + background: $dark-gray; color: $white; } @@ -184,7 +184,7 @@ // overflow: hidden; overflow is visible so the color menu isn't hidden -ftong .editableView-input { - color: $dark-color; + color: $dark-gray; } .editableView-input:hover, @@ -205,7 +205,7 @@ display: flex; align-items: center; justify-content: center; - color: $dark-color; + color: $dark-gray; .editableView-container-editing-oneLine, .editableView-container-editing { diff --git a/src/client/views/collections/CollectionStackingView.tsx b/src/client/views/collections/CollectionStackingView.tsx index 30f8e0112..7aa8dfd56 100644 --- a/src/client/views/collections/CollectionStackingView.tsx +++ b/src/client/views/collections/CollectionStackingView.tsx @@ -480,7 +480,7 @@ export class CollectionStackingView extends CollectionSubView{ hoverStyle = { opacity: 1, backgroundColor: "rgb(128, 128, 128)" - //backgroundColor: "rgb(178, 206, 248)" //$darker-alt-accent + //backgroundColor: "rgb(178, 206, 248)" //$medium-blue }; render() { diff --git a/src/client/views/search/SearchBox.scss b/src/client/views/search/SearchBox.scss index 8d6bc86cb..6a2fe6f19 100644 --- a/src/client/views/search/SearchBox.scss +++ b/src/client/views/search/SearchBox.scss @@ -20,7 +20,7 @@ display: flex; justify-content: center; align-items: center; - background-color: $dark-color; + background-color: $dark-gray; .searchBox-lozenges { position: absolute; @@ -86,7 +86,7 @@ &.searchBox-input { margin:5px; border-radius:20px; - border:$dark-color; + border:$dark-gray; display: block; width: 130px; -webkit-transition: width 0.4s; diff --git a/src/client/views/search/SelectorContextMenu.scss b/src/client/views/search/SelectorContextMenu.scss index 438b6a0c2..a114f679c 100644 --- a/src/client/views/search/SelectorContextMenu.scss +++ b/src/client/views/search/SelectorContextMenu.scss @@ -1,7 +1,7 @@ @import "../global/globalCssVariables"; .parents { - background: $lighter-alt-accent; + background: $light-blue; padding: 10px; // width: 300px; @@ -10,7 +10,7 @@ } .collection { - border-color: $darker-alt-accent; + border-color: $medium-blue; border-bottom-style: solid; } } \ No newline at end of file -- cgit v1.2.3-70-g09d2 From b33e45f1f839b3c6eaf1076e605abacd1bc6883c Mon Sep 17 00:00:00 2001 From: geireann Date: Thu, 29 Jul 2021 15:35:39 -0400 Subject: lots of updates! --- src/client/util/SettingsManager.tsx | 79 ++++++-- src/client/views/AntimodeMenu.scss | 2 +- src/client/views/MainView.scss | 27 --- src/client/views/MainView.tsx | 61 ++---- src/client/views/_nodeModuleOverrides.scss | 52 ++++- .../views/collections/CollectionDockingView.scss | 98 +++++++--- .../views/collections/CollectionDockingView.tsx | 2 +- src/client/views/collections/TabDocView.scss | 59 +++++- src/client/views/collections/TabDocView.tsx | 107 +++++++---- src/client/views/global/globalCssVariables.scss | 4 +- src/client/views/global/globalEnums.tsx | 4 + src/client/views/topbar/TopBar.scss | 211 +++++++++++++++++++++ src/client/views/topbar/TopBar.tsx | 58 ++++++ src/fields/Doc.ts | 6 +- 14 files changed, 618 insertions(+), 152 deletions(-) create mode 100644 src/client/views/topbar/TopBar.scss create mode 100644 src/client/views/topbar/TopBar.tsx (limited to 'src/client/views/MainView.scss') diff --git a/src/client/util/SettingsManager.tsx b/src/client/util/SettingsManager.tsx index 777394b05..3987497b8 100644 --- a/src/client/util/SettingsManager.tsx +++ b/src/client/util/SettingsManager.tsx @@ -18,6 +18,12 @@ const higflyout = require("@hig/flyout"); export const { anchorPoints } = higflyout; export const Flyout = higflyout.default; +export enum ColorScheme { + Dark = "Dark", + Light = "Light", + System = "Match System" +} + @observer export class SettingsManager extends React.Component<{}> { public static Instance: SettingsManager; @@ -32,7 +38,7 @@ export class SettingsManager extends React.Component<{}> { @observable activeTab = "Accounts"; @computed get backgroundColor() { return Doc.UserDoc().activeCollectionBackground; } - + @computed get colorScheme() { return Doc.UserDoc().colorScheme; } constructor(props: {}) { super(props); @@ -69,6 +75,28 @@ export class SettingsManager extends React.Component<{}> { else DocServer.Control.makeEditable(); }); + @undoBatch + @action + changeColorScheme = action((e: React.ChangeEvent) => { + const scheme: ColorScheme = (e.currentTarget as any).value; + switch (scheme) { + case ColorScheme.Light: + Doc.UserDoc().colorScheme = ColorScheme.Light; + addStyleSheetRule(SettingsManager._settingsStyle, "lm_header", { background: "#d3d3d3 !important" }); + break; + case ColorScheme.Dark: + Doc.UserDoc().colorScheme = ColorScheme.Dark; + addStyleSheetRule(SettingsManager._settingsStyle, "lm_header", { background: "black !important" }); + break; + case ColorScheme.System: default: + window.matchMedia('(prefers-color-scheme: dark)').addEventListener('change', e => { + Doc.UserDoc().colorScheme = e.matches ? ColorScheme.Dark : ColorScheme.Light; + }); + break; + } + }); + + @computed get colorsContent() { const colorBox = (func: (color: ColorState) => void) => { ; - const fontFamilies = ["Times New Roman", "Arial", "Georgia", "Comic Sans MS", "Tahoma", "Impact", "Crimson Text"]; - const fontSizes = ["7px", "8px", "9px", "10px", "12px", "14px", "16px", "18px", "20px", "24px", "32px", "48px", "72px"]; + const colorSchemes = [ColorScheme.Light, ColorScheme.Dark, ColorScheme.System]; return
@@ -102,14 +129,11 @@ export class SettingsManager extends React.Component<{}> {
Border/Header Color
{userColorFlyout}
-
-
Default Font
-
- - + {colorSchemes.map(scheme => )}
@@ -132,6 +156,16 @@ export class SettingsManager extends React.Component<{}> { checked={BoolCast(Doc.UserDoc()._raiseWhenDragged)} />
Raise on drag
+
+ Doc.UserDoc()._showLabel = !Doc.UserDoc()._showLabel} + checked={BoolCast(Doc.UserDoc()._showLabel)} /> +
Show tool button labels
+
+
+ Doc.UserDoc()._showMenuLabel = !Doc.UserDoc()._showMenuLabel} + checked={BoolCast(Doc.UserDoc()._showMenuLabel)} /> +
Show menu button labels
+
; } @@ -149,6 +183,27 @@ export class SettingsManager extends React.Component<{}> { ; } + @computed get textContent() { + + const fontFamilies = ["Times New Roman", "Arial", "Georgia", "Comic Sans MS", "Tahoma", "Impact", "Crimson Text", "Roboto"]; + const fontSizes = ["7px", "8px", "9px", "10px", "12px", "14px", "16px", "18px", "20px", "24px", "32px", "48px", "72px"]; + + return ( +
+
+
Default Font
+
+ + +
+
+
); + } + @action changeVal = (e: React.ChangeEvent, pass: string) => { const value = (e.target as any).value; @@ -228,7 +283,7 @@ export class SettingsManager extends React.Component<{}> { // { title: "Accounts", ele: this.accountsContent }, { title: "Preferences", ele: this.preferencesContent }]; const tabs = [{ title: "Accounts", ele: this.accountsContent }, { title: "Modes", ele: this.modesContent }, - { title: "Appearance", ele: this.appearanceContent }]; + { title: "Appearance", ele: this.appearanceContent }, { title: "Text", ele: this.textContent }]; return
diff --git a/src/client/views/AntimodeMenu.scss b/src/client/views/AntimodeMenu.scss index 2bac03af4..b509f9f54 100644 --- a/src/client/views/AntimodeMenu.scss +++ b/src/client/views/AntimodeMenu.scss @@ -6,7 +6,7 @@ z-index: 10001; height: $antimodemenu-height; background: $dark-gray; - box-shadow: 3px 3px 3px rgba(0, 0, 0, 0.25); + // box-shadow: 3px 3px 3px rgba(0, 0, 0, 0.25); // border-radius: 0px 6px 6px 6px; z-index: 1001; display: flex; diff --git a/src/client/views/MainView.scss b/src/client/views/MainView.scss index 07ca0257c..2069986ad 100644 --- a/src/client/views/MainView.scss +++ b/src/client/views/MainView.scss @@ -419,31 +419,4 @@ display: block; width: 500px; height: 1000px; -} - -.lm_drag_tab { - padding: 0; - width: 15px !important; - height: 15px !important; - position: relative !important; - display: inline-flex !important; - align-items: center; - top: 0 !important; - right: unset !important; - left: 0 !important; -} -.lm_close_tab { - padding: 0; - width: 15px !important; - height: 15px !important; - position: relative !important; - display: inline-flex !important; - align-items: center; - top: 0 !important; - right: unset !important; - left: 0 !important; -} -.lm_tab, .lm_tab_active { - display: flex !important; - padding-right: 0 !important; } \ No newline at end of file diff --git a/src/client/views/MainView.tsx b/src/client/views/MainView.tsx index f34851b00..7d6bfbd40 100644 --- a/src/client/views/MainView.tsx +++ b/src/client/views/MainView.tsx @@ -63,6 +63,7 @@ import { PreviewCursor } from './PreviewCursor'; import { PropertiesView } from './PropertiesView'; import { SearchBox } from './search/SearchBox'; import { DefaultStyleProvider, DashboardStyleProvider, StyleProp } from './StyleProvider'; +import { TopBar } from './topbar/TopBar'; const _global = (window /* browser */ || global /* node */) as any; @observer @@ -78,7 +79,7 @@ export class MainView extends React.Component { @observable private _sidebarContent: any = this.userDoc?.sidebar; @observable private _flyoutWidth: number = 0; - @computed private get topOffset() { return (CollectionMenu.Instance?.Pinned ? 35 : 0) + Number(SEARCH_PANEL_HEIGHT.replace("px", "")); } + @computed private get topOffset() { return Number(SEARCH_PANEL_HEIGHT.replace("px", "")); } //TODO remove @computed private get leftOffset() { return this.menuPanelWidth() - 2; } @computed private get userDoc() { return Doc.UserDoc(); } @computed private get darkScheme() { return BoolCast(CurrentUserUtils.ActiveDashboard?.darkScheme); } @@ -180,8 +181,8 @@ export class MainView extends React.Component { const targClass = targets[0].className.toString(); if (SearchBox.Instance._searchbarOpen || SearchBox.Instance.open) { const check = targets.some((thing) => - (thing.className === "collectionSchemaView-searchContainer" || (thing as any)?.dataset.icon === "filter" || - thing.className === "collectionSchema-header-menuOptions")); + (thing.className === "collectionSchemaView-searchContainer" || (thing as any)?.dataset.icon === "filter" || + thing.className === "collectionSchema-header-menuOptions")); !check && SearchBox.Instance.resetSearch(true); } !targClass.includes("contextMenu") && ContextMenu.Instance.closeMenu(); @@ -242,8 +243,9 @@ export class MainView extends React.Component { } getPWidth = () => this._panelWidth - this.propertiesWidth(); - getPHeight = () => this._panelHeight; + getPHeight = () => this._panelHeight - (CollectionMenu.Instance?.Pinned ? 35 : 0); getContentsHeight = () => this._panelHeight; + getMenuPanelHeight = () => this._panelHeight + (CollectionMenu.Instance?.Pinned ? 35 : 0); @computed get mainDocView() { return { e.stopPropagation(); e.preventDefault(); }} + // style={{ minWidth: `calc(100% - ${this._flyoutWidth + this.menuPanelWidth() + this.propertiesWidth()}px)`, width: `calc(100% - ${this._flyoutWidth + this.propertiesWidth()}px)` }}> + // FIXME update with property panel width style={{ minWidth: `calc(100% - ${this._flyoutWidth + this.menuPanelWidth() + this.propertiesWidth()}px)`, transform: LightboxView.LightboxDoc ? "scale(0.0001)" : undefined, - width: `calc(100% - ${this._flyoutWidth + this.menuPanelWidth() + this.propertiesWidth()}px)` + //TODO:glr width: `calc(100% - ${this._flyoutWidth + this.menuPanelWidth() + this.propertiesWidth()}px)` }}> {!this.mainContainer ? (null) : this.mainDocView}
; @@ -358,7 +362,7 @@ export class MainView extends React.Component { removeDocument={returnFalse} ScreenToLocalTransform={this.sidebarScreenToLocal} PanelWidth={this.menuPanelWidth} - PanelHeight={this.getContentsHeight} + PanelHeight={this.getMenuPanelHeight} renderDepth={0} docViewPath={returnEmptyDoclist} focus={DocUtils.DefaultFocus} @@ -405,16 +409,19 @@ export class MainView extends React.Component { {this.menuPanel}
{this.flyout} -
+
+
+ - {this.dockingContent} + {this.dockingContent} -
- +
+ +
+ {this.propertiesWidth() < 10 ? (null) : }
- {this.propertiesWidth() < 10 ? (null) : }
; } @@ -525,35 +532,8 @@ export class MainView extends React.Component { @computed get search() { TraceMobx(); - return
- + return
+
; } @@ -605,7 +585,6 @@ export class MainView extends React.Component { {this.search} - {LinkDescriptionPopup.descriptionPopup ? : null} {DocumentLinksButton.LinkEditorDocView ? : (null)} {LinkDocPreview.LinkInfo ? : (null)} diff --git a/src/client/views/_nodeModuleOverrides.scss b/src/client/views/_nodeModuleOverrides.scss index 56346b68b..cb59489c0 100644 --- a/src/client/views/_nodeModuleOverrides.scss +++ b/src/client/views/_nodeModuleOverrides.scss @@ -1,8 +1,49 @@ +@import "./global/globalCssVariables"; // this file is for overriding all the css from installed node modules // goldenlayout stuff div .lm_header { background: $dark-gray; + overflow: hidden; +} + +/* Width */ +.lm_header::-webkit-scrollbar { + -webkit-appearance: none; + display: none; +} + +/* Width */ +.lm_header:hover::-webkit-scrollbar { + -webkit-appearance: none; + display: block; + height: 0px; +} + +/* Track */ +.lm_header:hover::-webkit-scrollbar-track { + -webkit-appearance: none; + display: none; +} + +/* Handle */ +.lm_header:hover::-webkit-scrollbar-thumb { + -webkit-appearance: none; + background: $dark-gray; +} + +/* Handle on hover */ +.lm_header:hover::-webkit-scrollbar-thumb:hover { + -webkit-appearance: none; + background: $dark-gray; +} + +.lm_tabs { + display: flex; + position: absolute; + width: calc(100% - 60px); + overflow: scroll; + background: $dark-gray; } .lm_tab { @@ -15,7 +56,16 @@ div .lm_header { } .lm_header .lm_controls { - right: 1em !important; + align-items: center; + position: absolute; + background-color: #000000; + border-radius: 5px; + display: flex; + top: 2px; + justify-content: space-evenly; + right: 2px; + height: 18px; + width: 65px; } // @TODO the ril__navgiation buttons in the img gallery are a lil messed up but I can't figure out diff --git a/src/client/views/collections/CollectionDockingView.scss b/src/client/views/collections/CollectionDockingView.scss index a054f0ae1..b8180fe24 100644 --- a/src/client/views/collections/CollectionDockingView.scss +++ b/src/client/views/collections/CollectionDockingView.scss @@ -1,40 +1,46 @@ -@import "../../views/global/globalCssVariables.scss"; +@import "../global/globalCssVariables.scss"; .lm_title { - margin-top: 3px; - border-radius: 5px; - border: solid 0px dimgray; - border-width: 2px 2px 0px; - height: 20px; - transform: translate(0px, -3px); + -webkit-appearance: none; + display: inline-block; + align-self: center; + align-items: center; + height: 100%; + overflow: hidden; + text-overflow: ellipsis; + background: transparent; + border: solid 0px transparent; cursor: grab; + color: $black; } .lm_title.focus-visible { + -webkit-appearance: none; cursor: text; } .lm_title_wrap { overflow: hidden; - height: 19px; - margin-top: -2px; - display: inline-block; + align-items: center; + align-self: center; + background: transparent; + width: max-content; + height: 100%; + display: flex; } .lm_active .lm_title { - border: solid 1px lightgray; -} - -.lm_header .lm_tab .lm_close_tab { - position: absolute; - text-align: center; + -webkit-appearance: none; + // font-weight: 700; } .lm_header .lm_tab { - padding-right: 20px; - margin-top: -1px; - border-bottom: 1px black; + padding: 0px; + opacity: 0.7; + box-shadow: none; + height: 19px; + // border-bottom: 1px black; .collectionDockingView-gear { display: none; @@ -42,9 +48,13 @@ } .lm_header .lm_tab.lm_active { - padding-right: 20px; - margin-top: 1px; - border-bottom: unset; + padding: 0; + opacity: 1; + margin: 0; + box-shadow: none; + height: 22px; + margin-right: 2px; + // border-bottom: unset; .collectionDockingView-gear { display: inline-block; @@ -55,6 +65,41 @@ display: inline; } +.lm_drag_tab { + padding: 0; + width: 15px !important; + height: 15px !important; + position: relative !important; + display: inline-flex !important; + align-items: center; + top: 0 !important; + right: unset !important; + left: 0 !important; +} + +.lm_close_tab { + padding: 0; + align-self: center; + margin-right: 5px; + background-color: black; + border-radius: 3px; + opacity: 1 !important; + width: 15px !important; + height: 15px !important; + position: relative !important; + display: inline-flex !important; + align-items: center; + top: 0 !important; + right: unset !important; + left: 0 !important; +} + +.lm_tab, +.lm_tab_active { + display: flex !important; + padding-right: 0 !important; +} + .collectiondockingview-container { width: 100%; height: 100%; @@ -82,16 +127,17 @@ } .lm_content { - background: white; + background: $white; } .lm_controls>li { - opacity: 0.6; - transform: scale(1.2); + opacity: 1; + transform: scale(1); } .lm_controls .lm_popout { - background-image: url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAABUAAAAUCAAAAABHICnvAAAABGdBTUEAALGPC/xhBQAAACBjSFJNAAB6JgAAgIQAAPoAAACA6AAAdTAAAOpgAAA6mAAAF3CculE8AAAAAmJLR0QAAKqNIzIAAAAHdElNRQfkCBsXMgbrEyzaAAAAT0lEQVQY02NgIAcIu8tgEW3/u4IDQ5B14/8LQlhFhckVFfCJjIyIOfP/QWpEZGSQJFS05s9fIPj3/z+YmseCTxS7CZS7DI+PsYcOjpAkDAA6H0KZxzDzlgAAACV0RVh0ZGF0ZTpjcmVhdGUAMjAyMC0wOC0yN1QyMzo1MDowNi0wNDowMDvgVpQAAAAldEVYdGRhdGU6bW9kaWZ5ADIwMjAtMDgtMjdUMjM6NTA6MDYtMDQ6MDBKve4oAAAAAElFTkSuQmCC) + transform: rotate(45deg); + background-image: url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAAkAAAAJCAYAAADgkQYQAAAAQUlEQVR4nHXOQQ4AMAgCQeT/f6aXpsGK3jSTuCVJAAr7iBdoAwCKd0nwfaAdHbYERw5b44+E8JoBjEYGMBq5gAYP3usUDu2IvoUAAAAASUVORK5CYII=); } .lm_maximised .lm_controls .lm_maximise { diff --git a/src/client/views/collections/CollectionDockingView.tsx b/src/client/views/collections/CollectionDockingView.tsx index 388f9a909..a8471f8e2 100644 --- a/src/client/views/collections/CollectionDockingView.tsx +++ b/src/client/views/collections/CollectionDockingView.tsx @@ -445,4 +445,4 @@ Scripting.addGlobal(function openInLightbox(doc: any) { LightboxView.AddDocTab(d "opens up document in a lightbox", "(doc: any)"); Scripting.addGlobal(function openOnRight(doc: any) { return CollectionDockingView.AddSplit(doc, "right"); }, "opens up document in tab on right side of the screen", "(doc: any)"); -Scripting.addGlobal(function useRightSplit(doc: any, shiftKey?: boolean) { CollectionDockingView.ReplaceTab(doc, "right", undefined, shiftKey); }); +Scripting.addGlobal(function useRightSplit(doc: any, shiftKey?: boolean) { CollectionDockingView.ReplaceTab(doc, "right", undefined, shiftKey); }); \ No newline at end of file diff --git a/src/client/views/collections/TabDocView.scss b/src/client/views/collections/TabDocView.scss index 9acbc4f85..a963f1cb9 100644 --- a/src/client/views/collections/TabDocView.scss +++ b/src/client/views/collections/TabDocView.scss @@ -1,19 +1,62 @@ input.lm_title:focus, -input.lm_title -{ +input.lm_title { max-width: unset !important; + outline: none; transition-delay: unset; - width: 100%; + width: max-content; cursor: text; } + input.lm_title { transition-delay: 0.35s; - width: 100px; + width: max-content; cursor: pointer; } -.tabDocView-drag { - margin: auto; + +.lm_iconWrap { + display: flex; + color: black; + width: 15px; + height: 15px; + align-items: center; + align-self: center; + justify-content: center; + margin: 3px; + border-radius: 20%; + + .moreInfoDot { + background-color: white; + border-radius: 100%; + width: 3px; + height: 3px; + margin: 0.5px; + } +} + +.ffMenu { + display: grid; + grid-auto-rows: 35px; + grid-auto-columns: auto auto auto auto auto; + right: 10px; + bottom: 50px; + position: absolute; + min-height: 35px; + height: max-content; + border: solid 2px black; + border-radius: 5px; + background-color: #bddbe6; + width: max-content; + min-width: 35px; + + .ffMenuButton { + display: flex; + width: 35px; + height: 35px; + align-items: center; + justify-content: center; + } } + .miniMap-hidden, .miniMap { position: absolute; @@ -37,6 +80,7 @@ input.lm_title { } } } + .miniMap-hidden { position: absolute; bottom: 0; @@ -46,7 +90,8 @@ input.lm_title { transform: translate(20px, 20px) rotate(45deg); border-radius: 30px; padding: 2px; - > svg { + + >svg { margin-top: 3px; transform: translate(0px, 7px); } diff --git a/src/client/views/collections/TabDocView.tsx b/src/client/views/collections/TabDocView.tsx index 7e2f7811e..0e67bebd8 100644 --- a/src/client/views/collections/TabDocView.tsx +++ b/src/client/views/collections/TabDocView.tsx @@ -1,3 +1,4 @@ +import { IconProp } from '@fortawesome/fontawesome-svg-core'; import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'; import { Tooltip } from '@material-ui/core'; import 'golden-layout/src/css/goldenlayout-base.css'; @@ -9,9 +10,9 @@ import * as ReactDOM from 'react-dom'; import { DataSym, Doc, DocListCast, DocListCastAsync, HeightSym, Opt, WidthSym } from "../../../fields/Doc"; import { Id } from '../../../fields/FieldSymbols'; import { FieldId } from "../../../fields/RefField"; -import { Cast, NumCast, StrCast, BoolCast } from "../../../fields/Types"; +import { BoolCast, Cast, NumCast, StrCast } from "../../../fields/Types"; import { TraceMobx } from '../../../fields/util'; -import { emptyFunction, returnEmptyDoclist, returnFalse, returnTrue, setupMoveUpEvents, Utils } from "../../../Utils"; +import { emptyFunction, lightOrDark, returnEmptyDoclist, returnFalse, returnTrue, setupMoveUpEvents, Utils } from "../../../Utils"; import { DocServer } from "../../DocServer"; import { DocUtils } from '../../documents/Documents'; import { DocumentType } from '../../documents/DocumentTypes'; @@ -24,15 +25,15 @@ import { Transform } from '../../util/Transform'; import { undoBatch, UndoManager } from "../../util/UndoManager"; import { LightboxView } from '../LightboxView'; import { DocFocusOptions, DocumentView, DocumentViewProps } from "../nodes/DocumentView"; -import { FieldViewProps } from '../nodes/FieldView'; -import { PinProps, PresBox, PresMovement } from '../nodes/PresBox'; +import { PresBox, PinProps, PresMovement } from '../nodes/PresBox'; import { DefaultLayerProvider, DefaultStyleProvider, StyleLayers, StyleProp } from '../StyleProvider'; import { CollectionDockingView } from './CollectionDockingView'; import { CollectionDockingViewMenu } from './CollectionDockingViewMenu'; import { CollectionFreeFormView } from './collectionFreeForm/CollectionFreeFormView'; -import { CollectionViewType, CollectionView } from './CollectionView'; +import { CollectionView, CollectionViewType } from './CollectionView'; import "./TabDocView.scss"; import React = require("react"); +import Color = require('color'); const _global = (window /* browser */ || global /* node */) as any; interface TabDocViewProps { @@ -52,6 +53,14 @@ export class TabDocView extends React.Component { @computed get layoutDoc() { return this._document && Doc.Layout(this._document); } @computed get tabColor() { return StrCast(this._document?._backgroundColor, StrCast(this._document?.backgroundColor, DefaultStyleProvider(this._document, undefined, StyleProp.BackgroundColor))); } + @computed get tabTextColor() { return this._document?.type === DocumentType.PRES ? "black" : StrCast(this._document?._color, StrCast(this._document?.color, DefaultStyleProvider(this._document, undefined, StyleProp.Color))); } + // @computed get renderBounds() { + // const bounds = this._document ? Cast(this._document._renderContentBounds, listSpec("number"), [0, 0, this.returnMiniSize(), this.returnMiniSize()]) : [0, 0, 0, 0]; + // const xbounds = bounds[2] - bounds[0]; + // const ybounds = bounds[3] - bounds[1]; + // const dim = Math.max(xbounds, ybounds); + // return { l: bounds[0] + xbounds / 2 - dim / 2, t: bounds[1] + ybounds / 2 - dim / 2, cx: bounds[0] + xbounds / 2, cy: bounds[1] + ybounds / 2, dim }; + // } get stack() { return (this.props as any).glContainer.parent.parent; } get tab() { return (this.props as any).glContainer.tab; } @@ -65,15 +74,25 @@ export class TabDocView extends React.Component { tab.contentItem.config.fixed && (tab.contentItem.parent.config.fixed = true); tab.DashDoc = doc; CollectionDockingView.Instance.tabMap.add(tab); - + const iconType: IconProp = Doc.toIcon(doc); // setup the title element and set its size according to the # of chars in the title. Show the full title when clicked. const titleEle = tab.titleElement[0]; + const iconWrap = document.createElement("div"); + const closeWrap = document.createElement("div"); + + titleEle.size = StrCast(doc.title).length + 3; titleEle.value = doc.title; titleEle.onchange = undoBatch(action((e: any) => { titleEle.size = e.currentTarget.value.length + 3; Doc.GetProto(doc).title = e.currentTarget.value; })); + + const dragBtnDown = (e: React.PointerEvent) => { + setupMoveUpEvents(this, e, e => !e.defaultPrevented && DragManager.StartDocumentDrag([iconWrap], new DragManager.DocumentDragData([doc], doc.dropAction as dropActionType), e.clientX, e.clientY), returnFalse, emptyFunction); + }; + + if (tab.element[0].children[1].children.length === 1) { const toggle = document.createElement("div"); toggle.style.width = "10px"; @@ -83,18 +102,42 @@ export class TabDocView extends React.Component { toggle.style.borderTopRightRadius = "7px"; toggle.style.position = "relative"; toggle.style.display = "inline-block"; - toggle.style.background = "gray"; - toggle.style.borderLeft = "solid 1px black"; + toggle.style.background = "transparent"; toggle.onclick = (e: MouseEvent) => { if (tab.contentItem === tab.header.parent.getActiveContentItem()) { tab.DashDoc.activeLayer = tab.DashDoc.activeLayer ? undefined : StyleLayers.Background; } }; - tab.element[0].style.borderTopRightRadius = "8px"; - tab.element[0].children[1].appendChild(toggle); - tab._disposers.layerDisposer = reaction(() => - ({ layer: tab.DashDoc.activeLayer, color: this.tabColor }), - ({ layer, color }) => toggle.style.background = !layer ? color : "dimgrey", { fireImmediately: true }); + iconWrap.className = "lm_iconWrap"; + iconWrap.id = "lm_iconWrap"; + closeWrap.className = "lm_iconWrap"; + closeWrap.id = "lm_closeWrap"; + closeWrap.onclick = (e: MouseEvent) => { + tab.header.parent.contentItem.remove(); + Doc.AddDocToList(CurrentUserUtils.MyRecentlyClosed, "data", tab.DashDoc, undefined, true, true); + }; + const docIcon = ; + const closeIcon = ; + ReactDOM.render(docIcon, iconWrap); + ReactDOM.render(closeIcon, closeWrap); + // tab.element[0].append(closeWrap); + tab.element[0].prepend(iconWrap); + tab._disposers.layerDisposer = reaction(() => ({ layer: tab.DashDoc.activeLayer, color: this.tabColor }), + ({ layer, color }) => { + const textColor = lightOrDark(this.tabColor); //not working with StyleProp.Color + titleEle.style.color = textColor; + titleEle.style.backgroundColor = "transparent"; + iconWrap.style.color = textColor; + closeWrap.style.color = textColor; + moreInfoDrag.style.backgroundColor = textColor; + tab.element[0].style.background = !layer ? color : "dimgrey"; + }, { fireImmediately: true }); + // TODO:glr fix + // tab.element[0].style.borderTopRightRadius = "8px"; + // tab.element[0].children[1].appendChild(toggle); + // tab._disposers.layerDisposer = reaction(() => + // ({ layer: tab.DashDoc.activeLayer, color: this.tabColor }), + // ({ layer, color }) => toggle.style.background = !layer ? color : "dimgrey", { fireImmediately: true }); } // shifts the focus to this tab when another tab is dragged over it tab.element[0].onmouseenter = (e: MouseEvent) => { @@ -103,13 +146,11 @@ export class TabDocView extends React.Component { tab.setActive(true); } }; - const dragBtnDown = (e: React.PointerEvent) => { - setupMoveUpEvents(this, e, e => !e.defaultPrevented && DragManager.StartDocumentDrag([dragHdl], new DragManager.DocumentDragData([doc], doc.dropAction as dropActionType), e.clientX, e.clientY), returnFalse, emptyFunction); - }; + // select the tab document when the tab is directly clicked and activate the tab whenver the tab document is selected titleEle.onpointerdown = action((e: any) => { - if (e.target.className !== "lm_close_tab") { + if (e.target.className !== "lm_iconWrap") { if (this.view) SelectionManager.SelectView(this.view, false); else this._activated = true; if (Date.now() - titleEle.lastClick < 1000) titleEle.select(); @@ -123,25 +164,25 @@ export class TabDocView extends React.Component { const toggle = tab.element[0].children[1].children[0] as HTMLInputElement; selected && tab.contentItem !== tab.header.parent.getActiveContentItem() && UndoManager.RunInBatch(() => tab.header.parent.setActiveContentItem(tab.contentItem), "tab switch"); - toggle.style.fontWeight = selected ? "bold" : ""; - toggle.style.textTransform = selected ? "uppercase" : ""; + // toggle.style.fontWeight = selected ? "bold" : ""; + // toggle.style.textTransform = selected ? "uppercase" : ""; })); //attach the selection doc buttons menu to the drag handle const stack = tab.contentItem.parent; - const dragHdl = document.createElement("div"); - dragHdl.className = "lm_drag_tab"; + const moreInfoDrag = document.createElement("div"); + moreInfoDrag.className = "lm_iconWrap"; tab._disposers.buttonDisposer = reaction(() => this.view, view => - view && [ReactDOM.render( [view]} Stack={stack} />, dragHdl), tab._disposers.buttonDisposer?.()], + view && [ReactDOM.render( [view]} Stack={stack} />, moreInfoDrag), tab._disposers.buttonDisposer?.()], { fireImmediately: true }); - tab.reactComponents = [dragHdl]; - tab.closeElement.before(dragHdl); + // tab.reactComponents = [moreInfoDrag]; + // tab.element[0].children[3].before(moreInfoDrag); // highlight the tab when the tab document is brushed in any part of the UI tab._disposers.reactionDisposer = reaction(() => ({ title: doc.title, degree: Doc.IsBrushedDegree(doc) }), ({ title, degree }) => { titleEle.value = title; - titleEle.style.padding = degree ? 0 : 2; - titleEle.style.border = `${["gray", "gray", "gray"][degree]} ${["none", "dashed", "solid"][degree]} 2px`; + // titleEle.style.padding = degree ? 0 : 2; + // titleEle.style.border = `${["gray", "gray", "gray"][degree]} ${["none", "dashed", "solid"][degree]} 2px`; }, { fireImmediately: true }); // clean up the tab when it is closed @@ -221,9 +262,9 @@ export class TabDocView extends React.Component { })).observe(this.props.glContainer._element[0]); this.props.glContainer.layoutManager.on("activeContentItemChanged", this.onActiveContentItemChanged); this.props.glContainer.tab?.isActive && this.onActiveContentItemChanged(undefined); - this._tabReaction = reaction(() => ({ selected: this.active(), title: this.tab?.titleElement[0] }), - ({ selected, title }) => title && (title.style.backgroundColor = selected ? "white" : ""), - { fireImmediately: true }); + // this._tabReaction = reaction(() => ({ selected: this.active(), title: this.tab?.titleElement[0] }), + // ({ selected, title }) => title && (title.style.backgroundColor = selected ? "white" : ""), + // { fireImmediately: true }); } componentWillUnmount() { @@ -243,10 +284,10 @@ export class TabDocView extends React.Component { } // adds a tab to the layout based on the locaiton parameter which can be: - // close[:{left,right,top,bottom}] - e.g., "close" will close the tab, "close:left" will close the left tab, + // close[:{left,right,top,bottom}] - e.g., "close" will close the tab, "close:left" will close the left tab, // add[:{left,right,top,bottom}] - e.g., "add" will add a tab to the current stack, "add:right" will add a tab on the right - // replace[:{left,right,top,bottom,}] - e.g., "replace" will replace the current stack contents, - // "replace:right" - will replace the stack on the right named "right" if it exists, or create a stack on the right with that name, + // replace[:{left,right,top,bottom,}] - e.g., "replace" will replace the current stack contents, + // "replace:right" - will replace the stack on the right named "right" if it exists, or create a stack on the right with that name, // "replace:monkeys" - will replace any tab that has the label 'monkeys', or a tab with that label will be created by default on the right // inPlace - will add the document to any collection along the path from the document to the docking view that has a field isInPlaceContainer. if none is found, inPlace adds a tab to current stack addDocTab = (doc: Doc, location: string) => { @@ -460,4 +501,4 @@ export class TabMinimapView extends React.Component {
; } -} \ No newline at end of file +} diff --git a/src/client/views/global/globalCssVariables.scss b/src/client/views/global/globalCssVariables.scss index ead5e166e..a8d4235bd 100644 --- a/src/client/views/global/globalCssVariables.scss +++ b/src/client/views/global/globalCssVariables.scss @@ -21,8 +21,6 @@ $large-padding: 32px; //icon sizes $icon-size: 28px; -$antimodemenu-height: 36px; - // fonts $sans-serif: "Noto Sans", sans-serif; $large-header: 16px; @@ -33,6 +31,8 @@ $small-text: 9px; // misc values $border-radius: 0.3em; $search-thumnail-size: 130; +$topbar-height: 32px; +$antimodemenu-height: 36px; // dragged items $contextMenu-zindex: 100000; // context menu shows up over everything diff --git a/src/client/views/global/globalEnums.tsx b/src/client/views/global/globalEnums.tsx index 1e0381c33..2aeb8e338 100644 --- a/src/client/views/global/globalEnums.tsx +++ b/src/client/views/global/globalEnums.tsx @@ -31,4 +31,8 @@ export enum Padding { export enum IconSizes { ICON_SIZE = "28px", +} + +export enum Borders { + STANDARD = "solid 1px #9F9F9F" } \ No newline at end of file diff --git a/src/client/views/topbar/TopBar.scss b/src/client/views/topbar/TopBar.scss new file mode 100644 index 000000000..324b96dbd --- /dev/null +++ b/src/client/views/topbar/TopBar.scss @@ -0,0 +1,211 @@ +@import "../global/globalCssVariables"; + +.topbar-container { + display: flex; + flex-direction: column; + width: 100%; + position: relative; + font-size: 10px; + line-height: 1; + overflow-y: auto; + overflow-x: visible; + background: $dark-gray; + overflow: visible; + z-index: 1000; + + .topbar-bar { + height: $topbar-height; + display: grid; + grid-auto-columns: 33.3% 33.3% 33.3%; + align-items: center; + background-color: $dark-gray; + + .topbar-center { + grid-column: 2; + display: inline-flex; + justify-content: center; + align-items: center; + + .topbar-lozenge-dashboard { + display: flex; + + .topbar-dashboards { + display: none; + } + + .topbar-dashSelect { + border: none; + background-color: transparent; + color: black; + font-family: 'Roboto'; + font-size: 17; + font-weight: 500; + + &:hover { + cursor: pointer; + } + } + } + + .topbar-lozenge-dashboard:hover { + .topbar-dashboards { + display: inline-flex; + } + } + } + + .topBar-icon { + color: black; + cursor: pointer; + font-size: 15px; + height: 30; + width: 30; + display: flex; + justify-content: center; + align-items: center; + margin-right: 5px; + justify-self: center; + align-self: center; + border-radius: 100%; + transition: linear 0.1s; + background-color: #92adb900; + } + + .topBar-icon:hover { + background-color: rgba(0, 0, 0, 0.15); + } + + .topbar-right { + grid-column: 3; + position: relative; + display: flex; + justify-content: flex-end; + + .topbar-lozenge-user, + .topbar-lozenge { + height: 23; + font-size: 12; + color: black; + font-family: 'Roboto'; + font-weight: 400; + padding: 4px; + align-self: center; + margin-right: 7px; + display: flex; + align-items: center; + border: black 1px solid; + + .topbar-logoff { + border-radius: 3px; + background: olivedrab; + color: white; + display: none; + margin-left: 5px; + padding: 1px 2px 1px 2px; + cursor: pointer; + } + + .topbar-logoff { + background: red; + } + + .topbar-dashSelect { + border: none; + background-color: transparent; + color: black; + font-family: 'Roboto'; + font-size: 17; + font-weight: 500; + + &:hover { + cursor: pointer; + } + } + } + + .topbar-lozenge-user:hover { + .topbar-logoff { + display: inline-block; + } + } + + } + + .topbar-left { + grid-column: 1; + color: black; + font-family: 'Roboto'; + position: relative; + display: flex; + width: 450; + } + + .topbar-barChild { + + &.topbar-collection { + flex: 0 1 auto; + margin-left: 2px; + margin-right: 2px + } + + &.topbar-input { + margin:5px; + border-radius:20px; + border:$dark-gray; + display: block; + width: 130px; + -webkit-transition: width 0.4s; + transition: width 0.4s; + /* align-self: stretch; */ + outline: none; + + &:focus { + width: 500px; + outline: none; + } + } + + &.topbar-filter { + align-self: stretch; + + button { + transform: none; + + &:hover { + transform: none; + } + } + } + + &.topbar-submit { + margin-left: 2px; + margin-right: 2px + } + + &.topbar-close { + color: $white; + max-height: $topbar-height; + } + } + } +} + +.topbar-results { + display: flex; + flex-direction: column; + top: 300px; + display: flex; + flex-direction: column; + height: 100%; + overflow: visible; + + .no-result { + width: 500px; + background: $light-gray; + padding: 10px; + height: 50px; + text-transform: uppercase; + text-align: left; + font-weight: bold; + } +} \ No newline at end of file diff --git a/src/client/views/topbar/TopBar.tsx b/src/client/views/topbar/TopBar.tsx new file mode 100644 index 000000000..79239d4ea --- /dev/null +++ b/src/client/views/topbar/TopBar.tsx @@ -0,0 +1,58 @@ +import { FontAwesomeIcon } from "@fortawesome/react-fontawesome"; +import * as React from 'react'; +import { Doc, DocListCast } from '../../../fields/Doc'; +import { Id } from '../../../fields/FieldSymbols'; +import { StrCast } from '../../../fields/Types'; +import { Utils } from '../../../Utils'; +import { CurrentUserUtils } from "../../util/CurrentUserUtils"; +import { ColorScheme, SettingsManager } from "../../util/SettingsManager"; +import { undoBatch } from "../../util/UndoManager"; +import "./TopBar.scss"; +import { Colors, Borders } from "../global/globalEnums"; + +export const TopBar = () => { + + const myDashboards = DocListCast(CurrentUserUtils.MyDashboards.data); + return ( +
+
+
+
+ +
+
CurrentUserUtils.createNewDashboard(Doc.UserDoc()))} + style={{ color: Doc.UserDoc().colorScheme === ColorScheme.Dark ? "white" : "black" }}> + +
+
CurrentUserUtils.snapshotDashboard(Doc.UserDoc()))} + style={{ color: Doc.UserDoc().colorScheme === ColorScheme.Dark ? "white" : "black" }}> + +
+
+
+
+
+
+ +
+
SettingsManager.Instance.open()} + style={{ color: Doc.UserDoc().colorScheme === ColorScheme.Dark ? "white" : "black" }}> + +
+
+ {`${Doc.CurrentUserEmail}`} +
window.location.assign(Utils.prepend("/logout"))}> + Logoff +
+
+
+ +
+
+ ); +} \ No newline at end of file diff --git a/src/fields/Doc.ts b/src/fields/Doc.ts index 464a8ad05..ee8d36f09 100644 --- a/src/fields/Doc.ts +++ b/src/fields/Doc.ts @@ -23,6 +23,7 @@ import { Cast, FieldValue, NumCast, StrCast, ToConstructor } from "./Types"; import { AudioField, ImageField, PdfField, VideoField, WebField } from "./URLField"; import { deleteProperty, GetEffectiveAcl, getField, getter, makeEditable, makeReadOnly, normalizeEmail, setter, SharingPermissions, updateFunction } from "./util"; import JSZip = require("jszip"); +import { IconProp } from "@fortawesome/fontawesome-svg-core"; export namespace Field { export function toKeyValueString(doc: Doc, key: string): string { @@ -1184,7 +1185,10 @@ export namespace Doc { case DocumentType.IMG: return "image"; case DocumentType.COMPARISON: return "columns"; case DocumentType.RTF: return "sticky-note"; - case DocumentType.COL: return !doc?.isFolder ? "folder" + (isOpen ? "-open" : "") : "chevron-" + (isOpen ? "down" : "right"); + case DocumentType.COL: + const folder: IconProp = isOpen ? "folder-open" : "folder"; + const chevron: IconProp = isOpen ? "chevron-down" : "chevron-right" + return !doc?.isFolder ? folder : chevron; case DocumentType.WEB: return "globe-asia"; case DocumentType.SCREENSHOT: return "photo-video"; case DocumentType.WEBCAM: return "video"; -- cgit v1.2.3-70-g09d2 From c9f379adab864132e6cf044f808a43254601e4bb Mon Sep 17 00:00:00 2001 From: geireann Date: Fri, 30 Jul 2021 13:26:25 -0400 Subject: major UI / updates + refactoring --- deploy/assets/favicon.png | Bin 0 -> 22180 bytes deploy/index.html | 114 +- deploy/loader.css | 85 + deploy/loader.js | 14 + src/client/documents/Documents.ts | 4 +- src/client/util/CurrentUserUtils.ts | 44 +- src/client/views/AntimodeMenu.scss | 1 + src/client/views/DocumentButtonBar.tsx | 2 +- src/client/views/MainView.scss | 30 +- src/client/views/MainView.tsx | 29 +- src/client/views/PropertiesView.tsx | 2 +- src/client/views/_nodeModuleOverrides.scss | 4 +- src/client/views/collections/CollectionMenu.scss | 4 +- src/client/views/collections/CollectionMenu.tsx | 2 +- src/client/views/collections/TabDocView.tsx | 2 +- .../collectionFreeForm/CollectionFreeFormView.tsx | 10 +- .../collections/collectionFreeForm/MarqueeView.tsx | 3 +- src/client/views/global/globalCssVariables.scss | 3 + src/client/views/nodes/DocumentContentsView.tsx | 4 +- src/client/views/nodes/DocumentView.tsx | 2 +- src/client/views/nodes/FontIconBox.tsx | 3 +- src/client/views/nodes/PresBox.scss | 1243 ---------- src/client/views/nodes/PresBox.tsx | 2472 -------------------- .../views/nodes/formattedText/RichTextMenu.tsx | 10 +- src/client/views/nodes/trails/PresBox.scss | 1243 ++++++++++ src/client/views/nodes/trails/PresBox.tsx | 2440 +++++++++++++++++++ src/client/views/nodes/trails/PresElementBox.scss | 235 ++ src/client/views/nodes/trails/PresElementBox.tsx | 388 +++ src/client/views/nodes/trails/PresEnums.ts | 28 + src/client/views/nodes/trails/index.ts | 3 + .../views/presentationview/PresElementBox.scss | 235 -- .../views/presentationview/PresElementBox.tsx | 386 --- src/client/views/topbar/TopBar.scss | 12 +- src/client/views/topbar/TopBar.tsx | 89 +- tslint.json | 41 +- 35 files changed, 4587 insertions(+), 4600 deletions(-) create mode 100644 deploy/assets/favicon.png create mode 100644 deploy/loader.css create mode 100644 deploy/loader.js delete mode 100644 src/client/views/nodes/PresBox.scss delete mode 100644 src/client/views/nodes/PresBox.tsx create mode 100644 src/client/views/nodes/trails/PresBox.scss create mode 100644 src/client/views/nodes/trails/PresBox.tsx create mode 100644 src/client/views/nodes/trails/PresElementBox.scss create mode 100644 src/client/views/nodes/trails/PresElementBox.tsx create mode 100644 src/client/views/nodes/trails/PresEnums.ts create mode 100644 src/client/views/nodes/trails/index.ts delete mode 100644 src/client/views/presentationview/PresElementBox.scss delete mode 100644 src/client/views/presentationview/PresElementBox.tsx (limited to 'src/client/views/MainView.scss') diff --git a/deploy/assets/favicon.png b/deploy/assets/favicon.png new file mode 100644 index 000000000..59595b910 Binary files /dev/null and b/deploy/assets/favicon.png differ diff --git a/deploy/index.html b/deploy/index.html index dda0c6457..d96215391 100644 --- a/deploy/index.html +++ b/deploy/index.html @@ -1,114 +1,22 @@ - Dash Web - - + Dash + + + + - - - + + -
+
dashmesg("10%", "Loading Dash..."), load / 10); setTimeout(() => dashmesg("33%", "Preparing dashboards..."), load / 3); diff --git a/deploy/loader.css b/deploy/loader.css new file mode 100644 index 000000000..4be0cc98c --- /dev/null +++ b/deploy/loader.css @@ -0,0 +1,85 @@ +.dash-loader { + display: flex; + align-content: center; + justify-content: center; + background-color: #BDDDF5; + transition: 3s; + z-index: 10; + z-index:10; + width:100%; + height:100%; +} + +.dash-loader-container { + display: flex; + flex-direction: column; + justify-content: center; + align-items: center; + align-content: center; +} + +.dash-progress-bar { + width: 200px; + height: 5px; + align-self: center; + margin-top: 20px; + background-color: #ececec; + border-radius: 5px; + overflow: hidden; +} + +.dash-progress { + width: 0%; + height: 20px; + background-color: #4476F7; + transition: 0.1s; +} + +.dash-animation-container { + width: 10vw; + height: 10vw; + display: flex; + align-items: center; + justify-content: center; + border-radius: 100%; + background-color: #4476F7; + justify-self: center; +} + +.dash-loader-text { + font-size: 15px; + font-family: "Roboto"; + font-weight: bold; + text-align: center; + color: #4476F7; + user-select: none; + -webkit-user-select: none; +} + +.dash-d-path { + stroke-dasharray: 1000; + stroke-dashoffset: 1000; + animation: dash-d-path 3s linear infinite; +} + +@keyframes dash-d-path { + 0% { + stroke-dashoffset: 1000; + } + + 20% { + stroke-dashoffset: 0; + } + + 70% { + stroke-dashoffset: 0; + } + + 90% { + stroke-dashoffset: 1000; + } + + 100% { + stroke-dashoffset: 1000; + } +} \ No newline at end of file diff --git a/deploy/loader.js b/deploy/loader.js new file mode 100644 index 000000000..0be421e14 --- /dev/null +++ b/deploy/loader.js @@ -0,0 +1,14 @@ +function getCookie(cname) { + var name = cname + "="; + var ca = document.cookie.split(';'); + for (var i = 0; i < ca.length; i++) { + var c = ca[i]; + while (c.charAt(0) == ' ') { + c = c.substring(1); + } + if (c.indexOf(name) == 0) { + return Number(c.substring(name.length, c.length)); + } + } + return 3000; +} \ No newline at end of file diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts index f1db3e32c..81465a241 100644 --- a/src/client/documents/Documents.ts +++ b/src/client/documents/Documents.ts @@ -45,14 +45,14 @@ import { LabelBox } from "../views/nodes/LabelBox"; import { LinkBox } from "../views/nodes/LinkBox"; import { LinkDescriptionPopup } from "../views/nodes/LinkDescriptionPopup"; import { PDFBox } from "../views/nodes/PDFBox"; -import { PresBox } from "../views/nodes/PresBox"; +import { PresBox } from "../views/nodes/trails/PresBox"; import { ScreenshotBox } from "../views/nodes/ScreenshotBox"; import { ScriptingBox } from "../views/nodes/ScriptingBox"; import { SliderBox } from "../views/nodes/SliderBox"; import { TaskCompletionBox } from "../views/nodes/TaskCompletedBox"; import { VideoBox } from "../views/nodes/VideoBox"; import { WebBox } from "../views/nodes/WebBox"; -import { PresElementBox } from "../views/presentationview/PresElementBox"; +import { PresElementBox } from "../views/nodes/trails/PresElementBox"; import { SearchBox } from "../views/search/SearchBox"; import { DashWebRTCVideo } from "../views/webcam/DashWebRTCVideo"; import { DocumentType } from "./DocumentTypes"; diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts index 22504f102..62fab1b23 100644 --- a/src/client/util/CurrentUserUtils.ts +++ b/src/client/util/CurrentUserUtils.ts @@ -35,6 +35,8 @@ import { UndoManager } from "./UndoManager"; import { SnappingManager } from "./SnappingManager"; import { InkTool } from "../../fields/InkField"; import { computedFn } from "mobx-utils"; +import { ColorScheme } from "./SettingsManager"; +import { Colors } from "../views/global/globalEnums"; export let resolvedPorts: { server: number, socket: number }; @@ -472,7 +474,7 @@ export class CurrentUserUtils { { toolTip: "Tap to create a videoWall", title: "Wall", icon: "photo-video", click: 'openOnRight(copyDragFactory(this.dragFactory))', drag: 'copyDragFactory(this.dragFactory)', dragFactory: doc.emptyWall as Doc }, { toolTip: "Tap to create an audio recorder in a new pane, drag for an audio recorder", title: "Audio", icon: "microphone", click: 'openOnRight(copyDragFactory(this.dragFactory))', drag: 'copyDragFactory(this.dragFactory)', dragFactory: doc.emptyAudio as Doc, noviceMode: true }, { toolTip: "Tap to create a button in a new pane, drag for a button", title: "Button", icon: "bolt", click: 'openOnRight(copyDragFactory(this.dragFactory))', drag: 'copyDragFactory(this.dragFactory)', dragFactory: doc.emptyButton as Doc }, - { toolTip: "Tap to create a presentation in a new pane, drag for a presentation", title: "Trails", icon: "pres-trail", click: 'openOnRight(Doc.UserDoc().activePresentation = copyDragFactory(this.dragFactory))', drag: `Doc.UserDoc().activePresentation = copyDragFactory(this.dragFactory)`, dragFactory: doc.emptyPresentation as Doc, noviceMode: true }, + // { toolTip: "Tap to create a presentation in a new pane, drag for a presentation", title: "Trails", icon: "pres-trail", click: 'openOnRight(Doc.UserDoc().activePresentation = copyDragFactory(this.dragFactory))', drag: `Doc.UserDoc().activePresentation = copyDragFactory(this.dragFactory)`, dragFactory: doc.emptyPresentation as Doc, noviceMode: true }, { toolTip: "Tap to create a scripting box in a new pane, drag for a scripting box", title: "Script", icon: "terminal", click: 'openOnRight(copyDragFactory(this.dragFactory))', drag: 'copyDragFactory(this.dragFactory)', dragFactory: doc.emptyScript as Doc }, { toolTip: "Tap to create a mobile view in a new pane, drag for a mobile view", title: "Phone", icon: "mobile", click: 'openOnRight(Doc.UserDoc().activeMobileMenu)', drag: 'this.dragFactory', dragFactory: doc.activeMobileMenu as Doc }, { toolTip: "Tap to create a custom header note document, drag for a custom header note", title: "Custom", icon: "window-maximize", click: 'openOnRight(delegateDragFactory(this.dragFactory))', drag: 'delegateDragFactory(this.dragFactory)', dragFactory: doc.emptyHeader as Doc }, @@ -534,8 +536,8 @@ export class CurrentUserUtils { { title: "Sharing", target: Cast(doc.mySharedDocs, Doc, null), icon: "users", click: 'selectMainMenu(self)', watchedDocuments: doc.mySharedDocs as Doc }, // { title: "Filter", target: Cast(doc.currentFilter, Doc, null), icon: "filter", click: 'selectMainMenu(self)' }, { title: "Pres. Trails", target: Cast(doc.myPresentations, Doc, null), icon: "pres-trail", click: 'selectMainMenu(self)' }, - { title: "Help", target: undefined as any, icon: "question-circle", click: 'selectMainMenu(self)' }, - { title: "Settings", target: undefined as any, icon: "cog", click: 'selectMainMenu(self)' }, + // { title: "Help", target: undefined as any, icon: "question-circle", click: 'selectMainMenu(self)' }, + // { title: "Settings", target: undefined as any, icon: "cog", click: 'selectMainMenu(self)' }, { title: "User Doc", target: Cast(doc.myUserDoc, Doc, null), icon: "address-card", click: 'selectMainMenu(self)' }, ]; } @@ -561,7 +563,6 @@ export class CurrentUserUtils { dontUndo: true, title, target, - backgroundColor: "black", _dropAction: "alias", _removeDropProperties: new List(["dropAction", "_stayInCollection"]), _width: 60, @@ -576,8 +577,10 @@ export class CurrentUserUtils { title: "menuItemPanel", childDropAction: "alias", _chromeHidden: true, + backgroundColor: Colors.DARK_GRAY, + boxShadow: "rgba(0,0,0,0)", dropConverter: ScriptField.MakeScript("convertToButtons(dragData)", { dragData: DragManager.DocumentDragData.name }), - backgroundColor: "black", ignoreClick: true, + ignoreClick: true, _gridGap: 0, _yMargin: 0, _yPadding: 0, _xMargin: 0, _autoHeight: false, _width: 60, _columnWidth: 60, _lockedPosition: true, system: true @@ -587,8 +590,6 @@ export class CurrentUserUtils { PromiseValue(Cast(doc.menuStack, Doc)).then(stack => { stack && PromiseValue(stack.data).then(btns => { DocListCastAsync(btns).then(bts => bts?.forEach(btn => { - btn.color = "white"; - btn._backgroundColor = ""; btn.dontUndo = true; btn.system = true; if (btn.title === "Catalog" || btn.title === "My Files") { // migration from Catalog to My Files @@ -759,7 +760,7 @@ export class CurrentUserUtils { await doc.myDashboards; if (doc.myDashboards === undefined) { doc.myDashboards = new PrefetchProxy(Docs.Create.TreeDocument([], { - title: "My Dashboards", _height: 400, childHideLinkButton: true, + title: "My Dashboards", _showTitle: "title", _height: 400, childHideLinkButton: true, treeViewHideTitle: true, _xMargin: 5, _yMargin: 5, _gridGap: 5, _forceActive: true, childDropAction: "alias", treeViewTruncateTitleWidth: 150, ignoreClick: true, _lockedPosition: true, boxShadow: "0 0", childDontRegisterViews: true, targetDropAction: "same", system: true @@ -775,7 +776,7 @@ export class CurrentUserUtils { await doc.myPresentations; if (doc.myPresentations === undefined) { doc.myPresentations = new PrefetchProxy(Docs.Create.TreeDocument([], { - title: "My Presentations", _height: 100, + title: "My Trails", _showTitle: "title", _height: 100, treeViewHideTitle: true, _xMargin: 5, _yMargin: 5, _gridGap: 5, _forceActive: true, childDropAction: "alias", treeViewTruncateTitleWidth: 150, ignoreClick: true, _lockedPosition: true, boxShadow: "0 0", childDontRegisterViews: true, targetDropAction: "same", system: true @@ -794,7 +795,7 @@ export class CurrentUserUtils { doc.myFileOrphans = Docs.Create.TreeDocument([], { title: "Unfiled", _stayInCollection: true, system: true, isFolder: true }); doc.myFileRoot = Docs.Create.TreeDocument([], { title: "file root", _stayInCollection: true, system: true, isFolder: true }); doc.myFilesystem = new PrefetchProxy(Docs.Create.TreeDocument([doc.myFileRoot as Doc, doc.myFileOrphans as Doc], { - title: "My Documents", _height: 100, + title: "My Documents", _showTitle: "title", _height: 100, treeViewHideTitle: true, _xMargin: 5, _yMargin: 5, _gridGap: 5, _forceActive: true, childDropAction: "alias", treeViewTruncateTitleWidth: 150, ignoreClick: true, isFolder: true, treeViewType: "fileSystem", childHideLinkButton: true, @@ -808,7 +809,7 @@ export class CurrentUserUtils { // setup Recently Closed library item if (doc.myRecentlyClosedDocs === undefined) { doc.myRecentlyClosedDocs = new PrefetchProxy(Docs.Create.TreeDocument([], { - title: "Recently Closed", treeViewShowClearButton: true, childHideLinkButton: true, + title: "Recently Closed", _showTitle: "title", treeViewShowClearButton: true, childHideLinkButton: true, treeViewHideTitle: true, _xMargin: 5, _yMargin: 5, _gridGap: 5, _forceActive: true, childDropAction: "alias", treeViewTruncateTitleWidth: 150, ignoreClick: true, _lockedPosition: true, boxShadow: "0 0", childDontRegisterViews: true, targetDropAction: "same", system: true @@ -839,7 +840,7 @@ export class CurrentUserUtils { doc.treeViewOpen = true; doc.treeViewExpandedView = "fields"; doc.myUserDoc = new PrefetchProxy(Docs.Create.TreeDocument([doc], { - treeViewHideTitle: true, _xMargin: 5, _yMargin: 5, _gridGap: 5, _forceActive: true, title: "My UserDoc", + treeViewHideTitle: true, _xMargin: 5, _yMargin: 5, _gridGap: 5, _forceActive: true, title: "My UserDoc", _showTitle: "title", treeViewTruncateTitleWidth: 150, ignoreClick: true, _lockedPosition: true, boxShadow: "0 0", childDontRegisterViews: true, targetDropAction: "same", system: true })) as any as Doc; @@ -859,6 +860,7 @@ export class CurrentUserUtils { static async setupSidebarButtons(doc: Doc) { CurrentUserUtils.setupSidebarContainer(doc); await CurrentUserUtils.setupToolsBtnPanel(doc); + CurrentUserUtils.setupImportSidebar(doc); CurrentUserUtils.setupDashboards(doc); CurrentUserUtils.setupPresentations(doc); CurrentUserUtils.setupFilesystem(doc); @@ -891,6 +893,7 @@ export class CurrentUserUtils { (doc["dockedBtn-undo"] as Doc).dontUndo = true; (doc["dockedBtn-redo"] as Doc).dontUndo = true; } + // sets up the default set of documents to be shown in the Overlay layer static setupOverlays(doc: Doc) { if (doc.myOverlayDocs === undefined) { @@ -924,7 +927,8 @@ export class CurrentUserUtils { if (!sharedDocs) { sharedDocs = Docs.Create.StackingDocument([], { title: "My SharedDocs", childDropAction: "alias", system: true, contentPointerEvents: "none", childLimitHeight: 0, _yMargin: 50, _gridGap: 15, - _showTitle: "title", ignoreClick: true, _lockedPosition: true, "acl-Public": SharingPermissions.Add, "_acl-Public": SharingPermissions.Add, _chromeHidden: true, + _showTitle: "title", ignoreClick: true, _lockedPosition: true, "acl-Public": SharingPermissions.Add, "_acl-Public": SharingPermissions.Add, + _chromeHidden: true, boxShadow: "0 0", }, sharingDocumentId + "outer", sharingDocumentId); (sharedDocs as Doc)["acl-Public"] = (sharedDocs as Doc)[DataSym]["acl-Public"] = SharingPermissions.Add; } @@ -939,14 +943,14 @@ export class CurrentUserUtils { static setupImportSidebar(doc: Doc) { if (doc.myImportDocs === undefined) { doc.myImportDocs = new PrefetchProxy(Docs.Create.StackingDocument([], { - title: "My ImportDocuments", _forceActive: true, ignoreClick: true, _showTitle: "title", _stayInCollection: true, _hideContextMenu: true, childLimitHeight: 0, + title: "My ImportDocuments", _forceActive: true, ignoreClick: true, _stayInCollection: true, _hideContextMenu: true, childLimitHeight: 0, childDropAction: "alias", _autoHeight: true, _yMargin: 50, _gridGap: 15, _lockedPosition: true, system: true, _chromeHidden: true, })); } if (doc.myImportPanel === undefined) { const uploads = Cast(doc.myImportDocs, Doc, null); const newUpload = CurrentUserUtils.ficon({ onClick: ScriptField.MakeScript("importDocument()"), toolTip: "Import External document", _stayInCollection: true, _hideContextMenu: true, title: "Import", icon: "upload", system: true }); - doc.myImportPanel = new PrefetchProxy(Docs.Create.StackingDocument([newUpload, uploads], { title: "My ImportPanel", _yMargin: 20, ignoreClick: true, _chromeHidden: true, _stayInCollection: true, _hideContextMenu: true, _lockedPosition: true, system: true })); + doc.myImportPanel = new PrefetchProxy(Docs.Create.StackingDocument([newUpload, uploads], { title: "My ImportPanel", _yMargin: 20, _showTitle: "title", ignoreClick: true, _chromeHidden: true, _stayInCollection: true, _hideContextMenu: true, _lockedPosition: true, system: true, boxShadow: "0 0" })); } } @@ -1007,10 +1011,14 @@ export class CurrentUserUtils { const mygroups = groups?.filter(group => JSON.parse(StrCast(group.members)).includes(Doc.CurrentUserEmail)) || []; SnappingManager.SetCachedGroups(["Public", ...mygroups?.map(g => StrCast(g.title))]); }, { fireImmediately: true }); + // Document properties on load doc.system = true; + doc.darkScheme = ColorScheme.Dark; doc.noviceMode = doc.noviceMode === undefined ? "true" : doc.noviceMode; doc.title = Doc.CurrentUserEmail; doc._raiseWhenDragged = true; + doc._showLabel = false; + doc._showMenuLabel = true; doc.activeInkColor = StrCast(doc.activeInkColor, "rgb(0, 0, 0)"); doc.activeInkWidth = StrCast(doc.activeInkWidth, "1"); doc.activeInkBezier = StrCast(doc.activeInkBezier, "0"); @@ -1201,7 +1209,7 @@ export class CurrentUserUtils { const dashboardDoc = Docs.Create.StandardCollectionDockingDocument([{ doc: freeformDoc, initialWidth: 600 }], { title: `Dashboard ${dashboardCount}` }, id, "row"); Doc.AddDocToList(myPresentations, "data", presentation); userDoc.activePresentation = presentation; - const toggleTheme = ScriptField.MakeScript(`self.darkScheme = !self.darkScheme`); + const toggleTheme = ScriptField.MakeScript(`Doc.UserDoc().darkScheme = !Doc.UserDoc().darkScheme`); const toggleComic = ScriptField.MakeScript(`toggleComicMode()`); const snapshotDashboard = ScriptField.MakeScript(`snapshotDashboard()`); const createDashboard = ScriptField.MakeScript(`createNewDashboard()`); @@ -1257,6 +1265,4 @@ Scripting.addGlobal(function createNewPresentation() { return MainView.Instance. Scripting.addGlobal(function links(doc: any) { return new List(LinkManager.Instance.getAllRelatedLinks(doc)); }, "returns all the links to the document or its annotations", "(doc: any)"); Scripting.addGlobal(function importDocument() { return CurrentUserUtils.importDocument(); }, - "imports files from device directly into the import sidebar"); -Scripting.addGlobal(function toggleComicMode() { Doc.UserDoc().renderStyle = Doc.UserDoc().renderStyle === "comic" ? undefined : "comic"; }, - "toggle between regular rendeing and an informal sketch/comic style"); + "imports files from device directly into the import sidebar"); \ No newline at end of file diff --git a/src/client/views/AntimodeMenu.scss b/src/client/views/AntimodeMenu.scss index b509f9f54..e23bf27c1 100644 --- a/src/client/views/AntimodeMenu.scss +++ b/src/client/views/AntimodeMenu.scss @@ -6,6 +6,7 @@ z-index: 10001; height: $antimodemenu-height; background: $dark-gray; + border-bottom: $standard-border; // box-shadow: 3px 3px 3px rgba(0, 0, 0, 0.25); // border-radius: 0px 6px 6px 6px; z-index: 1001; diff --git a/src/client/views/DocumentButtonBar.tsx b/src/client/views/DocumentButtonBar.tsx index a5d80cd22..b11aa99b0 100644 --- a/src/client/views/DocumentButtonBar.tsx +++ b/src/client/views/DocumentButtonBar.tsx @@ -24,7 +24,7 @@ import { DocumentView } from './nodes/DocumentView'; import { GoogleRef } from "./nodes/formattedText/FormattedTextBox"; import { TemplateMenu } from "./TemplateMenu"; import React = require("react"); -import { PresBox } from './nodes/PresBox'; +import { PresBox } from './nodes/trails/PresBox'; import { undoBatch } from '../util/UndoManager'; import { CollectionViewType } from './collections/CollectionView'; const higflyout = require("@hig/flyout"); diff --git a/src/client/views/MainView.scss b/src/client/views/MainView.scss index 2069986ad..ba1c91720 100644 --- a/src/client/views/MainView.scss +++ b/src/client/views/MainView.scss @@ -22,10 +22,6 @@ height: 100%; } -.mainContent-div-flyout { - left: calc(-1 * var(--flyoutHandleWidth)); -} - // add nodes menu. Note that the + button is actually an input label, not an actual button. .mainView-docButtons { position: absolute; @@ -111,14 +107,21 @@ user-select: none; } +.properties-container { + height: 100%; + position: relative; + left: 100%; + top: calc(-100% - 36px); + z-index: 3000; +} + .mainView-propertiesDragger { //background-color: rgb(140, 139, 139); - background-color: $light-gray; + background-color: $medium-gray; height: 55px; width: 17px; position: absolute; top: 50%; - border: 1px black solid; border-radius: 0; border-top-left-radius: 10px; border-bottom-left-radius: 10px; @@ -141,18 +144,6 @@ } } -.mainiView-propertiesView { - display: flex; - flex-direction: column; - height: 100%; - position: absolute; - right: 0; - top: 0; - border-left: solid 1px; - z-index: 100000; - cursor: auto; -} - .mainView-innerContent, .mainView-innerContent-dark { display: contents; flex-direction: row; @@ -171,7 +162,7 @@ } .propertiesView { - right: 0; + left: 0; position: absolute; z-index: 2; background-color: $medium-gray; @@ -220,6 +211,7 @@ .mainView-menuPanel { min-width: var(--menuPanelWidth); background-color: $dark-gray; + border-right: $standard-border; .collectionStackingView { scrollbar-width: none; diff --git a/src/client/views/MainView.tsx b/src/client/views/MainView.tsx index 7d6bfbd40..49f4f7a6e 100644 --- a/src/client/views/MainView.tsx +++ b/src/client/views/MainView.tsx @@ -64,6 +64,7 @@ import { PropertiesView } from './PropertiesView'; import { SearchBox } from './search/SearchBox'; import { DefaultStyleProvider, DashboardStyleProvider, StyleProp } from './StyleProvider'; import { TopBar } from './topbar/TopBar'; +import { Colors } from './global/globalEnums'; const _global = (window /* browser */ || global /* node */) as any; @observer @@ -179,12 +180,12 @@ export class MainView extends React.Component { const targets = document.elementsFromPoint(e.x, e.y); if (targets.length) { const targClass = targets[0].className.toString(); - if (SearchBox.Instance._searchbarOpen || SearchBox.Instance.open) { - const check = targets.some((thing) => - (thing.className === "collectionSchemaView-searchContainer" || (thing as any)?.dataset.icon === "filter" || - thing.className === "collectionSchema-header-menuOptions")); - !check && SearchBox.Instance.resetSearch(true); - } + // if (SearchBox.Instance._searchbarOpen || SearchBox.Instance.open) { + // const check = targets.some((thing) => + // (thing.className === "collectionSchemaView-searchContainer" || (thing as any)?.dataset.icon === "filter" || + // thing.className === "collectionSchema-header-menuOptions")); + // !check && SearchBox.Instance.resetSearch(true); + // } !targClass.includes("contextMenu") && ContextMenu.Instance.closeMenu(); !["timeline-menu-desc", "timeline-menu-item", "timeline-menu-input"].includes(targClass) && TimelineMenu.Instance.closeMenu(); } @@ -193,7 +194,7 @@ export class MainView extends React.Component { initEventListeners = () => { window.addEventListener("drop", e => e.preventDefault(), false); // prevent default behavior of navigating to a new web page window.addEventListener("dragover", e => e.preventDefault(), false); - document.addEventListener("pointermove", action(e => SearchBox.Instance._undoBackground = UndoManager.batchCounter ? "#000000a8" : undefined)); + // document.addEventListener("pointermove", action(e => SearchBox.Instance._undoBackground = UndoManager.batchCounter ? "#000000a8" : undefined)); document.addEventListener("pointerdown", this.globalPointerDown); document.addEventListener("click", (e: MouseEvent) => { if (!e.cancelBubble) { @@ -405,22 +406,26 @@ export class MainView extends React.Component { } @computed get mainInnerContent() { + const width = this.propertiesWidth() + this._flyoutWidth + this.menuPanelWidth(); + const transform = this._flyoutWidth ? 'translate(-28px, 0px)' : undefined; return <> {this.menuPanel}
{this.flyout} -
+
-
+
{this.dockingContent} -
- +
+ +
+
+ {this.propertiesWidth() < 10 ? (null) : }
- {this.propertiesWidth() < 10 ? (null) : }
; diff --git a/src/client/views/PropertiesView.tsx b/src/client/views/PropertiesView.tsx index 4df3e4f00..8136edf04 100644 --- a/src/client/views/PropertiesView.tsx +++ b/src/client/views/PropertiesView.tsx @@ -24,7 +24,7 @@ import { EditableView } from "./EditableView"; import { InkStrokeProperties } from "./InkStrokeProperties"; import { DocumentView, StyleProviderFunc } from "./nodes/DocumentView"; import { KeyValueBox } from "./nodes/KeyValueBox"; -import { PresBox } from "./nodes/PresBox"; +import { PresBox } from "./nodes/trails/PresBox"; import { PropertiesButtons } from "./PropertiesButtons"; import { PropertiesDocContextSelector } from "./PropertiesDocContextSelector"; import "./PropertiesView.scss"; diff --git a/src/client/views/_nodeModuleOverrides.scss b/src/client/views/_nodeModuleOverrides.scss index cb59489c0..140be2140 100644 --- a/src/client/views/_nodeModuleOverrides.scss +++ b/src/client/views/_nodeModuleOverrides.scss @@ -58,12 +58,10 @@ div .lm_header { .lm_header .lm_controls { align-items: center; position: absolute; - background-color: #000000; + background-color: $dark-gray; border-radius: 5px; display: flex; - top: 2px; justify-content: space-evenly; - right: 2px; height: 18px; width: 65px; } diff --git a/src/client/views/collections/CollectionMenu.scss b/src/client/views/collections/CollectionMenu.scss index c0fc774d3..f04b19ef7 100644 --- a/src/client/views/collections/CollectionMenu.scss +++ b/src/client/views/collections/CollectionMenu.scss @@ -38,10 +38,10 @@ border: unset; .collectionMenu-divider { - height: 85%; + height: 100%; margin-left: 3px; margin-right: 3px; - width: 1.5px; + width: 2px; background-color: $medium-gray; } diff --git a/src/client/views/collections/CollectionMenu.tsx b/src/client/views/collections/CollectionMenu.tsx index 6e6fabd0d..a9b978c4e 100644 --- a/src/client/views/collections/CollectionMenu.tsx +++ b/src/client/views/collections/CollectionMenu.tsx @@ -29,7 +29,7 @@ import { ActiveFillColor, ActiveInkColor, SetActiveArrowEnd, SetActiveArrowStart import { CollectionFreeFormDocumentView } from "../nodes/CollectionFreeFormDocumentView"; import { DocumentView } from "../nodes/DocumentView"; import { RichTextMenu } from "../nodes/formattedText/RichTextMenu"; -import { PresBox } from "../nodes/PresBox"; +import { PresBox } from "../nodes/trails/PresBox"; import "./CollectionMenu.scss"; import { CollectionViewType, COLLECTION_BORDER_WIDTH } from "./CollectionView"; import { TabDocView } from "./TabDocView"; diff --git a/src/client/views/collections/TabDocView.tsx b/src/client/views/collections/TabDocView.tsx index 0e67bebd8..d82810652 100644 --- a/src/client/views/collections/TabDocView.tsx +++ b/src/client/views/collections/TabDocView.tsx @@ -25,7 +25,7 @@ import { Transform } from '../../util/Transform'; import { undoBatch, UndoManager } from "../../util/UndoManager"; import { LightboxView } from '../LightboxView'; import { DocFocusOptions, DocumentView, DocumentViewProps } from "../nodes/DocumentView"; -import { PresBox, PinProps, PresMovement } from '../nodes/PresBox'; +import { PinProps, PresBox, PresMovement } from '../nodes/trails'; import { DefaultLayerProvider, DefaultStyleProvider, StyleLayers, StyleProp } from '../StyleProvider'; import { CollectionDockingView } from './CollectionDockingView'; import { CollectionDockingViewMenu } from './CollectionDockingViewMenu'; diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx index a4e310e6c..c5f6f7bf2 100644 --- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx +++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx @@ -38,7 +38,7 @@ import { CollectionFreeFormDocumentView } from "../../nodes/CollectionFreeFormDo import { DocFocusOptions, DocumentView, DocumentViewProps, ViewAdjustment, ViewSpecPrefix } from "../../nodes/DocumentView"; import { FormattedTextBox } from "../../nodes/formattedText/FormattedTextBox"; import { pageSchema } from "../../nodes/ImageBox"; -import { PresBox } from "../../nodes/PresBox"; +import { PresBox } from "../../nodes/trails/PresBox"; import { StyleLayers, StyleProp } from "../../StyleProvider"; import { CollectionDockingView } from "../CollectionDockingView"; import { CollectionSubView } from "../CollectionSubView"; @@ -834,10 +834,10 @@ export class CollectionFreeFormView extends CollectionSubView ({ ...this.childDataProvider(doc, ""), ...this.childSizeProvider(doc, "") })); if (measuredDocs.length) { const ranges = measuredDocs.reduce(({ xrange, yrange }, { x, y, width, height }) => // computes range of content - ({ - xrange: { min: Math.min(xrange.min, x), max: Math.max(xrange.max, x + width) }, - yrange: { min: Math.min(yrange.min, y), max: Math.max(yrange.max, y + height) } - }) + ({ + xrange: { min: Math.min(xrange.min, x), max: Math.max(xrange.max, x + width) }, + yrange: { min: Math.min(yrange.min, y), max: Math.max(yrange.max, y + height) } + }) , { xrange: { min: Number.MAX_VALUE, max: -Number.MAX_VALUE }, yrange: { min: Number.MAX_VALUE, max: -Number.MAX_VALUE } diff --git a/src/client/views/collections/collectionFreeForm/MarqueeView.tsx b/src/client/views/collections/collectionFreeForm/MarqueeView.tsx index b1f2750c3..4fae961b1 100644 --- a/src/client/views/collections/collectionFreeForm/MarqueeView.tsx +++ b/src/client/views/collections/collectionFreeForm/MarqueeView.tsx @@ -19,7 +19,8 @@ import { Transform } from "../../../util/Transform"; import { undoBatch, UndoManager } from "../../../util/UndoManager"; import { ContextMenu } from "../../ContextMenu"; import { FormattedTextBox } from "../../nodes/formattedText/FormattedTextBox"; -import { PresBox, PresMovement } from "../../nodes/PresBox"; +import { PresBox } from "../../nodes/trails/PresBox"; +import { PresMovement } from "../../nodes/trails/PresEnums"; import { PreviewCursor } from "../../PreviewCursor"; import { CollectionDockingView } from "../CollectionDockingView"; import { SubCollectionViewProps } from "../CollectionSubView"; diff --git a/src/client/views/global/globalCssVariables.scss b/src/client/views/global/globalCssVariables.scss index a8d4235bd..72adc171b 100644 --- a/src/client/views/global/globalCssVariables.scss +++ b/src/client/views/global/globalCssVariables.scss @@ -38,6 +38,9 @@ $antimodemenu-height: 36px; $contextMenu-zindex: 100000; // context menu shows up over everything $radialMenu-zindex: 100000; // context menu shows up over everything +// borders +$standard-border: solid 1px #9F9F9F; + $searchpanel-height: 32px; $mainTextInput-zindex: 999; // then text input overlay so that it's context menu will appear over decorations, etc $docDecorations-zindex: 998; // then doc decorations appear over everything else diff --git a/src/client/views/nodes/DocumentContentsView.tsx b/src/client/views/nodes/DocumentContentsView.tsx index 9b75cd8f9..3d2cdf5a4 100644 --- a/src/client/views/nodes/DocumentContentsView.tsx +++ b/src/client/views/nodes/DocumentContentsView.tsx @@ -11,7 +11,7 @@ import { CollectionFreeFormView } from "../collections/collectionFreeForm/Collec import { CollectionSchemaView } from "../collections/collectionSchema/CollectionSchemaView"; import { CollectionView } from "../collections/CollectionView"; import { InkingStroke } from "../InkingStroke"; -import { PresElementBox } from "../presentationview/PresElementBox"; +import { PresElementBox } from "../nodes/trails/PresElementBox"; import { SearchBox } from "../search/SearchBox"; import { DashWebRTCVideo } from "../webcam/DashWebRTCVideo"; import { YoutubeBox } from "./../../apis/youtube/YoutubeBox"; @@ -32,7 +32,7 @@ import { LabelBox } from "./LabelBox"; import { LinkAnchorBox } from "./LinkAnchorBox"; import { LinkBox } from "./LinkBox"; import { PDFBox } from "./PDFBox"; -import { PresBox } from "./PresBox"; +import { PresBox } from "./trails/PresBox"; import { ScreenshotBox } from "./ScreenshotBox"; import { ScriptingBox } from "./ScriptingBox"; import { SliderBox } from "./SliderBox"; diff --git a/src/client/views/nodes/DocumentView.tsx b/src/client/views/nodes/DocumentView.tsx index 60fa462ad..80a014926 100644 --- a/src/client/views/nodes/DocumentView.tsx +++ b/src/client/views/nodes/DocumentView.tsx @@ -43,7 +43,7 @@ import { DocumentLinksButton } from './DocumentLinksButton'; import "./DocumentView.scss"; import { LinkAnchorBox } from './LinkAnchorBox'; import { LinkDocPreview } from "./LinkDocPreview"; -import { PresBox } from './PresBox'; +import { PresBox } from './trails/PresBox'; import { RadialMenu } from './RadialMenu'; import React = require("react"); import { ScriptingBox } from "./ScriptingBox"; diff --git a/src/client/views/nodes/FontIconBox.tsx b/src/client/views/nodes/FontIconBox.tsx index 6ae4b9726..0d415e238 100644 --- a/src/client/views/nodes/FontIconBox.tsx +++ b/src/client/views/nodes/FontIconBox.tsx @@ -14,6 +14,7 @@ import { DocComponent } from '../DocComponent'; import { StyleProp } from '../StyleProvider'; import { FieldView, FieldViewProps } from './FieldView'; import './FontIconBox.scss'; +import { Colors } from '../global/globalEnums'; const FontIconSchema = createSchema({ icon: "string", }); @@ -47,7 +48,7 @@ export class FontIconBox extends DocComponent( const icon = StrCast(this.dataDoc.icon, "user") as any; const presSize = shape === 'round' ? 25 : 30; const presTrailsIcon = ; + style={{ width: presSize, height: presSize, filter: `invert(${color === Colors.DARK_GRAY ? "0%" : "100%"})`, marginBottom: "5px" }} />; const button =