From 065a29e87c771b5cd9301b0468fb036e070cad17 Mon Sep 17 00:00:00 2001 From: yunahi <60233430+yunahi@users.noreply.github.com> Date: Fri, 10 Jul 2020 05:08:53 +0900 Subject: added format shape --- .../collectionFreeForm/FormatShapePane.tsx | 996 +++++++++++++++++++++ 1 file changed, 996 insertions(+) create mode 100644 src/client/views/collections/collectionFreeForm/FormatShapePane.tsx (limited to 'src/client/views/collections/collectionFreeForm/FormatShapePane.tsx') diff --git a/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx b/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx new file mode 100644 index 000000000..7b47b7ca4 --- /dev/null +++ b/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx @@ -0,0 +1,996 @@ +import React = require("react"); +import AntimodeMenu from "../../AntimodeMenu"; +import { observer } from "mobx-react"; +import { observable, action, computed } from "mobx"; +import "./FormatShapePane.scss"; +import { ActiveInkColor, ActiveInkBezierApprox, ActiveFillColor, ActiveArrowStart, ActiveArrowEnd, SetActiveInkWidth, SetActiveInkColor, SetActiveBezierApprox, SetActiveFillColor, SetActiveArrowStart, SetActiveArrowEnd, ActiveDash, SetActiveDash } from "../../InkingStroke"; +import { Scripting } from "../../../util/Scripting"; +import { InkTool, InkField } from "../../../../fields/InkField"; +import { ColorState } from "react-color"; +import { Utils } from "../../../../Utils"; +import GestureOverlay from "../../GestureOverlay"; +import { Doc } from "../../../../fields/Doc"; +import { SelectionManager } from "../../../util/SelectionManager"; +import { DocumentView } from "../../../views/nodes/DocumentView"; +import { Document } from "../../../../fields/documentSchemas"; +import { DocumentType } from "../../../documents/DocumentTypes"; +import { FontAwesomeIcon } from "@fortawesome/react-fontawesome"; +import { IconProp, library } from '@fortawesome/fontawesome-svg-core'; +import { faRulerCombined, faFillDrip, faPenNib } from "@fortawesome/free-solid-svg-icons"; +import { Cast, StrCast, BoolCast, NumCast } from "../../../../fields/Types"; +import e = require("express"); +import { ChangeEvent } from "mongodb"; +import { black } from "colors"; + + +library.add(faRulerCombined, faFillDrip, faPenNib); + +@observer +export default class FormatShapePane extends AntimodeMenu { + static Instance: FormatShapePane; + + private _palette = ["#D0021B", "#F5A623", "#F8E71C", "#8B572A", "#7ED321", "#417505", "#9013FE", "#4A90E2", "#50E3C2", "#B8E986", "#000000", "#4A4A4A", "#9B9B9B", "#FFFFFF"]; + private _width = ["1", "5", "10", "100"]; + private _mode = ["fill-drip", "ruler-combined"]; + private _subMenu = ["fill", "line", "size", "position"]; + private _headIcon = ["⎯", "←"]; + private _endIcon = ["⎯", "→"]; + private _head = ["none", "arrowHead"]; + private _end = ["none", "arrowEnd"]; + + @observable private _subOpen = [false, false, false, false]; + + @observable private collapsed: boolean = false; + @observable private currMode: string = "fill-drip"; + @observable _fillBtn = false; + @observable _lineBtn = false; + + @observable _selectDoc: DocumentView[] = []; + + @observable _noFill = false; + @observable _solidFill = false; + @observable _noLine = false; + @observable _solidLine = false; + @observable _dashLine = false; + @observable _lock = false; + + @observable _multiple = false; + + @observable _widthBtn = false; + + @observable _currWidth = "10"; + + @observable _single = false; + @observable _currFill = "#D0021B"; + @observable _currColor = "#D0021B"; + + @observable _arrowHead = false; + @observable _arrowEnd = false; + + + @observable _currSizeHeight = "10"; + @observable _currSizeWidth = "10"; + @observable _currRotation = "10"; + + @observable _currPositionHorizontal = "10"; + @observable _currPositionVertical = "10"; + + + constructor(props: Readonly<{}>) { + super(props); + FormatShapePane.Instance = this; + this._canFade = false; // don't let the inking menu fade away + this.Pinned = BoolCast(Doc.UserDoc()["formatShapePane-pinned"]); + + } + + @action + toggleMenuPin = (e: React.MouseEvent) => { + Doc.UserDoc()["formatShapePane-pinned"] = this.Pinned = !this.Pinned; + if (!this.Pinned) { + // this.fadeOut(true); + } + } + + @action + protected toggleCollapse = (e: React.MouseEvent) => { + this.collapsed = !this.collapsed; + setTimeout(() => { + const x = Math.min(this._left, window.innerWidth - FormatShapePane.Instance.width); + FormatShapePane.Instance.jumpTo(x, this._top, true); + }, 0); + } + + @action + closePane = () => { + this.jumpTo(-300, -300); + this.Pinned = false; + + } + + @action + checkSame = () => { + const docs = SelectionManager.SelectedDocuments(); + const inks: DocumentView[] = []; + for (var i = 0; i < docs.length; i++) { + if (Document(docs[i].rootDoc).type === DocumentType.INK) { + inks.push(docs[i]); + } + } + const firstWidth = Document(inks[0].rootDoc).strokeWidth; + const firstColor = Document(inks[0].rootDoc).color; + const firstFill = Document(inks[0].rootDoc).fillColor; + // const firstBezier + const firstRotation = Document(inks[0].rootDoc).rotation; + const firstArrowStart = Document(inks[0].rootDoc).arrowStart; + const firstArrowEnd = Document(inks[0].rootDoc).arrowEnd; + const firstDash = Document(inks[0].rootDoc).dash; + const firstWidthSize = Document(inks[0].rootDoc)._width; + const firstHeightSize = Document(inks[0].rootDoc)._height; + const firstHorizontal = Document(inks[0].rootDoc).x; + const firstVertical = Document(inks[0].rootDoc).y; + this._noFill = Document(inks[0].rootDoc).fillColor === "none" ? true : false; + this._solidFill = Document(inks[0].rootDoc).fillColor === "none" ? false : true; + this._noLine = Document(inks[0].rootDoc).color === "none" ? true : false; + if (Document(inks[0].rootDoc).color !== "none") { + this._solidLine = true; + this._dashLine = true; + if (Document(inks[0].rootDoc).dash === "0") { + this._dashLine = false; + } else { + this._solidLine = false; + + } + } + // this._solidLine = (Document(inks[0].rootDoc).color === "none") ? false : Document(inks[0].rootDoc).dash === 0 ? true : false; + // this._dashLine = (Document(inks[0].rootDoc).color === "none") ? false : Document(inks[0].rootDoc).dash !== 0 ? true : false; + // // this._widthBtn = false; + this._currWidth = String(Document(inks[0].rootDoc).strokeWidth); + // this._single = false; + this._currFill = String(Document(inks[0].rootDoc).fillColor); + this._currColor = String(Document(inks[0].rootDoc).color); + this._arrowHead = Document(inks[0].rootDoc).arrowStart === "none" ? false : true; + this._arrowEnd = Document(inks[0].rootDoc).arrowEnd === "none" ? false : true; + this._currSizeHeight = String(Document(inks[0].rootDoc)._height); + this._currSizeWidth = String(Document(inks[0].rootDoc)._width); + this._currRotation = String(Document(inks[0].rootDoc).rotation); + this._currPositionHorizontal = String(Document(inks[0].rootDoc).x); + this._currPositionVertical = String(Document(inks[0].rootDoc).y); + for (var i = 0; i < inks.length; i++) { + if (Document(inks[i].rootDoc).strokeWidth !== firstWidth) { + this._currWidth = ""; + } + if (Document(inks[i].rootDoc).color !== firstColor) { + this._noLine = false; + this._solidLine = false; + this._dashLine = false; + } + if (Document(inks[i].rootDoc).fillColor !== firstFill) { + this._solidFill = false; + this._noFill = false; + } + if (Document(inks[i].rootDoc).arrowStart !== firstArrowStart) { + this._arrowHead = false; + } + if (Document(inks[i].rootDoc).arrowEnd !== firstArrowEnd) { + this._arrowEnd = false; + } + if (Document(inks[i].rootDoc).x !== firstHorizontal) { + this._currPositionHorizontal = ""; + } + if (Document(inks[i].rootDoc).y !== firstVertical) { + this._currPositionVertical = ""; + } + if (Document(inks[i].rootDoc)._width !== firstWidthSize) { + this._currSizeWidth = ""; + } + if (Document(inks[i].rootDoc)._height !== firstHeightSize) { + this._currSizeHeight = ""; + } + if (Document(inks[i].rootDoc).rotation !== firstRotation) { + this._currRotation = ""; + } + } + + + + } + + @action + upDownButtons = (dirs: string, field: string) => { + SelectionManager.SelectedDocuments().forEach(action((element: DocumentView) => { + const doc = Document(element.rootDoc); + if (doc.type === DocumentType.INK) { + switch (field) { + case "width": + if (doc.strokeWidth) { + doc.strokeWidth = dirs === "up" ? doc.strokeWidth + 1 : doc.strokeWidth - 1; + SetActiveInkWidth(String(doc.strokeWidth)); + + } + break; + case "sizeWidth": + if (doc._width && doc._height) { + const oldWidth = doc._width; + const oldHeight = doc._height; + + doc._width = dirs === "up" ? doc._width + 10 : doc._width - 10; + if (this._lock) { + doc._height = (doc._width * oldHeight) / oldWidth; + } + } + break; + case "sizeHeight": + if (doc._width && doc._height) { + const oldWidth = doc._width; + const oldHeight = doc._height; + doc._height = dirs === "up" ? doc._height + 10 : doc._height - 10; + if (this._lock) { + doc._width = (doc._height * oldWidth) / oldHeight; + } + } + break; + case "horizontal": + if (doc.x) { + doc.x = dirs === "up" ? doc.x + 10 : doc.x - 10; + } + break; + case "vertical": + if (doc.y) { + doc.y = dirs === "up" ? doc.y + 10 : doc.y - 10; + } + case "rotation": + + this.rotate(dirs === "up" ? Number(doc.rotation) + Number(0.1) : Number(doc.rotation) - Number(0.1)); + + break; + default: + break; + } + this.selected(); + + } + })); + } + + @action + editProperties = (value: any, field: string) => { + SelectionManager.SelectedDocuments().forEach(action((element: DocumentView) => { + const doc = Document(element.rootDoc); + if (doc.type === DocumentType.INK) { + switch (field) { + case "width": + SetActiveInkWidth(value); + doc.strokeWidth = Number(value); + break; + case "color": + doc.color = String(value); + break; + case "fill": + doc.fillColor = String(value); + break; + case "bezier": + // doc.strokeBezier === 300 ? doc.strokeBezier = 0 : doc.strokeBezier = 300; + break; + case "arrowStart": + doc.arrowStart = String(value); + break; + case "arrowEnd": + doc.arrowEnd = String(value); + break; + case "dash": + doc.dash = String(value); + break; + case "widthSize": + if (doc._width && doc._height) { + const oldWidth = doc._width; + const oldHeight = doc._height; + + doc._width = Number(value); + if (this._lock) { + doc._height = (doc._width * oldHeight) / oldWidth; + } + } + break; + case "heightSize": + if (doc._width && doc._height) { + const oldWidth = doc._width; + const oldHeight = doc._height; + + doc._height = Number(value); + if (this._lock) { + doc._width = (doc._height * oldWidth) / oldHeight; + } + } + break; + case "horizontal": + doc.x = Number(value); + break; + case "vertical": + doc.y = Number(value); + + break; + default: + break; + } + } + this.selected(); + })); + this.checkSame(); + + } + + @computed get close() { + const close = ; + return close; + } + + @computed get modes() { + const modes =
+ {this._mode.map(mode => { + return ; + }) + }
; + return modes; + } + + @action + selected = () => { + this._selectDoc = SelectionManager.SelectedDocuments(); + if (this._selectDoc.length === 1 && Document(this._selectDoc[0].rootDoc).type === DocumentType.INK) { + this._single = true; + const doc = Document(this._selectDoc[0].rootDoc); + if (doc.type === DocumentType.INK) { + console.log(doc.fillColor); + if (doc.fillColor === "none") { + this._noFill = true; + this._solidFill = false; + } else { + this._solidFill = true; + this._noFill = false; + this._currFill = String(doc.fillColor); + } + if (doc.color === "none") { + this._noLine = true; + this._solidLine = false; + this._dashLine = false; + } else { + console.log(doc.strokeWidth); + this._currWidth = String(doc.strokeWidth); + this._currColor = String(doc.color); + if (doc.dash === "0") { + this._solidLine = true; + this._noLine = false; + this._dashLine = false; + } else { + this._dashLine = true; + this._noLine = false; + this._solidLine = false; + } + + this._arrowHead = doc.arrowStart === "none" ? false : true; + this._arrowEnd = doc.arrowEnd === "none" ? false : true; + + + this._currPositionHorizontal = String(doc.x); + this._currPositionVertical = String(doc.y); + console.log(doc.rotation); + this._currRotation = String(doc.rotation); + this._currSizeHeight = String(doc._height); + this._currSizeWidth = String(doc._width); + } + + } + } else { + this._noFill = false; + this._solidFill = false; + this._single = false; + this._currFill = "#D0021B"; + this._noLine = false; + this._solidLine = false; + this._dashLine = false; + this._currColor = "#D0021B"; + this._arrowHead = false; + this._arrowEnd = false; + this._currPositionHorizontal = ""; + this._currPositionVertical = ""; + this._currRotation = ""; + this._currSizeHeight = ""; + this._currSizeWidth = ""; + } + this.checkSame(); + } + + @action + rotate = (degrees: number) => { + SelectionManager.SelectedDocuments().forEach(action((element: DocumentView) => { + const doc = Document(element.rootDoc); + if (doc.type === DocumentType.INK && doc.x && doc.y && doc._width && doc._height && doc.data) { + // doc.rotation = (Number(doc.rotation) + (Number(angle) * 180 / Math.PI)); + // console.log(doc.rotation); + const angle = Number(degrees) - Number(doc.rotation); + doc.rotation = Number(degrees); + const ink = Cast(doc.data, InkField)?.inkData; + if (ink) { + const xs = ink.map(p => p.X); + const ys = ink.map(p => p.Y); + const left = Math.min(...xs); + const top = Math.min(...ys); + const right = Math.max(...xs); + const bottom = Math.max(...ys); + const _centerPoints: { X: number, Y: number }[] = []; + _centerPoints.push({ X: left, Y: top }); + + const newPoints: { X: number, Y: number }[] = []; + for (var i = 0; i < ink.length; i++) { + const newX = Math.cos(angle) * (ink[i].X - _centerPoints[0].X) - Math.sin(angle) * (ink[i].Y - _centerPoints[0].Y) + _centerPoints[0].X; + const newY = Math.sin(angle) * (ink[i].X - _centerPoints[0].X) + Math.cos(angle) * (ink[i].Y - _centerPoints[0].Y) + _centerPoints[0].Y; + newPoints.push({ X: newX, Y: newY }); + } + doc.data = new InkField(newPoints); + const xs2 = newPoints.map(p => p.X); + const ys2 = newPoints.map(p => p.Y); + const left2 = Math.min(...xs2); + const top2 = Math.min(...ys2); + const right2 = Math.max(...xs2); + const bottom2 = Math.max(...ys2); + + doc._height = (bottom2 - top2) * element.props.ScreenToLocalTransform().Scale; + doc._width = (right2 - left2) * element.props.ScreenToLocalTransform().Scale; + + } + } + })); + } + + @action + toggle = (check: string) => { + switch (check) { + case "noFill": + if (!this._noFill) { + this._noFill = true; + this._solidFill = false; + } + break; + case "solidFill": + if (!this._solidFill) { + this._solidFill = true; + this._noFill = false; + if (this._currFill === "none") { + this._currFill = "#D0021B"; + } + } + break; + case "noLine": + if (!this._noLine) { + this._noLine = true; + this._solidLine = false; + this._dashLine = false; + } + break; + case "solidLine": + if (!this._solidLine) { + this._solidLine = true; + this._noLine = false; + this._dashLine = false; + if (this._currColor === "none") { + this._currColor = "#D0021B"; + } + } + break; + case "dashLine": + if (!this._dashLine) { + this._dashLine = true; + this._solidLine = false; + this._noLine = false; + if (this._currColor === "none") { + this._currColor = "#D0021B"; + } + } + break; + case "lock": + if (this._lock) { + this._lock = false; + } else { + this._lock = true; + } + break; + case "arrowHead": + this._arrowHead = this._arrowHead ? false : true; + break; + case "arrowEnd": + this._arrowEnd = this._arrowEnd ? false : true; + break; + default: + break; + } + } + + @computed get subMenu() { + const fillCheck =
+ { this.toggle("noFill"); this.editProperties("none", "fill"); })} /> + No Fill +

+ { this.toggle("solidFill"); this.editProperties(this._currFill, "fill"); })} /> + Solid Fill +

+

+ {this._solidFill ? "Color" : ""} + {this._solidFill ? this.fillButton : ""} + {this._fillBtn && this._solidFill ? this.fillPicker : ""} + +
; + const arrows = <> { this.toggle("arrowHead"); this.editProperties(this._arrowHead ? "arrowHead" : "none", "arrowStart"); })} /> + Arrow Head +

+ + { this.toggle("arrowEnd"); this.editProperties(this._arrowEnd ? "arrowEnd" : "none", "arrowEnd"); })} /> + Arrow End +

; + const lineCheck =
+ { this.toggle("noLine"); this.editProperties("none", "color"); })} /> + No Line +

+ { this.toggle("solidLine"); this.editProperties(this._currColor, "color"); this.editProperties("0", "dash"); })} /> + Solid Line +

+ { this.toggle("dashLine"); this.editProperties(this._currColor, "color"); this.editProperties("2", "dash"); })} /> + Dash Line +

+

+ {(this._solidLine || this._dashLine) ? "Color" : ""} + {(this._solidLine || this._dashLine) ? this.lineButton : ""} + {this._lineBtn && (this._solidLine || this._dashLine) ? this.linePicker : ""} +

+ {(this._solidLine || this._dashLine) ? "Width" : ""} + {(this._solidLine || this._dashLine) ? this.widthInput : ""} +

+

+ {(this._solidLine || this._dashLine) ? arrows : ""} + +
; + + const sizeCheck =
+ Height {this.sizeHeightInput} +

+

+ + + Width {this.sizeWidthInput} +

+

+ + { this.toggle("lock"); })} /> + Lock Ratio +

+

+ + + Rotation {this.rotationInput} +

+

+ + +
; + const positionCheck =
+ Horizontal {this.positionHorizontalInput} +

+

+ + Vertical {this.positionVerticalInput} +

+

+ + +
; + + const subMenu =
+ {this._subMenu.map((subMenu, i) => { + if (subMenu === "fill" || subMenu === "line") { + return
+ {this.currMode === "fill-drip" && subMenu === "fill" && this._subOpen[0] ? fillCheck : ""} + {this.currMode === "fill-drip" && subMenu === "line" && this._subOpen[1] ? lineCheck : ""} + +
; + } + else if (subMenu === "size" || subMenu === "position") { + return
+ {this.currMode === "ruler-combined" && subMenu === "size" && this._subOpen[2] ? sizeCheck : ""} + {this.currMode === "ruler-combined" && subMenu === "position" && this._subOpen[3] ? positionCheck : ""} + +
+ ; + + } + }) + }
; + return subMenu; + } + + @computed get fillButton() { + const fillButton = <> +

+

; + return fillButton; + } + @computed get fillPicker() { + const fillPicker =
+ {this._palette.map(color => { + return ; + })} + +
; + return fillPicker; + } + + @computed get lineButton() { + const lineButton = <> +

+

; + return lineButton; + } + @computed get linePicker() { + const linePicker =
+ {this._palette.map(color => { + return ; + })} + +
; + return linePicker; + } + @computed get widthInput() { + const widthInput = <> + this.onChange(e.target.value, "width")} + autoFocus> +
+ ; + return widthInput; + } + @computed get sizeHeightInput() { + const sizeHeightInput = <> + this.onChange(e.target.value, "sizeHeight")} + autoFocus> + +
+ + ; + return sizeHeightInput; + } + + @computed get sizeWidthInput() { + const sizeWidthInput = <> + this.onChange(e.target.value, "sizeWidth")} + autoFocus> + +

+ ; + return sizeWidthInput; + } + + @computed get rotationInput() { + const rotationInput = + <> + this.onChange(e.target.value, "rotation")} + autoFocus> + +

+ ; + return rotationInput; + } + + @computed get positionHorizontalInput() { + const positionHorizontalInput = + <> this.onChange(e.target.value, "positionHorizontal")} + autoFocus> + +

+ ; + return positionHorizontalInput; + } + + @computed get positionVerticalInput() { + const positionVerticalInput = + <> this.onChange(e.target.value, "positionVertical")} + autoFocus> + +

+ ; + return positionVerticalInput; + } + + + @action + onChange = (val: string, property: string): void => { + if (!Number.isNaN(Number(val)) && Number(val) !== null && val !== " ") { + + // if (val === "") { + // val = "0"; + // } + switch (property) { + case "width": + this._currWidth = val; + if (val !== "") { + this.editProperties(this._currWidth, "width"); + } + break; + case "sizeHeight": + this._currSizeHeight = val; + if (val !== "") { + this.editProperties(this._currSizeHeight, "heightSize"); + } + break; + case "sizeWidth": + this._currSizeWidth = val; + if (val !== "") { + + this.editProperties(this._currSizeWidth, "widthSize"); + } + break; + case "rotation": + + this._currRotation = val; + if (val !== "") { + + this.rotate(Number(val)); + } + break; + case "positionHorizontal": + this._currPositionHorizontal = val; if (val !== "") { + + this.editProperties(this._currPositionHorizontal, "horizontal"); + } + + break; + case "positionVertical": + this._currPositionVertical = val; + if (val !== "") { + + this.editProperties(this._currPositionVertical, "vertical"); + } + + break; + default: + break; + } + } + } + + + + + // @action + // changeWidth = (event: React.ChangeEvent) => { + // console.log(event.target.value); + // this._currWidth = NumCast(event.target.value); + + // } + + @computed get upDown() { + const upDown =
+ +

+ +
; + return upDown; + } + + + @computed get widthPicker() { + var widthPicker = ; + if (this._widthBtn) { + widthPicker =
+ {widthPicker} + {this._width.map(wid => { + return ; + })} +
; + } + return widthPicker; + } + + + + render() { + const buttons = [ + + this.close, + this.modes, + this.subMenu + + ]; + + return this.getElementVert(buttons); + } +} +Scripting.addGlobal(function activatePen2(penBtn: any) { + if (penBtn) { + //no longer changes to inkmode + // Doc.SetSelectedTool(InkTool.Pen); + FormatShapePane.Instance.jumpTo(300, 300); + FormatShapePane.Instance.Pinned = true; + + } else { + // Doc.SetSelectedTool(InkTool.None); + FormatShapePane.Instance.Pinned = false; + FormatShapePane.Instance.fadeOut(true); + + } +}); \ No newline at end of file -- cgit v1.2.3-70-g09d2 From c8454d675a3081a83c56cf598b1b3637479b0459 Mon Sep 17 00:00:00 2001 From: yunahi <60233430+yunahi@users.noreply.github.com> Date: Fri, 10 Jul 2020 05:22:06 +0900 Subject: added format shape --- src/client/util/SelectionManager.ts | 3 +- .../collectionFreeForm/FormatShapePane.tsx | 137 ++++----------------- 2 files changed, 24 insertions(+), 116 deletions(-) (limited to 'src/client/views/collections/collectionFreeForm/FormatShapePane.tsx') diff --git a/src/client/util/SelectionManager.ts b/src/client/util/SelectionManager.ts index aea2c542b..af2f320d3 100644 --- a/src/client/util/SelectionManager.ts +++ b/src/client/util/SelectionManager.ts @@ -15,8 +15,7 @@ export namespace SelectionManager { SelectedDocuments: ObservableMap = new ObservableMap(); @action SelectDoc(docView: DocumentView, ctrlPressed: boolean): void { - console.log("select" - ); + // if doc is not in SelectedDocuments, add it if (!manager.SelectedDocuments.get(docView)) { if (!ctrlPressed) { diff --git a/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx b/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx index 7b47b7ca4..37ba805b6 100644 --- a/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx +++ b/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx @@ -3,12 +3,9 @@ import AntimodeMenu from "../../AntimodeMenu"; import { observer } from "mobx-react"; import { observable, action, computed } from "mobx"; import "./FormatShapePane.scss"; -import { ActiveInkColor, ActiveInkBezierApprox, ActiveFillColor, ActiveArrowStart, ActiveArrowEnd, SetActiveInkWidth, SetActiveInkColor, SetActiveBezierApprox, SetActiveFillColor, SetActiveArrowStart, SetActiveArrowEnd, ActiveDash, SetActiveDash } from "../../InkingStroke"; +import { SetActiveInkWidth } from "../../InkingStroke"; import { Scripting } from "../../../util/Scripting"; -import { InkTool, InkField } from "../../../../fields/InkField"; -import { ColorState } from "react-color"; -import { Utils } from "../../../../Utils"; -import GestureOverlay from "../../GestureOverlay"; +import { InkField } from "../../../../fields/InkField"; import { Doc } from "../../../../fields/Doc"; import { SelectionManager } from "../../../util/SelectionManager"; import { DocumentView } from "../../../views/nodes/DocumentView"; @@ -19,9 +16,6 @@ import { IconProp, library } from '@fortawesome/fontawesome-svg-core'; import { faRulerCombined, faFillDrip, faPenNib } from "@fortawesome/free-solid-svg-icons"; import { Cast, StrCast, BoolCast, NumCast } from "../../../../fields/Types"; import e = require("express"); -import { ChangeEvent } from "mongodb"; -import { black } from "colors"; - library.add(faRulerCombined, faFillDrip, faPenNib); @@ -33,63 +27,42 @@ export default class FormatShapePane extends AntimodeMenu { private _width = ["1", "5", "10", "100"]; private _mode = ["fill-drip", "ruler-combined"]; private _subMenu = ["fill", "line", "size", "position"]; - private _headIcon = ["⎯", "←"]; - private _endIcon = ["⎯", "→"]; - private _head = ["none", "arrowHead"]; - private _end = ["none", "arrowEnd"]; - @observable private _subOpen = [false, false, false, false]; - @observable private collapsed: boolean = false; @observable private currMode: string = "fill-drip"; @observable _fillBtn = false; @observable _lineBtn = false; - @observable _selectDoc: DocumentView[] = []; - @observable _noFill = false; @observable _solidFill = false; @observable _noLine = false; @observable _solidLine = false; @observable _dashLine = false; @observable _lock = false; - @observable _multiple = false; - @observable _widthBtn = false; - - @observable _currWidth = "10"; - @observable _single = false; - @observable _currFill = "#D0021B"; - @observable _currColor = "#D0021B"; - @observable _arrowHead = false; @observable _arrowEnd = false; - - @observable _currSizeHeight = "10"; @observable _currSizeWidth = "10"; @observable _currRotation = "10"; - @observable _currPositionHorizontal = "10"; @observable _currPositionVertical = "10"; - + @observable _currWidth = "10"; + @observable _currFill = "#D0021B"; + @observable _currColor = "#D0021B"; constructor(props: Readonly<{}>) { super(props); FormatShapePane.Instance = this; - this._canFade = false; // don't let the inking menu fade away + this._canFade = false; this.Pinned = BoolCast(Doc.UserDoc()["formatShapePane-pinned"]); - } @action toggleMenuPin = (e: React.MouseEvent) => { Doc.UserDoc()["formatShapePane-pinned"] = this.Pinned = !this.Pinned; - if (!this.Pinned) { - // this.fadeOut(true); - } } @action @@ -105,9 +78,9 @@ export default class FormatShapePane extends AntimodeMenu { closePane = () => { this.jumpTo(-300, -300); this.Pinned = false; - } + //if multiple inks are selected and do not share the same prop, leave blank @action checkSame = () => { const docs = SelectionManager.SelectedDocuments(); @@ -117,18 +90,6 @@ export default class FormatShapePane extends AntimodeMenu { inks.push(docs[i]); } } - const firstWidth = Document(inks[0].rootDoc).strokeWidth; - const firstColor = Document(inks[0].rootDoc).color; - const firstFill = Document(inks[0].rootDoc).fillColor; - // const firstBezier - const firstRotation = Document(inks[0].rootDoc).rotation; - const firstArrowStart = Document(inks[0].rootDoc).arrowStart; - const firstArrowEnd = Document(inks[0].rootDoc).arrowEnd; - const firstDash = Document(inks[0].rootDoc).dash; - const firstWidthSize = Document(inks[0].rootDoc)._width; - const firstHeightSize = Document(inks[0].rootDoc)._height; - const firstHorizontal = Document(inks[0].rootDoc).x; - const firstVertical = Document(inks[0].rootDoc).y; this._noFill = Document(inks[0].rootDoc).fillColor === "none" ? true : false; this._solidFill = Document(inks[0].rootDoc).fillColor === "none" ? false : true; this._noLine = Document(inks[0].rootDoc).color === "none" ? true : false; @@ -142,11 +103,7 @@ export default class FormatShapePane extends AntimodeMenu { } } - // this._solidLine = (Document(inks[0].rootDoc).color === "none") ? false : Document(inks[0].rootDoc).dash === 0 ? true : false; - // this._dashLine = (Document(inks[0].rootDoc).color === "none") ? false : Document(inks[0].rootDoc).dash !== 0 ? true : false; - // // this._widthBtn = false; this._currWidth = String(Document(inks[0].rootDoc).strokeWidth); - // this._single = false; this._currFill = String(Document(inks[0].rootDoc).fillColor); this._currColor = String(Document(inks[0].rootDoc).color); this._arrowHead = Document(inks[0].rootDoc).arrowStart === "none" ? false : true; @@ -157,45 +114,43 @@ export default class FormatShapePane extends AntimodeMenu { this._currPositionHorizontal = String(Document(inks[0].rootDoc).x); this._currPositionVertical = String(Document(inks[0].rootDoc).y); for (var i = 0; i < inks.length; i++) { - if (Document(inks[i].rootDoc).strokeWidth !== firstWidth) { + if (Document(inks[i].rootDoc).strokeWidth !== Document(inks[0].rootDoc).strokeWidth) { this._currWidth = ""; } - if (Document(inks[i].rootDoc).color !== firstColor) { + if (Document(inks[i].rootDoc).color !== Document(inks[0].rootDoc).color) { this._noLine = false; this._solidLine = false; this._dashLine = false; } - if (Document(inks[i].rootDoc).fillColor !== firstFill) { + if (Document(inks[i].rootDoc).fillColor !== Document(inks[0].rootDoc).fillColor) { this._solidFill = false; this._noFill = false; } - if (Document(inks[i].rootDoc).arrowStart !== firstArrowStart) { + if (Document(inks[i].rootDoc).arrowStart !== Document(inks[0].rootDoc).arrowStart) { this._arrowHead = false; } - if (Document(inks[i].rootDoc).arrowEnd !== firstArrowEnd) { + if (Document(inks[i].rootDoc).arrowEnd !== Document(inks[0].rootDoc).arrowEnd) { this._arrowEnd = false; } - if (Document(inks[i].rootDoc).x !== firstHorizontal) { + if (Document(inks[i].rootDoc).x !== Document(inks[0].rootDoc).x) { this._currPositionHorizontal = ""; } - if (Document(inks[i].rootDoc).y !== firstVertical) { + if (Document(inks[i].rootDoc).y !== Document(inks[0].rootDoc).y) { this._currPositionVertical = ""; } - if (Document(inks[i].rootDoc)._width !== firstWidthSize) { + if (Document(inks[i].rootDoc)._width !== Document(inks[0].rootDoc)._width) { this._currSizeWidth = ""; } - if (Document(inks[i].rootDoc)._height !== firstHeightSize) { + if (Document(inks[i].rootDoc)._height !== Document(inks[0].rootDoc)._height) { this._currSizeHeight = ""; } - if (Document(inks[i].rootDoc).rotation !== firstRotation) { + if (Document(inks[i].rootDoc).rotation !== Document(inks[0].rootDoc).rotation) { this._currRotation = ""; } } - - - } + @action upDownButtons = (dirs: string, field: string) => { SelectionManager.SelectedDocuments().forEach(action((element: DocumentView) => { @@ -206,14 +161,12 @@ export default class FormatShapePane extends AntimodeMenu { if (doc.strokeWidth) { doc.strokeWidth = dirs === "up" ? doc.strokeWidth + 1 : doc.strokeWidth - 1; SetActiveInkWidth(String(doc.strokeWidth)); - } break; case "sizeWidth": if (doc._width && doc._height) { const oldWidth = doc._width; const oldHeight = doc._height; - doc._width = dirs === "up" ? doc._width + 10 : doc._width - 10; if (this._lock) { doc._height = (doc._width * oldHeight) / oldWidth; @@ -240,19 +193,17 @@ export default class FormatShapePane extends AntimodeMenu { doc.y = dirs === "up" ? doc.y + 10 : doc.y - 10; } case "rotation": - this.rotate(dirs === "up" ? Number(doc.rotation) + Number(0.1) : Number(doc.rotation) - Number(0.1)); - break; default: break; } this.selected(); - } })); } + @action editProperties = (value: any, field: string) => { SelectionManager.SelectedDocuments().forEach(action((element: DocumentView) => { @@ -270,7 +221,6 @@ export default class FormatShapePane extends AntimodeMenu { doc.fillColor = String(value); break; case "bezier": - // doc.strokeBezier === 300 ? doc.strokeBezier = 0 : doc.strokeBezier = 300; break; case "arrowStart": doc.arrowStart = String(value); @@ -285,7 +235,6 @@ export default class FormatShapePane extends AntimodeMenu { if (doc._width && doc._height) { const oldWidth = doc._width; const oldHeight = doc._height; - doc._width = Number(value); if (this._lock) { doc._height = (doc._width * oldHeight) / oldWidth; @@ -296,7 +245,6 @@ export default class FormatShapePane extends AntimodeMenu { if (doc._width && doc._height) { const oldWidth = doc._width; const oldHeight = doc._height; - doc._height = Number(value); if (this._lock) { doc._width = (doc._height * oldWidth) / oldHeight; @@ -308,7 +256,6 @@ export default class FormatShapePane extends AntimodeMenu { break; case "vertical": doc.y = Number(value); - break; default: break; @@ -331,13 +278,14 @@ export default class FormatShapePane extends AntimodeMenu { return close; } + //select either coor&fill or size&position @computed get modes() { const modes =
{this._mode.map(mode => { return ; @@ -346,6 +294,7 @@ export default class FormatShapePane extends AntimodeMenu { return modes; } + //detects currently selected document and change value in pane @action selected = () => { this._selectDoc = SelectionManager.SelectedDocuments(); @@ -353,7 +302,6 @@ export default class FormatShapePane extends AntimodeMenu { this._single = true; const doc = Document(this._selectDoc[0].rootDoc); if (doc.type === DocumentType.INK) { - console.log(doc.fillColor); if (doc.fillColor === "none") { this._noFill = true; this._solidFill = false; @@ -382,11 +330,8 @@ export default class FormatShapePane extends AntimodeMenu { this._arrowHead = doc.arrowStart === "none" ? false : true; this._arrowEnd = doc.arrowEnd === "none" ? false : true; - - this._currPositionHorizontal = String(doc.x); this._currPositionVertical = String(doc.y); - console.log(doc.rotation); this._currRotation = String(doc.rotation); this._currSizeHeight = String(doc._height); this._currSizeWidth = String(doc._width); @@ -418,8 +363,6 @@ export default class FormatShapePane extends AntimodeMenu { SelectionManager.SelectedDocuments().forEach(action((element: DocumentView) => { const doc = Document(element.rootDoc); if (doc.type === DocumentType.INK && doc.x && doc.y && doc._width && doc._height && doc.data) { - // doc.rotation = (Number(doc.rotation) + (Number(angle) * 180 / Math.PI)); - // console.log(doc.rotation); const angle = Number(degrees) - Number(doc.rotation); doc.rotation = Number(degrees); const ink = Cast(doc.data, InkField)?.inkData; @@ -446,10 +389,8 @@ export default class FormatShapePane extends AntimodeMenu { const top2 = Math.min(...ys2); const right2 = Math.max(...xs2); const bottom2 = Math.max(...ys2); - doc._height = (bottom2 - top2) * element.props.ScreenToLocalTransform().Scale; doc._width = (right2 - left2) * element.props.ScreenToLocalTransform().Scale; - } } })); @@ -854,14 +795,11 @@ export default class FormatShapePane extends AntimodeMenu { return positionVerticalInput; } - + //change inputs @action onChange = (val: string, property: string): void => { if (!Number.isNaN(Number(val)) && Number(val) !== null && val !== " ") { - // if (val === "") { - // val = "0"; - // } switch (property) { case "width": this._currWidth = val; @@ -912,35 +850,6 @@ export default class FormatShapePane extends AntimodeMenu { } - - - // @action - // changeWidth = (event: React.ChangeEvent) => { - // console.log(event.target.value); - // this._currWidth = NumCast(event.target.value); - - // } - - @computed get upDown() { - const upDown =
- -

- -
; - return upDown; - } - - @computed get widthPicker() { var widthPicker = + return <> +

-

; - return fillButton; +

+ ; } @computed get fillPicker() { - const fillPicker =
+ return
{this._palette.map(color => { return
; - return fillPicker; } @computed get lineButton() { - const lineButton = <> -

-

; - return lineButton; + return <> + +
+
+ ; } @computed get linePicker() { - const linePicker =
+ return
{this._palette.map(color => { return
; - return linePicker; } @computed get widthInput() { const widthInput = <> this.onChange(e.target.value, "width")} - autoFocus>
@@ -672,8 +494,8 @@ export default class FormatShapePane extends AntimodeMenu { this.onChange(e.target.value, "sizeHeight")} - autoFocus> + onChange={e => this._currSizeHeight = e.target.value} + autoFocus /> -

+
-

+
+

+ -

- ; - return positionHorizontalInput; + ; } @computed get positionVerticalInput() { - const positionVerticalInput = - <> + this.onChange(e.target.value, "positionVertical")} + onChange={e => this._currPositionVertical = e.target.value} autoFocus> - -

- ; - return positionVerticalInput; - } - - //change inputs - @action - onChange = (val: string, property: string): void => { - if (!Number.isNaN(Number(val)) && Number(val) !== null && val !== " ") { - - switch (property) { - case "width": - this._currWidth = val; - if (val !== "") { - this.editProperties(this._currWidth, "width"); - } - break; - case "sizeHeight": - this._currSizeHeight = val; - if (val !== "") { - this.editProperties(this._currSizeHeight, "heightSize"); - } - break; - case "sizeWidth": - this._currSizeWidth = val; - if (val !== "") { - - this.editProperties(this._currSizeWidth, "widthSize"); - } - break; - case "rotation": - - this._currRotation = val; - if (val !== "") { - - this.rotate(Number(val)); - } - break; - case "positionHorizontal": - this._currPositionHorizontal = val; if (val !== "") { - - this.editProperties(this._currPositionHorizontal, "horizontal"); - } - - break; - case "positionVertical": - this._currPositionVertical = val; - if (val !== "") { - - this.editProperties(this._currPositionVertical, "vertical"); - } - - break; - default: - break; - } - } - } - - - @computed get widthPicker() { - var widthPicker = ; - if (this._widthBtn) { - widthPicker =
- {widthPicker} - {this._width.map(wid => { - return ; - })} -
; - } - return widthPicker; +

+ + ; } - - render() { const buttons = [ diff --git a/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx b/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx index e4f3248d0..0866db2be 100644 --- a/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx +++ b/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx @@ -25,19 +25,19 @@ library.add(faBold, faItalic, faChevronLeft, faUnderline, faStrikethrough, faSup export default class InkOptionsMenu extends AntimodeMenu { static Instance: InkOptionsMenu; - private _palette = ["#D0021B", "#F5A623", "#F8E71C", "#8B572A", "#7ED321", "#417505", "#9013FE", "#4A90E2", "#50E3C2", "#B8E986", "#000000", "#4A4A4A", "#9B9B9B", "#FFFFFF", "none"]; + private _palette = ["#D0021B", "#F5A623", "#F8E71C", "#8B572A", "#7ED321", "#417505", "#9013FE", "#4A90E2", "#50E3C2", "#B8E986", "#000000", "#4A4A4A", "#9B9B9B", "#FFFFFF", ""]; private _width = ["1", "5", "10", "100"]; // private _buttons = ["circle", "triangle", "rectangle", "arrow", "line"]; // private _icons = ["O", "∆", "ロ", "➜", "-"]; // private _buttons = ["circle", "triangle", "rectangle", "line", "noRec", "",]; // private _icons = ["O", "∆", "ロ", "⎯⎯⎯", "✖︎", " "]; //arrowStart and arrowEnd must match and defs must exist in Inking Stroke - // private _arrowStart = ["arrowHead", "arrowHead", "dot", "dot", "none"]; + // private _arrowStart = ["arrowStart", "arrowStart", "dot", "dot", "none"]; // private _arrowEnd = ["none", "arrowEnd", "none", "dot", "none"]; // private _arrowIcons = ["→", "↔︎", "•", "••", " "]; private _draw = ["⎯", "→", "↔︎", "∿", "↝", "↭", "ロ", "O", "∆"]; - private _head = ["none", "none", "arrowHead", "none", "none", "arrowHead", "none", "none", "none"]; - private _end = ["none", "arrowEnd", "arrowEnd", "none", "arrowEnd", "arrowEnd", "none", "none", "none"]; + private _head = ["", "", "arrow", "", "", "arrow", "", "", ""]; + private _end = ["", "arrow", "arrow", "", "arrow", "arrow", "", "", ""]; private _shape = ["", "", "", "", "", "", "rectangle", "circle", "triangle"]; @observable _shapesNum = this._shape.length; @@ -122,12 +122,6 @@ export default class InkOptionsMenu extends AntimodeMenu { case "bezier": // doc.strokeBezier === 300 ? doc.strokeBezier = 0 : doc.strokeBezier = 300; break; - case "arrowStart": - doc.arrowStart = String(value); - break; - case "arrowEnd": - doc.arrowEnd = String(value); - break; case "dash": doc.dash = Number(value); default: @@ -165,13 +159,12 @@ export default class InkOptionsMenu extends AntimodeMenu { SetActiveArrowEnd(this._end[i]); SetActiveBezierApprox("300"); - // this.editProperties(this._head[i], "arrowStart"), this.editProperties(this._end[i], "arrowEnd"); GestureOverlay.Instance.InkShape = this._shape[i]; } else { this._selected = this._shapesNum; Doc.SetSelectedTool(InkTool.None); - SetActiveArrowStart("none"); - SetActiveArrowEnd("none"); + SetActiveArrowStart(""); + SetActiveArrowEnd(""); GestureOverlay.Instance.InkShape = ""; SetActiveBezierApprox("0"); @@ -189,13 +182,12 @@ export default class InkOptionsMenu extends AntimodeMenu { SetActiveArrowEnd(this._end[i]); SetActiveBezierApprox("300"); - // this.editProperties(this._head[i], "arrowStart"), this.editProperties(this._end[i], "arrowEnd"); GestureOverlay.Instance.InkShape = this._shape[i]; } else { this._selected = this._shapesNum; Doc.SetSelectedTool(InkTool.None); - SetActiveArrowStart("none"); - SetActiveArrowEnd("none"); + SetActiveArrowStart(""); + SetActiveArrowEnd(""); GestureOverlay.Instance.InkShape = ""; SetActiveBezierApprox("0"); diff --git a/src/client/views/nodes/ColorBox.tsx b/src/client/views/nodes/ColorBox.tsx index 137b387c0..31c5a8b13 100644 --- a/src/client/views/nodes/ColorBox.tsx +++ b/src/client/views/nodes/ColorBox.tsx @@ -14,7 +14,6 @@ import { ViewBoxBaseComponent } from "../DocComponent"; import { ActiveInkPen, ActiveInkWidth, ActiveInkBezierApprox, SetActiveInkColor, SetActiveInkWidth, SetActiveBezierApprox } from "../InkingStroke"; import "./ColorBox.scss"; import { FieldView, FieldViewProps } from './FieldView'; -import { FormattedTextBox } from "./formattedText/FormattedTextBox"; type ColorDocument = makeInterface<[typeof documentSchema]>; const ColorDocument = makeInterface(documentSchema); -- cgit v1.2.3-70-g09d2 From cef8f8d5fb9f5b9dc1f56768c4fa5ec406fbc6ba Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Sat, 11 Jul 2020 20:02:55 -0400 Subject: fixed layout of inkOptionsMenu --- src/client/views/collections/collectionFreeForm/FormatShapePane.scss | 2 +- src/client/views/collections/collectionFreeForm/FormatShapePane.tsx | 4 ++-- 2 files changed, 3 insertions(+), 3 deletions(-) (limited to 'src/client/views/collections/collectionFreeForm/FormatShapePane.tsx') diff --git a/src/client/views/collections/collectionFreeForm/FormatShapePane.scss b/src/client/views/collections/collectionFreeForm/FormatShapePane.scss index 80a74fe4c..7720140b9 100644 --- a/src/client/views/collections/collectionFreeForm/FormatShapePane.scss +++ b/src/client/views/collections/collectionFreeForm/FormatShapePane.scss @@ -1,6 +1,6 @@ .antimodeMenu-button { width: 200px; - position: absolute; + position: relative; text-align: left; .color-previewI { diff --git a/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx b/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx index 3a1c8b18d..095473330 100644 --- a/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx +++ b/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx @@ -136,7 +136,7 @@ export default class FormatShapePane extends AntimodeMenu { } @computed get close() { - return ; } @@ -320,7 +320,7 @@ export default class FormatShapePane extends AntimodeMenu { colorButton(value: string, setter: () => {}) { return <> - -- cgit v1.2.3-70-g09d2 From 49b6ab8536f570ef244199ac39194d3b176c9e77 Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Sat, 11 Jul 2020 20:47:55 -0400 Subject: added open formatting pane to inkOptions. switched to radio buttons for some options. changed names of stroke parameters to start with 'stroke" --- src/client/views/InkingStroke.tsx | 4 ++-- .../collectionFreeForm/FormatShapePane.tsx | 25 +++++++++++----------- .../collectionFreeForm/InkOptionsMenu.tsx | 17 +++++++++++---- src/client/views/nodes/ColorBox.tsx | 11 ++++++++-- 4 files changed, 37 insertions(+), 20 deletions(-) (limited to 'src/client/views/collections/collectionFreeForm/FormatShapePane.tsx') diff --git a/src/client/views/InkingStroke.tsx b/src/client/views/InkingStroke.tsx index 46f714875..d7f956e4f 100644 --- a/src/client/views/InkingStroke.tsx +++ b/src/client/views/InkingStroke.tsx @@ -63,8 +63,8 @@ export class InkingStroke extends ViewBoxBaseComponent 5 ? strokeColor : "transparent", strokeWidth, (strokeWidth + 15), StrCast(this.layoutDoc.strokeBezier), StrCast(this.layoutDoc.fillColor, "transparent"), diff --git a/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx b/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx index 095473330..77d1b646d 100644 --- a/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx +++ b/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx @@ -43,10 +43,10 @@ export default class FormatShapePane extends AntimodeMenu { @computed get _noFill() { return this.inks?.reduce((p, i) => p && !i.rootDoc.fillColor ? true : false, true) || false; } @computed get _solidFill() { return this.inks?.reduce((p, i) => p && i.rootDoc.fillColor ? true : false, true) || false; } @computed get _noLine() { return this.inks?.reduce((p, i) => p && !i.rootDoc.color ? true : false, true) || false; } - @computed get _solidLine() { return this.inks?.reduce((p, i) => p && i.rootDoc.color && (!i.rootDoc.dash || i.rootDoc.dash === "0") ? true : false, true) || false; } - @computed get _arrowStart() { return this.getField("arrowStart") || ""; } - @computed get _arrowEnd() { return this.getField("arrowEnd") || ""; } - @computed get _dashLine() { return !this._noLine && this.getField("dash") || ""; } + @computed get _solidLine() { return this.inks?.reduce((p, i) => p && i.rootDoc.color && (!i.rootDoc.strokeDash || i.rootDoc.strokeDash === "0") ? true : false, true) || false; } + @computed get _arrowStart() { return this.getField("strokeArrowStart") || ""; } + @computed get _arrowEnd() { return this.getField("strokeArrowEnd") || ""; } + @computed get _dashLine() { return !this._noLine && this.getField("strokeDash") || ""; } @computed get _currSizeHeight() { return this.getField("_height"); } @computed get _currSizeWidth() { return this.getField("_width"); } @computed get _currRotation() { return this.getField("rotation"); } @@ -59,13 +59,13 @@ export default class FormatShapePane extends AntimodeMenu { set _solidFill(value) { this._noFill = !value; } set _currFill(value) { value && (this._lastFill = value); this.inks?.forEach(i => i.rootDoc.fillColor = value ? value : undefined); } set _currColor(value) { value && (this._lastLine = value); this.inks?.forEach(i => i.rootDoc.color = value ? value : undefined); } - set _arrowStart(value) { this.inks?.forEach(i => i.rootDoc.arrowStart = value); } - set _arrowEnd(value) { this.inks?.forEach(i => i.rootDoc.arrowEnd = value); } + set _arrowStart(value) { this.inks?.forEach(i => i.rootDoc.strokeArrowStart = value); } + set _arrowEnd(value) { this.inks?.forEach(i => i.rootDoc.strokeArrowEnd = value); } set _noLine(value) { this._currColor = value ? "" : this._lastLine; } set _solidLine(value) { this._dashLine = ""; this._noLine = !value; } set _dashLine(value) { value && (this._lastDash = value) && (this._noLine = false); - this.inks?.forEach(i => i.rootDoc.dash = value ? this._lastDash : undefined); + this.inks?.forEach(i => i.rootDoc.strokeDash = value ? this._lastDash : undefined); } set _currXpos(value) { this.inks?.forEach(i => i.rootDoc.x = Number(value)); } set _currYpos(value) { this.inks?.forEach(i => i.rootDoc.y = Number(value)); } @@ -192,10 +192,10 @@ export default class FormatShapePane extends AntimodeMenu { @computed get subMenu() { const fillCheck =
- this._noFill = true)} /> + this._noFill = true)} /> No Fill
- this._solidFill = true)} /> + this._solidFill = true)} /> Solid Fill

@@ -214,13 +214,13 @@ export default class FormatShapePane extends AntimodeMenu { ; const lineCheck =
- this._noLine = true)} /> + this._noLine = true)} /> No Line
- this._solidLine = true)} /> + this._solidLine = true)} /> Solid Line
- this._dashLine = "2")} /> + this._dashLine = "2")} /> Dash Line

@@ -230,6 +230,7 @@ export default class FormatShapePane extends AntimodeMenu {
{(this._solidLine || this._dashLine) ? "Width" : ""} {(this._solidLine || this._dashLine) ? this.widthInput : ""} + {(this._solidLine || this._dashLine) ? this._currStrokeWidth = e.target.value} /> : (null)}

{(this._solidLine || this._dashLine) ? arrows : ""} diff --git a/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx b/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx index ddba8a66d..7f0bb5364 100644 --- a/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx +++ b/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx @@ -18,6 +18,7 @@ import { FontAwesomeIcon } from "@fortawesome/react-fontawesome"; import { IconProp, library } from '@fortawesome/fontawesome-svg-core'; import { faBold, faItalic, faChevronLeft, faUnderline, faStrikethrough, faSubscript, faSuperscript, faIndent, faEyeDropper, faCaretDown, faPalette, faArrowsAlt, faHighlighter, faLink, faPaintRoller, faSleigh, faBars, faFillDrip, faBrush, faPenNib, faShapes, faArrowLeft, faEllipsisH, faBezierCurve, } from "@fortawesome/free-solid-svg-icons"; import { Cast, StrCast, BoolCast } from "../../../../fields/Types"; +import FormatShapePane from "./FormatShapePane"; library.add(faBold, faItalic, faChevronLeft, faUnderline, faStrikethrough, faSuperscript, faSubscript, faIndent, faEyeDropper, faCaretDown, faPalette, faArrowsAlt, faHighlighter, faLink, faPaintRoller, faBars, faFillDrip, faBrush, faPenNib, faShapes, faArrowLeft, faEllipsisH, faBezierCurve); @@ -40,7 +41,7 @@ export default class InkOptionsMenu extends AntimodeMenu { private _draw = ["⎯", "→", "↔︎", "∿", "↝", "↭", "ロ", "O", "∆"]; private _head = ["", "", "arrow", "", "", "arrow", "", "", ""]; private _end = ["", "arrow", "arrow", "", "arrow", "arrow", "", "", ""]; - private _shape = ["", "", "", "", "", "", "rectangle", "circle", "triangle"]; + private _shape = ["line", "line", "line", "", "", "", "rectangle", "circle", "triangle"]; @observable _shapesNum = this._shape.length; @observable _selected = this._shapesNum; @@ -127,7 +128,7 @@ export default class InkOptionsMenu extends AntimodeMenu { // doc.strokeBezier === 300 ? doc.strokeBezier = 0 : doc.strokeBezier = 300; break; case "dash": - doc.dash = Number(value); + doc.strokeDash = Number(value); default: break; } @@ -144,7 +145,7 @@ export default class InkOptionsMenu extends AntimodeMenu { @action changeDash = (e: React.PointerEvent): void => { SetActiveDash(ActiveDash() === "0" ? "2" : "0"); - this.editProperties(ActiveDash(), "dash"); + this.editProperties(ActiveDash(), "strokeDash"); } @computed get drawButtons() { @@ -296,6 +297,14 @@ export default class InkOptionsMenu extends AntimodeMenu { } return colorPicker; } + @computed get formatPane() { + return ; + } @computed get fillPicker() { var fillPicker = - ]; // return this.getElement(buttons); diff --git a/src/client/views/nodes/ColorBox.tsx b/src/client/views/nodes/ColorBox.tsx index c35c52644..57028b0ca 100644 --- a/src/client/views/nodes/ColorBox.tsx +++ b/src/client/views/nodes/ColorBox.tsx @@ -14,6 +14,7 @@ import { ViewBoxBaseComponent } from "../DocComponent"; import { ActiveInkPen, ActiveInkWidth, ActiveInkBezierApprox, SetActiveInkColor, SetActiveInkWidth, SetActiveBezierApprox } from "../InkingStroke"; import "./ColorBox.scss"; import { FieldView, FieldViewProps } from './FieldView'; +import { DocumentType } from "../../documents/DocumentTypes"; type ColorDocument = makeInterface<[typeof documentSchema]>; const ColorDocument = makeInterface(documentSchema); @@ -62,9 +63,15 @@ export class ColorBox extends ViewBoxBaseComponent
{ActiveInkWidth() ?? 2}
- ) => SetActiveInkWidth(e.target.value)} /> + ) => { + SetActiveInkWidth(e.target.value); + SelectionManager.SelectedDocuments().filter(i => StrCast(i.rootDoc.type) === DocumentType.INK).map(i => i.rootDoc.strokeWidth = Number(e.target.value)); + }} />
{ActiveInkBezierApprox() ?? 2}
- ) => SetActiveBezierApprox(e.target.value)} /> + ) => { + SetActiveBezierApprox(e.target.value); + SelectionManager.SelectedDocuments().filter(i => StrCast(i.rootDoc.type) === DocumentType.INK).map(i => i.rootDoc.strokeBezier = e.target.value); + }} />

-- cgit v1.2.3-70-g09d2 From add9dfeec764b5a60a57344c79fd23a91c031a2d Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Sun, 12 Jul 2020 10:31:06 -0400 Subject: final cleanup of names and structure of FormatShapePane --- src/client/views/InkingStroke.tsx | 2 +- .../collectionFreeForm/FormatShapePane.scss | 5 + .../collectionFreeForm/FormatShapePane.tsx | 404 +++++++++------------ .../collectionFreeForm/InkOptionsMenu.tsx | 9 +- 4 files changed, 182 insertions(+), 238 deletions(-) (limited to 'src/client/views/collections/collectionFreeForm/FormatShapePane.tsx') diff --git a/src/client/views/InkingStroke.tsx b/src/client/views/InkingStroke.tsx index d7f956e4f..abc698e62 100644 --- a/src/client/views/InkingStroke.tsx +++ b/src/client/views/InkingStroke.tsx @@ -63,7 +63,7 @@ export class InkingStroke extends ViewBoxBaseComponent 5 ? strokeColor : "transparent", strokeWidth, (strokeWidth + 15), diff --git a/src/client/views/collections/collectionFreeForm/FormatShapePane.scss b/src/client/views/collections/collectionFreeForm/FormatShapePane.scss index 7720140b9..88876471c 100644 --- a/src/client/views/collections/collectionFreeForm/FormatShapePane.scss +++ b/src/client/views/collections/collectionFreeForm/FormatShapePane.scss @@ -22,6 +22,11 @@ padding: 0; } +.formatShapePane-inputBtn { + width: inherit; + position: absolute; +} + .sketch-picker { background: #323232; diff --git a/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx b/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx index 77d1b646d..56ba9e96a 100644 --- a/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx +++ b/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx @@ -1,18 +1,16 @@ import React = require("react"); -import AntimodeMenu from "../../AntimodeMenu"; +import { IconProp } from '@fortawesome/fontawesome-svg-core'; +import { FontAwesomeIcon } from "@fortawesome/react-fontawesome"; +import { action, computed, observable } from "mobx"; import { observer } from "mobx-react"; -import { observable, action, computed } from "mobx"; -import "./FormatShapePane.scss"; -import { Scripting } from "../../../util/Scripting"; -import { InkField } from "../../../../fields/InkField"; -import { Doc, Opt, Field } from "../../../../fields/Doc"; -import { SelectionManager } from "../../../util/SelectionManager"; -import { DocumentView } from "../../../views/nodes/DocumentView"; +import { Doc, Field, Opt } from "../../../../fields/Doc"; import { Document } from "../../../../fields/documentSchemas"; +import { InkField } from "../../../../fields/InkField"; +import { BoolCast, Cast, NumCast } from "../../../../fields/Types"; import { DocumentType } from "../../../documents/DocumentTypes"; -import { FontAwesomeIcon } from "@fortawesome/react-fontawesome"; -import { IconProp } from '@fortawesome/fontawesome-svg-core'; -import { Cast, StrCast, BoolCast, NumCast } from "../../../../fields/Types"; +import { SelectionManager } from "../../../util/SelectionManager"; +import AntimodeMenu from "../../AntimodeMenu"; +import "./FormatShapePane.scss"; @observer export default class FormatShapePane extends AntimodeMenu { @@ -23,63 +21,62 @@ export default class FormatShapePane extends AntimodeMenu { private _lastDash = "2"; private _palette = ["#D0021B", "#F5A623", "#F8E71C", "#8B572A", "#7ED321", "#417505", "#9013FE", "#4A90E2", "#50E3C2", "#B8E986", "#000000", "#4A4A4A", "#9B9B9B", "#FFFFFF"]; private _mode = ["fill-drip", "ruler-combined"]; - private _subMenu = ["fill", "line", "size", "position"]; @observable private _subOpen = [false, false, false, false]; - @observable private _currMode: string = "fill-drip"; + @observable private _currMode = "fill-drip"; @observable private _lock = false; @observable private _fillBtn = false; @observable private _lineBtn = false; getField(key: string) { - return this.inks?.reduce((p, i) => + return this.selectedInk?.reduce((p, i) => (p === undefined || (p && p === i.rootDoc[key])) && i.rootDoc[key] !== "0" ? Field.toString(i.rootDoc[key] as Field) : "", undefined as Opt) } - @computed get inks() { + @computed get selectedInk() { const inks = SelectionManager.SelectedDocuments().filter(i => Document(i.rootDoc).type === DocumentType.INK); return inks.length ? inks : undefined; } - @computed get _noFill() { return this.inks?.reduce((p, i) => p && !i.rootDoc.fillColor ? true : false, true) || false; } - @computed get _solidFill() { return this.inks?.reduce((p, i) => p && i.rootDoc.fillColor ? true : false, true) || false; } - @computed get _noLine() { return this.inks?.reduce((p, i) => p && !i.rootDoc.color ? true : false, true) || false; } - @computed get _solidLine() { return this.inks?.reduce((p, i) => p && i.rootDoc.color && (!i.rootDoc.strokeDash || i.rootDoc.strokeDash === "0") ? true : false, true) || false; } - @computed get _arrowStart() { return this.getField("strokeArrowStart") || ""; } - @computed get _arrowEnd() { return this.getField("strokeArrowEnd") || ""; } - @computed get _dashLine() { return !this._noLine && this.getField("strokeDash") || ""; } - @computed get _currSizeHeight() { return this.getField("_height"); } - @computed get _currSizeWidth() { return this.getField("_width"); } - @computed get _currRotation() { return this.getField("rotation"); } - @computed get _currXpos() { return this.getField("x"); } - @computed get _currYpos() { return this.getField("y"); } - @computed get _currStrokeWidth() { return this.getField("strokeWidth"); } - @computed get _currFill() { const cfill = this.getField("fillColor") || ""; cfill && (this._lastFill = cfill); return cfill; } - @computed get _currColor() { const ccol = this.getField("color") || ""; ccol && (this._lastLine = ccol); return ccol; } - set _noFill(value) { this._currFill = value ? "" : this._lastFill; } - set _solidFill(value) { this._noFill = !value; } - set _currFill(value) { value && (this._lastFill = value); this.inks?.forEach(i => i.rootDoc.fillColor = value ? value : undefined); } - set _currColor(value) { value && (this._lastLine = value); this.inks?.forEach(i => i.rootDoc.color = value ? value : undefined); } - set _arrowStart(value) { this.inks?.forEach(i => i.rootDoc.strokeArrowStart = value); } - set _arrowEnd(value) { this.inks?.forEach(i => i.rootDoc.strokeArrowEnd = value); } - set _noLine(value) { this._currColor = value ? "" : this._lastLine; } - set _solidLine(value) { this._dashLine = ""; this._noLine = !value; } - set _dashLine(value) { - value && (this._lastDash = value) && (this._noLine = false); - this.inks?.forEach(i => i.rootDoc.strokeDash = value ? this._lastDash : undefined); + @computed get unFilled() { return this.selectedInk?.reduce((p, i) => p && !i.rootDoc.fillColor ? true : false, true) || false; } + @computed get unStrokd() { return this.selectedInk?.reduce((p, i) => p && !i.rootDoc.color ? true : false, true) || false; } + @computed get solidFil() { return this.selectedInk?.reduce((p, i) => p && i.rootDoc.fillColor ? true : false, true) || false; } + @computed get solidStk() { return this.selectedInk?.reduce((p, i) => p && i.rootDoc.color && (!i.rootDoc.strokeDash || i.rootDoc.strokeDash === "0") ? true : false, true) || false; } + @computed get dashdStk() { return !this.unStrokd && this.getField("strokeDash") || ""; } + @computed get colorFil() { const ccol = this.getField("fillColor") || ""; ccol && (this._lastFill = ccol); return ccol; } + @computed get colorStk() { const ccol = this.getField("color") || ""; ccol && (this._lastLine = ccol); return ccol; } + @computed get widthStk() { return this.getField("strokeWidth") || "1"; } + @computed get markHead() { return this.getField("strokeStartMarker") || ""; } + @computed get markTail() { return this.getField("strokeEndMarker") || ""; } + @computed get shapeHgt() { return this.getField("_height"); } + @computed get shapeWid() { return this.getField("_width"); } + @computed get shapeXps() { return this.getField("x"); } + @computed get shapeYps() { return this.getField("y"); } + @computed get shapeRot() { return this.getField("rotation"); } + set unFilled(value) { this.colorFil = value ? "" : this._lastFill; } + set solidFil(value) { this.unFilled = !value; } + set colorFil(value) { value && (this._lastFill = value); this.selectedInk?.forEach(i => i.rootDoc.fillColor = value ? value : undefined); } + set colorStk(value) { value && (this._lastLine = value); this.selectedInk?.forEach(i => i.rootDoc.color = value ? value : undefined); } + set markHead(value) { this.selectedInk?.forEach(i => i.rootDoc.strokeStartMarker = value); } + set markTail(value) { this.selectedInk?.forEach(i => i.rootDoc.strokeEndMarker = value); } + set unStrokd(value) { this.colorStk = value ? "" : this._lastLine; } + set solidStk(value) { this.dashdStk = ""; this.unStrokd = !value; } + set dashdStk(value) { + value && (this._lastDash = value) && (this.unStrokd = false); + this.selectedInk?.forEach(i => i.rootDoc.strokeDash = value ? this._lastDash : undefined); } - set _currXpos(value) { this.inks?.forEach(i => i.rootDoc.x = Number(value)); } - set _currYpos(value) { this.inks?.forEach(i => i.rootDoc.y = Number(value)); } - set _currRotation(value) { this.inks?.forEach(i => i.rootDoc.rotation = Number(value)); } - set _currStrokeWidth(value) { this.inks?.forEach(i => i.rootDoc.strokeWidth = Number(value)); } - set _currSizeWidth(value) { - this.inks?.filter(i => i.rootDoc._width && i.rootDoc._height).forEach(i => { + set shapeXps(value) { this.selectedInk?.forEach(i => i.rootDoc.x = Number(value)); } + set shapeYps(value) { this.selectedInk?.forEach(i => i.rootDoc.y = Number(value)); } + set shapeRot(value) { this.selectedInk?.forEach(i => i.rootDoc.rotation = Number(value)); } + set widthStk(value) { this.selectedInk?.forEach(i => i.rootDoc.strokeWidth = Number(value)); } + set shapeWid(value) { + this.selectedInk?.filter(i => i.rootDoc._width && i.rootDoc._height).forEach(i => { const oldWidth = NumCast(i.rootDoc._width); i.rootDoc._width = Number(value); this._lock && (i.rootDoc._height = (i.rootDoc._width * NumCast(i.rootDoc._height)) / oldWidth); }); } - set _currSizeHeight(value) { - this.inks?.filter(i => i.rootDoc._width && i.rootDoc._height).forEach(i => { + set shapeHgt(value) { + this.selectedInk?.filter(i => i.rootDoc._width && i.rootDoc._height).forEach(i => { const oldHeight = NumCast(i.rootDoc._height); i.rootDoc._height = Number(value); this._lock && (i.rootDoc._width = (i.rootDoc._height * NumCast(i.rootDoc._width)) / oldHeight); @@ -90,72 +87,41 @@ export default class FormatShapePane extends AntimodeMenu { super(props); FormatShapePane.Instance = this; this._canFade = false; - this.Pinned = BoolCast(Doc.UserDoc()["formatShapePane-pinned"]); + this.Pinned = BoolCast(Doc.UserDoc()["menuFormatShape-pinned"]); } @action closePane = () => { - this.jumpTo(-300, -300); + this.fadeOut(false); this.Pinned = false; } @action upDownButtons = (dirs: string, field: string) => { switch (field) { - case "horizontal": this.inks?.forEach(i => i.rootDoc.x = NumCast(i.rootDoc.x) + (dirs === "up" ? 10 : -10)); break; - case "vertical": this.inks?.forEach(i => i.rootDoc.y = NumCast(i.rootDoc.y) + (dirs === "up" ? 10 : -10)); break; - case "rotation": this.rotate((dirs === "up" ? .1 : -.1)); break; - case "width": this.inks?.forEach(i => i.rootDoc.strokeWidth = NumCast(i.rootDoc.strokeWidth) + (dirs === "up" ? .1 : -.1)); break; - case "sizeWidth": - this.inks?.forEach(i => { - const doc = i.rootDoc; - if (doc._width && doc._height) { - const oldWidth = NumCast(doc._width); - const oldHeight = NumCast(doc._height); - doc._width = NumCast(doc._width) + (dirs === "up" ? 10 : - 10); - if (this._lock) { - doc._height = (NumCast(doc._width) * oldHeight) / oldWidth; - } - } - }); + case "rot": this.rotate((dirs === "up" ? .1 : -.1)); break; + case "Xps": this.selectedInk?.forEach(i => i.rootDoc.x = NumCast(i.rootDoc.x) + (dirs === "up" ? 10 : -10)); break; + case "Yps": this.selectedInk?.forEach(i => i.rootDoc.y = NumCast(i.rootDoc.y) + (dirs === "up" ? 10 : -10)); break; + case "stk": this.selectedInk?.forEach(i => i.rootDoc.strokeWidth = NumCast(i.rootDoc.strokeWidth) + (dirs === "up" ? .1 : -.1)); break; + case "wid": this.selectedInk?.filter(i => i.rootDoc._width && i.rootDoc._height).forEach(i => { + const oldWidth = NumCast(i.rootDoc._width); + i.rootDoc._width = oldWidth + (dirs === "up" ? 10 : - 10); + this._lock && (i.rootDoc._height = (i.rootDoc._width / oldWidth * NumCast(i.rootDoc._height))); + }); break; - case "sizeHeight": - this.inks?.forEach(i => { - const doc = i.rootDoc; - if (doc._width && doc._height) { - const oldWidth = NumCast(doc._width); - const oldHeight = NumCast(doc._height); - doc._height = NumCast(doc._height) + (dirs === "up" ? 10 : - 10); - if (this._lock) { - doc._width = (NumCast(doc._height) * oldWidth) / oldHeight; - } - } - }); + case "hgt": this.selectedInk?.filter(i => i.rootDoc._width && i.rootDoc._height).forEach(i => { + const oldHeight = NumCast(i.rootDoc._height); + i.rootDoc._height = oldHeight + (dirs === "up" ? 10 : - 10); + this._lock && (i.rootDoc._width = (i.rootDoc._height / oldHeight * NumCast(i.rootDoc._width))); + }); break; } } - @computed get close() { - return ; - } - - //select either coor&fill or size&position - @computed get modes() { - return
- {this._mode.map(mode => - )} -
; - } - @action rotate = (degrees: number) => { - SelectionManager.SelectedDocuments().forEach(action((element: DocumentView) => { - const doc = Document(element.rootDoc); + this.selectedInk?.forEach(action(inkView => { + const doc = Document(inkView.rootDoc); if (doc.type === DocumentType.INK && doc.x && doc.y && doc._width && doc._height && doc.data) { const angle = Number(degrees) - Number(doc.rotation); doc.rotation = Number(degrees); @@ -183,117 +149,13 @@ export default class FormatShapePane extends AntimodeMenu { const top2 = Math.min(...ys2); const right2 = Math.max(...xs2); const bottom2 = Math.max(...ys2); - doc._height = (bottom2 - top2) * element.props.ScreenToLocalTransform().Scale; - doc._width = (right2 - left2) * element.props.ScreenToLocalTransform().Scale; + doc._height = (bottom2 - top2) * inkView.props.ScreenToLocalTransform().Scale; + doc._width = (right2 - left2) * inkView.props.ScreenToLocalTransform().Scale; } } })); } - @computed get subMenu() { - const fillCheck =
- this._noFill = true)} /> - No Fill -
- this._solidFill = true)} /> - Solid Fill -
-
- {this._solidFill ? "Color" : ""} - {this._solidFill ? this.fillButton : ""} - {this._fillBtn && this._solidFill ? this.fillPicker : ""} -
; - - const arrows = <> - this._arrowStart = this._arrowStart ? "" : "arrow")} /> - Arrow Head -
- this._arrowEnd = this._arrowEnd ? "" : "arrow")} /> - Arrow End -
- ; - - const lineCheck =
- this._noLine = true)} /> - No Line -
- this._solidLine = true)} /> - Solid Line -
- this._dashLine = "2")} /> - Dash Line -
-
- {(this._solidLine || this._dashLine) ? "Color" : ""} - {(this._solidLine || this._dashLine) ? this.lineButton : ""} - {this._lineBtn && (this._solidLine || this._dashLine) ? this.linePicker : ""} -
- {(this._solidLine || this._dashLine) ? "Width" : ""} - {(this._solidLine || this._dashLine) ? this.widthInput : ""} - {(this._solidLine || this._dashLine) ? this._currStrokeWidth = e.target.value} /> : (null)} -
-
- {(this._solidLine || this._dashLine) ? arrows : ""} -
; - - const sizeCheck =
- Height {this.sizeHeightInput} -
-
- - Width {this.sizeWidthInput} -
-
- - this._lock = !this._lock)} /> - Lock Ratio -
-
- - Rotation {this.rotationInput} -
-
-
; - - const positionCheck =
- Horizontal {this.positionHorizontalInput} -
-
- - Vertical {this.positionVerticalInput} -
-
-
; - - return
- {this._subMenu.map((subMenu, i) => { - if (subMenu === "fill" || subMenu === "line") { - return
- - {this._currMode === "fill-drip" && subMenu === "fill" && this._subOpen[0] ? fillCheck : ""} - {this._currMode === "fill-drip" && subMenu === "line" && this._subOpen[1] ? lineCheck : ""} -
; - } - else if (subMenu === "size" || subMenu === "position") { - return
- - {this._currMode === "ruler-combined" && subMenu === "size" && this._subOpen[2] ? sizeCheck : ""} - {this._currMode === "ruler-combined" && subMenu === "position" && this._subOpen[3] ? positionCheck : ""} -
; - } - })} -
; - } colorPicker(setter: (color: string) => {}) { return
@@ -325,37 +187,119 @@ export default class FormatShapePane extends AntimodeMenu {
-

-

+

; } - @computed get fillButton() { return this.colorButton(this._currFill, () => this._fillBtn = !this._fillBtn); } - @computed get lineButton() { return this.colorButton(this._currColor, () => this._lineBtn = !this._lineBtn); } + @computed get fillButton() { return this.colorButton(this.colorFil, () => this._fillBtn = !this._fillBtn); } + @computed get lineButton() { return this.colorButton(this.colorStk, () => this._lineBtn = !this._lineBtn); } - @computed get fillPicker() { return this.colorPicker((color: string) => this._currFill = color); } - @computed get linePicker() { return this.colorPicker((color: string) => this._currColor = color); } + @computed get fillPicker() { return this.colorPicker((color: string) => this.colorFil = color); } + @computed get linePicker() { return this.colorPicker((color: string) => this.colorStk = color); } - @computed get widthInput() { return this.inputBox("width", this._currStrokeWidth, (val: string) => this._currStrokeWidth = val); } - @computed get sizeHeightInput() { return this.inputBox("height", this._currSizeHeight, (val: string) => this._currSizeHeight = val); } - @computed get sizeWidthInput() { return this.inputBox("height", this._currSizeWidth, (val: string) => this._currSizeWidth = val); } - @computed get rotationInput() { return this.inputBox("rotation", this._currRotation, (val: string) => this._currRotation = val); } - @computed get positionHorizontalInput() { return this.inputBox("horizontal", this._currXpos, (val: string) => this._currXpos = val); } - @computed get positionVerticalInput() { return this.inputBox("vertical", this._currYpos, (val: string) => this._currYpos = val); } + @computed get stkInput() { return this.inputBox("stk", this.widthStk, (val: string) => this.widthStk = val); } + @computed get hgtInput() { return this.inputBox("hgt", this.shapeHgt, (val: string) => this.shapeHgt = val); } + @computed get widInput() { return this.inputBox("wid", this.shapeWid, (val: string) => this.shapeWid = val); } + @computed get rotInput() { return this.inputBox("rot", this.shapeRot, (val: string) => this.shapeRot = val); } + @computed get XpsInput() { return this.inputBox("Xps", this.shapeXps, (val: string) => this.shapeXps = val); } + @computed get YpsInput() { return this.inputBox("Yps", this.shapeYps, (val: string) => this.shapeYps = val); } - render() { - return this.getElementVert([this.close, this.modes, this.subMenu]); + @computed get propertyGroupItems() { + const fillCheck =
+ this.unFilled = true)} /> + No Fill +
+ this.solidFil = true)} /> + Solid Fill +

+ {this.solidFil ? "Color" : ""} + {this.solidFil ? this.fillButton : ""} + {this._fillBtn && this.solidFil ? this.fillPicker : ""} +
; + + const markers = <> + this.markHead = this.markHead ? "" : "arrow")} /> + Arrow Head +
+ this.markTail = this.markTail ? "" : "arrow")} /> + Arrow End +
+ ; + + const lineCheck =
+ this.unStrokd = true)} /> + No Line +
+ this.solidStk = true)} /> + Solid Line +
+ this.dashdStk = "2")} /> + Dash Line +
+
+ {(this.solidStk || this.dashdStk) ? "Color" : ""} + {(this.solidStk || this.dashdStk) ? this.lineButton : ""} + {(this.solidStk || this.dashdStk) && this._lineBtn ? this.linePicker : ""} +
+ {(this.solidStk || this.dashdStk) ? "Width" : ""} + {(this.solidStk || this.dashdStk) ? this.stkInput : ""} + {(this.solidStk || this.dashdStk) ? this.widthStk = e.target.value} /> : (null)} +

+ {(this.solidStk || this.dashdStk) ? markers : ""} +
; + + const sizeCheck =
+ Height {this.hgtInput} +

+ Width {this.widInput} +

+ this._lock = !this._lock)} /> + Lock Ratio +

+ Rotation {this.rotInput} +

+
; + + const positionCheck =
+ Horizontal {this.XpsInput} +

+ Vertical {this.YpsInput} +

+
; + + const subMenus = this._currMode === "fill-drip" ? [`fill`, `line`] : [`size`, `position`]; + const menuItems = this._currMode === "fill-drip" ? [fillCheck, lineCheck] : [sizeCheck, positionCheck]; + const indexOffset = this._currMode === "fill-drip" ? 0 : 2; + return
+ {subMenus.map((subMenu, i) => +
+ + {menuItems[i]} +
)} +
; + } + + @computed get closeBtn() { + return ; + } + + @computed get propertyGroupBtn() { + return
+ {this._mode.map(mode => + )} +
; } -} -Scripting.addGlobal(function activatePen2(penBtn: any) { - if (penBtn) { - //no longer changes to inkmode - // Doc.SetSelectedTool(InkTool.Pen); - FormatShapePane.Instance.jumpTo(300, 300); - FormatShapePane.Instance.Pinned = true; - } else { - // Doc.SetSelectedTool(InkTool.None); - FormatShapePane.Instance.Pinned = false; - FormatShapePane.Instance.fadeOut(true); + + render() { + return this.getElementVert([this.closeBtn, this.propertyGroupBtn, this.propertyGroupItems]); } -}); \ No newline at end of file +} \ No newline at end of file diff --git a/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx b/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx index 7f0bb5364..15707ad9e 100644 --- a/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx +++ b/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx @@ -62,13 +62,13 @@ export default class InkOptionsMenu extends AntimodeMenu { super(props); InkOptionsMenu.Instance = this; this._canFade = false; // don't let the inking menu fade away - this.Pinned = BoolCast(Doc.UserDoc()["inkOptionsMenu-pinned"]); + this.Pinned = BoolCast(Doc.UserDoc()["menuInkOptions-pinned"]); } @action toggleMenuPin = (e: React.MouseEvent) => { - Doc.UserDoc()["inkOptionsMenu-pinned"] = this.Pinned = !this.Pinned; + Doc.UserDoc()["menuInkOptions-pinned"] = this.Pinned = !this.Pinned; if (!this.Pinned) { // this.fadeOut(true); } @@ -426,15 +426,10 @@ export default class InkOptionsMenu extends AntimodeMenu { } Scripting.addGlobal(function activatePen(penBtn: any) { if (penBtn) { - //no longer changes to inkmode - // Doc.SetSelectedTool(InkTool.Pen); InkOptionsMenu.Instance.jumpTo(300, 300); InkOptionsMenu.Instance.Pinned = true; - } else { - // Doc.SetSelectedTool(InkTool.None); InkOptionsMenu.Instance.Pinned = false; InkOptionsMenu.Instance.fadeOut(true); - } }); -- cgit v1.2.3-70-g09d2 From 0e2a5196b47c05eab74d0aae06c2db4a9528f0fb Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Mon, 13 Jul 2020 20:44:03 -0400 Subject: switched context menus to be less hierarchical. --- src/client/util/CurrentUserUtils.ts | 2 - src/client/util/SettingsManager.scss | 2 +- src/client/util/SettingsManager.tsx | 14 ++++++- src/client/views/ContextMenuItem.tsx | 6 +++ .../views/collections/CollectionCarousel3DView.tsx | 13 +----- .../views/collections/CollectionCarouselView.tsx | 14 +------ .../views/collections/CollectionTreeView.tsx | 2 +- src/client/views/collections/CollectionView.tsx | 6 +-- .../collectionFreeForm/FormatShapePane.tsx | 26 ++++++------ .../collectionGrid/CollectionGridView.tsx | 5 +-- src/client/views/nodes/DocumentView.tsx | 38 ++++++++--------- src/client/views/nodes/ImageBox.tsx | 48 +++++++++++----------- src/client/views/nodes/LabelBox.tsx | 2 +- .../views/nodes/formattedText/FormattedTextBox.tsx | 48 +++++++++++----------- 14 files changed, 111 insertions(+), 115 deletions(-) (limited to 'src/client/views/collections/collectionFreeForm/FormatShapePane.tsx') diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts index 39781a5ce..048ab9edc 100644 --- a/src/client/util/CurrentUserUtils.ts +++ b/src/client/util/CurrentUserUtils.ts @@ -423,8 +423,6 @@ export class CurrentUserUtils { // { title: "use drag", icon: "mouse-pointer", click: 'deactivateInk();this.activeInkPen = this;', ischecked: `sameDocs(this.activeInkPen, this)`, backgroundColor: "white", activeInkPen: doc }, { title: "Drag a document previewer", label: "Prev", icon: "expand", click: 'openOnRight(getCopy(this.dragFactory, true))', drag: 'getCopy(this.dragFactory,true)', dragFactory: doc.emptyDocHolder as Doc }, { title: "Toggle a Calculator REPL", label: "repl", icon: "calculator", click: 'addOverlayWindow("ScriptingRepl", { x: 300, y: 100, width: 200, height: 200, title: "Scripting REPL" })' }, - { title: "Connect a Google Account", label: "Google Account", icon: "external-link-alt", click: 'GoogleAuthenticationManager.Instance.fetchOrGenerateAccessToken(true)' }, - { title: "Connect a Hypothesis Account", label: "Hypothesis Account", icon: "heading", click: 'HypothesisAuthenticationManager.Instance.fetchOrGenerateAccessToken(true)' }, ]; } diff --git a/src/client/util/SettingsManager.scss b/src/client/util/SettingsManager.scss index 13c65042c..6d394a38d 100644 --- a/src/client/util/SettingsManager.scss +++ b/src/client/util/SettingsManager.scss @@ -56,7 +56,7 @@ .settings-type { display: flex; flex-direction: column; - flex-basis: 30%; + flex-basis: 45%; } diff --git a/src/client/util/SettingsManager.tsx b/src/client/util/SettingsManager.tsx index 9888cce48..f7ca3942b 100644 --- a/src/client/util/SettingsManager.tsx +++ b/src/client/util/SettingsManager.tsx @@ -11,6 +11,8 @@ import { Networking } from "../Network"; import { CurrentUserUtils } from "./CurrentUserUtils"; import { Utils } from "../../Utils"; import { Doc } from "../../fields/Doc"; +import HypothesisAuthenticationManager from "../apis/HypothesisAuthenticationManager"; +import GoogleAuthenticationManager from "../apis/GoogleAuthenticationManager"; library.add(fa.faWindowClose); @@ -83,6 +85,14 @@ export default class SettingsManager extends React.Component<{}> { noviceToggle = (event: any) => { Doc.UserDoc().noviceMode = !Doc.UserDoc().noviceMode; } + @action + googleAuthorize = (event: any) => { + GoogleAuthenticationManager.Instance.fetchOrGenerateAccessToken(true) + } + @action + hypothesisAuthorize = (event: any) => { + HypothesisAuthenticationManager.Instance.fetchAccessToken(true) + } private get settingsInterface() { return ( @@ -96,7 +106,9 @@ export default class SettingsManager extends React.Component<{}> {
- + + + diff --git a/src/client/views/ContextMenuItem.tsx b/src/client/views/ContextMenuItem.tsx index 99840047f..68ebd8e14 100644 --- a/src/client/views/ContextMenuItem.tsx +++ b/src/client/views/ContextMenuItem.tsx @@ -19,6 +19,7 @@ export interface OriginalMenuProps { export interface SubmenuProps { description: string; subitems: ContextMenuProps[]; + noexpand?: boolean; icon: IconProp; //maybe should be optional (icon?) closeMenu?: () => void; } @@ -96,6 +97,11 @@ export class ContextMenuItem extends React.Component {this._items.map(prop => )}
; + if (!("noexpand" in this.props)) { + return <> + {this._items.map(prop => )} + ; + } return (
diff --git a/src/client/views/collections/CollectionCarousel3DView.tsx b/src/client/views/collections/CollectionCarousel3DView.tsx index 1344b70f4..8f1cd5311 100644 --- a/src/client/views/collections/CollectionCarousel3DView.tsx +++ b/src/client/views/collections/CollectionCarousel3DView.tsx @@ -108,17 +108,6 @@ export class CollectionCarousel3DView extends CollectionSubView(Carousel3DDocume }, 1500); } - onContextMenu = (e: React.MouseEvent): void => { - // need to test if propagation has stopped because GoldenLayout forces a parallel react hierarchy to be created for its top-level layout - if (!e.isPropagationStopped()) { - ContextMenu.Instance.addItem({ - description: "Make Hero Image", event: () => { - const index = NumCast(this.layoutDoc._itemIndex); - (this.dataDoc || Doc.GetProto(this.props.Document)).hero = ObjectField.MakeCopy(this.childLayoutPairs[index].layout.data as ObjectField); - }, icon: "plus" - }); - } - } _downX = 0; _downY = 0; onPointerDown = (e: React.PointerEvent) => { @@ -184,7 +173,7 @@ export class CollectionCarousel3DView extends CollectionSubView(Carousel3DDocume const index = NumCast(this.layoutDoc._itemIndex); const translateX = (1 - index) / this.childLayoutPairs.length * 100; - return
+ return
{this.content}
diff --git a/src/client/views/collections/CollectionCarouselView.tsx b/src/client/views/collections/CollectionCarouselView.tsx index bd0e4fc9a..b3fecfb91 100644 --- a/src/client/views/collections/CollectionCarouselView.tsx +++ b/src/client/views/collections/CollectionCarouselView.tsx @@ -83,18 +83,6 @@ export class CollectionCarouselView extends CollectionSubView(CarouselDocument) ; } - - onContextMenu = (e: React.MouseEvent): void => { - // need to test if propagation has stopped because GoldenLayout forces a parallel react hierarchy to be created for its top-level layout - if (!e.isPropagationStopped()) { - ContextMenu.Instance?.addItem({ - description: "Make Hero Image", event: () => { - const index = NumCast(this.layoutDoc._itemIndex); - (this.dataDoc || Doc.GetProto(this.props.Document)).hero = ObjectField.MakeCopy(this.childLayoutPairs[index].layout.data as ObjectField); - }, icon: "plus" - }); - } - } _downX = 0; _downY = 0; onPointerDown = (e: React.PointerEvent) => { @@ -119,7 +107,7 @@ export class CollectionCarouselView extends CollectionSubView(CarouselDocument) } render() { - return
+ return
{this.content} {this.props.Document._chromeStatus !== "replaced" ? this.buttons : (null)}
; diff --git a/src/client/views/collections/CollectionTreeView.tsx b/src/client/views/collections/CollectionTreeView.tsx index 26c41f524..dbd39d8df 100644 --- a/src/client/views/collections/CollectionTreeView.tsx +++ b/src/client/views/collections/CollectionTreeView.tsx @@ -780,7 +780,7 @@ export class CollectionTreeView extends CollectionSubView UndoManager.RunInBatch(() => DocUtils.makeCustomViewClicked(this.doc, undefined, "onCheckedClick"), "edit onCheckedClick"), icon: "edit" }); - !existingOnClick && ContextMenu.Instance.addItem({ description: "OnClick...", subitems: onClicks, icon: "hand-point-right" }); + !existingOnClick && ContextMenu.Instance.addItem({ description: "OnClick...", noexpand: true, subitems: onClicks, icon: "hand-point-right" }); } outerXf = () => Utils.GetScreenTransform(this._mainEle!); onTreeDrop = (e: React.DragEvent) => this.onExternalDrop(e, {}); diff --git a/src/client/views/collections/CollectionView.tsx b/src/client/views/collections/CollectionView.tsx index df21d6a28..cbd1ac9af 100644 --- a/src/client/views/collections/CollectionView.tsx +++ b/src/client/views/collections/CollectionView.tsx @@ -272,7 +272,7 @@ export class CollectionView extends Touchable this._isLightboxOpen = true), icon: "eye" }); - !existingVm && ContextMenu.Instance.addItem({ description: category, subitems: subItems, icon: "eye" }); + !existingVm && ContextMenu.Instance.addItem({ description: category, noexpand: true, subitems: subItems, icon: "eye" }); } onContextMenu = (e: React.MouseEvent): void => { @@ -294,7 +294,7 @@ export class CollectionView extends Touchable this.props.addDocTab(this.props.Document.childClickedOpenTemplateView as Doc, "onRight"), icon: "project-diagram" }); } - layoutItems.push({ description: `${this.props.Document.isInPlaceContainer ? "Unset" : "Set"} inPlace Container`, event: () => this.props.Document.isInPlaceContainer = !this.props.Document.isInPlaceContainer, icon: "project-diagram" }); + !Doc.UserDoc().noviceMode && layoutItems.push({ description: `${this.props.Document.isInPlaceContainer ? "Unset" : "Set"} inPlace Container`, event: () => this.props.Document.isInPlaceContainer = !this.props.Document.isInPlaceContainer, icon: "project-diagram" }); !existing && cm.addItem({ description: "Options...", subitems: layoutItems, icon: "hand-point-right" }); @@ -314,7 +314,7 @@ export class CollectionView extends Touchable this.props.Document[StrCast(childClick.targetScriptKey)] = ObjectField.MakeCopy(ScriptCast(childClick.data)), })); - !existingOnClick && cm.addItem({ description: "OnClick...", subitems: onClicks, icon: "hand-point-right" }); + !existingOnClick && cm.addItem({ description: "OnClick...", noexpand: true, subitems: onClicks, icon: "hand-point-right" }); if (!Doc.UserDoc().noviceMode) { const more = cm.findByDescription("More..."); diff --git a/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx b/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx index 56ba9e96a..9d9ce7f36 100644 --- a/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx +++ b/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx @@ -11,6 +11,7 @@ import { DocumentType } from "../../../documents/DocumentTypes"; import { SelectionManager } from "../../../util/SelectionManager"; import AntimodeMenu from "../../AntimodeMenu"; import "./FormatShapePane.scss"; +import { undoBatch } from "../../../util/UndoManager"; @observer export default class FormatShapePane extends AntimodeMenu { @@ -118,6 +119,7 @@ export default class FormatShapePane extends AntimodeMenu { } } + @undoBatch @action rotate = (degrees: number) => { this.selectedInk?.forEach(action(inkView => { @@ -160,7 +162,7 @@ export default class FormatShapePane extends AntimodeMenu { colorPicker(setter: (color: string) => {}) { return
{this._palette.map(color => - )}
; @@ -171,11 +173,11 @@ export default class FormatShapePane extends AntimodeMenu { type="text" value={value} onChange={e => setter(e.target.value)} autoFocus /> -
- ; @@ -183,7 +185,7 @@ export default class FormatShapePane extends AntimodeMenu { colorButton(value: string, setter: () => {}) { return <> - @@ -206,10 +208,10 @@ export default class FormatShapePane extends AntimodeMenu { @computed get propertyGroupItems() { const fillCheck =
- this.unFilled = true)} /> + this.unFilled = true))} /> No Fill
- this.solidFil = true)} /> + this.solidFil = true))} /> Solid Fill

{this.solidFil ? "Color" : ""} @@ -218,22 +220,22 @@ export default class FormatShapePane extends AntimodeMenu {
; const markers = <> - this.markHead = this.markHead ? "" : "arrow")} /> + this.markHead = this.markHead ? "" : "arrow"))} /> Arrow Head
- this.markTail = this.markTail ? "" : "arrow")} /> + this.markTail = this.markTail ? "" : "arrow"))} /> Arrow End
; const lineCheck =
- this.unStrokd = true)} /> + this.unStrokd = true))} /> No Line
- this.solidStk = true)} /> + this.solidStk = true))} /> Solid Line
- this.dashdStk = "2")} /> + this.dashdStk = "2"))} /> Dash Line

@@ -253,7 +255,7 @@ export default class FormatShapePane extends AntimodeMenu {

Width {this.widInput}

- this._lock = !this._lock)} /> + this._lock = !this._lock))} /> Lock Ratio

Rotation {this.rotInput} diff --git a/src/client/views/collections/collectionGrid/CollectionGridView.tsx b/src/client/views/collections/collectionGrid/CollectionGridView.tsx index 2015ca930..188b88c41 100644 --- a/src/client/views/collections/collectionGrid/CollectionGridView.tsx +++ b/src/client/views/collections/collectionGrid/CollectionGridView.tsx @@ -1,7 +1,7 @@ import { action, computed, Lambda, observable, reaction } from 'mobx'; import { observer } from 'mobx-react'; import * as React from "react"; -import { Doc, Opt } from '../../../../fields/Doc'; +import { Doc, Opt, WidthSym } from '../../../../fields/Doc'; import { documentSchema } from '../../../../fields/documentSchemas'; import { Id } from '../../../../fields/FieldSymbols'; import { makeInterface } from '../../../../fields/Schema'; @@ -248,8 +248,7 @@ export class CollectionGridView extends CollectionSubView(GridSchema) { */ onContextMenu = () => { const displayOptionsMenu: ContextMenuProps[] = []; - displayOptionsMenu.push({ description: "Contents", event: () => this.props.Document.display = "contents", icon: "copy" }); - displayOptionsMenu.push({ description: "Undefined", event: () => this.props.Document.display = undefined, icon: "exclamation" }); + displayOptionsMenu.push({ description: "Toggle Content Display Style", event: () => this.props.Document.display = this.props.Document.display ? undefined : "contents", icon: "copy" }); ContextMenu.Instance.addItem({ description: "Display", subitems: displayOptionsMenu, icon: "tv" }); } diff --git a/src/client/views/nodes/DocumentView.tsx b/src/client/views/nodes/DocumentView.tsx index 6ef976ceb..a586e81d8 100644 --- a/src/client/views/nodes/DocumentView.tsx +++ b/src/client/views/nodes/DocumentView.tsx @@ -770,6 +770,7 @@ export class DocumentView extends DocComponent(Docu const options = cm.findByDescription("Options..."); const optionItems: ContextMenuProps[] = options && "subitems" in options ? options.subitems : []; const templateDoc = Cast(this.props.Document[StrCast(this.props.Document.layoutKey)], Doc, null); + optionItems.push({ description: this.Document.lockedPosition ? "Unlock Position" : "Lock Position", event: this.toggleLockPosition, icon: BoolCast(this.Document.lockedPosition) ? "unlock" : "lock" }); templateDoc && optionItems.push({ description: "Open Template ", event: () => this.props.addDocTab(templateDoc, "onRight"), icon: "eye" }); !options && cm.addItem({ description: "Options...", subitems: optionItems, icon: "compass" }); @@ -783,14 +784,14 @@ export class DocumentView extends DocComponent(Docu onClicks.push({ description: this.Document.isLinkButton ? "Remove Follow Behavior" : "Follow Link on Right", event: this.toggleFollowOnRight, icon: "concierge-bell" }); onClicks.push({ description: this.Document.isLinkButton || this.onClickHandler ? "Remove Click Behavior" : "Follow Link", event: this.toggleLinkButtonBehavior, icon: "concierge-bell" }); onClicks.push({ description: "Edit onClick Script", event: () => UndoManager.RunInBatch(() => DocUtils.makeCustomViewClicked(this.props.Document, undefined, "onClick"), "edit onClick"), icon: "edit" }); - !existingOnClick && cm.addItem({ description: "OnClick...", subitems: onClicks, icon: "hand-point-right" }); + !existingOnClick && cm.addItem({ description: "OnClick...", noexpand: true, subitems: onClicks, icon: "hand-point-right" }); const funcs: ContextMenuProps[] = []; if (this.layoutDoc.onDragStart) { funcs.push({ description: "Drag an Alias", icon: "edit", event: () => this.Document.dragFactory && (this.layoutDoc.onDragStart = ScriptField.MakeFunction('getAlias(this.dragFactory)')) }); funcs.push({ description: "Drag a Copy", icon: "edit", event: () => this.Document.dragFactory && (this.layoutDoc.onDragStart = ScriptField.MakeFunction('getCopy(this.dragFactory, true)')) }); funcs.push({ description: "Drag Document", icon: "edit", event: () => this.layoutDoc.onDragStart = undefined }); - cm.addItem({ description: "OnDrag...", subitems: funcs, icon: "asterisk" }); + cm.addItem({ description: "OnDrag...", noexpand: true, subitems: funcs, icon: "asterisk" }); } const more = cm.findByDescription("More..."); @@ -817,29 +818,28 @@ export class DocumentView extends DocComponent(Docu // a.download = `DocExport-${this.props.Document[Id]}.zip`; // a.click(); }); + moreItems.push({ description: "Copy ID", event: () => Utils.CopyText(Utils.prepend("/doc/" + this.props.Document[Id])), icon: "fingerprint" }); } - moreItems.push({ description: this.Document.lockedPosition ? "Unlock Position" : "Lock Position", event: this.toggleLockPosition, icon: BoolCast(this.Document.lockedPosition) ? "unlock" : "lock" }); - moreItems.push({ description: "Copy ID", event: () => Utils.CopyText(Utils.prepend("/doc/" + this.props.Document[Id])), icon: "fingerprint" }); moreItems.push({ description: "Delete", event: this.deleteClicked, icon: "trash" }); moreItems.push({ description: "Share", event: () => SharingManager.Instance.open(this), icon: "external-link-alt" }); !more && cm.addItem({ description: "More...", subitems: moreItems, icon: "hand-point-right" }); cm.moveAfter(cm.findByDescription("More...")!, cm.findByDescription("OnClick...")!); - const help = cm.findByDescription("Help..."); - const helpItems: ContextMenuProps[] = help && "subitems" in help ? help.subitems : []; - helpItems.push({ description: "Text Shortcuts Ctrl+/", event: () => this.props.addDocTab(Docs.Create.PdfDocument(Utils.prepend("/assets/cheat-sheet.pdf"), { _width: 300, _height: 300 }), "onRight"), icon: "keyboard" }); - helpItems.push({ description: "Show Fields ", event: () => this.props.addDocTab(Docs.Create.KVPDocument(this.props.Document, { _width: 300, _height: 300 }), "onRight"), icon: "layer-group" }); - cm.addItem({ description: "Help...", subitems: helpItems, icon: "question" }); - - const existingAcls = cm.findByDescription("Privacy..."); - const aclItems: ContextMenuProps[] = existingAcls && "subitems" in existingAcls ? existingAcls.subitems : []; - aclItems.push({ description: "Make Add Only", event: () => this.setAcl("addOnly"), icon: "concierge-bell" }); - aclItems.push({ description: "Make Read Only", event: () => this.setAcl("readOnly"), icon: "concierge-bell" }); - aclItems.push({ description: "Make Private", event: () => this.setAcl("ownerOnly"), icon: "concierge-bell" }); - aclItems.push({ description: "Make Editable", event: () => this.setAcl("write"), icon: "concierge-bell" }); - aclItems.push({ description: "Test Private", event: () => this.testAcl("ownerOnly"), icon: "concierge-bell" }); - aclItems.push({ description: "Test Readonly", event: () => this.testAcl("readOnly"), icon: "concierge-bell" }); - !existingAcls && cm.addItem({ description: "Privacy...", subitems: aclItems, icon: "question" }); + // const help = cm.findByDescription("Help..."); + // const helpItems: ContextMenuProps[] = help && "subitems" in help ? help.subitems : []; + // helpItems.push({ description: "Text Shortcuts Ctrl+/", event: () => this.props.addDocTab(Docs.Create.PdfDocument(Utils.prepend("/assets/cheat-sheet.pdf"), { _width: 300, _height: 300 }), "onRight"), icon: "keyboard" }); + // helpItems.push({ description: "Show Fields ", event: () => this.props.addDocTab(Docs.Create.KVPDocument(this.props.Document, { _width: 300, _height: 300 }), "onRight"), icon: "layer-group" }); + // cm.addItem({ description: "Help...", subitems: helpItems, icon: "question" }); + + // const existingAcls = cm.findByDescription("Privacy..."); + // const aclItems: ContextMenuProps[] = existingAcls && "subitems" in existingAcls ? existingAcls.subitems : []; + // aclItems.push({ description: "Make Add Only", event: () => this.setAcl("addOnly"), icon: "concierge-bell" }); + // aclItems.push({ description: "Make Read Only", event: () => this.setAcl("readOnly"), icon: "concierge-bell" }); + // aclItems.push({ description: "Make Private", event: () => this.setAcl("ownerOnly"), icon: "concierge-bell" }); + // aclItems.push({ description: "Make Editable", event: () => this.setAcl("write"), icon: "concierge-bell" }); + // aclItems.push({ description: "Test Private", event: () => this.testAcl("ownerOnly"), icon: "concierge-bell" }); + // aclItems.push({ description: "Test Readonly", event: () => this.testAcl("readOnly"), icon: "concierge-bell" }); + // !existingAcls && cm.addItem({ description: "Privacy...", subitems: aclItems, icon: "question" }); // const recommender_subitems: ContextMenuProps[] = []; diff --git a/src/client/views/nodes/ImageBox.tsx b/src/client/views/nodes/ImageBox.tsx index d16aa528c..4eba21eab 100644 --- a/src/client/views/nodes/ImageBox.tsx +++ b/src/client/views/nodes/ImageBox.tsx @@ -157,29 +157,31 @@ export class ImageBox extends ViewBoxAnnotatableComponent GooglePhotos.Transactions.UploadImages([this.props.Document]), icon: "caret-square-right" }); - funcs.push({ description: "Copy path", event: () => Utils.CopyText(field.url.href), icon: "expand-arrows-alt" }); - // funcs.push({ - // description: "Reset Native Dimensions", event: action(async () => { - // const curNW = NumCast(this.dataDoc[this.fieldKey + "-nativeWidth"]); - // const curNH = NumCast(this.dataDoc[this.fieldKey + "-nativeHeight"]); - // if (this.props.PanelWidth() / this.props.PanelHeight() > curNW / curNH) { - // this.dataDoc[this.fieldKey + "-nativeWidth"] = this.props.PanelHeight() * curNW / curNH; - // this.dataDoc[this.fieldKey + "-nativeHeight"] = this.props.PanelHeight(); - // } else { - // this.dataDoc[this.fieldKey + "-nativeWidth"] = this.props.PanelWidth(); - // this.dataDoc[this.fieldKey + "-nativeHeight"] = this.props.PanelWidth() * curNH / curNW; - // } - // }), icon: "expand-arrows-alt" - // }); - - const existingAnalyze = ContextMenu.Instance?.findByDescription("Analyzers..."); - const modes: ContextMenuProps[] = existingAnalyze && "subitems" in existingAnalyze ? existingAnalyze.subitems : []; - modes.push({ description: "Generate Tags", event: this.generateMetadata, icon: "tag" }); - modes.push({ description: "Find Faces", event: this.extractFaces, icon: "camera" }); - //modes.push({ description: "Recommend", event: this.extractText, icon: "brain" }); - !existingAnalyze && ContextMenu.Instance?.addItem({ description: "Analyzers...", subitems: modes, icon: "hand-point-right" }); + funcs.push({ description: "Rotate Clockwise 90", event: this.rotate, icon: "expand-arrows-alt" }); + if (!Doc.UserDoc().noviceMode) { + funcs.push({ description: "Export to Google Photos", event: () => GooglePhotos.Transactions.UploadImages([this.props.Document]), icon: "caret-square-right" }); + funcs.push({ description: "Copy path", event: () => Utils.CopyText(field.url.href), icon: "expand-arrows-alt" }); + // funcs.push({ + // description: "Reset Native Dimensions", event: action(async () => { + // const curNW = NumCast(this.dataDoc[this.fieldKey + "-nativeWidth"]); + // const curNH = NumCast(this.dataDoc[this.fieldKey + "-nativeHeight"]); + // if (this.props.PanelWidth() / this.props.PanelHeight() > curNW / curNH) { + // this.dataDoc[this.fieldKey + "-nativeWidth"] = this.props.PanelHeight() * curNW / curNH; + // this.dataDoc[this.fieldKey + "-nativeHeight"] = this.props.PanelHeight(); + // } else { + // this.dataDoc[this.fieldKey + "-nativeWidth"] = this.props.PanelWidth(); + // this.dataDoc[this.fieldKey + "-nativeHeight"] = this.props.PanelWidth() * curNH / curNW; + // } + // }), icon: "expand-arrows-alt" + // }); + + const existingAnalyze = ContextMenu.Instance?.findByDescription("Analyzers..."); + const modes: ContextMenuProps[] = existingAnalyze && "subitems" in existingAnalyze ? existingAnalyze.subitems : []; + modes.push({ description: "Generate Tags", event: this.generateMetadata, icon: "tag" }); + modes.push({ description: "Find Faces", event: this.extractFaces, icon: "camera" }); + //modes.push({ description: "Recommend", event: this.extractText, icon: "brain" }); + !existingAnalyze && ContextMenu.Instance?.addItem({ description: "Analyzers...", subitems: modes, icon: "hand-point-right" }); + } ContextMenu.Instance?.addItem({ description: "Options...", subitems: funcs, icon: "asterisk" }); } diff --git a/src/client/views/nodes/LabelBox.tsx b/src/client/views/nodes/LabelBox.tsx index 836ef4149..0dfbdc5cf 100644 --- a/src/client/views/nodes/LabelBox.tsx +++ b/src/client/views/nodes/LabelBox.tsx @@ -41,7 +41,7 @@ export class LabelBox extends ViewBoxBaseComponent DocUtils.makeCustomViewClicked(this.rootDoc, Docs.Create.FreeformDocument, "freeform"), icon: "eye" }); - appearanceItems.push({ description: "Change Perspective...", subitems: changeItems, icon: "external-link-alt" }); + appearanceItems.push({ description: "Change Perspective...", noexpand: true, subitems: changeItems, icon: "external-link-alt" }); const uicontrols: ContextMenuProps[] = []; uicontrols.push({ description: "Toggle Sidebar", event: () => this.layoutDoc._showSidebar = !this.layoutDoc._showSidebar, icon: "expand-arrows-alt" }); uicontrols.push({ description: "Toggle Dictation Icon", event: () => this.layoutDoc._showAudio = !this.layoutDoc._showAudio, icon: "expand-arrows-alt" }); @@ -489,10 +489,29 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp proto instanceof Doc && (proto.BROADCAST_MESSAGE = Cast(this.rootDoc[this.fieldKey], RichTextField)?.Text)), icon: "expand-arrows-alt" }); - appearanceItems.push({ description: "UI Controls...", subitems: uicontrols, icon: "asterisk" }); + appearanceItems.push({ description: "UI Controls...", noexpand: true, subitems: uicontrols, icon: "asterisk" }); this.rootDoc.isTemplateDoc && appearanceItems.push({ description: "Make Default Layout", event: async () => Doc.UserDoc().defaultTextLayout = new PrefetchProxy(this.rootDoc), icon: "eye" }); Doc.UserDoc().defaultTextLayout && appearanceItems.push({ description: "Reset default note style", event: () => Doc.UserDoc().defaultTextLayout = undefined, icon: "eye" }); - appearanceItems.push({ + + !appearance && ContextMenu.Instance.addItem({ description: "Appearance...", subitems: appearanceItems, icon: "eye" }); + + const funcs: ContextMenuProps[] = []; + + const highlighting: ContextMenuProps[] = []; + ["My Text", "Text from Others", "Todo Items", "Important Items", "Ignore Items", "Disagree Items", "By Recent Minute", "By Recent Hour"].forEach(option => + highlighting.push({ + description: (FormattedTextBox._highlights.indexOf(option) === -1 ? "Highlight " : "Unhighlight ") + option, event: () => { + e.stopPropagation(); + if (FormattedTextBox._highlights.indexOf(option) === -1) { + FormattedTextBox._highlights.push(option); + } else { + FormattedTextBox._highlights.splice(FormattedTextBox._highlights.indexOf(option), 1); + } + this.updateHighlights(); + }, icon: "expand-arrows-alt" + })); + funcs.push({ description: "highlighting...", noexpand: true, subitems: highlighting, icon: "hand-point-right" }); + funcs.push({ description: "Convert to be a template style", event: () => { if (!this.layoutDoc.isTemplateDoc) { const title = StrCast(this.rootDoc.title); @@ -517,29 +536,10 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp Doc.AddDocToList(Cast(Doc.UserDoc()["template-notes"], Doc, null), "data", this.rootDoc); }, icon: "eye" }); - !appearance && ContextMenu.Instance.addItem({ description: "Appearance...", subitems: appearanceItems, icon: "eye" }); + funcs.push({ description: `${this.Document._autoHeight ? "Variable Height" : "Auto Height"}`, event: () => this.layoutDoc._autoHeight = !this.layoutDoc._autoHeight, icon: "plus" }); - const funcs: ContextMenuProps[] = []; - - //funcs.push({ description: `${this.Document._autoHeight ? "Variable Height" : "Auto Height"}`, event: () => this.layoutDoc._autoHeight = !this.layoutDoc._autoHeight, icon: "plus" }); - funcs.push({ description: (!this.layoutDoc._nativeWidth || !this.layoutDoc._nativeHeight ? "Freeze" : "Unfreeze") + " Aspect", event: this.toggleNativeDimensions, icon: "snowflake" }); funcs.push({ description: "Toggle Single Line", event: () => this.layoutDoc._singleLine = !this.layoutDoc._singleLine, icon: "expand-arrows-alt" }); - - const highlighting: ContextMenuProps[] = []; - ["My Text", "Text from Others", "Todo Items", "Important Items", "Ignore Items", "Disagree Items", "By Recent Minute", "By Recent Hour"].forEach(option => - highlighting.push({ - description: (FormattedTextBox._highlights.indexOf(option) === -1 ? "Highlight " : "Unhighlight ") + option, event: () => { - e.stopPropagation(); - if (FormattedTextBox._highlights.indexOf(option) === -1) { - FormattedTextBox._highlights.push(option); - } else { - FormattedTextBox._highlights.splice(FormattedTextBox._highlights.indexOf(option), 1); - } - this.updateHighlights(); - }, icon: "expand-arrows-alt" - })); - funcs.push({ description: "highlighting...", subitems: highlighting, icon: "hand-point-right" }); - + funcs.push({ description: (!this.layoutDoc._nativeWidth || !this.layoutDoc._nativeHeight ? "Freeze" : "Unfreeze") + " Aspect", event: this.toggleNativeDimensions, icon: "snowflake" }); ContextMenu.Instance.addItem({ description: "Options...", subitems: funcs, icon: "asterisk" }); this._downX = this._downY = Number.NaN; } -- cgit v1.2.3-70-g09d2 From 866561aa20aff0f570d31edf64eae36cd2d35279 Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Tue, 14 Jul 2020 17:27:19 -0400 Subject: fixed onClickHandler stuff to use functions properly. fixed several linking to annotations/pushpins problems. --- src/client/documents/Documents.ts | 8 +- src/client/util/DocumentManager.ts | 4 +- src/client/util/LinkManager.ts | 11 ++- src/client/util/SettingsManager.tsx | 4 +- src/client/views/DocumentButtonBar.tsx | 2 +- src/client/views/MetadataEntryMenu.tsx | 96 ++++++---------------- src/client/views/collections/CollectionView.tsx | 7 +- .../collectionFreeForm/CollectionFreeFormView.tsx | 10 +-- .../collectionFreeForm/FormatShapePane.tsx | 2 +- .../collectionFreeForm/InkOptionsMenu.tsx | 2 +- .../collectionGrid/CollectionGridView.tsx | 2 +- .../CollectionMulticolumnView.tsx | 5 +- .../CollectionMultirowView.tsx | 4 +- src/client/views/linking/LinkMenuGroup.tsx | 4 +- src/client/views/linking/LinkMenuItem.tsx | 5 +- src/client/views/nodes/DocumentLinksButton.tsx | 3 - src/client/views/nodes/DocumentView.tsx | 17 ++-- src/client/views/nodes/FieldView.tsx | 2 +- .../views/nodes/formattedText/RichTextMenu.tsx | 2 +- src/fields/documentSchemas.ts | 3 + 20 files changed, 78 insertions(+), 115 deletions(-) (limited to 'src/client/views/collections/collectionFreeForm/FormatShapePane.tsx') diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts index 90cef31d9..1fd533b62 100644 --- a/src/client/documents/Documents.ts +++ b/src/client/documents/Documents.ts @@ -102,6 +102,8 @@ export interface DocumentOptions { childLayoutTemplate?: Doc; // template for collection to use to render its children (see PresBox or Buxton layout in tree view) childLayoutString?: string; // template string for collection to use to render its children hideFilterView?: boolean; // whether to hide the filter popout on collections + hideLinkButton?: boolean; // whether the blue link counter button should be hidden + hideAllLinks?: boolean; // whether all individual blue anchor dots should be hidden _columnsHideIfEmpty?: boolean; // whether stacking view column headings should be hidden isTemplateForField?: string; // the field key for which the containing document is a rendering template isTemplateDoc?: boolean; @@ -137,7 +139,7 @@ export interface DocumentOptions { lookupField?: ScriptField; // script that returns the value of a field. This script is passed the rootDoc, layoutDoc, field, and container of the document. see PresBox. "onDoubleClick-rawScript"?: string; // onDoubleClick script in raw text form "onChildDoubleClick-rawScript"?: string; // onChildDoubleClick script in raw text form - "onChildClick-rawScript"?: string // on ChildClick script in raw text form + "onChildClick-rawScript"?: string; // on ChildClick script in raw text form "onClick-rawScript"?: string; // onClick script in raw text form "onCheckedClick-rawScript"?: string; // onChecked script in raw text form "onCheckedClick-params"?: List; // parameter list for onChecked treeview functions @@ -779,7 +781,7 @@ export namespace Docs { export function FontIconDocument(options?: DocumentOptions) { - return InstanceFromProto(Prototypes.get(DocumentType.FONTICON), undefined, { ...(options || {}) }); + return InstanceFromProto(Prototypes.get(DocumentType.FONTICON), undefined, { hideLinkButton: true, ...(options || {}) }); } export function PresElementBoxDocument(options?: DocumentOptions) { @@ -912,6 +914,8 @@ export namespace DocUtils { if (target.doc === Doc.UserDoc()) return undefined; const linkDoc = Docs.Create.LinkDocument(source, target, { linkRelationship, layoutKey: "layout_linkView", description }, id); + linkDoc.linkDisplay = true; + linkDoc.hideAnhors = true; linkDoc.layout_linkView = Cast(Cast(Doc.UserDoc()["template-button-link"], Doc, null).dragFactory, Doc, null); Doc.GetProto(linkDoc).title = ComputedField.MakeFunction('self.anchor1?.title +" (" + (self.linkRelationship||"to") +") " + self.anchor2?.title'); diff --git a/src/client/util/DocumentManager.ts b/src/client/util/DocumentManager.ts index 1fa5faeb3..b66e7fdc4 100644 --- a/src/client/util/DocumentManager.ts +++ b/src/client/util/DocumentManager.ts @@ -146,7 +146,7 @@ export class DocumentManager { }; const docView = getFirstDocView(targetDoc, originatingDoc); let annotatedDoc = await Cast(targetDoc.annotationOn, Doc); - if (annotatedDoc && !linkDoc?.isPushpin) { + if (annotatedDoc && !targetDoc?.isPushpin) { const first = getFirstDocView(annotatedDoc); if (first) { annotatedDoc = first.props.Document; @@ -156,7 +156,7 @@ export class DocumentManager { } } if (docView) { // we have a docView already and aren't forced to create a new one ... just focus on the document. TODO move into view if necessary otherwise just highlight? - if (linkDoc?.isPushpin) docView.props.Document.hidden = !docView.props.Document.hidden; + if (originatingDoc?.isPushpin) docView.props.Document.hidden = !docView.props.Document.hidden; else { docView.props.Document.hidden && (docView.props.Document.hidden = undefined); docView.props.focus(docView.props.Document, willZoom, undefined, focusAndFinish); diff --git a/src/client/util/LinkManager.ts b/src/client/util/LinkManager.ts index 50f3fc1d6..974744344 100644 --- a/src/client/util/LinkManager.ts +++ b/src/client/util/LinkManager.ts @@ -63,12 +63,17 @@ export class LinkManager { } // finds all links that contain the given anchor - public getAllRelatedLinks(anchor: Doc): Doc[] { + public getAllDirectLinks(anchor: Doc): Doc[] { const related = LinkManager.Instance.getAllLinks().filter(link => { const protomatch1 = Doc.AreProtosEqual(anchor, Cast(link.anchor1, Doc, null)); const protomatch2 = Doc.AreProtosEqual(anchor, Cast(link.anchor2, Doc, null)); return protomatch1 || protomatch2 || Doc.AreProtosEqual(link, anchor); }); + return related; + } + // finds all links that contain the given anchor + public getAllRelatedLinks(anchor: Doc): Doc[] { + const related = LinkManager.Instance.getAllDirectLinks(anchor); DocListCast(anchor[Doc.LayoutFieldKey(anchor) + "-annotations"]).map(anno => { related.push(...LinkManager.Instance.getAllRelatedLinks(anno)); }); @@ -208,4 +213,6 @@ export class LinkManager { } Scripting.addGlobal(function links(doc: any) { return new List(LinkManager.Instance.getAllRelatedLinks(doc)); }, - "creates a link to inputted document", "(doc: any)"); \ No newline at end of file + "returns all the links to the document or its annotations", "(doc: any)"); +Scripting.addGlobal(function directLinks(doc: any) { return new List(LinkManager.Instance.getAllDirectLinks(doc)); }, + "returns all the links directly to the document", "(doc: any)"); \ No newline at end of file diff --git a/src/client/util/SettingsManager.tsx b/src/client/util/SettingsManager.tsx index f7ca3942b..981ee698d 100644 --- a/src/client/util/SettingsManager.tsx +++ b/src/client/util/SettingsManager.tsx @@ -87,11 +87,11 @@ export default class SettingsManager extends React.Component<{}> { } @action googleAuthorize = (event: any) => { - GoogleAuthenticationManager.Instance.fetchOrGenerateAccessToken(true) + GoogleAuthenticationManager.Instance.fetchOrGenerateAccessToken(true); } @action hypothesisAuthorize = (event: any) => { - HypothesisAuthenticationManager.Instance.fetchAccessToken(true) + HypothesisAuthenticationManager.Instance.fetchAccessToken(true); } private get settingsInterface() { diff --git a/src/client/views/DocumentButtonBar.tsx b/src/client/views/DocumentButtonBar.tsx index c188618f4..927c192cd 100644 --- a/src/client/views/DocumentButtonBar.tsx +++ b/src/client/views/DocumentButtonBar.tsx @@ -208,7 +208,7 @@ export class DocumentButtonBar extends React.Component<{ views: () => (DocumentV const view0 = this.view0; return !view0 ? (null) :
this.props.views().filter(dv => dv).map(dv => dv!.props.Document)} suggestWithFunction /> /* tfs: @bcz This might need to be the data document? */}> + content={ dv).map(dv => dv!.props.Document)} suggestWithFunction /> /* tfs: @bcz This might need to be the data document? */}>
e.stopPropagation()} > {}
diff --git a/src/client/views/MetadataEntryMenu.tsx b/src/client/views/MetadataEntryMenu.tsx index b0752ffb2..ca8a6e1d7 100644 --- a/src/client/views/MetadataEntryMenu.tsx +++ b/src/client/views/MetadataEntryMenu.tsx @@ -3,14 +3,14 @@ import "./MetadataEntryMenu.scss"; import { observer } from 'mobx-react'; import { observable, action, runInAction, trace, computed, IReactionDisposer, reaction } from 'mobx'; import { KeyValueBox } from './nodes/KeyValueBox'; -import { Doc, Field, DocListCastAsync } from '../../fields/Doc'; +import { Doc, Field, DocListCastAsync, DocListCast } from '../../fields/Doc'; import * as Autosuggest from 'react-autosuggest'; -import { undoBatch } from '../util/UndoManager'; +import { undoBatch, UndoManager } from '../util/UndoManager'; import { emptyFunction, emptyPath } from '../../Utils'; export type DocLike = Doc | Doc[] | Promise | Promise; export interface MetadataEntryProps { - docs: DocLike | (() => DocLike); + docs: Doc[]; onError?: () => boolean; suggestWithFunction?: boolean; } @@ -39,26 +39,13 @@ export class MetadataEntryMenu extends React.Component{ let onProto: boolean = false; let value: string | undefined = undefined; let docs = this.props.docs; - if (typeof docs === "function") { - if (this.props.suggestWithFunction) { - docs = docs(); - } else { - return; - } - } - docs = await docs; - if (docs instanceof Doc) { - await docs[this._currentKey]; - value = Field.toKeyValueString(docs, this._currentKey); - } else { - for (const doc of docs) { - const v = await doc[this._currentKey]; - onProto = onProto || !Object.keys(doc).includes(this._currentKey); - if (field === null) { - field = v; - } else if (v !== field) { - value = "multiple values"; - } + for (const doc of docs) { + const v = await doc[this._currentKey]; + onProto = onProto || !Object.keys(doc).includes(this._currentKey); + if (field === null) { + field = v; + } else if (v !== field) { + value = "multiple values"; } } if (value === undefined) { @@ -86,27 +73,16 @@ export class MetadataEntryMenu extends React.Component{ const script = KeyValueBox.CompileKVPScript(this._currentValue); if (!script) return; - let doc = this.props.docs; - if (typeof doc === "function") { - doc = doc(); - } - doc = await doc; - - let success: boolean; - if (doc instanceof Doc) { - success = KeyValueBox.ApplyKVPScript(doc, this._currentKey, script); - } else { - let childSuccess = true; - if (this._addChildren) { - for (const document of doc) { - const collectionChildren = await DocListCastAsync(document.data); - if (collectionChildren) { - childSuccess = collectionChildren.every(c => KeyValueBox.ApplyKVPScript(c, this._currentKey, script)); - } + let childSuccess = true; + if (this._addChildren) { + for (const document of this.props.docs) { + const collectionChildren = DocListCast(document.data); + if (collectionChildren) { + childSuccess = collectionChildren.every(c => KeyValueBox.ApplyKVPScript(c, this._currentKey, script)); } } - success = doc.every(d => KeyValueBox.ApplyKVPScript(d, this._currentKey, script)) && childSuccess; } + const success = this.props.docs.every(d => KeyValueBox.ApplyKVPScript(d, this._currentKey, script)) && childSuccess; if (!success) { if (this.props.onError) { if (this.props.onError()) { @@ -132,24 +108,12 @@ export class MetadataEntryMenu extends React.Component{ } } - getKeySuggestions = async (value: string): Promise => { + getKeySuggestions = (value: string) => { value = value.toLowerCase(); let docs = this.props.docs; - if (typeof docs === "function") { - if (this.props.suggestWithFunction) { - docs = docs(); - } else { - return []; - } - } - docs = await docs; - if (docs instanceof Doc) { - return Object.keys(docs).filter(key => key.toLowerCase().startsWith(value)); - } else { - const keys = new Set(); - docs.forEach(doc => Doc.allKeys(doc).forEach(key => keys.add(key))); - return Array.from(keys).filter(key => key.toLowerCase().startsWith(value)); - } + const keys = new Set(); + docs.forEach(doc => Doc.allKeys(doc).forEach(key => keys.add(key))); + return Array.from(keys).filter(key => key.toLowerCase().startsWith(value)); } getSuggestionValue = (suggestion: string) => suggestion; @@ -157,9 +121,8 @@ export class MetadataEntryMenu extends React.Component{ return (null); } componentDidMount() { - this._suggestionDispser = reaction(() => this._currentKey, - () => this.getKeySuggestions(this._currentKey).then(action((s: string[]) => this._allSuggestions = s)), + () => this._allSuggestions = this.getKeySuggestions(this._currentKey), { fireImmediately: true }); } componentWillUnmount() { @@ -171,19 +134,8 @@ export class MetadataEntryMenu extends React.Component{ } private get considerChildOptions() { - let docSource = this.props.docs; - if (typeof docSource === "function") { - docSource = docSource(); - } - docSource = docSource as Doc[] | Doc; - if (docSource instanceof Doc) { - if (docSource._viewType === undefined) { - return (null); - } - } else if (Array.isArray(docSource)) { - if (!docSource.every(doc => doc._viewType !== undefined)) { - return null; - } + if (!this.props.docs.every(doc => doc._viewType !== undefined)) { + return null; } return (
diff --git a/src/client/views/collections/CollectionView.tsx b/src/client/views/collections/CollectionView.tsx index 5165a8f11..6ab4645ea 100644 --- a/src/client/views/collections/CollectionView.tsx +++ b/src/client/views/collections/CollectionView.tsx @@ -140,17 +140,18 @@ export class CollectionView extends Touchable { const context = Cast(doc.context, Doc, null); - if (context && (context.type === DocumentType.VID || context.type === DocumentType.WEB || context.type === DocumentType.PDF || context.type === DocumentType.IMG) && - !DocListCast(doc.links).some(d => d.isPushpin)) { + if (context && (context.type === DocumentType.VID || context.type === DocumentType.WEB || context.type === DocumentType.PDF || context.type === DocumentType.IMG)) { const pushpin = Docs.Create.FontIconDocument({ icon: "map-pin", x: Cast(doc.x, "number", null), y: Cast(doc.y, "number", null), _backgroundColor: "#0000003d", color: "#ACCEF7", _width: 15, _height: 15, _xPadding: 0, isLinkButton: true, displayTimecode: Cast(doc.displayTimecode, "number", null) }); + pushpin.isPushpin = true; + Doc.GetProto(pushpin).annotationOn = doc.annotationOn; + Doc.SetInPlace(doc, "annotationOn", undefined, true); Doc.AddDocToList(context, Doc.LayoutFieldKey(context) + "-annotations", pushpin); const pushpinLink = DocUtils.MakeLink({ doc: pushpin }, { doc: doc }, "pushpin", ""); const first = DocListCast(pushpin.links).find(d => d instanceof Doc); first && (first.hidden = true); - pushpinLink && (Doc.GetProto(pushpinLink).isPushpin = true); doc.displayTimecode = undefined; } doc.context = this.props.Document; diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx index f33b5371f..994f4ce6e 100644 --- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx +++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx @@ -939,9 +939,9 @@ export class CollectionFreeFormView extends CollectionSubView (this.props.childClickScript || ScriptCast(this.Document.onChildClick)); } - @computed get onChildDoubleClickHandler() { return () => (this.props.childDoubleClickScript || ScriptCast(this.Document.onChildDoubleClick)); } @computed get backgroundActive() { return this.layoutDoc.isBackground && (this.props.ContainingCollectionView?.active() || this.props.active()); } + onChildClickHandler = () => this.props.childClickScript || ScriptCast(this.Document.onChildClick); + onChildDoubleClickHandler = () => this.props.childDoubleClickScript || ScriptCast(this.Document.onChildDoubleClick); backgroundHalo = () => BoolCast(this.Document.useClusters); parentActive = (outsideReaction: boolean) => this.props.active(outsideReaction) || this.backgroundActive ? true : false; getChildDocumentViewProps(childLayout: Doc, childData?: Doc): DocumentViewProps { @@ -1186,8 +1186,8 @@ export class CollectionFreeFormView extends CollectionSubView - (p === undefined || (p && p === i.rootDoc[key])) && i.rootDoc[key] !== "0" ? Field.toString(i.rootDoc[key] as Field) : "", undefined as Opt) + (p === undefined || (p && p === i.rootDoc[key])) && i.rootDoc[key] !== "0" ? Field.toString(i.rootDoc[key] as Field) : "", undefined as Opt); } @computed get selectedInk() { diff --git a/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx b/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx index 15707ad9e..5d115df69 100644 --- a/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx +++ b/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx @@ -128,7 +128,7 @@ export default class InkOptionsMenu extends AntimodeMenu { // doc.strokeBezier === 300 ? doc.strokeBezier = 0 : doc.strokeBezier = 300; break; case "dash": - doc.strokeDash = Number(value); + doc.strokeDash = value; default: break; } diff --git a/src/client/views/collections/collectionGrid/CollectionGridView.tsx b/src/client/views/collections/collectionGrid/CollectionGridView.tsx index b2e506dfa..73d0ae374 100644 --- a/src/client/views/collections/collectionGrid/CollectionGridView.tsx +++ b/src/client/views/collections/collectionGrid/CollectionGridView.tsx @@ -31,7 +31,7 @@ export class CollectionGridView extends CollectionSubView(GridSchema) { @observable private _rowHeight: Opt; // temporary store of row height to make change undoable @observable private _scroll: number = 0; // required to make sure the decorations box container updates on scroll - @computed get onChildClickHandler() { return () => ScriptCast(this.Document.onChildClick); } + onChildClickHandler = () => ScriptCast(this.Document.onChildClick); @computed get numCols() { return NumCast(this.props.Document.gridNumCols, 10); } @computed get rowHeight() { return this._rowHeight === undefined ? NumCast(this.props.Document.gridRowHeight, 100) : this._rowHeight; } diff --git a/src/client/views/collections/collectionMulticolumn/CollectionMulticolumnView.tsx b/src/client/views/collections/collectionMulticolumn/CollectionMulticolumnView.tsx index 402e7563d..21d283547 100644 --- a/src/client/views/collections/collectionMulticolumn/CollectionMulticolumnView.tsx +++ b/src/client/views/collections/collectionMulticolumn/CollectionMulticolumnView.tsx @@ -202,9 +202,8 @@ export class CollectionMulticolumnView extends CollectionSubView(MulticolumnDocu } - @computed get onChildClickHandler() { return () => ScriptCast(this.Document.onChildClick); } - @computed get onChildDoubleClickHandler() { return () => ScriptCast(this.Document.onChildDoubleClick); } - + onChildClickHandler = () => ScriptCast(this.Document.onChildClick); + onChildDoubleClickHandler = () => ScriptCast(this.Document.onChildDoubleClick); addDocTab = (doc: Doc, where: string) => { if (where === "inPlace" && this.layoutDoc.isInPlaceContainer) { diff --git a/src/client/views/collections/collectionMulticolumn/CollectionMultirowView.tsx b/src/client/views/collections/collectionMulticolumn/CollectionMultirowView.tsx index e4ef9b436..d02088a6c 100644 --- a/src/client/views/collections/collectionMulticolumn/CollectionMultirowView.tsx +++ b/src/client/views/collections/collectionMulticolumn/CollectionMultirowView.tsx @@ -202,8 +202,8 @@ export class CollectionMultirowView extends CollectionSubView(MultirowDocument) } - @computed get onChildClickHandler() { return () => ScriptCast(this.Document.onChildClick); } - @computed get onChildDoubleClickHandler() { return () => ScriptCast(this.Document.onChildDoubleClick); } + onChildClickHandler = () => ScriptCast(this.Document.onChildClick); + onChildDoubleClickHandler = () => ScriptCast(this.Document.onChildDoubleClick); addDocTab = (doc: Doc, where: string) => { if (where === "inPlace" && this.layoutDoc.isInPlaceContainer) { diff --git a/src/client/views/linking/LinkMenuGroup.tsx b/src/client/views/linking/LinkMenuGroup.tsx index 2f6b75437..2ae87ac13 100644 --- a/src/client/views/linking/LinkMenuGroup.tsx +++ b/src/client/views/linking/LinkMenuGroup.tsx @@ -11,6 +11,7 @@ import { DocumentView } from "../nodes/DocumentView"; import './LinkMenu.scss'; import { LinkMenuItem, StartLinkTargetsDrag } from "./LinkMenuItem"; import React = require("react"); +import { Cast } from "../../../fields/Types"; interface LinkMenuGroupProps { sourceDoc: Doc; @@ -66,7 +67,8 @@ export class LinkMenuGroup extends React.Component { render() { const groupItems = this.props.group.map(linkDoc => { - const destination = LinkManager.Instance.getOppositeAnchor(linkDoc, this.props.sourceDoc); + const destination = LinkManager.Instance.getOppositeAnchor(linkDoc, this.props.sourceDoc) || + LinkManager.Instance.getOppositeAnchor(linkDoc, Cast(linkDoc.anchor2, Doc, null).annotationOn === this.props.sourceDoc ? Cast(linkDoc.anchor2, Doc, null) : Cast(linkDoc.anchor1, Doc, null)); if (destination && this.props.sourceDoc) { return { const eyeIcon = this.props.linkDoc.hidden ? "eye-slash" : "eye"; - let destinationIcon: string = "";; + let destinationIcon: FontAwesomeIconProps["icon"] = "question"; switch (this.props.destinationDoc.type) { case DocumentType.IMG: destinationIcon = "image"; break; case DocumentType.COMPARISON: destinationIcon = "columns"; break; @@ -205,7 +205,6 @@ export class LinkMenuItem extends React.Component { case DocumentType.SCRIPTING: destinationIcon = "terminal"; break; case DocumentType.IMPORT: destinationIcon = "cloud-upload-alt"; break; case DocumentType.DOCHOLDER: destinationIcon = "expand"; break; - default: "question"; } const title = StrCast(this.props.destinationDoc.title).length > 18 ? diff --git a/src/client/views/nodes/DocumentLinksButton.tsx b/src/client/views/nodes/DocumentLinksButton.tsx index 83710cfbf..823e25471 100644 --- a/src/client/views/nodes/DocumentLinksButton.tsx +++ b/src/client/views/nodes/DocumentLinksButton.tsx @@ -101,8 +101,6 @@ export class DocumentLinksButton extends React.Component { if (linkDoc) { @@ -137,7 +135,6 @@ export class DocumentLinksButton extends React.Component { if (linkDoc) { diff --git a/src/client/views/nodes/DocumentView.tsx b/src/client/views/nodes/DocumentView.tsx index 7d9c4da87..a6771443a 100644 --- a/src/client/views/nodes/DocumentView.tsx +++ b/src/client/views/nodes/DocumentView.tsx @@ -128,9 +128,9 @@ export class DocumentView extends DocComponent(Docu @computed get nativeWidth() { return NumCast(this.layoutDoc._nativeWidth, this.props.NativeWidth() || (this.freezeDimensions ? this.layoutDoc[WidthSym]() : 0)); } @computed get nativeHeight() { return NumCast(this.layoutDoc._nativeHeight, this.props.NativeHeight() || (this.freezeDimensions ? this.layoutDoc[HeightSym]() : 0)); } @computed get onClickHandler() { return this.props.onClick?.() ?? Cast(this.Document.onClick, ScriptField, Cast(this.layoutDoc.onClick, ScriptField, null)); } - @computed get onDoubleClickHandler() { return this.props.onDoubleClick?.() || (Cast(this.layoutDoc.onDoubleClick, ScriptField, null) || this.Document.onDoubleClick); } - @computed get onPointerDownHandler() { return this.props.onPointerDown?.() || ScriptCast(this.Document.onPointerDown) } - @computed get onPointerUpHandler() { return this.props.onPointerUp?.() || ScriptCast(this.Document.onPointerUp); } + @computed get onDoubleClickHandler() { return this.props.onDoubleClick?.() ?? (Cast(this.layoutDoc.onDoubleClick, ScriptField, null) ?? this.Document.onDoubleClick); } + @computed get onPointerDownHandler() { return this.props.onPointerDown?.() ?? ScriptCast(this.Document.onPointerDown); } + @computed get onPointerUpHandler() { return this.props.onPointerUp?.() ?? ScriptCast(this.Document.onPointerUp); } NativeWidth = () => this.nativeWidth; NativeHeight = () => this.nativeHeight; onClickFunc = () => this.onClickHandler; @@ -298,7 +298,7 @@ export class DocumentView extends DocComponent(Docu if (this._doubleTap && this.props.renderDepth && !this.onClickHandler?.script) { // disable double-click to show full screen for things that have an on click behavior since clicking them twice can be misinterpreted as a double click if (!(e.nativeEvent as any).formattedHandled) { if (this.onDoubleClickHandler?.script && !StrCast(Doc.LayoutField(this.layoutDoc))?.includes("ScriptingBox")) { // bcz: hack? don't execute script if you're clicking on a scripting box itself - const func = () => this.onDoubleClickHandler?.script.run({ + const func = () => this.onDoubleClickHandler.script.run({ this: this.layoutDoc, self: this.rootDoc, thisContainer: this.props.ContainingCollectionDoc, shiftKey: e.shiftKey @@ -320,7 +320,7 @@ export class DocumentView extends DocComponent(Docu } } else if (this.onClickHandler?.script && !StrCast(Doc.LayoutField(this.layoutDoc))?.includes("ScriptingBox")) { // bcz: hack? don't execute script if you're clicking on a scripting box itself //SelectionManager.DeselectAll(); - const func = () => this.onClickHandler?.script.run({ + const func = () => this.onClickHandler.script.run({ this: this.layoutDoc, self: this.rootDoc, thisContainer: this.props.ContainingCollectionDoc, shiftKey: e.shiftKey @@ -556,7 +556,7 @@ export class DocumentView extends DocComponent(Docu this.cleanUpInteractions(); if (this.onPointerUpHandler?.script && !InteractionUtils.IsType(e, InteractionUtils.PENTYPE)) { - this.onPointerUpHandler?.script.run({ self: this.rootDoc, this: this.layoutDoc }, console.log); + this.onPointerUpHandler.script.run({ self: this.rootDoc, this: this.layoutDoc }, console.log); document.removeEventListener("pointerup", this.onPointerUp); return; } @@ -644,7 +644,6 @@ export class DocumentView extends DocComponent(Docu const makeLink = action((linkDoc: Doc) => { LinkManager.currentLink = linkDoc; linkDoc.hidden = true; - linkDoc.linkDisplay = true; LinkCreatedBox.popupX = de.x; LinkCreatedBox.popupY = de.y - 33; @@ -1076,7 +1075,7 @@ export class DocumentView extends DocComponent(Docu layoutKey={this.finalLayoutKey} /> {this.layoutDoc.hideAllLinks ? (null) : this.allAnchors} {/* {this.allAnchors} */} - {this.props.forcedBackgroundColor?.(this.Document) === "transparent" || this.props.dontRegisterView ? (null) : } + {this.props.forcedBackgroundColor?.(this.Document) === "transparent" || this.layoutDoc.hideLinkButton || this.props.dontRegisterView ? (null) : }
); } @@ -1105,7 +1104,7 @@ export class DocumentView extends DocComponent(Docu return (this.props.treeViewDoc && this.props.LayoutTemplateString) || // render nothing for: tree view anchor dots this.layoutDoc.presBox || // presentationbox nodes this.props.dontRegisterView ? (null) : // view that are not registered - DocUtils.FilterDocs(DocListCast(this.Document.links), this.props.docFilters(), []).filter(d => !d.hidden && this.isNonTemporalLink).map((d, i) => + DocUtils.FilterDocs(LinkManager.Instance.getAllDirectLinks(this.Document), this.props.docFilters(), []).filter(d => !d.hidden && this.isNonTemporalLink).map((d, i) => ScriptField; dropAction: dropActionType; backgroundHalo?: () => boolean; docFilters: () => string[]; diff --git a/src/client/views/nodes/formattedText/RichTextMenu.tsx b/src/client/views/nodes/formattedText/RichTextMenu.tsx index 8da1f99b5..c8798d757 100644 --- a/src/client/views/nodes/formattedText/RichTextMenu.tsx +++ b/src/client/views/nodes/formattedText/RichTextMenu.tsx @@ -431,7 +431,7 @@ export default class RichTextMenu extends AntimodeMenu { const nextIsOL = this.view.state.selection.$from.nodeAfter?.type === schema.nodes.ordered_list; let inList: any = undefined; let fromList = -1; - let path: any = Array.from((this.view.state.selection.$from as any).path); + const path: any = Array.from((this.view.state.selection.$from as any).path); for (let i = 0; i < path.length; i++) { if (path[i]?.type === schema.nodes.ordered_list) { inList = path[i]; diff --git a/src/fields/documentSchemas.ts b/src/fields/documentSchemas.ts index 9dda644f3..ddffb56c3 100644 --- a/src/fields/documentSchemas.ts +++ b/src/fields/documentSchemas.ts @@ -65,6 +65,7 @@ export const documentSchema = createSchema({ color: "string", // foreground color of document fitToBox: "boolean", // whether freeform view contents should be zoomed/panned to fill the area of the document view fontSize: "string", + hidden: "boolean", // whether a document should not be displayed isInkMask: "boolean", // is the document a mask (ie, sits on top of other documents, has an unbounded width/height that is dark, and content uses 'hard-light' mix-blend-mode to let other documents pop through) layout: "string", // this is the native layout string for the document. templates can be added using other fields and setting layoutKey below layoutKey: "string", // holds the field key for the field that actually holds the current lyoat @@ -87,6 +88,8 @@ export const documentSchema = createSchema({ onPointerUp: ScriptField, // script to run when document is clicked (can be overriden by an onClick prop) onDragStart: ScriptField, // script to run when document is dragged (without being selected). the script should return the Doc to be dropped. followLinkLocation: "string",// flag for where to place content when following a click interaction (e.g., onRight, inPlace, inTab, ) + hideLinkButton: "boolean", // whether the blue link counter button should be hidden + hideAllLinks: "boolean", // whether all individual blue anchor dots should be hidden isInPlaceContainer: "boolean",// whether the marked object will display addDocTab() calls that target "inPlace" destinations isLinkButton: "boolean", // whether document functions as a link follow button to follow the first link on the document when clicked isBackground: "boolean", // whether document is a background element and ignores input events (can only select with marquee) -- cgit v1.2.3-70-g09d2 From 53713fc7ab10257d1117193941cda2f3e0cabcf5 Mon Sep 17 00:00:00 2001 From: yunahi <60233430+yunahi@users.noreply.github.com> Date: Sun, 19 Jul 2020 04:44:51 +0900 Subject: added control points --- src/client/util/InteractionUtils.tsx | 9 +++ src/client/views/GestureOverlay.tsx | 17 +++++ src/client/views/InkingStroke.tsx | 82 ++++++++++++++++++++++ .../collectionFreeForm/FormatShapePane.tsx | 59 ++++++++++++++++ 4 files changed, 167 insertions(+) (limited to 'src/client/views/collections/collectionFreeForm/FormatShapePane.tsx') diff --git a/src/client/util/InteractionUtils.tsx b/src/client/util/InteractionUtils.tsx index 07adbb8b1..1d7655748 100644 --- a/src/client/util/InteractionUtils.tsx +++ b/src/client/util/InteractionUtils.tsx @@ -99,6 +99,15 @@ export namespace InteractionUtils { if (shape) { //if any of the shape are true pts = makePolygon(shape, points); } + else if (points.length > 9 && points[3].X === points[4].X && points[7].X === points[8].X) { + for (var i = 0; i < points.length; i += 4) { + const array = [[points[i].X, points[i].Y], [points[i + 1].X, points[i + 1].Y], [points[i + 2].X, points[i + 2].Y], [points[i + 3].X, points[i + 3].Y]]; + for (var t = 0; t < 1; t += 0.01) { + const point = beziercurve(t, array); + pts.push({ X: point[0], Y: point[1] }); + } + } + } else if (points.length > 1 && points[points.length - 1].X === points[0].X && points[points.length - 1].Y === points[0].Y) { //pointer is up (first and last points are the same) const newPoints = points.reduce((p, pts) => { p.push([pts.X, pts.Y]); return p; }, [] as number[][]); diff --git a/src/client/views/GestureOverlay.tsx b/src/client/views/GestureOverlay.tsx index a48b7b673..90d8b370e 100644 --- a/src/client/views/GestureOverlay.tsx +++ b/src/client/views/GestureOverlay.tsx @@ -23,6 +23,7 @@ import HorizontalPalette from "./Palette"; import { Touchable } from "./Touchable"; import TouchScrollableMenu, { TouchScrollableMenuItem } from "./TouchScrollableMenu"; import InkOptionsMenu from "./collections/collectionFreeForm/InkOptionsMenu"; +import * as fitCurve from 'fit-curve'; @observer export default class GestureOverlay extends Touchable { @@ -632,6 +633,22 @@ export default class GestureOverlay extends Touchable { // if no gesture (or if the gesture was unsuccessful), "dry" the stroke into an ink document if (!actionPerformed) { + const newPoints = this._points.reduce((p, pts) => { p.push([pts.X, pts.Y]); return p; }, [] as number[][]); + newPoints.pop(); + const controlPoints: { X: number, Y: number }[] = []; + + const bezierCurves = fitCurve(newPoints, 10); + for (const curve of bezierCurves) { + + controlPoints.push({ X: curve[0][0], Y: curve[0][1] }); + controlPoints.push({ X: curve[1][0], Y: curve[1][1] }); + controlPoints.push({ X: curve[2][0], Y: curve[2][1] }); + controlPoints.push({ X: curve[3][0], Y: curve[3][1] }); + + + } + this._points = controlPoints; + this.dispatchGesture(GestureUtils.Gestures.Stroke); } this._points = []; diff --git a/src/client/views/InkingStroke.tsx b/src/client/views/InkingStroke.tsx index abc698e62..974921be8 100644 --- a/src/client/views/InkingStroke.tsx +++ b/src/client/views/InkingStroke.tsx @@ -17,6 +17,7 @@ import { Scripting } from "../util/Scripting"; import { Doc } from "../../fields/Doc"; import FormatShapePane from "./collections/collectionFreeForm/FormatShapePane"; import { action } from "mobx"; +import { setupMoveUpEvents } from "../../Utils"; library.add(faPaintBrush); @@ -45,6 +46,38 @@ export class InkingStroke extends ViewBoxBaseComponent { + setupMoveUpEvents(this, e, this.onControlMove, this.onControlup, (e) => { }); + this._prevX = e.clientX; + this._prevY = e.clientY; + this._controlNum = i; + } + + @action + changeCurrPoint = (i: number) => { + FormatShapePane.Instance._currPoint = i; + } + + @action + onControlMove = (e: PointerEvent, down: number[]): boolean => { + const xDiff = this._prevX - e.clientX; + const yDiff = this._prevY - e.clientY; + FormatShapePane.Instance.control(xDiff, yDiff, this._controlNum); + this._prevX = e.clientX; + this._prevY = e.clientY; + return false; + } + + onControlup = (e: PointerEvent) => { + this._prevX = 0; + this._prevY = 0; + this._controlNum = 0; + } + render() { TraceMobx(); const data: InkData = Cast(this.dataDoc[this.fieldKey], InkField)?.inkData ?? []; @@ -69,6 +102,51 @@ export class InkingStroke extends ViewBoxBaseComponent 5 ? strokeColor : "transparent", strokeWidth, (strokeWidth + 15), StrCast(this.layoutDoc.strokeBezier), StrCast(this.layoutDoc.fillColor, "transparent"), "none", "none", "0", scaleX, scaleY, "", this.props.active() ? "visiblepainted" : "none", false, true); + + const controlPoints: { X: number, Y: number, I: number }[] = []; + const handlePoints: { X: number, Y: number, I: number, dot1: number, dot2: number }[] = []; + const handleLine: { X1: number, Y1: number, X2: number, Y2: number, X3: number, Y3: number, dot1: number, dot2: number }[] = []; + + if (data.length > 5) { + for (var i = 0; i <= data.length - 4; i += 4) { + controlPoints.push({ X: data[i].X, Y: data[i].Y, I: i }); + controlPoints.push({ X: data[i + 3].X, Y: data[i + 3].Y, I: i + 3 }); + handlePoints.push({ X: data[i + 1].X, Y: data[i + 1].Y, I: i + 1, dot1: i, dot2: i === 0 ? i : i - 1 }); + handlePoints.push({ X: data[i + 2].X, Y: data[i + 2].Y, I: i + 2, dot1: i + 3, dot2: i === data.length ? i + 3 : i + 4 }); + } + handleLine.push({ X1: data[0].X, Y1: data[0].Y, X2: data[0].X, Y2: data[0].Y, X3: data[1].X, Y3: data[1].Y, dot1: 0, dot2: 0 }); + for (var i = 2; i < data.length - 2; i += 4) { + handleLine.push({ X1: data[i].X, Y1: data[i].Y, X2: data[i + 1].X, Y2: data[i + 1].Y, X3: data[i + 3].X, Y3: data[i + 3].Y, dot1: i + 1, dot2: i + 2 }); + } + handleLine.push({ X1: data[data.length - 2].X, Y1: data[data.length - 2].Y, X2: data[data.length - 1].X, Y2: data[data.length - 1].Y, X3: data[data.length - 1].X, Y3: data[data.length - 1].Y, dot1: data.length - 1, dot2: data.length - 1 }); + + + } + const controls = controlPoints.map((pts, i) => + + + { this.changeCurrPoint(pts.I); this.onControlDown(e, pts.I); }} pointerEvents="all" cursor="all-scroll" /> + ); + const handles = handlePoints.map((pts, i) => + + + this.onControlDown(e, pts.I)} pointerEvents="all" cursor="all-scroll" display={(pts.dot1 === FormatShapePane.Instance._currPoint || pts.dot2 === FormatShapePane.Instance._currPoint) ? "inherit" : "none"} /> + ); + const handleLines = handleLine.map((pts, i) => + + + + + + ); + + return ( {hpoints} {points} + {FormatShapePane.Instance._controlBtn && this.props.isSelected() ? controls : ""} + {FormatShapePane.Instance._controlBtn && this.props.isSelected() ? handles : ""} + {FormatShapePane.Instance._controlBtn && this.props.isSelected() ? handleLines : ""} + ); } diff --git a/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx b/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx index 9d9ce7f36..a2dc241c0 100644 --- a/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx +++ b/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx @@ -28,6 +28,9 @@ export default class FormatShapePane extends AntimodeMenu { @observable private _lock = false; @observable private _fillBtn = false; @observable private _lineBtn = false; + @observable _controlBtn = false; + @observable private _controlPoints: { X: number, Y: number }[] = []; + @observable _currPoint = -1; getField(key: string) { return this.selectedInk?.reduce((p, i) => @@ -158,6 +161,51 @@ export default class FormatShapePane extends AntimodeMenu { })); } + @undoBatch + @action + control = (xDiff: number, yDiff: number, controlNum: number) => { + this.selectedInk?.forEach(action(inkView => { + if (this.selectedInk?.length === 1) { + const doc = Document(inkView.rootDoc); + if (doc.type === DocumentType.INK && doc.x && doc.y && doc._width && doc._height && doc.data) { + const ink = Cast(doc.data, InkField)?.inkData; + if (ink) { + + const newPoints: { X: number, Y: number }[] = []; + const order = controlNum % 4; + for (var i = 0; i < ink.length; i++) { + if (controlNum === i || + (order === 0 && i === controlNum + 1) || + (order === 0 && controlNum !== 0 && i === controlNum - 2) || + (order === 0 && controlNum !== 0 && i === controlNum - 1) || + (order === 3 && i === controlNum - 1) || + (order === 3 && controlNum !== ink.length - 1 && i === controlNum + 1) || + (order === 3 && controlNum !== ink.length - 1 && i === controlNum + 2)) { + newPoints.push({ X: ink[i].X - (xDiff), Y: ink[i].Y - (yDiff) }); + } + else { + newPoints.push({ X: ink[i].X, Y: ink[i].Y }); + } + } + const oldx = doc.x; + const oldy = doc.y; + doc.data = new InkField(newPoints); + const xs2 = newPoints.map(p => p.X); + const ys2 = newPoints.map(p => p.Y); + const left2 = Math.min(...xs2); + const top2 = Math.min(...ys2); + const right2 = Math.max(...xs2); + const bottom2 = Math.max(...ys2); + doc._height = (bottom2 - top2) * inkView.props.ScreenToLocalTransform().Scale; + doc._width = (right2 - left2) * inkView.props.ScreenToLocalTransform().Scale; + doc.x = oldx; + doc.y = oldy; + } + } + } + })); + } + colorPicker(setter: (color: string) => {}) { return
@@ -193,6 +241,14 @@ export default class FormatShapePane extends AntimodeMenu { ; } + controlPointsButton() { + return <> + +

+ ; + } @computed get fillButton() { return this.colorButton(this.colorFil, () => this._fillBtn = !this._fillBtn); } @computed get lineButton() { return this.colorButton(this.colorStk, () => this._lineBtn = !this._lineBtn); } @@ -206,6 +262,8 @@ export default class FormatShapePane extends AntimodeMenu { @computed get XpsInput() { return this.inputBox("Xps", this.shapeXps, (val: string) => this.shapeXps = val); } @computed get YpsInput() { return this.inputBox("Yps", this.shapeYps, (val: string) => this.shapeYps = val); } + @computed get controlPoints() { return this.controlPointsButton(); } + @computed get propertyGroupItems() { const fillCheck =
this.unFilled = true))} /> @@ -260,6 +318,7 @@ export default class FormatShapePane extends AntimodeMenu {

Rotation {this.rotInput}

+ Edit Points {this.controlPoints}
; const positionCheck =
-- cgit v1.2.3-70-g09d2 From 258ad0d8628737e01613341437eb0421359ad168 Mon Sep 17 00:00:00 2001 From: yunahi <60233430+yunahi@users.noreply.github.com> Date: Tue, 28 Jul 2020 00:02:40 +0900 Subject: rotation/resize fix, changed ui, added sketchpicker etc. --- src/client/util/InteractionUtils.tsx | 7 +- src/client/views/DocumentDecorations.tsx | 54 +++- src/client/views/GestureOverlay.tsx | 16 +- src/client/views/InkingStroke.tsx | 15 +- .../collectionFreeForm/FormatShapePane.scss | 4 +- .../collectionFreeForm/FormatShapePane.tsx | 333 ++++++++++++++------- .../collectionFreeForm/InkOptionsMenu.tsx | 128 ++------ src/client/views/nodes/ColorBox.tsx | 45 +-- 8 files changed, 347 insertions(+), 255 deletions(-) (limited to 'src/client/views/collections/collectionFreeForm/FormatShapePane.tsx') diff --git a/src/client/util/InteractionUtils.tsx b/src/client/util/InteractionUtils.tsx index 31b2a56e6..69256ce67 100644 --- a/src/client/util/InteractionUtils.tsx +++ b/src/client/util/InteractionUtils.tsx @@ -123,6 +123,12 @@ export namespace InteractionUtils { } else { pts = points; } + if (isNaN(scalex)) { + scalex = 1; + } + if (isNaN(scaley)) { + scaley = 1; + } const strpts = pts.reduce((acc: string, pt: { X: number, Y: number }) => acc + `${(pt.X - left - width / 2) * scalex + width / 2}, ${(pt.Y - top - width / 2) * scaley + width / 2} `, ""); @@ -141,7 +147,6 @@ export namespace InteractionUtils { } } - private _prevX = 0; private _prevY = 0; private _centerPoints: { X: number, Y: number }[] = []; + private _inkDocs: { x: number, y: number, width: number, height: number }[] = []; @observable private _accumulatedTitle = ""; @observable private _titleControlString: string = "#title"; @@ -309,8 +312,10 @@ export class DocumentDecorations extends React.Component<{}, { value: string }> const right = Math.max(...xs); const bottom = Math.max(...ys); - doc._height = (bottom - top) * element.props.ScreenToLocalTransform().Scale; - doc._width = (right - left) * element.props.ScreenToLocalTransform().Scale; + // doc._height = (bottom - top) * element.props.ScreenToLocalTransform().Scale; + // doc._width = (right - left) * element.props.ScreenToLocalTransform().Scale; + doc._height = (bottom - top); + doc._width = (right - left); } index++; @@ -329,6 +334,16 @@ export class DocumentDecorations extends React.Component<{}, { value: string }> _dragHeights = new Map(); @action onPointerDown = (e: React.PointerEvent): void => { + + this._inkDocs = []; + SelectionManager.SelectedDocuments().forEach(action((element: DocumentView) => { + const doc = Document(element.rootDoc); + if (doc.type === DocumentType.INK && doc.x && doc.y && doc._width && doc._height) { + this._inkDocs.push({ x: doc.x, y: doc.y, width: doc._width, height: doc._height }); + } + + })); + setupMoveUpEvents(this, e, this.onPointerMove, this.onPointerUp, (e) => { }); if (e.button === 0) { this._resizeHdlId = e.currentTarget.id; @@ -501,6 +516,28 @@ export class DocumentDecorations extends React.Component<{}, { value: string }> (e.button === 0) && this._resizeUndo?.end(); this._resizeUndo = undefined; SnappingManager.clearSnapLines(); + + + //need to change points for resize, or else rotation/control points will fail. + SelectionManager.SelectedDocuments().forEach(action((element: DocumentView, index) => { + const doc = Document(element.rootDoc); + if (doc.type === DocumentType.INK && doc.x && doc.y && doc._height && doc._width) { + console.log(doc.x, doc.y, doc._height, doc._width); + const ink = Cast(doc.data, InkField)?.inkData; + if (ink) { + const newPoints: { X: number, Y: number }[] = []; + for (var i = 0; i < ink.length; i++) { + // (new x — oldx) + (oldxpoint * newWidt)/oldWidth + const newX = (doc.x - this._inkDocs[index].x) + (ink[i].X * doc._width) / this._inkDocs[index].width; + const newY = (doc.y - this._inkDocs[index].y) + (ink[i].Y * doc._height) / this._inkDocs[index].height; + newPoints.push({ X: newX, Y: newY }); + } + doc.data = new InkField(newPoints); + + } + + } + })); } @computed @@ -591,6 +628,11 @@ export class DocumentDecorations extends React.Component<{}, { value: string }> if (bounds.y > bounds.b) { bounds.y = bounds.b - (this._resizeBorderWidth + this._linkBoxHeight + this._titleHeight); } + var offset = 0; + //make offset larger for ink to edit points + if (seldoc.rootDoc.type === DocumentType.INK) { + offset = 20; + } return (
{bounds.r - bounds.x < 15 && bounds.b - bounds.y < 15 ? (null) : <>
{maximizeIcon} {titleArea} diff --git a/src/client/views/GestureOverlay.tsx b/src/client/views/GestureOverlay.tsx index 2eec8ed6a..9faf5e6a5 100644 --- a/src/client/views/GestureOverlay.tsx +++ b/src/client/views/GestureOverlay.tsx @@ -668,6 +668,10 @@ export default class GestureOverlay extends Touchable { } makePolygon = (shape: string, gesture: boolean) => { + //take off gesture recognition for now + if (gesture) { + return false; + } const xs = this._points.map(p => p.X); const ys = this._points.map(p => p.Y); var right = Math.max(...xs); @@ -796,19 +800,7 @@ export default class GestureOverlay extends Touchable { break; case "line": this._points.push({ X: left, Y: top }); - - this._points.push({ X: left, Y: top }); - - // this._points.push({ X: right, Y: bottom }); - // this._points.push({ X: right, Y: bottom }); - // this._points.push({ X: right, Y: bottom }); - // this._points.push({ X: right, Y: bottom }); - - - this._points.push({ X: right, Y: bottom }); this._points.push({ X: right, Y: bottom }); - - // this._points.push({ X: right, Y: bottom - 1 }); break; case "arrow": const x1 = left; diff --git a/src/client/views/InkingStroke.tsx b/src/client/views/InkingStroke.tsx index 22c89b6da..b03d8e79b 100644 --- a/src/client/views/InkingStroke.tsx +++ b/src/client/views/InkingStroke.tsx @@ -105,9 +105,9 @@ export class InkingStroke extends ViewBoxBaseComponent= 4) { for (var i = 0; i <= data.length - 4; i += 4) { controlPoints.push({ X: data[i].X, Y: data[i].Y, I: i }); @@ -125,6 +125,15 @@ export class InkingStroke extends ViewBoxBaseComponent { switch (field) { case "rot": this.rotate((dirs === "up" ? .1 : -.1)); break; + // case "rot": this.selectedInk?.forEach(i => i.rootDoc.rotation = NumCast(i.rootDoc.rotation) + (dirs === "up" ? 0.1 : -0.1)); break; case "Xps": this.selectedInk?.forEach(i => i.rootDoc.x = NumCast(i.rootDoc.x) + (dirs === "up" ? 10 : -10)); break; case "Yps": this.selectedInk?.forEach(i => i.rootDoc.y = NumCast(i.rootDoc.y) + (dirs === "up" ? 10 : -10)); break; case "stk": this.selectedInk?.forEach(i => i.rootDoc.strokeWidth = NumCast(i.rootDoc.strokeWidth) + (dirs === "up" ? .1 : -.1)); break; case "wid": this.selectedInk?.filter(i => i.rootDoc._width && i.rootDoc._height).forEach(i => { + //redraw points const oldWidth = NumCast(i.rootDoc._width); + const oldHeight = NumCast(i.rootDoc._height); + const oldX = NumCast(i.rootDoc.x); + const oldY = NumCast(i.rootDoc.y); i.rootDoc._width = oldWidth + (dirs === "up" ? 10 : - 10); this._lock && (i.rootDoc._height = (i.rootDoc._width / oldWidth * NumCast(i.rootDoc._height))); + const doc = Document(i.rootDoc); + if (doc.type === DocumentType.INK && doc.x && doc.y && doc._height && doc._width) { + console.log(doc.x, doc.y, doc._height, doc._width); + const ink = Cast(doc.data, InkField)?.inkData; + console.log(ink); + if (ink) { + const newPoints: { X: number, Y: number }[] = []; + for (var j = 0; j < ink.length; j++) { + // (new x — oldx) + (oldxpoint * newWidt)/oldWidth + const newX = (doc.x - oldX) + (ink[j].X * doc._width) / oldWidth; + const newY = (doc.y - oldY) + (ink[j].Y * doc._height) / oldHeight; + newPoints.push({ X: newX, Y: newY }); + } + doc.data = new InkField(newPoints); + } + } }); break; case "hgt": this.selectedInk?.filter(i => i.rootDoc._width && i.rootDoc._height).forEach(i => { + const oldWidth = NumCast(i.rootDoc._width); const oldHeight = NumCast(i.rootDoc._height); - i.rootDoc._height = oldHeight + (dirs === "up" ? 10 : - 10); + const oldX = NumCast(i.rootDoc.x); + const oldY = NumCast(i.rootDoc.y); i.rootDoc._height = oldHeight + (dirs === "up" ? 10 : - 10); this._lock && (i.rootDoc._width = (i.rootDoc._height / oldHeight * NumCast(i.rootDoc._width))); + const doc = Document(i.rootDoc); + if (doc.type === DocumentType.INK && doc.x && doc.y && doc._height && doc._width) { + console.log(doc.x, doc.y, doc._height, doc._width); + const ink = Cast(doc.data, InkField)?.inkData; + console.log(ink); + if (ink) { + const newPoints: { X: number, Y: number }[] = []; + for (var j = 0; j < ink.length; j++) { + // (new x — oldx) + (oldxpoint * newWidt)/oldWidth + const newX = (doc.x - oldX) + (ink[j].X * doc._width) / oldWidth; + const newY = (doc.y - oldY) + (ink[j].Y * doc._height) / oldHeight; + newPoints.push({ X: newX, Y: newY }); + } + doc.data = new InkField(newPoints); + } + } }); break; } @@ -124,12 +164,11 @@ export default class FormatShapePane extends AntimodeMenu { @undoBatch @action - rotate = (degrees: number) => { - this.selectedInk?.forEach(action(inkView => { + rotate = (angle: number) => { + const _centerPoints: { X: number, Y: number }[] = []; + SelectionManager.SelectedDocuments().forEach(action(inkView => { const doc = Document(inkView.rootDoc); if (doc.type === DocumentType.INK && doc.x && doc.y && doc._width && doc._height && doc.data) { - const angle = Number(degrees) - Number(doc.rotation); - doc.rotation = Number(degrees); const ink = Cast(doc.data, InkField)?.inkData; if (ink) { const xs = ink.map(p => p.X); @@ -138,25 +177,37 @@ export default class FormatShapePane extends AntimodeMenu { const top = Math.min(...ys); const right = Math.max(...xs); const bottom = Math.max(...ys); - const _centerPoints: { X: number, Y: number }[] = []; _centerPoints.push({ X: left, Y: top }); + } + } + })); + + var index = 0; + SelectionManager.SelectedDocuments().forEach(action(inkView => { + const doc = Document(inkView.rootDoc); + if (doc.type === DocumentType.INK && doc.x && doc.y && doc._width && doc._height && doc.data) { + doc.rotation = Number(doc.rotation) + Number(angle); + const ink = Cast(doc.data, InkField)?.inkData; + if (ink) { const newPoints: { X: number, Y: number }[] = []; for (var i = 0; i < ink.length; i++) { - const newX = Math.cos(angle) * (ink[i].X - _centerPoints[0].X) - Math.sin(angle) * (ink[i].Y - _centerPoints[0].Y) + _centerPoints[0].X; - const newY = Math.sin(angle) * (ink[i].X - _centerPoints[0].X) + Math.cos(angle) * (ink[i].Y - _centerPoints[0].Y) + _centerPoints[0].Y; + const newX = Math.cos(angle) * (ink[i].X - _centerPoints[index].X) - Math.sin(angle) * (ink[i].Y - _centerPoints[index].Y) + _centerPoints[index].X; + const newY = Math.sin(angle) * (ink[i].X - _centerPoints[index].X) + Math.cos(angle) * (ink[i].Y - _centerPoints[index].Y) + _centerPoints[index].Y; newPoints.push({ X: newX, Y: newY }); } doc.data = new InkField(newPoints); - const xs2 = newPoints.map(p => p.X); - const ys2 = newPoints.map(p => p.Y); - const left2 = Math.min(...xs2); - const top2 = Math.min(...ys2); - const right2 = Math.max(...xs2); - const bottom2 = Math.max(...ys2); - doc._height = (bottom2 - top2) * inkView.props.ScreenToLocalTransform().Scale; - doc._width = (right2 - left2) * inkView.props.ScreenToLocalTransform().Scale; + const xs = newPoints.map(p => p.X); + const ys = newPoints.map(p => p.Y); + const left = Math.min(...xs); + const top = Math.min(...ys); + const right = Math.max(...xs); + const bottom = Math.max(...ys); + + doc._height = (bottom - top); + doc._width = (right - left); } + index++; } })); } @@ -180,8 +231,10 @@ export default class FormatShapePane extends AntimodeMenu { (order === 0 && controlNum !== 0 && i === controlNum - 1) || (order === 3 && i === controlNum - 1) || (order === 3 && controlNum !== ink.length - 1 && i === controlNum + 1) || - (order === 3 && controlNum !== ink.length - 1 && i === controlNum + 2)) { - newPoints.push({ X: ink[i].X - (xDiff), Y: ink[i].Y - (yDiff) }); + (order === 3 && controlNum !== ink.length - 1 && i === controlNum + 2) + || ((ink[0].X === ink[ink.length - 1].X) && (ink[0].Y === ink[ink.length - 1].Y) && (i === 0 || i === ink.length - 1) && (controlNum === 0 || controlNum === ink.length - 1)) + ) { + newPoints.push({ X: ink[i].X - (xDiff * inkView.props.ScreenToLocalTransform().Scale), Y: ink[i].Y - (yDiff * inkView.props.ScreenToLocalTransform().Scale) }); } else { newPoints.push({ X: ink[i].X, Y: ink[i].Y }); @@ -189,6 +242,10 @@ export default class FormatShapePane extends AntimodeMenu { } const oldx = doc.x; const oldy = doc.y; + const xs = newPoints.map(p => p.X); + const ys = newPoints.map(p => p.Y); + const left = Math.min(...xs); + const top = Math.min(...ys); doc.data = new InkField(newPoints); const xs2 = newPoints.map(p => p.X); const ys2 = newPoints.map(p => p.Y); @@ -196,141 +253,202 @@ export default class FormatShapePane extends AntimodeMenu { const top2 = Math.min(...ys2); const right2 = Math.max(...xs2); const bottom2 = Math.max(...ys2); - doc._height = (bottom2 - top2) * inkView.props.ScreenToLocalTransform().Scale; - doc._width = (right2 - left2) * inkView.props.ScreenToLocalTransform().Scale; - doc.x = oldx; - doc.y = oldy; + doc._height = (bottom2 - top2); + doc._width = (right2 - left2); + + doc.x = oldx - (left - left2); + doc.y = oldy - (top - top2); } } } })); } + @undoBatch + @action + switchStk = (color: ColorState) => { + const val = String(color.hex); + this.colorStk = val; + return true; + } - colorPicker(setter: (color: string) => {}) { - return
- {this._palette.map(color => - )} + @undoBatch + @action + switchFil = (color: ColorState) => { + const val = String(color.hex); + this.colorFil = val; + return true; + } + + + colorPicker(setter: (color: string) => {}, type: string) { + return
+
; } inputBox = (key: string, value: any, setter: (val: string) => {}) => { return <> - setter(e.target.value)} + onChange={undoBatch(action((e) => setter(e.target.value)))} autoFocus /> -
- ; } + inputBoxDuo = (key: string, value: any, setter: (val: string) => {}, title1: string, key2: string, value2: any, setter2: (val: string) => {}, title2: string) => { + return <> + {title1} +

{title2}

+ + setter(e.target.value)} + autoFocus /> + + + {title2 === "" ? "" : <> + setter2(e.target.value)} + autoFocus /> + +
+ } + ; + } + + colorButton(value: string, setter: () => {}) { return <> - -

; } controlPointsButton() { return <> - + + +

+ ; + } + + lockRatioButton() { + return <> + +

+ ; + } + + rotate90Button() { + return <> +

; } - @computed get fillButton() { return this.colorButton(this.colorFil, () => this._fillBtn = !this._fillBtn); } - @computed get lineButton() { return this.colorButton(this.colorStk, () => this._lineBtn = !this._lineBtn); } + @computed get fillButton() { return this.colorButton(this.colorFil, () => { this._fillBtn = !this._fillBtn; this._lineBtn = false; return true; }); } + @computed get lineButton() { return this.colorButton(this.colorStk, () => { this._lineBtn = !this._lineBtn; this._fillBtn = false; return true; }); } - @computed get fillPicker() { return this.colorPicker((color: string) => this.colorFil = color); } - @computed get linePicker() { return this.colorPicker((color: string) => this.colorStk = color); } + @computed get fillPicker() { return this.colorPicker((color: string) => this.colorFil = color, "fil"); } + @computed get linePicker() { return this.colorPicker((color: string) => this.colorStk = color, "stk"); } @computed get stkInput() { return this.inputBox("stk", this.widthStk, (val: string) => this.widthStk = val); } - @computed get hgtInput() { return this.inputBox("hgt", this.shapeHgt, (val: string) => this.shapeHgt = val); } + @computed get dashInput() { return this.inputBox("dsh", this.widthStk, (val: string) => this.widthStk = val); } + + @computed get hgtInput() { return this.inputBoxDuo("hgt", this.shapeHgt, (val: string) => this.shapeHgt = val, "H:", "wid", this.shapeWid, (val: string) => this.shapeWid = val, "W:"); } @computed get widInput() { return this.inputBox("wid", this.shapeWid, (val: string) => this.shapeWid = val); } - @computed get rotInput() { return this.inputBox("rot", this.shapeRot, (val: string) => this.shapeRot = val); } - @computed get XpsInput() { return this.inputBox("Xps", this.shapeXps, (val: string) => this.shapeXps = val); } + @computed get rotInput() { return this.inputBoxDuo("rot", this.shapeRot, (val: string) => { this.rotate(Number(val) - Number(this.shapeRot)); this.shapeRot = val; return true; }, "∠:", "rot", this.shapeRot, (val: string) => this.shapeRot = val, ""); } + + @computed get XpsInput() { return this.inputBoxDuo("Xps", this.shapeXps, (val: string) => this.shapeXps = val, "X:", "Yps", this.shapeYps, (val: string) => this.shapeYps = val, "Y:"); } @computed get YpsInput() { return this.inputBox("Yps", this.shapeYps, (val: string) => this.shapeYps = val); } @computed get controlPoints() { return this.controlPointsButton(); } + @computed get lockRatio() { return this.lockRatioButton(); } + @computed get rotate90() { return this.rotate90Button(); } - @computed get propertyGroupItems() { - const fillCheck =
- this.unFilled = true))} /> - No Fill -
- this.solidFil = true))} /> - Solid Fill -

- {this.solidFil ? "Color" : ""} - {this.solidFil ? this.fillButton : ""} - {this._fillBtn && this.solidFil ? this.fillPicker : ""} -
; - const markers = <> - this.markHead = this.markHead ? "" : "arrow"))} /> - Arrow Head -
- this.markTail = this.markTail ? "" : "arrow"))} /> - Arrow End -
- ; + @computed get propertyGroupItems() { + const fillCheck =
= 1) ? "" : "none", width: "inherit", backgroundColor: "#323232", color: "white", }}> + Fill: + {this.fillButton} +
+ Stroke: + {this.lineButton} +
- const lineCheck =
- this.unStrokd = true))} /> - No Line -
- this.solidStk = true))} /> - Solid Line -
- this.dashdStk = "2"))} /> - Dash Line -
-
- {(this.solidStk || this.dashdStk) ? "Color" : ""} - {(this.solidStk || this.dashdStk) ? this.lineButton : ""} - {(this.solidStk || this.dashdStk) && this._lineBtn ? this.linePicker : ""} -
+ {this._fillBtn ? this.fillPicker : ""} + {this._lineBtn ? this.linePicker : ""} + {this._fillBtn || this._lineBtn ? "" :
} {(this.solidStk || this.dashdStk) ? "Width" : ""} {(this.solidStk || this.dashdStk) ? this.stkInput : ""} - {(this.solidStk || this.dashdStk) ? this.widthStk = e.target.value} /> : (null)} -

- {(this.solidStk || this.dashdStk) ? markers : ""} -
; - const sizeCheck =
- Height {this.hgtInput} -

- Width {this.widInput} -

- this._lock = !this._lock))} /> - Lock Ratio -

- Rotation {this.rotInput} -

- Edit Points {this.controlPoints} -
; - const positionCheck =
- Horizontal {this.XpsInput} -

- Vertical {this.YpsInput} -

+ {(this.solidStk || this.dashdStk) ? this.widthStk = e.target.value))} /> : (null)} +
+ {(this.solidStk || this.dashdStk) ? <> +

Arrow Head

+ this.markHead = this.markHead ? "" : "arrow"))} style={{ position: "absolute", right: 110, width: 20 }} /> +

Arrow End

+ this.markTail = this.markTail ? "" : "arrow"))} style={{ position: "absolute", right: 0, width: 20 }} /> +
+ : ""} + Dash: this.dashdStk = this.dashdStk === "2" ? "0" : "2"))} style={{ position: "absolute", right: 110, width: 20 }} /> + + +
; - const subMenus = this._currMode === "fill-drip" ? [`fill`, `line`] : [`size`, `position`]; - const menuItems = this._currMode === "fill-drip" ? [fillCheck, lineCheck] : [sizeCheck, positionCheck]; - const indexOffset = this._currMode === "fill-drip" ? 0 : 2; + + + const sizeCheck = + +
= 1) ? "" : "none", width: "inherit", backgroundColor: "#323232", color: "white", }}> + {this.controlPoints} + {this.hgtInput} + {this.XpsInput} + {this.rotInput} + +
; + + + const subMenus = this._currMode === "fill-drip" ? [`Appearance`, 'Transform'] : []; + const menuItems = this._currMode === "fill-drip" ? [fillCheck, sizeCheck] : []; + const indexOffset = 0; + return
{subMenus.map((subMenu, i) =>
@@ -361,6 +479,7 @@ export default class FormatShapePane extends AntimodeMenu { } render() { - return this.getElementVert([this.closeBtn, this.propertyGroupBtn, this.propertyGroupItems]); + return this.getElementVert([this.closeBtn, + this.propertyGroupItems]); } } \ No newline at end of file diff --git a/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx b/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx index 15707ad9e..80d1264ce 100644 --- a/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx +++ b/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx @@ -16,11 +16,11 @@ import { Document } from "../../../../fields/documentSchemas"; import { DocumentType } from "../../../documents/DocumentTypes"; import { FontAwesomeIcon } from "@fortawesome/react-fontawesome"; import { IconProp, library } from '@fortawesome/fontawesome-svg-core'; -import { faBold, faItalic, faChevronLeft, faUnderline, faStrikethrough, faSubscript, faSuperscript, faIndent, faEyeDropper, faCaretDown, faPalette, faArrowsAlt, faHighlighter, faLink, faPaintRoller, faSleigh, faBars, faFillDrip, faBrush, faPenNib, faShapes, faArrowLeft, faEllipsisH, faBezierCurve, } from "@fortawesome/free-solid-svg-icons"; +import { faBold, faItalic, faChevronLeft, faUnderline, faStrikethrough, faSubscript, faSuperscript, faIndent, faEyeDropper, faCaretDown, faPalette, faArrowsAlt, faHighlighter, faLink, faPaintRoller, faSleigh, faBars, faFillDrip, faBrush, faPenNib, faShapes, faArrowLeft, faEllipsisH, faBezierCurve, faArrowRight, faArrowsAltH, faMinus, faCircle, faExclamationTriangle, faSquare, faLongArrowAltRight, faPenFancy, faCaretSquareRight, faAngleDoubleRight, } from "@fortawesome/free-solid-svg-icons"; import { Cast, StrCast, BoolCast } from "../../../../fields/Types"; import FormatShapePane from "./FormatShapePane"; -library.add(faBold, faItalic, faChevronLeft, faUnderline, faStrikethrough, faSuperscript, faSubscript, faIndent, faEyeDropper, faCaretDown, faPalette, faArrowsAlt, faHighlighter, faLink, faPaintRoller, faBars, faFillDrip, faBrush, faPenNib, faShapes, faArrowLeft, faEllipsisH, faBezierCurve); +library.add(faBold, faItalic, faChevronLeft, faUnderline, faStrikethrough, faSuperscript, faSubscript, faIndent, faEyeDropper, faCaretDown, faPalette, faArrowsAlt, faHighlighter, faLink, faPaintRoller, faBars, faFillDrip, faBrush, faPenNib, faShapes, faArrowLeft, faEllipsisH, faBezierCurve, faLongArrowAltRight, faArrowsAltH, faMinus, faCircle, faSquare, faSquare, faPenFancy, faAngleDoubleRight,); @@ -30,18 +30,13 @@ export default class InkOptionsMenu extends AntimodeMenu { private _palette = ["#D0021B", "#F5A623", "#F8E71C", "#8B572A", "#7ED321", "#417505", "#9013FE", "#4A90E2", "#50E3C2", "#B8E986", "#000000", "#4A4A4A", "#9B9B9B", "#FFFFFF", ""]; private _width = ["1", "5", "10", "100"]; - // private _buttons = ["circle", "triangle", "rectangle", "arrow", "line"]; - // private _icons = ["O", "∆", "ロ", "➜", "-"]; - // private _buttons = ["circle", "triangle", "rectangle", "line", "noRec", "",]; - // private _icons = ["O", "∆", "ロ", "⎯⎯⎯", "✖︎", " "]; - //arrowStart and arrowEnd must match and defs must exist in Inking Stroke - // private _arrowStart = ["arrowStart", "arrowStart", "dot", "dot", "none"]; - // private _arrowEnd = ["none", "arrowEnd", "none", "dot", "none"]; - // private _arrowIcons = ["→", "↔︎", "•", "••", " "]; - private _draw = ["⎯", "→", "↔︎", "∿", "↝", "↭", "ロ", "O", "∆"]; - private _head = ["", "", "arrow", "", "", "arrow", "", "", ""]; - private _end = ["", "arrow", "arrow", "", "arrow", "arrow", "", "", ""]; - private _shape = ["line", "line", "line", "", "", "", "rectangle", "circle", "triangle"]; + private _dotsize = [10, 20, 30, 40]; + private _draw = ["∿", "⎯", "→", "↔︎", "ロ", "O"]; + private _head = ["", "", "", "arrow", "", ""]; + private _end = ["", "", "arrow", "arrow", "", ""]; + private _shape = ["", "line", "line", "line", "rectangle", "circle"]; + private _title = ["pen", "line", "line with arrow", "line with double arrows", "square", "circle",]; + private _faName = ["pen-fancy", "minus", "long-arrow-alt-right", "arrows-alt-h", "square", "circle"]; @observable _shapesNum = this._shape.length; @observable _selected = this._shapesNum; @@ -154,6 +149,7 @@ export default class InkOptionsMenu extends AntimodeMenu { return ; })}
; return drawButtons; } - // @computed get arrowPicker() { - // var currIcon; - // for (var i = 0; i < this._arrowStart.length; i++) { - // if (this._arrowStart[i] === ActiveArrowStart() && this._arrowEnd[i] === ActiveArrowEnd()) { - // currIcon = this._arrowIcons[i]; - // if (this._arrowIcons[i] === " ") { - // currIcon = "➤"; - // } - // } - // } - // var arrowPicker = ; - // if (this._arrowBtn) { - // arrowPicker =
- // {arrowPicker} - // {this._arrowStart.map((arrowStart, i) => { - // return ; - // })} - //
; - // } - // return arrowPicker; - // } @computed get widthPicker() { var widthPicker = ; })}
; @@ -273,7 +238,7 @@ export default class InkOptionsMenu extends AntimodeMenu { var colorPicker = ; } @@ -310,7 +275,7 @@ export default class InkOptionsMenu extends AntimodeMenu { var fillPicker = ; - // if (this._shapeBtn) { - // shapePicker =
- // {shapePicker} - // {this._buttons.map((btn, i) => { - // var ttl = btn; - // if (btn === "") { - // ttl = "no shape"; - // } - // if (btn === "noRec") { - // ttl = "disable shape recognition"; - // } - // return ; - // })} - //
; - // } - // return shapePicker; - // } @computed get bezierButton() { return , - // this.shapePicker, - // this.bezierButton, + + this.drawButtons, this.widthPicker, this.colorPicker, this.fillPicker, - this.drawButtons, + + this.formatPane, - // this.arrowPicker, - // this.dashButton, + diff --git a/src/client/views/nodes/ColorBox.tsx b/src/client/views/nodes/ColorBox.tsx index 57028b0ca..b186d9ffc 100644 --- a/src/client/views/nodes/ColorBox.tsx +++ b/src/client/views/nodes/ColorBox.tsx @@ -54,27 +54,30 @@ export class ColorBox extends ViewBoxBaseComponent e.button === 0 && !e.ctrlKey && e.stopPropagation()} - style={{ transform: `scale(${this.props.ContentScaling()})`, width: `${100 / this.props.ContentScaling()}%`, height: `${100 / this.props.ContentScaling()}%` }} > + // return
e.button === 0 && !e.ctrlKey && e.stopPropagation()} + // style={{ transform: `scale(${this.props.ContentScaling()})`, width: `${100 / this.props.ContentScaling()}%`, height: `${100 / this.props.ContentScaling()}%` }} > - -
-
{ActiveInkWidth() ?? 2}
- ) => { - SetActiveInkWidth(e.target.value); - SelectionManager.SelectedDocuments().filter(i => StrCast(i.rootDoc.type) === DocumentType.INK).map(i => i.rootDoc.strokeWidth = Number(e.target.value)); - }} /> -
{ActiveInkBezierApprox() ?? 2}
- ) => { - SetActiveBezierApprox(e.target.value); - SelectionManager.SelectedDocuments().filter(i => StrCast(i.rootDoc.type) === DocumentType.INK).map(i => i.rootDoc.strokeBezier = e.target.value); - }} /> -
-
-
-
; + // + + //
+ //
{ActiveInkWidth() ?? 2}
+ // ) => { + // SetActiveInkWidth(e.target.value); + // SelectionManager.SelectedDocuments().filter(i => StrCast(i.rootDoc.type) === DocumentType.INK).map(i => i.rootDoc.strokeWidth = Number(e.target.value)); + // }} /> + //
{ActiveInkBezierApprox() ?? 2}
+ // ) => { + // SetActiveBezierApprox(e.target.value); + // SelectionManager.SelectedDocuments().filter(i => StrCast(i.rootDoc.type) === DocumentType.INK).map(i => i.rootDoc.strokeBezier = e.target.value); + // }} /> + //
+ //
+ //
+ //
+ // ; + return <>; } } -- cgit v1.2.3-70-g09d2 From 65d3c9672fc3cf0dc981588f220dad269beb4aeb Mon Sep 17 00:00:00 2001 From: yunahi <60233430+yunahi@users.noreply.github.com> Date: Tue, 28 Jul 2020 00:10:22 +0900 Subject: fixed control points from moving --- .../views/collections/collectionFreeForm/FormatShapePane.tsx | 8 +++++--- 1 file changed, 5 insertions(+), 3 deletions(-) (limited to 'src/client/views/collections/collectionFreeForm/FormatShapePane.tsx') diff --git a/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx b/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx index a47430453..adb71c6aa 100644 --- a/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx +++ b/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx @@ -242,8 +242,8 @@ export default class FormatShapePane extends AntimodeMenu { } const oldx = doc.x; const oldy = doc.y; - const xs = newPoints.map(p => p.X); - const ys = newPoints.map(p => p.Y); + const xs = ink.map(p => p.X); + const ys = ink.map(p => p.Y); const left = Math.min(...xs); const top = Math.min(...ys); doc.data = new InkField(newPoints); @@ -255,9 +255,11 @@ export default class FormatShapePane extends AntimodeMenu { const bottom2 = Math.max(...ys2); doc._height = (bottom2 - top2); doc._width = (right2 - left2); - + //if points move out of bounds + console.log(doc.x); doc.x = oldx - (left - left2); doc.y = oldy - (top - top2); + console.log(doc.x); } } } -- cgit v1.2.3-70-g09d2 From f3a331573be09115f9a92b8e927081f8f743c478 Mon Sep 17 00:00:00 2001 From: yunahi <60233430+yunahi@users.noreply.github.com> Date: Tue, 28 Jul 2020 01:28:22 +0900 Subject: delete console.log --- src/client/views/collections/collectionFreeForm/FormatShapePane.tsx | 4 ++-- 1 file changed, 2 insertions(+), 2 deletions(-) (limited to 'src/client/views/collections/collectionFreeForm/FormatShapePane.tsx') diff --git a/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx b/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx index adb71c6aa..a2600a2b3 100644 --- a/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx +++ b/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx @@ -256,10 +256,10 @@ export default class FormatShapePane extends AntimodeMenu { doc._height = (bottom2 - top2); doc._width = (right2 - left2); //if points move out of bounds - console.log(doc.x); + doc.x = oldx - (left - left2); doc.y = oldy - (top - top2); - console.log(doc.x); + } } } -- cgit v1.2.3-70-g09d2 From c40feda5e8799831e77639b24db2789d5ff8cdc3 Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Wed, 29 Jul 2020 22:09:07 -0400 Subject: fixed Pileup interactions - no double tap. shift to dra out items. --- src/client/documents/Documents.ts | 2 +- .../views/collections/CollectionPileView.tsx | 28 ++++++++++------------ src/client/views/collections/CollectionSubView.tsx | 8 +++++-- src/client/views/collections/CollectionView.tsx | 3 +-- .../collectionFreeForm/FormatShapePane.tsx | 12 +++++----- 5 files changed, 26 insertions(+), 27 deletions(-) (limited to 'src/client/views/collections/collectionFreeForm/FormatShapePane.tsx') diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts index ad19ea7b2..7e094089f 100644 --- a/src/client/documents/Documents.ts +++ b/src/client/documents/Documents.ts @@ -726,7 +726,7 @@ export namespace Docs { } export function PileDocument(documents: Array, options: DocumentOptions, id?: string) { - return InstanceFromProto(Prototypes.get(DocumentType.COL), new List(documents), { _chromeStatus: "collapsed", backgroundColor: "black", ...options, _viewType: CollectionViewType.Pile }, id); + return InstanceFromProto(Prototypes.get(DocumentType.COL), new List(documents), { _chromeStatus: "collapsed", backgroundColor: "black", hideFilterView: true, forceActive: true, ...options, _viewType: CollectionViewType.Pile }, id); } export function LinearDocument(documents: Array, options: DocumentOptions, id?: string) { diff --git a/src/client/views/collections/CollectionPileView.tsx b/src/client/views/collections/CollectionPileView.tsx index 22a3877ab..2e4055256 100644 --- a/src/client/views/collections/CollectionPileView.tsx +++ b/src/client/views/collections/CollectionPileView.tsx @@ -39,7 +39,15 @@ export class CollectionPileView extends CollectionSubView(doc => doc) { @computed get contents() { return
- + { + (doc instanceof Doc ? [doc] : doc).map((d) => DocUtils.iconify(d)); + return this.props.addDocument(doc); + }} + moveDocument={(doc: Doc | Doc[], targetCollection: Doc | undefined, addDoc: (doc: Doc | Doc[]) => boolean) => { + (doc instanceof Doc ? [doc] : doc).map((d) => Doc.deiconifyView(d)); + return this.props.moveDocument(doc, targetCollection, addDoc); + }} />
; } toggleStarburst = action(() => { @@ -72,24 +80,13 @@ export class CollectionPileView extends CollectionSubView(doc => doc) { } }); - @undoBatch - @action - onInternalDrop = (e: Event, de: DragManager.DropEvent) => { - if (super.onInternalDrop(e, de)) { - if (de.complete.docDragData) { - DocUtils.pileup(this.childDocs); - } - } - return true; - } - _undoBatch: UndoManager.Batch | undefined; pointerDown = (e: React.PointerEvent) => { let dist = 0; SnappingManager.SetIsDragging(true); // this._lastTap should be set to 0, and this._doubleTap should be set to false in the class header setupMoveUpEvents(this, e, (e: PointerEvent, down: number[], delta: number[]) => { - if (this.layoutEngine() === "pass" && this.childDocs.length && this.props.isSelected(true)) { + if (this.layoutEngine() === "pass" && this.childDocs.length && e.shiftKey) { dist += Math.sqrt(delta[0] * delta[0] + delta[1] * delta[1]); if (dist > 100) { if (!this._undoBatch) { @@ -110,11 +107,11 @@ export class CollectionPileView extends CollectionSubView(doc => doc) { if (!this.childDocs.length) { this.props.ContainingCollectionView?.removeDocument(this.props.Document); } - }, emptyFunction, false, this.layoutEngine() === "pass" && this.props.isSelected(true)); // this sets _doubleTap + }, emptyFunction, e.shiftKey && this.layoutEngine() === "pass", this.layoutEngine() === "pass" && e.shiftKey); // this sets _doubleTap } onClick = (e: React.MouseEvent) => { - if (e.button === 0 && this._doubleTap) { + if (e.button === 0) {//} && this._doubleTap) { SelectionManager.DeselectAll(); this.toggleStarburst(); e.stopPropagation(); @@ -124,7 +121,6 @@ export class CollectionPileView extends CollectionSubView(doc => doc) { render() { return
{this.contents}
; diff --git a/src/client/views/collections/CollectionSubView.tsx b/src/client/views/collections/CollectionSubView.tsx index 99acfdcc2..a89fcc703 100644 --- a/src/client/views/collections/CollectionSubView.tsx +++ b/src/client/views/collections/CollectionSubView.tsx @@ -195,7 +195,11 @@ export function CollectionSubView(schemaCtor: (doc: Doc) => T, moreProps?: const movedDocs = docDragData.droppedDocuments.filter((d, i) => docDragData.draggedDocuments[i] === d); const addedDocs = docDragData.droppedDocuments.filter((d, i) => docDragData.draggedDocuments[i] !== d); const res = addedDocs.length ? this.addDocument(addedDocs) : true; - added = movedDocs.length ? docDragData.moveDocument(movedDocs, this.props.Document, Doc.AreProtosEqual(Cast(movedDocs[0].annotationOn, Doc, null), this.props.Document) || de.embedKey || !this.props.isAnnotationOverlay ? this.addDocument : returnFalse) : res; + if (movedDocs.length) { + const canAdd = this.props.Document._viewType === CollectionViewType.Pile || de.embedKey || !this.props.isAnnotationOverlay || + Doc.AreProtosEqual(Cast(movedDocs[0].annotationOn, Doc, null), this.props.Document); + added = docDragData.moveDocument(movedDocs, this.props.Document, canAdd ? this.addDocument : returnFalse); + } else added = res; } else { added = this.addDocument(docDragData.droppedDocuments); } @@ -430,7 +434,7 @@ import { Docs, DocumentOptions, DocUtils } from "../../documents/Documents"; import { CurrentUserUtils } from "../../util/CurrentUserUtils"; import { DocumentType } from "../../documents/DocumentTypes"; import { FormattedTextBox, GoogleRef } from "../nodes/formattedText/FormattedTextBox"; -import { CollectionView } from "./CollectionView"; +import { CollectionView, CollectionViewType } from "./CollectionView"; import { SelectionManager } from "../../util/SelectionManager"; import { OverlayView } from "../OverlayView"; import { setTimeout } from "timers"; diff --git a/src/client/views/collections/CollectionView.tsx b/src/client/views/collections/CollectionView.tsx index 5a3396b68..42d320308 100644 --- a/src/client/views/collections/CollectionView.tsx +++ b/src/client/views/collections/CollectionView.tsx @@ -45,7 +45,6 @@ import { SubCollectionViewProps } from './CollectionSubView'; import { CollectionTimeView } from './CollectionTimeView'; import { CollectionTreeView } from "./CollectionTreeView"; import './CollectionView.scss'; -import CollectionMenu from './CollectionMenu'; import { ContextMenuProps } from '../ContextMenuItem'; const higflyout = require("@hig/flyout"); export const { anchorPoints } = higflyout; @@ -586,7 +585,7 @@ export class CollectionView extends Touchable } diff --git a/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx b/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx index cd5ca7fd4..ddc282e57 100644 --- a/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx +++ b/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx @@ -338,7 +338,7 @@ export default class FormatShapePane extends AntimodeMenu { colorButton(value: string, setter: () => {}) { return <> - @@ -347,14 +347,14 @@ export default class FormatShapePane extends AntimodeMenu { controlPointsButton() { return <> - - -

@@ -363,7 +363,7 @@ export default class FormatShapePane extends AntimodeMenu { lockRatioButton() { return <> -