From 7c93a65535a278dd1381b27fbd4c3869eed19527 Mon Sep 17 00:00:00 2001 From: yunahi <60233430+yunahi@users.noreply.github.com> Date: Fri, 3 Jul 2020 20:22:52 +0900 Subject: pin and icon --- .../collectionFreeForm/InkOptionsMenu.scss | 5 + .../collectionFreeForm/InkOptionsMenu.tsx | 267 ++++++++++++++------- 2 files changed, 179 insertions(+), 93 deletions(-) (limited to 'src/client/views/collections/collectionFreeForm') diff --git a/src/client/views/collections/collectionFreeForm/InkOptionsMenu.scss b/src/client/views/collections/collectionFreeForm/InkOptionsMenu.scss index a9fab4c1e..7329f4fc1 100644 --- a/src/client/views/collections/collectionFreeForm/InkOptionsMenu.scss +++ b/src/client/views/collections/collectionFreeForm/InkOptionsMenu.scss @@ -26,6 +26,11 @@ /* Make the buttons appear below each other */ } +.btn-draw { + display: inline; + /* Make the buttons appear below each other */ +} + .btn2-group { display: block; background: #323232; diff --git a/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx b/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx index f1032adaa..7de70b8cd 100644 --- a/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx +++ b/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx @@ -17,6 +17,7 @@ import { DocumentType } from "../../../documents/DocumentTypes"; import { FontAwesomeIcon } from "@fortawesome/react-fontawesome"; import { IconProp, library } from '@fortawesome/fontawesome-svg-core'; import { faBold, faItalic, faChevronLeft, faUnderline, faStrikethrough, faSubscript, faSuperscript, faIndent, faEyeDropper, faCaretDown, faPalette, faArrowsAlt, faHighlighter, faLink, faPaintRoller, faSleigh, faBars, faFillDrip, faBrush, faPenNib, faShapes, faArrowLeft, faEllipsisH, faBezierCurve, } from "@fortawesome/free-solid-svg-icons"; +import { Cast, StrCast, BoolCast } from "../../../../fields/Types"; library.add(faBold, faItalic, faChevronLeft, faUnderline, faStrikethrough, faSuperscript, faSubscript, faIndent, faEyeDropper, faCaretDown, faPalette, faArrowsAlt, faHighlighter, faLink, faPaintRoller, faBars, faFillDrip, faBrush, faPenNib, faShapes, faArrowLeft, faEllipsisH, faBezierCurve); @@ -28,36 +29,67 @@ export default class InkOptionsMenu extends AntimodeMenu { private _width = ["1", "5", "10", "100"]; // private _buttons = ["circle", "triangle", "rectangle", "arrow", "line"]; // private _icons = ["O", "∆", "ロ", "➜", "-"]; - private _buttons = ["circle", "triangle", "rectangle", "line", "noRec", "",]; - private _icons = ["O", "∆", "ロ", "⎯", "✖︎", " "]; + // private _buttons = ["circle", "triangle", "rectangle", "line", "noRec", "",]; + // private _icons = ["O", "∆", "ロ", "⎯⎯⎯", "✖︎", " "]; //arrowStart and arrowEnd must match and defs must exist in Inking Stroke - private _arrowStart = ["arrowHead", "arrowHead", "dot", "dot", "none"]; - private _arrowEnd = ["none", "arrowEnd", "none", "dot", "none"]; - private _arrowIcons = ["→", "↔︎", "•", "••", " "]; + // private _arrowStart = ["arrowHead", "arrowHead", "dot", "dot", "none"]; + // private _arrowEnd = ["none", "arrowEnd", "none", "dot", "none"]; + // private _arrowIcons = ["→", "↔︎", "•", "••", " "]; + private _draw = ["⎯", "→", "↔︎", "∿", "↝", "↭", "ロ", "O", "∆"]; + private _head = ["none", "arrowHead", "arrowHead", "none", "arrowHead", "arrowHead", "none", "none", "none"]; + private _end = ["none", "none", "arrowEnd", "none", "none", "arrowEnd", "none", "none", "none"]; + private _shape = ["", "", "", "", "", "", "rectangle", "circle", "triangle"]; + + @observable _shapesNum = this._shape.length; + @observable _selected = this._shapesNum; + + @observable private collapsed: boolean = false; @observable _colorBtn = false; @observable _widthBtn = false; @observable _fillBtn = false; - @observable _arrowBtn = false; - @observable _dashBtn = false; - @observable _shapeBtn = false; + // @observable _arrowBtn = false; + // @observable _dashBtn = false; + // @observable _shapeBtn = false; constructor(props: Readonly<{}>) { super(props); InkOptionsMenu.Instance = this; this._canFade = false; // don't let the inking menu fade away + this.Pinned = BoolCast(Doc.UserDoc()["inkOptionsMenu-pinned"]); + } - getColors = () => { - return this._palette; + @action + toggleMenuPin = (e: React.MouseEvent) => { + Doc.UserDoc()["inkOptionsMenu-pinned"] = this.Pinned = !this.Pinned; + if (!this.Pinned) { + // this.fadeOut(true); + } } @action - changeArrow = (arrowStart: string, arrowEnd: string) => { - SetActiveArrowStart(arrowStart); - SetActiveArrowEnd(arrowEnd); + protected toggleCollapse = (e: React.MouseEvent) => { + this.collapsed = !this.collapsed; + setTimeout(() => { + const x = Math.min(this._left, window.innerWidth - InkOptionsMenu.Instance.width); + InkOptionsMenu.Instance.jumpTo(x, this._top, true); + }, 0); + } + + + + + getColors = () => { + return this._palette; } + // @action + // changeArrow = (arrowStart: string, arrowEnd: string) => { + // SetActiveArrowStart(arrowStart); + // SetActiveArrowEnd(arrowEnd); + // } + @action changeColor = (color: string, type: string) => { const col: ColorState = { @@ -116,40 +148,77 @@ export default class InkOptionsMenu extends AntimodeMenu { this.editProperties(ActiveDash(), "dash"); } - @computed get arrowPicker() { - var currIcon; - for (var i = 0; i < this._arrowStart.length; i++) { - if (this._arrowStart[i] === ActiveArrowStart() && this._arrowEnd[i] === ActiveArrowEnd()) { - currIcon = this._arrowIcons[i]; - if (this._arrowIcons[i] === " ") { - currIcon = "➤"; - } - } - } - var arrowPicker = ; - if (this._arrowBtn) { - arrowPicker =
- {arrowPicker} - {this._arrowStart.map((arrowStart, i) => { - return ; - })} -
; - } - return arrowPicker; + @computed get drawButtons() { + const drawButtons =
+ {this._draw.map((icon, i) => { + return ; + })}
; + return drawButtons; } + // @computed get arrowPicker() { + // var currIcon; + // for (var i = 0; i < this._arrowStart.length; i++) { + // if (this._arrowStart[i] === ActiveArrowStart() && this._arrowEnd[i] === ActiveArrowEnd()) { + // currIcon = this._arrowIcons[i]; + // if (this._arrowIcons[i] === " ") { + // currIcon = "➤"; + // } + // } + // } + // var arrowPicker = ; + // if (this._arrowBtn) { + // arrowPicker =
+ // {arrowPicker} + // {this._arrowStart.map((arrowStart, i) => { + // return ; + // })} + //
; + // } + // return arrowPicker; + // } + @computed get widthPicker() { var widthPicker = ; - if (this._shapeBtn) { - shapePicker =
- {shapePicker} - {this._buttons.map((btn, i) => { - var ttl = btn; - if (btn === "") { - ttl = "no shape"; - } - if (btn === "noRec") { - ttl = "disable shape recognition"; - } - return ; - })} -
; - } - return shapePicker; - } + // @computed get shapePicker() { + // var currIcon; + // if (GestureOverlay.Instance.InkShape === "") { + // currIcon = ; + // } else { + // for (var i = 0; i < this._icons.length; i++) { + // if (GestureOverlay.Instance.InkShape === this._buttons[i]) { + // currIcon = this._icons[i]; + // } + // } + // } + // var shapePicker = ; + // if (this._shapeBtn) { + // shapePicker =
+ // {shapePicker} + // {this._buttons.map((btn, i) => { + // var ttl = btn; + // if (btn === "") { + // ttl = "no shape"; + // } + // if (btn === "noRec") { + // ttl = "disable shape recognition"; + // } + // return ; + // })} + //
; + // } + // return shapePicker; + // } @computed get bezierButton() { return , - this.shapePicker, - this.bezierButton, + // this.shapePicker, + // this.bezierButton, this.widthPicker, this.colorPicker, this.fillPicker, - this.arrowPicker, - this.dashButton, + this.drawButtons, + // this.arrowPicker, + // this.dashButton, + + ]; + + // return this.getElement(buttons); return this.getElement(buttons); } } Scripting.addGlobal(function activatePen(penBtn: any) { if (penBtn) { - Doc.SetSelectedTool(InkTool.Pen); + //no longer changes to inkmode + // Doc.SetSelectedTool(InkTool.Pen); InkOptionsMenu.Instance.jumpTo(300, 300); + InkOptionsMenu.Instance.Pinned = true; + } else { - Doc.SetSelectedTool(InkTool.None); + // Doc.SetSelectedTool(InkTool.None); + InkOptionsMenu.Instance.Pinned = false; InkOptionsMenu.Instance.fadeOut(true); + } }); \ No newline at end of file -- cgit v1.2.3-70-g09d2 From 3beca8e7d268dc7b67b20b2c8760ea5e4b6fdb88 Mon Sep 17 00:00:00 2001 From: anika-ahluwalia Date: Wed, 8 Jul 2020 18:59:37 -0500 Subject: added dashDragging event --- src/client/util/DragManager.ts | 48 ++++++++++++++++++++++ .../collectionFreeForm/CollectionFreeFormView.tsx | 15 +++++++ src/client/views/nodes/DocumentLinksButton.tsx | 2 +- 3 files changed, 64 insertions(+), 1 deletion(-) (limited to 'src/client/views/collections/collectionFreeForm') diff --git a/src/client/util/DragManager.ts b/src/client/util/DragManager.ts index 2ceafff30..64c3d8458 100644 --- a/src/client/util/DragManager.ts +++ b/src/client/util/DragManager.ts @@ -427,6 +427,54 @@ export namespace DragManager { }, dragData.droppedDocuments); } + const target = document.elementFromPoint(e.x, e.y); + + const complete = new DragCompleteEvent(false, dragData); + + if (target) { + target.dispatchEvent( + new CustomEvent("dashDragging", { + bubbles: true, + detail: { + shiftKey: e.shiftKey, + altKey: e.altKey, + metaKey: e.metaKey, + ctrlKey: e.ctrlKey, + clientX: e.clientX, + clientY: e.clientY, + dataTransfer: new DataTransfer, + button: e.button, + buttons: e.buttons, + getModifierState: e.getModifierState, + movementX: e.movementX, + movementY: e.movementY, + pageX: e.pageX, + pageY: e.pageY, + relatedTarget: e.relatedTarget, + screenX: e.screenX, + screenY: e.screenY, + detail: e.detail, + view: e.view ? e.view : new Window, + nativeEvent: new DragEvent("dashDragging"), + currentTarget: target, + target: target, + bubbles: true, + cancelable: true, + defaultPrevented: true, + eventPhase: e.eventPhase, + isTrusted: true, + preventDefault: e.preventDefault, + isDefaultPrevented: () => true, + stopPropagation: e.stopPropagation, + isPropagationStopped: () => true, + persist: emptyFunction, + timeStamp: e.timeStamp, + type: "dashDragging" + } + }) + ); + } + const { thisX, thisY } = snapDrag(e, xFromLeft, yFromTop, xFromRight, yFromBottom); const moveX = thisX - lastX; diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx index 9bf425db2..5a762a85c 100644 --- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx +++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx @@ -1143,10 +1143,19 @@ export class CollectionFreeFormView extends CollectionSubView this.doLayoutComputation, (elements) => this._layoutElements = elements || [], { fireImmediately: true, name: "doLayout" }); + + const handler = (e: Event) => this.handleDragging(e, (e as CustomEvent).detail); + + document.addEventListener("dashDragging", handler); } + componentWillUnmount() { this._layoutComputeReaction?.(); + + const handler = (e: Event) => this.handleDragging(e, (e as CustomEvent).detail); + document.removeEventListener("dashDragging", handler); } + @computed get views() { return this._layoutElements.filter(ele => ele.bounds && !ele.bounds.z).map(ele => ele.ele); } elementFunc = () => this._layoutElements; @@ -1155,6 +1164,12 @@ export class CollectionFreeFormView extends CollectionSubView { + console.log(de.clientX); + console.log(de.clientX); + } + promoteCollection = undoBatch(action(() => { const childDocs = this.childDocs.slice(); childDocs.forEach(doc => { diff --git a/src/client/views/nodes/DocumentLinksButton.tsx b/src/client/views/nodes/DocumentLinksButton.tsx index 7fb447cab..44e72215d 100644 --- a/src/client/views/nodes/DocumentLinksButton.tsx +++ b/src/client/views/nodes/DocumentLinksButton.tsx @@ -152,7 +152,7 @@ export class DocumentLinksButton extends React.Component
Date: Thu, 9 Jul 2020 01:54:29 -0500 Subject: started dragging pans screen (needs cleaning) --- src/client/util/LinkManager.ts | 2 + .../collectionFreeForm/CollectionFreeFormView.tsx | 105 ++++++++++++++++++--- 2 files changed, 96 insertions(+), 11 deletions(-) (limited to 'src/client/views/collections/collectionFreeForm') diff --git a/src/client/util/LinkManager.ts b/src/client/util/LinkManager.ts index 6da581f35..50f3fc1d6 100644 --- a/src/client/util/LinkManager.ts +++ b/src/client/util/LinkManager.ts @@ -3,6 +3,7 @@ import { List } from "../../fields/List"; import { listSpec } from "../../fields/Schema"; import { Cast, StrCast } from "../../fields/Types"; import { Scripting } from "./Scripting"; +import { undoBatch } from "./UndoManager"; /* * link doc: @@ -52,6 +53,7 @@ export class LinkManager { return false; } + @undoBatch public deleteLink(linkDoc: Doc): boolean { if (LinkManager.Instance.LinkManagerDoc && linkDoc instanceof Doc) { Doc.RemoveDocFromList(LinkManager.Instance.LinkManagerDoc, "data", linkDoc); diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx index 5a762a85c..a3d3a210d 100644 --- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx +++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx @@ -101,6 +101,10 @@ export class CollectionFreeFormView extends CollectionSubView(); + @observable _marqueeRef = React.createRef(); + @observable canPanX: boolean = true; + @observable canPanY: boolean = true; + @computed get fitToContentScaling() { return this.fitToContent ? NumCast(this.layoutDoc.fitToContentScaling, 1) : 1; } @computed get fitToContent() { return (this.props.fitToBox || this.Document._fitToBox) && !this.isAnnotationOverlay; } @computed get parentScaling() { return this.props.ContentScaling && this.fitToContent && !this.isAnnotationOverlay ? this.props.ContentScaling() : 1; } @@ -1164,10 +1168,87 @@ export class CollectionFreeFormView extends CollectionSubView + @action handleDragging = (e: Event, de: DragEvent) => { - console.log(de.clientX); - console.log(de.clientX); + + const nw = NumCast(this.Document._nativeWidth, this.props.NativeWidth()); + const nh = NumCast(this.Document._nativeHeight, this.props.NativeHeight()); + const hscale = nh ? this.props.PanelHeight() / nh : 1; + const wscale = nw ? this.props.PanelWidth() / nw : 1; + + if (this._marqueeRef) { + if (this._marqueeRef.current) { + + // console.log("left: " + this._marqueeRef.current.clientLeft); + // console.log("width: " + this._marqueeRef.current.clientWidth); + // console.log("client x: " + de.clientX); + + // console.log("top: " + this._marqueeRef.current.clientTop); + // console.log("height: " + this._marqueeRef.current.clientHeight); + // console.log("client y: " + de.clientY); + + + if (this._marqueeRef.current.clientWidth > 0) { + if (de.clientX - 315 - this._marqueeRef.current.clientLeft < 25) { + console.log("PAN left "); + if (this.canPanX) { + this.Document._panX = de.clientX - 20 - this._marqueeRef.current.clientLeft; + setTimeout(action(() => { + this.canPanX = true; + this.panX(); + }), 2500); + this.canPanX = false; + } + } else if (de.clientX - 315 - this._marqueeRef.current.clientLeft - + this._marqueeRef.current.clientWidth < 25) { + console.log("PAN right "); + if (this.canPanX) { + this.Document._panX = de.clientX - 315 - this._marqueeRef.current.clientLeft - + this._marqueeRef.current.clientWidth; + + setTimeout(action(() => { + this.panX(); + this.canPanX = true; + }), 2500); + this.canPanX = false; + } + + } + } + + if (this._marqueeRef.current.clientHeight > 0) { + if (de.clientY - 120 - this._marqueeRef.current.clientTop < 25) { + console.log("PAN top "); + if (this.canPanY) { + this.Document._panY = de.clientY - 20 - this._marqueeRef.current.clientTop; + setTimeout(action(() => { + this.canPanY = true; + this.panY(); + }), 2500); + this.canPanY = false; + } + } else if (de.clientY - 120 - this._marqueeRef.current.clientTop - + this._marqueeRef.current.clientHeight < 25) { + console.log("PAN bottom "); + if (this.canPanY) { + this.Document._panY = de.clientY - 120 - this._marqueeRef.current.clientTop - + this._marqueeRef.current.clientHeight; + + setTimeout(action(() => { + this.panY(); + this.canPanY = true; + }), 2500); + this.canPanY = false; + } + + } + + } + } + } } promoteCollection = undoBatch(action(() => { @@ -1351,7 +1432,8 @@ export class CollectionFreeFormView extends CollectionSubView - - {this.children} - +
+ + {this.children} +
{this.showTimeline ? : (null)} ; } -- cgit v1.2.3-70-g09d2 From 27b0f32460245539d77bcd435627a68364e0bc0d Mon Sep 17 00:00:00 2001 From: anika-ahluwalia Date: Thu, 9 Jul 2020 12:15:42 -0500 Subject: fixed linking undo issues --- .../collectionFreeForm/CollectionFreeFormView.tsx | 96 ++++++++++++---------- src/client/views/nodes/DocumentLinksButton.tsx | 6 +- .../views/nodes/formattedText/FormattedTextBox.tsx | 2 + 3 files changed, 57 insertions(+), 47 deletions(-) (limited to 'src/client/views/collections/collectionFreeForm') diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx index a3d3a210d..ffa4be4b9 100644 --- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx +++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx @@ -1174,47 +1174,55 @@ export class CollectionFreeFormView extends CollectionSubView { - const nw = NumCast(this.Document._nativeWidth, this.props.NativeWidth()); - const nh = NumCast(this.Document._nativeHeight, this.props.NativeHeight()); - const hscale = nh ? this.props.PanelHeight() / nh : 1; - const wscale = nw ? this.props.PanelWidth() / nw : 1; + const top = this.panX(); + const left = this.panY(); + + const size = this.getTransform().transformDirection(this.props.PanelWidth(), this.props.PanelHeight()); + + const scale = this.getLocalTransform().inverse().Scale; if (this._marqueeRef) { + if (this._marqueeRef.current) { + // console.log("top: " + this._marqueeRef.current.clientTop); // console.log("left: " + this._marqueeRef.current.clientLeft); // console.log("width: " + this._marqueeRef.current.clientWidth); - // console.log("client x: " + de.clientX); - - // console.log("top: " + this._marqueeRef.current.clientTop); // console.log("height: " + this._marqueeRef.current.clientHeight); - // console.log("client y: " + de.clientY); + + console.log("width: " + this._marqueeRef.current.getBoundingClientRect().width); + console.log("height: " + this._marqueeRef.current.getBoundingClientRect().width); + console.log("x: " + this._marqueeRef.current.getBoundingClientRect().x); + console.log("y: " + this._marqueeRef.current.getBoundingClientRect().y); + + // console.log("mouse x: " + de.screenX); + // console.log("mouse y: " + de.screenY); if (this._marqueeRef.current.clientWidth > 0) { if (de.clientX - 315 - this._marqueeRef.current.clientLeft < 25) { console.log("PAN left "); - if (this.canPanX) { - this.Document._panX = de.clientX - 20 - this._marqueeRef.current.clientLeft; - setTimeout(action(() => { - this.canPanX = true; - this.panX(); - }), 2500); - this.canPanX = false; - } + + // if (this.canPanX) { + // this.Document._panX = left - 5; + // setTimeout(action(() => { + // this.canPanX = true; + // this.panX(); + // }), 250); + // this.canPanX = false; + // } } else if (de.clientX - 315 - this._marqueeRef.current.clientLeft - this._marqueeRef.current.clientWidth < 25) { console.log("PAN right "); - if (this.canPanX) { - this.Document._panX = de.clientX - 315 - this._marqueeRef.current.clientLeft - - this._marqueeRef.current.clientWidth; - - setTimeout(action(() => { - this.panX(); - this.canPanX = true; - }), 2500); - this.canPanX = false; - } + + // if (this.canPanX) { + // this.Document._panX = left + 5; + // setTimeout(action(() => { + // this.panX(); + // this.canPanX = true; + // }), 250); + // this.canPanX = false; + // } } } @@ -1222,27 +1230,27 @@ export class CollectionFreeFormView extends CollectionSubView 0) { if (de.clientY - 120 - this._marqueeRef.current.clientTop < 25) { console.log("PAN top "); - if (this.canPanY) { - this.Document._panY = de.clientY - 20 - this._marqueeRef.current.clientTop; - setTimeout(action(() => { - this.canPanY = true; - this.panY(); - }), 2500); - this.canPanY = false; - } + + // if (this.canPanY) { + // this.Document._panY = top - 5; + // setTimeout(action(() => { + // this.canPanY = true; + // this.panY(); + // }), 250); + // this.canPanY = false; + // } } else if (de.clientY - 120 - this._marqueeRef.current.clientTop - this._marqueeRef.current.clientHeight < 25) { console.log("PAN bottom "); - if (this.canPanY) { - this.Document._panY = de.clientY - 120 - this._marqueeRef.current.clientTop - - this._marqueeRef.current.clientHeight; - - setTimeout(action(() => { - this.panY(); - this.canPanY = true; - }), 2500); - this.canPanY = false; - } + + // if (this.canPanY) { + // this.Document._panY = top + 5; + // setTimeout(action(() => { + // this.panY(); + // this.canPanY = true; + // }), 250); + // this.canPanY = false; + // } } diff --git a/src/client/views/nodes/DocumentLinksButton.tsx b/src/client/views/nodes/DocumentLinksButton.tsx index 44e72215d..ce96eddfe 100644 --- a/src/client/views/nodes/DocumentLinksButton.tsx +++ b/src/client/views/nodes/DocumentLinksButton.tsx @@ -3,7 +3,7 @@ import { observer } from "mobx-react"; import { Doc, DocListCast } from "../../../fields/Doc"; import { emptyFunction, setupMoveUpEvents, returnFalse } from "../../../Utils"; import { DragManager } from "../../util/DragManager"; -import { UndoManager } from "../../util/UndoManager"; +import { UndoManager, undoBatch } from "../../util/UndoManager"; import './DocumentLinksButton.scss'; import { DocumentView } from "./DocumentView"; import React = require("react"); @@ -29,7 +29,7 @@ export class DocumentLinksButton extends React.Component { if (this._linkButton.current !== null) { const linkDrag = UndoManager.StartBatch("Drag Link"); @@ -56,7 +56,7 @@ export class DocumentLinksButton extends React.Component { setupMoveUpEvents(this, e, this.onLinkButtonMoved, emptyFunction, action((e, doubleTap) => { if (doubleTap && this.props.InMenu) { diff --git a/src/client/views/nodes/formattedText/FormattedTextBox.tsx b/src/client/views/nodes/formattedText/FormattedTextBox.tsx index fc63dfbf5..30e0738bf 100644 --- a/src/client/views/nodes/formattedText/FormattedTextBox.tsx +++ b/src/client/views/nodes/formattedText/FormattedTextBox.tsx @@ -944,6 +944,8 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp frag.forEach(node => nodes.push(marker(node))); return Fragment.fromArray(nodes); } + + function addLinkMark(node: Node, title: string, linkId: string) { if (!node.isText) { const content = addMarkToFrag(node.content, (node: Node) => addLinkMark(node, title, linkId)); -- cgit v1.2.3-70-g09d2 From f774d6953d23dda9b8b20ed24b64e28607d3d88c Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Thu, 9 Jul 2020 14:53:52 -0400 Subject: fixed auto panning in collectionview. --- .../collectionFreeForm/CollectionFreeFormView.tsx | 124 +++++++++------------ 1 file changed, 51 insertions(+), 73 deletions(-) (limited to 'src/client/views/collections/collectionFreeForm') diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx index ffa4be4b9..7a7505319 100644 --- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx +++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx @@ -1172,89 +1172,67 @@ export class CollectionFreeFormView extends CollectionSubView @action - handleDragging = (e: Event, de: DragEvent) => { + handleDragging = (e: CustomEvent, de: DragEvent) => { const top = this.panX(); const left = this.panY(); const size = this.getTransform().transformDirection(this.props.PanelWidth(), this.props.PanelHeight()); - const scale = this.getLocalTransform().inverse().Scale; - if (this._marqueeRef) { - - if (this._marqueeRef.current) { - - // console.log("top: " + this._marqueeRef.current.clientTop); - // console.log("left: " + this._marqueeRef.current.clientLeft); - // console.log("width: " + this._marqueeRef.current.clientWidth); - // console.log("height: " + this._marqueeRef.current.clientHeight); - - console.log("width: " + this._marqueeRef.current.getBoundingClientRect().width); - console.log("height: " + this._marqueeRef.current.getBoundingClientRect().width); - console.log("x: " + this._marqueeRef.current.getBoundingClientRect().x); - console.log("y: " + this._marqueeRef.current.getBoundingClientRect().y); - - // console.log("mouse x: " + de.screenX); - // console.log("mouse y: " + de.screenY); - - - if (this._marqueeRef.current.clientWidth > 0) { - if (de.clientX - 315 - this._marqueeRef.current.clientLeft < 25) { - console.log("PAN left "); - - // if (this.canPanX) { - // this.Document._panX = left - 5; - // setTimeout(action(() => { - // this.canPanX = true; - // this.panX(); - // }), 250); - // this.canPanX = false; - // } - } else if (de.clientX - 315 - this._marqueeRef.current.clientLeft - - this._marqueeRef.current.clientWidth < 25) { - console.log("PAN right "); - - // if (this.canPanX) { - // this.Document._panX = left + 5; - // setTimeout(action(() => { - // this.panX(); - // this.canPanX = true; - // }), 250); - // this.canPanX = false; - // } - - } - } + if (this._marqueeRef?.current) { + const dragX = e.detail.clientX; + const dragY = e.detail.clientY; + const bounds = this._marqueeRef.current?.getBoundingClientRect()!; + + if (dragX - bounds.left < 25) { + console.log("PAN left "); + + // if (this.canPanX) { + // this.Document._panX = left - 5; + // setTimeout(action(() => { + // this.canPanX = true; + // this.panX(); + // }), 250); + // this.canPanX = false; + // } + } else if (bounds.right - dragX < 25) { + console.log("PAN right "); + + // if (this.canPanX) { + // this.Document._panX = left + 5; + // setTimeout(action(() => { + // this.panX(); + // this.canPanX = true; + // }), 250); + // this.canPanX = false; + // } - if (this._marqueeRef.current.clientHeight > 0) { - if (de.clientY - 120 - this._marqueeRef.current.clientTop < 25) { - console.log("PAN top "); - - // if (this.canPanY) { - // this.Document._panY = top - 5; - // setTimeout(action(() => { - // this.canPanY = true; - // this.panY(); - // }), 250); - // this.canPanY = false; - // } - } else if (de.clientY - 120 - this._marqueeRef.current.clientTop - - this._marqueeRef.current.clientHeight < 25) { - console.log("PAN bottom "); - - // if (this.canPanY) { - // this.Document._panY = top + 5; - // setTimeout(action(() => { - // this.panY(); - // this.canPanY = true; - // }), 250); - // this.canPanY = false; - // } + } - } + if (dragY - bounds.top < 25) { + console.log("PAN top "); + + // if (this.canPanY) { + // this.Document._panY = top - 5; + // setTimeout(action(() => { + // this.canPanY = true; + // this.panY(); + // }), 250); + // this.canPanY = false; + // } + } else if (bounds.bottom - dragY < 25) { + console.log("PAN bottom "); + + // if (this.canPanY) { + // this.Document._panY = top + 5; + // setTimeout(action(() => { + // this.panY(); + // this.canPanY = true; + // }), 250); + // this.canPanY = false; + // } - } } } } -- cgit v1.2.3-70-g09d2 From 065a29e87c771b5cd9301b0468fb036e070cad17 Mon Sep 17 00:00:00 2001 From: yunahi <60233430+yunahi@users.noreply.github.com> Date: Fri, 10 Jul 2020 05:08:53 +0900 Subject: added format shape --- src/client/documents/Documents.ts | 3 +- src/client/util/InteractionUtils.tsx | 8 + src/client/util/SelectionManager.ts | 5 + src/client/views/AntimodeMenu.tsx | 18 + src/client/views/ContextMenu.tsx | 1 + src/client/views/DocumentDecorations.tsx | 2 + src/client/views/GestureOverlay.tsx | 17 +- src/client/views/InkingStroke.tsx | 15 +- src/client/views/MainView.tsx | 13 +- .../collectionFreeForm/FormatShapePane.scss | 53 ++ .../collectionFreeForm/FormatShapePane.tsx | 996 +++++++++++++++++++++ .../collectionFreeForm/InkOptionsMenu.scss | 2 +- .../collectionFreeForm/InkOptionsMenu.tsx | 40 +- 13 files changed, 1152 insertions(+), 21 deletions(-) create mode 100644 src/client/views/collections/collectionFreeForm/FormatShapePane.scss create mode 100644 src/client/views/collections/collectionFreeForm/FormatShapePane.tsx (limited to 'src/client/views/collections/collectionFreeForm') diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts index b70971c2d..eb8e04317 100644 --- a/src/client/documents/Documents.ts +++ b/src/client/documents/Documents.ts @@ -653,7 +653,7 @@ export namespace Docs { I.type = DocumentType.INK; I.layout = InkingStroke.LayoutString("data"); I.color = color; - I.strokeWidth = strokeWidth; + I.strokeWidth = Number(strokeWidth); I.strokeBezier = strokeBezier; I.fillColor = fillColor; I.arrowStart = arrowStart; @@ -667,6 +667,7 @@ export namespace Docs { I._width = options._width; I._height = options._height; I.author = Doc.CurrentUserEmail; + I.rotation = 0; I.data = new InkField(points); return I; // return I; diff --git a/src/client/util/InteractionUtils.tsx b/src/client/util/InteractionUtils.tsx index edeb461e0..2883e2056 100644 --- a/src/client/util/InteractionUtils.tsx +++ b/src/client/util/InteractionUtils.tsx @@ -3,6 +3,7 @@ import * as beziercurve from 'bezier-curve'; import * as fitCurve from 'fit-curve'; import "./InteractionUtils.scss"; import { Utils } from "../../Utils"; +import InkOptionsMenu from "../views/collections/collectionFreeForm/InkOptionsMenu"; export namespace InteractionUtils { export const MOUSETYPE = "mouse"; @@ -94,6 +95,13 @@ export namespace InteractionUtils { export function CreatePolyline(points: { X: number, Y: number }[], left: number, top: number, color: string, width: number, strokeWidth: number, bezier: string, fill: string, arrowStart: string, arrowEnd: string, dash: string, scalex: number, scaley: number, shape: string, pevents: string, drawHalo: boolean, nodefs: boolean) { + + // if (InkOptionsMenu.Instance.Pinned) { + // for (var i = 0; i < points.length; i++) { + // points[i].Y -= 35; + // } + // } + let pts: { X: number; Y: number; }[] = []; if (shape) { //if any of the shape are true pts = makePolygon(shape, points); diff --git a/src/client/util/SelectionManager.ts b/src/client/util/SelectionManager.ts index 024532f90..aea2c542b 100644 --- a/src/client/util/SelectionManager.ts +++ b/src/client/util/SelectionManager.ts @@ -5,6 +5,7 @@ import { computedFn } from "mobx-utils"; import { List } from "../../fields/List"; import { Scripting } from "./Scripting"; import { DocumentManager } from "./DocumentManager"; +import FormatShapePane from "../views/collections/collectionFreeForm/FormatShapePane"; export namespace SelectionManager { @@ -14,6 +15,8 @@ export namespace SelectionManager { SelectedDocuments: ObservableMap = new ObservableMap(); @action SelectDoc(docView: DocumentView, ctrlPressed: boolean): void { + console.log("select" + ); // if doc is not in SelectedDocuments, add it if (!manager.SelectedDocuments.get(docView)) { if (!ctrlPressed) { @@ -29,6 +32,8 @@ export namespace SelectionManager { manager.SelectedDocuments.set(docView, true); } Doc.UserDoc().activeSelection = new List(SelectionManager.SelectedDocuments().map(dv => dv.props.Document)); + FormatShapePane.Instance.selected(); + } @action DeselectDoc(docView: DocumentView): void { diff --git a/src/client/views/AntimodeMenu.tsx b/src/client/views/AntimodeMenu.tsx index d83ac434c..cb6de1785 100644 --- a/src/client/views/AntimodeMenu.tsx +++ b/src/client/views/AntimodeMenu.tsx @@ -1,6 +1,7 @@ import React = require("react"); import { observable, action } from "mobx"; import "./AntimodeMenu.scss"; +import { inherits } from "util"; /** * This is an abstract class that serves as the base for a PDF-style or Marquee-style @@ -147,6 +148,23 @@ export default abstract class AntimodeMenu extends React.Component { ); } + protected getElementVert(buttons: JSX.Element[]) { + return ( +
+ {buttons} +
+ ); + } + protected getElementWithRows(rows: JSX.Element[], numRows: number, hasDragger: boolean = true) { diff --git a/src/client/views/ContextMenu.tsx b/src/client/views/ContextMenu.tsx index 941d7b44a..1a6b7ab90 100644 --- a/src/client/views/ContextMenu.tsx +++ b/src/client/views/ContextMenu.tsx @@ -224,6 +224,7 @@ export class ContextMenu extends React.Component { } render() { + console.log("context"); if (!this._display) { return null; } diff --git a/src/client/views/DocumentDecorations.tsx b/src/client/views/DocumentDecorations.tsx index 4fda10926..8edd4c4a9 100644 --- a/src/client/views/DocumentDecorations.tsx +++ b/src/client/views/DocumentDecorations.tsx @@ -293,6 +293,8 @@ export class DocumentDecorations extends React.Component<{}, { value: string }> SelectionManager.SelectedDocuments().forEach(action((element: DocumentView) => { const doc = Document(element.rootDoc); if (doc.type === DocumentType.INK && doc.x && doc.y && doc._width && doc._height && doc.data) { + doc.rotation = Number(doc.rotation) + Number(angle); + console.log(doc.rotation); const ink = Cast(doc.data, InkField)?.inkData; if (ink) { diff --git a/src/client/views/GestureOverlay.tsx b/src/client/views/GestureOverlay.tsx index bfd659207..26a06090b 100644 --- a/src/client/views/GestureOverlay.tsx +++ b/src/client/views/GestureOverlay.tsx @@ -633,7 +633,8 @@ export default class GestureOverlay extends Touchable { this.makePolygon(this.InkShape, false); this.dispatchGesture(GestureUtils.Gestures.Stroke); this._points = []; - if (this.InkShape !== "noRec") { + if (InkOptionsMenu.Instance._double === "") { + this.InkShape = ""; } } @@ -687,12 +688,14 @@ export default class GestureOverlay extends Touchable { } //get out of ink mode after each stroke= console.log("now"); - Doc.SetSelectedTool(InkTool.None); - InkOptionsMenu.Instance._selected = InkOptionsMenu.Instance._shapesNum; - SetActiveArrowStart("none"); - GestureOverlay.Instance.SavedArrowStart = ActiveArrowStart(); - SetActiveArrowEnd("none"); - GestureOverlay.Instance.SavedArrowEnd = ActiveArrowEnd(); + if (InkOptionsMenu.Instance._double === "") { + Doc.SetSelectedTool(InkTool.None); + InkOptionsMenu.Instance._selected = InkOptionsMenu.Instance._shapesNum; + SetActiveArrowStart("none"); + GestureOverlay.Instance.SavedArrowStart = ActiveArrowStart(); + SetActiveArrowEnd("none"); + GestureOverlay.Instance.SavedArrowEnd = ActiveArrowEnd(); + } document.removeEventListener("pointermove", this.onPointerMove); document.removeEventListener("pointerup", this.onPointerUp); diff --git a/src/client/views/InkingStroke.tsx b/src/client/views/InkingStroke.tsx index c32e76cec..4a7ec40be 100644 --- a/src/client/views/InkingStroke.tsx +++ b/src/client/views/InkingStroke.tsx @@ -15,6 +15,8 @@ import { FieldView, FieldViewProps } from "./nodes/FieldView"; import React = require("react"); import { Scripting } from "../util/Scripting"; import { Doc } from "../../fields/Doc"; +import FormatShapePane from "./collections/collectionFreeForm/FormatShapePane"; +import { action } from "mobx"; library.add(faPaintBrush); @@ -38,10 +40,19 @@ export class InkingStroke extends ViewBoxBaseComponent { + console.log("Clicked"); + FormatShapePane.Instance.Pinned = true; + FormatShapePane.Instance.selected(); + + } + render() { TraceMobx(); const data: InkData = Cast(this.dataDoc[this.fieldKey], InkField)?.inkData ?? []; - const strokeWidth = Number(StrCast(this.layoutDoc.strokeWidth, ActiveInkWidth())); + // const strokeWidth = Number(StrCast(this.layoutDoc.strokeWidth, ActiveInkWidth())); + const strokeWidth = Number(this.layoutDoc.strokeWidth); const xs = data.map(p => p.X); const ys = data.map(p => p.Y); const left = Math.min(...xs) - strokeWidth / 2; @@ -74,6 +85,8 @@ export class InkingStroke extends ViewBoxBaseComponent { ContextMenu.Instance.addItem({ description: "Analyze Stroke", event: this.analyzeStrokes, icon: "paint-brush" }); ContextMenu.Instance.addItem({ description: "Make Mask", event: this.makeMask, icon: "paint-brush" }); + ContextMenu.Instance.addItem({ description: "Format Shape", event: this.formatShape, icon: "paint-brush" }); + }} > diff --git a/src/client/views/MainView.tsx b/src/client/views/MainView.tsx index afdff4ed8..3eed44654 100644 --- a/src/client/views/MainView.tsx +++ b/src/client/views/MainView.tsx @@ -58,7 +58,7 @@ import { DocumentManager } from '../util/DocumentManager'; import { DocumentLinksButton } from './nodes/DocumentLinksButton'; import { LinkMenu } from './linking/LinkMenu'; import { LinkDocPreview } from './nodes/LinkDocPreview'; - +import FormatShapePane from "./collections/collectionFreeForm/FormatShapePane"; @observer export class MainView extends React.Component { public static Instance: MainView; @@ -453,12 +453,13 @@ export class MainView extends React.Component { @computed get mainContent() { const sidebar = this.userDoc?.["tabs-panelContainer"]; - console.log(InkOptionsMenu.Instance?.Pinned); + console.log('${ ANTIMODEMENU_HEIGHT }'); return !this.userDoc || !(sidebar instanceof Doc) ? (null) : (
@@ -597,7 +598,10 @@ export class MainView extends React.Component { + + + {this.mainContent} @@ -608,6 +612,7 @@ export class MainView extends React.Component { linkDoc={LinkDocPreview.LinkInfo.linkDoc} linkSrc={LinkDocPreview.LinkInfo.linkSrc} href={LinkDocPreview.LinkInfo.href} addDocTab={LinkDocPreview.LinkInfo.addDocTab} /> : (null)} + diff --git a/src/client/views/collections/collectionFreeForm/FormatShapePane.scss b/src/client/views/collections/collectionFreeForm/FormatShapePane.scss new file mode 100644 index 000000000..5789c6c75 --- /dev/null +++ b/src/client/views/collections/collectionFreeForm/FormatShapePane.scss @@ -0,0 +1,53 @@ +.antimodeMenu-button { + width: 200px; + + .color-previewI { + width: 100%; + height: 40%; + } + + .color-previewII { + width: 100%; + height: 100%; + } + + +} + +.sketch-picker { + background: #323232; + + .flexbox-fit { + background: #323232; + } +} + +.btn-group { + display: grid; + grid-template-columns: auto auto auto auto; + /* Make the buttons appear below each other */ +} + +.btn-group-palette { + display: block; + /* Make the buttons appear below each other */ +} + +.btn-draw { + display: inline; + /* Make the buttons appear below each other */ +} + +.btn2-group { + display: block; + background: #323232; + grid-template-columns: auto; + + /* Make the buttons appear below each other */ + .antimodeMenu-button { + background: #323232; + display: block; + + + } +} \ No newline at end of file diff --git a/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx b/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx new file mode 100644 index 000000000..7b47b7ca4 --- /dev/null +++ b/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx @@ -0,0 +1,996 @@ +import React = require("react"); +import AntimodeMenu from "../../AntimodeMenu"; +import { observer } from "mobx-react"; +import { observable, action, computed } from "mobx"; +import "./FormatShapePane.scss"; +import { ActiveInkColor, ActiveInkBezierApprox, ActiveFillColor, ActiveArrowStart, ActiveArrowEnd, SetActiveInkWidth, SetActiveInkColor, SetActiveBezierApprox, SetActiveFillColor, SetActiveArrowStart, SetActiveArrowEnd, ActiveDash, SetActiveDash } from "../../InkingStroke"; +import { Scripting } from "../../../util/Scripting"; +import { InkTool, InkField } from "../../../../fields/InkField"; +import { ColorState } from "react-color"; +import { Utils } from "../../../../Utils"; +import GestureOverlay from "../../GestureOverlay"; +import { Doc } from "../../../../fields/Doc"; +import { SelectionManager } from "../../../util/SelectionManager"; +import { DocumentView } from "../../../views/nodes/DocumentView"; +import { Document } from "../../../../fields/documentSchemas"; +import { DocumentType } from "../../../documents/DocumentTypes"; +import { FontAwesomeIcon } from "@fortawesome/react-fontawesome"; +import { IconProp, library } from '@fortawesome/fontawesome-svg-core'; +import { faRulerCombined, faFillDrip, faPenNib } from "@fortawesome/free-solid-svg-icons"; +import { Cast, StrCast, BoolCast, NumCast } from "../../../../fields/Types"; +import e = require("express"); +import { ChangeEvent } from "mongodb"; +import { black } from "colors"; + + +library.add(faRulerCombined, faFillDrip, faPenNib); + +@observer +export default class FormatShapePane extends AntimodeMenu { + static Instance: FormatShapePane; + + private _palette = ["#D0021B", "#F5A623", "#F8E71C", "#8B572A", "#7ED321", "#417505", "#9013FE", "#4A90E2", "#50E3C2", "#B8E986", "#000000", "#4A4A4A", "#9B9B9B", "#FFFFFF"]; + private _width = ["1", "5", "10", "100"]; + private _mode = ["fill-drip", "ruler-combined"]; + private _subMenu = ["fill", "line", "size", "position"]; + private _headIcon = ["⎯", "←"]; + private _endIcon = ["⎯", "→"]; + private _head = ["none", "arrowHead"]; + private _end = ["none", "arrowEnd"]; + + @observable private _subOpen = [false, false, false, false]; + + @observable private collapsed: boolean = false; + @observable private currMode: string = "fill-drip"; + @observable _fillBtn = false; + @observable _lineBtn = false; + + @observable _selectDoc: DocumentView[] = []; + + @observable _noFill = false; + @observable _solidFill = false; + @observable _noLine = false; + @observable _solidLine = false; + @observable _dashLine = false; + @observable _lock = false; + + @observable _multiple = false; + + @observable _widthBtn = false; + + @observable _currWidth = "10"; + + @observable _single = false; + @observable _currFill = "#D0021B"; + @observable _currColor = "#D0021B"; + + @observable _arrowHead = false; + @observable _arrowEnd = false; + + + @observable _currSizeHeight = "10"; + @observable _currSizeWidth = "10"; + @observable _currRotation = "10"; + + @observable _currPositionHorizontal = "10"; + @observable _currPositionVertical = "10"; + + + constructor(props: Readonly<{}>) { + super(props); + FormatShapePane.Instance = this; + this._canFade = false; // don't let the inking menu fade away + this.Pinned = BoolCast(Doc.UserDoc()["formatShapePane-pinned"]); + + } + + @action + toggleMenuPin = (e: React.MouseEvent) => { + Doc.UserDoc()["formatShapePane-pinned"] = this.Pinned = !this.Pinned; + if (!this.Pinned) { + // this.fadeOut(true); + } + } + + @action + protected toggleCollapse = (e: React.MouseEvent) => { + this.collapsed = !this.collapsed; + setTimeout(() => { + const x = Math.min(this._left, window.innerWidth - FormatShapePane.Instance.width); + FormatShapePane.Instance.jumpTo(x, this._top, true); + }, 0); + } + + @action + closePane = () => { + this.jumpTo(-300, -300); + this.Pinned = false; + + } + + @action + checkSame = () => { + const docs = SelectionManager.SelectedDocuments(); + const inks: DocumentView[] = []; + for (var i = 0; i < docs.length; i++) { + if (Document(docs[i].rootDoc).type === DocumentType.INK) { + inks.push(docs[i]); + } + } + const firstWidth = Document(inks[0].rootDoc).strokeWidth; + const firstColor = Document(inks[0].rootDoc).color; + const firstFill = Document(inks[0].rootDoc).fillColor; + // const firstBezier + const firstRotation = Document(inks[0].rootDoc).rotation; + const firstArrowStart = Document(inks[0].rootDoc).arrowStart; + const firstArrowEnd = Document(inks[0].rootDoc).arrowEnd; + const firstDash = Document(inks[0].rootDoc).dash; + const firstWidthSize = Document(inks[0].rootDoc)._width; + const firstHeightSize = Document(inks[0].rootDoc)._height; + const firstHorizontal = Document(inks[0].rootDoc).x; + const firstVertical = Document(inks[0].rootDoc).y; + this._noFill = Document(inks[0].rootDoc).fillColor === "none" ? true : false; + this._solidFill = Document(inks[0].rootDoc).fillColor === "none" ? false : true; + this._noLine = Document(inks[0].rootDoc).color === "none" ? true : false; + if (Document(inks[0].rootDoc).color !== "none") { + this._solidLine = true; + this._dashLine = true; + if (Document(inks[0].rootDoc).dash === "0") { + this._dashLine = false; + } else { + this._solidLine = false; + + } + } + // this._solidLine = (Document(inks[0].rootDoc).color === "none") ? false : Document(inks[0].rootDoc).dash === 0 ? true : false; + // this._dashLine = (Document(inks[0].rootDoc).color === "none") ? false : Document(inks[0].rootDoc).dash !== 0 ? true : false; + // // this._widthBtn = false; + this._currWidth = String(Document(inks[0].rootDoc).strokeWidth); + // this._single = false; + this._currFill = String(Document(inks[0].rootDoc).fillColor); + this._currColor = String(Document(inks[0].rootDoc).color); + this._arrowHead = Document(inks[0].rootDoc).arrowStart === "none" ? false : true; + this._arrowEnd = Document(inks[0].rootDoc).arrowEnd === "none" ? false : true; + this._currSizeHeight = String(Document(inks[0].rootDoc)._height); + this._currSizeWidth = String(Document(inks[0].rootDoc)._width); + this._currRotation = String(Document(inks[0].rootDoc).rotation); + this._currPositionHorizontal = String(Document(inks[0].rootDoc).x); + this._currPositionVertical = String(Document(inks[0].rootDoc).y); + for (var i = 0; i < inks.length; i++) { + if (Document(inks[i].rootDoc).strokeWidth !== firstWidth) { + this._currWidth = ""; + } + if (Document(inks[i].rootDoc).color !== firstColor) { + this._noLine = false; + this._solidLine = false; + this._dashLine = false; + } + if (Document(inks[i].rootDoc).fillColor !== firstFill) { + this._solidFill = false; + this._noFill = false; + } + if (Document(inks[i].rootDoc).arrowStart !== firstArrowStart) { + this._arrowHead = false; + } + if (Document(inks[i].rootDoc).arrowEnd !== firstArrowEnd) { + this._arrowEnd = false; + } + if (Document(inks[i].rootDoc).x !== firstHorizontal) { + this._currPositionHorizontal = ""; + } + if (Document(inks[i].rootDoc).y !== firstVertical) { + this._currPositionVertical = ""; + } + if (Document(inks[i].rootDoc)._width !== firstWidthSize) { + this._currSizeWidth = ""; + } + if (Document(inks[i].rootDoc)._height !== firstHeightSize) { + this._currSizeHeight = ""; + } + if (Document(inks[i].rootDoc).rotation !== firstRotation) { + this._currRotation = ""; + } + } + + + + } + + @action + upDownButtons = (dirs: string, field: string) => { + SelectionManager.SelectedDocuments().forEach(action((element: DocumentView) => { + const doc = Document(element.rootDoc); + if (doc.type === DocumentType.INK) { + switch (field) { + case "width": + if (doc.strokeWidth) { + doc.strokeWidth = dirs === "up" ? doc.strokeWidth + 1 : doc.strokeWidth - 1; + SetActiveInkWidth(String(doc.strokeWidth)); + + } + break; + case "sizeWidth": + if (doc._width && doc._height) { + const oldWidth = doc._width; + const oldHeight = doc._height; + + doc._width = dirs === "up" ? doc._width + 10 : doc._width - 10; + if (this._lock) { + doc._height = (doc._width * oldHeight) / oldWidth; + } + } + break; + case "sizeHeight": + if (doc._width && doc._height) { + const oldWidth = doc._width; + const oldHeight = doc._height; + doc._height = dirs === "up" ? doc._height + 10 : doc._height - 10; + if (this._lock) { + doc._width = (doc._height * oldWidth) / oldHeight; + } + } + break; + case "horizontal": + if (doc.x) { + doc.x = dirs === "up" ? doc.x + 10 : doc.x - 10; + } + break; + case "vertical": + if (doc.y) { + doc.y = dirs === "up" ? doc.y + 10 : doc.y - 10; + } + case "rotation": + + this.rotate(dirs === "up" ? Number(doc.rotation) + Number(0.1) : Number(doc.rotation) - Number(0.1)); + + break; + default: + break; + } + this.selected(); + + } + })); + } + + @action + editProperties = (value: any, field: string) => { + SelectionManager.SelectedDocuments().forEach(action((element: DocumentView) => { + const doc = Document(element.rootDoc); + if (doc.type === DocumentType.INK) { + switch (field) { + case "width": + SetActiveInkWidth(value); + doc.strokeWidth = Number(value); + break; + case "color": + doc.color = String(value); + break; + case "fill": + doc.fillColor = String(value); + break; + case "bezier": + // doc.strokeBezier === 300 ? doc.strokeBezier = 0 : doc.strokeBezier = 300; + break; + case "arrowStart": + doc.arrowStart = String(value); + break; + case "arrowEnd": + doc.arrowEnd = String(value); + break; + case "dash": + doc.dash = String(value); + break; + case "widthSize": + if (doc._width && doc._height) { + const oldWidth = doc._width; + const oldHeight = doc._height; + + doc._width = Number(value); + if (this._lock) { + doc._height = (doc._width * oldHeight) / oldWidth; + } + } + break; + case "heightSize": + if (doc._width && doc._height) { + const oldWidth = doc._width; + const oldHeight = doc._height; + + doc._height = Number(value); + if (this._lock) { + doc._width = (doc._height * oldWidth) / oldHeight; + } + } + break; + case "horizontal": + doc.x = Number(value); + break; + case "vertical": + doc.y = Number(value); + + break; + default: + break; + } + } + this.selected(); + })); + this.checkSame(); + + } + + @computed get close() { + const close = ; + return close; + } + + @computed get modes() { + const modes =
+ {this._mode.map(mode => { + return ; + }) + }
; + return modes; + } + + @action + selected = () => { + this._selectDoc = SelectionManager.SelectedDocuments(); + if (this._selectDoc.length === 1 && Document(this._selectDoc[0].rootDoc).type === DocumentType.INK) { + this._single = true; + const doc = Document(this._selectDoc[0].rootDoc); + if (doc.type === DocumentType.INK) { + console.log(doc.fillColor); + if (doc.fillColor === "none") { + this._noFill = true; + this._solidFill = false; + } else { + this._solidFill = true; + this._noFill = false; + this._currFill = String(doc.fillColor); + } + if (doc.color === "none") { + this._noLine = true; + this._solidLine = false; + this._dashLine = false; + } else { + console.log(doc.strokeWidth); + this._currWidth = String(doc.strokeWidth); + this._currColor = String(doc.color); + if (doc.dash === "0") { + this._solidLine = true; + this._noLine = false; + this._dashLine = false; + } else { + this._dashLine = true; + this._noLine = false; + this._solidLine = false; + } + + this._arrowHead = doc.arrowStart === "none" ? false : true; + this._arrowEnd = doc.arrowEnd === "none" ? false : true; + + + this._currPositionHorizontal = String(doc.x); + this._currPositionVertical = String(doc.y); + console.log(doc.rotation); + this._currRotation = String(doc.rotation); + this._currSizeHeight = String(doc._height); + this._currSizeWidth = String(doc._width); + } + + } + } else { + this._noFill = false; + this._solidFill = false; + this._single = false; + this._currFill = "#D0021B"; + this._noLine = false; + this._solidLine = false; + this._dashLine = false; + this._currColor = "#D0021B"; + this._arrowHead = false; + this._arrowEnd = false; + this._currPositionHorizontal = ""; + this._currPositionVertical = ""; + this._currRotation = ""; + this._currSizeHeight = ""; + this._currSizeWidth = ""; + } + this.checkSame(); + } + + @action + rotate = (degrees: number) => { + SelectionManager.SelectedDocuments().forEach(action((element: DocumentView) => { + const doc = Document(element.rootDoc); + if (doc.type === DocumentType.INK && doc.x && doc.y && doc._width && doc._height && doc.data) { + // doc.rotation = (Number(doc.rotation) + (Number(angle) * 180 / Math.PI)); + // console.log(doc.rotation); + const angle = Number(degrees) - Number(doc.rotation); + doc.rotation = Number(degrees); + const ink = Cast(doc.data, InkField)?.inkData; + if (ink) { + const xs = ink.map(p => p.X); + const ys = ink.map(p => p.Y); + const left = Math.min(...xs); + const top = Math.min(...ys); + const right = Math.max(...xs); + const bottom = Math.max(...ys); + const _centerPoints: { X: number, Y: number }[] = []; + _centerPoints.push({ X: left, Y: top }); + + const newPoints: { X: number, Y: number }[] = []; + for (var i = 0; i < ink.length; i++) { + const newX = Math.cos(angle) * (ink[i].X - _centerPoints[0].X) - Math.sin(angle) * (ink[i].Y - _centerPoints[0].Y) + _centerPoints[0].X; + const newY = Math.sin(angle) * (ink[i].X - _centerPoints[0].X) + Math.cos(angle) * (ink[i].Y - _centerPoints[0].Y) + _centerPoints[0].Y; + newPoints.push({ X: newX, Y: newY }); + } + doc.data = new InkField(newPoints); + const xs2 = newPoints.map(p => p.X); + const ys2 = newPoints.map(p => p.Y); + const left2 = Math.min(...xs2); + const top2 = Math.min(...ys2); + const right2 = Math.max(...xs2); + const bottom2 = Math.max(...ys2); + + doc._height = (bottom2 - top2) * element.props.ScreenToLocalTransform().Scale; + doc._width = (right2 - left2) * element.props.ScreenToLocalTransform().Scale; + + } + } + })); + } + + @action + toggle = (check: string) => { + switch (check) { + case "noFill": + if (!this._noFill) { + this._noFill = true; + this._solidFill = false; + } + break; + case "solidFill": + if (!this._solidFill) { + this._solidFill = true; + this._noFill = false; + if (this._currFill === "none") { + this._currFill = "#D0021B"; + } + } + break; + case "noLine": + if (!this._noLine) { + this._noLine = true; + this._solidLine = false; + this._dashLine = false; + } + break; + case "solidLine": + if (!this._solidLine) { + this._solidLine = true; + this._noLine = false; + this._dashLine = false; + if (this._currColor === "none") { + this._currColor = "#D0021B"; + } + } + break; + case "dashLine": + if (!this._dashLine) { + this._dashLine = true; + this._solidLine = false; + this._noLine = false; + if (this._currColor === "none") { + this._currColor = "#D0021B"; + } + } + break; + case "lock": + if (this._lock) { + this._lock = false; + } else { + this._lock = true; + } + break; + case "arrowHead": + this._arrowHead = this._arrowHead ? false : true; + break; + case "arrowEnd": + this._arrowEnd = this._arrowEnd ? false : true; + break; + default: + break; + } + } + + @computed get subMenu() { + const fillCheck =
+ { this.toggle("noFill"); this.editProperties("none", "fill"); })} /> + No Fill +

+ { this.toggle("solidFill"); this.editProperties(this._currFill, "fill"); })} /> + Solid Fill +

+

+ {this._solidFill ? "Color" : ""} + {this._solidFill ? this.fillButton : ""} + {this._fillBtn && this._solidFill ? this.fillPicker : ""} + +
; + const arrows = <> { this.toggle("arrowHead"); this.editProperties(this._arrowHead ? "arrowHead" : "none", "arrowStart"); })} /> + Arrow Head +

+ + { this.toggle("arrowEnd"); this.editProperties(this._arrowEnd ? "arrowEnd" : "none", "arrowEnd"); })} /> + Arrow End +

; + const lineCheck =
+ { this.toggle("noLine"); this.editProperties("none", "color"); })} /> + No Line +

+ { this.toggle("solidLine"); this.editProperties(this._currColor, "color"); this.editProperties("0", "dash"); })} /> + Solid Line +

+ { this.toggle("dashLine"); this.editProperties(this._currColor, "color"); this.editProperties("2", "dash"); })} /> + Dash Line +

+

+ {(this._solidLine || this._dashLine) ? "Color" : ""} + {(this._solidLine || this._dashLine) ? this.lineButton : ""} + {this._lineBtn && (this._solidLine || this._dashLine) ? this.linePicker : ""} +

+ {(this._solidLine || this._dashLine) ? "Width" : ""} + {(this._solidLine || this._dashLine) ? this.widthInput : ""} +

+

+ {(this._solidLine || this._dashLine) ? arrows : ""} + +
; + + const sizeCheck =
+ Height {this.sizeHeightInput} +

+

+ + + Width {this.sizeWidthInput} +

+

+ + { this.toggle("lock"); })} /> + Lock Ratio +

+

+ + + Rotation {this.rotationInput} +

+

+ + +
; + const positionCheck =
+ Horizontal {this.positionHorizontalInput} +

+

+ + Vertical {this.positionVerticalInput} +

+

+ + +
; + + const subMenu =
+ {this._subMenu.map((subMenu, i) => { + if (subMenu === "fill" || subMenu === "line") { + return
+ {this.currMode === "fill-drip" && subMenu === "fill" && this._subOpen[0] ? fillCheck : ""} + {this.currMode === "fill-drip" && subMenu === "line" && this._subOpen[1] ? lineCheck : ""} + +
; + } + else if (subMenu === "size" || subMenu === "position") { + return
+ {this.currMode === "ruler-combined" && subMenu === "size" && this._subOpen[2] ? sizeCheck : ""} + {this.currMode === "ruler-combined" && subMenu === "position" && this._subOpen[3] ? positionCheck : ""} + +
+ ; + + } + }) + }
; + return subMenu; + } + + @computed get fillButton() { + const fillButton = <> +

+

; + return fillButton; + } + @computed get fillPicker() { + const fillPicker =
+ {this._palette.map(color => { + return ; + })} + +
; + return fillPicker; + } + + @computed get lineButton() { + const lineButton = <> +

+

; + return lineButton; + } + @computed get linePicker() { + const linePicker =
+ {this._palette.map(color => { + return ; + })} + +
; + return linePicker; + } + @computed get widthInput() { + const widthInput = <> + this.onChange(e.target.value, "width")} + autoFocus> +
+ ; + return widthInput; + } + @computed get sizeHeightInput() { + const sizeHeightInput = <> + this.onChange(e.target.value, "sizeHeight")} + autoFocus> + +
+ + ; + return sizeHeightInput; + } + + @computed get sizeWidthInput() { + const sizeWidthInput = <> + this.onChange(e.target.value, "sizeWidth")} + autoFocus> + +

+ ; + return sizeWidthInput; + } + + @computed get rotationInput() { + const rotationInput = + <> + this.onChange(e.target.value, "rotation")} + autoFocus> + +

+ ; + return rotationInput; + } + + @computed get positionHorizontalInput() { + const positionHorizontalInput = + <> this.onChange(e.target.value, "positionHorizontal")} + autoFocus> + +

+ ; + return positionHorizontalInput; + } + + @computed get positionVerticalInput() { + const positionVerticalInput = + <> this.onChange(e.target.value, "positionVertical")} + autoFocus> + +

+ ; + return positionVerticalInput; + } + + + @action + onChange = (val: string, property: string): void => { + if (!Number.isNaN(Number(val)) && Number(val) !== null && val !== " ") { + + // if (val === "") { + // val = "0"; + // } + switch (property) { + case "width": + this._currWidth = val; + if (val !== "") { + this.editProperties(this._currWidth, "width"); + } + break; + case "sizeHeight": + this._currSizeHeight = val; + if (val !== "") { + this.editProperties(this._currSizeHeight, "heightSize"); + } + break; + case "sizeWidth": + this._currSizeWidth = val; + if (val !== "") { + + this.editProperties(this._currSizeWidth, "widthSize"); + } + break; + case "rotation": + + this._currRotation = val; + if (val !== "") { + + this.rotate(Number(val)); + } + break; + case "positionHorizontal": + this._currPositionHorizontal = val; if (val !== "") { + + this.editProperties(this._currPositionHorizontal, "horizontal"); + } + + break; + case "positionVertical": + this._currPositionVertical = val; + if (val !== "") { + + this.editProperties(this._currPositionVertical, "vertical"); + } + + break; + default: + break; + } + } + } + + + + + // @action + // changeWidth = (event: React.ChangeEvent) => { + // console.log(event.target.value); + // this._currWidth = NumCast(event.target.value); + + // } + + @computed get upDown() { + const upDown =
+ +

+ +
; + return upDown; + } + + + @computed get widthPicker() { + var widthPicker = ; + if (this._widthBtn) { + widthPicker =
+ {widthPicker} + {this._width.map(wid => { + return ; + })} +
; + } + return widthPicker; + } + + + + render() { + const buttons = [ + + this.close, + this.modes, + this.subMenu + + ]; + + return this.getElementVert(buttons); + } +} +Scripting.addGlobal(function activatePen2(penBtn: any) { + if (penBtn) { + //no longer changes to inkmode + // Doc.SetSelectedTool(InkTool.Pen); + FormatShapePane.Instance.jumpTo(300, 300); + FormatShapePane.Instance.Pinned = true; + + } else { + // Doc.SetSelectedTool(InkTool.None); + FormatShapePane.Instance.Pinned = false; + FormatShapePane.Instance.fadeOut(true); + + } +}); \ No newline at end of file diff --git a/src/client/views/collections/collectionFreeForm/InkOptionsMenu.scss b/src/client/views/collections/collectionFreeForm/InkOptionsMenu.scss index 7329f4fc1..f739fcc8c 100644 --- a/src/client/views/collections/collectionFreeForm/InkOptionsMenu.scss +++ b/src/client/views/collections/collectionFreeForm/InkOptionsMenu.scss @@ -32,7 +32,7 @@ } .btn2-group { - display: block; + display: grid; background: #323232; grid-template-columns: auto; diff --git a/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx b/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx index 7de70b8cd..e4f3248d0 100644 --- a/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx +++ b/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx @@ -36,14 +36,15 @@ export default class InkOptionsMenu extends AntimodeMenu { // private _arrowEnd = ["none", "arrowEnd", "none", "dot", "none"]; // private _arrowIcons = ["→", "↔︎", "•", "••", " "]; private _draw = ["⎯", "→", "↔︎", "∿", "↝", "↭", "ロ", "O", "∆"]; - private _head = ["none", "arrowHead", "arrowHead", "none", "arrowHead", "arrowHead", "none", "none", "none"]; - private _end = ["none", "none", "arrowEnd", "none", "none", "arrowEnd", "none", "none", "none"]; + private _head = ["none", "none", "arrowHead", "none", "none", "arrowHead", "none", "none", "none"]; + private _end = ["none", "arrowEnd", "arrowEnd", "none", "arrowEnd", "arrowEnd", "none", "none", "none"]; private _shape = ["", "", "", "", "", "", "rectangle", "circle", "triangle"]; @observable _shapesNum = this._shape.length; @observable _selected = this._shapesNum; @observable private collapsed: boolean = false; + @observable _double = ""; @observable _colorBtn = false; @observable _widthBtn = false; @@ -155,7 +156,7 @@ export default class InkOptionsMenu extends AntimodeMenu { className="antimodeMenu-button" key={icon} onPointerDown={action(() => { - console.log(this._selected); + this._double = ""; if (this._selected !== i) { this._selected = i; @@ -177,6 +178,31 @@ export default class InkOptionsMenu extends AntimodeMenu { } console.log(this._selected); + })} + onDoubleClick={action(() => { + console.log("double"); + this._double = this._draw[i]; + if (this._selected !== i) { + this._selected = i; + Doc.SetSelectedTool(InkTool.Pen); + SetActiveArrowStart(this._head[i]); + SetActiveArrowEnd(this._end[i]); + SetActiveBezierApprox("300"); + + // this.editProperties(this._head[i], "arrowStart"), this.editProperties(this._end[i], "arrowEnd"); + GestureOverlay.Instance.InkShape = this._shape[i]; + } else { + this._selected = this._shapesNum; + Doc.SetSelectedTool(InkTool.None); + SetActiveArrowStart("none"); + SetActiveArrowEnd("none"); + GestureOverlay.Instance.InkShape = ""; + SetActiveBezierApprox("0"); + + } + + + })} style={{ backgroundColor: i === this._selected ? "121212" : "", fontSize: "20" }}> {this._draw[i]} @@ -235,7 +261,7 @@ export default class InkOptionsMenu extends AntimodeMenu { className="antimodeMenu-button" key={wid} onPointerDown={action(() => { SetActiveInkWidth(wid); this._widthBtn = false; this.editProperties(wid, "width"); })} - style={{ backgroundColor: this._widthBtn ? "121212" : "" }}> + style={{ backgroundColor: this._widthBtn ? "121212" : "", zIndex: 1001 }}> {wid} ; })} @@ -265,7 +291,7 @@ export default class InkOptionsMenu extends AntimodeMenu { className="antimodeMenu-button" key={color} onPointerDown={action(() => { this.changeColor(color, "color"); this._colorBtn = false; this.editProperties(color, "color"); })} - style={{ backgroundColor: this._colorBtn ? "121212" : "" }}> + style={{ backgroundColor: this._colorBtn ? "121212" : "", zIndex: 1001 }}> {/* */}
; @@ -286,14 +312,14 @@ export default class InkOptionsMenu extends AntimodeMenu {
; if (this._fillBtn) { - fillPicker =
+ fillPicker =
{fillPicker} {this._palette.map(color => { return ; })} -- cgit v1.2.3-70-g09d2 From c8454d675a3081a83c56cf598b1b3637479b0459 Mon Sep 17 00:00:00 2001 From: yunahi <60233430+yunahi@users.noreply.github.com> Date: Fri, 10 Jul 2020 05:22:06 +0900 Subject: added format shape --- src/client/util/SelectionManager.ts | 3 +- .../collectionFreeForm/FormatShapePane.tsx | 137 ++++----------------- 2 files changed, 24 insertions(+), 116 deletions(-) (limited to 'src/client/views/collections/collectionFreeForm') diff --git a/src/client/util/SelectionManager.ts b/src/client/util/SelectionManager.ts index aea2c542b..af2f320d3 100644 --- a/src/client/util/SelectionManager.ts +++ b/src/client/util/SelectionManager.ts @@ -15,8 +15,7 @@ export namespace SelectionManager { SelectedDocuments: ObservableMap = new ObservableMap(); @action SelectDoc(docView: DocumentView, ctrlPressed: boolean): void { - console.log("select" - ); + // if doc is not in SelectedDocuments, add it if (!manager.SelectedDocuments.get(docView)) { if (!ctrlPressed) { diff --git a/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx b/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx index 7b47b7ca4..37ba805b6 100644 --- a/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx +++ b/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx @@ -3,12 +3,9 @@ import AntimodeMenu from "../../AntimodeMenu"; import { observer } from "mobx-react"; import { observable, action, computed } from "mobx"; import "./FormatShapePane.scss"; -import { ActiveInkColor, ActiveInkBezierApprox, ActiveFillColor, ActiveArrowStart, ActiveArrowEnd, SetActiveInkWidth, SetActiveInkColor, SetActiveBezierApprox, SetActiveFillColor, SetActiveArrowStart, SetActiveArrowEnd, ActiveDash, SetActiveDash } from "../../InkingStroke"; +import { SetActiveInkWidth } from "../../InkingStroke"; import { Scripting } from "../../../util/Scripting"; -import { InkTool, InkField } from "../../../../fields/InkField"; -import { ColorState } from "react-color"; -import { Utils } from "../../../../Utils"; -import GestureOverlay from "../../GestureOverlay"; +import { InkField } from "../../../../fields/InkField"; import { Doc } from "../../../../fields/Doc"; import { SelectionManager } from "../../../util/SelectionManager"; import { DocumentView } from "../../../views/nodes/DocumentView"; @@ -19,9 +16,6 @@ import { IconProp, library } from '@fortawesome/fontawesome-svg-core'; import { faRulerCombined, faFillDrip, faPenNib } from "@fortawesome/free-solid-svg-icons"; import { Cast, StrCast, BoolCast, NumCast } from "../../../../fields/Types"; import e = require("express"); -import { ChangeEvent } from "mongodb"; -import { black } from "colors"; - library.add(faRulerCombined, faFillDrip, faPenNib); @@ -33,63 +27,42 @@ export default class FormatShapePane extends AntimodeMenu { private _width = ["1", "5", "10", "100"]; private _mode = ["fill-drip", "ruler-combined"]; private _subMenu = ["fill", "line", "size", "position"]; - private _headIcon = ["⎯", "←"]; - private _endIcon = ["⎯", "→"]; - private _head = ["none", "arrowHead"]; - private _end = ["none", "arrowEnd"]; - @observable private _subOpen = [false, false, false, false]; - @observable private collapsed: boolean = false; @observable private currMode: string = "fill-drip"; @observable _fillBtn = false; @observable _lineBtn = false; - @observable _selectDoc: DocumentView[] = []; - @observable _noFill = false; @observable _solidFill = false; @observable _noLine = false; @observable _solidLine = false; @observable _dashLine = false; @observable _lock = false; - @observable _multiple = false; - @observable _widthBtn = false; - - @observable _currWidth = "10"; - @observable _single = false; - @observable _currFill = "#D0021B"; - @observable _currColor = "#D0021B"; - @observable _arrowHead = false; @observable _arrowEnd = false; - - @observable _currSizeHeight = "10"; @observable _currSizeWidth = "10"; @observable _currRotation = "10"; - @observable _currPositionHorizontal = "10"; @observable _currPositionVertical = "10"; - + @observable _currWidth = "10"; + @observable _currFill = "#D0021B"; + @observable _currColor = "#D0021B"; constructor(props: Readonly<{}>) { super(props); FormatShapePane.Instance = this; - this._canFade = false; // don't let the inking menu fade away + this._canFade = false; this.Pinned = BoolCast(Doc.UserDoc()["formatShapePane-pinned"]); - } @action toggleMenuPin = (e: React.MouseEvent) => { Doc.UserDoc()["formatShapePane-pinned"] = this.Pinned = !this.Pinned; - if (!this.Pinned) { - // this.fadeOut(true); - } } @action @@ -105,9 +78,9 @@ export default class FormatShapePane extends AntimodeMenu { closePane = () => { this.jumpTo(-300, -300); this.Pinned = false; - } + //if multiple inks are selected and do not share the same prop, leave blank @action checkSame = () => { const docs = SelectionManager.SelectedDocuments(); @@ -117,18 +90,6 @@ export default class FormatShapePane extends AntimodeMenu { inks.push(docs[i]); } } - const firstWidth = Document(inks[0].rootDoc).strokeWidth; - const firstColor = Document(inks[0].rootDoc).color; - const firstFill = Document(inks[0].rootDoc).fillColor; - // const firstBezier - const firstRotation = Document(inks[0].rootDoc).rotation; - const firstArrowStart = Document(inks[0].rootDoc).arrowStart; - const firstArrowEnd = Document(inks[0].rootDoc).arrowEnd; - const firstDash = Document(inks[0].rootDoc).dash; - const firstWidthSize = Document(inks[0].rootDoc)._width; - const firstHeightSize = Document(inks[0].rootDoc)._height; - const firstHorizontal = Document(inks[0].rootDoc).x; - const firstVertical = Document(inks[0].rootDoc).y; this._noFill = Document(inks[0].rootDoc).fillColor === "none" ? true : false; this._solidFill = Document(inks[0].rootDoc).fillColor === "none" ? false : true; this._noLine = Document(inks[0].rootDoc).color === "none" ? true : false; @@ -142,11 +103,7 @@ export default class FormatShapePane extends AntimodeMenu { } } - // this._solidLine = (Document(inks[0].rootDoc).color === "none") ? false : Document(inks[0].rootDoc).dash === 0 ? true : false; - // this._dashLine = (Document(inks[0].rootDoc).color === "none") ? false : Document(inks[0].rootDoc).dash !== 0 ? true : false; - // // this._widthBtn = false; this._currWidth = String(Document(inks[0].rootDoc).strokeWidth); - // this._single = false; this._currFill = String(Document(inks[0].rootDoc).fillColor); this._currColor = String(Document(inks[0].rootDoc).color); this._arrowHead = Document(inks[0].rootDoc).arrowStart === "none" ? false : true; @@ -157,45 +114,43 @@ export default class FormatShapePane extends AntimodeMenu { this._currPositionHorizontal = String(Document(inks[0].rootDoc).x); this._currPositionVertical = String(Document(inks[0].rootDoc).y); for (var i = 0; i < inks.length; i++) { - if (Document(inks[i].rootDoc).strokeWidth !== firstWidth) { + if (Document(inks[i].rootDoc).strokeWidth !== Document(inks[0].rootDoc).strokeWidth) { this._currWidth = ""; } - if (Document(inks[i].rootDoc).color !== firstColor) { + if (Document(inks[i].rootDoc).color !== Document(inks[0].rootDoc).color) { this._noLine = false; this._solidLine = false; this._dashLine = false; } - if (Document(inks[i].rootDoc).fillColor !== firstFill) { + if (Document(inks[i].rootDoc).fillColor !== Document(inks[0].rootDoc).fillColor) { this._solidFill = false; this._noFill = false; } - if (Document(inks[i].rootDoc).arrowStart !== firstArrowStart) { + if (Document(inks[i].rootDoc).arrowStart !== Document(inks[0].rootDoc).arrowStart) { this._arrowHead = false; } - if (Document(inks[i].rootDoc).arrowEnd !== firstArrowEnd) { + if (Document(inks[i].rootDoc).arrowEnd !== Document(inks[0].rootDoc).arrowEnd) { this._arrowEnd = false; } - if (Document(inks[i].rootDoc).x !== firstHorizontal) { + if (Document(inks[i].rootDoc).x !== Document(inks[0].rootDoc).x) { this._currPositionHorizontal = ""; } - if (Document(inks[i].rootDoc).y !== firstVertical) { + if (Document(inks[i].rootDoc).y !== Document(inks[0].rootDoc).y) { this._currPositionVertical = ""; } - if (Document(inks[i].rootDoc)._width !== firstWidthSize) { + if (Document(inks[i].rootDoc)._width !== Document(inks[0].rootDoc)._width) { this._currSizeWidth = ""; } - if (Document(inks[i].rootDoc)._height !== firstHeightSize) { + if (Document(inks[i].rootDoc)._height !== Document(inks[0].rootDoc)._height) { this._currSizeHeight = ""; } - if (Document(inks[i].rootDoc).rotation !== firstRotation) { + if (Document(inks[i].rootDoc).rotation !== Document(inks[0].rootDoc).rotation) { this._currRotation = ""; } } - - - } + @action upDownButtons = (dirs: string, field: string) => { SelectionManager.SelectedDocuments().forEach(action((element: DocumentView) => { @@ -206,14 +161,12 @@ export default class FormatShapePane extends AntimodeMenu { if (doc.strokeWidth) { doc.strokeWidth = dirs === "up" ? doc.strokeWidth + 1 : doc.strokeWidth - 1; SetActiveInkWidth(String(doc.strokeWidth)); - } break; case "sizeWidth": if (doc._width && doc._height) { const oldWidth = doc._width; const oldHeight = doc._height; - doc._width = dirs === "up" ? doc._width + 10 : doc._width - 10; if (this._lock) { doc._height = (doc._width * oldHeight) / oldWidth; @@ -240,19 +193,17 @@ export default class FormatShapePane extends AntimodeMenu { doc.y = dirs === "up" ? doc.y + 10 : doc.y - 10; } case "rotation": - this.rotate(dirs === "up" ? Number(doc.rotation) + Number(0.1) : Number(doc.rotation) - Number(0.1)); - break; default: break; } this.selected(); - } })); } + @action editProperties = (value: any, field: string) => { SelectionManager.SelectedDocuments().forEach(action((element: DocumentView) => { @@ -270,7 +221,6 @@ export default class FormatShapePane extends AntimodeMenu { doc.fillColor = String(value); break; case "bezier": - // doc.strokeBezier === 300 ? doc.strokeBezier = 0 : doc.strokeBezier = 300; break; case "arrowStart": doc.arrowStart = String(value); @@ -285,7 +235,6 @@ export default class FormatShapePane extends AntimodeMenu { if (doc._width && doc._height) { const oldWidth = doc._width; const oldHeight = doc._height; - doc._width = Number(value); if (this._lock) { doc._height = (doc._width * oldHeight) / oldWidth; @@ -296,7 +245,6 @@ export default class FormatShapePane extends AntimodeMenu { if (doc._width && doc._height) { const oldWidth = doc._width; const oldHeight = doc._height; - doc._height = Number(value); if (this._lock) { doc._width = (doc._height * oldWidth) / oldHeight; @@ -308,7 +256,6 @@ export default class FormatShapePane extends AntimodeMenu { break; case "vertical": doc.y = Number(value); - break; default: break; @@ -331,13 +278,14 @@ export default class FormatShapePane extends AntimodeMenu { return close; } + //select either coor&fill or size&position @computed get modes() { const modes =
{this._mode.map(mode => { return ; @@ -346,6 +294,7 @@ export default class FormatShapePane extends AntimodeMenu { return modes; } + //detects currently selected document and change value in pane @action selected = () => { this._selectDoc = SelectionManager.SelectedDocuments(); @@ -353,7 +302,6 @@ export default class FormatShapePane extends AntimodeMenu { this._single = true; const doc = Document(this._selectDoc[0].rootDoc); if (doc.type === DocumentType.INK) { - console.log(doc.fillColor); if (doc.fillColor === "none") { this._noFill = true; this._solidFill = false; @@ -382,11 +330,8 @@ export default class FormatShapePane extends AntimodeMenu { this._arrowHead = doc.arrowStart === "none" ? false : true; this._arrowEnd = doc.arrowEnd === "none" ? false : true; - - this._currPositionHorizontal = String(doc.x); this._currPositionVertical = String(doc.y); - console.log(doc.rotation); this._currRotation = String(doc.rotation); this._currSizeHeight = String(doc._height); this._currSizeWidth = String(doc._width); @@ -418,8 +363,6 @@ export default class FormatShapePane extends AntimodeMenu { SelectionManager.SelectedDocuments().forEach(action((element: DocumentView) => { const doc = Document(element.rootDoc); if (doc.type === DocumentType.INK && doc.x && doc.y && doc._width && doc._height && doc.data) { - // doc.rotation = (Number(doc.rotation) + (Number(angle) * 180 / Math.PI)); - // console.log(doc.rotation); const angle = Number(degrees) - Number(doc.rotation); doc.rotation = Number(degrees); const ink = Cast(doc.data, InkField)?.inkData; @@ -446,10 +389,8 @@ export default class FormatShapePane extends AntimodeMenu { const top2 = Math.min(...ys2); const right2 = Math.max(...xs2); const bottom2 = Math.max(...ys2); - doc._height = (bottom2 - top2) * element.props.ScreenToLocalTransform().Scale; doc._width = (right2 - left2) * element.props.ScreenToLocalTransform().Scale; - } } })); @@ -854,14 +795,11 @@ export default class FormatShapePane extends AntimodeMenu { return positionVerticalInput; } - + //change inputs @action onChange = (val: string, property: string): void => { if (!Number.isNaN(Number(val)) && Number(val) !== null && val !== " ") { - // if (val === "") { - // val = "0"; - // } switch (property) { case "width": this._currWidth = val; @@ -912,35 +850,6 @@ export default class FormatShapePane extends AntimodeMenu { } - - - // @action - // changeWidth = (event: React.ChangeEvent) => { - // console.log(event.target.value); - // this._currWidth = NumCast(event.target.value); - - // } - - @computed get upDown() { - const upDown =
- -

- -
; - return upDown; - } - - @computed get widthPicker() { var widthPicker =
-
+
Math.min(350, NumCast(target._width, 350))} - PanelHeight={() => Math.min(250, NumCast(target._height, 250))} + PanelWidth={() => 170} //Math.min(350, NumCast(target._width, 350))} + PanelHeight={() => 170} //Math.min(250, NumCast(target._height, 250))} focus={emptyFunction} whenActiveChanged={returnFalse} bringToFront={returnFalse} ContentScaling={returnOne} - NativeWidth={returnZero} - NativeHeight={returnZero} + NativeWidth={() => target._nativeWidth ? NumCast(target._nativeWidth) : 0} + NativeHeight={() => target._nativeHeight ? NumCast(target._nativeHeight) : 0} />
; -- cgit v1.2.3-70-g09d2 From 3d0c64cf9979f739177b0efd9970ad0e0a9fa3d0 Mon Sep 17 00:00:00 2001 From: anika-ahluwalia Date: Thu, 9 Jul 2020 17:00:12 -0500 Subject: small changes --- src/client/documents/Documents.ts | 6 +----- .../collections/collectionFreeForm/CollectionFreeFormView.tsx | 8 +++++--- src/client/views/linking/LinkMenuItem.tsx | 2 +- src/client/views/nodes/formattedText/FormattedTextBox.tsx | 2 ++ 4 files changed, 9 insertions(+), 9 deletions(-) (limited to 'src/client/views/collections/collectionFreeForm') diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts index 565e7c25d..fa85d58f0 100644 --- a/src/client/documents/Documents.ts +++ b/src/client/documents/Documents.ts @@ -909,7 +909,7 @@ export namespace DocUtils { DocUtils.ActiveRecordings.map(d => DocUtils.MakeLink({ doc: doc }, { doc: d }, "audio link", "audio timeline")); } - export function MakeLink(source: { doc: Doc }, target: { doc: Doc }, linkRelationship: string = "", description: string = "", id?: string, linkedText?: string) { + export function MakeLink(source: { doc: Doc }, target: { doc: Doc }, linkRelationship: string = "", description: string = "", id?: string) { const sv = DocumentManager.Instance.getDocumentView(source.doc); if (sv && sv.props.ContainingCollectionDoc === target.doc) return; if (target.doc === Doc.UserDoc()) return undefined; @@ -921,10 +921,6 @@ export namespace DocUtils { Doc.GetProto(source.doc).links = ComputedField.MakeFunction("links(self)"); Doc.GetProto(target.doc).links = ComputedField.MakeFunction("links(self)"); - if (linkedText) { - Doc.GetProto(linkDoc).linkedText = linkedText; - } - return linkDoc; } diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx index 965bfdf24..9d79c0c89 100644 --- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx +++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx @@ -1181,17 +1181,19 @@ export class CollectionFreeFormView extends CollectionSubView { this.props.destinationDoc.type === "screenshot" ? "photo-video" : this.props.destinationDoc.type === "webcam" ? "video" : this.props.destinationDoc.type === "audio" ? "microphone" : - this.props.destinationDoc.type === "button" ? "lightning" : + this.props.destinationDoc.type === "button" ? "bolt" : this.props.destinationDoc.type === "presentation" ? "tv" : this.props.destinationDoc.type === "query" ? "search" : this.props.destinationDoc.type === "script" ? "terminal" : diff --git a/src/client/views/nodes/formattedText/FormattedTextBox.tsx b/src/client/views/nodes/formattedText/FormattedTextBox.tsx index bff6f1c8c..4f6927d3d 100644 --- a/src/client/views/nodes/formattedText/FormattedTextBox.tsx +++ b/src/client/views/nodes/formattedText/FormattedTextBox.tsx @@ -176,9 +176,11 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp doLinkOnDeselect() { console.log("link on deselect"); + Array.from(this.linkOnDeselect.entries()).map(entry => { const key = entry[0]; const value = entry[1]; + const id = Utils.GenerateDeterministicGuid(this.dataDoc[Id] + key); DocServer.GetRefField(value).then(doc => { DocServer.GetRefField(id).then(linkDoc => { -- cgit v1.2.3-70-g09d2 From 756a2d4e680bcdcc339e8f2493f699bb01e3fbb0 Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Thu, 9 Jul 2020 18:37:03 -0400 Subject: fixed type errors. --- .../views/collections/collectionFreeForm/CollectionFreeFormView.tsx | 4 ++-- 1 file changed, 2 insertions(+), 2 deletions(-) (limited to 'src/client/views/collections/collectionFreeForm') diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx index 9d79c0c89..f2a39b240 100644 --- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx +++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx @@ -1172,7 +1172,7 @@ export class CollectionFreeFormView extends CollectionSubView - _lastClientY = 0; + _lastClientY: number | undefined = 0; @action handleDragging = (e: CustomEvent, de: DragEvent) => { if ((e as any).handlePan) return; @@ -1233,7 +1233,7 @@ export class CollectionFreeFormView extends CollectionSubView { setTimeout(() => { const dragY = this._lastClientY; - if (this._lastClientY !== undefined && this._marqueeRef.current) { + if (dragY !== undefined && this._marqueeRef.current) { const bounds = this._marqueeRef.current.getBoundingClientRect()!; this.Document._panY = NumCast(this.Document._panY) + delta; (dragY - bounds.top < 25 || bounds.bottom - dragY < 25) && this.continueYPan(delta); -- cgit v1.2.3-70-g09d2 From b9ba531c64fe7926a6794ab57e4989e1ea6c6992 Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Fri, 10 Jul 2020 11:23:44 -0400 Subject: fixes for x/y panning on drag --- .../collectionFreeForm/CollectionFreeFormView.tsx | 66 ++++++---------------- 1 file changed, 16 insertions(+), 50 deletions(-) (limited to 'src/client/views/collections/collectionFreeForm') diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx index f2a39b240..3fdf6683e 100644 --- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx +++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx @@ -84,6 +84,8 @@ export class CollectionFreeFormView extends CollectionSubView = new Map(); @@ -579,7 +581,7 @@ export class CollectionFreeFormView extends CollectionSubView { - this._lastClientY = undefined; + this._lastClientY = this._lastClientX = undefined; if (InteractionUtils.IsType(e, InteractionUtils.TOUCHTYPE)) return; document.removeEventListener("pointermove", this.onPointerMove); @@ -1172,76 +1174,40 @@ export class CollectionFreeFormView extends CollectionSubView - _lastClientY: number | undefined = 0; @action handleDragging = (e: CustomEvent, de: DragEvent) => { if ((e as any).handlePan) return; (e as any).handlePan = true; - const top = this.panX(); - const left = this.panY(); this._lastClientY = e.detail.clientY; - - console.log("draggg"); - - const size = this.getTransform().transformDirection(this.props.PanelWidth(), this.props.PanelHeight()); - const scale = this.getLocalTransform().inverse().Scale; + this._lastClientX = e.detail.clientX; if (this._marqueeRef?.current) { - - console.log("hellp"); - const dragX = e.detail.clientX; const dragY = e.detail.clientY; const bounds = this._marqueeRef.current?.getBoundingClientRect(); - if (dragX - bounds.left < 25) { - console.log("PAN left "); - - if (this.canPanX) { - this.Document._panX = left - 5; - setTimeout(action(() => { - this.canPanX = true; - this.panX(); - }), 250); - this.canPanX = false; - } - } else if (bounds.right - dragX < 25) { - console.log("PAN right "); - - if (this.canPanX) { - this.Document._panX = left + 5; - setTimeout(action(() => { - this.panX(); - this.canPanX = true; - }), 250); - this.canPanX = false; - } - - } - - if (dragY - bounds.top < 25) { - console.log("PAN top "); - this.continueYPan(-2); - } else if (bounds.bottom - dragY < 25) { - console.log("PAN bottom "); - this.continueYPan(2); - } + let deltaX = dragX - bounds.left < 25 ? -2 : bounds.right - dragX < 25 ? 2 : 0; + let deltaY = dragY - bounds.top < 25 ? -2 : bounds.bottom - dragY < 25 ? 2 : 0; + (deltaX !== 0 || deltaY !== 0) && this.continuePan(deltaX, deltaY); } e.stopPropagation(); } - continueYPan = (delta: number) => { + continuePan = (deltaX: number, deltaY: number) => { setTimeout(() => { const dragY = this._lastClientY; - if (dragY !== undefined && this._marqueeRef.current) { + const dragX = this._lastClientX; + if (dragY !== undefined && dragX !== undefined && this._marqueeRef.current) { const bounds = this._marqueeRef.current.getBoundingClientRect()!; - this.Document._panY = NumCast(this.Document._panY) + delta; - (dragY - bounds.top < 25 || bounds.bottom - dragY < 25) && this.continueYPan(delta); - } else this._lastClientY !== undefined && this.continueYPan(delta); + this.Document._panY = NumCast(this.Document._panY) + deltaY; + this.Document._panX = NumCast(this.Document._panX) + deltaX; + if (dragY - bounds.top < 25 || bounds.bottom - dragY < 25 || dragX - bounds.left < 25 || bounds.right - dragX < 25) { + this.continuePan(deltaX, deltaY); + } + } else this._lastClientY !== undefined && this._lastClientX !== undefined && this.continuePan(deltaX, deltaY); }, 50); } - promoteCollection = undoBatch(action(() => { const childDocs = this.childDocs.slice(); childDocs.forEach(doc => { -- cgit v1.2.3-70-g09d2 From d064024d9ab2cd8e836df5ba75e064d77617445b Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Fri, 10 Jul 2020 11:25:08 -0400 Subject: from last --- .../views/collections/collectionFreeForm/CollectionFreeFormView.tsx | 4 ++-- 1 file changed, 2 insertions(+), 2 deletions(-) (limited to 'src/client/views/collections/collectionFreeForm') diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx index 3fdf6683e..2191021d2 100644 --- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx +++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx @@ -1194,7 +1194,7 @@ export class CollectionFreeFormView extends CollectionSubView { - setTimeout(() => { + setTimeout(action(() => { const dragY = this._lastClientY; const dragX = this._lastClientX; if (dragY !== undefined && dragX !== undefined && this._marqueeRef.current) { @@ -1205,7 +1205,7 @@ export class CollectionFreeFormView extends CollectionSubView { -- cgit v1.2.3-70-g09d2 From 5a70fb56062d6a5ed45cf3cf4453089bc83f3c6b Mon Sep 17 00:00:00 2001 From: anika-ahluwalia Date: Fri, 10 Jul 2020 18:11:09 -0500 Subject: added showing individual links with one bug --- .../collectionFreeForm/CollectionFreeFormLinkView.tsx | 4 ++-- src/client/views/linking/LinkMenuItem.tsx | 13 ++++++++++--- src/client/views/nodes/DocumentLinksButton.tsx | 8 +++++++- src/client/views/nodes/DocumentView.tsx | 18 ++++++++++++++---- 4 files changed, 33 insertions(+), 10 deletions(-) (limited to 'src/client/views/collections/collectionFreeForm') diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormLinkView.tsx b/src/client/views/collections/collectionFreeForm/CollectionFreeFormLinkView.tsx index a24693c30..ae79c27e0 100644 --- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormLinkView.tsx +++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormLinkView.tsx @@ -110,10 +110,10 @@ export class CollectionFreeFormLinkView extends React.Component - {text !== "-ungrouped-" ? text : ""} + {text} diff --git a/src/client/views/linking/LinkMenuItem.tsx b/src/client/views/linking/LinkMenuItem.tsx index f7d189b20..8fc1ea12f 100644 --- a/src/client/views/linking/LinkMenuItem.tsx +++ b/src/client/views/linking/LinkMenuItem.tsx @@ -177,11 +177,16 @@ export class LinkMenuItem extends React.Component { DocumentLinksButton.EditLink = undefined; } + @action + showLink = () => { + this.props.linkDoc.hidden = !this.props.linkDoc.hidden; + } + render() { const keys = LinkManager.Instance.getMetadataKeysInGroup(this.props.groupType);//groupMetadataKeys.get(this.props.groupType); const canExpand = keys ? keys.length > 0 : false; - const eyeIcon = this.props.linkDoc.shown ? "eye-slash" : "eye"; + const eyeIcon = this.props.linkDoc.hidden ? "eye-slash" : "eye"; const destinationIcon = this.props.destinationDoc.type === "image" ? "image" : this.props.destinationDoc.type === "comparison" ? "columns" : @@ -208,7 +213,9 @@ export class LinkMenuItem extends React.Component { // from anika to bob: here's where the text that is specifically linked would show up (linkDoc.storedText) // ... const source = this.props.sourceDoc.type === "rtf" ? this.props.linkDoc.storedText ? - "stored text would show up here" : undefined : undefined; + StrCast(this.props.linkDoc.storedText).length > 17 ? + StrCast(this.props.linkDoc.storedText).substr(0, 18) + : this.props.linkDoc.storedText : undefined : undefined; return (
@@ -243,7 +250,7 @@ export class LinkMenuItem extends React.Component {
: <>} -
+
diff --git a/src/client/views/nodes/DocumentLinksButton.tsx b/src/client/views/nodes/DocumentLinksButton.tsx index 22431117e..f07a2ea5a 100644 --- a/src/client/views/nodes/DocumentLinksButton.tsx +++ b/src/client/views/nodes/DocumentLinksButton.tsx @@ -95,6 +95,9 @@ export class DocumentLinksButton extends React.Component { LinkCreatedBox.popupX = e.screenX; LinkCreatedBox.popupY = e.screenY - 133; @@ -123,6 +126,9 @@ export class DocumentLinksButton extends React.Component { LinkCreatedBox.popupX = e.screenX; LinkCreatedBox.popupY = e.screenY - 133; @@ -173,7 +179,7 @@ export class DocumentLinksButton extends React.Component : (null)}
; - return (!links.length || links[0].hidden) && !this.props.AlwaysOn ? (null) : + return (!links.length) && !this.props.AlwaysOn ? (null) : {linkButton} ; diff --git a/src/client/views/nodes/DocumentView.tsx b/src/client/views/nodes/DocumentView.tsx index 97e3bc01c..310260832 100644 --- a/src/client/views/nodes/DocumentView.tsx +++ b/src/client/views/nodes/DocumentView.tsx @@ -201,6 +201,8 @@ export class DocumentView extends DocComponent(Docu this._mainCont.current && (this.multiTouchDisposer = InteractionUtils.MakeMultiTouchTarget(this._mainCont.current, this.onTouchStart.bind(this))); // this._mainCont.current && (this.holdDisposer = InteractionUtils.MakeHoldTouchTarget(this._mainCont.current, this.handle1PointerHoldStart.bind(this))); + //this.layoutDoc.showAllLinks = true; + if (!this.props.dontRegisterView) { DocumentManager.Instance.DocumentViews.push(this); } @@ -646,6 +648,8 @@ export class DocumentView extends DocComponent(Docu const linkDoc = DocUtils.MakeLink({ doc: de.complete.annoDragData.annotationDocument }, { doc: this.props.Document }, "link"); LinkManager.currentLink = linkDoc; + linkDoc ? linkDoc.hidden = true : null; + linkDoc ? linkDoc.linkDisplay = true : null; runInAction(() => { LinkCreatedBox.popupX = de.x; @@ -668,6 +672,8 @@ export class DocumentView extends DocComponent(Docu const linkDoc = DocUtils.MakeLink({ doc: de.complete.linkDragData.linkSourceDocument }, { doc: this.props.Document }, `link`); LinkManager.currentLink = linkDoc; + linkDoc ? linkDoc.hidden = true : null; + linkDoc ? linkDoc.linkDisplay = true : null; de.complete.linkDragData.linkSourceDocument !== this.props.Document && (de.complete.linkDragData.linkDocument = linkDoc); // TODODO this is where in text links get passed @@ -783,9 +789,12 @@ export class DocumentView extends DocComponent(Docu const optionItems: ContextMenuProps[] = options && "subitems" in options ? options.subitems : []; const templateDoc = Cast(this.props.Document[StrCast(this.props.Document.layoutKey)], Doc, null); templateDoc && optionItems.push({ description: "Open Template ", event: () => this.props.addDocTab(templateDoc, "onRight"), icon: "eye" }); - optionItems.push({ description: "Toggle Show Each Link Dot", event: () => this.layoutDoc.showLinks = !this.layoutDoc.showLinks, icon: "eye" }); + optionItems.push({ + description: "Toggle Show Each Link Dot", event: () => { this.layoutDoc.showAllLinks = !this.layoutDoc.showAllLinks; }, icon: "eye" + }); !options && cm.addItem({ description: "Options...", subitems: optionItems, icon: "compass" }); + const existingOnClick = cm.findByDescription("OnClick..."); const onClicks: ContextMenuProps[] = existingOnClick && "subitems" in existingOnClick ? existingOnClick.subitems : []; onClicks.push({ description: "Enter Portal", event: this.makeIntoPortal, icon: "window-restore" }); @@ -1084,7 +1093,7 @@ export class DocumentView extends DocComponent(Docu select={this.select} onClick={this.onClickHandler} layoutKey={this.finalLayoutKey} /> - {this.layoutDoc.showLinks ? this.anchors : (null)} + {this.layoutDoc.showAllLinks ? this.allAnchors : null} {this.props.forcedBackgroundColor?.(this.Document) === "transparent" || this.props.dontRegisterView ? (null) : }
); @@ -1107,7 +1116,8 @@ export class DocumentView extends DocComponent(Docu hideLinkAnchor = (doc: Doc | Doc[]) => (doc instanceof Doc ? [doc] : doc).reduce((flg: boolean, doc) => flg && (doc.hidden = true), true) anchorPanelWidth = () => this.props.PanelWidth() || 1; anchorPanelHeight = () => this.props.PanelHeight() || 1; - @computed get anchors() { + + @computed get allAnchors() { TraceMobx(); return (this.props.treeViewDoc && this.props.LayoutTemplateString) || // render nothing for: tree view anchor dots this.layoutDoc.presBox || // presentationbox nodes @@ -1133,7 +1143,7 @@ export class DocumentView extends DocComponent(Docu if (this.props.treeViewDoc && !this.props.LayoutTemplateString) { // this happens when the document is a tree view label (but not an anchor dot) return
{StrCast(this.props.Document.title)} - {this.anchors} + {this.allAnchors}
; } -- cgit v1.2.3-70-g09d2 From 6b5c11a26e114f26f3907342f9afbd47b27cecf4 Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Sat, 11 Jul 2020 17:54:20 -0400 Subject: restructured ink to make more react-friendly --- src/client/util/CurrentUserUtils.ts | 6 +- src/client/util/InteractionUtils.tsx | 21 +- src/client/util/SelectionManager.ts | 3 - src/client/views/AntimodeMenu.tsx | 1 - src/client/views/DocumentDecorations.tsx | 5 +- src/client/views/InkingStroke.tsx | 18 +- .../collectionFreeForm/FormatShapePane.tsx | 801 +++++++-------------- .../collectionFreeForm/InkOptionsMenu.tsx | 24 +- src/client/views/nodes/ColorBox.tsx | 1 - 9 files changed, 299 insertions(+), 581 deletions(-) (limited to 'src/client/views/collections/collectionFreeForm') diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts index d0ca0e57e..0b644fa79 100644 --- a/src/client/util/CurrentUserUtils.ts +++ b/src/client/util/CurrentUserUtils.ts @@ -760,9 +760,9 @@ export class CurrentUserUtils { doc.activeInkColor = StrCast(doc.activeInkColor, "rgb(0, 0, 0)"); doc.activeInkWidth = StrCast(doc.activeInkWidth, "1"); doc.activeInkBezier = StrCast(doc.activeInkBezier, "0"); - doc.activeFillColor = StrCast(doc.activeFillColor, "none"); - doc.activeArrowStart = StrCast(doc.activeArrowStart, "none"); - doc.activeArrowEnd = StrCast(doc.activeArrowEnd, "none"); + doc.activeFillColor = StrCast(doc.activeFillColor, ""); + doc.activeArrowStart = StrCast(doc.activeArrowStart, ""); + doc.activeArrowEnd = StrCast(doc.activeArrowEnd, ""); doc.activeDash = StrCast(doc.activeDash, "0"); doc.fontSize = NumCast(doc.fontSize, 12); doc["constants-snapThreshold"] = NumCast(doc["constants-snapThreshold"], 10); // diff --git a/src/client/util/InteractionUtils.tsx b/src/client/util/InteractionUtils.tsx index 2883e2056..6ab7bcc87 100644 --- a/src/client/util/InteractionUtils.tsx +++ b/src/client/util/InteractionUtils.tsx @@ -3,7 +3,6 @@ import * as beziercurve from 'bezier-curve'; import * as fitCurve from 'fit-curve'; import "./InteractionUtils.scss"; import { Utils } from "../../Utils"; -import InkOptionsMenu from "../views/collections/collectionFreeForm/InkOptionsMenu"; export namespace InteractionUtils { export const MOUSETYPE = "mouse"; @@ -96,12 +95,6 @@ export namespace InteractionUtils { color: string, width: number, strokeWidth: number, bezier: string, fill: string, arrowStart: string, arrowEnd: string, dash: string, scalex: number, scaley: number, shape: string, pevents: string, drawHalo: boolean, nodefs: boolean) { - // if (InkOptionsMenu.Instance.Pinned) { - // for (var i = 0; i < points.length; i++) { - // points[i].Y -= 35; - // } - // } - let pts: { X: number; Y: number; }[] = []; if (shape) { //if any of the shape are true pts = makePolygon(shape, points); @@ -127,15 +120,15 @@ export namespace InteractionUtils { const dashArray = String(Number(width) * Number(dash)); const defGuid = Utils.GenerateGuid(); const arrowDim = Math.max(0.5, 8 / Math.log(Math.max(2, strokeWidth))); - return ( {/* setting the svg fill sets the arrowhead fill */} + return ( {/* setting the svg fill sets the arrowStart fill */} {nodefs ? (null) : {arrowStart !== "dot" && arrowEnd !== "dot" ? (null) : } - {arrowStart !== "arrowHead" && arrowEnd !== "arrowHead" ? (null) : + {arrowStart !== "arrow" && arrowEnd !== "arrow" ? (null) : } - {arrowStart !== "arrowEnd" && arrowEnd !== "arrowEnd" ? (null) : + {arrowStart !== "arrow" && arrowEnd !== "arrow" ? (null) : } } @@ -144,7 +137,7 @@ export namespace InteractionUtils { points={strpts} style={{ filter: drawHalo ? "url(#inkSelectionHalo)" : undefined, - fill, + fill: fill ? fill : "transparent", opacity: strokeWidth !== width ? 0.5 : undefined, pointerEvents: pevents as any, stroke: color ?? "rgb(0, 0, 0)", @@ -153,8 +146,8 @@ export namespace InteractionUtils { strokeLinecap: "round", strokeDasharray: dashArray }} - markerStart={`url(#${arrowStart + defGuid})`} - markerEnd={`url(#${arrowEnd + defGuid})`} + markerStart={`url(#${arrowStart + "Start" + defGuid})`} + markerEnd={`url(#${arrowEnd + "End" + defGuid})`} /> ); @@ -163,7 +156,7 @@ export namespace InteractionUtils { // export function makeArrow() { // return ( // InkOptionsMenu.Instance.getColors().map(color => { - // const id1 = "arrowHeadTest" + color; + // const id1 = "arrowStartTest" + color; // console.log(color); // // diff --git a/src/client/util/SelectionManager.ts b/src/client/util/SelectionManager.ts index af2f320d3..9a968aeda 100644 --- a/src/client/util/SelectionManager.ts +++ b/src/client/util/SelectionManager.ts @@ -5,7 +5,6 @@ import { computedFn } from "mobx-utils"; import { List } from "../../fields/List"; import { Scripting } from "./Scripting"; import { DocumentManager } from "./DocumentManager"; -import FormatShapePane from "../views/collections/collectionFreeForm/FormatShapePane"; export namespace SelectionManager { @@ -31,8 +30,6 @@ export namespace SelectionManager { manager.SelectedDocuments.set(docView, true); } Doc.UserDoc().activeSelection = new List(SelectionManager.SelectedDocuments().map(dv => dv.props.Document)); - FormatShapePane.Instance.selected(); - } @action DeselectDoc(docView: DocumentView): void { diff --git a/src/client/views/AntimodeMenu.tsx b/src/client/views/AntimodeMenu.tsx index cb6de1785..3303a5e68 100644 --- a/src/client/views/AntimodeMenu.tsx +++ b/src/client/views/AntimodeMenu.tsx @@ -1,7 +1,6 @@ import React = require("react"); import { observable, action } from "mobx"; import "./AntimodeMenu.scss"; -import { inherits } from "util"; /** * This is an abstract class that serves as the base for a PDF-style or Marquee-style diff --git a/src/client/views/DocumentDecorations.tsx b/src/client/views/DocumentDecorations.tsx index 8edd4c4a9..81b4f9162 100644 --- a/src/client/views/DocumentDecorations.tsx +++ b/src/client/views/DocumentDecorations.tsx @@ -152,8 +152,8 @@ export class DocumentDecorations extends React.Component<{}, { value: string }> if (e.button === 0 && !e.altKey && !e.ctrlKey) { let child = SelectionManager.SelectedDocuments()[0].ContentDiv!.children[0]; while (child.children.length) { - const next = Array.from(child.children).find(c => !c.className.includes("collectionViewChrome")); - if (next?.className.includes("documentView-node")) break; + const next = Array.from(child.children).find(c => typeof (c.className) !== "string" || !c.className.includes("collectionViewChrome")); + if (typeof (next?.className) === "string" && next?.className.includes("documentView-node")) break; if (next) child = next; else break; } @@ -294,7 +294,6 @@ export class DocumentDecorations extends React.Component<{}, { value: string }> const doc = Document(element.rootDoc); if (doc.type === DocumentType.INK && doc.x && doc.y && doc._width && doc._height && doc.data) { doc.rotation = Number(doc.rotation) + Number(angle); - console.log(doc.rotation); const ink = Cast(doc.data, InkField)?.inkData; if (ink) { diff --git a/src/client/views/InkingStroke.tsx b/src/client/views/InkingStroke.tsx index 7d9a3c8b3..224abfd77 100644 --- a/src/client/views/InkingStroke.tsx +++ b/src/client/views/InkingStroke.tsx @@ -43,8 +43,6 @@ export class InkingStroke extends ViewBoxBaseComponent { FormatShapePane.Instance.Pinned = true; - FormatShapePane.Instance.selected(); - } render() { @@ -62,14 +60,14 @@ export class InkingStroke extends ViewBoxBaseComponent 5 ? strokeColor : "transparent", strokeWidth, (strokeWidth + 15), - StrCast(this.layoutDoc.strokeBezier, ActiveInkBezierApprox()), StrCast(this.layoutDoc.fillColor, ActiveFillColor()), + StrCast(this.layoutDoc.strokeBezier), StrCast(this.layoutDoc.fillColor, "transparent"), "none", "none", "0", scaleX, scaleY, "", this.props.active() ? "visiblepainted" : "none", false, true); return ( p && !i.rootDoc.fillColor ? true : false, true) || false; + } + @computed get _solidFill() { + return this.inks?.reduce((p, i) => p && i.rootDoc.fillColor ? true : false, true) || false; + } + set _noFill(value) { this._currFill = value ? "" : this._lastFill; } + set _solidFill(value) { this._noFill = !value; } + + @computed get _noLine() { + return this.inks?.reduce((p, i) => p && !i.rootDoc.color ? true : false, true) || false; + } + @computed get _solidLine() { + return this.inks?.reduce((p, i) => p && + i.rootDoc.color && (i.rootDoc.dash === undefined || i.rootDoc.dash === "0") ? true : false, true) || false; + } + @computed get _dashLine() { + return !this._noLine && this.inks?.reduce((p, i) => + (p === undefined || (p && p === i.rootDoc.dash)) && i.rootDoc.dash !== "0" ? StrCast(i.rootDoc.dash) : "", undefined as Opt) || ""; + } + set _noLine(value) { this._currColor = value ? "" : this._lastLine; } + set _solidLine(value) { this._dashLine = ""; this._noLine = !value; } + set _dashLine(value) { + value && (this._lastDash = value); this._noLine = false; + this.inks?.forEach(i => i.rootDoc.dash = value ? this._lastDash : undefined) + } + + @computed get _currFill() { + const cfill = this._noFill || !this.inks ? "" : StrCast(this.inks[0].rootDoc.fillColor); + cfill && (this._lastFill = cfill); + return cfill; + } + @computed get _currColor() { + const ccol = this._noLine || !this.inks ? "" : StrCast(this.inks[0].rootDoc.color, ""); + this._lastLine = ccol ? ccol : this._lastLine; + return ccol; + } + set _currFill(value) { value && (this._lastFill = value); this.inks?.forEach(i => i.rootDoc.fillColor = value); } + set _currColor(value) { value && (this._lastLine = value); this.inks?.forEach(i => i.rootDoc.color = value ? value : undefined) } + + @computed get _arrowStart() { + return this.inks?.reduce((p, i) => + (p === undefined || (p && p === i.rootDoc.arrowStart)) ? StrCast(i.rootDoc.arrowStart) : "", undefined as Opt) || ""; + } + @computed get _arrowEnd() { + return this.inks?.reduce((p, i) => + (p === undefined || (p && p === i.rootDoc.arrowEnd)) ? StrCast(i.rootDoc.arrowEnd) : "", undefined as Opt) || "" + } + set _arrowStart(value) { this.inks?.forEach(i => i.rootDoc.arrowStart = value); } + set _arrowEnd(value) { this.inks?.forEach(i => i.rootDoc.arrowEnd = value); } + + @computed get _currSizeHeight() { + return this.inks?.reduce((p, i) => + (p === undefined || (p === NumCast(i.rootDoc._height).toString())) ? NumCast(i.rootDoc._height).toString() : "", undefined as Opt) || "" + } + @computed get _currSizeWidth() { + return this.inks?.reduce((p, i) => + (p === undefined || (p === NumCast(i.rootDoc._width).toString())) ? NumCast(i.rootDoc._width).toString() : "", undefined as Opt) || "" + } + @computed get _currRotation() { + return this.inks?.reduce((p, i) => + (p === undefined || (p === NumCast(i.rootDoc.rotation).toString())) ? NumCast(i.rootDoc.rotation).toString() : "", undefined as Opt) || "" + } + @computed get _currPositionHorizontal() { + return this.inks?.reduce((p, i) => + (p === undefined || (p === NumCast(i.rootDoc.x).toString())) ? NumCast(i.rootDoc.x).toString() : "", undefined as Opt) || "" + } + @computed get _currPositionVertical() { + return this.inks?.reduce((p, i) => + (p === undefined || (p === NumCast(i.rootDoc.y).toString())) ? NumCast(i.rootDoc.y).toString() : "", undefined as Opt) || "" + } + @computed get _currStrokeWidth() { + return this.inks?.reduce((p, i) => + (p === undefined || (p === NumCast(i.rootDoc.strokeWidth).toString())) ? NumCast(i.rootDoc.strokeWidth).toString() : "", undefined as Opt) || "" + } + set _currPositionHorizontal(value) { this.inks?.forEach(i => i.rootDoc.x = Number(value)); } + set _currPositionVertical(value) { this.inks?.forEach(i => i.rootDoc.y = Number(value)); } + set _currRotation(value) { this.inks?.forEach(i => i.rootDoc.rotation = Number(value)); } + set _currStrokeWidth(value) { this.inks?.forEach(i => i.rootDoc.strokeWidth = Number(value)); } + set _currSizeWidth(value) { + this.inks?.forEach(i => { + const doc = i.rootDoc; + if (doc._width && doc._height) { + const oldWidth = NumCast(doc._width); + const oldHeight = NumCast(doc._height); + doc._width = Number(value); + if (this._lock) { + doc._height = (doc._width * oldHeight) / oldWidth; + } + } + }); + } + set _currSizeHeight(value) { + this.inks?.forEach(i => { + const doc = i.rootDoc; + if (doc._width && doc._height) { + const oldWidth = NumCast(doc._width); + const oldHeight = NumCast(doc._height); + doc._height = Number(value); + if (this._lock) { + doc._width = (doc._height * oldWidth) / oldHeight; + } + } + }); + } constructor(props: Readonly<{}>) { super(props); @@ -80,191 +178,40 @@ export default class FormatShapePane extends AntimodeMenu { this.Pinned = false; } - //if multiple inks are selected and do not share the same prop, leave blank - @action - checkSame = () => { - const docs = SelectionManager.SelectedDocuments(); - const inks: DocumentView[] = []; - for (var i = 0; i < docs.length; i++) { - if (Document(docs[i].rootDoc).type === DocumentType.INK) { - inks.push(docs[i]); - } - } - this._noFill = Document(inks[0].rootDoc).fillColor === "none" ? true : false; - this._solidFill = Document(inks[0].rootDoc).fillColor === "none" ? false : true; - this._noLine = Document(inks[0].rootDoc).color === "none" ? true : false; - if (Document(inks[0].rootDoc).color !== "none") { - this._solidLine = true; - this._dashLine = true; - if (Document(inks[0].rootDoc).dash === "0") { - this._dashLine = false; - } else { - this._solidLine = false; - - } - } - this._currWidth = String(Document(inks[0].rootDoc).strokeWidth); - this._currFill = String(Document(inks[0].rootDoc).fillColor); - this._currColor = String(Document(inks[0].rootDoc).color); - this._arrowHead = Document(inks[0].rootDoc).arrowStart === "none" ? false : true; - this._arrowEnd = Document(inks[0].rootDoc).arrowEnd === "none" ? false : true; - this._currSizeHeight = String(Document(inks[0].rootDoc)._height); - this._currSizeWidth = String(Document(inks[0].rootDoc)._width); - this._currRotation = String(Document(inks[0].rootDoc).rotation); - this._currPositionHorizontal = String(Document(inks[0].rootDoc).x); - this._currPositionVertical = String(Document(inks[0].rootDoc).y); - for (var i = 0; i < inks.length; i++) { - if (Document(inks[i].rootDoc).strokeWidth !== Document(inks[0].rootDoc).strokeWidth) { - this._currWidth = ""; - } - if (Document(inks[i].rootDoc).color !== Document(inks[0].rootDoc).color) { - this._noLine = false; - this._solidLine = false; - this._dashLine = false; - } - if (Document(inks[i].rootDoc).fillColor !== Document(inks[0].rootDoc).fillColor) { - this._solidFill = false; - this._noFill = false; - } - if (Document(inks[i].rootDoc).arrowStart !== Document(inks[0].rootDoc).arrowStart) { - this._arrowHead = false; - } - if (Document(inks[i].rootDoc).arrowEnd !== Document(inks[0].rootDoc).arrowEnd) { - this._arrowEnd = false; - } - if (Document(inks[i].rootDoc).x !== Document(inks[0].rootDoc).x) { - this._currPositionHorizontal = ""; - } - if (Document(inks[i].rootDoc).y !== Document(inks[0].rootDoc).y) { - this._currPositionVertical = ""; - } - if (Document(inks[i].rootDoc)._width !== Document(inks[0].rootDoc)._width) { - this._currSizeWidth = ""; - } - if (Document(inks[i].rootDoc)._height !== Document(inks[0].rootDoc)._height) { - this._currSizeHeight = ""; - } - if (Document(inks[i].rootDoc).rotation !== Document(inks[0].rootDoc).rotation) { - this._currRotation = ""; - } - } - } - - @action upDownButtons = (dirs: string, field: string) => { - SelectionManager.SelectedDocuments().forEach(action((element: DocumentView) => { - const doc = Document(element.rootDoc); - if (doc.type === DocumentType.INK) { - switch (field) { - case "width": - if (doc.strokeWidth) { - doc.strokeWidth = dirs === "up" ? doc.strokeWidth + 1 : doc.strokeWidth - 1; - SetActiveInkWidth(String(doc.strokeWidth)); + switch (field) { + case "horizontal": this.inks?.forEach(i => i.rootDoc.x = NumCast(i.rootDoc.x) + (dirs === "up" ? 10 : -10)); break; + case "vertical": this.inks?.forEach(i => i.rootDoc.y = NumCast(i.rootDoc.y) + (dirs === "up" ? 10 : -10)); break; + case "rotation": this.rotate((dirs === "up" ? .1 : -.1)); break; + case "width": this.inks?.forEach(i => i.rootDoc.strokeWidth = NumCast(i.rootDoc.strokeWidth) + (dirs === "up" ? .1 : -.1)); break; + case "sizeWidth": + this.inks?.forEach(i => { + const doc = i.rootDoc; + if (doc._width && doc._height) { + const oldWidth = NumCast(doc._width); + const oldHeight = NumCast(doc._height); + doc._width = NumCast(doc._width) + (dirs === "up" ? 10 : - 10); + if (this._lock) { + doc._height = (NumCast(doc._width) * oldHeight) / oldWidth; } - break; - case "sizeWidth": - if (doc._width && doc._height) { - const oldWidth = doc._width; - const oldHeight = doc._height; - doc._width = dirs === "up" ? doc._width + 10 : doc._width - 10; - if (this._lock) { - doc._height = (doc._width * oldHeight) / oldWidth; - } - } - break; - case "sizeHeight": - if (doc._width && doc._height) { - const oldWidth = doc._width; - const oldHeight = doc._height; - doc._height = dirs === "up" ? doc._height + 10 : doc._height - 10; - if (this._lock) { - doc._width = (doc._height * oldWidth) / oldHeight; - } - } - break; - case "horizontal": - if (doc.x) { - doc.x = dirs === "up" ? doc.x + 10 : doc.x - 10; - } - break; - case "vertical": - if (doc.y) { - doc.y = dirs === "up" ? doc.y + 10 : doc.y - 10; - } - case "rotation": - this.rotate(dirs === "up" ? Number(doc.rotation) + Number(0.1) : Number(doc.rotation) - Number(0.1)); - break; - default: - break; - } - this.selected(); - } - })); - } - - - @action - editProperties = (value: any, field: string) => { - SelectionManager.SelectedDocuments().forEach(action((element: DocumentView) => { - const doc = Document(element.rootDoc); - if (doc.type === DocumentType.INK) { - switch (field) { - case "width": - SetActiveInkWidth(value); - doc.strokeWidth = Number(value); - break; - case "color": - doc.color = String(value); - break; - case "fill": - doc.fillColor = String(value); - break; - case "bezier": - break; - case "arrowStart": - doc.arrowStart = String(value); - break; - case "arrowEnd": - doc.arrowEnd = String(value); - break; - case "dash": - doc.dash = String(value); - break; - case "widthSize": - if (doc._width && doc._height) { - const oldWidth = doc._width; - const oldHeight = doc._height; - doc._width = Number(value); - if (this._lock) { - doc._height = (doc._width * oldHeight) / oldWidth; - } - } - break; - case "heightSize": - if (doc._width && doc._height) { - const oldWidth = doc._width; - const oldHeight = doc._height; - doc._height = Number(value); - if (this._lock) { - doc._width = (doc._height * oldWidth) / oldHeight; - } + } + }); + break; + case "sizeHeight": + this.inks?.forEach(i => { + const doc = i.rootDoc; + if (doc._width && doc._height) { + const oldWidth = NumCast(doc._width); + const oldHeight = NumCast(doc._height) + doc._height = NumCast(doc._height) + (dirs === "up" ? 10 : - 10); + if (this._lock) { + doc._width = (NumCast(doc._height) * oldWidth) / oldHeight; } - break; - case "horizontal": - doc.x = Number(value); - break; - case "vertical": - doc.y = Number(value); - break; - default: - break; - } - } - this.selected(); - })); - this.checkSame(); - + } + }); + break; + } } @computed get close() { @@ -294,69 +241,6 @@ export default class FormatShapePane extends AntimodeMenu { return modes; } - //detects currently selected document and change value in pane - @action - selected = () => { - this._selectDoc = SelectionManager.SelectedDocuments(); - if (this._selectDoc.length === 1 && Document(this._selectDoc[0].rootDoc).type === DocumentType.INK) { - this._single = true; - const doc = Document(this._selectDoc[0].rootDoc); - if (doc.type === DocumentType.INK) { - if (doc.fillColor === "none") { - this._noFill = true; - this._solidFill = false; - } else { - this._solidFill = true; - this._noFill = false; - this._currFill = String(doc.fillColor); - } - if (doc.color === "none") { - this._noLine = true; - this._solidLine = false; - this._dashLine = false; - } else { - this._currWidth = String(doc.strokeWidth); - this._currColor = String(doc.color); - if (doc.dash === "0") { - this._solidLine = true; - this._noLine = false; - this._dashLine = false; - } else { - this._dashLine = true; - this._noLine = false; - this._solidLine = false; - } - - this._arrowHead = doc.arrowStart === "none" ? false : true; - this._arrowEnd = doc.arrowEnd === "none" ? false : true; - this._currPositionHorizontal = String(doc.x); - this._currPositionVertical = String(doc.y); - this._currRotation = String(doc.rotation); - this._currSizeHeight = String(doc._height); - this._currSizeWidth = String(doc._width); - } - - } - } else { - this._noFill = false; - this._solidFill = false; - this._single = false; - this._currFill = "#D0021B"; - this._noLine = false; - this._solidLine = false; - this._dashLine = false; - this._currColor = "#D0021B"; - this._arrowHead = false; - this._arrowEnd = false; - this._currPositionHorizontal = ""; - this._currPositionVertical = ""; - this._currRotation = ""; - this._currSizeHeight = ""; - this._currSizeWidth = ""; - } - this.checkSame(); - } - @action rotate = (degrees: number) => { SelectionManager.SelectedDocuments().forEach(action((element: DocumentView) => { @@ -395,143 +279,80 @@ export default class FormatShapePane extends AntimodeMenu { })); } - @action - toggle = (check: string) => { - switch (check) { - case "noFill": - if (!this._noFill) { - this._noFill = true; - this._solidFill = false; - } - break; - case "solidFill": - if (!this._solidFill) { - this._solidFill = true; - this._noFill = false; - if (this._currFill === "none") { - this._currFill = "#D0021B"; - } - } - break; - case "noLine": - if (!this._noLine) { - this._noLine = true; - this._solidLine = false; - this._dashLine = false; - } - break; - case "solidLine": - if (!this._solidLine) { - this._solidLine = true; - this._noLine = false; - this._dashLine = false; - if (this._currColor === "none") { - this._currColor = "#D0021B"; - } - } - break; - case "dashLine": - if (!this._dashLine) { - this._dashLine = true; - this._solidLine = false; - this._noLine = false; - if (this._currColor === "none") { - this._currColor = "#D0021B"; - } - } - break; - case "lock": - if (this._lock) { - this._lock = false; - } else { - this._lock = true; - } - break; - case "arrowHead": - this._arrowHead = this._arrowHead ? false : true; - break; - case "arrowEnd": - this._arrowEnd = this._arrowEnd ? false : true; - break; - default: - break; - } - } - @computed get subMenu() { const fillCheck =
- { this.toggle("noFill"); this.editProperties("none", "fill"); })} /> + this._noFill = true)} /> No Fill -

- { this.toggle("solidFill"); this.editProperties(this._currFill, "fill"); })} /> +
+ this._solidFill = true)} /> Solid Fill -

-

+
+
{this._solidFill ? "Color" : ""} {this._solidFill ? this.fillButton : ""} {this._fillBtn && this._solidFill ? this.fillPicker : ""}
; - const arrows = <> { this.toggle("arrowHead"); this.editProperties(this._arrowHead ? "arrowHead" : "none", "arrowStart"); })} /> + const arrows = <> this._arrowStart = this._arrowStart ? "" : "arrow")} /> Arrow Head -

+
- { this.toggle("arrowEnd"); this.editProperties(this._arrowEnd ? "arrowEnd" : "none", "arrowEnd"); })} /> + this._arrowEnd = this._arrowEnd ? "" : "arrow")} /> Arrow End -

; +
; const lineCheck =
- { this.toggle("noLine"); this.editProperties("none", "color"); })} /> + this._noLine = true)} /> No Line -

- { this.toggle("solidLine"); this.editProperties(this._currColor, "color"); this.editProperties("0", "dash"); })} /> +
+ this._solidLine = true)} /> Solid Line -

- { this.toggle("dashLine"); this.editProperties(this._currColor, "color"); this.editProperties("2", "dash"); })} /> +
+ this._dashLine = "2")} /> Dash Line -

-

+
+
{(this._solidLine || this._dashLine) ? "Color" : ""} {(this._solidLine || this._dashLine) ? this.lineButton : ""} {this._lineBtn && (this._solidLine || this._dashLine) ? this.linePicker : ""} -

+
{(this._solidLine || this._dashLine) ? "Width" : ""} {(this._solidLine || this._dashLine) ? this.widthInput : ""} -

-

+
+
{(this._solidLine || this._dashLine) ? arrows : ""}
; const sizeCheck =
Height {this.sizeHeightInput} -

-

+
+
Width {this.sizeWidthInput} -

-

+
+
- { this.toggle("lock"); })} /> + this._lock = !this._lock)} /> Lock Ratio -

-

+
+
Rotation {this.rotationInput} -

-

+
+
; const positionCheck =
Horizontal {this.positionHorizontalInput} -

-

+
+
Vertical {this.positionVerticalInput} -

-

+
+
; @@ -574,29 +395,30 @@ export default class FormatShapePane extends AntimodeMenu { } @computed get fillButton() { - const fillButton = <> + return <> +

-

; - return fillButton; +

+ ; } @computed get fillPicker() { - const fillPicker =
+ return
{this._palette.map(color => { return
; - return fillPicker; } @computed get lineButton() { - const lineButton = <> -

-

; - return lineButton; + return <> + +
+
+ ; } @computed get linePicker() { - const linePicker =
+ return
{this._palette.map(color => { return
; - return linePicker; } @computed get widthInput() { const widthInput = <> this.onChange(e.target.value, "width")} - autoFocus>
@@ -672,8 +494,8 @@ export default class FormatShapePane extends AntimodeMenu { this.onChange(e.target.value, "sizeHeight")} - autoFocus> + onChange={e => this._currSizeHeight = e.target.value} + autoFocus /> -

+
-

+
+

+ -

- ; - return positionHorizontalInput; + ; } @computed get positionVerticalInput() { - const positionVerticalInput = - <> + this.onChange(e.target.value, "positionVertical")} + onChange={e => this._currPositionVertical = e.target.value} autoFocus> - -

- ; - return positionVerticalInput; - } - - //change inputs - @action - onChange = (val: string, property: string): void => { - if (!Number.isNaN(Number(val)) && Number(val) !== null && val !== " ") { - - switch (property) { - case "width": - this._currWidth = val; - if (val !== "") { - this.editProperties(this._currWidth, "width"); - } - break; - case "sizeHeight": - this._currSizeHeight = val; - if (val !== "") { - this.editProperties(this._currSizeHeight, "heightSize"); - } - break; - case "sizeWidth": - this._currSizeWidth = val; - if (val !== "") { - - this.editProperties(this._currSizeWidth, "widthSize"); - } - break; - case "rotation": - - this._currRotation = val; - if (val !== "") { - - this.rotate(Number(val)); - } - break; - case "positionHorizontal": - this._currPositionHorizontal = val; if (val !== "") { - - this.editProperties(this._currPositionHorizontal, "horizontal"); - } - - break; - case "positionVertical": - this._currPositionVertical = val; - if (val !== "") { - - this.editProperties(this._currPositionVertical, "vertical"); - } - - break; - default: - break; - } - } - } - - - @computed get widthPicker() { - var widthPicker = ; - if (this._widthBtn) { - widthPicker =
- {widthPicker} - {this._width.map(wid => { - return ; - })} -
; - } - return widthPicker; +

+ + ; } - - render() { const buttons = [ diff --git a/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx b/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx index e4f3248d0..0866db2be 100644 --- a/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx +++ b/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx @@ -25,19 +25,19 @@ library.add(faBold, faItalic, faChevronLeft, faUnderline, faStrikethrough, faSup export default class InkOptionsMenu extends AntimodeMenu { static Instance: InkOptionsMenu; - private _palette = ["#D0021B", "#F5A623", "#F8E71C", "#8B572A", "#7ED321", "#417505", "#9013FE", "#4A90E2", "#50E3C2", "#B8E986", "#000000", "#4A4A4A", "#9B9B9B", "#FFFFFF", "none"]; + private _palette = ["#D0021B", "#F5A623", "#F8E71C", "#8B572A", "#7ED321", "#417505", "#9013FE", "#4A90E2", "#50E3C2", "#B8E986", "#000000", "#4A4A4A", "#9B9B9B", "#FFFFFF", ""]; private _width = ["1", "5", "10", "100"]; // private _buttons = ["circle", "triangle", "rectangle", "arrow", "line"]; // private _icons = ["O", "∆", "ロ", "➜", "-"]; // private _buttons = ["circle", "triangle", "rectangle", "line", "noRec", "",]; // private _icons = ["O", "∆", "ロ", "⎯⎯⎯", "✖︎", " "]; //arrowStart and arrowEnd must match and defs must exist in Inking Stroke - // private _arrowStart = ["arrowHead", "arrowHead", "dot", "dot", "none"]; + // private _arrowStart = ["arrowStart", "arrowStart", "dot", "dot", "none"]; // private _arrowEnd = ["none", "arrowEnd", "none", "dot", "none"]; // private _arrowIcons = ["→", "↔︎", "•", "••", " "]; private _draw = ["⎯", "→", "↔︎", "∿", "↝", "↭", "ロ", "O", "∆"]; - private _head = ["none", "none", "arrowHead", "none", "none", "arrowHead", "none", "none", "none"]; - private _end = ["none", "arrowEnd", "arrowEnd", "none", "arrowEnd", "arrowEnd", "none", "none", "none"]; + private _head = ["", "", "arrow", "", "", "arrow", "", "", ""]; + private _end = ["", "arrow", "arrow", "", "arrow", "arrow", "", "", ""]; private _shape = ["", "", "", "", "", "", "rectangle", "circle", "triangle"]; @observable _shapesNum = this._shape.length; @@ -122,12 +122,6 @@ export default class InkOptionsMenu extends AntimodeMenu { case "bezier": // doc.strokeBezier === 300 ? doc.strokeBezier = 0 : doc.strokeBezier = 300; break; - case "arrowStart": - doc.arrowStart = String(value); - break; - case "arrowEnd": - doc.arrowEnd = String(value); - break; case "dash": doc.dash = Number(value); default: @@ -165,13 +159,12 @@ export default class InkOptionsMenu extends AntimodeMenu { SetActiveArrowEnd(this._end[i]); SetActiveBezierApprox("300"); - // this.editProperties(this._head[i], "arrowStart"), this.editProperties(this._end[i], "arrowEnd"); GestureOverlay.Instance.InkShape = this._shape[i]; } else { this._selected = this._shapesNum; Doc.SetSelectedTool(InkTool.None); - SetActiveArrowStart("none"); - SetActiveArrowEnd("none"); + SetActiveArrowStart(""); + SetActiveArrowEnd(""); GestureOverlay.Instance.InkShape = ""; SetActiveBezierApprox("0"); @@ -189,13 +182,12 @@ export default class InkOptionsMenu extends AntimodeMenu { SetActiveArrowEnd(this._end[i]); SetActiveBezierApprox("300"); - // this.editProperties(this._head[i], "arrowStart"), this.editProperties(this._end[i], "arrowEnd"); GestureOverlay.Instance.InkShape = this._shape[i]; } else { this._selected = this._shapesNum; Doc.SetSelectedTool(InkTool.None); - SetActiveArrowStart("none"); - SetActiveArrowEnd("none"); + SetActiveArrowStart(""); + SetActiveArrowEnd(""); GestureOverlay.Instance.InkShape = ""; SetActiveBezierApprox("0"); diff --git a/src/client/views/nodes/ColorBox.tsx b/src/client/views/nodes/ColorBox.tsx index 137b387c0..31c5a8b13 100644 --- a/src/client/views/nodes/ColorBox.tsx +++ b/src/client/views/nodes/ColorBox.tsx @@ -14,7 +14,6 @@ import { ViewBoxBaseComponent } from "../DocComponent"; import { ActiveInkPen, ActiveInkWidth, ActiveInkBezierApprox, SetActiveInkColor, SetActiveInkWidth, SetActiveBezierApprox } from "../InkingStroke"; import "./ColorBox.scss"; import { FieldView, FieldViewProps } from './FieldView'; -import { FormattedTextBox } from "./formattedText/FormattedTextBox"; type ColorDocument = makeInterface<[typeof documentSchema]>; const ColorDocument = makeInterface(documentSchema); -- cgit v1.2.3-70-g09d2 From cef8f8d5fb9f5b9dc1f56768c4fa5ec406fbc6ba Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Sat, 11 Jul 2020 20:02:55 -0400 Subject: fixed layout of inkOptionsMenu --- src/client/views/collections/collectionFreeForm/FormatShapePane.scss | 2 +- src/client/views/collections/collectionFreeForm/FormatShapePane.tsx | 4 ++-- 2 files changed, 3 insertions(+), 3 deletions(-) (limited to 'src/client/views/collections/collectionFreeForm') diff --git a/src/client/views/collections/collectionFreeForm/FormatShapePane.scss b/src/client/views/collections/collectionFreeForm/FormatShapePane.scss index 80a74fe4c..7720140b9 100644 --- a/src/client/views/collections/collectionFreeForm/FormatShapePane.scss +++ b/src/client/views/collections/collectionFreeForm/FormatShapePane.scss @@ -1,6 +1,6 @@ .antimodeMenu-button { width: 200px; - position: absolute; + position: relative; text-align: left; .color-previewI { diff --git a/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx b/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx index 3a1c8b18d..095473330 100644 --- a/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx +++ b/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx @@ -136,7 +136,7 @@ export default class FormatShapePane extends AntimodeMenu { } @computed get close() { - return ; } @@ -320,7 +320,7 @@ export default class FormatShapePane extends AntimodeMenu { colorButton(value: string, setter: () => {}) { return <> - -- cgit v1.2.3-70-g09d2 From 49b6ab8536f570ef244199ac39194d3b176c9e77 Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Sat, 11 Jul 2020 20:47:55 -0400 Subject: added open formatting pane to inkOptions. switched to radio buttons for some options. changed names of stroke parameters to start with 'stroke" --- src/client/views/InkingStroke.tsx | 4 ++-- .../collectionFreeForm/FormatShapePane.tsx | 25 +++++++++++----------- .../collectionFreeForm/InkOptionsMenu.tsx | 17 +++++++++++---- src/client/views/nodes/ColorBox.tsx | 11 ++++++++-- 4 files changed, 37 insertions(+), 20 deletions(-) (limited to 'src/client/views/collections/collectionFreeForm') diff --git a/src/client/views/InkingStroke.tsx b/src/client/views/InkingStroke.tsx index 46f714875..d7f956e4f 100644 --- a/src/client/views/InkingStroke.tsx +++ b/src/client/views/InkingStroke.tsx @@ -63,8 +63,8 @@ export class InkingStroke extends ViewBoxBaseComponent 5 ? strokeColor : "transparent", strokeWidth, (strokeWidth + 15), StrCast(this.layoutDoc.strokeBezier), StrCast(this.layoutDoc.fillColor, "transparent"), diff --git a/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx b/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx index 095473330..77d1b646d 100644 --- a/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx +++ b/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx @@ -43,10 +43,10 @@ export default class FormatShapePane extends AntimodeMenu { @computed get _noFill() { return this.inks?.reduce((p, i) => p && !i.rootDoc.fillColor ? true : false, true) || false; } @computed get _solidFill() { return this.inks?.reduce((p, i) => p && i.rootDoc.fillColor ? true : false, true) || false; } @computed get _noLine() { return this.inks?.reduce((p, i) => p && !i.rootDoc.color ? true : false, true) || false; } - @computed get _solidLine() { return this.inks?.reduce((p, i) => p && i.rootDoc.color && (!i.rootDoc.dash || i.rootDoc.dash === "0") ? true : false, true) || false; } - @computed get _arrowStart() { return this.getField("arrowStart") || ""; } - @computed get _arrowEnd() { return this.getField("arrowEnd") || ""; } - @computed get _dashLine() { return !this._noLine && this.getField("dash") || ""; } + @computed get _solidLine() { return this.inks?.reduce((p, i) => p && i.rootDoc.color && (!i.rootDoc.strokeDash || i.rootDoc.strokeDash === "0") ? true : false, true) || false; } + @computed get _arrowStart() { return this.getField("strokeArrowStart") || ""; } + @computed get _arrowEnd() { return this.getField("strokeArrowEnd") || ""; } + @computed get _dashLine() { return !this._noLine && this.getField("strokeDash") || ""; } @computed get _currSizeHeight() { return this.getField("_height"); } @computed get _currSizeWidth() { return this.getField("_width"); } @computed get _currRotation() { return this.getField("rotation"); } @@ -59,13 +59,13 @@ export default class FormatShapePane extends AntimodeMenu { set _solidFill(value) { this._noFill = !value; } set _currFill(value) { value && (this._lastFill = value); this.inks?.forEach(i => i.rootDoc.fillColor = value ? value : undefined); } set _currColor(value) { value && (this._lastLine = value); this.inks?.forEach(i => i.rootDoc.color = value ? value : undefined); } - set _arrowStart(value) { this.inks?.forEach(i => i.rootDoc.arrowStart = value); } - set _arrowEnd(value) { this.inks?.forEach(i => i.rootDoc.arrowEnd = value); } + set _arrowStart(value) { this.inks?.forEach(i => i.rootDoc.strokeArrowStart = value); } + set _arrowEnd(value) { this.inks?.forEach(i => i.rootDoc.strokeArrowEnd = value); } set _noLine(value) { this._currColor = value ? "" : this._lastLine; } set _solidLine(value) { this._dashLine = ""; this._noLine = !value; } set _dashLine(value) { value && (this._lastDash = value) && (this._noLine = false); - this.inks?.forEach(i => i.rootDoc.dash = value ? this._lastDash : undefined); + this.inks?.forEach(i => i.rootDoc.strokeDash = value ? this._lastDash : undefined); } set _currXpos(value) { this.inks?.forEach(i => i.rootDoc.x = Number(value)); } set _currYpos(value) { this.inks?.forEach(i => i.rootDoc.y = Number(value)); } @@ -192,10 +192,10 @@ export default class FormatShapePane extends AntimodeMenu { @computed get subMenu() { const fillCheck =
- this._noFill = true)} /> + this._noFill = true)} /> No Fill
- this._solidFill = true)} /> + this._solidFill = true)} /> Solid Fill

@@ -214,13 +214,13 @@ export default class FormatShapePane extends AntimodeMenu { ; const lineCheck =
- this._noLine = true)} /> + this._noLine = true)} /> No Line
- this._solidLine = true)} /> + this._solidLine = true)} /> Solid Line
- this._dashLine = "2")} /> + this._dashLine = "2")} /> Dash Line

@@ -230,6 +230,7 @@ export default class FormatShapePane extends AntimodeMenu {
{(this._solidLine || this._dashLine) ? "Width" : ""} {(this._solidLine || this._dashLine) ? this.widthInput : ""} + {(this._solidLine || this._dashLine) ? this._currStrokeWidth = e.target.value} /> : (null)}

{(this._solidLine || this._dashLine) ? arrows : ""} diff --git a/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx b/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx index ddba8a66d..7f0bb5364 100644 --- a/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx +++ b/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx @@ -18,6 +18,7 @@ import { FontAwesomeIcon } from "@fortawesome/react-fontawesome"; import { IconProp, library } from '@fortawesome/fontawesome-svg-core'; import { faBold, faItalic, faChevronLeft, faUnderline, faStrikethrough, faSubscript, faSuperscript, faIndent, faEyeDropper, faCaretDown, faPalette, faArrowsAlt, faHighlighter, faLink, faPaintRoller, faSleigh, faBars, faFillDrip, faBrush, faPenNib, faShapes, faArrowLeft, faEllipsisH, faBezierCurve, } from "@fortawesome/free-solid-svg-icons"; import { Cast, StrCast, BoolCast } from "../../../../fields/Types"; +import FormatShapePane from "./FormatShapePane"; library.add(faBold, faItalic, faChevronLeft, faUnderline, faStrikethrough, faSuperscript, faSubscript, faIndent, faEyeDropper, faCaretDown, faPalette, faArrowsAlt, faHighlighter, faLink, faPaintRoller, faBars, faFillDrip, faBrush, faPenNib, faShapes, faArrowLeft, faEllipsisH, faBezierCurve); @@ -40,7 +41,7 @@ export default class InkOptionsMenu extends AntimodeMenu { private _draw = ["⎯", "→", "↔︎", "∿", "↝", "↭", "ロ", "O", "∆"]; private _head = ["", "", "arrow", "", "", "arrow", "", "", ""]; private _end = ["", "arrow", "arrow", "", "arrow", "arrow", "", "", ""]; - private _shape = ["", "", "", "", "", "", "rectangle", "circle", "triangle"]; + private _shape = ["line", "line", "line", "", "", "", "rectangle", "circle", "triangle"]; @observable _shapesNum = this._shape.length; @observable _selected = this._shapesNum; @@ -127,7 +128,7 @@ export default class InkOptionsMenu extends AntimodeMenu { // doc.strokeBezier === 300 ? doc.strokeBezier = 0 : doc.strokeBezier = 300; break; case "dash": - doc.dash = Number(value); + doc.strokeDash = Number(value); default: break; } @@ -144,7 +145,7 @@ export default class InkOptionsMenu extends AntimodeMenu { @action changeDash = (e: React.PointerEvent): void => { SetActiveDash(ActiveDash() === "0" ? "2" : "0"); - this.editProperties(ActiveDash(), "dash"); + this.editProperties(ActiveDash(), "strokeDash"); } @computed get drawButtons() { @@ -296,6 +297,14 @@ export default class InkOptionsMenu extends AntimodeMenu { } return colorPicker; } + @computed get formatPane() { + return ; + } @computed get fillPicker() { var fillPicker = - ]; // return this.getElement(buttons); diff --git a/src/client/views/nodes/ColorBox.tsx b/src/client/views/nodes/ColorBox.tsx index c35c52644..57028b0ca 100644 --- a/src/client/views/nodes/ColorBox.tsx +++ b/src/client/views/nodes/ColorBox.tsx @@ -14,6 +14,7 @@ import { ViewBoxBaseComponent } from "../DocComponent"; import { ActiveInkPen, ActiveInkWidth, ActiveInkBezierApprox, SetActiveInkColor, SetActiveInkWidth, SetActiveBezierApprox } from "../InkingStroke"; import "./ColorBox.scss"; import { FieldView, FieldViewProps } from './FieldView'; +import { DocumentType } from "../../documents/DocumentTypes"; type ColorDocument = makeInterface<[typeof documentSchema]>; const ColorDocument = makeInterface(documentSchema); @@ -62,9 +63,15 @@ export class ColorBox extends ViewBoxBaseComponent
{ActiveInkWidth() ?? 2}
- ) => SetActiveInkWidth(e.target.value)} /> + ) => { + SetActiveInkWidth(e.target.value); + SelectionManager.SelectedDocuments().filter(i => StrCast(i.rootDoc.type) === DocumentType.INK).map(i => i.rootDoc.strokeWidth = Number(e.target.value)); + }} />
{ActiveInkBezierApprox() ?? 2}
- ) => SetActiveBezierApprox(e.target.value)} /> + ) => { + SetActiveBezierApprox(e.target.value); + SelectionManager.SelectedDocuments().filter(i => StrCast(i.rootDoc.type) === DocumentType.INK).map(i => i.rootDoc.strokeBezier = e.target.value); + }} />

-- cgit v1.2.3-70-g09d2 From add9dfeec764b5a60a57344c79fd23a91c031a2d Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Sun, 12 Jul 2020 10:31:06 -0400 Subject: final cleanup of names and structure of FormatShapePane --- src/client/views/InkingStroke.tsx | 2 +- .../collectionFreeForm/FormatShapePane.scss | 5 + .../collectionFreeForm/FormatShapePane.tsx | 404 +++++++++------------ .../collectionFreeForm/InkOptionsMenu.tsx | 9 +- 4 files changed, 182 insertions(+), 238 deletions(-) (limited to 'src/client/views/collections/collectionFreeForm') diff --git a/src/client/views/InkingStroke.tsx b/src/client/views/InkingStroke.tsx index d7f956e4f..abc698e62 100644 --- a/src/client/views/InkingStroke.tsx +++ b/src/client/views/InkingStroke.tsx @@ -63,7 +63,7 @@ export class InkingStroke extends ViewBoxBaseComponent 5 ? strokeColor : "transparent", strokeWidth, (strokeWidth + 15), diff --git a/src/client/views/collections/collectionFreeForm/FormatShapePane.scss b/src/client/views/collections/collectionFreeForm/FormatShapePane.scss index 7720140b9..88876471c 100644 --- a/src/client/views/collections/collectionFreeForm/FormatShapePane.scss +++ b/src/client/views/collections/collectionFreeForm/FormatShapePane.scss @@ -22,6 +22,11 @@ padding: 0; } +.formatShapePane-inputBtn { + width: inherit; + position: absolute; +} + .sketch-picker { background: #323232; diff --git a/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx b/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx index 77d1b646d..56ba9e96a 100644 --- a/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx +++ b/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx @@ -1,18 +1,16 @@ import React = require("react"); -import AntimodeMenu from "../../AntimodeMenu"; +import { IconProp } from '@fortawesome/fontawesome-svg-core'; +import { FontAwesomeIcon } from "@fortawesome/react-fontawesome"; +import { action, computed, observable } from "mobx"; import { observer } from "mobx-react"; -import { observable, action, computed } from "mobx"; -import "./FormatShapePane.scss"; -import { Scripting } from "../../../util/Scripting"; -import { InkField } from "../../../../fields/InkField"; -import { Doc, Opt, Field } from "../../../../fields/Doc"; -import { SelectionManager } from "../../../util/SelectionManager"; -import { DocumentView } from "../../../views/nodes/DocumentView"; +import { Doc, Field, Opt } from "../../../../fields/Doc"; import { Document } from "../../../../fields/documentSchemas"; +import { InkField } from "../../../../fields/InkField"; +import { BoolCast, Cast, NumCast } from "../../../../fields/Types"; import { DocumentType } from "../../../documents/DocumentTypes"; -import { FontAwesomeIcon } from "@fortawesome/react-fontawesome"; -import { IconProp } from '@fortawesome/fontawesome-svg-core'; -import { Cast, StrCast, BoolCast, NumCast } from "../../../../fields/Types"; +import { SelectionManager } from "../../../util/SelectionManager"; +import AntimodeMenu from "../../AntimodeMenu"; +import "./FormatShapePane.scss"; @observer export default class FormatShapePane extends AntimodeMenu { @@ -23,63 +21,62 @@ export default class FormatShapePane extends AntimodeMenu { private _lastDash = "2"; private _palette = ["#D0021B", "#F5A623", "#F8E71C", "#8B572A", "#7ED321", "#417505", "#9013FE", "#4A90E2", "#50E3C2", "#B8E986", "#000000", "#4A4A4A", "#9B9B9B", "#FFFFFF"]; private _mode = ["fill-drip", "ruler-combined"]; - private _subMenu = ["fill", "line", "size", "position"]; @observable private _subOpen = [false, false, false, false]; - @observable private _currMode: string = "fill-drip"; + @observable private _currMode = "fill-drip"; @observable private _lock = false; @observable private _fillBtn = false; @observable private _lineBtn = false; getField(key: string) { - return this.inks?.reduce((p, i) => + return this.selectedInk?.reduce((p, i) => (p === undefined || (p && p === i.rootDoc[key])) && i.rootDoc[key] !== "0" ? Field.toString(i.rootDoc[key] as Field) : "", undefined as Opt) } - @computed get inks() { + @computed get selectedInk() { const inks = SelectionManager.SelectedDocuments().filter(i => Document(i.rootDoc).type === DocumentType.INK); return inks.length ? inks : undefined; } - @computed get _noFill() { return this.inks?.reduce((p, i) => p && !i.rootDoc.fillColor ? true : false, true) || false; } - @computed get _solidFill() { return this.inks?.reduce((p, i) => p && i.rootDoc.fillColor ? true : false, true) || false; } - @computed get _noLine() { return this.inks?.reduce((p, i) => p && !i.rootDoc.color ? true : false, true) || false; } - @computed get _solidLine() { return this.inks?.reduce((p, i) => p && i.rootDoc.color && (!i.rootDoc.strokeDash || i.rootDoc.strokeDash === "0") ? true : false, true) || false; } - @computed get _arrowStart() { return this.getField("strokeArrowStart") || ""; } - @computed get _arrowEnd() { return this.getField("strokeArrowEnd") || ""; } - @computed get _dashLine() { return !this._noLine && this.getField("strokeDash") || ""; } - @computed get _currSizeHeight() { return this.getField("_height"); } - @computed get _currSizeWidth() { return this.getField("_width"); } - @computed get _currRotation() { return this.getField("rotation"); } - @computed get _currXpos() { return this.getField("x"); } - @computed get _currYpos() { return this.getField("y"); } - @computed get _currStrokeWidth() { return this.getField("strokeWidth"); } - @computed get _currFill() { const cfill = this.getField("fillColor") || ""; cfill && (this._lastFill = cfill); return cfill; } - @computed get _currColor() { const ccol = this.getField("color") || ""; ccol && (this._lastLine = ccol); return ccol; } - set _noFill(value) { this._currFill = value ? "" : this._lastFill; } - set _solidFill(value) { this._noFill = !value; } - set _currFill(value) { value && (this._lastFill = value); this.inks?.forEach(i => i.rootDoc.fillColor = value ? value : undefined); } - set _currColor(value) { value && (this._lastLine = value); this.inks?.forEach(i => i.rootDoc.color = value ? value : undefined); } - set _arrowStart(value) { this.inks?.forEach(i => i.rootDoc.strokeArrowStart = value); } - set _arrowEnd(value) { this.inks?.forEach(i => i.rootDoc.strokeArrowEnd = value); } - set _noLine(value) { this._currColor = value ? "" : this._lastLine; } - set _solidLine(value) { this._dashLine = ""; this._noLine = !value; } - set _dashLine(value) { - value && (this._lastDash = value) && (this._noLine = false); - this.inks?.forEach(i => i.rootDoc.strokeDash = value ? this._lastDash : undefined); + @computed get unFilled() { return this.selectedInk?.reduce((p, i) => p && !i.rootDoc.fillColor ? true : false, true) || false; } + @computed get unStrokd() { return this.selectedInk?.reduce((p, i) => p && !i.rootDoc.color ? true : false, true) || false; } + @computed get solidFil() { return this.selectedInk?.reduce((p, i) => p && i.rootDoc.fillColor ? true : false, true) || false; } + @computed get solidStk() { return this.selectedInk?.reduce((p, i) => p && i.rootDoc.color && (!i.rootDoc.strokeDash || i.rootDoc.strokeDash === "0") ? true : false, true) || false; } + @computed get dashdStk() { return !this.unStrokd && this.getField("strokeDash") || ""; } + @computed get colorFil() { const ccol = this.getField("fillColor") || ""; ccol && (this._lastFill = ccol); return ccol; } + @computed get colorStk() { const ccol = this.getField("color") || ""; ccol && (this._lastLine = ccol); return ccol; } + @computed get widthStk() { return this.getField("strokeWidth") || "1"; } + @computed get markHead() { return this.getField("strokeStartMarker") || ""; } + @computed get markTail() { return this.getField("strokeEndMarker") || ""; } + @computed get shapeHgt() { return this.getField("_height"); } + @computed get shapeWid() { return this.getField("_width"); } + @computed get shapeXps() { return this.getField("x"); } + @computed get shapeYps() { return this.getField("y"); } + @computed get shapeRot() { return this.getField("rotation"); } + set unFilled(value) { this.colorFil = value ? "" : this._lastFill; } + set solidFil(value) { this.unFilled = !value; } + set colorFil(value) { value && (this._lastFill = value); this.selectedInk?.forEach(i => i.rootDoc.fillColor = value ? value : undefined); } + set colorStk(value) { value && (this._lastLine = value); this.selectedInk?.forEach(i => i.rootDoc.color = value ? value : undefined); } + set markHead(value) { this.selectedInk?.forEach(i => i.rootDoc.strokeStartMarker = value); } + set markTail(value) { this.selectedInk?.forEach(i => i.rootDoc.strokeEndMarker = value); } + set unStrokd(value) { this.colorStk = value ? "" : this._lastLine; } + set solidStk(value) { this.dashdStk = ""; this.unStrokd = !value; } + set dashdStk(value) { + value && (this._lastDash = value) && (this.unStrokd = false); + this.selectedInk?.forEach(i => i.rootDoc.strokeDash = value ? this._lastDash : undefined); } - set _currXpos(value) { this.inks?.forEach(i => i.rootDoc.x = Number(value)); } - set _currYpos(value) { this.inks?.forEach(i => i.rootDoc.y = Number(value)); } - set _currRotation(value) { this.inks?.forEach(i => i.rootDoc.rotation = Number(value)); } - set _currStrokeWidth(value) { this.inks?.forEach(i => i.rootDoc.strokeWidth = Number(value)); } - set _currSizeWidth(value) { - this.inks?.filter(i => i.rootDoc._width && i.rootDoc._height).forEach(i => { + set shapeXps(value) { this.selectedInk?.forEach(i => i.rootDoc.x = Number(value)); } + set shapeYps(value) { this.selectedInk?.forEach(i => i.rootDoc.y = Number(value)); } + set shapeRot(value) { this.selectedInk?.forEach(i => i.rootDoc.rotation = Number(value)); } + set widthStk(value) { this.selectedInk?.forEach(i => i.rootDoc.strokeWidth = Number(value)); } + set shapeWid(value) { + this.selectedInk?.filter(i => i.rootDoc._width && i.rootDoc._height).forEach(i => { const oldWidth = NumCast(i.rootDoc._width); i.rootDoc._width = Number(value); this._lock && (i.rootDoc._height = (i.rootDoc._width * NumCast(i.rootDoc._height)) / oldWidth); }); } - set _currSizeHeight(value) { - this.inks?.filter(i => i.rootDoc._width && i.rootDoc._height).forEach(i => { + set shapeHgt(value) { + this.selectedInk?.filter(i => i.rootDoc._width && i.rootDoc._height).forEach(i => { const oldHeight = NumCast(i.rootDoc._height); i.rootDoc._height = Number(value); this._lock && (i.rootDoc._width = (i.rootDoc._height * NumCast(i.rootDoc._width)) / oldHeight); @@ -90,72 +87,41 @@ export default class FormatShapePane extends AntimodeMenu { super(props); FormatShapePane.Instance = this; this._canFade = false; - this.Pinned = BoolCast(Doc.UserDoc()["formatShapePane-pinned"]); + this.Pinned = BoolCast(Doc.UserDoc()["menuFormatShape-pinned"]); } @action closePane = () => { - this.jumpTo(-300, -300); + this.fadeOut(false); this.Pinned = false; } @action upDownButtons = (dirs: string, field: string) => { switch (field) { - case "horizontal": this.inks?.forEach(i => i.rootDoc.x = NumCast(i.rootDoc.x) + (dirs === "up" ? 10 : -10)); break; - case "vertical": this.inks?.forEach(i => i.rootDoc.y = NumCast(i.rootDoc.y) + (dirs === "up" ? 10 : -10)); break; - case "rotation": this.rotate((dirs === "up" ? .1 : -.1)); break; - case "width": this.inks?.forEach(i => i.rootDoc.strokeWidth = NumCast(i.rootDoc.strokeWidth) + (dirs === "up" ? .1 : -.1)); break; - case "sizeWidth": - this.inks?.forEach(i => { - const doc = i.rootDoc; - if (doc._width && doc._height) { - const oldWidth = NumCast(doc._width); - const oldHeight = NumCast(doc._height); - doc._width = NumCast(doc._width) + (dirs === "up" ? 10 : - 10); - if (this._lock) { - doc._height = (NumCast(doc._width) * oldHeight) / oldWidth; - } - } - }); + case "rot": this.rotate((dirs === "up" ? .1 : -.1)); break; + case "Xps": this.selectedInk?.forEach(i => i.rootDoc.x = NumCast(i.rootDoc.x) + (dirs === "up" ? 10 : -10)); break; + case "Yps": this.selectedInk?.forEach(i => i.rootDoc.y = NumCast(i.rootDoc.y) + (dirs === "up" ? 10 : -10)); break; + case "stk": this.selectedInk?.forEach(i => i.rootDoc.strokeWidth = NumCast(i.rootDoc.strokeWidth) + (dirs === "up" ? .1 : -.1)); break; + case "wid": this.selectedInk?.filter(i => i.rootDoc._width && i.rootDoc._height).forEach(i => { + const oldWidth = NumCast(i.rootDoc._width); + i.rootDoc._width = oldWidth + (dirs === "up" ? 10 : - 10); + this._lock && (i.rootDoc._height = (i.rootDoc._width / oldWidth * NumCast(i.rootDoc._height))); + }); break; - case "sizeHeight": - this.inks?.forEach(i => { - const doc = i.rootDoc; - if (doc._width && doc._height) { - const oldWidth = NumCast(doc._width); - const oldHeight = NumCast(doc._height); - doc._height = NumCast(doc._height) + (dirs === "up" ? 10 : - 10); - if (this._lock) { - doc._width = (NumCast(doc._height) * oldWidth) / oldHeight; - } - } - }); + case "hgt": this.selectedInk?.filter(i => i.rootDoc._width && i.rootDoc._height).forEach(i => { + const oldHeight = NumCast(i.rootDoc._height); + i.rootDoc._height = oldHeight + (dirs === "up" ? 10 : - 10); + this._lock && (i.rootDoc._width = (i.rootDoc._height / oldHeight * NumCast(i.rootDoc._width))); + }); break; } } - @computed get close() { - return ; - } - - //select either coor&fill or size&position - @computed get modes() { - return
- {this._mode.map(mode => - )} -
; - } - @action rotate = (degrees: number) => { - SelectionManager.SelectedDocuments().forEach(action((element: DocumentView) => { - const doc = Document(element.rootDoc); + this.selectedInk?.forEach(action(inkView => { + const doc = Document(inkView.rootDoc); if (doc.type === DocumentType.INK && doc.x && doc.y && doc._width && doc._height && doc.data) { const angle = Number(degrees) - Number(doc.rotation); doc.rotation = Number(degrees); @@ -183,117 +149,13 @@ export default class FormatShapePane extends AntimodeMenu { const top2 = Math.min(...ys2); const right2 = Math.max(...xs2); const bottom2 = Math.max(...ys2); - doc._height = (bottom2 - top2) * element.props.ScreenToLocalTransform().Scale; - doc._width = (right2 - left2) * element.props.ScreenToLocalTransform().Scale; + doc._height = (bottom2 - top2) * inkView.props.ScreenToLocalTransform().Scale; + doc._width = (right2 - left2) * inkView.props.ScreenToLocalTransform().Scale; } } })); } - @computed get subMenu() { - const fillCheck =
- this._noFill = true)} /> - No Fill -
- this._solidFill = true)} /> - Solid Fill -
-
- {this._solidFill ? "Color" : ""} - {this._solidFill ? this.fillButton : ""} - {this._fillBtn && this._solidFill ? this.fillPicker : ""} -
; - - const arrows = <> - this._arrowStart = this._arrowStart ? "" : "arrow")} /> - Arrow Head -
- this._arrowEnd = this._arrowEnd ? "" : "arrow")} /> - Arrow End -
- ; - - const lineCheck =
- this._noLine = true)} /> - No Line -
- this._solidLine = true)} /> - Solid Line -
- this._dashLine = "2")} /> - Dash Line -
-
- {(this._solidLine || this._dashLine) ? "Color" : ""} - {(this._solidLine || this._dashLine) ? this.lineButton : ""} - {this._lineBtn && (this._solidLine || this._dashLine) ? this.linePicker : ""} -
- {(this._solidLine || this._dashLine) ? "Width" : ""} - {(this._solidLine || this._dashLine) ? this.widthInput : ""} - {(this._solidLine || this._dashLine) ? this._currStrokeWidth = e.target.value} /> : (null)} -
-
- {(this._solidLine || this._dashLine) ? arrows : ""} -
; - - const sizeCheck =
- Height {this.sizeHeightInput} -
-
- - Width {this.sizeWidthInput} -
-
- - this._lock = !this._lock)} /> - Lock Ratio -
-
- - Rotation {this.rotationInput} -
-
-
; - - const positionCheck =
- Horizontal {this.positionHorizontalInput} -
-
- - Vertical {this.positionVerticalInput} -
-
-
; - - return
- {this._subMenu.map((subMenu, i) => { - if (subMenu === "fill" || subMenu === "line") { - return
- - {this._currMode === "fill-drip" && subMenu === "fill" && this._subOpen[0] ? fillCheck : ""} - {this._currMode === "fill-drip" && subMenu === "line" && this._subOpen[1] ? lineCheck : ""} -
; - } - else if (subMenu === "size" || subMenu === "position") { - return
- - {this._currMode === "ruler-combined" && subMenu === "size" && this._subOpen[2] ? sizeCheck : ""} - {this._currMode === "ruler-combined" && subMenu === "position" && this._subOpen[3] ? positionCheck : ""} -
; - } - })} -
; - } colorPicker(setter: (color: string) => {}) { return
@@ -325,37 +187,119 @@ export default class FormatShapePane extends AntimodeMenu {
-

-

+

; } - @computed get fillButton() { return this.colorButton(this._currFill, () => this._fillBtn = !this._fillBtn); } - @computed get lineButton() { return this.colorButton(this._currColor, () => this._lineBtn = !this._lineBtn); } + @computed get fillButton() { return this.colorButton(this.colorFil, () => this._fillBtn = !this._fillBtn); } + @computed get lineButton() { return this.colorButton(this.colorStk, () => this._lineBtn = !this._lineBtn); } - @computed get fillPicker() { return this.colorPicker((color: string) => this._currFill = color); } - @computed get linePicker() { return this.colorPicker((color: string) => this._currColor = color); } + @computed get fillPicker() { return this.colorPicker((color: string) => this.colorFil = color); } + @computed get linePicker() { return this.colorPicker((color: string) => this.colorStk = color); } - @computed get widthInput() { return this.inputBox("width", this._currStrokeWidth, (val: string) => this._currStrokeWidth = val); } - @computed get sizeHeightInput() { return this.inputBox("height", this._currSizeHeight, (val: string) => this._currSizeHeight = val); } - @computed get sizeWidthInput() { return this.inputBox("height", this._currSizeWidth, (val: string) => this._currSizeWidth = val); } - @computed get rotationInput() { return this.inputBox("rotation", this._currRotation, (val: string) => this._currRotation = val); } - @computed get positionHorizontalInput() { return this.inputBox("horizontal", this._currXpos, (val: string) => this._currXpos = val); } - @computed get positionVerticalInput() { return this.inputBox("vertical", this._currYpos, (val: string) => this._currYpos = val); } + @computed get stkInput() { return this.inputBox("stk", this.widthStk, (val: string) => this.widthStk = val); } + @computed get hgtInput() { return this.inputBox("hgt", this.shapeHgt, (val: string) => this.shapeHgt = val); } + @computed get widInput() { return this.inputBox("wid", this.shapeWid, (val: string) => this.shapeWid = val); } + @computed get rotInput() { return this.inputBox("rot", this.shapeRot, (val: string) => this.shapeRot = val); } + @computed get XpsInput() { return this.inputBox("Xps", this.shapeXps, (val: string) => this.shapeXps = val); } + @computed get YpsInput() { return this.inputBox("Yps", this.shapeYps, (val: string) => this.shapeYps = val); } - render() { - return this.getElementVert([this.close, this.modes, this.subMenu]); + @computed get propertyGroupItems() { + const fillCheck =
+ this.unFilled = true)} /> + No Fill +
+ this.solidFil = true)} /> + Solid Fill +

+ {this.solidFil ? "Color" : ""} + {this.solidFil ? this.fillButton : ""} + {this._fillBtn && this.solidFil ? this.fillPicker : ""} +
; + + const markers = <> + this.markHead = this.markHead ? "" : "arrow")} /> + Arrow Head +
+ this.markTail = this.markTail ? "" : "arrow")} /> + Arrow End +
+ ; + + const lineCheck =
+ this.unStrokd = true)} /> + No Line +
+ this.solidStk = true)} /> + Solid Line +
+ this.dashdStk = "2")} /> + Dash Line +
+
+ {(this.solidStk || this.dashdStk) ? "Color" : ""} + {(this.solidStk || this.dashdStk) ? this.lineButton : ""} + {(this.solidStk || this.dashdStk) && this._lineBtn ? this.linePicker : ""} +
+ {(this.solidStk || this.dashdStk) ? "Width" : ""} + {(this.solidStk || this.dashdStk) ? this.stkInput : ""} + {(this.solidStk || this.dashdStk) ? this.widthStk = e.target.value} /> : (null)} +

+ {(this.solidStk || this.dashdStk) ? markers : ""} +
; + + const sizeCheck =
+ Height {this.hgtInput} +

+ Width {this.widInput} +

+ this._lock = !this._lock)} /> + Lock Ratio +

+ Rotation {this.rotInput} +

+
; + + const positionCheck =
+ Horizontal {this.XpsInput} +

+ Vertical {this.YpsInput} +

+
; + + const subMenus = this._currMode === "fill-drip" ? [`fill`, `line`] : [`size`, `position`]; + const menuItems = this._currMode === "fill-drip" ? [fillCheck, lineCheck] : [sizeCheck, positionCheck]; + const indexOffset = this._currMode === "fill-drip" ? 0 : 2; + return
+ {subMenus.map((subMenu, i) => +
+ + {menuItems[i]} +
)} +
; + } + + @computed get closeBtn() { + return ; + } + + @computed get propertyGroupBtn() { + return
+ {this._mode.map(mode => + )} +
; } -} -Scripting.addGlobal(function activatePen2(penBtn: any) { - if (penBtn) { - //no longer changes to inkmode - // Doc.SetSelectedTool(InkTool.Pen); - FormatShapePane.Instance.jumpTo(300, 300); - FormatShapePane.Instance.Pinned = true; - } else { - // Doc.SetSelectedTool(InkTool.None); - FormatShapePane.Instance.Pinned = false; - FormatShapePane.Instance.fadeOut(true); + + render() { + return this.getElementVert([this.closeBtn, this.propertyGroupBtn, this.propertyGroupItems]); } -}); \ No newline at end of file +} \ No newline at end of file diff --git a/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx b/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx index 7f0bb5364..15707ad9e 100644 --- a/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx +++ b/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx @@ -62,13 +62,13 @@ export default class InkOptionsMenu extends AntimodeMenu { super(props); InkOptionsMenu.Instance = this; this._canFade = false; // don't let the inking menu fade away - this.Pinned = BoolCast(Doc.UserDoc()["inkOptionsMenu-pinned"]); + this.Pinned = BoolCast(Doc.UserDoc()["menuInkOptions-pinned"]); } @action toggleMenuPin = (e: React.MouseEvent) => { - Doc.UserDoc()["inkOptionsMenu-pinned"] = this.Pinned = !this.Pinned; + Doc.UserDoc()["menuInkOptions-pinned"] = this.Pinned = !this.Pinned; if (!this.Pinned) { // this.fadeOut(true); } @@ -426,15 +426,10 @@ export default class InkOptionsMenu extends AntimodeMenu { } Scripting.addGlobal(function activatePen(penBtn: any) { if (penBtn) { - //no longer changes to inkmode - // Doc.SetSelectedTool(InkTool.Pen); InkOptionsMenu.Instance.jumpTo(300, 300); InkOptionsMenu.Instance.Pinned = true; - } else { - // Doc.SetSelectedTool(InkTool.None); InkOptionsMenu.Instance.Pinned = false; InkOptionsMenu.Instance.fadeOut(true); - } }); -- cgit v1.2.3-70-g09d2 From 0b0183de3a13649819983203e2aba1dc6b84fdb1 Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Sun, 12 Jul 2020 23:34:34 -0400 Subject: fixed updating RichTextMenu with proper values for fontFamily, size, bullet, and alignment --- src/client/documents/Documents.ts | 2 +- src/client/util/CurrentUserUtils.ts | 15 +-- src/client/util/DragManager.ts | 2 +- src/client/views/animationtimeline/Timeline.tsx | 4 +- .../collectionFreeForm/CollectionFreeFormView.tsx | 2 +- .../collections/collectionFreeForm/MarqueeView.tsx | 2 +- src/client/views/nodes/DocumentView.tsx | 2 +- src/client/views/nodes/LabelBox.tsx | 2 +- src/client/views/nodes/SliderBox.tsx | 2 +- .../views/nodes/formattedText/FormattedTextBox.tsx | 7 +- .../views/nodes/formattedText/RichTextMenu.tsx | 111 ++++++++++++--------- .../views/nodes/formattedText/RichTextRules.ts | 2 +- src/fields/documentSchemas.ts | 2 +- 13 files changed, 88 insertions(+), 67 deletions(-) (limited to 'src/client/views/collections/collectionFreeForm') diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts index 72b716492..a415e17c8 100644 --- a/src/client/documents/Documents.ts +++ b/src/client/documents/Documents.ts @@ -123,7 +123,7 @@ export interface DocumentOptions { isBackground?: boolean; isLinkButton?: boolean; _columnWidth?: number; - _fontSize?: number; + _fontSize?: string; _fontFamily?: string; curPage?: number; currentTimecode?: number; // the current timecode of a time-based document (e.g., current time of a video) value is in seconds diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts index ce910c062..39781a5ce 100644 --- a/src/client/util/CurrentUserUtils.ts +++ b/src/client/util/CurrentUserUtils.ts @@ -211,7 +211,7 @@ export class CurrentUserUtils { details.text = new RichTextField(JSON.stringify(detailedTemplate), buxtonFieldKeys.join(" ")); const shared = { _chromeStatus: "disabled", _autoHeight: true, _xMargin: 0 }; - const detailViewOpts = { title: "detailView", _width: 300, _fontFamily: "Arial", _fontSize: 12 }; + const detailViewOpts = { title: "detailView", _width: 300, _fontFamily: "Arial", _fontSize: "12pt" }; const descriptionWrapperOpts = { title: "descriptions", _height: 300, _columnWidth: -1, treeViewHideTitle: true, _pivotField: "title" }; const descriptionWrapper = MasonryDocument([details, short, long], { ...shared, ...descriptionWrapperOpts }); @@ -525,13 +525,13 @@ export class CurrentUserUtils { // Sets up the title of the button static mobileButtonText = (opts: DocumentOptions, buttonTitle: string) => Docs.Create.TextDocument(buttonTitle, { ...opts, - dropAction: undefined, title: buttonTitle, _fontSize: 37, _xMargin: 0, _yMargin: 0, ignoreClick: true, _chromeStatus: "disabled", backgroundColor: "rgba(0,0,0,0)" + dropAction: undefined, title: buttonTitle, _fontSize: "37pt", _xMargin: 0, _yMargin: 0, ignoreClick: true, _chromeStatus: "disabled", backgroundColor: "rgba(0,0,0,0)" }) as any as Doc // Sets up the description of the button static mobileButtonInfo = (opts: DocumentOptions, buttonInfo: string) => Docs.Create.TextDocument(buttonInfo, { ...opts, - dropAction: undefined, title: "info", _fontSize: 25, _xMargin: 0, _yMargin: 0, ignoreClick: true, _chromeStatus: "disabled", backgroundColor: "rgba(0,0,0,0)", _dimMagnitude: 2, + dropAction: undefined, title: "info", _fontSize: "25pt", _xMargin: 0, _yMargin: 0, ignoreClick: true, _chromeStatus: "disabled", backgroundColor: "rgba(0,0,0,0)", _dimMagnitude: 2, }) as any as Doc @@ -598,7 +598,7 @@ export class CurrentUserUtils { _width: 500, lockedPosition: true, _chromeStatus: "disabled", title: "tools stack", forceActive: true })) as any as Doc; doc["tabs-button-tools"] = new PrefetchProxy(Docs.Create.ButtonDocument({ - _width: 35, _height: 25, title: "Tools", _fontSize: 10, + _width: 35, _height: 25, title: "Tools", _fontSize: "10pt", letterSpacing: "0px", textTransform: "unset", borderRounding: "5px 5px 0px 0px", boxShadow: "3px 3px 0px rgb(34, 34, 34)", sourcePanel: toolsStack, onDragStart: ScriptField.MakeFunction('getAlias(this.dragFactory, true)'), @@ -663,7 +663,7 @@ export class CurrentUserUtils { lockedPosition: true, boxShadow: "0 0", dontRegisterChildViews: true, targetDropAction: "same" })) as any as Doc; doc["tabs-button-library"] = new PrefetchProxy(Docs.Create.ButtonDocument({ - _width: 50, _height: 25, title: "Library", _fontSize: 10, targetDropAction: "same", + _width: 50, _height: 25, title: "Library", _fontSize: "10pt", targetDropAction: "same", letterSpacing: "0px", textTransform: "unset", borderRounding: "5px 5px 0px 0px", boxShadow: "3px 3px 0px rgb(34, 34, 34)", sourcePanel: libraryStack, onDragStart: ScriptField.MakeFunction('getAlias(this.dragFactory, true)'), @@ -681,7 +681,7 @@ export class CurrentUserUtils { static setupSearchBtnPanel(doc: Doc, sidebarContainer: Doc) { if (doc["tabs-button-search"] === undefined) { doc["tabs-button-search"] = new PrefetchProxy(Docs.Create.ButtonDocument({ - _width: 50, _height: 25, title: "Search", _fontSize: 10, + _width: 50, _height: 25, title: "Search", _fontSize: "10pt", letterSpacing: "0px", textTransform: "unset", borderRounding: "5px 5px 0px 0px", boxShadow: "3px 3px 0px rgb(34, 34, 34)", sourcePanel: new PrefetchProxy(Docs.Create.QueryDocument({ title: "search stack", })) as any as Doc, searchFileTypes: new List([DocumentType.RTF, DocumentType.IMG, DocumentType.PDF, DocumentType.VID, DocumentType.WEB, DocumentType.SCRIPTING]), @@ -824,7 +824,8 @@ export class CurrentUserUtils { doc.activeArrowStart = StrCast(doc.activeArrowStart, ""); doc.activeArrowEnd = StrCast(doc.activeArrowEnd, ""); doc.activeDash = StrCast(doc.activeDash, "0"); - doc.fontSize = NumCast(doc.fontSize, 12); + doc.fontSize = StrCast(doc.fontSize, "12pt"); + doc.fontFamily = StrCast(doc.fontFamily, "Arial"); doc["constants-snapThreshold"] = NumCast(doc["constants-snapThreshold"], 10); // doc["constants-dragThreshold"] = NumCast(doc["constants-dragThreshold"], 4); // Utils.DRAG_THRESHOLD = NumCast(doc["constants-dragThreshold"]); diff --git a/src/client/util/DragManager.ts b/src/client/util/DragManager.ts index 64c3d8458..5f34509a1 100644 --- a/src/client/util/DragManager.ts +++ b/src/client/util/DragManager.ts @@ -323,7 +323,7 @@ export namespace DragManager { dragLabel = document.createElement("div"); dragLabel.className = "dragManager-dragLabel"; dragLabel.style.zIndex = "100001"; - dragLabel.style.fontSize = "10"; + dragLabel.style.fontSize = "10pt"; dragLabel.style.position = "absolute"; // dragLabel.innerText = "press 'a' to embed on drop"; // bcz: need to move this to a status bar dragDiv.appendChild(dragLabel); diff --git a/src/client/views/animationtimeline/Timeline.tsx b/src/client/views/animationtimeline/Timeline.tsx index f54bd3aff..eac30ca75 100644 --- a/src/client/views/animationtimeline/Timeline.tsx +++ b/src/client/views/animationtimeline/Timeline.tsx @@ -385,10 +385,10 @@ export class Timeline extends React.Component { const ttime = `Total: ${this.toReadTime(this._time)}`; return (
-
+
{ctime}
-
+
{ttime}
diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx index 2191021d2..ef6ea8f99 100644 --- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx +++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx @@ -1034,7 +1034,7 @@ export class CollectionFreeFormView extends CollectionSubView val === undefined) ? undefined : { ele:
diff --git a/src/client/views/collections/collectionFreeForm/MarqueeView.tsx b/src/client/views/collections/collectionFreeForm/MarqueeView.tsx index b47236bea..2db665337 100644 --- a/src/client/views/collections/collectionFreeForm/MarqueeView.tsx +++ b/src/client/views/collections/collectionFreeForm/MarqueeView.tsx @@ -129,7 +129,7 @@ export class MarqueeView extends React.Component(Docu background: finalColor, opacity: finalOpacity, fontFamily: StrCast(this.Document._fontFamily, "inherit"), - fontSize: Cast(this.Document._fontSize, "number", null) + fontSize: Cast(this.Document._fontSize, "string", null) }}> {this.onClickHandler && this.props.ContainingCollectionView?.props.Document._viewType === CollectionViewType.Time ? <> {this.innards} diff --git a/src/client/views/nodes/LabelBox.tsx b/src/client/views/nodes/LabelBox.tsx index 360ead18e..836ef4149 100644 --- a/src/client/views/nodes/LabelBox.tsx +++ b/src/client/views/nodes/LabelBox.tsx @@ -67,7 +67,7 @@ export class LabelBox extends ViewBoxBaseComponent
this._editorView && RichTextMenu.Instance.updateFromDash(this._editorView, undefined, this.props), 0); - } else if (FormattedTextBoxComment.textBox === this) { + setTimeout(() => this._editorView && RichTextMenu.Instance.updateFromDash(this._editorView, undefined, this.props), this.props.isSelected() ? 10 : 0); // need to make sure that we update a text box that is selected after updating the one that was deselected + if (!this.props.isSelected() && FormattedTextBoxComment.textBox === this) { setTimeout(() => FormattedTextBoxComment.Hide(), 0); } const selPad = this.props.isSelected() ? -10 : 0; @@ -1376,7 +1375,7 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp opacity: this.props.hideOnLeave ? (this._entered ? 1 : 0.1) : 1, color: this.props.color ? this.props.color : StrCast(this.layoutDoc[this.props.fieldKey + "-color"], this.props.hideOnLeave ? "white" : "inherit"), pointerEvents: interactive ? undefined : "none", - fontSize: Cast(this.layoutDoc._fontSize, "number", null), + fontSize: Cast(this.layoutDoc._fontSize, "string", null), fontFamily: StrCast(this.layoutDoc._fontFamily, "inherit"), transition: "opacity 1s" }} diff --git a/src/client/views/nodes/formattedText/RichTextMenu.tsx b/src/client/views/nodes/formattedText/RichTextMenu.tsx index 1a8a4ceb7..a70f879ff 100644 --- a/src/client/views/nodes/formattedText/RichTextMenu.tsx +++ b/src/client/views/nodes/formattedText/RichTextMenu.tsx @@ -11,7 +11,7 @@ import { EditorState, NodeSelection, TextSelection } from "prosemirror-state"; import { EditorView } from "prosemirror-view"; import { Doc } from "../../../../fields/Doc"; import { DarkPastelSchemaPalette, PastelSchemaPalette } from '../../../../fields/SchemaHeaderField'; -import { Cast, StrCast, BoolCast } from "../../../../fields/Types"; +import { Cast, StrCast, BoolCast, NumCast } from "../../../../fields/Types"; import { unimplementedFunction, Utils } from "../../../../Utils"; import { DocServer } from "../../../DocServer"; import { LinkManager } from "../../../util/LinkManager"; @@ -112,6 +112,7 @@ export default class RichTextMenu extends AntimodeMenu { { node: schema.nodes.ordered_list.create({ mapStyle: "bullet" }), title: "Set list type", label: ":", command: this.changeListType }, { node: schema.nodes.ordered_list.create({ mapStyle: "decimal" }), title: "Set list type", label: "1.1", command: this.changeListType }, { node: schema.nodes.ordered_list.create({ mapStyle: "multi" }), title: "Set list type", label: "A.1", command: this.changeListType }, + { node: schema.nodes.ordered_list.create({ mapStyle: "" }), title: "Set list type", label: "", command: this.changeListType }, //{ node: undefined, title: "Set list type", label: "Remove", command: this.changeListType }, ]; @@ -217,7 +218,7 @@ export default class RichTextMenu extends AntimodeMenu { // finds font sizes and families in selection getActiveAlignment() { - if (this.view) { + if (this.view && this.TextView.props.isSelected()) { const path = (this.view.state.selection.$from as any).path; for (let i = path.length - 3; i < path.length && i >= 0; i -= 3) { if (path[i]?.type === this.view.state.schema.nodes.paragraph) { @@ -230,15 +231,18 @@ export default class RichTextMenu extends AntimodeMenu { // finds font sizes and families in selection getActiveListStyle() { - if (this.view) { + if (this.view && this.TextView.props.isSelected()) { const path = (this.view.state.selection.$from as any).path; for (let i = 0; i < path.length; i += 3) { if (path[i].type === this.view.state.schema.nodes.ordered_list) { return path[i].attrs.mapStyle; } } + if (this.view.state.selection.$from.nodeAfter?.type === this.view.state.schema.nodes.ordered_list) { + return this.view.state.selection.$from.nodeAfter?.attrs.mapStyle; + } } - return "decimal"; + return ""; } // finds font sizes and families in selection @@ -247,16 +251,21 @@ export default class RichTextMenu extends AntimodeMenu { const activeFamilies: string[] = []; const activeSizes: string[] = []; - const state = this.view.state; - const pos = this.view.state.selection.$from; - const ref_node = this.reference_node(pos); - if (ref_node && ref_node !== this.view.state.doc && ref_node.isText) { - ref_node.marks.forEach(m => { - m.type === state.schema.marks.pFontFamily && activeFamilies.push(m.attrs.family); - m.type === state.schema.marks.pFontSize && activeSizes.push(String(m.attrs.fontSize) + "pt"); - }); + if (this.TextView.props.isSelected()) { + const state = this.view.state; + const pos = this.view.state.selection.$from; + const ref_node = this.reference_node(pos); + if (ref_node && ref_node !== this.view.state.doc && ref_node.isText) { + ref_node.marks.forEach(m => { + m.type === state.schema.marks.pFontFamily && activeFamilies.push(m.attrs.family); + m.type === state.schema.marks.pFontSize && activeSizes.push(String(m.attrs.fontSize) + "pt"); + }); + } + !activeFamilies.length && (activeFamilies.push(StrCast(this.TextView.layoutDoc._fontFamily, StrCast(Doc.UserDoc().fontFamily)))); + !activeSizes.length && (activeSizes.push(StrCast(this.TextView.layoutDoc._fontSize, StrCast(Doc.UserDoc().fontSize)))); } - + !activeFamilies.length && (activeFamilies.push(StrCast(Doc.UserDoc().fontFamily))); + !activeSizes.length && (activeSizes.push(StrCast(Doc.UserDoc().fontSize))); return { activeFamilies, activeSizes }; } @@ -269,14 +278,14 @@ export default class RichTextMenu extends AntimodeMenu { //finds all active marks on selection in given group getActiveMarksOnSelection() { - if (!this.view) return; + let activeMarks: MarkType[] = []; + if (!this.view || !this.TextView.props.isSelected()) return activeMarks; const markGroup = [schema.marks.strong, schema.marks.em, schema.marks.underline, schema.marks.strikethrough, schema.marks.superscript, schema.marks.subscript]; if (this.view.state.storedMarks) return this.view.state.storedMarks.map(mark => mark.type); //current selection const { empty, ranges, $to } = this.view.state.selection as TextSelection; const state = this.view.state; - let activeMarks: MarkType[] = []; if (!empty) { activeMarks = markGroup.filter(mark => { const has = false; @@ -357,13 +366,9 @@ export default class RichTextMenu extends AntimodeMenu { createMarksDropdown(activeOption: string, options: { mark: Mark | null, title: string, label: string, command: (mark: Mark, view: EditorView) => void, hidden?: boolean, style?: {} }[], key: string): JSX.Element { const items = options.map(({ title, label, hidden, style }) => { if (hidden) { - return label === activeOption ? - : - ; + return ; } - return label === activeOption ? - : - ; + return ; }); const self = this; @@ -372,37 +377,42 @@ export default class RichTextMenu extends AntimodeMenu { e.preventDefault(); self.TextView.endUndoTypingBatch(); options.forEach(({ label, mark, command }) => { - if (e.target.value === label) { - UndoManager.RunInBatch(() => self.view && mark && command(mark, self.view), "text mark dropdown"); + if (e.target.value === label && mark) { + if (!self.TextView.props.isSelected()) { + switch (mark.type) { + case schema.marks.pFontFamily: Doc.UserDoc().fontFamily = mark.attrs.family; break; + case schema.marks.pFontSize: Doc.UserDoc().fontSize = mark.attrs.fontSize.toString() + "pt"; break; + } + } + else UndoManager.RunInBatch(() => self.view && mark && command(mark, self.view), "text mark dropdown"); } }); } - return ; + return ; } - createNodesDropdown(activeMap: string, options: { node: NodeType | any | null, title: string, label: string, command: (node: NodeType | any) => void, hidden?: boolean, style?: {} }[], key: string): JSX.Element { - const activeOption = activeMap === "bullet" ? ":" : activeMap === "decimal" ? "1.1" : "A.1"; + createNodesDropdown(activeMap: string, options: { node: NodeType | any | null, title: string, label: string, command: (node: NodeType | any) => void, hidden?: boolean, style?: {} }[], key: string, setter: (val: string) => {}): JSX.Element { + const activeOption = activeMap === "bullet" ? ":" : activeMap === "decimal" ? "1.1" : activeMap === "multi" ? "A.1" : ""; const items = options.map(({ title, label, hidden, style }) => { if (hidden) { - return label === activeOption ? - : - ; + return ; } - return label === activeOption ? - : - ; + return ; }); const self = this; function onChange(val: string) { self.TextView.endUndoTypingBatch(); options.forEach(({ label, node, command }) => { - if (val === label) { - UndoManager.RunInBatch(() => self.view && node && command(node), "nodes dropdown"); + if (val === label && node) { + if (self.TextView.props.isSelected()) { + UndoManager.RunInBatch(() => self.view && node && command(node), "nodes dropdown"); + setter(val); + } } }); } - return ; + return ; } changeFontSize = (mark: Mark, view: EditorView) => { @@ -416,10 +426,21 @@ export default class RichTextMenu extends AntimodeMenu { // TODO: remove doesn't work //remove all node type and apply the passed-in one to the selected text changeListType = (nodeType: Node | undefined) => { - if (!this.view) return; + if (!this.view || (nodeType as any)?.attrs.mapStyle === "") return; + + const nextIsOL = this.view.state.selection.$from.nodeAfter?.type === schema.nodes.ordered_list; + let inList: any = undefined; + let fromList = -1; + let path: any = Array.from((this.view.state.selection.$from as any).path); + for (let i = 0; i < path.length; i++) { + if (path[i]?.type === schema.nodes.ordered_list) { + inList = path[i]; + fromList = path[i - 1]; + } + } const marks = this.view.state.storedMarks || (this.view.state.selection.$to.parentOffset && this.view.state.selection.$from.marks()); - if (!wrapInList(schema.nodes.ordered_list)(this.view.state, (tx2: any) => { + if (inList || !wrapInList(schema.nodes.ordered_list)(this.view.state, (tx2: any) => { const tx3 = updateBullets(tx2, schema, nodeType && (nodeType as any).attrs.mapStyle, this.view!.state.selection.from - 1, this.view!.state.selection.to + 1); marks && tx3.ensureMarks([...marks]); marks && tx3.setStoredMarks([...marks]); @@ -427,12 +448,12 @@ export default class RichTextMenu extends AntimodeMenu { this.view!.dispatch(tx2); })) { const tx2 = this.view.state.tr; - if (nodeType && this.view.state.selection.$from.nodeAfter?.type === schema.nodes.ordered_list) { - const tx3 = updateBullets(tx2, schema, nodeType && (nodeType as any).attrs.mapStyle, this.view.state.selection.from, this.view.state.selection.to); + if (nodeType && (inList || nextIsOL)) { + const tx3 = updateBullets(tx2, schema, nodeType && (nodeType as any).attrs.mapStyle, inList ? fromList : this.view.state.selection.from, + inList ? fromList + inList.nodeSize : this.view.state.selection.to); marks && tx3.ensureMarks([...marks]); marks && tx3.setStoredMarks([...marks]); - - this.view.dispatch(tx3.setSelection(new NodeSelection(tx3.doc.resolve(this.view.state.selection.$from.pos)))); + this.view.dispatch(tx3); } } } @@ -448,13 +469,13 @@ export default class RichTextMenu extends AntimodeMenu { return true; } alignCenter = (state: EditorState, dispatch: any) => { - return this.alignParagraphs(state, "center", dispatch); + return this.TextView.props.isSelected() && this.alignParagraphs(state, "center", dispatch); } alignLeft = (state: EditorState, dispatch: any) => { - return this.alignParagraphs(state, "left", dispatch); + return this.TextView.props.isSelected() && this.alignParagraphs(state, "left", dispatch); } alignRight = (state: EditorState, dispatch: any) => { - return this.alignParagraphs(state, "right", dispatch); + return this.TextView.props.isSelected() && this.alignParagraphs(state, "right", dispatch); } alignParagraphs(state: EditorState, align: "left" | "right" | "center", dispatch: any) { @@ -914,7 +935,7 @@ export default class RichTextMenu extends AntimodeMenu { {[this.createMarksDropdown(this.activeFontSize, this.fontSizeOptions, "font size"), this.createMarksDropdown(this.activeFontFamily, this.fontFamilyOptions, "font family"),
, - this.createNodesDropdown(this.activeListType, this.listTypeOptions, "nodes"), + this.createNodesDropdown(this.activeListType, this.listTypeOptions, "nodes", action((val: string) => this.activeListType = val)), this.createButton("sort-amount-down", "Summarize", undefined, this.insertSummarizer), this.createButton("quote-left", "Blockquote", undefined, this.insertBlockquote), this.createButton("minus", "Horizontal Rule", undefined, this.insertHorizontalRule), diff --git a/src/client/views/nodes/formattedText/RichTextRules.ts b/src/client/views/nodes/formattedText/RichTextRules.ts index ca30dde9d..ef0fead4a 100644 --- a/src/client/views/nodes/formattedText/RichTextRules.ts +++ b/src/client/views/nodes/formattedText/RichTextRules.ts @@ -90,7 +90,7 @@ export class RichTextRules { textDoc.inlineTextCount = numInlines + 1; const inlineFieldKey = "inline" + numInlines; // which field on the text document this annotation will write to const inlineLayoutKey = "layout_" + inlineFieldKey; // the field holding the layout string that will render the inline annotation - const textDocInline = Docs.Create.TextDocument("", { layoutKey: inlineLayoutKey, _width: 75, _height: 35, annotationOn: textDoc, _autoHeight: true, _fontSize: 9, title: "inline comment" }); + const textDocInline = Docs.Create.TextDocument("", { layoutKey: inlineLayoutKey, _width: 75, _height: 35, annotationOn: textDoc, _autoHeight: true, _fontSize: "9pt", title: "inline comment" }); textDocInline.title = inlineFieldKey; // give the annotation its own title textDocInline.customTitle = true; // And make sure that it's 'custom' so that editing text doesn't change the title of the containing doc textDocInline.isTemplateForField = inlineFieldKey; // this is needed in case the containing text doc is converted to a template at some point diff --git a/src/fields/documentSchemas.ts b/src/fields/documentSchemas.ts index c1659d4d5..61a37ef8a 100644 --- a/src/fields/documentSchemas.ts +++ b/src/fields/documentSchemas.ts @@ -55,7 +55,7 @@ export const documentSchema = createSchema({ _columnsHideIfEmpty: "boolean", // whether empty stacking view column headings should be hidden _columnHeaders: listSpec(SchemaHeaderField), // header descriptions for stacking/masonry _schemaHeaders: listSpec(SchemaHeaderField), // header descriptions for schema views - _fontSize: "number", + _fontSize: "string", _fontFamily: "string", _sidebarWidthPercent: "string", // percent of text window width taken up by sidebar -- cgit v1.2.3-70-g09d2