From 1d667d19f5402dc9f9069e0a57008dac96f6de2a Mon Sep 17 00:00:00 2001 From: madelinegr Date: Tue, 12 Feb 2019 18:55:11 -0500 Subject: set up web box classes --- src/client/views/nodes/FieldView.tsx | 5 +++ src/client/views/nodes/WebBox.scss | 13 +++++++ src/client/views/nodes/WebBox.tsx | 73 ++++++++++++++++++++++++++++++++++++ 3 files changed, 91 insertions(+) create mode 100644 src/client/views/nodes/WebBox.scss create mode 100644 src/client/views/nodes/WebBox.tsx (limited to 'src/client/views/nodes') diff --git a/src/client/views/nodes/FieldView.tsx b/src/client/views/nodes/FieldView.tsx index 12371eb2e..df6a409ec 100644 --- a/src/client/views/nodes/FieldView.tsx +++ b/src/client/views/nodes/FieldView.tsx @@ -7,9 +7,11 @@ import { TextField } from "../../../fields/TextField"; import { NumberField } from "../../../fields/NumberField"; import { RichTextField } from "../../../fields/RichTextField"; import { ImageField } from "../../../fields/ImageField"; +import { WebField } from "../../../fields/WebField"; import { Key } from "../../../fields/Key"; import { FormattedTextBox } from "./FormattedTextBox"; import { ImageBox } from "./ImageBox"; +import { WebBox } from "./WebBox"; import { DocumentView } from "./DocumentView"; // @@ -45,6 +47,9 @@ export class FieldView extends React.Component { else if (field instanceof ImageField) { return } + else if (field instanceof WebField) { + return + } else if (field instanceof NumberField) { return

{field.Data}

} else if (field != FieldWaiting) { diff --git a/src/client/views/nodes/WebBox.scss b/src/client/views/nodes/WebBox.scss new file mode 100644 index 000000000..2bd8b1d3c --- /dev/null +++ b/src/client/views/nodes/WebBox.scss @@ -0,0 +1,13 @@ + +.imageBox-cont { + padding: 0vw; + position: absolute; + width: 100% +} + +.imageBox-button { + padding : 0vw; + border: none; + width : 100%; + height: 100%; +} \ No newline at end of file diff --git a/src/client/views/nodes/WebBox.tsx b/src/client/views/nodes/WebBox.tsx new file mode 100644 index 000000000..f50f8c60e --- /dev/null +++ b/src/client/views/nodes/WebBox.tsx @@ -0,0 +1,73 @@ + +import Lightbox from 'react-image-lightbox'; +import { SelectionManager } from "../../util/SelectionManager"; +import "./WebBox.scss"; +import React = require("react") +import { WebField } from '../../../fields/WebField'; +import { FieldViewProps, FieldView } from './FieldView'; +import { CollectionFreeFormDocumentView } from './CollectionFreeFormDocumentView'; +import { FieldWaiting } from '../../../fields/Field'; +import { observer } from "mobx-react" +import { observable, action, spy } from 'mobx'; +import { KeyStore } from '../../../fields/Key'; + +@observer +export class WebBox extends React.Component { + + public static LayoutString() { return FieldView.LayoutString("WebBox"); } + private _ref: React.RefObject; + private _downX: number = 0; + private _downY: number = 0; + private _lastTap: number = 0; + @observable private _isOpen: boolean = false; + + constructor(props: FieldViewProps) { + super(props); + + this._ref = React.createRef(); + this.state = { + isOpen: false, + }; + } + + componentDidMount() { + } + + componentWillUnmount() { + } + + onPointerDown = (e: React.PointerEvent): void => { + if (Date.now() - this._lastTap < 300) { + if (e.buttons === 1 && this.props.DocumentViewForField instanceof CollectionFreeFormDocumentView && + SelectionManager.IsSelected(this.props.DocumentViewForField)) { + e.stopPropagation(); + this._downX = e.clientX; + this._downY = e.clientY; + document.removeEventListener("pointerup", this.onPointerUp); + document.addEventListener("pointerup", this.onPointerUp); + } + } else { + this._lastTap = Date.now(); + } + } + @action + onPointerUp = (e: PointerEvent): void => { + document.removeEventListener("pointerup", this.onPointerUp); + if (Math.abs(e.clientX - this._downX) < 2 && Math.abs(e.clientY - this._downY) < 2) { + this._isOpen = true; + } + e.stopPropagation(); + } + + render() { + let field = this.props.doc.Get(this.props.fieldKey); + let path = field == FieldWaiting ? "https://image.flaticon.com/icons/svg/66/66163.svg" : + field instanceof WebField ? field.Data.href : "https://cs.brown.edu/"; + let nativeWidth = this.props.doc.GetNumber(KeyStore.NativeWidth, 1); + + return ( +
+ +
) + } +} \ No newline at end of file -- cgit v1.2.3-70-g09d2 From 837509322d7e556830c57653828e223b06eb38a6 Mon Sep 17 00:00:00 2001 From: madelinegr Date: Tue, 12 Feb 2019 19:25:28 -0500 Subject: fixed bugs with launching --- .DS_Store | Bin 0 -> 6148 bytes package-lock.json | 6 +- src/.DS_Store | Bin 0 -> 6148 bytes src/client/documents/Documents.ts | 4 +- src/client/views/nodes/DocumentView.tsx | 5 +- src/client/views/nodes/WebBox.scss | 4 +- src/documents/Documents.ts | 92 -------------- src/fields/Document 2.ts | 93 -------------- src/fields/DocumentReference 2.ts | 46 ------- src/fields/Field 2.ts | 54 --------- src/fields/FieldUpdatedArgs 2.ts | 27 ----- src/fields/Key 2.ts | 45 ------- src/fields/ListField 2.ts | 21 ---- src/fields/NumberField 2.ts | 13 -- src/fields/TextField 2.ts | 13 -- src/stores/NodeCollectionStore.ts | 25 ---- src/stores/NodeStore.ts | 24 ---- src/stores/RootStore.ts | 16 --- src/stores/StaticTextNodeStore.ts | 16 --- src/stores/VideoNodeStore.ts | 17 --- src/util/TypedEvent.ts | 42 ------- src/viewmodels/DocumentViewModel.ts | 11 -- .../freeformcanvas/CollectionFreeFormView.scss | 15 --- .../freeformcanvas/CollectionFreeFormView.tsx | 98 --------------- src/views/freeformcanvas/FreeFormCanvas.scss | 15 --- src/views/freeformcanvas/FreeFormCanvas.tsx | 86 ------------- src/views/nodes/DocumentView.tsx | 134 --------------------- src/views/nodes/FieldTextBox.tsx | 117 ------------------ src/views/nodes/NodeView.scss | 31 ----- src/views/nodes/RichTextView.tsx | 0 src/views/nodes/TextNodeView.tsx | 28 ----- src/views/nodes/TopBar.tsx | 46 ------- src/views/nodes/VideoNodeView.scss | 5 - src/views/nodes/VideoNodeView.tsx | 29 ----- 34 files changed, 10 insertions(+), 1168 deletions(-) create mode 100644 .DS_Store create mode 100644 src/.DS_Store delete mode 100644 src/documents/Documents.ts delete mode 100644 src/fields/Document 2.ts delete mode 100644 src/fields/DocumentReference 2.ts delete mode 100644 src/fields/Field 2.ts delete mode 100644 src/fields/FieldUpdatedArgs 2.ts delete mode 100644 src/fields/Key 2.ts delete mode 100644 src/fields/ListField 2.ts delete mode 100644 src/fields/NumberField 2.ts delete mode 100644 src/fields/TextField 2.ts delete mode 100644 src/stores/NodeCollectionStore.ts delete mode 100644 src/stores/NodeStore.ts delete mode 100644 src/stores/RootStore.ts delete mode 100644 src/stores/StaticTextNodeStore.ts delete mode 100644 src/stores/VideoNodeStore.ts delete mode 100644 src/util/TypedEvent.ts delete mode 100644 src/viewmodels/DocumentViewModel.ts delete mode 100644 src/views/freeformcanvas/CollectionFreeFormView.scss delete mode 100644 src/views/freeformcanvas/CollectionFreeFormView.tsx delete mode 100644 src/views/freeformcanvas/FreeFormCanvas.scss delete mode 100644 src/views/freeformcanvas/FreeFormCanvas.tsx delete mode 100644 src/views/nodes/DocumentView.tsx delete mode 100644 src/views/nodes/FieldTextBox.tsx delete mode 100644 src/views/nodes/NodeView.scss delete mode 100644 src/views/nodes/RichTextView.tsx delete mode 100644 src/views/nodes/TextNodeView.tsx delete mode 100644 src/views/nodes/TopBar.tsx delete mode 100644 src/views/nodes/VideoNodeView.scss delete mode 100644 src/views/nodes/VideoNodeView.tsx (limited to 'src/client/views/nodes') diff --git a/.DS_Store b/.DS_Store new file mode 100644 index 000000000..8493b4a74 Binary files /dev/null and b/.DS_Store differ diff --git a/package-lock.json b/package-lock.json index a4939f1cb..5b62532c4 100644 --- a/package-lock.json +++ b/package-lock.json @@ -9119,7 +9119,7 @@ }, "regjsparser": { "version": "0.1.5", - "resolved": "https://registry.npmjs.org/regjsparser/-/regjsparser-0.1.5.tgz", + "resolved": "http://registry.npmjs.org/regjsparser/-/regjsparser-0.1.5.tgz", "integrity": "sha1-fuj4Tcb6eS0/0K4ijSS9lJ6tIFw=", "dev": true, "requires": { @@ -9470,7 +9470,7 @@ }, "sha.js": { "version": "2.4.11", - "resolved": "https://registry.npmjs.org/sha.js/-/sha.js-2.4.11.tgz", + "resolved": "http://registry.npmjs.org/sha.js/-/sha.js-2.4.11.tgz", "integrity": "sha512-QMEp5B7cftE7APOjk5Y6xgrbWu+WkLVQwk8JNjZ8nKRciZaByEW6MubieAiToS7+dwvrjGhH8jRXz3MVd0AYqQ==", "dev": true, "requires": { @@ -9962,7 +9962,7 @@ }, "strip-eof": { "version": "1.0.0", - "resolved": "https://registry.npmjs.org/strip-eof/-/strip-eof-1.0.0.tgz", + "resolved": "http://registry.npmjs.org/strip-eof/-/strip-eof-1.0.0.tgz", "integrity": "sha1-u0P/VZim6wXYm1n80SnJgzE2Br8=" }, "strip-indent": { diff --git a/src/.DS_Store b/src/.DS_Store new file mode 100644 index 000000000..4d6acb95a Binary files /dev/null and b/src/.DS_Store differ diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts index d8db6ee79..605a99bef 100644 --- a/src/client/documents/Documents.ts +++ b/src/client/documents/Documents.ts @@ -69,7 +69,7 @@ export namespace Documents { export function TextDocument(options: DocumentOptions = {}): Document { let doc = GetTextPrototype().MakeDelegate(); setupOptions(doc, options); - // doc.SetField(KeyStore.Data, new RichTextField()); + // doc.Set(KeyStore.Data, new RichTextField()); return doc; } @@ -131,7 +131,7 @@ export namespace Documents { imageProto.Set(KeyStore.Height, new NumberField(300)); imageProto.Set(KeyStore.Layout, new TextField(CollectionFreeFormView.LayoutString("AnnotationsKey"))); imageProto.Set(KeyStore.BackgroundLayout, new TextField(ImageBox.LayoutString())); - // imageProto.SetField(KeyStore.Layout, new TextField('
')); + // imageProto.Set(KeyStore.Layout, new TextField('
')); imageProto.Set(KeyStore.LayoutKeys, new ListField([KeyStore.Data, KeyStore.Annotations])); Server.AddDocument(imageProto); return imageProto; diff --git a/src/client/views/nodes/DocumentView.tsx b/src/client/views/nodes/DocumentView.tsx index 3a73f2fde..b13d6486b 100644 --- a/src/client/views/nodes/DocumentView.tsx +++ b/src/client/views/nodes/DocumentView.tsx @@ -13,6 +13,7 @@ import { CollectionSchemaView } from "../collections/CollectionSchemaView"; import { CollectionViewBase, COLLECTION_BORDER_WIDTH } from "../collections/CollectionViewBase"; import { FormattedTextBox } from "../nodes/FormattedTextBox"; import { ImageBox } from "../nodes/ImageBox"; +import { WebBox } from "../nodes/WebBox"; import "./NodeView.scss"; import React = require("react"); import { Transform } from "../../util/Transform"; @@ -151,7 +152,7 @@ export class DocumentView extends React.Component { bindings.DocumentView = this; // set the DocumentView to this if it hasn't already been set by a sub-class during its render method. } var annotated = { return (
")); - textProto.SetField(KeyStore.LayoutKeys, new ListField([KeyStore.Data])); - } - return textProto; - } - - export function TextDocument(text: string, options:DocumentOptions = {}): Document { - let doc = GetTextPrototype().MakeDelegate(); - setupOptions(doc, options); - // doc.SetField(KeyStore.Data, new TextField(text)); - return doc; - } - - let imageProto:Document; - function GetImagePrototype(): Document { - if(!imageProto) { - imageProto = new Document(); - imageProto.SetField(KeyStore.X, new NumberField(0)); - imageProto.SetField(KeyStore.Y, new NumberField(0)); - imageProto.SetField(KeyStore.Width, new NumberField(300)); - imageProto.SetField(KeyStore.Height, new NumberField(300)); - imageProto.SetField(KeyStore.Layout, new TextField('Image not found')); - imageProto.SetField(KeyStore.LayoutFields, new ListField([KeyStore.Data])); - } - return imageProto; - } - - export function ImageDocument(url: string, options:DocumentOptions = {}): Document { - let doc = GetImagePrototype().MakeDelegate(); - setupOptions(doc, options); - doc.SetField(KeyStore.Data, new TextField(url)); - return doc; - } - - let collectionProto:Document; - function GetCollectionPrototype(): Document { - if(!collectionProto) { - collectionProto = new Document(); - collectionProto.SetField(KeyStore.X, new NumberField(150)); - collectionProto.SetField(KeyStore.Y, new NumberField(0)); - collectionProto.SetField(KeyStore.Width, new NumberField(300)); - collectionProto.SetField(KeyStore.Height, new NumberField(300)); - collectionProto.SetField(KeyStore.Layout, new TextField('')); - collectionProto.SetField(KeyStore.LayoutKeys, new ListField([KeyStore.Data])); - } - return collectionProto; - } - - export function CollectionDocument( documents: Array, options:DocumentOptions = {}): Document { - let doc = GetCollectionPrototype().MakeDelegate(); - setupOptions(doc, options); - doc.SetField(KeyStore.Data, new ListField(documents)); - return doc; - } -} \ No newline at end of file diff --git a/src/fields/Document 2.ts b/src/fields/Document 2.ts deleted file mode 100644 index 0bba9c21e..000000000 --- a/src/fields/Document 2.ts +++ /dev/null @@ -1,93 +0,0 @@ -import { Field, Cast, Opt } from "./Field" -import { Key, KeyStore } from "./Key" -import { ObservableMap } from "mobx"; - -export class Document extends Field { - private fields: ObservableMap = new ObservableMap(); - - GetField(key: Key, ignoreProto: boolean = false): Opt { - let field: Opt; - if (ignoreProto) { - if (this.fields.has(key)) { - field = this.fields.get(key); - } - } else { - let doc: Opt = this; - while (doc && !(doc.fields.has(key))) { - doc = doc.GetPrototype(); - } - - if (doc) { - field = doc.fields.get(key); - } - } - - return field; - } - - GetFieldT(key: Key, ctor: { new(): T }, ignoreProto?: boolean): Opt { - return Cast(this.GetField(key, ignoreProto), ctor); - } - - GetFieldValue(key: Key, ctor: { new(): U }, defaultVal: T): T { - let val = this.GetField(key); - return (val && val instanceof ctor) ? val.Data : defaultVal; - } - - SetField(key: Key, field: Opt): void { - if (field) { - this.fields.set(key, field); - } else { - this.fields.delete(key); - } - } - - SetFieldValue(key: Key, value: any, ctor: { new(): T }): boolean { - let field = this.GetField(key, true); - if (field != null) { - return field.TrySetValue(value); - } else { - field = new ctor(); - if (field.TrySetValue(value)) { - this.SetField(key, field); - return true; - } else { - return false; - } - } - } - - GetPrototype(): Opt { - return this.GetFieldT(KeyStore.Prototype, Document, true); - } - - GetAllPrototypes(): Document[] { - let protos: Document[] = []; - let doc: Opt = this; - while (doc != null) { - protos.push(doc); - doc = doc.GetPrototype(); - } - return protos; - } - - MakeDelegate(): Document { - let delegate = new Document(); - - delegate.SetField(KeyStore.Prototype, this); - - return delegate; - } - - TrySetValue(value: any): boolean { - throw new Error("Method not implemented."); - } - GetValue() { - throw new Error("Method not implemented."); - } - Copy(): Field { - throw new Error("Method not implemented."); - } - - -} \ No newline at end of file diff --git a/src/fields/DocumentReference 2.ts b/src/fields/DocumentReference 2.ts deleted file mode 100644 index 936067bd2..000000000 --- a/src/fields/DocumentReference 2.ts +++ /dev/null @@ -1,46 +0,0 @@ -import { Field, Opt } from "./Field"; -import { Document } from "./Document"; -import { Key } from "./Key"; -import { DocumentUpdatedArgs } from "./FieldUpdatedArgs"; - -export class DocumentReference extends Field { - get Key(): Key{ - return this.key; - } - - get Document(): Document { - return this.document; - } - - constructor(private document: Document, private key: Key) { - super(); - } - - private DocFieldUpdated(args: DocumentUpdatedArgs):void{ - // this.FieldUpdated.emit(args.fieldArgs); - } - - Dereference() : Opt { - return this.document.GetField(this.key); - } - - DereferenceToRoot(): Opt { - let field: Opt = this; - while (field instanceof DocumentReference) { - field = field.Dereference(); - } - return field; - } - - TrySetValue(value: any): boolean { - throw new Error("Method not implemented."); - } - GetValue() { - throw new Error("Method not implemented."); - } - Copy(): Field { - throw new Error("Method not implemented."); - } - - -} \ No newline at end of file diff --git a/src/fields/Field 2.ts b/src/fields/Field 2.ts deleted file mode 100644 index 46f92f203..000000000 --- a/src/fields/Field 2.ts +++ /dev/null @@ -1,54 +0,0 @@ -import { TypedEvent } from "../util/TypedEvent"; -import { FieldUpdatedArgs } from "./FieldUpdatedArgs"; -import { DocumentReference } from "./DocumentReference"; -import { Utils } from "../Utils"; - -export function Cast(field: Opt, ctor: { new(): T }): Opt { - if (field) { - if (ctor && field instanceof ctor) { - return field; - } - } - return undefined; -} - -export type Opt = T | undefined; - -export abstract class Field { - //FieldUpdated: TypedEvent> = new TypedEvent>(); - - private id: string; - get Id(): string { - return this.id; - } - - constructor(id: Opt = undefined) { - this.id = id || Utils.GenerateGuid(); - } - - Dereference(): Opt { - return this; - } - DereferenceToRoot(): Opt { - return this; - } - - DereferenceT(ctor: { new(): T }): Opt { - return Cast(this.Dereference(), ctor); - } - - DereferenceToRootT(ctor: { new(): T }): Opt { - return Cast(this.DereferenceToRoot(), ctor); - } - - Equals(other: Field): boolean { - return this.id === other.id; - } - - abstract TrySetValue(value: any): boolean; - - abstract GetValue(): any; - - abstract Copy(): Field; - -} \ No newline at end of file diff --git a/src/fields/FieldUpdatedArgs 2.ts b/src/fields/FieldUpdatedArgs 2.ts deleted file mode 100644 index 23ccf2a5a..000000000 --- a/src/fields/FieldUpdatedArgs 2.ts +++ /dev/null @@ -1,27 +0,0 @@ -import { Field, Opt } from "./Field"; -import { Document } from "./Document"; -import { Key } from "./Key"; - -export enum FieldUpdatedAction { - Add, - Remove, - Replace, - Update -} - -export interface FieldUpdatedArgs { - field: Field; - action: FieldUpdatedAction; -} - -export interface DocumentUpdatedArgs { - field: Document; - key: Key; - - oldValue: Opt; - newValue: Opt; - - fieldArgs?: FieldUpdatedArgs; - - action: FieldUpdatedAction; -} diff --git a/src/fields/Key 2.ts b/src/fields/Key 2.ts deleted file mode 100644 index db30f545d..000000000 --- a/src/fields/Key 2.ts +++ /dev/null @@ -1,45 +0,0 @@ -import { Field } from "./Field" -import { Utils } from "../Utils"; -import { observable } from "mobx"; - -export class Key extends Field { - private name:string; - - get Name():string { - return this.name; - } - - constructor(name:string){ - super(Utils.GenerateDeterministicGuid(name)); - - this.name = name; - } - - TrySetValue(value: any): boolean { - throw new Error("Method not implemented."); - } - - GetValue() { - return this.Name; - } - - Copy(): Field { - return this; - } - - -} - -export namespace KeyStore { - export let Prototype = new Key("Prototype"); - export let X = new Key("X"); - export let Y = new Key("Y"); - export let PanX = new Key("PanX"); - export let PanY = new Key("PanY"); - export let Width = new Key("Width"); - export let Height = new Key("Height"); - export let Data = new Key("Data"); - export let Layout = new Key("Layout"); - export let LayoutKeys = new Key("LayoutKeys"); - export let LayoutFields = new Key("LayoutFields"); -} \ No newline at end of file diff --git a/src/fields/ListField 2.ts b/src/fields/ListField 2.ts deleted file mode 100644 index dd96ea8c8..000000000 --- a/src/fields/ListField 2.ts +++ /dev/null @@ -1,21 +0,0 @@ -import { Field } from "./Field"; -import { BasicField } from "./BasicField"; - -export class ListField extends BasicField { - constructor(data: T[] = []) { - super(data.slice()); - } - - Get(index:number) : T{ - return this.Data[index]; - } - - Set(index:number, value:T):void { - this.Data[index] = value; - } - - Copy(): Field { - return new ListField(this.Data); - } - -} \ No newline at end of file diff --git a/src/fields/NumberField 2.ts b/src/fields/NumberField 2.ts deleted file mode 100644 index cbe15f987..000000000 --- a/src/fields/NumberField 2.ts +++ /dev/null @@ -1,13 +0,0 @@ -import { BasicField } from "./BasicField" - -export class NumberField extends BasicField { - constructor(data: number = 0) { - super(data); - } - - Copy() { - return new NumberField(this.Data); - } - - -} \ No newline at end of file diff --git a/src/fields/TextField 2.ts b/src/fields/TextField 2.ts deleted file mode 100644 index a7c221788..000000000 --- a/src/fields/TextField 2.ts +++ /dev/null @@ -1,13 +0,0 @@ -import { BasicField } from "./BasicField" - -export class TextField extends BasicField { - constructor(data: string = "") { - super(data); - } - - Copy() { - return new TextField(this.Data); - } - - -} diff --git a/src/stores/NodeCollectionStore.ts b/src/stores/NodeCollectionStore.ts deleted file mode 100644 index ac4f515f1..000000000 --- a/src/stores/NodeCollectionStore.ts +++ /dev/null @@ -1,25 +0,0 @@ -import { computed, observable, action } from "mobx"; -import { NodeStore } from "./NodeStore"; -import { Document } from "../fields/Document"; - -export class NodeCollectionStore extends NodeStore { - - @observable - public Scale: number = 1; - - @observable - public Nodes: NodeStore[] = new Array(); - - @observable - public Docs: Document[] = []; - - @computed - public get Transform(): string { - return "translate(" + this.X + "px," + this.Y + "px) scale(" + this.Scale + "," + this.Scale + ")"; - } - - @action - public AddNodes(stores: NodeStore[]): void { - stores.forEach(store => this.Nodes.push(store)); - } -} \ No newline at end of file diff --git a/src/stores/NodeStore.ts b/src/stores/NodeStore.ts deleted file mode 100644 index 6a734cf44..000000000 --- a/src/stores/NodeStore.ts +++ /dev/null @@ -1,24 +0,0 @@ -import { computed, observable } from "mobx"; -import { Utils } from "../Utils"; - -export class NodeStore { - - public Id: string = Utils.GenerateGuid(); - - @observable - public X: number = 0; - - @observable - public Y: number = 0; - - @observable - public Width: number = 0; - - @observable - public Height: number = 0; - - @computed - public get Transform(): string { - return "translate(" + this.X + "px, " + this.Y + "px)"; - } -} \ No newline at end of file diff --git a/src/stores/RootStore.ts b/src/stores/RootStore.ts deleted file mode 100644 index fa551c1d1..000000000 --- a/src/stores/RootStore.ts +++ /dev/null @@ -1,16 +0,0 @@ -import { action, observable } from "mobx"; -import { NodeStore } from "./NodeStore"; - -// This globally accessible store might come in handy, although you may decide that you don't need it. -export class RootStore { - - private constructor() { - // initialization code - } - - private static _instance: RootStore; - - public static get Instance():RootStore { - return this._instance || (this._instance = new this()); - } -} \ No newline at end of file diff --git a/src/stores/StaticTextNodeStore.ts b/src/stores/StaticTextNodeStore.ts deleted file mode 100644 index 7c342a7a2..000000000 --- a/src/stores/StaticTextNodeStore.ts +++ /dev/null @@ -1,16 +0,0 @@ -import { observable } from "mobx"; -import { NodeStore } from "./NodeStore"; - -export class StaticTextNodeStore extends NodeStore { - - constructor(initializer: Partial) { - super(); - Object.assign(this, initializer); - } - - @observable - public Title: string = ""; - - @observable - public Text: string = ""; -} \ No newline at end of file diff --git a/src/stores/VideoNodeStore.ts b/src/stores/VideoNodeStore.ts deleted file mode 100644 index e5187ab07..000000000 --- a/src/stores/VideoNodeStore.ts +++ /dev/null @@ -1,17 +0,0 @@ -import { observable } from "mobx"; -import { NodeStore } from "./NodeStore"; - -export class VideoNodeStore extends NodeStore { - - constructor(initializer: Partial) { - super(); - Object.assign(this, initializer); - } - - @observable - public Title: string = ""; - - @observable - public Url: string = ""; - -} \ No newline at end of file diff --git a/src/util/TypedEvent.ts b/src/util/TypedEvent.ts deleted file mode 100644 index 0714a7f5c..000000000 --- a/src/util/TypedEvent.ts +++ /dev/null @@ -1,42 +0,0 @@ -export interface Listener { - (event: T): any; -} - -export interface Disposable { - dispose(): void; -} - -/** passes through events as they happen. You will not get events from before you start listening */ -export class TypedEvent { - private listeners: Listener[] = []; - private listenersOncer: Listener[] = []; - - on = (listener: Listener): Disposable => { - this.listeners.push(listener); - return { - dispose: () => this.off(listener) - }; - } - - once = (listener: Listener): void => { - this.listenersOncer.push(listener); - } - - off = (listener: Listener) => { - var callbackIndex = this.listeners.indexOf(listener); - if (callbackIndex > -1) this.listeners.splice(callbackIndex, 1); - } - - emit = (event: T) => { - /** Update any general listeners */ - this.listeners.forEach((listener) => listener(event)); - - /** Clear the `once` queue */ - this.listenersOncer.forEach((listener) => listener(event)); - this.listenersOncer = []; - } - - pipe = (te: TypedEvent): Disposable => { - return this.on((e) => te.emit(e)); - } -} \ No newline at end of file diff --git a/src/viewmodels/DocumentViewModel.ts b/src/viewmodels/DocumentViewModel.ts deleted file mode 100644 index 008275f3c..000000000 --- a/src/viewmodels/DocumentViewModel.ts +++ /dev/null @@ -1,11 +0,0 @@ -import { Document } from "../fields/Document"; - -export class DocumentViewModel { - constructor(private doc: Document) { - - } - - get Doc(): Document { - return this.doc; - } -} \ No newline at end of file diff --git a/src/views/freeformcanvas/CollectionFreeFormView.scss b/src/views/freeformcanvas/CollectionFreeFormView.scss deleted file mode 100644 index cb4805eb3..000000000 --- a/src/views/freeformcanvas/CollectionFreeFormView.scss +++ /dev/null @@ -1,15 +0,0 @@ -.collectionfreeformview-container { - position: absolute; - top: 0; - left: 0; - width: 100%; - height: 100%; - overflow: hidden; - - .collectionfreeformview { - position: absolute; - top: 0; - left: 0; - } -} - diff --git a/src/views/freeformcanvas/CollectionFreeFormView.tsx b/src/views/freeformcanvas/CollectionFreeFormView.tsx deleted file mode 100644 index d5343536d..000000000 --- a/src/views/freeformcanvas/CollectionFreeFormView.tsx +++ /dev/null @@ -1,98 +0,0 @@ -import { observer } from "mobx-react"; -import { Key, KeyStore } from "../../fields/Key"; -import "./FreeFormCanvas.scss"; -import React = require("react"); -import { action } from "mobx"; -import { Document } from "../../fields/Document"; -import { DocumentViewModel } from "../../viewmodels/DocumentViewModel"; -import { DocumentView } from "../nodes/DocumentView"; -import { ListField } from "../../fields/ListField"; -import { NumberField } from "../../fields/NumberField"; -import { SSL_OP_SINGLE_DH_USE } from "constants"; - -interface IProps { - fieldKey: Key; - doc: Document; -} - -@observer -export class CollectionFreeFormView extends React.Component { - - private _isPointerDown: boolean = false; - - constructor(props: IProps) { - super(props); - } - - @action - onPointerDown = (e: React.PointerEvent): void => { - e.stopPropagation(); - if (e.button === 2) { - this._isPointerDown = true; - document.removeEventListener("pointermove", this.onPointerMove); - document.addEventListener("pointermove", this.onPointerMove); - document.removeEventListener("pointerup", this.onPointerUp); - document.addEventListener("pointerup", this.onPointerUp); - } - } - - @action - onPointerUp = (e: PointerEvent): void => { - e.stopPropagation(); - if (e.button === 2) { - this._isPointerDown = false; - document.removeEventListener("pointermove", this.onPointerMove); - document.removeEventListener("pointerup", this.onPointerUp); - } - } - - @action - onPointerMove = (e: PointerEvent): void => { - e.preventDefault(); - e.stopPropagation(); - if (!this._isPointerDown) { - return; - } - const { doc } = this.props; - let x = doc.GetFieldValue(KeyStore.PanX, NumberField, Number(0)); - let y = doc.GetFieldValue(KeyStore.PanY, NumberField, Number(0)); - doc.SetFieldValue(KeyStore.PanX, x + e.movementX, NumberField); - doc.SetFieldValue(KeyStore.PanY, y + e.movementY, NumberField); - } - - @action - onPointerWheel = (e: React.WheelEvent): void => { - e.stopPropagation(); - - let scaleAmount = 1 - (e.deltaY / 1000); - //this.props.store.Scale *= scaleAmount; - } - - render() { - const { fieldKey, doc } = this.props; - const value: Document[] = doc.GetFieldValue(fieldKey, ListField, []); - const panx: number = doc.GetFieldValue(KeyStore.PanX, NumberField, Number(0)); - const pany: number = doc.GetFieldValue(KeyStore.PanY, NumberField, Number(0)); - return ( - -
-
e.preventDefault()} style={{ - width: "100%", - height: "calc(100% - 4px)", - overflow: "hidden" - }}> -
-
- {value.map(doc => { - return (); - })} -
-
-
-
- ); - } -} \ No newline at end of file diff --git a/src/views/freeformcanvas/FreeFormCanvas.scss b/src/views/freeformcanvas/FreeFormCanvas.scss deleted file mode 100644 index 884ef90e6..000000000 --- a/src/views/freeformcanvas/FreeFormCanvas.scss +++ /dev/null @@ -1,15 +0,0 @@ -.freeformcanvas-container { - position: absolute; - top: 0; - left: 0; - width: 100%; - height: 100%; - overflow: hidden; - - .freeformcanvas { - position: absolute; - top: 0; - left: 0; - } -} - diff --git a/src/views/freeformcanvas/FreeFormCanvas.tsx b/src/views/freeformcanvas/FreeFormCanvas.tsx deleted file mode 100644 index 9ef5ab8f7..000000000 --- a/src/views/freeformcanvas/FreeFormCanvas.tsx +++ /dev/null @@ -1,86 +0,0 @@ -import { observer } from "mobx-react"; -import { Key } from "../../fields/Key"; -import { NodeCollectionStore } from "../../stores/NodeCollectionStore"; -import "./FreeFormCanvas.scss"; -import React = require("react"); -import { action } from "mobx"; -import { Document } from "../../fields/Document"; -import {DocumentViewModel} from "../../viewmodels/DocumentViewModel"; -import {DocumentView} from "../nodes/DocumentView"; -import {TextField} from "../../fields/TextField"; -import {ListField} from "../../fields/ListField"; -import {Field} from "../../fields/Field"; - -interface IProps { - store: NodeCollectionStore; -} - -@observer -export class FreeFormCanvas extends React.Component { - - private _isPointerDown: boolean = false; - - constructor(props:IProps) { - super(props); - } - - @action - onPointerDown = (e: React.PointerEvent): void => { - e.stopPropagation(); - if (e.button === 2) { - this._isPointerDown = true; - document.removeEventListener("pointermove", this.onPointerMove); - document.addEventListener("pointermove", this.onPointerMove); - document.removeEventListener("pointerup", this.onPointerUp); - document.addEventListener("pointerup", this.onPointerUp); - } - } - - @action - onPointerUp = (e: PointerEvent): void => { - e.stopPropagation(); - if (e.button === 2) { - this._isPointerDown = false; - document.removeEventListener("pointermove", this.onPointerMove); - document.removeEventListener("pointerup", this.onPointerUp); - } - - // let doc = this.props.store.Docs[0]; - // let dataField = doc.GetFieldT(KeyStore.Data, TextField); - // let data = dataField ? dataField.Data : ""; - // this.props.store.Docs[0].SetFieldValue(KeyStore.Data, data + " hello", TextField); - } - - @action - onPointerMove = (e: PointerEvent): void => { - e.stopPropagation(); - if (!this._isPointerDown) { - return; - } - this.props.store.X += e.movementX; - this.props.store.Y += e.movementY; - } - - @action - onPointerWheel = (e: React.WheelEvent): void => { - e.stopPropagation(); - - let scaleAmount = 1 - (e.deltaY / 1000); - this.props.store.Scale *= scaleAmount; - } - - render() { - let store = this.props.store; - return ( -
e.preventDefault()}> -
-
- {this.props.store.Docs.map(doc => { - return (); - })} -
-
-
- ); - } -} \ No newline at end of file diff --git a/src/views/nodes/DocumentView.tsx b/src/views/nodes/DocumentView.tsx deleted file mode 100644 index f955a8c39..000000000 --- a/src/views/nodes/DocumentView.tsx +++ /dev/null @@ -1,134 +0,0 @@ -import { observer } from "mobx-react"; -import React = require("react"); -import { computed } from "mobx"; -import { KeyStore, Key } from "../../fields/Key"; -import { NumberField } from "../../fields/NumberField"; -import { TextField } from "../../fields/TextField"; -import { DocumentViewModel } from "../../viewmodels/DocumentViewModel"; -import { ListField } from "../../fields/ListField"; -import { FieldTextBox } from "../nodes/FieldTextBox" -import { FreeFormCanvas } from "../freeformcanvas/FreeFormCanvas" -import { CollectionFreeFormView } from "../freeformcanvas/CollectionFreeFormView" -import "./NodeView.scss" -const JsxParser = require('react-jsx-parser').default;//TODO Why does this need to be imported like this? - -interface IProps { - dvm: DocumentViewModel; -} - -@observer -export class DocumentView extends React.Component { - @computed - get x(): number { - return this.props.dvm.Doc.GetFieldValue(KeyStore.X, NumberField, Number(0)); - } - - @computed - get y(): number { - return this.props.dvm.Doc.GetFieldValue(KeyStore.Y, NumberField, Number(0)); - } - - set x(x: number) { - this.props.dvm.Doc.SetFieldValue(KeyStore.X, x, NumberField) - } - - set y(y: number) { - this.props.dvm.Doc.SetFieldValue(KeyStore.Y, y, NumberField) - } - - @computed - get transform(): string { - return `translate(${this.x}px, ${this.y}px)`; - } - - @computed - get width(): number { - return this.props.dvm.Doc.GetFieldValue(KeyStore.Width, NumberField, Number(0)); - } - - @computed - get height(): number { - return this.props.dvm.Doc.GetFieldValue(KeyStore.Height, NumberField, Number(0)); - } - - @computed - get layout(): string { - return this.props.dvm.Doc.GetFieldValue(KeyStore.Layout, TextField, String("

Error loading layout data

")); - } - - @computed - get layoutKeys(): Key[] { - return this.props.dvm.Doc.GetFieldValue(KeyStore.LayoutKeys, ListField, new Array()); - } - - @computed - get layoutFields(): Key[] { - return this.props.dvm.Doc.GetFieldValue(KeyStore.LayoutFields, ListField, new Array()); - } - - private _isPointerDown = false; - - onPointerDown = (e: React.PointerEvent): void => { - e.stopPropagation(); - if (e.button === 2) { - this._isPointerDown = true; - document.removeEventListener("pointermove", this.onPointerMove); - document.addEventListener("pointermove", this.onPointerMove); - document.removeEventListener("pointerup", this.onPointerUp); - document.addEventListener("pointerup", this.onPointerUp); - } - } - - onPointerUp = (e: PointerEvent): void => { - e.stopPropagation(); - if (e.button === 2) { - e.preventDefault(); - this._isPointerDown = false; - document.removeEventListener("pointermove", this.onPointerMove); - document.removeEventListener("pointerup", this.onPointerUp); - } - } - - onPointerMove = (e: PointerEvent): void => { - e.stopPropagation(); - e.preventDefault(); - if (!this._isPointerDown) { - return; - } - this.x += e.movementX; - this.y += e.movementY; - } - - render() { - let doc = this.props.dvm.Doc; - let bindings: any = { - doc: doc - }; - for (const key of this.layoutKeys) { - bindings[key.Name + "Key"] = key; - } - for (const key of this.layoutFields) { - let field = doc.GetField(key); - if (field) { - bindings[key.Name] = field.GetValue(); - } - } - return ( -
{ - e.preventDefault() - }}> - -
- ); - } - -} \ No newline at end of file diff --git a/src/views/nodes/FieldTextBox.tsx b/src/views/nodes/FieldTextBox.tsx deleted file mode 100644 index dbac3906a..000000000 --- a/src/views/nodes/FieldTextBox.tsx +++ /dev/null @@ -1,117 +0,0 @@ -import { Key, KeyStore } from "../../fields/Key"; -import { Document } from "../../fields/Document"; -import { observer } from "mobx-react"; -import { TextField } from "../../fields/TextField"; -import React = require("react") -import { action, observable, reaction, IReactionDisposer } from "mobx"; - -import {schema} from "prosemirror-schema-basic"; -import {EditorState, Transaction} from "prosemirror-state" -import {EditorView} from "prosemirror-view" -import {keymap} from "prosemirror-keymap" -import {baseKeymap} from "prosemirror-commands" -import {undo, redo, history} from "prosemirror-history" -import { Opt } from "../../fields/Field"; - -interface IProps { - fieldKey:Key; - doc:Document; -} - -// FieldTextBox: Displays an editable plain text node that maps to a specified Key of a Document -// -// HTML Markup: Key} />"); -// and the node's binding to the specified document KEYNAME as: -// document.SetField(KeyStore.LayoutKeys, new ListField([KeyStore.])); -// The Jsx parser at run time will bind: -// 'fieldKey' property to the Key stored in LayoutKeys -// and 'doc' property to the document that is being rendered -// -// When rendered() by React, this extracts the TextController from the Document stored at the -// specified Key and assigns it to an HTML input node. When changes are made tot his node, -// this will edit the document and assign the new value to that field. -// -@observer -export class FieldTextBox extends React.Component { - private _ref: React.RefObject; - private _editorView: Opt; - private _reactionDisposer: Opt; - - constructor(props:IProps) { - super(props); - - this._ref = React.createRef(); - - this.onChange = this.onChange.bind(this); - } - - dispatchTransaction = (tx: Transaction) => { - if(this._editorView) { - const state = this._editorView.state.apply(tx); - this._editorView.updateState(state); - const {doc, fieldKey} = this.props; - doc.SetFieldValue(fieldKey, JSON.stringify(state.toJSON()), TextField); - } - } - - componentDidMount() { - let state:EditorState; - const {doc, fieldKey} = this.props; - const config = { - schema, - plugins: [ - history(), - keymap({"Mod-z": undo, "Mod-y": redo}), - keymap(baseKeymap) - ] - }; - - let field = doc.GetFieldT(fieldKey, TextField); - if(field) { - state = EditorState.fromJSON(config, JSON.parse(field.Data)); - } else { - state = EditorState.create(config); - } - if(this._ref.current) { - this._editorView = new EditorView(this._ref.current, { - state, - dispatchTransaction: this.dispatchTransaction - }); - } - - this._reactionDisposer = reaction(() => { - const field = this.props.doc.GetFieldT(this.props.fieldKey, TextField); - return field ? field.Data : undefined; - }, (field) => { - if(field && this._editorView) { - this._editorView.updateState(EditorState.fromJSON(config, JSON.parse(field))); - } - }) - } - - componentWillUnmount() { - if(this._editorView) { - this._editorView.destroy(); - } - if(this._reactionDisposer) { - this._reactionDisposer(); - } - } - - shouldComponentUpdate() { - return false; - } - - @action - onChange(e: React.ChangeEvent) { - const {fieldKey, doc} = this.props; - doc.SetFieldValue(fieldKey, e.target.value, TextField); - } - - render() { - return (
) - } -} \ No newline at end of file diff --git a/src/views/nodes/NodeView.scss b/src/views/nodes/NodeView.scss deleted file mode 100644 index a68335f87..000000000 --- a/src/views/nodes/NodeView.scss +++ /dev/null @@ -1,31 +0,0 @@ -.node { - position: absolute; - background: #cdcdcd; - - overflow: hidden; - - - &.minimized { - width: 30px; - height: 30px; - } - - .top { - background: #232323; - height: 20px; - cursor: pointer; - } - - .content { - padding: 20px 20px; - height: auto; - box-sizing: border-box; - - } - - .scroll-box { - overflow-y: scroll; - height: calc(100% - 20px); - } -} - diff --git a/src/views/nodes/RichTextView.tsx b/src/views/nodes/RichTextView.tsx deleted file mode 100644 index e69de29bb..000000000 diff --git a/src/views/nodes/TextNodeView.tsx b/src/views/nodes/TextNodeView.tsx deleted file mode 100644 index 4831e658c..000000000 --- a/src/views/nodes/TextNodeView.tsx +++ /dev/null @@ -1,28 +0,0 @@ -import { observer } from "mobx-react"; -import { StaticTextNodeStore } from "../../stores/StaticTextNodeStore"; -import "./NodeView.scss"; -import { TopBar } from "./TopBar"; -import React = require("react"); - -interface IProps { - store: StaticTextNodeStore; -} - -@observer -export class TextNodeView extends React.Component { - - render() { - let store = this.props.store; - return ( -
- -
-
-

{store.Title}

-

{store.Text}

-
-
-
- ); - } -} \ No newline at end of file diff --git a/src/views/nodes/TopBar.tsx b/src/views/nodes/TopBar.tsx deleted file mode 100644 index bb126e8b5..000000000 --- a/src/views/nodes/TopBar.tsx +++ /dev/null @@ -1,46 +0,0 @@ -import { observer } from "mobx-react"; -import { NodeStore } from "../../stores/NodeStore"; -import "./NodeView.scss"; -import React = require("react"); - -interface IProps { - store: NodeStore; -} - -@observer -export class TopBar extends React.Component { - - private _isPointerDown = false; - - onPointerDown = (e: React.PointerEvent): void => { - e.stopPropagation(); - e.preventDefault(); - this._isPointerDown = true; - document.removeEventListener("pointermove", this.onPointerMove); - document.addEventListener("pointermove", this.onPointerMove); - document.removeEventListener("pointerup", this.onPointerUp); - document.addEventListener("pointerup", this.onPointerUp); - } - - onPointerUp = (e: PointerEvent): void => { - e.stopPropagation(); - e.preventDefault(); - this._isPointerDown = false; - document.removeEventListener("pointermove", this.onPointerMove); - document.removeEventListener("pointerup", this.onPointerUp); - } - - onPointerMove = (e: PointerEvent): void => { - e.stopPropagation(); - e.preventDefault(); - if (!this._isPointerDown) { - return; - } - this.props.store.X += e.movementX; - this.props.store.Y += e.movementY; - } - - render() { - return
- } -} diff --git a/src/views/nodes/VideoNodeView.scss b/src/views/nodes/VideoNodeView.scss deleted file mode 100644 index f412c3519..000000000 --- a/src/views/nodes/VideoNodeView.scss +++ /dev/null @@ -1,5 +0,0 @@ -.node { - video { - width: 100%; - } -} \ No newline at end of file diff --git a/src/views/nodes/VideoNodeView.tsx b/src/views/nodes/VideoNodeView.tsx deleted file mode 100644 index 0a7b3d174..000000000 --- a/src/views/nodes/VideoNodeView.tsx +++ /dev/null @@ -1,29 +0,0 @@ -import { observer } from "mobx-react"; -import { VideoNodeStore } from "../../stores/VideoNodeStore"; -import "./NodeView.scss"; -import { TopBar } from "./TopBar"; -import "./VideoNodeView.scss"; -import React = require("react"); - -interface IProps { - store: VideoNodeStore; -} - -@observer -export class VideoNodeView extends React.Component { - - render() { - let store = this.props.store; - return ( -
- -
-
-

{store.Title}

-
-
-
- ); - } -} \ No newline at end of file -- cgit v1.2.3-70-g09d2 From e8bd54161e55b8ed429a3c99e05be8ea89653194 Mon Sep 17 00:00:00 2001 From: Monika Hedman Date: Wed, 13 Feb 2019 15:31:29 -0500 Subject: nav beginning --- src/TempTreeView.scss | 0 src/TempTreeView.tsx | 28 ------------- src/client/views/DocumentManager.tsx | 51 +++++++++++++++++++++++ src/client/views/Main.tsx | 74 ++++++++++++++++----------------- src/client/views/TempTreeView.scss | 12 ++++++ src/client/views/TempTreeView.tsx | 47 +++++++++++++++++++++ src/client/views/nodes/DocumentView.tsx | 18 ++++++++ 7 files changed, 164 insertions(+), 66 deletions(-) delete mode 100644 src/TempTreeView.scss delete mode 100644 src/TempTreeView.tsx create mode 100644 src/client/views/DocumentManager.tsx create mode 100644 src/client/views/TempTreeView.scss create mode 100644 src/client/views/TempTreeView.tsx (limited to 'src/client/views/nodes') diff --git a/src/TempTreeView.scss b/src/TempTreeView.scss deleted file mode 100644 index e69de29bb..000000000 diff --git a/src/TempTreeView.tsx b/src/TempTreeView.tsx deleted file mode 100644 index 0311d09bc..000000000 --- a/src/TempTreeView.tsx +++ /dev/null @@ -1,28 +0,0 @@ -import { observable, computed } from "mobx"; -import React = require("react"); -import { observer } from "mobx-react"; -import { Document } from "./fields/Document"; - -export interface IProps { - mainCollection: Array; -} - -@observer -export class TempTreeView extends React.Component{ - - render() { - return ( -
- {this.props.mainCollection.map(node => { - return ( -
- {node.Title} -
- ) - } - )}} -
- ); - } - -} \ No newline at end of file diff --git a/src/client/views/DocumentManager.tsx b/src/client/views/DocumentManager.tsx new file mode 100644 index 000000000..b69d40148 --- /dev/null +++ b/src/client/views/DocumentManager.tsx @@ -0,0 +1,51 @@ +import React = require('react') +import { observer } from 'mobx-react'; +import { observable, action } from 'mobx'; +import { DocumentView } from './nodes/DocumentView'; +import { Document } from "../../fields/Document" + + +export class DocumentManager { + + //global holds all of the nodes (regardless of which collection they're in) + @observable + public DocumentViews: DocumentView[]; + + // singleton instance + private static _instance: DocumentManager; + + // create one and only one instance of NodeManager + public static get Instance(): DocumentManager { + return this._instance || (this._instance = new this()); + } + + //private constructor so no other class can create a nodemanager + private constructor() { + this.DocumentViews = new Array(); + } + + public getDocumentView(toFind: Document): DocumentView | null { + + let toReturn: DocumentView | null; + toReturn = null; + + DocumentManager.Instance.DocumentViews.map(view => { + let doc = view.props.Document; + if (Object.is(doc, toFind)) { + toReturn = view; + return; + } + }) + + return (toReturn); + } + + public centerNode(doc: DocumentView) { + + } + + public setPosition(doc: DocumentView) { + + } + +} \ No newline at end of file diff --git a/src/client/views/Main.tsx b/src/client/views/Main.tsx index 6202be95f..240010f27 100644 --- a/src/client/views/Main.tsx +++ b/src/client/views/Main.tsx @@ -40,43 +40,41 @@ document.addEventListener("pointerdown", action(function (e: PointerEvent) { //runInAction(() => -{ - let doc1 = Documents.TextDocument({ title: "hello", width: 400, height: 300 }); - let doc2 = doc1.MakeDelegate(); - doc2.Set(KS.X, new NumberField(150)); - doc2.Set(KS.Y, new NumberField(20)); - let doc3 = Documents.ImageDocument("https://psmag.com/.image/t_share/MTMyNzc2NzM1MDY1MjgzMDM4/shutterstock_151341212jpg.jpg", { - x: 450, y: 100, title: "cat 1", width: 606, height: 386, nativeWidth: 606, nativeHeight: 386 - }); - //doc3.Set(KeyStore.Data, new ImageField); - const schemaDocs = Array.from(Array(5).keys()).map(v => Documents.ImageDocument("https://psmag.com/.image/t_share/MTMyNzc2NzM1MDY1MjgzMDM4/shutterstock_151341212jpg.jpg", { - x: 50 + 100 * v, y: 50, width: 100, height: 100, title: "cat" + v, nativeWidth: 606, nativeHeight: 386 - })); - schemaDocs[0].SetData(KS.Author, "Tyler", TextField); - schemaDocs[4].SetData(KS.Author, "Bob", TextField); - schemaDocs.push(doc2); - const doc7 = Documents.SchemaDocument(schemaDocs) - const docset = [doc1, doc2, doc3, doc7]; - let doc4 = Documents.CollectionDocument(docset, { - x: 0, y: 400, title: "mini collection" - }); - // let doc5 = Documents.ImageDocument("https://upload.wikimedia.org/wikipedia/commons/thumb/3/3a/Cat03.jpg/1200px-Cat03.jpg", { - // x: 650, y: 500, width: 600, height: 600, title: "cat 2" - // }); - let docset2 = [doc3, doc1, doc2]; - let doc6 = Documents.CollectionDocument(docset2, { - x: 350, y: 100, width: 600, height: 600, title: "docking collection" - }); - let mainNodes = mainContainer.GetOrCreate>(KeyStore.Data, ListField); - // mainNodes.Data.push(doc6); - // mainNodes.Data.push(doc2); - mainNodes.Data.push(doc4); - mainNodes.Data.push(doc3); - // mainNodes.Data.push(doc5); - // mainNodes.Data.push(doc1); - // mainNodes.Data.push(doc2); - mainNodes.Data.push(doc6); -} +let doc1 = Documents.TextDocument({ title: "hello", width: 400, height: 300 }); +let doc2 = doc1.MakeDelegate(); +doc2.Set(KS.X, new NumberField(150)); +doc2.Set(KS.Y, new NumberField(20)); +let doc3 = Documents.ImageDocument("https://psmag.com/.image/t_share/MTMyNzc2NzM1MDY1MjgzMDM4/shutterstock_151341212jpg.jpg", { + x: 450, y: 100, title: "cat 1", width: 606, height: 386, nativeWidth: 606, nativeHeight: 386 +}); +//doc3.Set(KeyStore.Data, new ImageField); +const schemaDocs = Array.from(Array(5).keys()).map(v => Documents.ImageDocument("https://psmag.com/.image/t_share/MTMyNzc2NzM1MDY1MjgzMDM4/shutterstock_151341212jpg.jpg", { + x: 50 + 100 * v, y: 50, width: 100, height: 100, title: "cat" + v, nativeWidth: 606, nativeHeight: 386 +})); +schemaDocs[0].SetData(KS.Author, "Tyler", TextField); +schemaDocs[4].SetData(KS.Author, "Bob", TextField); +schemaDocs.push(doc2); +const doc7 = Documents.SchemaDocument(schemaDocs) +const docset = [doc1, doc2, doc3, doc7]; +let doc4 = Documents.CollectionDocument(docset, { + x: 0, y: 400, title: "mini collection" +}); +// let doc5 = Documents.ImageDocument("https://upload.wikimedia.org/wikipedia/commons/thumb/3/3a/Cat03.jpg/1200px-Cat03.jpg", { +// x: 650, y: 500, width: 600, height: 600, title: "cat 2" +// }); +let docset2 = [doc3, doc1, doc2]; +let doc6 = Documents.CollectionDocument(docset2, { + x: 350, y: 100, width: 600, height: 600, title: "docking collection" +}); +let mainNodes = mainContainer.GetOrCreate>(KeyStore.Data, ListField); +// mainNodes.Data.push(doc6); +// mainNodes.Data.push(doc2); +mainNodes.Data.push(doc4); +mainNodes.Data.push(doc3); +// mainNodes.Data.push(doc5); +// mainNodes.Data.push(doc1); +// mainNodes.Data.push(doc2); +mainNodes.Data.push(doc6); //} //); @@ -88,6 +86,6 @@ ReactDOM.render(( ContainingCollectionView={undefined} DocumentView={undefined} /> - {/* */} +
), document.getElementById('root')); \ No newline at end of file diff --git a/src/client/views/TempTreeView.scss b/src/client/views/TempTreeView.scss new file mode 100644 index 000000000..c50b5be2c --- /dev/null +++ b/src/client/views/TempTreeView.scss @@ -0,0 +1,12 @@ +.temptree { + background: #ADD8E6; + width: 300px; + height: 100px; + z-index: 100; + position: fixed; + bottom: 0px; + .list { + padding: 5px; + color: #1e5162; + } +} \ No newline at end of file diff --git a/src/client/views/TempTreeView.tsx b/src/client/views/TempTreeView.tsx new file mode 100644 index 000000000..eeffe6cba --- /dev/null +++ b/src/client/views/TempTreeView.tsx @@ -0,0 +1,47 @@ +import { observable, computed } from "mobx"; +import React = require("react"); +import { observer } from "mobx-react"; +import { Document } from "../../fields/Document"; +import { ListField } from "../../fields/ListField"; +import "./TempTreeView.scss" +import { DocumentManager } from "./DocumentManager"; + +export interface IProps { + mainCollection: Array; +} + +@observer +export class TempTreeView extends React.Component{ + + onClick(doc: Document) { + let view = DocumentManager.Instance.getDocumentView(doc); + if (view != null) { + console.log(view.Id) + console.log(view.props.Document.Title) + if (view.props.ContainingCollectionView != undefined) { + console.log(view.props.ContainingCollectionView.Id) + } + else { + console.log("containing collection is undefined") + } + } + } + + render() { + return ( +
+
+ {this.props.mainCollection.map(doc => { + return ( +
{ this.onClick(doc) }}> + {doc.Title} +
+ ) + } + )} +
+
+ ); + } + +} \ No newline at end of file diff --git a/src/client/views/nodes/DocumentView.tsx b/src/client/views/nodes/DocumentView.tsx index d7ecc6d9d..3be8afda3 100644 --- a/src/client/views/nodes/DocumentView.tsx +++ b/src/client/views/nodes/DocumentView.tsx @@ -16,6 +16,7 @@ import { ImageBox } from "../nodes/ImageBox"; import "./NodeView.scss"; import React = require("react"); import { Transform } from "../../util/Transform"; +import { DocumentManager } from "../DocumentManager"; const JsxParser = require('react-jsx-parser').default;//TODO Why does this need to be imported like this? export interface DocumentViewProps { @@ -32,6 +33,9 @@ export interface DocumentViewProps { @observer export class DocumentView extends React.Component { + public Id: string = Utils.GenerateGuid(); + public tempTitle: string = "hello there" + protected _mainCont = React.createRef(); get MainContent() { return this._mainCont; @@ -69,6 +73,20 @@ export class DocumentView extends React.Component { return 1; } + //adds doc to global list + componentDidMount: () => void = () => { + DocumentManager.Instance.DocumentViews.push(this); + } + + //removes doc from global list + componentWillUnmount: () => void = () => { + for (let node of DocumentManager.Instance.DocumentViews) { + if (Object.is(node, this)) { + DocumentManager.Instance.DocumentViews.splice(DocumentManager.Instance.DocumentViews.indexOf(this), 1); + } + } + } + render() { let bindings = { ...this.props } as any; -- cgit v1.2.3-70-g09d2 From 1e8240e9ca1c2e2ff0e02ffb8b43be8dcbba9d14 Mon Sep 17 00:00:00 2001 From: Monika Hedman Date: Wed, 13 Feb 2019 20:57:12 -0500 Subject: nav working --- src/client/util/Transform.ts | 7 ++ src/client/views/DocumentManager.tsx | 81 +++++++++++++++++++++- src/client/views/TempTreeView.tsx | 5 ++ .../views/collections/CollectionFreeFormView.tsx | 1 + src/client/views/nodes/DocumentView.tsx | 19 ++++- src/client/views/nodes/NodeView.scss | 2 + src/temp.txt | 6 ++ 7 files changed, 118 insertions(+), 3 deletions(-) (limited to 'src/client/views/nodes') diff --git a/src/client/util/Transform.ts b/src/client/util/Transform.ts index 8ae3f837f..aa922f358 100644 --- a/src/client/util/Transform.ts +++ b/src/client/util/Transform.ts @@ -55,6 +55,13 @@ export class Transform { return this; } + //MONIKA + center = (x: number, y: number): Transform => { + this._translateX = x + this._translateY = y + return this; + } + preTransform = (transform: Transform): Transform => { this._translateX = transform._translateX + this._translateX * transform._scale; this._translateY = transform._translateY + this._translateY * transform._scale; diff --git a/src/client/views/DocumentManager.tsx b/src/client/views/DocumentManager.tsx index b69d40148..2ab643657 100644 --- a/src/client/views/DocumentManager.tsx +++ b/src/client/views/DocumentManager.tsx @@ -3,6 +3,9 @@ import { observer } from 'mobx-react'; import { observable, action } from 'mobx'; import { DocumentView } from './nodes/DocumentView'; import { Document } from "../../fields/Document" +import { CollectionFreeFormView } from './collections/CollectionFreeFormView'; +import { KeyStore } from '../../fields/Key'; +import { CollectionViewBase } from './collections/CollectionViewBase'; export class DocumentManager { @@ -29,19 +32,95 @@ export class DocumentManager { let toReturn: DocumentView | null; toReturn = null; + //gets document view that is in a freeform canvas collection DocumentManager.Instance.DocumentViews.map(view => { let doc = view.props.Document; + // if (view.props.ContainingCollectionView instanceof CollectionFreeFormView) { + // if (Object.is(doc, toFind)) { + // toReturn = view; + // return; + // } + // } + if (Object.is(doc, toFind)) { toReturn = view; return; } + + }) + + return (toReturn); + } + + public getDocumentViewFreeform(toFind: Document): DocumentView | null { + + let toReturn: DocumentView | null; + toReturn = null; + + //gets document view that is in a freeform canvas collection + DocumentManager.Instance.DocumentViews.map(view => { + let doc = view.props.Document; + if (view.props.ContainingCollectionView instanceof CollectionFreeFormView) { + if (Object.is(doc, toFind)) { + toReturn = view; + return; + } + } }) return (toReturn); } - public centerNode(doc: DocumentView) { + public centerNode(doc: Document): any { + + //gets document view that is in freeform collection + let docView: DocumentView | null = this.getDocumentViewFreeform(doc) + + let scale: number; + let XView: number; + let YView: number; + let width: number; + let height: number; + + //if the view exists in a freeform collection + if (docView != null) { + //view.props.GetTransform().TranslateX + width = docView.props.Document.GetNumber(KeyStore.NativeWidth, 0) + height = docView.props.Document.GetNumber(KeyStore.NativeHeight, 0) + + //base case: parent does not exist (aka is parent) + if (docView.props.ContainingCollectionView == null) { + // scale = RootStore.Instance.MainNodeCollection.Scale; + // XView = (-node.X * scale) + (window.innerWidth / 2) - (node.Width * scale / 2); + // YView = (-node.Y * scale) + (window.innerHeight / 2) - (node.Height * scale / 2); + // RootStore.Instance.MainNodeCollection.SetViewportXY(XView, YView); + scale = docView.props.GetTransform().Scale + XView = (-docView.props.GetTransform().TranslateX * scale) + (window.innerWidth / 2) - (width * scale / 2) + YView = (-docView.props.GetTransform().TranslateY * scale) + (window.innerHeight / 2) - (height * scale / 2) + } + //parent is not main, parent is centered and calls itself + else { + if (docView.props.ContainingCollectionView.props.ContainingDocumentView != null) { + + let parentWidth = docView.props.ContainingCollectionView.props.ContainingDocumentView.props.Document.GetNumber(KeyStore.NativeWidth, 0) + let parentHeight = docView.props.ContainingCollectionView.props.ContainingDocumentView.props.Document.GetNumber(KeyStore.NativeHeight, 0) + + scale = docView.props.ContainingCollectionView.props.ContainingDocumentView.props.GetTransform().Scale + XView = (-docView.props.GetTransform().TranslateX * scale) + (parentWidth / 2) - (width * scale / 2); + YView = (-docView.props.GetTransform().TranslateY * scale) + (parentHeight / 2) - (height * scale / 2); + //node.Parent.setViewportXY(XView, YView); + this.setViewportXY(docView.props.ContainingCollectionView, XView, YView) + + return this.centerNode(docView.props.ContainingCollectionView.props.ContainingDocumentView.props.Document); + } + } + } + } + private setViewportXY(collection: CollectionViewBase, x: number, y: number) { + if (collection.props.ContainingDocumentView != null) { + collection.props.ContainingDocumentView.props.GetTransform().center(x, y) + } } public setPosition(doc: DocumentView) { diff --git a/src/client/views/TempTreeView.tsx b/src/client/views/TempTreeView.tsx index 8dd256c8a..5bb44fde2 100644 --- a/src/client/views/TempTreeView.tsx +++ b/src/client/views/TempTreeView.tsx @@ -17,13 +17,18 @@ export class TempTreeView extends React.Component{ let view = DocumentManager.Instance.getDocumentView(doc); if (view != null) { console.log(view.Id) + console.log(view.props.GetTransform().TranslateX) + console.log(view.props.Document.Title) if (view.props.ContainingCollectionView != undefined) { //console.log(view.props.ContainingCollectionView.Id) + // view.props.ContainingCollectionView } else { console.log("containing collection is undefined") } + + view.switchColor(); } } diff --git a/src/client/views/collections/CollectionFreeFormView.tsx b/src/client/views/collections/CollectionFreeFormView.tsx index 7947b1c51..d60b98edd 100644 --- a/src/client/views/collections/CollectionFreeFormView.tsx +++ b/src/client/views/collections/CollectionFreeFormView.tsx @@ -25,6 +25,7 @@ export class CollectionFreeFormView extends CollectionViewBase { private _lastY: number = 0; private _downX: number = 0; private _downY: number = 0; + private _borderColor: string = "red" constructor(props: CollectionViewProps) { super(props); diff --git a/src/client/views/nodes/DocumentView.tsx b/src/client/views/nodes/DocumentView.tsx index bc27c424c..f653919cf 100644 --- a/src/client/views/nodes/DocumentView.tsx +++ b/src/client/views/nodes/DocumentView.tsx @@ -1,5 +1,6 @@ import { action, computed } from "mobx"; import { observer } from "mobx-react"; +import { observable } from "mobx"; import { Document } from "../../../fields/Document"; import { Opt, FieldWaiting } from "../../../fields/Field"; import { Key, KeyStore } from "../../../fields/Key"; @@ -38,7 +39,14 @@ export interface DocumentViewProps { export class DocumentView extends React.Component { public Id: string = Utils.GenerateGuid(); - public tempTitle: string = "hello there" + + @observable + public Border: string = "white" + + @action + public switchColor() { + this.Border = "red" + } private _mainCont = React.createRef(); get MainContent() { @@ -172,6 +180,12 @@ export class DocumentView extends React.Component { ContextMenu.Instance.displayMenu(e.pageX - 15, e.pageY - 15) } + @action + Center = (e: React.MouseEvent): void => { + //DocumentManager.Instance.centerNode() + console.log("centering...") + } + @action onContextMenu = (e: React.MouseEvent): void => { if (!SelectionManager.IsSelected(this)) { @@ -193,6 +207,7 @@ export class DocumentView extends React.Component { e.stopPropagation(); ContextMenu.Instance.clearItems(); + ContextMenu.Instance.addItem({ description: "Center", event: this.Center }) ContextMenu.Instance.addItem({ description: "Full Screen", event: this.fullScreenClicked }) ContextMenu.Instance.addItem({ description: "Open Right", event: this.openRight }) ContextMenu.Instance.addItem({ description: "Delete", event: this.deleteClicked }) @@ -268,7 +283,7 @@ export class DocumentView extends React.Component { var height = this.props.Document.GetNumber(KeyStore.NativeHeight, 0); var strheight = height > 0 ? height.toString() + "px" : "100%"; return ( -
Date: Wed, 13 Feb 2019 21:21:03 -0500 Subject: translate - need docview of collection? --- src/client/views/DocumentManager.tsx | 32 +++++++++++++++++++++----------- src/client/views/Main.tsx | 2 ++ src/client/views/nodes/DocumentView.tsx | 5 +++-- 3 files changed, 26 insertions(+), 13 deletions(-) (limited to 'src/client/views/nodes') diff --git a/src/client/views/DocumentManager.tsx b/src/client/views/DocumentManager.tsx index 2ab643657..904ac0cce 100644 --- a/src/client/views/DocumentManager.tsx +++ b/src/client/views/DocumentManager.tsx @@ -71,10 +71,18 @@ export class DocumentManager { return (toReturn); } - public centerNode(doc: Document): any { - + public centerNode(doc: Document | DocumentView): any { + //console.log(doc.Title) //gets document view that is in freeform collection - let docView: DocumentView | null = this.getDocumentViewFreeform(doc) + + let docView: DocumentView | null; + + if (doc instanceof Document) { + docView = this.getDocumentViewFreeform(doc) + } + else { + docView = doc + } let scale: number; let XView: number; @@ -88,6 +96,7 @@ export class DocumentManager { width = docView.props.Document.GetNumber(KeyStore.NativeWidth, 0) height = docView.props.Document.GetNumber(KeyStore.NativeHeight, 0) + //base case: parent does not exist (aka is parent) if (docView.props.ContainingCollectionView == null) { // scale = RootStore.Instance.MainNodeCollection.Scale; @@ -100,26 +109,27 @@ export class DocumentManager { } //parent is not main, parent is centered and calls itself else { - if (docView.props.ContainingCollectionView.props.ContainingDocumentView != null) { - - let parentWidth = docView.props.ContainingCollectionView.props.ContainingDocumentView.props.Document.GetNumber(KeyStore.NativeWidth, 0) - let parentHeight = docView.props.ContainingCollectionView.props.ContainingDocumentView.props.Document.GetNumber(KeyStore.NativeHeight, 0) + console.log("parent does exist") + if (docView.props.ContainingCollectionView.props.BackgroundView != null) { + console.log("view of parent exists") + let parentWidth = docView.props.ContainingCollectionView.props.BackgroundView.props.Document.GetNumber(KeyStore.NativeWidth, 0) + let parentHeight = docView.props.ContainingCollectionView.props.BackgroundView.props.Document.GetNumber(KeyStore.NativeHeight, 0) - scale = docView.props.ContainingCollectionView.props.ContainingDocumentView.props.GetTransform().Scale + scale = docView.props.ContainingCollectionView.props.BackgroundView.props.GetTransform().Scale XView = (-docView.props.GetTransform().TranslateX * scale) + (parentWidth / 2) - (width * scale / 2); YView = (-docView.props.GetTransform().TranslateY * scale) + (parentHeight / 2) - (height * scale / 2); //node.Parent.setViewportXY(XView, YView); this.setViewportXY(docView.props.ContainingCollectionView, XView, YView) - return this.centerNode(docView.props.ContainingCollectionView.props.ContainingDocumentView.props.Document); + return this.centerNode(docView.props.ContainingCollectionView.props.BackgroundView.props.Document); } } } } private setViewportXY(collection: CollectionViewBase, x: number, y: number) { - if (collection.props.ContainingDocumentView != null) { - collection.props.ContainingDocumentView.props.GetTransform().center(x, y) + if (collection.props.BackgroundView != null) { + collection.props.BackgroundView.props.GetTransform().center(x, y) } } diff --git a/src/client/views/Main.tsx b/src/client/views/Main.tsx index 17abceedf..5d23f5439 100644 --- a/src/client/views/Main.tsx +++ b/src/client/views/Main.tsx @@ -15,6 +15,7 @@ import { DocumentView } from './../views/nodes/DocumentView'; import { CompileScript } from './../util/Scripting'; import { TempTreeView } from './../views/TempTreeView'; import { Transform } from '../util/Transform'; +import { DocumentManager } from './DocumentManager'; configure({ @@ -78,6 +79,7 @@ mainNodes.Data.push(doc6); //} //); + ReactDOM.render((
{ @action Center = (e: React.MouseEvent): void => { - //DocumentManager.Instance.centerNode() - console.log("centering...") + DocumentManager.Instance.centerNode(this.props.Document) + DocumentManager.Instance.centerNode(this) + //console.log(this.props.ContainingCollectionView.props.) } @action -- cgit v1.2.3-70-g09d2 From 281f6268238c4f9f1640899ce258535ad4fe2401 Mon Sep 17 00:00:00 2001 From: madelinegr Date: Mon, 18 Feb 2019 18:01:47 -0500 Subject: tried to get around cors with crossorigin.me --- src/client/views/Main.tsx | 2 +- src/client/views/nodes/WebBox.tsx | 2 +- src/fields/WebField.ts | 2 +- 3 files changed, 3 insertions(+), 3 deletions(-) (limited to 'src/client/views/nodes') diff --git a/src/client/views/Main.tsx b/src/client/views/Main.tsx index 3e5118379..f310be950 100644 --- a/src/client/views/Main.tsx +++ b/src/client/views/Main.tsx @@ -79,7 +79,7 @@ document.addEventListener("pointerdown", action(function (e: PointerEvent) { // mainNodes.Data.push(doc2); mainNodes.Data.push(doc6); - let doc9 = Documents.WebDocument("https://cs.brown.edu/", { + let doc9 = Documents.WebDocument("https://crossorigin.me/https://google.com", { x: 450, y: 100, title: "cat 1", width: 606, height: 386, nativeWidth: 606, nativeHeight: 386 }); mainNodes.Data.push(doc9); diff --git a/src/client/views/nodes/WebBox.tsx b/src/client/views/nodes/WebBox.tsx index f50f8c60e..b9d0853b9 100644 --- a/src/client/views/nodes/WebBox.tsx +++ b/src/client/views/nodes/WebBox.tsx @@ -62,7 +62,7 @@ export class WebBox extends React.Component { render() { let field = this.props.doc.Get(this.props.fieldKey); let path = field == FieldWaiting ? "https://image.flaticon.com/icons/svg/66/66163.svg" : - field instanceof WebField ? field.Data.href : "https://cs.brown.edu/"; + field instanceof WebField ? field.Data.href : "https://crossorigin.me/" + "https://cs.brown.edu"; let nativeWidth = this.props.doc.GetNumber(KeyStore.NativeWidth, 1); return ( diff --git a/src/fields/WebField.ts b/src/fields/WebField.ts index 88e6130e0..cd3519128 100644 --- a/src/fields/WebField.ts +++ b/src/fields/WebField.ts @@ -3,7 +3,7 @@ import { Field } from "./Field"; export class WebField extends BasicField { constructor(data: URL | undefined = undefined) { - super(data == undefined ? new URL("https://cs.brown.edu/") : data); + super(data == undefined ? new URL("https://crossorigin.me/" + "https://cs.brown.edu/") : data); } toString(): string { -- cgit v1.2.3-70-g09d2 From 31e1f193f4c57475628e7f6e5662721efc0a54c4 Mon Sep 17 00:00:00 2001 From: madelinegr Date: Mon, 18 Feb 2019 18:27:38 -0500 Subject: merge and install --- package-lock.json | 4772 +++++++++++++++---------------- src/client/views/nodes/DocumentView.tsx | 4 - 2 files changed, 2386 insertions(+), 2390 deletions(-) (limited to 'src/client/views/nodes') diff --git a/package-lock.json b/package-lock.json index 12997997b..013630762 100644 --- a/package-lock.json +++ b/package-lock.json @@ -9,7 +9,7 @@ "resolved": "https://registry.npmjs.org/@babel/runtime/-/runtime-7.3.1.tgz", "integrity": "sha512-7jGW8ppV0ant637pIqAcFfQDDH1orEPGJb8aXfUozuCU3QqX7rX4DA8iwrbPrR1hcH0FTTHz47yQnk+bl5xHQA==", "requires": { - "regenerator-runtime": "0.12.1" + "regenerator-runtime": "^0.12.0" } }, "@fortawesome/fontawesome-common-types": { @@ -22,7 +22,7 @@ "resolved": "https://registry.npmjs.org/@fortawesome/fontawesome-svg-core/-/fontawesome-svg-core-1.2.14.tgz", "integrity": "sha512-T1qCqkwm9PuvK53J64D1ovfrOTa1kG+SrHNj5cFst/rrskhCnbxpRdbqFIdc/thmXC0ebBX8nOUyja2/mrxe4g==", "requires": { - "@fortawesome/fontawesome-common-types": "0.2.14" + "@fortawesome/fontawesome-common-types": "^0.2.14" } }, "@types/anymatch": { @@ -35,8 +35,8 @@ "resolved": "https://registry.npmjs.org/@types/body-parser/-/body-parser-1.17.0.tgz", "integrity": "sha512-a2+YeUjPkztKJu5aIF2yArYFQQp8d51wZ7DavSHjFuY1mqVgidGyzEQ41JIVNy82fXj8yPgy2vJmfIywgESW6w==", "requires": { - "@types/connect": "3.4.32", - "@types/node": "10.12.24" + "@types/connect": "*", + "@types/node": "*" } }, "@types/chai": { @@ -50,7 +50,7 @@ "resolved": "https://registry.npmjs.org/@types/connect/-/connect-3.4.32.tgz", "integrity": "sha512-4r8qa0quOvh7lGD0pre62CAb1oni1OO6ecJLGCezTmhQ8Fz50Arx9RUszryR8KlgK6avuSXvviL6yWyViQABOg==", "requires": { - "@types/node": "10.12.24" + "@types/node": "*" } }, "@types/express": { @@ -58,9 +58,9 @@ "resolved": "https://registry.npmjs.org/@types/express/-/express-4.16.1.tgz", "integrity": "sha512-V0clmJow23WeyblmACoxbHBu2JKlE5TiIme6Lem14FnPW9gsttyHtk6wq7njcdIWH1njAaFgR8gW09lgY98gQg==", "requires": { - "@types/body-parser": "1.17.0", - "@types/express-serve-static-core": "4.16.1", - "@types/serve-static": "1.13.2" + "@types/body-parser": "*", + "@types/express-serve-static-core": "*", + "@types/serve-static": "*" } }, "@types/express-serve-static-core": { @@ -68,8 +68,8 @@ "resolved": "https://registry.npmjs.org/@types/express-serve-static-core/-/express-serve-static-core-4.16.1.tgz", "integrity": "sha512-QgbIMRU1EVRry5cIu1ORCQP4flSYqLM1lS5LYyGWfKnFT3E58f0gKto7BR13clBFVrVZ0G0rbLZ1hUpSkgQQOA==", "requires": { - "@types/node": "10.12.24", - "@types/range-parser": "1.2.3" + "@types/node": "*", + "@types/range-parser": "*" } }, "@types/jquery": { @@ -77,7 +77,7 @@ "resolved": "https://registry.npmjs.org/@types/jquery/-/jquery-3.3.29.tgz", "integrity": "sha512-FhJvBninYD36v3k6c+bVk1DSZwh7B5Dpb/Pyk3HKVsiohn0nhbefZZ+3JXbWQhFyt0MxSl2jRDdGQPHeOHFXrQ==", "requires": { - "@types/sizzle": "2.3.2" + "@types/sizzle": "*" } }, "@types/loglevel": { @@ -92,7 +92,7 @@ "integrity": "sha512-j5AcZo7dbMxHoOimcHEIh0JZe5e1b8q8AqGSpZJrYc7xOgCIP79cIjTdx5jSDLtySnQDwkDTqwlC7Xw7uXw7qg==", "dev": true, "requires": { - "@types/node": "10.12.24" + "@types/node": "*" } }, "@types/mime": { @@ -126,9 +126,9 @@ "resolved": "https://registry.npmjs.org/@types/prosemirror-commands/-/prosemirror-commands-1.0.1.tgz", "integrity": "sha512-GeE12m8VT9N1JrzoY//946IX8ZyQOLNmvryJ+BNQs/HvhmXW9EWOcWUE6OBRtxK7Y8SrzSOwx4XmqSgVmK3tGQ==", "requires": { - "@types/prosemirror-model": "1.7.0", - "@types/prosemirror-state": "1.2.1", - "@types/prosemirror-view": "1.3.0" + "@types/prosemirror-model": "*", + "@types/prosemirror-state": "*", + "@types/prosemirror-view": "*" } }, "@types/prosemirror-history": { @@ -136,8 +136,8 @@ "resolved": "https://registry.npmjs.org/@types/prosemirror-history/-/prosemirror-history-1.0.1.tgz", "integrity": "sha512-BYyPJlWDo3VEnWS5X2DCHXrrAKEjdbCe1DUjGL6R/8hmwMFe3iMJGYdBkOXU1FfkTpw7Z+PlwY/pMyeelVydmg==", "requires": { - "@types/prosemirror-model": "1.7.0", - "@types/prosemirror-state": "1.2.1" + "@types/prosemirror-model": "*", + "@types/prosemirror-state": "*" } }, "@types/prosemirror-keymap": { @@ -145,8 +145,8 @@ "resolved": "https://registry.npmjs.org/@types/prosemirror-keymap/-/prosemirror-keymap-1.0.1.tgz", "integrity": "sha512-8IjM8ySmoZps9Tn+aKfB4ZR6zoNOjeQfAc9YLQujYXHJB6tdGWV0cbTuoT4QmZOR1iecN1EJ6E9RiRUBk796kQ==", "requires": { - "@types/prosemirror-state": "1.2.1", - "@types/prosemirror-view": "1.3.0" + "@types/prosemirror-state": "*", + "@types/prosemirror-view": "*" } }, "@types/prosemirror-model": { @@ -154,7 +154,7 @@ "resolved": "https://registry.npmjs.org/@types/prosemirror-model/-/prosemirror-model-1.7.0.tgz", "integrity": "sha512-kLD9uDGIER7Mg18OzPAYwlRgBGTKJ2og1v4Ojsi+I8qOGrxVK/XGFypg0AS8zyGHCzLRb9h5ZMhC+1Ltly0TcQ==", "requires": { - "@types/orderedmap": "1.0.0" + "@types/orderedmap": "*" } }, "@types/prosemirror-schema-basic": { @@ -162,7 +162,7 @@ "resolved": "https://registry.npmjs.org/@types/prosemirror-schema-basic/-/prosemirror-schema-basic-1.0.1.tgz", "integrity": "sha512-IOQAYf1urifbH+Zwbq5XfFOUMNCbEnvIqpuSAE8SUt00nDAoH62T/S8Qhu8LuF++KQbyXb7fdMp352zkPW9Hmw==", "requires": { - "@types/prosemirror-model": "1.7.0" + "@types/prosemirror-model": "*" } }, "@types/prosemirror-state": { @@ -170,9 +170,9 @@ "resolved": "https://registry.npmjs.org/@types/prosemirror-state/-/prosemirror-state-1.2.1.tgz", "integrity": "sha512-tE/p/YSzxCKyNDl2C8pElQiWQH9jLt8zvOnn3ZG5iKNW1XtWnKqXnaM5BU5yVSOQ9f8W9y0T+JB3lYEry9y/8w==", "requires": { - "@types/prosemirror-model": "1.7.0", - "@types/prosemirror-transform": "1.1.0", - "@types/prosemirror-view": "1.3.0" + "@types/prosemirror-model": "*", + "@types/prosemirror-transform": "*", + "@types/prosemirror-view": "*" } }, "@types/prosemirror-transform": { @@ -180,7 +180,7 @@ "resolved": "https://registry.npmjs.org/@types/prosemirror-transform/-/prosemirror-transform-1.1.0.tgz", "integrity": "sha512-VsPiEj+88Xvw8f0vXHL65z2qHlnrvnybW9GC7w9I9PORcKheDi7hQBgP8JdDwUPG7ttyUYUaSAec0TV6DsdWKg==", "requires": { - "@types/prosemirror-model": "1.7.0" + "@types/prosemirror-model": "*" } }, "@types/prosemirror-view": { @@ -188,9 +188,9 @@ "resolved": "https://registry.npmjs.org/@types/prosemirror-view/-/prosemirror-view-1.3.0.tgz", "integrity": "sha512-wf64TepBlTX8/iu/7fY6oDfpAArVAXYjJ0sWpuq64lAxSnZyx5bKHM1NChF6ATOdfOpPcsm8oaFZnwhWNF9g8A==", "requires": { - "@types/prosemirror-model": "1.7.0", - "@types/prosemirror-state": "1.2.1", - "@types/prosemirror-transform": "1.1.0" + "@types/prosemirror-model": "*", + "@types/prosemirror-state": "*", + "@types/prosemirror-transform": "*" } }, "@types/range-parser": { @@ -203,8 +203,8 @@ "resolved": "https://registry.npmjs.org/@types/react/-/react-16.8.1.tgz", "integrity": "sha512-tD1ETKJcuhANOejRc/p7OgQ16DKnbGi0M3LccelKlPnUCDp2a5koVxZFoRN9HN+A+m84HB5VGN7I+r3nNhS3PA==", "requires": { - "@types/prop-types": "15.5.8", - "csstype": "2.6.2" + "@types/prop-types": "*", + "csstype": "^2.2.0" } }, "@types/react-dom": { @@ -213,7 +213,7 @@ "integrity": "sha512-x6zUx9/42B5Kl2Vl9HlopV8JF64wLpX3c+Pst9kc1HgzrsH+mkehe/zmHMQTplIrR48H2gpU7ZqurQolYu8XBA==", "dev": true, "requires": { - "@types/react": "16.8.1" + "@types/react": "*" } }, "@types/react-measure": { @@ -221,7 +221,7 @@ "resolved": "https://registry.npmjs.org/@types/react-measure/-/react-measure-2.0.4.tgz", "integrity": "sha512-0puxiERCQ5Az4LyO+2r9bh6ECXTuy2PpsO+LY8ICezEi3YgIVaJwqRsplpNU18dZMqkpsdJlTB2cvSvkY0eR5Q==", "requires": { - "@types/react": "16.8.1" + "@types/react": "*" } }, "@types/react-table": { @@ -229,7 +229,7 @@ "resolved": "https://registry.npmjs.org/@types/react-table/-/react-table-6.7.21.tgz", "integrity": "sha512-XiYCcn/CBajrj18vLA3kO79AHr5yZTCJe2kl87ZNTRxLO14y9D0IGeGZ3xLsqhfYrJSkkVzAJV8v+bQ4nuKCRQ==", "requires": { - "@types/react": "16.8.1" + "@types/react": "*" } }, "@types/serve-static": { @@ -237,8 +237,8 @@ "resolved": "https://registry.npmjs.org/@types/serve-static/-/serve-static-1.13.2.tgz", "integrity": "sha512-/BZ4QRLpH/bNYgZgwhKEh+5AsboDBcUdlBYgzoLX0fpj3Y2gp6EApyOlM3bK53wQS/OE1SrdSYBAbux2D1528Q==", "requires": { - "@types/express-serve-static-core": "4.16.1", - "@types/mime": "2.0.1" + "@types/express-serve-static-core": "*", + "@types/mime": "*" } }, "@types/sizzle": { @@ -256,7 +256,7 @@ "resolved": "https://registry.npmjs.org/@types/typescript/-/typescript-2.0.0.tgz", "integrity": "sha1-xDNTnJi64oaCswfqp6D9IRW4PCg=", "requires": { - "typescript": "3.3.1" + "typescript": "*" } }, "@types/uglify-js": { @@ -264,7 +264,7 @@ "resolved": "https://registry.npmjs.org/@types/uglify-js/-/uglify-js-3.0.4.tgz", "integrity": "sha512-SudIN9TRJ+v8g5pTG8RRCqfqTMNqgWCKKd3vtynhGzkIIjxaicNAMuY5TRadJ6tzDu3Dotf3ngaMILtmOdmWEQ==", "requires": { - "source-map": "0.6.1" + "source-map": "^0.6.1" }, "dependencies": { "source-map": { @@ -279,7 +279,7 @@ "resolved": "https://registry.npmjs.org/@types/uuid/-/uuid-3.4.4.tgz", "integrity": "sha512-tPIgT0GUmdJQNSHxp0X2jnpQfBSTfGxUMc/2CXBU2mnyTFVYVa2ojpoQ74w0U2yn2vw3jnC640+77lkFFpdVDw==", "requires": { - "@types/node": "10.12.24" + "@types/node": "*" } }, "@types/webpack": { @@ -287,11 +287,11 @@ "resolved": "https://registry.npmjs.org/@types/webpack/-/webpack-4.4.24.tgz", "integrity": "sha512-yg99CjvB7xZ/iuHrsZ7dkGKoq/FRDzqLzAxKh2EmTem6FWjzrty4FqCqBYuX5z+MFwSaaQGDAX4Q9HQkLjGLnQ==", "requires": { - "@types/anymatch": "1.3.0", - "@types/node": "10.12.24", - "@types/tapable": "1.0.4", - "@types/uglify-js": "3.0.4", - "source-map": "0.6.1" + "@types/anymatch": "*", + "@types/node": "*", + "@types/tapable": "*", + "@types/uglify-js": "*", + "source-map": "^0.6.0" }, "dependencies": { "source-map": { @@ -307,10 +307,10 @@ "integrity": "sha512-uZ1avIbAcnspcDKKm0WfgIdvBYRqUapPmwb0MYGzzB74q2F3T4Xi+qPSoS0Oq5iQvIMVxOm7KMqHQJii4VDCsw==", "dev": true, "requires": { - "@types/connect": "3.4.32", - "@types/loglevel": "1.5.4", - "@types/memory-fs": "0.3.2", - "@types/webpack": "4.4.24" + "@types/connect": "*", + "@types/loglevel": "*", + "@types/memory-fs": "*", + "@types/webpack": "*" } }, "@types/webpack-hot-middleware": { @@ -319,8 +319,8 @@ "integrity": "sha512-z9np8JOIx7P66GMPJn+FkFcClo1RZZvmwVp9GAfupcEF1i+6+QmVaozTPZwpHexukgVy0F7RRQkybAeV2y+RjA==", "dev": true, "requires": { - "@types/connect": "3.4.32", - "@types/webpack": "4.4.24" + "@types/connect": "*", + "@types/webpack": "*" } }, "@webassemblyjs/ast": { @@ -397,7 +397,7 @@ "integrity": "sha512-Mmqx/cS68K1tSrvRLtaV/Lp3NZWzXtOHUW2IvDvl2sihAwJh4ACE0eL6A8FvMyDG9abes3saB6dMimLOs+HMoQ==", "dev": true, "requires": { - "@xtuc/ieee754": "1.2.0" + "@xtuc/ieee754": "^1.2.0" } }, "@webassemblyjs/leb128": { @@ -517,7 +517,7 @@ "resolved": "https://registry.npmjs.org/accepts/-/accepts-1.3.5.tgz", "integrity": "sha1-63d99gEXI6OxTopywIBcjoZ0a9I=", "requires": { - "mime-types": "2.1.21", + "mime-types": "~2.1.18", "negotiator": "0.6.1" } }, @@ -537,7 +537,7 @@ "resolved": "https://registry.npmjs.org/acorn-jsx/-/acorn-jsx-4.1.1.tgz", "integrity": "sha512-JY+iV6r+cO21KtntVvFkD+iqjtdpRUpGqKWgfkCdZq1R+kbreEl8EcdcJR4SmiIgsIQT33s6QzheQ9a275Q8xw==", "requires": { - "acorn": "5.7.3" + "acorn": "^5.0.3" } }, "ajv": { @@ -545,10 +545,10 @@ "resolved": "https://registry.npmjs.org/ajv/-/ajv-6.8.1.tgz", "integrity": "sha512-eqxCp82P+JfqL683wwsL73XmFs1eG6qjw+RD3YHx+Jll1r0jNd4dh8QG9NYAeNGA/hnZjeEDgtTskgJULbxpWQ==", "requires": { - "fast-deep-equal": "2.0.1", - "fast-json-stable-stringify": "2.0.0", - "json-schema-traverse": "0.4.1", - "uri-js": "4.2.2" + "fast-deep-equal": "^2.0.1", + "fast-json-stable-stringify": "^2.0.0", + "json-schema-traverse": "^0.4.1", + "uri-js": "^4.2.2" } }, "ajv-errors": { @@ -571,7 +571,7 @@ "resolved": "https://registry.npmjs.org/ansi-align/-/ansi-align-2.0.0.tgz", "integrity": "sha1-w2rsy6VjuJzrVW82kPCx2eNUf38=", "requires": { - "string-width": "2.1.1" + "string-width": "^2.0.0" }, "dependencies": { "ansi-regex": { @@ -589,8 +589,8 @@ "resolved": "https://registry.npmjs.org/string-width/-/string-width-2.1.1.tgz", "integrity": "sha512-nOqH59deCq9SRHlxq1Aw85Jnt4w6KvLKqWVik6oA9ZklXLNIOlqg4F2yrT1MVaTjAqvVwdfeZ7w7aCvJD7ugkw==", "requires": { - "is-fullwidth-code-point": "2.0.0", - "strip-ansi": "4.0.0" + "is-fullwidth-code-point": "^2.0.0", + "strip-ansi": "^4.0.0" } }, "strip-ansi": { @@ -598,7 +598,7 @@ "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-4.0.0.tgz", "integrity": "sha1-qEeQIusaw2iocTibY1JixQXuNo8=", "requires": { - "ansi-regex": "3.0.0" + "ansi-regex": "^3.0.0" } } } @@ -630,8 +630,8 @@ "resolved": "https://registry.npmjs.org/anymatch/-/anymatch-2.0.0.tgz", "integrity": "sha512-5teOsQWABXHHBFP9y3skS5P3d/WfWXpv3FUpy+LorMrNYaT9pI4oLMQX7jzQ2KklNpGpWHzdCXTDT2Y3XGlZBw==", "requires": { - "micromatch": "3.1.10", - "normalize-path": "2.1.1" + "micromatch": "^3.1.4", + "normalize-path": "^2.1.1" } }, "aproba": { @@ -644,8 +644,8 @@ "resolved": "https://registry.npmjs.org/are-we-there-yet/-/are-we-there-yet-1.1.5.tgz", "integrity": "sha512-5hYdAkZlcG8tOLujVDTgCT+uPX0VnpAH28gWsLfzpXYm7wP6mp5Q/gYyR7YQ0cKVJcXJnl3j2kpBan13PtQf6w==", "requires": { - "delegates": "1.0.0", - "readable-stream": "2.3.6" + "delegates": "^1.0.0", + "readable-stream": "^2.0.6" } }, "arr-diff": { @@ -680,7 +680,7 @@ "integrity": "sha1-mjRBDk9OPaI96jdb5b5w8kd47Dk=", "dev": true, "requires": { - "array-uniq": "1.0.3" + "array-uniq": "^1.0.1" } }, "array-uniq": { @@ -710,7 +710,7 @@ "resolved": "https://registry.npmjs.org/asn1/-/asn1-0.2.4.tgz", "integrity": "sha512-jxwzQpLQjSmWXgwaCZE9Nz+glAG01yF1QnWgbhGwHI5A6FRIEY6IVqtHhIepHqI7/kyEyQEagBC5mBEFlIYvdg==", "requires": { - "safer-buffer": "2.1.2" + "safer-buffer": "~2.1.0" } }, "asn1.js": { @@ -719,9 +719,9 @@ "integrity": "sha512-p32cOF5q0Zqs9uBiONKYLm6BClCoBCM5O9JfeUSlnQLBTxYdTK+pW+nXflm8UkKd2UYlEbYz5qEi0JuZR9ckSw==", "dev": true, "requires": { - "bn.js": "4.11.8", - "inherits": "2.0.3", - "minimalistic-assert": "1.0.1" + "bn.js": "^4.0.0", + "inherits": "^2.0.1", + "minimalistic-assert": "^1.0.0" } }, "assert": { @@ -741,7 +741,7 @@ }, "util": { "version": "0.10.3", - "resolved": "http://registry.npmjs.org/util/-/util-0.10.3.tgz", + "resolved": "https://registry.npmjs.org/util/-/util-0.10.3.tgz", "integrity": "sha1-evsa/lCAUkZInj23/g7TeTNqwPk=", "dev": true, "requires": { @@ -773,7 +773,7 @@ }, "async": { "version": "1.5.2", - "resolved": "http://registry.npmjs.org/async/-/async-1.5.2.tgz", + "resolved": "https://registry.npmjs.org/async/-/async-1.5.2.tgz", "integrity": "sha1-7GphrlZIDAw8skHJVhjiCJL5Zyo=", "dev": true }, @@ -803,14 +803,14 @@ "integrity": "sha512-slv66OAJB8orL+UUaTI3pKlLorwIvS4ARZzYR9iJJyGsEgOqueMfOMdKySWzZ73vIkEe3fcwFgsKMg4d8zyb1g==", "dev": true, "requires": { - "chalk": "2.4.2", - "enhanced-resolve": "4.1.0", - "loader-utils": "1.2.3", - "lodash": "4.17.11", - "micromatch": "3.1.10", - "mkdirp": "0.5.1", - "source-map-support": "0.5.10", - "webpack-log": "1.2.0" + "chalk": "^2.4.1", + "enhanced-resolve": "^4.0.0", + "loader-utils": "^1.1.0", + "lodash": "^4.17.5", + "micromatch": "^3.1.9", + "mkdirp": "^0.5.1", + "source-map-support": "^0.5.3", + "webpack-log": "^1.2.0" }, "dependencies": { "ansi-styles": { @@ -819,7 +819,7 @@ "integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==", "dev": true, "requires": { - "color-convert": "1.9.3" + "color-convert": "^1.9.0" } }, "chalk": { @@ -828,9 +828,9 @@ "integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==", "dev": true, "requires": { - "ansi-styles": "3.2.1", - "escape-string-regexp": "1.0.5", - "supports-color": "5.5.0" + "ansi-styles": "^3.2.1", + "escape-string-regexp": "^1.0.5", + "supports-color": "^5.3.0" } }, "supports-color": { @@ -839,7 +839,7 @@ "integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==", "dev": true, "requires": { - "has-flag": "3.0.0" + "has-flag": "^3.0.0" } } } @@ -864,13 +864,13 @@ "resolved": "https://registry.npmjs.org/base/-/base-0.11.2.tgz", "integrity": "sha512-5T6P4xPgpp0YDFvSWwEZ4NoE3aM4QBQXDzmVbraCkFj8zHM+mba8SyqB5DbZWyR7mYHo6Y7BdQo3MoA4m0TeQg==", "requires": { - "cache-base": "1.0.1", - "class-utils": "0.3.6", - "component-emitter": "1.2.1", - "define-property": "1.0.0", - "isobject": "3.0.1", - "mixin-deep": "1.3.1", - "pascalcase": "0.1.1" + "cache-base": "^1.0.1", + "class-utils": "^0.3.5", + "component-emitter": "^1.2.1", + "define-property": "^1.0.0", + "isobject": "^3.0.1", + "mixin-deep": "^1.2.0", + "pascalcase": "^0.1.1" }, "dependencies": { "define-property": { @@ -878,7 +878,7 @@ "resolved": "https://registry.npmjs.org/define-property/-/define-property-1.0.0.tgz", "integrity": "sha1-dp66rz9KY6rTr56NMEybvnm/sOY=", "requires": { - "is-descriptor": "1.0.2" + "is-descriptor": "^1.0.0" } }, "is-accessor-descriptor": { @@ -886,7 +886,7 @@ "resolved": "https://registry.npmjs.org/is-accessor-descriptor/-/is-accessor-descriptor-1.0.0.tgz", "integrity": "sha512-m5hnHTkcVsPfqx3AKlyttIPb7J+XykHvJP2B9bZDjlhLIoEq4XoK64Vg7boZlVWYK6LUY94dYPEE7Lh0ZkZKcQ==", "requires": { - "kind-of": "6.0.2" + "kind-of": "^6.0.0" } }, "is-data-descriptor": { @@ -894,7 +894,7 @@ "resolved": "https://registry.npmjs.org/is-data-descriptor/-/is-data-descriptor-1.0.0.tgz", "integrity": "sha512-jbRXy1FmtAoCjQkVmIVYwuuqDFUbaOeDjmed1tOGPrsMhtJA4rD9tkgA0F1qJ3gRFRXcHYVkdeaP50Q5rE/jLQ==", "requires": { - "kind-of": "6.0.2" + "kind-of": "^6.0.0" } }, "is-descriptor": { @@ -902,9 +902,9 @@ "resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-1.0.2.tgz", "integrity": "sha512-2eis5WqQGV7peooDyLmNEPUrps9+SXX5c9pL3xEB+4e9HnGuDa7mB7kHxHw4CbqS9k1T2hOH3miL8n8WtiYVtg==", "requires": { - "is-accessor-descriptor": "1.0.0", - "is-data-descriptor": "1.0.0", - "kind-of": "6.0.2" + "is-accessor-descriptor": "^1.0.0", + "is-data-descriptor": "^1.0.0", + "kind-of": "^6.0.2" } } } @@ -931,7 +931,7 @@ "resolved": "https://registry.npmjs.org/bcrypt-pbkdf/-/bcrypt-pbkdf-1.0.2.tgz", "integrity": "sha1-pDAdOJtqQ/m2f/PKEaP2Y342Dp4=", "requires": { - "tweetnacl": "0.14.5" + "tweetnacl": "^0.14.3" } }, "big.js": { @@ -949,7 +949,7 @@ "resolved": "https://registry.npmjs.org/block-stream/-/block-stream-0.0.9.tgz", "integrity": "sha1-E+v+d4oDIFz+A3UUgeu0szAMEmo=", "requires": { - "inherits": "2.0.3" + "inherits": "~2.0.0" } }, "bluebird": { @@ -970,15 +970,15 @@ "integrity": "sha1-WykhmP/dVTs6DyDe0FkrlWlVyLQ=", "requires": { "bytes": "3.0.0", - "content-type": "1.0.4", + "content-type": "~1.0.4", "debug": "2.6.9", - "depd": "1.1.2", - "http-errors": "1.6.3", + "depd": "~1.1.2", + "http-errors": "~1.6.3", "iconv-lite": "0.4.23", - "on-finished": "2.3.0", + "on-finished": "~2.3.0", "qs": "6.5.2", "raw-body": "2.3.3", - "type-is": "1.6.16" + "type-is": "~1.6.16" } }, "bonjour": { @@ -987,12 +987,12 @@ "integrity": "sha1-jokKGD2O6aI5OzhExpGkK897yfU=", "dev": true, "requires": { - "array-flatten": "2.1.2", - "deep-equal": "1.0.1", - "dns-equal": "1.0.0", - "dns-txt": "2.0.2", - "multicast-dns": "6.2.3", - "multicast-dns-service-types": "1.1.0" + "array-flatten": "^2.1.0", + "deep-equal": "^1.0.1", + "dns-equal": "^1.0.0", + "dns-txt": "^2.0.2", + "multicast-dns": "^6.0.1", + "multicast-dns-service-types": "^1.1.0" } }, "boxen": { @@ -1000,13 +1000,13 @@ "resolved": "https://registry.npmjs.org/boxen/-/boxen-1.3.0.tgz", "integrity": "sha512-TNPjfTr432qx7yOjQyaXm3dSR0MH9vXp7eT1BFSl/C51g+EFnOR9hTg1IreahGBmDNCehscshe45f+C1TBZbLw==", "requires": { - "ansi-align": "2.0.0", - "camelcase": "4.1.0", - "chalk": "2.4.2", - "cli-boxes": "1.0.0", - "string-width": "2.1.1", - "term-size": "1.2.0", - "widest-line": "2.0.1" + "ansi-align": "^2.0.0", + "camelcase": "^4.0.0", + "chalk": "^2.0.1", + "cli-boxes": "^1.0.0", + "string-width": "^2.0.0", + "term-size": "^1.2.0", + "widest-line": "^2.0.0" }, "dependencies": { "ansi-regex": { @@ -1019,7 +1019,7 @@ "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz", "integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==", "requires": { - "color-convert": "1.9.3" + "color-convert": "^1.9.0" } }, "camelcase": { @@ -1032,9 +1032,9 @@ "resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz", "integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==", "requires": { - "ansi-styles": "3.2.1", - "escape-string-regexp": "1.0.5", - "supports-color": "5.5.0" + "ansi-styles": "^3.2.1", + "escape-string-regexp": "^1.0.5", + "supports-color": "^5.3.0" } }, "is-fullwidth-code-point": { @@ -1047,8 +1047,8 @@ "resolved": "https://registry.npmjs.org/string-width/-/string-width-2.1.1.tgz", "integrity": "sha512-nOqH59deCq9SRHlxq1Aw85Jnt4w6KvLKqWVik6oA9ZklXLNIOlqg4F2yrT1MVaTjAqvVwdfeZ7w7aCvJD7ugkw==", "requires": { - "is-fullwidth-code-point": "2.0.0", - "strip-ansi": "4.0.0" + "is-fullwidth-code-point": "^2.0.0", + "strip-ansi": "^4.0.0" } }, "strip-ansi": { @@ -1056,7 +1056,7 @@ "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-4.0.0.tgz", "integrity": "sha1-qEeQIusaw2iocTibY1JixQXuNo8=", "requires": { - "ansi-regex": "3.0.0" + "ansi-regex": "^3.0.0" } }, "supports-color": { @@ -1064,7 +1064,7 @@ "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz", "integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==", "requires": { - "has-flag": "3.0.0" + "has-flag": "^3.0.0" } } } @@ -1074,7 +1074,7 @@ "resolved": "https://registry.npmjs.org/brace-expansion/-/brace-expansion-1.1.11.tgz", "integrity": "sha512-iCuPHDFgrHX7H2vEI/5xpz07zSHB00TpugqhmYtVmMO6518mCuRMoOYFldEBl0g187ufozdaHgWKcYFb61qGiA==", "requires": { - "balanced-match": "1.0.0", + "balanced-match": "^1.0.0", "concat-map": "0.0.1" } }, @@ -1083,16 +1083,16 @@ "resolved": "https://registry.npmjs.org/braces/-/braces-2.3.2.tgz", "integrity": "sha512-aNdbnj9P8PjdXU4ybaWLK2IF3jc/EoDYbC7AazW6to3TRsfXxscC9UXOB5iDiEQrkyIbWp2SLQda4+QAa7nc3w==", "requires": { - "arr-flatten": "1.1.0", - "array-unique": "0.3.2", - "extend-shallow": "2.0.1", - "fill-range": "4.0.0", - "isobject": "3.0.1", - "repeat-element": "1.1.3", - "snapdragon": "0.8.2", - "snapdragon-node": "2.1.1", - "split-string": "3.1.0", - "to-regex": "3.0.2" + "arr-flatten": "^1.1.0", + "array-unique": "^0.3.2", + "extend-shallow": "^2.0.1", + "fill-range": "^4.0.0", + "isobject": "^3.0.1", + "repeat-element": "^1.1.2", + "snapdragon": "^0.8.1", + "snapdragon-node": "^2.0.1", + "split-string": "^3.0.2", + "to-regex": "^3.0.1" }, "dependencies": { "extend-shallow": { @@ -1100,7 +1100,7 @@ "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz", "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=", "requires": { - "is-extendable": "0.1.1" + "is-extendable": "^0.1.0" } } } @@ -1119,16 +1119,16 @@ }, "browserify-aes": { "version": "1.2.0", - "resolved": "http://registry.npmjs.org/browserify-aes/-/browserify-aes-1.2.0.tgz", + "resolved": "https://registry.npmjs.org/browserify-aes/-/browserify-aes-1.2.0.tgz", "integrity": "sha512-+7CHXqGuspUn/Sl5aO7Ea0xWGAtETPXNSAjHo48JfLdPWcMng33Xe4znFvQweqc/uzk5zSOI3H52CYnjCfb5hA==", "dev": true, "requires": { - "buffer-xor": "1.0.3", - "cipher-base": "1.0.4", - "create-hash": "1.2.0", - "evp_bytestokey": "1.0.3", - "inherits": "2.0.3", - "safe-buffer": "5.1.2" + "buffer-xor": "^1.0.3", + "cipher-base": "^1.0.0", + "create-hash": "^1.1.0", + "evp_bytestokey": "^1.0.3", + "inherits": "^2.0.1", + "safe-buffer": "^5.0.1" } }, "browserify-cipher": { @@ -1137,9 +1137,9 @@ "integrity": "sha512-sPhkz0ARKbf4rRQt2hTpAHqn47X3llLkUGn+xEJzLjwY8LRs2p0v7ljvI5EyoRO/mexrNunNECisZs+gw2zz1w==", "dev": true, "requires": { - "browserify-aes": "1.2.0", - "browserify-des": "1.0.2", - "evp_bytestokey": "1.0.3" + "browserify-aes": "^1.0.4", + "browserify-des": "^1.0.0", + "evp_bytestokey": "^1.0.0" } }, "browserify-des": { @@ -1148,20 +1148,20 @@ "integrity": "sha512-BioO1xf3hFwz4kc6iBhI3ieDFompMhrMlnDFC4/0/vd5MokpuAc3R+LYbwTA9A5Yc9pq9UYPqffKpW2ObuwX5A==", "dev": true, "requires": { - "cipher-base": "1.0.4", - "des.js": "1.0.0", - "inherits": "2.0.3", - "safe-buffer": "5.1.2" + "cipher-base": "^1.0.1", + "des.js": "^1.0.0", + "inherits": "^2.0.1", + "safe-buffer": "^5.1.2" } }, "browserify-rsa": { "version": "4.0.1", - "resolved": "http://registry.npmjs.org/browserify-rsa/-/browserify-rsa-4.0.1.tgz", + "resolved": "https://registry.npmjs.org/browserify-rsa/-/browserify-rsa-4.0.1.tgz", "integrity": "sha1-IeCr+vbyApzy+vsTNWenAdQTVSQ=", "dev": true, "requires": { - "bn.js": "4.11.8", - "randombytes": "2.0.6" + "bn.js": "^4.1.0", + "randombytes": "^2.0.1" } }, "browserify-sign": { @@ -1170,13 +1170,13 @@ "integrity": "sha1-qk62jl17ZYuqa/alfmMMvXqT0pg=", "dev": true, "requires": { - "bn.js": "4.11.8", - "browserify-rsa": "4.0.1", - "create-hash": "1.2.0", - "create-hmac": "1.1.7", - "elliptic": "6.4.1", - "inherits": "2.0.3", - "parse-asn1": "5.1.3" + "bn.js": "^4.1.1", + "browserify-rsa": "^4.0.0", + "create-hash": "^1.1.0", + "create-hmac": "^1.1.2", + "elliptic": "^6.0.0", + "inherits": "^2.0.1", + "parse-asn1": "^5.0.0" } }, "browserify-zlib": { @@ -1185,18 +1185,18 @@ "integrity": "sha512-Z942RysHXmJrhqk88FmKBVq/v5tqmSkDz7p54G/MGyjMnCFFnC79XWNbg+Vta8W6Wb2qtSZTSxIGkJrRpCFEiA==", "dev": true, "requires": { - "pako": "1.0.8" + "pako": "~1.0.5" } }, "buffer": { "version": "4.9.1", - "resolved": "http://registry.npmjs.org/buffer/-/buffer-4.9.1.tgz", + "resolved": "https://registry.npmjs.org/buffer/-/buffer-4.9.1.tgz", "integrity": "sha1-bRu2AbB6TvztlwlBMgkwJ8lbwpg=", "dev": true, "requires": { - "base64-js": "1.3.0", - "ieee754": "1.1.12", - "isarray": "1.0.0" + "base64-js": "^1.0.2", + "ieee754": "^1.1.4", + "isarray": "^1.0.0" } }, "buffer-from": { @@ -1239,19 +1239,19 @@ "integrity": "sha512-Dph0MzuH+rTQzGPNT9fAnrPmMmjKfST6trxJeK7NQuHRaVw24VzPRWTmg9MpcwOVQZO0E1FBICUlFeNaKPIfHA==", "dev": true, "requires": { - "bluebird": "3.5.3", - "chownr": "1.1.1", - "glob": "7.1.3", - "graceful-fs": "4.1.15", - "lru-cache": "4.1.5", - "mississippi": "2.0.0", - "mkdirp": "0.5.1", - "move-concurrently": "1.0.1", - "promise-inflight": "1.0.1", - "rimraf": "2.6.3", - "ssri": "5.3.0", - "unique-filename": "1.1.1", - "y18n": "4.0.0" + "bluebird": "^3.5.1", + "chownr": "^1.0.1", + "glob": "^7.1.2", + "graceful-fs": "^4.1.11", + "lru-cache": "^4.1.1", + "mississippi": "^2.0.0", + "mkdirp": "^0.5.1", + "move-concurrently": "^1.0.1", + "promise-inflight": "^1.0.1", + "rimraf": "^2.6.2", + "ssri": "^5.2.4", + "unique-filename": "^1.1.0", + "y18n": "^4.0.0" }, "dependencies": { "y18n": { @@ -1267,15 +1267,15 @@ "resolved": "https://registry.npmjs.org/cache-base/-/cache-base-1.0.1.tgz", "integrity": "sha512-AKcdTnFSWATd5/GCPRxr2ChwIJ85CeyrEyjRHlKxQ56d4XJMGym0uAiKn0xbLOGOl3+yRpOTi484dVCEc5AUzQ==", "requires": { - "collection-visit": "1.0.0", - "component-emitter": "1.2.1", - "get-value": "2.0.6", - "has-value": "1.0.0", - "isobject": "3.0.1", - "set-value": "2.0.0", - "to-object-path": "0.3.0", - "union-value": "1.0.0", - "unset-value": "1.0.0" + "collection-visit": "^1.0.0", + "component-emitter": "^1.2.1", + "get-value": "^2.0.6", + "has-value": "^1.0.0", + "isobject": "^3.0.1", + "set-value": "^2.0.0", + "to-object-path": "^0.3.0", + "union-value": "^1.0.0", + "unset-value": "^1.0.0" } }, "camelcase": { @@ -1285,11 +1285,11 @@ }, "camelcase-keys": { "version": "2.1.0", - "resolved": "http://registry.npmjs.org/camelcase-keys/-/camelcase-keys-2.1.0.tgz", + "resolved": "https://registry.npmjs.org/camelcase-keys/-/camelcase-keys-2.1.0.tgz", "integrity": "sha1-MIvur/3ygRkFHvodkyITyRuPkuc=", "requires": { - "camelcase": "2.1.1", - "map-obj": "1.0.1" + "camelcase": "^2.0.0", + "map-obj": "^1.0.0" } }, "capture-stack-trace": { @@ -1308,12 +1308,12 @@ "integrity": "sha512-XQU3bhBukrOsQCuwZndwGcCVQHyZi53fQ6Ys1Fym7E4olpIqqZZhhoFJoaKVvV17lWQoXYwgWN2nF5crA8J2jw==", "dev": true, "requires": { - "assertion-error": "1.1.0", - "check-error": "1.0.2", - "deep-eql": "3.0.1", - "get-func-name": "2.0.0", - "pathval": "1.1.0", - "type-detect": "4.0.8" + "assertion-error": "^1.1.0", + "check-error": "^1.0.2", + "deep-eql": "^3.0.1", + "get-func-name": "^2.0.0", + "pathval": "^1.1.0", + "type-detect": "^4.0.5" } }, "chalk": { @@ -1321,11 +1321,11 @@ "resolved": "https://registry.npmjs.org/chalk/-/chalk-1.1.3.tgz", "integrity": "sha1-qBFcVeSnAv5NFQq9OHKCKn4J/Jg=", "requires": { - "ansi-styles": "2.2.1", - "escape-string-regexp": "1.0.5", - "has-ansi": "2.0.0", - "strip-ansi": "3.0.1", - "supports-color": "2.0.0" + "ansi-styles": "^2.2.1", + "escape-string-regexp": "^1.0.2", + "has-ansi": "^2.0.0", + "strip-ansi": "^3.0.0", + "supports-color": "^2.0.0" } }, "check-error": { @@ -1340,19 +1340,19 @@ "integrity": "sha512-z9n7yt9rOvIJrMhvDtDictKrkFHeihkNl6uWMmZlmL6tJtX9Cs+87oK+teBx+JIgzvbX3yZHT3eF8vpbDxHJXQ==", "dev": true, "requires": { - "anymatch": "2.0.0", - "async-each": "1.0.1", - "braces": "2.3.2", - "fsevents": "1.2.7", - "glob-parent": "3.1.0", - "inherits": "2.0.3", - "is-binary-path": "1.0.1", - "is-glob": "4.0.0", - "lodash.debounce": "4.0.8", - "normalize-path": "2.1.1", - "path-is-absolute": "1.0.1", - "readdirp": "2.2.1", - "upath": "1.1.0" + "anymatch": "^2.0.0", + "async-each": "^1.0.0", + "braces": "^2.3.0", + "fsevents": "^1.2.2", + "glob-parent": "^3.1.0", + "inherits": "^2.0.1", + "is-binary-path": "^1.0.0", + "is-glob": "^4.0.0", + "lodash.debounce": "^4.0.8", + "normalize-path": "^2.1.1", + "path-is-absolute": "^1.0.0", + "readdirp": "^2.0.0", + "upath": "^1.0.5" } }, "chownr": { @@ -1367,7 +1367,7 @@ "integrity": "sha512-xDbVgyfDTT2piup/h8dK/y4QZfJRSa73bw1WZ8b4XM1o7fsFubUVGYcE+1ANtOzJJELGpYoG2961z0Z6OAld9A==", "dev": true, "requires": { - "tslib": "1.9.3" + "tslib": "^1.9.0" } }, "ci-info": { @@ -1381,8 +1381,8 @@ "integrity": "sha512-Kkht5ye6ZGmwv40uUDZztayT2ThLQGfnj/T71N/XzeZeo3nf8foyW7zGTsPYkEya3m5f3cAypH+qe7YOrM1U2Q==", "dev": true, "requires": { - "inherits": "2.0.3", - "safe-buffer": "5.1.2" + "inherits": "^2.0.1", + "safe-buffer": "^5.0.1" } }, "class-utils": { @@ -1390,10 +1390,10 @@ "resolved": "https://registry.npmjs.org/class-utils/-/class-utils-0.3.6.tgz", "integrity": "sha512-qOhPa/Fj7s6TY8H8esGu5QNpMMQxz79h+urzrNYN6mn+9BnxlDGf5QZ+XeCDsxSjPqsSR56XOZOJmpeurnLMeg==", "requires": { - "arr-union": "3.1.0", - "define-property": "0.2.5", - "isobject": "3.0.1", - "static-extend": "0.1.2" + "arr-union": "^3.1.0", + "define-property": "^0.2.5", + "isobject": "^3.0.0", + "static-extend": "^0.1.1" }, "dependencies": { "define-property": { @@ -1401,7 +1401,7 @@ "resolved": "https://registry.npmjs.org/define-property/-/define-property-0.2.5.tgz", "integrity": "sha1-w1se+RjsPJkPmlvFe+BKrOxcgRY=", "requires": { - "is-descriptor": "0.1.6" + "is-descriptor": "^0.1.0" } } } @@ -1421,9 +1421,9 @@ "resolved": "https://registry.npmjs.org/cliui/-/cliui-3.2.0.tgz", "integrity": "sha1-EgYBU3qRbSmUD5NNo7SNWFo5IT0=", "requires": { - "string-width": "1.0.2", - "strip-ansi": "3.0.1", - "wrap-ansi": "2.1.0" + "string-width": "^1.0.1", + "strip-ansi": "^3.0.1", + "wrap-ansi": "^2.0.0" } }, "clone-deep": { @@ -1432,10 +1432,10 @@ "integrity": "sha512-SZegPTKjCgpQH63E+eN6mVEEPdQBOUzjyJm5Pora4lrwWRFS8I0QAxV/KD6vV/i0WuijHZWQC1fMsPEdxfdVCQ==", "dev": true, "requires": { - "for-own": "1.0.0", - "is-plain-object": "2.0.4", - "kind-of": "6.0.2", - "shallow-clone": "1.0.0" + "for-own": "^1.0.0", + "is-plain-object": "^2.0.4", + "kind-of": "^6.0.0", + "shallow-clone": "^1.0.0" } }, "code-point-at": { @@ -1448,8 +1448,8 @@ "resolved": "https://registry.npmjs.org/collection-visit/-/collection-visit-1.0.0.tgz", "integrity": "sha1-S8A3PBZLwykbTTaMgpzxqApZ3KA=", "requires": { - "map-visit": "1.0.0", - "object-visit": "1.0.1" + "map-visit": "^1.0.0", + "object-visit": "^1.0.0" } }, "color-convert": { @@ -1470,7 +1470,7 @@ "resolved": "https://registry.npmjs.org/combined-stream/-/combined-stream-1.0.7.tgz", "integrity": "sha512-brWl9y6vOB1xYPZcpZde3N9zDByXTosAeMDo4p1wzo6UMOX4vumB+TP1RZ76sfE6Md68Q0NJSrE/gbezd4Ul+w==", "requires": { - "delayed-stream": "1.0.0" + "delayed-stream": "~1.0.0" } }, "commander": { @@ -1489,15 +1489,15 @@ "resolved": "https://registry.npmjs.org/commoner/-/commoner-0.10.8.tgz", "integrity": "sha1-NPw2cs0kOT6LtH5wyqApOBH08sU=", "requires": { - "commander": "2.15.1", - "detective": "4.7.1", - "glob": "5.0.15", - "graceful-fs": "4.1.15", - "iconv-lite": "0.4.23", - "mkdirp": "0.5.1", - "private": "0.1.8", - "q": "1.5.1", - "recast": "0.11.23" + "commander": "^2.5.0", + "detective": "^4.3.1", + "glob": "^5.0.15", + "graceful-fs": "^4.1.2", + "iconv-lite": "^0.4.5", + "mkdirp": "^0.5.0", + "private": "^0.1.6", + "q": "^1.1.2", + "recast": "^0.11.17" }, "dependencies": { "glob": { @@ -1505,11 +1505,11 @@ "resolved": "https://registry.npmjs.org/glob/-/glob-5.0.15.tgz", "integrity": "sha1-G8k2ueAvSmA/zCIuz3Yz0wuLk7E=", "requires": { - "inflight": "1.0.6", - "inherits": "2.0.3", - "minimatch": "3.0.4", - "once": "1.4.0", - "path-is-absolute": "1.0.1" + "inflight": "^1.0.4", + "inherits": "2", + "minimatch": "2 || 3", + "once": "^1.3.0", + "path-is-absolute": "^1.0.0" } } } @@ -1525,7 +1525,7 @@ "integrity": "sha512-4aE67DL33dSW9gw4CI2H/yTxqHLNcxp0yS6jB+4h+wr3e43+1z7vm0HU9qXOH8j+qjKuL8+UtkOxYQSMq60Ylw==", "dev": true, "requires": { - "mime-db": "1.37.0" + "mime-db": ">= 1.36.0 < 2" } }, "compression": { @@ -1534,13 +1534,13 @@ "integrity": "sha512-HSjyBG5N1Nnz7tF2+O7A9XUhyjru71/fwgNb7oIsEVHR0WShfs2tIS/EySLgiTe98aOK18YDlMXpzjCXY/n9mg==", "dev": true, "requires": { - "accepts": "1.3.5", + "accepts": "~1.3.5", "bytes": "3.0.0", - "compressible": "2.0.15", + "compressible": "~2.0.14", "debug": "2.6.9", - "on-headers": "1.0.1", + "on-headers": "~1.0.1", "safe-buffer": "5.1.2", - "vary": "1.1.2" + "vary": "~1.1.2" } }, "concat-map": { @@ -1554,10 +1554,10 @@ "integrity": "sha512-27HBghJxjiZtIk3Ycvn/4kbJk/1uZuJFfuPEns6LaEvpvG1f0hTea8lilrouyo9mVc2GWdcEZ8OLoGmSADlrCw==", "dev": true, "requires": { - "buffer-from": "1.1.1", - "inherits": "2.0.3", - "readable-stream": "2.3.6", - "typedarray": "0.0.6" + "buffer-from": "^1.0.0", + "inherits": "^2.0.3", + "readable-stream": "^2.2.2", + "typedarray": "^0.0.6" } }, "configstore": { @@ -1565,12 +1565,12 @@ "resolved": "https://registry.npmjs.org/configstore/-/configstore-3.1.2.tgz", "integrity": "sha512-vtv5HtGjcYUgFrXc6Kx747B83MRRVS5R1VTEQoXvuP+kMI+if6uywV0nDGoiydJRy4yk7h9od5Og0kxx4zUXmw==", "requires": { - "dot-prop": "4.2.0", - "graceful-fs": "4.1.15", - "make-dir": "1.3.0", - "unique-string": "1.0.0", - "write-file-atomic": "2.4.2", - "xdg-basedir": "3.0.0" + "dot-prop": "^4.1.0", + "graceful-fs": "^4.1.2", + "make-dir": "^1.0.0", + "unique-string": "^1.0.0", + "write-file-atomic": "^2.0.0", + "xdg-basedir": "^3.0.0" } }, "connect-history-api-fallback": { @@ -1585,7 +1585,7 @@ "integrity": "sha1-8CQcRXMKn8YyOyBtvzjtx0HQuxA=", "dev": true, "requires": { - "date-now": "0.1.4" + "date-now": "^0.1.4" } }, "console-control-strings": { @@ -1601,7 +1601,7 @@ }, "content-disposition": { "version": "0.5.2", - "resolved": "http://registry.npmjs.org/content-disposition/-/content-disposition-0.5.2.tgz", + "resolved": "https://registry.npmjs.org/content-disposition/-/content-disposition-0.5.2.tgz", "integrity": "sha1-DPaLud318r55YcOoUXjLhdunjLQ=" }, "content-type": { @@ -1625,12 +1625,12 @@ "integrity": "sha512-f2domd9fsVDFtaFcbaRZuYXwtdmnzqbADSwhSWYxYB/Q8zsdUUFMXVRwXGDMWmbEzAn1kdRrtI1T/KTFOL4X2A==", "dev": true, "requires": { - "aproba": "1.2.0", - "fs-write-stream-atomic": "1.0.10", - "iferr": "0.1.5", - "mkdirp": "0.5.1", - "rimraf": "2.6.3", - "run-queue": "1.0.3" + "aproba": "^1.1.1", + "fs-write-stream-atomic": "^1.0.8", + "iferr": "^0.1.5", + "mkdirp": "^0.5.1", + "rimraf": "^2.5.4", + "run-queue": "^1.0.0" } }, "copy-descriptor": { @@ -1644,14 +1644,14 @@ "integrity": "sha512-Y+SQCF+0NoWQryez2zXn5J5knmr9z/9qSQt7fbL78u83rxmigOy8X5+BFn8CFSuX+nKT8gpYwJX68ekqtQt6ZA==", "dev": true, "requires": { - "cacache": "10.0.4", - "find-cache-dir": "1.0.0", - "globby": "7.1.1", - "is-glob": "4.0.0", - "loader-utils": "1.2.3", - "minimatch": "3.0.4", - "p-limit": "1.3.0", - "serialize-javascript": "1.6.1" + "cacache": "^10.0.4", + "find-cache-dir": "^1.0.0", + "globby": "^7.1.1", + "is-glob": "^4.0.0", + "loader-utils": "^1.1.0", + "minimatch": "^3.0.4", + "p-limit": "^1.0.0", + "serialize-javascript": "^1.4.0" } }, "core-js": { @@ -1670,8 +1670,8 @@ "integrity": "sha512-GbEHQPMOswGpKXM9kCWVrremUcBmjteUaQ01T9rkKCPDXfUHX0IoP9LpHYo2NPFampa4e+/pFDc3jQdxrxQLaw==", "dev": true, "requires": { - "bn.js": "4.11.8", - "elliptic": "6.4.1" + "bn.js": "^4.1.0", + "elliptic": "^6.0.0" } }, "create-error-class": { @@ -1679,34 +1679,34 @@ "resolved": "https://registry.npmjs.org/create-error-class/-/create-error-class-3.0.2.tgz", "integrity": "sha1-Br56vvlHo/FKMP1hBnHUAbyot7Y=", "requires": { - "capture-stack-trace": "1.0.1" + "capture-stack-trace": "^1.0.0" } }, "create-hash": { "version": "1.2.0", - "resolved": "http://registry.npmjs.org/create-hash/-/create-hash-1.2.0.tgz", + "resolved": "https://registry.npmjs.org/create-hash/-/create-hash-1.2.0.tgz", "integrity": "sha512-z00bCGNHDG8mHAkP7CtT1qVu+bFQUPjYq/4Iv3C3kWjTFV10zIjfSoeqXo9Asws8gwSHDGj/hl2u4OGIjapeCg==", "dev": true, "requires": { - "cipher-base": "1.0.4", - "inherits": "2.0.3", - "md5.js": "1.3.5", - "ripemd160": "2.0.2", - "sha.js": "2.4.11" + "cipher-base": "^1.0.1", + "inherits": "^2.0.1", + "md5.js": "^1.3.4", + "ripemd160": "^2.0.1", + "sha.js": "^2.4.0" } }, "create-hmac": { "version": "1.1.7", - "resolved": "http://registry.npmjs.org/create-hmac/-/create-hmac-1.1.7.tgz", + "resolved": "https://registry.npmjs.org/create-hmac/-/create-hmac-1.1.7.tgz", "integrity": "sha512-MJG9liiZ+ogc4TzUwuvbER1JRdgvUFSB5+VR/g5h82fGaIRWMWddtKBHi7/sVhfjQZ6SehlyhvQYrcYkaUIpLg==", "dev": true, "requires": { - "cipher-base": "1.0.4", - "create-hash": "1.2.0", - "inherits": "2.0.3", - "ripemd160": "2.0.2", - "safe-buffer": "5.1.2", - "sha.js": "2.4.11" + "cipher-base": "^1.0.3", + "create-hash": "^1.1.0", + "inherits": "^2.0.1", + "ripemd160": "^2.0.0", + "safe-buffer": "^5.0.1", + "sha.js": "^2.4.8" } }, "cross-spawn": { @@ -1714,8 +1714,8 @@ "resolved": "https://registry.npmjs.org/cross-spawn/-/cross-spawn-3.0.1.tgz", "integrity": "sha1-ElYDfsufDF9549bvE14wdwGEuYI=", "requires": { - "lru-cache": "4.1.5", - "which": "1.3.1" + "lru-cache": "^4.0.1", + "which": "^1.2.9" } }, "crypto-browserify": { @@ -1724,17 +1724,17 @@ "integrity": "sha512-fz4spIh+znjO2VjL+IdhEpRJ3YN6sMzITSBijk6FK2UvTqruSQW+/cCZTSNsMiZNvUeq0CqurF+dAbyiGOY6Wg==", "dev": true, "requires": { - "browserify-cipher": "1.0.1", - "browserify-sign": "4.0.4", - "create-ecdh": "4.0.3", - "create-hash": "1.2.0", - "create-hmac": "1.1.7", - "diffie-hellman": "5.0.3", - "inherits": "2.0.3", - "pbkdf2": "3.0.17", - "public-encrypt": "4.0.3", - "randombytes": "2.0.6", - "randomfill": "1.0.4" + "browserify-cipher": "^1.0.0", + "browserify-sign": "^4.0.0", + "create-ecdh": "^4.0.0", + "create-hash": "^1.1.0", + "create-hmac": "^1.1.0", + "diffie-hellman": "^5.0.0", + "inherits": "^2.0.1", + "pbkdf2": "^3.0.3", + "public-encrypt": "^4.0.0", + "randombytes": "^2.0.0", + "randomfill": "^1.0.3" } }, "crypto-random-string": { @@ -1748,16 +1748,16 @@ "integrity": "sha512-MoOu+CStsGrSt5K2OeZ89q3Snf+IkxRfAIt9aAKg4piioTrhtP1iEFPu+OVn3Ohz24FO6L+rw9UJxBILiSBw5Q==", "dev": true, "requires": { - "icss-utils": "4.0.0", - "loader-utils": "1.2.3", - "lodash": "4.17.11", - "postcss": "7.0.14", - "postcss-modules-extract-imports": "2.0.0", - "postcss-modules-local-by-default": "2.0.4", - "postcss-modules-scope": "2.0.1", - "postcss-modules-values": "2.0.0", - "postcss-value-parser": "3.3.1", - "schema-utils": "1.0.0" + "icss-utils": "^4.0.0", + "loader-utils": "^1.2.1", + "lodash": "^4.17.11", + "postcss": "^7.0.6", + "postcss-modules-extract-imports": "^2.0.0", + "postcss-modules-local-by-default": "^2.0.3", + "postcss-modules-scope": "^2.0.0", + "postcss-modules-values": "^2.0.0", + "postcss-value-parser": "^3.3.0", + "schema-utils": "^1.0.0" } }, "css-selector-tokenizer": { @@ -1766,9 +1766,9 @@ "integrity": "sha512-xYL0AMZJ4gFzJQsHUKa5jiWWi2vH77WVNg7JYRyewwj6oPh4yb/y6Y9ZCw9dsj/9UauMhtuxR+ogQd//EdEVNA==", "dev": true, "requires": { - "cssesc": "0.1.0", - "fastparse": "1.1.2", - "regexpu-core": "1.0.0" + "cssesc": "^0.1.0", + "fastparse": "^1.1.1", + "regexpu-core": "^1.0.0" } }, "cssesc": { @@ -1787,7 +1787,7 @@ "resolved": "https://registry.npmjs.org/currently-unhandled/-/currently-unhandled-0.4.1.tgz", "integrity": "sha1-mI3zP+qxke95mmE2nddsF635V+o=", "requires": { - "array-find-index": "1.0.2" + "array-find-index": "^1.0.1" } }, "cyclist": { @@ -1798,11 +1798,11 @@ }, "d": { "version": "1.0.0", - "resolved": "http://registry.npmjs.org/d/-/d-1.0.0.tgz", + "resolved": "https://registry.npmjs.org/d/-/d-1.0.0.tgz", "integrity": "sha1-dUu1v+VUUdpppYuU1F9MWwRi1Y8=", "dev": true, "requires": { - "es5-ext": "0.10.47" + "es5-ext": "^0.10.9" } }, "dashdash": { @@ -1810,7 +1810,7 @@ "resolved": "https://registry.npmjs.org/dashdash/-/dashdash-1.14.1.tgz", "integrity": "sha1-hTz6D3y+L+1d4gMmuN1YEDX24vA=", "requires": { - "assert-plus": "1.0.0" + "assert-plus": "^1.0.0" } }, "date-now": { @@ -1843,7 +1843,7 @@ "integrity": "sha512-+QeIQyN5ZuO+3Uk5DYh6/1eKO0m0YmJFGNmFHGACpf1ClL1nmlV/p4gNgbl2pJGxgXb4faqo6UE+M5ACEMyVcw==", "dev": true, "requires": { - "type-detect": "4.0.8" + "type-detect": "^4.0.0" } }, "deep-equal": { @@ -1863,8 +1863,8 @@ "integrity": "sha512-lAc4i9QJR0YHSDFdzeBQKfZ1SRDG3hsJNEkrpcZa8QhBfidLAilT60BDEIVUUGqosFp425KOgB3uYqcnQrWafQ==", "dev": true, "requires": { - "execa": "0.10.0", - "ip-regex": "2.1.0" + "execa": "^0.10.0", + "ip-regex": "^2.1.0" }, "dependencies": { "cross-spawn": { @@ -1873,11 +1873,11 @@ "integrity": "sha512-eTVLrBSt7fjbDygz805pMnstIs2VTBNkRm0qxZd+M7A5XDdxVRWO5MxGBXZhjY4cqLYLdtrGqRf8mBPmzwSpWQ==", "dev": true, "requires": { - "nice-try": "1.0.5", - "path-key": "2.0.1", - "semver": "5.6.0", - "shebang-command": "1.2.0", - "which": "1.3.1" + "nice-try": "^1.0.4", + "path-key": "^2.0.1", + "semver": "^5.5.0", + "shebang-command": "^1.2.0", + "which": "^1.2.9" } }, "execa": { @@ -1886,13 +1886,13 @@ "integrity": "sha512-7XOMnz8Ynx1gGo/3hyV9loYNPWM94jG3+3T3Y8tsfSstFmETmENCMU/A/zj8Lyaj1lkgEepKepvd6240tBRvlw==", "dev": true, "requires": { - "cross-spawn": "6.0.5", - "get-stream": "3.0.0", - "is-stream": "1.1.0", - "npm-run-path": "2.0.2", - "p-finally": "1.0.0", - "signal-exit": "3.0.2", - "strip-eof": "1.0.0" + "cross-spawn": "^6.0.0", + "get-stream": "^3.0.0", + "is-stream": "^1.1.0", + "npm-run-path": "^2.0.0", + "p-finally": "^1.0.0", + "signal-exit": "^3.0.0", + "strip-eof": "^1.0.0" } }, "get-stream": { @@ -1909,7 +1909,7 @@ "integrity": "sha512-3MqfYKj2lLzdMSf8ZIZE/V+Zuy+BgD6f164e8K2w7dgnpKArBDerGYpM46IYYcjnkdPNMjPk9A6VFB8+3SKlXQ==", "dev": true, "requires": { - "object-keys": "1.0.12" + "object-keys": "^1.0.12" } }, "define-property": { @@ -1917,8 +1917,8 @@ "resolved": "https://registry.npmjs.org/define-property/-/define-property-2.0.2.tgz", "integrity": "sha512-jwK2UV4cnPpbcG7+VRARKTZPUWowwXA8bzH5NP6ud0oeAxyYPuGZUAC7hMugpCdz4BeSZl2Dl9k66CHJ/46ZYQ==", "requires": { - "is-descriptor": "1.0.2", - "isobject": "3.0.1" + "is-descriptor": "^1.0.2", + "isobject": "^3.0.1" }, "dependencies": { "is-accessor-descriptor": { @@ -1926,7 +1926,7 @@ "resolved": "https://registry.npmjs.org/is-accessor-descriptor/-/is-accessor-descriptor-1.0.0.tgz", "integrity": "sha512-m5hnHTkcVsPfqx3AKlyttIPb7J+XykHvJP2B9bZDjlhLIoEq4XoK64Vg7boZlVWYK6LUY94dYPEE7Lh0ZkZKcQ==", "requires": { - "kind-of": "6.0.2" + "kind-of": "^6.0.0" } }, "is-data-descriptor": { @@ -1934,7 +1934,7 @@ "resolved": "https://registry.npmjs.org/is-data-descriptor/-/is-data-descriptor-1.0.0.tgz", "integrity": "sha512-jbRXy1FmtAoCjQkVmIVYwuuqDFUbaOeDjmed1tOGPrsMhtJA4rD9tkgA0F1qJ3gRFRXcHYVkdeaP50Q5rE/jLQ==", "requires": { - "kind-of": "6.0.2" + "kind-of": "^6.0.0" } }, "is-descriptor": { @@ -1942,9 +1942,9 @@ "resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-1.0.2.tgz", "integrity": "sha512-2eis5WqQGV7peooDyLmNEPUrps9+SXX5c9pL3xEB+4e9HnGuDa7mB7kHxHw4CbqS9k1T2hOH3miL8n8WtiYVtg==", "requires": { - "is-accessor-descriptor": "1.0.0", - "is-data-descriptor": "1.0.0", - "kind-of": "6.0.2" + "is-accessor-descriptor": "^1.0.0", + "is-data-descriptor": "^1.0.0", + "kind-of": "^6.0.2" } } } @@ -1960,12 +1960,12 @@ "integrity": "sha1-U+z2mf/LyzljdpGrE7rxYIGXZuU=", "dev": true, "requires": { - "globby": "6.1.0", - "is-path-cwd": "1.0.0", - "is-path-in-cwd": "1.0.1", - "p-map": "1.2.0", - "pify": "3.0.0", - "rimraf": "2.6.3" + "globby": "^6.1.0", + "is-path-cwd": "^1.0.0", + "is-path-in-cwd": "^1.0.0", + "p-map": "^1.1.1", + "pify": "^3.0.0", + "rimraf": "^2.2.8" }, "dependencies": { "globby": { @@ -1974,11 +1974,11 @@ "integrity": "sha1-9abXDoOV4hyFj7BInWTfAkJNUGw=", "dev": true, "requires": { - "array-union": "1.0.2", - "glob": "7.1.3", - "object-assign": "4.1.1", - "pify": "2.3.0", - "pinkie-promise": "2.0.1" + "array-union": "^1.0.1", + "glob": "^7.0.3", + "object-assign": "^4.0.1", + "pify": "^2.0.0", + "pinkie-promise": "^2.0.0" }, "dependencies": { "pify": { @@ -2018,8 +2018,8 @@ "integrity": "sha1-wHTS4qpqipoH29YfmhXCzYPsjsw=", "dev": true, "requires": { - "inherits": "2.0.3", - "minimalistic-assert": "1.0.1" + "inherits": "^2.0.1", + "minimalistic-assert": "^1.0.0" } }, "destroy": { @@ -2044,8 +2044,8 @@ "resolved": "https://registry.npmjs.org/detective/-/detective-4.7.1.tgz", "integrity": "sha512-H6PmeeUcZloWtdt4DAkFyzFL94arpHr3NOwwmVILFiy+9Qd4JTxxXrzfyGk/lmct2qVGBwTSwSXagqu2BxmWig==", "requires": { - "acorn": "5.7.3", - "defined": "1.0.0" + "acorn": "^5.2.1", + "defined": "^1.0.0" } }, "diff": { @@ -2056,13 +2056,13 @@ }, "diffie-hellman": { "version": "5.0.3", - "resolved": "http://registry.npmjs.org/diffie-hellman/-/diffie-hellman-5.0.3.tgz", + "resolved": "https://registry.npmjs.org/diffie-hellman/-/diffie-hellman-5.0.3.tgz", "integrity": "sha512-kqag/Nl+f3GwyK25fhUMYj81BUOrZ9IuJsjIcDE5icNM9FJHAVm3VcUDxdLPoQtTuUylWm6ZIknYJwwaPxsUzg==", "dev": true, "requires": { - "bn.js": "4.11.8", - "miller-rabin": "4.0.1", - "randombytes": "2.0.6" + "bn.js": "^4.1.0", + "miller-rabin": "^4.0.0", + "randombytes": "^2.0.0" } }, "dir-glob": { @@ -2071,7 +2071,7 @@ "integrity": "sha512-f9LBi5QWzIW3I6e//uxZoLBlUt9kcp66qo0sSCxL6YZKc75R1c4MFCoe/LaZiBGmgujvQdxc5Bn3QhfyvK5Hsw==", "dev": true, "requires": { - "path-type": "3.0.0" + "path-type": "^3.0.0" }, "dependencies": { "path-type": { @@ -2080,7 +2080,7 @@ "integrity": "sha512-T2ZUsdZFHgA3u4e5PfPbjd7HDDpxPnQb5jN0SrDsjNSuVXHJqtwTnWqG0B1jZrgmJ/7lj1EmVIByWt1gxGkWvg==", "dev": true, "requires": { - "pify": "3.0.0" + "pify": "^3.0.0" } }, "pify": { @@ -2103,8 +2103,8 @@ "integrity": "sha512-0UxfQkMhYAUaZI+xrNZOz/as5KgDU0M/fQ9b6SpkyLbk3GEswDi6PADJVaYJradtRVsRIlF1zLyOodbcTCDzUg==", "dev": true, "requires": { - "ip": "1.1.5", - "safe-buffer": "5.1.2" + "ip": "^1.1.0", + "safe-buffer": "^5.0.1" } }, "dns-txt": { @@ -2113,7 +2113,7 @@ "integrity": "sha1-uR2Ab10nGI5Ks+fRB9iBocxGQrY=", "dev": true, "requires": { - "buffer-indexof": "1.1.1" + "buffer-indexof": "^1.0.0" } }, "domain-browser": { @@ -2127,7 +2127,7 @@ "resolved": "https://registry.npmjs.org/dot-prop/-/dot-prop-4.2.0.tgz", "integrity": "sha512-tUMXrxlExSW6U2EXiiKGSBVdYgtV8qlHL+C10TsW4PURY/ic+eaysnSkwB4kA/mBlCyy/IKDJ+Lc3wbWeaXtuQ==", "requires": { - "is-obj": "1.0.1" + "is-obj": "^1.0.0" } }, "duplexer3": { @@ -2141,10 +2141,10 @@ "integrity": "sha512-07z8uv2wMyS51kKhD1KsdXJg5WQ6t93RneqRxUHnskXVtlYYkLqM0gqStQZ3pj073g687jPCHrqNfCzawLYh5g==", "dev": true, "requires": { - "end-of-stream": "1.4.1", - "inherits": "2.0.3", - "readable-stream": "2.3.6", - "stream-shift": "1.0.0" + "end-of-stream": "^1.0.0", + "inherits": "^2.0.1", + "readable-stream": "^2.0.0", + "stream-shift": "^1.0.0" } }, "ecc-jsbn": { @@ -2152,8 +2152,8 @@ "resolved": "https://registry.npmjs.org/ecc-jsbn/-/ecc-jsbn-0.1.2.tgz", "integrity": "sha1-OoOpBOVDUyh4dMVkt1SThoSamMk=", "requires": { - "jsbn": "0.1.1", - "safer-buffer": "2.1.2" + "jsbn": "~0.1.0", + "safer-buffer": "^2.1.0" } }, "ee-first": { @@ -2172,13 +2172,13 @@ "integrity": "sha512-BsXLz5sqX8OHcsh7CqBMztyXARmGQ3LWPtGjJi6DiJHq5C/qvi9P3OqgswKSDftbu8+IoI/QDTAm2fFnQ9SZSQ==", "dev": true, "requires": { - "bn.js": "4.11.8", - "brorand": "1.1.0", - "hash.js": "1.1.7", - "hmac-drbg": "1.0.1", - "inherits": "2.0.3", - "minimalistic-assert": "1.0.1", - "minimalistic-crypto-utils": "1.0.1" + "bn.js": "^4.4.0", + "brorand": "^1.0.1", + "hash.js": "^1.0.0", + "hmac-drbg": "^1.0.0", + "inherits": "^2.0.1", + "minimalistic-assert": "^1.0.0", + "minimalistic-crypto-utils": "^1.0.0" } }, "emojis-list": { @@ -2197,7 +2197,7 @@ "integrity": "sha512-1MkrZNvWTKCaigbn+W15elq2BB/L22nqrSY5DKlo3X6+vclJm8Bb5djXJBmEX6fS3+zCh/F4VBK5Z2KxJt4s2Q==", "dev": true, "requires": { - "once": "1.4.0" + "once": "^1.4.0" } }, "enhanced-resolve": { @@ -2206,9 +2206,9 @@ "integrity": "sha512-F/7vkyTtyc/llOIn8oWclcB25KdRaiPBpZYDgJHgh/UHtpgT2p2eldQgtQnLtUvfMKPKxbRaQM/hHkvLHt1Vng==", "dev": true, "requires": { - "graceful-fs": "4.1.15", - "memory-fs": "0.4.1", - "tapable": "1.1.1" + "graceful-fs": "^4.1.2", + "memory-fs": "^0.4.0", + "tapable": "^1.0.0" } }, "envify": { @@ -2216,8 +2216,8 @@ "resolved": "https://registry.npmjs.org/envify/-/envify-3.4.1.tgz", "integrity": "sha1-1xIjKejfFoi6dxsSUBkXyc5cvOg=", "requires": { - "jstransform": "11.0.3", - "through": "2.3.8" + "jstransform": "^11.0.3", + "through": "~2.3.4" } }, "errno": { @@ -2226,7 +2226,7 @@ "integrity": "sha512-MfrRBDWzIWifgq6tJj60gkAwtLNb6sQPlcFrSOflcP1aFmmruKQ2wRnze/8V6kgyz7H3FF8Npzv78mZ7XLLflg==", "dev": true, "requires": { - "prr": "1.0.1" + "prr": "~1.0.1" } }, "error-ex": { @@ -2234,7 +2234,7 @@ "resolved": "https://registry.npmjs.org/error-ex/-/error-ex-1.3.2.tgz", "integrity": "sha512-7dFHNmqeFSEt2ZBsCriorKnn3Z2pj+fd9kmI6QoWw4//DL+icEBfc0U7qJCisqrTsKTjw4fNFy2pW9OqStD84g==", "requires": { - "is-arrayish": "0.2.1" + "is-arrayish": "^0.2.1" } }, "es5-ext": { @@ -2243,9 +2243,9 @@ "integrity": "sha512-/1TItLfj+TTfWoeRcDn/0FbGV6SNo4R+On2GGVucPU/j3BWnXE2Co8h8CTo4Tu34gFJtnmwS9xiScKs4EjZhdw==", "dev": true, "requires": { - "es6-iterator": "2.0.3", - "es6-symbol": "3.1.1", - "next-tick": "1.0.0" + "es6-iterator": "~2.0.3", + "es6-symbol": "~3.1.1", + "next-tick": "1" } }, "es6-iterator": { @@ -2254,9 +2254,9 @@ "integrity": "sha1-p96IkUGgWpSwhUQDstCg+/qY87c=", "dev": true, "requires": { - "d": "1.0.0", - "es5-ext": "0.10.47", - "es6-symbol": "3.1.1" + "d": "1", + "es5-ext": "^0.10.35", + "es6-symbol": "^3.1.1" } }, "es6-symbol": { @@ -2265,8 +2265,8 @@ "integrity": "sha1-vwDvT9q2uhtG7Le2KbTH7VcVzHc=", "dev": true, "requires": { - "d": "1.0.0", - "es5-ext": "0.10.47" + "d": "1", + "es5-ext": "~0.10.14" } }, "escape-html": { @@ -2285,8 +2285,8 @@ "integrity": "sha512-1G6UTDi7Jc1ELFwnR58HV4fK9OQK4S6N985f166xqXxpjU6plxFISJa2Ba9KCQuFa8RCnj/lSFJbHo7UFDBnUA==", "dev": true, "requires": { - "esrecurse": "4.2.1", - "estraverse": "4.2.0" + "esrecurse": "^4.1.0", + "estraverse": "^4.1.1" } }, "esprima-fb": { @@ -2300,7 +2300,7 @@ "integrity": "sha512-64RBB++fIOAXPw3P9cy89qfMlvZEXZkqqJkjqqXIvzP5ezRZjW+lPWjw35UX/3EhUPFYbg5ER4JYgDw4007/DQ==", "dev": true, "requires": { - "estraverse": "4.2.0" + "estraverse": "^4.1.0" } }, "estraverse": { @@ -2331,7 +2331,7 @@ "integrity": "sha512-4Ln17+vVT0k8aWq+t/bF5arcS3EpT9gYtW66EPacdj/mAFevznsnyoHLPy2BA8gbIQeIHoPsvwmfBftfcG//BQ==", "dev": true, "requires": { - "original": "1.0.2" + "original": "^1.0.0" } }, "evp_bytestokey": { @@ -2340,8 +2340,8 @@ "integrity": "sha512-/f2Go4TognH/KvCISP7OUsHn85hT9nUkxxA9BEWxFn+Oj9o8ZNLm/40hdlgSLyuOimsrTKLUMEorQexp/aPQeA==", "dev": true, "requires": { - "md5.js": "1.3.5", - "safe-buffer": "5.1.2" + "md5.js": "^1.3.4", + "safe-buffer": "^5.1.1" } }, "execa": { @@ -2350,13 +2350,13 @@ "integrity": "sha512-adbxcyWV46qiHyvSp50TKt05tB4tK3HcmF7/nxfAdhnox83seTDbwnaqKO4sXRy7roHAIFqJP/Rw/AuEbX61LA==", "dev": true, "requires": { - "cross-spawn": "6.0.5", - "get-stream": "4.1.0", - "is-stream": "1.1.0", - "npm-run-path": "2.0.2", - "p-finally": "1.0.0", - "signal-exit": "3.0.2", - "strip-eof": "1.0.0" + "cross-spawn": "^6.0.0", + "get-stream": "^4.0.0", + "is-stream": "^1.1.0", + "npm-run-path": "^2.0.0", + "p-finally": "^1.0.0", + "signal-exit": "^3.0.0", + "strip-eof": "^1.0.0" }, "dependencies": { "cross-spawn": { @@ -2365,11 +2365,11 @@ "integrity": "sha512-eTVLrBSt7fjbDygz805pMnstIs2VTBNkRm0qxZd+M7A5XDdxVRWO5MxGBXZhjY4cqLYLdtrGqRf8mBPmzwSpWQ==", "dev": true, "requires": { - "nice-try": "1.0.5", - "path-key": "2.0.1", - "semver": "5.6.0", - "shebang-command": "1.2.0", - "which": "1.3.1" + "nice-try": "^1.0.4", + "path-key": "^2.0.1", + "semver": "^5.5.0", + "shebang-command": "^1.2.0", + "which": "^1.2.9" } } } @@ -2384,13 +2384,13 @@ "resolved": "https://registry.npmjs.org/expand-brackets/-/expand-brackets-2.1.4.tgz", "integrity": "sha1-t3c14xXOMPa27/D4OwQVGiJEliI=", "requires": { - "debug": "2.6.9", - "define-property": "0.2.5", - "extend-shallow": "2.0.1", - "posix-character-classes": "0.1.1", - "regex-not": "1.0.2", - "snapdragon": "0.8.2", - "to-regex": "3.0.2" + "debug": "^2.3.3", + "define-property": "^0.2.5", + "extend-shallow": "^2.0.1", + "posix-character-classes": "^0.1.0", + "regex-not": "^1.0.0", + "snapdragon": "^0.8.1", + "to-regex": "^3.0.1" }, "dependencies": { "define-property": { @@ -2398,7 +2398,7 @@ "resolved": "https://registry.npmjs.org/define-property/-/define-property-0.2.5.tgz", "integrity": "sha1-w1se+RjsPJkPmlvFe+BKrOxcgRY=", "requires": { - "is-descriptor": "0.1.6" + "is-descriptor": "^0.1.0" } }, "extend-shallow": { @@ -2406,7 +2406,7 @@ "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz", "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=", "requires": { - "is-extendable": "0.1.1" + "is-extendable": "^0.1.0" } } } @@ -2417,7 +2417,7 @@ "integrity": "sha1-l+gBqgUt8CRU3kawK/YhZCzchQI=", "dev": true, "requires": { - "homedir-polyfill": "1.0.1" + "homedir-polyfill": "^1.0.1" } }, "express": { @@ -2425,41 +2425,41 @@ "resolved": "https://registry.npmjs.org/express/-/express-4.16.4.tgz", "integrity": "sha512-j12Uuyb4FMrd/qQAm6uCHAkPtO8FDTRJZBDd5D2KOL2eLaz1yUNdUB/NOIyq0iU4q4cFarsUCrnFDPBcnksuOg==", "requires": { - "accepts": "1.3.5", + "accepts": "~1.3.5", "array-flatten": "1.1.1", "body-parser": "1.18.3", "content-disposition": "0.5.2", - "content-type": "1.0.4", + "content-type": "~1.0.4", "cookie": "0.3.1", "cookie-signature": "1.0.6", "debug": "2.6.9", - "depd": "1.1.2", - "encodeurl": "1.0.2", - "escape-html": "1.0.3", - "etag": "1.8.1", + "depd": "~1.1.2", + "encodeurl": "~1.0.2", + "escape-html": "~1.0.3", + "etag": "~1.8.1", "finalhandler": "1.1.1", "fresh": "0.5.2", "merge-descriptors": "1.0.1", - "methods": "1.1.2", - "on-finished": "2.3.0", - "parseurl": "1.3.2", + "methods": "~1.1.2", + "on-finished": "~2.3.0", + "parseurl": "~1.3.2", "path-to-regexp": "0.1.7", - "proxy-addr": "2.0.4", + "proxy-addr": "~2.0.4", "qs": "6.5.2", - "range-parser": "1.2.0", + "range-parser": "~1.2.0", "safe-buffer": "5.1.2", "send": "0.16.2", "serve-static": "1.13.2", "setprototypeof": "1.1.0", - "statuses": "1.4.0", - "type-is": "1.6.16", + "statuses": "~1.4.0", + "type-is": "~1.6.16", "utils-merge": "1.0.1", - "vary": "1.1.2" + "vary": "~1.1.2" }, "dependencies": { "array-flatten": { "version": "1.1.1", - "resolved": "http://registry.npmjs.org/array-flatten/-/array-flatten-1.1.1.tgz", + "resolved": "https://registry.npmjs.org/array-flatten/-/array-flatten-1.1.1.tgz", "integrity": "sha1-ml9pkFGx5wczKPKgCJaLZOopVdI=" } } @@ -2474,8 +2474,8 @@ "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-3.0.2.tgz", "integrity": "sha1-Jqcarwc7OfshJxcnRhMcJwQCjbg=", "requires": { - "assign-symbols": "1.0.0", - "is-extendable": "1.0.1" + "assign-symbols": "^1.0.0", + "is-extendable": "^1.0.1" }, "dependencies": { "is-extendable": { @@ -2483,7 +2483,7 @@ "resolved": "https://registry.npmjs.org/is-extendable/-/is-extendable-1.0.1.tgz", "integrity": "sha512-arnXMxT1hhoKo9k1LZdmlNyJdDDfy2v0fXjFlmok4+i8ul/6WlbVge9bhM74OpNPQPMGUToDtz+KXa1PneJxOA==", "requires": { - "is-plain-object": "2.0.4" + "is-plain-object": "^2.0.4" } } } @@ -2493,14 +2493,14 @@ "resolved": "https://registry.npmjs.org/extglob/-/extglob-2.0.4.tgz", "integrity": "sha512-Nmb6QXkELsuBr24CJSkilo6UHHgbekK5UiZgfE6UHD3Eb27YC6oD+bhcT+tJ6cl8dmsgdQxnWlcry8ksBIBLpw==", "requires": { - "array-unique": "0.3.2", - "define-property": "1.0.0", - "expand-brackets": "2.1.4", - "extend-shallow": "2.0.1", - "fragment-cache": "0.2.1", - "regex-not": "1.0.2", - "snapdragon": "0.8.2", - "to-regex": "3.0.2" + "array-unique": "^0.3.2", + "define-property": "^1.0.0", + "expand-brackets": "^2.1.4", + "extend-shallow": "^2.0.1", + "fragment-cache": "^0.2.1", + "regex-not": "^1.0.0", + "snapdragon": "^0.8.1", + "to-regex": "^3.0.1" }, "dependencies": { "define-property": { @@ -2508,7 +2508,7 @@ "resolved": "https://registry.npmjs.org/define-property/-/define-property-1.0.0.tgz", "integrity": "sha1-dp66rz9KY6rTr56NMEybvnm/sOY=", "requires": { - "is-descriptor": "1.0.2" + "is-descriptor": "^1.0.0" } }, "extend-shallow": { @@ -2516,7 +2516,7 @@ "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz", "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=", "requires": { - "is-extendable": "0.1.1" + "is-extendable": "^0.1.0" } }, "is-accessor-descriptor": { @@ -2524,7 +2524,7 @@ "resolved": "https://registry.npmjs.org/is-accessor-descriptor/-/is-accessor-descriptor-1.0.0.tgz", "integrity": "sha512-m5hnHTkcVsPfqx3AKlyttIPb7J+XykHvJP2B9bZDjlhLIoEq4XoK64Vg7boZlVWYK6LUY94dYPEE7Lh0ZkZKcQ==", "requires": { - "kind-of": "6.0.2" + "kind-of": "^6.0.0" } }, "is-data-descriptor": { @@ -2532,7 +2532,7 @@ "resolved": "https://registry.npmjs.org/is-data-descriptor/-/is-data-descriptor-1.0.0.tgz", "integrity": "sha512-jbRXy1FmtAoCjQkVmIVYwuuqDFUbaOeDjmed1tOGPrsMhtJA4rD9tkgA0F1qJ3gRFRXcHYVkdeaP50Q5rE/jLQ==", "requires": { - "kind-of": "6.0.2" + "kind-of": "^6.0.0" } }, "is-descriptor": { @@ -2540,9 +2540,9 @@ "resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-1.0.2.tgz", "integrity": "sha512-2eis5WqQGV7peooDyLmNEPUrps9+SXX5c9pL3xEB+4e9HnGuDa7mB7kHxHw4CbqS9k1T2hOH3miL8n8WtiYVtg==", "requires": { - "is-accessor-descriptor": "1.0.0", - "is-data-descriptor": "1.0.0", - "kind-of": "6.0.2" + "is-accessor-descriptor": "^1.0.0", + "is-data-descriptor": "^1.0.0", + "kind-of": "^6.0.2" } } } @@ -2574,7 +2574,7 @@ "integrity": "sha1-TkkvjQTftviQA1B/btvy1QHnxvQ=", "dev": true, "requires": { - "websocket-driver": "0.7.0" + "websocket-driver": ">=0.5.1" } }, "fbjs": { @@ -2582,11 +2582,11 @@ "resolved": "https://registry.npmjs.org/fbjs/-/fbjs-0.6.1.tgz", "integrity": "sha1-lja3cF9bqWhNRLcveDISVK/IYPc=", "requires": { - "core-js": "1.2.7", - "loose-envify": "1.4.0", - "promise": "7.3.1", - "ua-parser-js": "0.7.19", - "whatwg-fetch": "0.9.0" + "core-js": "^1.0.0", + "loose-envify": "^1.0.0", + "promise": "^7.0.3", + "ua-parser-js": "^0.7.9", + "whatwg-fetch": "^0.9.0" } }, "figgy-pudding": { @@ -2600,10 +2600,10 @@ "resolved": "https://registry.npmjs.org/fill-range/-/fill-range-4.0.0.tgz", "integrity": "sha1-1USBHUKPmOsGpj3EAtJAPDKMOPc=", "requires": { - "extend-shallow": "2.0.1", - "is-number": "3.0.0", - "repeat-string": "1.6.1", - "to-regex-range": "2.1.1" + "extend-shallow": "^2.0.1", + "is-number": "^3.0.0", + "repeat-string": "^1.6.1", + "to-regex-range": "^2.1.0" }, "dependencies": { "extend-shallow": { @@ -2611,23 +2611,23 @@ "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz", "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=", "requires": { - "is-extendable": "0.1.1" + "is-extendable": "^0.1.0" } } } }, "finalhandler": { "version": "1.1.1", - "resolved": "http://registry.npmjs.org/finalhandler/-/finalhandler-1.1.1.tgz", + "resolved": "https://registry.npmjs.org/finalhandler/-/finalhandler-1.1.1.tgz", "integrity": "sha512-Y1GUDo39ez4aHAw7MysnUD5JzYX+WaIj8I57kO3aEPT1fFRL4sr7mjei97FgnwhAyyzRYmQZaTHb2+9uZ1dPtg==", "requires": { "debug": "2.6.9", - "encodeurl": "1.0.2", - "escape-html": "1.0.3", - "on-finished": "2.3.0", - "parseurl": "1.3.2", - "statuses": "1.4.0", - "unpipe": "1.0.0" + "encodeurl": "~1.0.2", + "escape-html": "~1.0.3", + "on-finished": "~2.3.0", + "parseurl": "~1.3.2", + "statuses": "~1.4.0", + "unpipe": "~1.0.0" } }, "find-cache-dir": { @@ -2636,9 +2636,9 @@ "integrity": "sha1-kojj6ePMN0hxfTnq3hfPcfww7m8=", "dev": true, "requires": { - "commondir": "1.0.1", - "make-dir": "1.3.0", - "pkg-dir": "2.0.0" + "commondir": "^1.0.1", + "make-dir": "^1.0.0", + "pkg-dir": "^2.0.0" } }, "find-up": { @@ -2646,8 +2646,8 @@ "resolved": "https://registry.npmjs.org/find-up/-/find-up-1.1.2.tgz", "integrity": "sha1-ay6YIrGizgpgq2TWEOzK1TyyTQ8=", "requires": { - "path-exists": "2.1.0", - "pinkie-promise": "2.0.1" + "path-exists": "^2.0.0", + "pinkie-promise": "^2.0.0" } }, "findup-sync": { @@ -2656,10 +2656,10 @@ "integrity": "sha1-kyaxSIwi0aYIhlCoaQGy2akKLLw=", "dev": true, "requires": { - "detect-file": "1.0.0", - "is-glob": "3.1.0", - "micromatch": "3.1.10", - "resolve-dir": "1.0.1" + "detect-file": "^1.0.0", + "is-glob": "^3.1.0", + "micromatch": "^3.0.4", + "resolve-dir": "^1.0.1" }, "dependencies": { "is-glob": { @@ -2668,7 +2668,7 @@ "integrity": "sha1-e6WuJCF4BKxwcHuWkiVnSGzD6Eo=", "dev": true, "requires": { - "is-extglob": "2.1.1" + "is-extglob": "^2.1.0" } } } @@ -2684,8 +2684,8 @@ "integrity": "sha512-6MHED/cmsyux1G4/Cek2Z776y9t7WCNd3h2h/HW91vFeU7pzMhA8XvAlDhHcanG5IWuIh/xcC7JASY4WQpG6xg==", "dev": true, "requires": { - "inherits": "2.0.3", - "readable-stream": "3.1.1" + "inherits": "^2.0.3", + "readable-stream": "^3.1.1" }, "dependencies": { "readable-stream": { @@ -2694,9 +2694,9 @@ "integrity": "sha512-DkN66hPyqDhnIQ6Jcsvx9bFjhw214O4poMBcIMgPVpQvNy9a0e0Uhg5SqySyDKAmUlwt8LonTBz1ezOnM8pUdA==", "dev": true, "requires": { - "inherits": "2.0.3", - "string_decoder": "1.1.1", - "util-deprecate": "1.0.2" + "inherits": "^2.0.3", + "string_decoder": "^1.1.1", + "util-deprecate": "^1.0.1" } } } @@ -2707,7 +2707,7 @@ "integrity": "sha512-t2JCjbzxQpWvbhts3l6SH1DKzSrx8a+SsaVf4h6bG4kOXUuPYS/kg2Lr4gQSb7eemaHqJkOThF1BGyjlUkO1GQ==", "dev": true, "requires": { - "debug": "3.1.0" + "debug": "=3.1.0" }, "dependencies": { "debug": { @@ -2732,7 +2732,7 @@ "integrity": "sha1-xjMy9BXO3EsE2/5wz4NklMU8tEs=", "dev": true, "requires": { - "for-in": "1.0.2" + "for-in": "^1.0.1" } }, "forever-agent": { @@ -2745,9 +2745,9 @@ "resolved": "https://registry.npmjs.org/form-data/-/form-data-2.3.3.tgz", "integrity": "sha512-1lLKB2Mu3aGP1Q/2eCOx0fNbRMe7XdwktwOruhfqqd0rIJWwN4Dh+E3hrPSlDCXnSR7UtZ1N38rVXm+6+MEhJQ==", "requires": { - "asynckit": "0.4.0", - "combined-stream": "1.0.7", - "mime-types": "2.1.21" + "asynckit": "^0.4.0", + "combined-stream": "^1.0.6", + "mime-types": "^2.1.12" } }, "forwarded": { @@ -2760,7 +2760,7 @@ "resolved": "https://registry.npmjs.org/fragment-cache/-/fragment-cache-0.2.1.tgz", "integrity": "sha1-QpD60n8T6Jvn8zeZxrxaCr//DRk=", "requires": { - "map-cache": "0.2.2" + "map-cache": "^0.2.2" } }, "fresh": { @@ -2774,8 +2774,8 @@ "integrity": "sha1-i/tVAr3kpNNs/e6gB/zKIdfjgq8=", "dev": true, "requires": { - "inherits": "2.0.3", - "readable-stream": "2.3.6" + "inherits": "^2.0.1", + "readable-stream": "^2.0.0" } }, "fs-write-stream-atomic": { @@ -2784,10 +2784,10 @@ "integrity": "sha1-tH31NJPvkR33VzHnCp3tAYnbQMk=", "dev": true, "requires": { - "graceful-fs": "4.1.15", - "iferr": "0.1.5", - "imurmurhash": "0.1.4", - "readable-stream": "2.3.6" + "graceful-fs": "^4.1.2", + "iferr": "^0.1.5", + "imurmurhash": "^0.1.4", + "readable-stream": "1 || 2" } }, "fs.realpath": { @@ -2801,8 +2801,8 @@ "integrity": "sha512-Pxm6sI2MeBD7RdD12RYsqaP0nMiwx8eZBXCa6z2L+mRHm2DYrOYwihmhjpkdjUHwQhslWQjRpEgNq4XvBmaAuw==", "optional": true, "requires": { - "nan": "2.12.1", - "node-pre-gyp": "0.10.3" + "nan": "^2.9.2", + "node-pre-gyp": "^0.10.0" }, "dependencies": { "abbrev": { @@ -2824,8 +2824,8 @@ "bundled": true, "optional": true, "requires": { - "delegates": "1.0.0", - "readable-stream": "2.3.6" + "delegates": "^1.0.0", + "readable-stream": "^2.0.6" } }, "balanced-match": { @@ -2836,7 +2836,7 @@ "version": "1.1.11", "bundled": true, "requires": { - "balanced-match": "1.0.0", + "balanced-match": "^1.0.0", "concat-map": "0.0.1" } }, @@ -2890,7 +2890,7 @@ "bundled": true, "optional": true, "requires": { - "minipass": "2.3.5" + "minipass": "^2.2.1" } }, "fs.realpath": { @@ -2903,14 +2903,14 @@ "bundled": true, "optional": true, "requires": { - "aproba": "1.2.0", - "console-control-strings": "1.1.0", - "has-unicode": "2.0.1", - "object-assign": "4.1.1", - "signal-exit": "3.0.2", - "string-width": "1.0.2", - "strip-ansi": "3.0.1", - "wide-align": "1.1.3" + "aproba": "^1.0.3", + "console-control-strings": "^1.0.0", + "has-unicode": "^2.0.0", + "object-assign": "^4.1.0", + "signal-exit": "^3.0.0", + "string-width": "^1.0.1", + "strip-ansi": "^3.0.1", + "wide-align": "^1.1.0" } }, "glob": { @@ -2918,12 +2918,12 @@ "bundled": true, "optional": true, "requires": { - "fs.realpath": "1.0.0", - "inflight": "1.0.6", - "inherits": "2.0.3", - "minimatch": "3.0.4", - "once": "1.4.0", - "path-is-absolute": "1.0.1" + "fs.realpath": "^1.0.0", + "inflight": "^1.0.4", + "inherits": "2", + "minimatch": "^3.0.4", + "once": "^1.3.0", + "path-is-absolute": "^1.0.0" } }, "has-unicode": { @@ -2936,7 +2936,7 @@ "bundled": true, "optional": true, "requires": { - "safer-buffer": "2.1.2" + "safer-buffer": ">= 2.1.2 < 3" } }, "ignore-walk": { @@ -2944,7 +2944,7 @@ "bundled": true, "optional": true, "requires": { - "minimatch": "3.0.4" + "minimatch": "^3.0.4" } }, "inflight": { @@ -2952,8 +2952,8 @@ "bundled": true, "optional": true, "requires": { - "once": "1.4.0", - "wrappy": "1.0.2" + "once": "^1.3.0", + "wrappy": "1" } }, "inherits": { @@ -2969,7 +2969,7 @@ "version": "1.0.0", "bundled": true, "requires": { - "number-is-nan": "1.0.1" + "number-is-nan": "^1.0.0" } }, "isarray": { @@ -2981,7 +2981,7 @@ "version": "3.0.4", "bundled": true, "requires": { - "brace-expansion": "1.1.11" + "brace-expansion": "^1.1.7" } }, "minimist": { @@ -2992,8 +2992,8 @@ "version": "2.3.5", "bundled": true, "requires": { - "safe-buffer": "5.1.2", - "yallist": "3.0.3" + "safe-buffer": "^5.1.2", + "yallist": "^3.0.0" } }, "minizlib": { @@ -3001,7 +3001,7 @@ "bundled": true, "optional": true, "requires": { - "minipass": "2.3.5" + "minipass": "^2.2.1" } }, "mkdirp": { @@ -3021,9 +3021,9 @@ "bundled": true, "optional": true, "requires": { - "debug": "2.6.9", - "iconv-lite": "0.4.24", - "sax": "1.2.4" + "debug": "^2.1.2", + "iconv-lite": "^0.4.4", + "sax": "^1.2.4" } }, "node-pre-gyp": { @@ -3031,16 +3031,16 @@ "bundled": true, "optional": true, "requires": { - "detect-libc": "1.0.3", - "mkdirp": "0.5.1", - "needle": "2.2.4", - "nopt": "4.0.1", - "npm-packlist": "1.2.0", - "npmlog": "4.1.2", - "rc": "1.2.8", - "rimraf": "2.6.3", - "semver": "5.6.0", - "tar": "4.4.8" + "detect-libc": "^1.0.2", + "mkdirp": "^0.5.1", + "needle": "^2.2.1", + "nopt": "^4.0.1", + "npm-packlist": "^1.1.6", + "npmlog": "^4.0.2", + "rc": "^1.2.7", + "rimraf": "^2.6.1", + "semver": "^5.3.0", + "tar": "^4" } }, "nopt": { @@ -3048,8 +3048,8 @@ "bundled": true, "optional": true, "requires": { - "abbrev": "1.1.1", - "osenv": "0.1.5" + "abbrev": "1", + "osenv": "^0.1.4" } }, "npm-bundled": { @@ -3062,8 +3062,8 @@ "bundled": true, "optional": true, "requires": { - "ignore-walk": "3.0.1", - "npm-bundled": "1.0.5" + "ignore-walk": "^3.0.1", + "npm-bundled": "^1.0.1" } }, "npmlog": { @@ -3071,10 +3071,10 @@ "bundled": true, "optional": true, "requires": { - "are-we-there-yet": "1.1.5", - "console-control-strings": "1.1.0", - "gauge": "2.7.4", - "set-blocking": "2.0.0" + "are-we-there-yet": "~1.1.2", + "console-control-strings": "~1.1.0", + "gauge": "~2.7.3", + "set-blocking": "~2.0.0" } }, "number-is-nan": { @@ -3090,7 +3090,7 @@ "version": "1.4.0", "bundled": true, "requires": { - "wrappy": "1.0.2" + "wrappy": "1" } }, "os-homedir": { @@ -3108,8 +3108,8 @@ "bundled": true, "optional": true, "requires": { - "os-homedir": "1.0.2", - "os-tmpdir": "1.0.2" + "os-homedir": "^1.0.0", + "os-tmpdir": "^1.0.0" } }, "path-is-absolute": { @@ -3127,10 +3127,10 @@ "bundled": true, "optional": true, "requires": { - "deep-extend": "0.6.0", - "ini": "1.3.5", - "minimist": "1.2.0", - "strip-json-comments": "2.0.1" + "deep-extend": "^0.6.0", + "ini": "~1.3.0", + "minimist": "^1.2.0", + "strip-json-comments": "~2.0.1" }, "dependencies": { "minimist": { @@ -3145,13 +3145,13 @@ "bundled": true, "optional": true, "requires": { - "core-util-is": "1.0.2", - "inherits": "2.0.3", - "isarray": "1.0.0", - "process-nextick-args": "2.0.0", - "safe-buffer": "5.1.2", - "string_decoder": "1.1.1", - "util-deprecate": "1.0.2" + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" } }, "rimraf": { @@ -3159,7 +3159,7 @@ "bundled": true, "optional": true, "requires": { - "glob": "7.1.3" + "glob": "^7.1.3" } }, "safe-buffer": { @@ -3195,9 +3195,9 @@ "version": "1.0.2", "bundled": true, "requires": { - "code-point-at": "1.1.0", - "is-fullwidth-code-point": "1.0.0", - "strip-ansi": "3.0.1" + "code-point-at": "^1.0.0", + "is-fullwidth-code-point": "^1.0.0", + "strip-ansi": "^3.0.0" } }, "string_decoder": { @@ -3205,14 +3205,14 @@ "bundled": true, "optional": true, "requires": { - "safe-buffer": "5.1.2" + "safe-buffer": "~5.1.0" } }, "strip-ansi": { "version": "3.0.1", "bundled": true, "requires": { - "ansi-regex": "2.1.1" + "ansi-regex": "^2.0.0" } }, "strip-json-comments": { @@ -3225,13 +3225,13 @@ "bundled": true, "optional": true, "requires": { - "chownr": "1.1.1", - "fs-minipass": "1.2.5", - "minipass": "2.3.5", - "minizlib": "1.2.1", - "mkdirp": "0.5.1", - "safe-buffer": "5.1.2", - "yallist": "3.0.3" + "chownr": "^1.1.1", + "fs-minipass": "^1.2.5", + "minipass": "^2.3.4", + "minizlib": "^1.1.1", + "mkdirp": "^0.5.0", + "safe-buffer": "^5.1.2", + "yallist": "^3.0.2" } }, "util-deprecate": { @@ -3244,7 +3244,7 @@ "bundled": true, "optional": true, "requires": { - "string-width": "1.0.2" + "string-width": "^1.0.2 || 2" } }, "wrappy": { @@ -3262,10 +3262,10 @@ "resolved": "https://registry.npmjs.org/fstream/-/fstream-1.0.11.tgz", "integrity": "sha1-XB+x8RdHcRTwYyoOtLcbPLD9MXE=", "requires": { - "graceful-fs": "4.1.15", - "inherits": "2.0.3", - "mkdirp": "0.5.1", - "rimraf": "2.6.3" + "graceful-fs": "^4.1.2", + "inherits": "~2.0.0", + "mkdirp": ">=0.5 0", + "rimraf": "2" } }, "function-bind": { @@ -3279,14 +3279,14 @@ "resolved": "https://registry.npmjs.org/gauge/-/gauge-2.7.4.tgz", "integrity": "sha1-LANAXHU4w51+s3sxcCLjJfsBi/c=", "requires": { - "aproba": "1.2.0", - "console-control-strings": "1.1.0", - "has-unicode": "2.0.1", - "object-assign": "4.1.1", - "signal-exit": "3.0.2", - "string-width": "1.0.2", - "strip-ansi": "3.0.1", - "wide-align": "1.1.3" + "aproba": "^1.0.3", + "console-control-strings": "^1.0.0", + "has-unicode": "^2.0.0", + "object-assign": "^4.1.0", + "signal-exit": "^3.0.0", + "string-width": "^1.0.1", + "strip-ansi": "^3.0.1", + "wide-align": "^1.1.0" } }, "gaze": { @@ -3294,7 +3294,7 @@ "resolved": "https://registry.npmjs.org/gaze/-/gaze-1.1.3.tgz", "integrity": "sha512-BRdNm8hbWzFzWHERTrejLqwHDfS4GibPoq5wjTPIoJHoBtKGPg3xAFfxmM+9ztbXelxcf2hwQcaz1PtmFeue8g==", "requires": { - "globule": "1.2.1" + "globule": "^1.0.0" } }, "get-caller-file": { @@ -3324,7 +3324,7 @@ "integrity": "sha512-GMat4EJ5161kIy2HevLlr4luNjBgvmj413KaQA7jt4V8B4RDsfpHk7WQ9GVqfYyyx8OS/L66Kox+rJRNklLK7w==", "dev": true, "requires": { - "pump": "3.0.0" + "pump": "^3.0.0" }, "dependencies": { "pump": { @@ -3333,8 +3333,8 @@ "integrity": "sha512-LwZy+p3SFs1Pytd/jYct4wpv49HiYCqd9Rlc5ZVdk0V+8Yzv6jR5Blk3TRmPL1ft69TxP0IMZGJ+WPFU2BFhww==", "dev": true, "requires": { - "end-of-stream": "1.4.1", - "once": "1.4.0" + "end-of-stream": "^1.1.0", + "once": "^1.3.1" } } } @@ -3349,7 +3349,7 @@ "resolved": "https://registry.npmjs.org/getpass/-/getpass-0.1.7.tgz", "integrity": "sha1-Xv+OPmhNVprkyysSgmBOi6YhSfo=", "requires": { - "assert-plus": "1.0.0" + "assert-plus": "^1.0.0" } }, "glob": { @@ -3357,12 +3357,12 @@ "resolved": "https://registry.npmjs.org/glob/-/glob-7.1.3.tgz", "integrity": "sha512-vcfuiIxogLV4DlGBHIUOwI0IbrJ8HWPc4MU7HzviGeNho/UJDfi6B5p3sHeWIQ0KGIU0Jpxi5ZHxemQfLkkAwQ==", "requires": { - "fs.realpath": "1.0.0", - "inflight": "1.0.6", - "inherits": "2.0.3", - "minimatch": "3.0.4", - "once": "1.4.0", - "path-is-absolute": "1.0.1" + "fs.realpath": "^1.0.0", + "inflight": "^1.0.4", + "inherits": "2", + "minimatch": "^3.0.4", + "once": "^1.3.0", + "path-is-absolute": "^1.0.0" } }, "glob-parent": { @@ -3370,8 +3370,8 @@ "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-3.1.0.tgz", "integrity": "sha1-nmr2KZ2NO9K9QEMIMr0RPfkGxa4=", "requires": { - "is-glob": "3.1.0", - "path-dirname": "1.0.2" + "is-glob": "^3.1.0", + "path-dirname": "^1.0.0" }, "dependencies": { "is-glob": { @@ -3379,7 +3379,7 @@ "resolved": "https://registry.npmjs.org/is-glob/-/is-glob-3.1.0.tgz", "integrity": "sha1-e6WuJCF4BKxwcHuWkiVnSGzD6Eo=", "requires": { - "is-extglob": "2.1.1" + "is-extglob": "^2.1.0" } } } @@ -3389,7 +3389,7 @@ "resolved": "https://registry.npmjs.org/global-dirs/-/global-dirs-0.1.1.tgz", "integrity": "sha1-sxnA3UYH81PzvpzKTHL8FIxJ9EU=", "requires": { - "ini": "1.3.5" + "ini": "^1.3.4" } }, "global-modules": { @@ -3398,9 +3398,9 @@ "integrity": "sha512-sKzpEkf11GpOFuw0Zzjzmt4B4UZwjOcG757PPvrfhxcLFbq0wpsgpOqxpxtxFiCG4DtG93M6XRVbF2oGdev7bg==", "dev": true, "requires": { - "global-prefix": "1.0.2", - "is-windows": "1.0.2", - "resolve-dir": "1.0.1" + "global-prefix": "^1.0.1", + "is-windows": "^1.0.1", + "resolve-dir": "^1.0.0" } }, "global-modules-path": { @@ -3415,11 +3415,11 @@ "integrity": "sha1-2/dDxsFJklk8ZVVoy2btMsASLr4=", "dev": true, "requires": { - "expand-tilde": "2.0.2", - "homedir-polyfill": "1.0.1", - "ini": "1.3.5", - "is-windows": "1.0.2", - "which": "1.3.1" + "expand-tilde": "^2.0.2", + "homedir-polyfill": "^1.0.1", + "ini": "^1.3.4", + "is-windows": "^1.0.1", + "which": "^1.2.14" } }, "globby": { @@ -3428,12 +3428,12 @@ "integrity": "sha1-+yzP+UAfhgCUXfral0QMypcrhoA=", "dev": true, "requires": { - "array-union": "1.0.2", - "dir-glob": "2.2.2", - "glob": "7.1.3", - "ignore": "3.3.10", - "pify": "3.0.0", - "slash": "1.0.0" + "array-union": "^1.0.1", + "dir-glob": "^2.0.0", + "glob": "^7.1.2", + "ignore": "^3.3.5", + "pify": "^3.0.0", + "slash": "^1.0.0" }, "dependencies": { "pify": { @@ -3449,9 +3449,9 @@ "resolved": "https://registry.npmjs.org/globule/-/globule-1.2.1.tgz", "integrity": "sha512-g7QtgWF4uYSL5/dn71WxubOrS7JVGCnFPEnoeChJmBnyR9Mw8nGoEwOgJL/RC2Te0WhbsEUCejfH8SZNJ+adYQ==", "requires": { - "glob": "7.1.3", - "lodash": "4.17.11", - "minimatch": "3.0.4" + "glob": "~7.1.1", + "lodash": "~4.17.10", + "minimatch": "~3.0.2" } }, "golden-layout": { @@ -3459,7 +3459,7 @@ "resolved": "https://registry.npmjs.org/golden-layout/-/golden-layout-1.5.9.tgz", "integrity": "sha1-o5vB9qZ+b4hreXwBbdkk6UJrp38=", "requires": { - "jquery": "3.3.1" + "jquery": "*" } }, "got": { @@ -3467,17 +3467,17 @@ "resolved": "https://registry.npmjs.org/got/-/got-6.7.1.tgz", "integrity": "sha1-JAzQV4WpoY5WHcG0S0HHY+8ejbA=", "requires": { - "create-error-class": "3.0.2", - "duplexer3": "0.1.4", - "get-stream": "3.0.0", - "is-redirect": "1.0.0", - "is-retry-allowed": "1.1.0", - "is-stream": "1.1.0", - "lowercase-keys": "1.0.1", - "safe-buffer": "5.1.2", - "timed-out": "4.0.1", - "unzip-response": "2.0.1", - "url-parse-lax": "1.0.0" + "create-error-class": "^3.0.0", + "duplexer3": "^0.1.4", + "get-stream": "^3.0.0", + "is-redirect": "^1.0.0", + "is-retry-allowed": "^1.0.0", + "is-stream": "^1.0.0", + "lowercase-keys": "^1.0.0", + "safe-buffer": "^5.0.1", + "timed-out": "^4.0.0", + "unzip-response": "^2.0.1", + "url-parse-lax": "^1.0.0" }, "dependencies": { "get-stream": { @@ -3514,8 +3514,8 @@ "resolved": "https://registry.npmjs.org/har-validator/-/har-validator-5.1.3.tgz", "integrity": "sha512-sNvOCzEQNr/qrvJgc3UG/kD4QtlHycrzwS+6mfTrrSq97BvaYcPZZI1ZSqGSPR73Cxn4LKTD4PttRwfU7jWq5g==", "requires": { - "ajv": "6.8.1", - "har-schema": "2.0.0" + "ajv": "^6.5.5", + "har-schema": "^2.0.0" } }, "has-ansi": { @@ -3523,7 +3523,7 @@ "resolved": "https://registry.npmjs.org/has-ansi/-/has-ansi-2.0.0.tgz", "integrity": "sha1-NPUEnOHs3ysGSa8+8k5F7TVBbZE=", "requires": { - "ansi-regex": "2.1.1" + "ansi-regex": "^2.0.0" } }, "has-flag": { @@ -3547,9 +3547,9 @@ "resolved": "https://registry.npmjs.org/has-value/-/has-value-1.0.0.tgz", "integrity": "sha1-GLKB2lhbHFxR3vJMkw7SmgvmsXc=", "requires": { - "get-value": "2.0.6", - "has-values": "1.0.0", - "isobject": "3.0.1" + "get-value": "^2.0.6", + "has-values": "^1.0.0", + "isobject": "^3.0.0" } }, "has-values": { @@ -3557,8 +3557,8 @@ "resolved": "https://registry.npmjs.org/has-values/-/has-values-1.0.0.tgz", "integrity": "sha1-lbC2P+whRmGab+V/51Yo1aOe/k8=", "requires": { - "is-number": "3.0.0", - "kind-of": "4.0.0" + "is-number": "^3.0.0", + "kind-of": "^4.0.0" }, "dependencies": { "kind-of": { @@ -3566,7 +3566,7 @@ "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-4.0.0.tgz", "integrity": "sha1-IIE989cSkosgc3hpGkUGb65y3Vc=", "requires": { - "is-buffer": "1.1.6" + "is-buffer": "^1.1.5" } } } @@ -3577,8 +3577,8 @@ "integrity": "sha1-X8hoaEfs1zSZQDMZprCj8/auSRg=", "dev": true, "requires": { - "inherits": "2.0.3", - "safe-buffer": "5.1.2" + "inherits": "^2.0.1", + "safe-buffer": "^5.0.1" } }, "hash.js": { @@ -3587,8 +3587,8 @@ "integrity": "sha512-taOaskGt4z4SOANNseOviYDvjEJinIkRgmp7LbKP2YTTmVxWBl87s/uzK9r+44BclBSp2X7K1hqeNfz9JbBeXA==", "dev": true, "requires": { - "inherits": "2.0.3", - "minimalistic-assert": "1.0.1" + "inherits": "^2.0.3", + "minimalistic-assert": "^1.0.1" } }, "he": { @@ -3603,9 +3603,9 @@ "integrity": "sha1-0nRXAQJabHdabFRXk+1QL8DGSaE=", "dev": true, "requires": { - "hash.js": "1.1.7", - "minimalistic-assert": "1.0.1", - "minimalistic-crypto-utils": "1.0.1" + "hash.js": "^1.0.3", + "minimalistic-assert": "^1.0.0", + "minimalistic-crypto-utils": "^1.0.1" } }, "hoist-non-react-statics": { @@ -3613,7 +3613,7 @@ "resolved": "https://registry.npmjs.org/hoist-non-react-statics/-/hoist-non-react-statics-3.3.0.tgz", "integrity": "sha512-0XsbTXxgiaCDYDIWFcwkmerZPSwywfUqYmwT4jzewKTQSWoE6FCMoUVOeBJWK3E/CrWbxRG3m5GzY4lnIwGRBA==", "requires": { - "react-is": "16.7.0" + "react-is": "^16.7.0" } }, "homedir-polyfill": { @@ -3622,7 +3622,7 @@ "integrity": "sha1-TCu8inWJmP7r9e1oWA921GdotLw=", "dev": true, "requires": { - "parse-passwd": "1.0.0" + "parse-passwd": "^1.0.0" } }, "hosted-git-info": { @@ -3636,10 +3636,10 @@ "integrity": "sha1-h3dMCUnlE/QuhFdbPEVoH63ioLI=", "dev": true, "requires": { - "inherits": "2.0.3", - "obuf": "1.1.2", - "readable-stream": "2.3.6", - "wbuf": "1.7.3" + "inherits": "^2.0.1", + "obuf": "^1.0.0", + "readable-stream": "^2.0.1", + "wbuf": "^1.1.0" } }, "html-entities": { @@ -3656,13 +3656,13 @@ }, "http-errors": { "version": "1.6.3", - "resolved": "http://registry.npmjs.org/http-errors/-/http-errors-1.6.3.tgz", + "resolved": "https://registry.npmjs.org/http-errors/-/http-errors-1.6.3.tgz", "integrity": "sha1-i1VoC7S+KDoLW/TqLjhYC+HZMg0=", "requires": { - "depd": "1.1.2", + "depd": "~1.1.2", "inherits": "2.0.3", "setprototypeof": "1.1.0", - "statuses": "1.4.0" + "statuses": ">= 1.4.0 < 2" } }, "http-parser-js": { @@ -3677,9 +3677,9 @@ "integrity": "sha512-Taqn+3nNvYRfJ3bGvKfBSRwy1v6eePlm3oc/aWVxZp57DQr5Eq3xhKJi7Z4hZpS8PC3H4qI+Yly5EmFacGuA/g==", "dev": true, "requires": { - "eventemitter3": "3.1.0", - "follow-redirects": "1.6.1", - "requires-port": "1.0.0" + "eventemitter3": "^3.0.0", + "follow-redirects": "^1.0.0", + "requires-port": "^1.0.0" }, "dependencies": { "eventemitter3": { @@ -3692,14 +3692,14 @@ }, "http-proxy-middleware": { "version": "0.18.0", - "resolved": "http://registry.npmjs.org/http-proxy-middleware/-/http-proxy-middleware-0.18.0.tgz", + "resolved": "https://registry.npmjs.org/http-proxy-middleware/-/http-proxy-middleware-0.18.0.tgz", "integrity": "sha512-Fs25KVMPAIIcgjMZkVHJoKg9VcXcC1C8yb9JUgeDvVXY0S/zgVIhMb+qVswDIgtJe2DfckMSY2d6TuTEutlk6Q==", "dev": true, "requires": { - "http-proxy": "1.17.0", - "is-glob": "4.0.0", - "lodash": "4.17.11", - "micromatch": "3.1.10" + "http-proxy": "^1.16.2", + "is-glob": "^4.0.0", + "lodash": "^4.17.5", + "micromatch": "^3.1.9" } }, "http-signature": { @@ -3707,9 +3707,9 @@ "resolved": "https://registry.npmjs.org/http-signature/-/http-signature-1.2.0.tgz", "integrity": "sha1-muzZJRFHcvPZW2WmCruPfBj7rOE=", "requires": { - "assert-plus": "1.0.0", - "jsprim": "1.4.1", - "sshpk": "1.16.1" + "assert-plus": "^1.0.0", + "jsprim": "^1.2.2", + "sshpk": "^1.7.0" } }, "https-browserify": { @@ -3723,7 +3723,7 @@ "resolved": "https://registry.npmjs.org/iconv-lite/-/iconv-lite-0.4.23.tgz", "integrity": "sha512-neyTUVFtahjf0mB3dZT77u+8O0QB89jFdnBkd5P1JgYPbPaia3gXXOVL2fq8VyU2gMMD7SaN7QukTB/pmXYvDA==", "requires": { - "safer-buffer": "2.1.2" + "safer-buffer": ">= 2.1.2 < 3" } }, "icss-replace-symbols": { @@ -3738,7 +3738,7 @@ "integrity": "sha512-bA/xGiwWM17qjllIs9X/y0EjsB7e0AV08F3OL8UPsoNkNRibIuu8f1eKTnQ8QO1DteKKTxTUAn+IEWUToIwGOA==", "dev": true, "requires": { - "postcss": "7.0.14" + "postcss": "^7.0.5" } }, "ieee754": { @@ -3780,8 +3780,8 @@ "integrity": "sha512-b6s04m3O+s3CGSbqDIyP4R6aAwAeYlVq9+WUWep6iHa8ETRf9yei1U48C5MmfJmV9AiLYYBKPMq/W+/WRpQmCQ==", "dev": true, "requires": { - "pkg-dir": "3.0.0", - "resolve-cwd": "2.0.0" + "pkg-dir": "^3.0.0", + "resolve-cwd": "^2.0.0" }, "dependencies": { "find-up": { @@ -3790,7 +3790,7 @@ "integrity": "sha512-1yD6RmLI1XBfxugvORwlck6f75tYL+iR0jqwsOrOxMZyGYqUuDhJ0l4AXdO1iX/FTs9cBAMEk1gWSEx1kSbylg==", "dev": true, "requires": { - "locate-path": "3.0.0" + "locate-path": "^3.0.0" } }, "locate-path": { @@ -3799,8 +3799,8 @@ "integrity": "sha512-7AO748wWnIhNqAuaty2ZWHkQHRSNfPVIsPIfwEOWO22AmaoVrWavlOcMR5nzTLNYvp36X220/maaRsrec1G65A==", "dev": true, "requires": { - "p-locate": "3.0.0", - "path-exists": "3.0.0" + "p-locate": "^3.0.0", + "path-exists": "^3.0.0" } }, "p-limit": { @@ -3809,7 +3809,7 @@ "integrity": "sha512-NhURkNcrVB+8hNfLuysU8enY5xn2KXphsHBaC2YmRNTZRc7RWusw6apSpdEj3jo4CMb6W9nrF6tTnsJsJeyu6g==", "dev": true, "requires": { - "p-try": "2.0.0" + "p-try": "^2.0.0" } }, "p-locate": { @@ -3818,7 +3818,7 @@ "integrity": "sha512-x+12w/To+4GFfgJhBEpiDcLozRJGegY+Ei7/z0tSLkMmxGZNybVMSfWj9aJn8Z5Fc7dBUNJOOVgPv2H7IwulSQ==", "dev": true, "requires": { - "p-limit": "2.1.0" + "p-limit": "^2.0.0" } }, "p-try": { @@ -3839,7 +3839,7 @@ "integrity": "sha512-/E57AYkoeQ25qkxMj5PBOVgF8Kiu/h7cYS30Z5+R7WaiCCBfLq58ZI/dSeaEKb9WVJV5n/03QwrN3IeWIFllvw==", "dev": true, "requires": { - "find-up": "3.0.0" + "find-up": "^3.0.0" } } } @@ -3859,7 +3859,7 @@ "resolved": "https://registry.npmjs.org/indent-string/-/indent-string-2.1.0.tgz", "integrity": "sha1-ji1INIdCEhtKghi3oTfppSBJ3IA=", "requires": { - "repeating": "2.0.1" + "repeating": "^2.0.0" } }, "indexof": { @@ -3873,8 +3873,8 @@ "resolved": "https://registry.npmjs.org/inflight/-/inflight-1.0.6.tgz", "integrity": "sha1-Sb1jMdfQLQwJvJEKEHW6gWW1bfk=", "requires": { - "once": "1.4.0", - "wrappy": "1.0.2" + "once": "^1.3.0", + "wrappy": "1" } }, "inherits": { @@ -3893,8 +3893,8 @@ "integrity": "sha512-NXXgESC2nNVtU+pqmC9e6R8B1GpKxzsAQhffvh5AL79qKnodd+L7tnEQmTiUAVngqLalPbSqRA7XGIEL5nCd0Q==", "dev": true, "requires": { - "default-gateway": "2.7.2", - "ipaddr.js": "1.8.0" + "default-gateway": "^2.6.0", + "ipaddr.js": "^1.5.2" } }, "interpret": { @@ -3927,10 +3927,10 @@ }, "is-accessor-descriptor": { "version": "0.1.6", - "resolved": "http://registry.npmjs.org/is-accessor-descriptor/-/is-accessor-descriptor-0.1.6.tgz", + "resolved": "https://registry.npmjs.org/is-accessor-descriptor/-/is-accessor-descriptor-0.1.6.tgz", "integrity": "sha1-qeEss66Nh2cn7u84Q/igiXtcmNY=", "requires": { - "kind-of": "3.2.2" + "kind-of": "^3.0.2" }, "dependencies": { "kind-of": { @@ -3938,7 +3938,7 @@ "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz", "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=", "requires": { - "is-buffer": "1.1.6" + "is-buffer": "^1.1.5" } } } @@ -3953,7 +3953,7 @@ "resolved": "https://registry.npmjs.org/is-binary-path/-/is-binary-path-1.0.1.tgz", "integrity": "sha1-dfFmQrSA8YenEcgUFh/TpKdlWJg=", "requires": { - "binary-extensions": "1.13.0" + "binary-extensions": "^1.0.0" } }, "is-buffer": { @@ -3963,10 +3963,10 @@ }, "is-builtin-module": { "version": "1.0.0", - "resolved": "http://registry.npmjs.org/is-builtin-module/-/is-builtin-module-1.0.0.tgz", + "resolved": "https://registry.npmjs.org/is-builtin-module/-/is-builtin-module-1.0.0.tgz", "integrity": "sha1-VAVy0096wxGfj3bDDLwbHgN6/74=", "requires": { - "builtin-modules": "1.1.1" + "builtin-modules": "^1.0.0" } }, "is-ci": { @@ -3974,15 +3974,15 @@ "resolved": "https://registry.npmjs.org/is-ci/-/is-ci-1.2.1.tgz", "integrity": "sha512-s6tfsaQaQi3JNciBH6shVqEDvhGut0SUXr31ag8Pd8BBbVVlcGfWhpPmEOoM6RJ5TFhbypvf5yyRw/VXW1IiWg==", "requires": { - "ci-info": "1.6.0" + "ci-info": "^1.5.0" } }, "is-data-descriptor": { "version": "0.1.4", - "resolved": "http://registry.npmjs.org/is-data-descriptor/-/is-data-descriptor-0.1.4.tgz", + "resolved": "https://registry.npmjs.org/is-data-descriptor/-/is-data-descriptor-0.1.4.tgz", "integrity": "sha1-C17mSDiOLIYCgueT8YVv7D8wG1Y=", "requires": { - "kind-of": "3.2.2" + "kind-of": "^3.0.2" }, "dependencies": { "kind-of": { @@ -3990,7 +3990,7 @@ "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz", "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=", "requires": { - "is-buffer": "1.1.6" + "is-buffer": "^1.1.5" } } } @@ -4000,9 +4000,9 @@ "resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-0.1.6.tgz", "integrity": "sha512-avDYr0SB3DwO9zsMov0gKCESFYqCnE4hq/4z3TdUlukEy5t9C0YRq7HLrsN52NAcqXKaepeCD0n+B0arnVG3Hg==", "requires": { - "is-accessor-descriptor": "0.1.6", - "is-data-descriptor": "0.1.4", - "kind-of": "5.1.0" + "is-accessor-descriptor": "^0.1.6", + "is-data-descriptor": "^0.1.4", + "kind-of": "^5.0.0" }, "dependencies": { "kind-of": { @@ -4027,7 +4027,7 @@ "resolved": "https://registry.npmjs.org/is-finite/-/is-finite-1.0.2.tgz", "integrity": "sha1-zGZ3aVYCvlUO8R6LSqYwU0K20Ko=", "requires": { - "number-is-nan": "1.0.1" + "number-is-nan": "^1.0.0" } }, "is-fullwidth-code-point": { @@ -4035,7 +4035,7 @@ "resolved": "https://registry.npmjs.org/is-fullwidth-code-point/-/is-fullwidth-code-point-1.0.0.tgz", "integrity": "sha1-754xOG8DGn8NZDr4L95QxFfvAMs=", "requires": { - "number-is-nan": "1.0.1" + "number-is-nan": "^1.0.0" } }, "is-glob": { @@ -4043,7 +4043,7 @@ "resolved": "https://registry.npmjs.org/is-glob/-/is-glob-4.0.0.tgz", "integrity": "sha1-lSHHaEXMJhCoUgPd8ICpWML/q8A=", "requires": { - "is-extglob": "2.1.1" + "is-extglob": "^2.1.1" } }, "is-installed-globally": { @@ -4051,8 +4051,8 @@ "resolved": "https://registry.npmjs.org/is-installed-globally/-/is-installed-globally-0.1.0.tgz", "integrity": "sha1-Df2Y9akRFxbdU13aZJL2e/PSWoA=", "requires": { - "global-dirs": "0.1.1", - "is-path-inside": "1.0.1" + "global-dirs": "^0.1.0", + "is-path-inside": "^1.0.0" } }, "is-npm": { @@ -4065,7 +4065,7 @@ "resolved": "https://registry.npmjs.org/is-number/-/is-number-3.0.0.tgz", "integrity": "sha1-JP1iAaR4LPUFYcgQJ2r8fRLXEZU=", "requires": { - "kind-of": "3.2.2" + "kind-of": "^3.0.2" }, "dependencies": { "kind-of": { @@ -4073,7 +4073,7 @@ "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz", "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=", "requires": { - "is-buffer": "1.1.6" + "is-buffer": "^1.1.5" } } } @@ -4095,7 +4095,7 @@ "integrity": "sha512-FjV1RTW48E7CWM7eE/J2NJvAEEVektecDBVBE5Hh3nM1Jd0kvhHtX68Pr3xsDf857xt3Y4AkwVULK1Vku62aaQ==", "dev": true, "requires": { - "is-path-inside": "1.0.1" + "is-path-inside": "^1.0.0" } }, "is-path-inside": { @@ -4103,7 +4103,7 @@ "resolved": "https://registry.npmjs.org/is-path-inside/-/is-path-inside-1.0.1.tgz", "integrity": "sha1-jvW33lBDej/cprToZe96pVy0gDY=", "requires": { - "path-is-inside": "1.0.2" + "path-is-inside": "^1.0.1" } }, "is-plain-object": { @@ -4111,7 +4111,7 @@ "resolved": "https://registry.npmjs.org/is-plain-object/-/is-plain-object-2.0.4.tgz", "integrity": "sha512-h5PpgXkWitc38BBMYawTYMWJHFZJVnBquFE57xFpjB8pJFiF6gZ+bU+WyI/yqXiFR5mdLsgYNaPe8uao6Uv9Og==", "requires": { - "isobject": "3.0.1" + "isobject": "^3.0.1" } }, "is-redirect": { @@ -4192,7 +4192,7 @@ }, "jsesc": { "version": "0.5.0", - "resolved": "http://registry.npmjs.org/jsesc/-/jsesc-0.5.0.tgz", + "resolved": "https://registry.npmjs.org/jsesc/-/jsesc-0.5.0.tgz", "integrity": "sha1-597mbjXW/Bb3EP6R1c9p9w8IkR0=", "dev": true }, @@ -4233,7 +4233,7 @@ "resolved": "https://registry.npmjs.org/json5/-/json5-1.0.1.tgz", "integrity": "sha512-aKS4WQjPenRxiQsC93MNfjx+nbF4PAdYzmd/1JIj8HYzqfbu86beTuNgXDzPknWk0n0uARlyewZo4s++ES36Ow==", "requires": { - "minimist": "1.2.0" + "minimist": "^1.2.0" } }, "jsprim": { @@ -4252,11 +4252,11 @@ "resolved": "https://registry.npmjs.org/jstransform/-/jstransform-11.0.3.tgz", "integrity": "sha1-CaeJk+CuTU70SH9hVakfYZDLQiM=", "requires": { - "base62": "1.2.8", - "commoner": "0.10.8", - "esprima-fb": "15001.1.0-dev-harmony-fb", - "object-assign": "2.1.1", - "source-map": "0.4.4" + "base62": "^1.1.0", + "commoner": "^0.10.1", + "esprima-fb": "^15001.1.0-dev-harmony-fb", + "object-assign": "^2.0.0", + "source-map": "^0.4.2" }, "dependencies": { "object-assign": { @@ -4271,9 +4271,9 @@ "resolved": "https://registry.npmjs.org/jsx-to-string/-/jsx-to-string-1.4.0.tgz", "integrity": "sha1-Ztw013PaufQP6ZPP+ZQOXaZVtwU=", "requires": { - "immutable": "4.0.0-rc.12", - "json-stringify-pretty-compact": "1.2.0", - "react": "0.14.9" + "immutable": "^4.0.0-rc.9", + "json-stringify-pretty-compact": "^1.0.1", + "react": "^0.14.0" }, "dependencies": { "react": { @@ -4281,8 +4281,8 @@ "resolved": "https://registry.npmjs.org/react/-/react-0.14.9.tgz", "integrity": "sha1-kRCmSXxJ1EuhwO3TF67CnC4NkdE=", "requires": { - "envify": "3.4.1", - "fbjs": "0.6.1" + "envify": "^3.0.0", + "fbjs": "^0.6.1" } } } @@ -4303,7 +4303,7 @@ "resolved": "https://registry.npmjs.org/latest-version/-/latest-version-3.1.0.tgz", "integrity": "sha1-ogU4P+oyKzO1rjsYq+4NwvNW7hU=", "requires": { - "package-json": "4.0.1" + "package-json": "^4.0.0" } }, "lcid": { @@ -4311,7 +4311,7 @@ "resolved": "https://registry.npmjs.org/lcid/-/lcid-1.0.0.tgz", "integrity": "sha1-MIrMr6C8SDo4Z7S28rlQYlHRuDU=", "requires": { - "invert-kv": "1.0.0" + "invert-kv": "^1.0.0" } }, "lightercollective": { @@ -4322,14 +4322,14 @@ }, "load-json-file": { "version": "1.1.0", - "resolved": "http://registry.npmjs.org/load-json-file/-/load-json-file-1.1.0.tgz", + "resolved": "https://registry.npmjs.org/load-json-file/-/load-json-file-1.1.0.tgz", "integrity": "sha1-lWkFcI1YtLq0wiYbBPWfMcmTdMA=", "requires": { - "graceful-fs": "4.1.15", - "parse-json": "2.2.0", - "pify": "2.3.0", - "pinkie-promise": "2.0.1", - "strip-bom": "2.0.0" + "graceful-fs": "^4.1.2", + "parse-json": "^2.2.0", + "pify": "^2.0.0", + "pinkie-promise": "^2.0.0", + "strip-bom": "^2.0.0" } }, "loader-runner": { @@ -4343,9 +4343,9 @@ "resolved": "https://registry.npmjs.org/loader-utils/-/loader-utils-1.2.3.tgz", "integrity": "sha512-fkpz8ejdnEMG3s37wGL07iSBDg99O9D5yflE9RGNH3hRdx9SOwYfnGYdZOUIZitN8E+E2vkq3MUMYMvPYl5ZZA==", "requires": { - "big.js": "5.2.2", - "emojis-list": "2.1.0", - "json5": "1.0.1" + "big.js": "^5.2.2", + "emojis-list": "^2.0.0", + "json5": "^1.0.1" } }, "locate-path": { @@ -4354,8 +4354,8 @@ "integrity": "sha1-K1aLJl7slExtnA3pw9u7ygNUzY4=", "dev": true, "requires": { - "p-locate": "2.0.0", - "path-exists": "3.0.0" + "p-locate": "^2.0.0", + "path-exists": "^3.0.0" }, "dependencies": { "path-exists": { @@ -4404,7 +4404,7 @@ "integrity": "sha512-VeIAFslyIerEJLXHziedo2basKbMKtTw3vfn5IzG0XTjhAVEJyNHnL2p7vc+wBDSdQuUpNw3M2u6xb9QsAY5Eg==", "dev": true, "requires": { - "chalk": "2.4.2" + "chalk": "^2.0.1" }, "dependencies": { "ansi-styles": { @@ -4413,7 +4413,7 @@ "integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==", "dev": true, "requires": { - "color-convert": "1.9.3" + "color-convert": "^1.9.0" } }, "chalk": { @@ -4422,9 +4422,9 @@ "integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==", "dev": true, "requires": { - "ansi-styles": "3.2.1", - "escape-string-regexp": "1.0.5", - "supports-color": "5.5.0" + "ansi-styles": "^3.2.1", + "escape-string-regexp": "^1.0.5", + "supports-color": "^5.3.0" } }, "supports-color": { @@ -4433,7 +4433,7 @@ "integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==", "dev": true, "requires": { - "has-flag": "3.0.0" + "has-flag": "^3.0.0" } } } @@ -4450,8 +4450,8 @@ "integrity": "sha512-V/73qkPuJmx4BcBF19xPBr+0ZRVBhc4POxvZTZdMeXpJ4NItXSJ/MSwuFT0kQJlCbXvdlZoQQ/418bS1y9Jh6A==", "dev": true, "requires": { - "es6-symbol": "3.1.1", - "object.assign": "4.1.0" + "es6-symbol": "^3.1.1", + "object.assign": "^4.1.0" } }, "loose-envify": { @@ -4459,7 +4459,7 @@ "resolved": "https://registry.npmjs.org/loose-envify/-/loose-envify-1.4.0.tgz", "integrity": "sha512-lyuxPGr/Wfhrlem2CL/UcnUc1zcqKAImBDzukY7Y5F/yQiNdko6+fRLevlw1HgMySw7f611UIY408EtxRSoK3Q==", "requires": { - "js-tokens": "4.0.0" + "js-tokens": "^3.0.0 || ^4.0.0" } }, "loud-rejection": { @@ -4467,8 +4467,8 @@ "resolved": "https://registry.npmjs.org/loud-rejection/-/loud-rejection-1.6.0.tgz", "integrity": "sha1-W0b4AUft7leIcPCG0Eghz5mOVR8=", "requires": { - "currently-unhandled": "0.4.1", - "signal-exit": "3.0.2" + "currently-unhandled": "^0.4.1", + "signal-exit": "^3.0.0" } }, "lowercase-keys": { @@ -4481,8 +4481,8 @@ "resolved": "https://registry.npmjs.org/lru-cache/-/lru-cache-4.1.5.tgz", "integrity": "sha512-sWZlbEP2OsHNkXrMl5GYk/jKk70MBng6UU4YI/qGDYbgf6YbP4EvmqISbXCoJiRKs+1bSpFHVgQxvJ17F2li5g==", "requires": { - "pseudomap": "1.0.2", - "yallist": "2.1.2" + "pseudomap": "^1.0.2", + "yallist": "^2.1.2" } }, "make-dir": { @@ -4490,7 +4490,7 @@ "resolved": "https://registry.npmjs.org/make-dir/-/make-dir-1.3.0.tgz", "integrity": "sha512-2w31R7SJtieJJnQtGc7RVL2StM2vGYVfqUOvUDxH6bC6aJTxPxTF0GnIgCyu7tjockiUWAYQRbxa7vKn34s5sQ==", "requires": { - "pify": "3.0.0" + "pify": "^3.0.0" }, "dependencies": { "pify": { @@ -4512,7 +4512,7 @@ "integrity": "sha512-bJzx6nMoP6PDLPBFmg7+xRKeFZvFboMrGlxmNj9ClvX53KrmvM5bXFXEWjbz4cz1AFn+jWJ9z/DJSz7hrs0w3w==", "dev": true, "requires": { - "p-defer": "1.0.0" + "p-defer": "^1.0.0" } }, "map-cache": { @@ -4530,7 +4530,7 @@ "resolved": "https://registry.npmjs.org/map-visit/-/map-visit-1.0.0.tgz", "integrity": "sha1-7Nyo8TFE5mDxtb1B8S80edmN+48=", "requires": { - "object-visit": "1.0.1" + "object-visit": "^1.0.0" } }, "md5.js": { @@ -4539,14 +4539,14 @@ "integrity": "sha512-xitP+WxNPcTTOgnTJcrhM0xvdPepipPSf3I8EIpGKeFLjt3PlJLIDG3u8EX53ZIubkb+5U2+3rELYpEhHhzdkg==", "dev": true, "requires": { - "hash-base": "3.0.4", - "inherits": "2.0.3", - "safe-buffer": "5.1.2" + "hash-base": "^3.0.0", + "inherits": "^2.0.1", + "safe-buffer": "^5.1.2" } }, "media-typer": { "version": "0.3.0", - "resolved": "http://registry.npmjs.org/media-typer/-/media-typer-0.3.0.tgz", + "resolved": "https://registry.npmjs.org/media-typer/-/media-typer-0.3.0.tgz", "integrity": "sha1-hxDXrwqmJvj/+hzgAWhUUmMlV0g=" }, "mem": { @@ -4555,9 +4555,9 @@ "integrity": "sha512-I5u6Q1x7wxO0kdOpYBB28xueHADYps5uty/zg936CiG8NTe5sJL8EjrCuLneuDW3PlMdZBGDIn8BirEVdovZvg==", "dev": true, "requires": { - "map-age-cleaner": "0.1.3", - "mimic-fn": "1.2.0", - "p-is-promise": "2.0.0" + "map-age-cleaner": "^0.1.1", + "mimic-fn": "^1.0.0", + "p-is-promise": "^2.0.0" } }, "memory-fs": { @@ -4566,25 +4566,25 @@ "integrity": "sha1-OpoguEYlI+RHz7x+i7gO1me/xVI=", "dev": true, "requires": { - "errno": "0.1.7", - "readable-stream": "2.3.6" + "errno": "^0.1.3", + "readable-stream": "^2.0.1" } }, "meow": { "version": "3.7.0", - "resolved": "http://registry.npmjs.org/meow/-/meow-3.7.0.tgz", + "resolved": "https://registry.npmjs.org/meow/-/meow-3.7.0.tgz", "integrity": "sha1-cstmi0JSKCkKu/qFaJJYcwioAfs=", "requires": { - "camelcase-keys": "2.1.0", - "decamelize": "1.2.0", - "loud-rejection": "1.6.0", - "map-obj": "1.0.1", - "minimist": "1.2.0", - "normalize-package-data": "2.4.2", - "object-assign": "4.1.1", - "read-pkg-up": "1.0.1", - "redent": "1.0.0", - "trim-newlines": "1.0.0" + "camelcase-keys": "^2.0.0", + "decamelize": "^1.1.2", + "loud-rejection": "^1.0.0", + "map-obj": "^1.0.1", + "minimist": "^1.1.3", + "normalize-package-data": "^2.3.4", + "object-assign": "^4.0.1", + "read-pkg-up": "^1.0.1", + "redent": "^1.0.0", + "trim-newlines": "^1.0.0" } }, "merge-descriptors": { @@ -4602,19 +4602,19 @@ "resolved": "https://registry.npmjs.org/micromatch/-/micromatch-3.1.10.tgz", "integrity": "sha512-MWikgl9n9M3w+bpsY3He8L+w9eF9338xRl8IAO5viDizwSzziFEyUzo2xrrloB64ADbTf8uA8vRqqttDTOmccg==", "requires": { - "arr-diff": "4.0.0", - "array-unique": "0.3.2", - "braces": "2.3.2", - "define-property": "2.0.2", - "extend-shallow": "3.0.2", - "extglob": "2.0.4", - "fragment-cache": "0.2.1", - "kind-of": "6.0.2", - "nanomatch": "1.2.13", - "object.pick": "1.3.0", - "regex-not": "1.0.2", - "snapdragon": "0.8.2", - "to-regex": "3.0.2" + "arr-diff": "^4.0.0", + "array-unique": "^0.3.2", + "braces": "^2.3.1", + "define-property": "^2.0.2", + "extend-shallow": "^3.0.2", + "extglob": "^2.0.4", + "fragment-cache": "^0.2.1", + "kind-of": "^6.0.2", + "nanomatch": "^1.2.9", + "object.pick": "^1.3.0", + "regex-not": "^1.0.0", + "snapdragon": "^0.8.1", + "to-regex": "^3.0.2" } }, "miller-rabin": { @@ -4623,8 +4623,8 @@ "integrity": "sha512-115fLhvZVqWwHPbClyntxEVfVDfl9DLLTuJvq3g2O/Oxi8AiNouAHvDSzHS0viUJc+V5vm3eq91Xwqn9dp4jRA==", "dev": true, "requires": { - "bn.js": "4.11.8", - "brorand": "1.1.0" + "bn.js": "^4.0.0", + "brorand": "^1.0.1" } }, "mime": { @@ -4642,7 +4642,7 @@ "resolved": "https://registry.npmjs.org/mime-types/-/mime-types-2.1.21.tgz", "integrity": "sha512-3iL6DbwpyLzjR3xHSFNFeb9Nz/M8WDkX33t1GFQnFOllWk8pOrh/LSrB5OXlnlW5P9LH73X6loW/eogc+F5lJg==", "requires": { - "mime-db": "1.37.0" + "mime-db": "~1.37.0" } }, "mimic-fn": { @@ -4668,7 +4668,7 @@ "resolved": "https://registry.npmjs.org/minimatch/-/minimatch-3.0.4.tgz", "integrity": "sha512-yJHVQEhyqPLUTgt9B83PXu6W3rx4MvvHvSUvToogpwoGDOUQ+yDrR0HRot+yOCdCO7u4hX3pWft6kWBBcqh0UA==", "requires": { - "brace-expansion": "1.1.11" + "brace-expansion": "^1.1.7" } }, "minimist": { @@ -4682,16 +4682,16 @@ "integrity": "sha512-zHo8v+otD1J10j/tC+VNoGK9keCuByhKovAvdn74dmxJl9+mWHnx6EMsDN4lgRoMI/eYo2nchAxniIbUPb5onw==", "dev": true, "requires": { - "concat-stream": "1.6.2", - "duplexify": "3.7.1", - "end-of-stream": "1.4.1", - "flush-write-stream": "1.1.0", - "from2": "2.3.0", - "parallel-transform": "1.1.0", - "pump": "2.0.1", - "pumpify": "1.5.1", - "stream-each": "1.2.3", - "through2": "2.0.5" + "concat-stream": "^1.5.0", + "duplexify": "^3.4.2", + "end-of-stream": "^1.1.0", + "flush-write-stream": "^1.0.0", + "from2": "^2.1.0", + "parallel-transform": "^1.1.0", + "pump": "^2.0.1", + "pumpify": "^1.3.3", + "stream-each": "^1.1.0", + "through2": "^2.0.0" } }, "mixin-deep": { @@ -4699,8 +4699,8 @@ "resolved": "https://registry.npmjs.org/mixin-deep/-/mixin-deep-1.3.1.tgz", "integrity": "sha512-8ZItLHeEgaqEvd5lYBXfm4EZSFCX29Jb9K+lAHhDKzReKBQKj3R+7NOF6tjqYi9t4oI8VUfaWITJQm86wnXGNQ==", "requires": { - "for-in": "1.0.2", - "is-extendable": "1.0.1" + "for-in": "^1.0.2", + "is-extendable": "^1.0.1" }, "dependencies": { "is-extendable": { @@ -4708,7 +4708,7 @@ "resolved": "https://registry.npmjs.org/is-extendable/-/is-extendable-1.0.1.tgz", "integrity": "sha512-arnXMxT1hhoKo9k1LZdmlNyJdDDfy2v0fXjFlmok4+i8ul/6WlbVge9bhM74OpNPQPMGUToDtz+KXa1PneJxOA==", "requires": { - "is-plain-object": "2.0.4" + "is-plain-object": "^2.0.4" } } } @@ -4719,8 +4719,8 @@ "integrity": "sha1-T7lJRB2rGCVA8f4DW6YOGUel5X4=", "dev": true, "requires": { - "for-in": "0.1.8", - "is-extendable": "0.1.1" + "for-in": "^0.1.3", + "is-extendable": "^0.1.1" }, "dependencies": { "for-in": { @@ -4733,7 +4733,7 @@ }, "mkdirp": { "version": "0.5.1", - "resolved": "http://registry.npmjs.org/mkdirp/-/mkdirp-0.5.1.tgz", + "resolved": "https://registry.npmjs.org/mkdirp/-/mkdirp-0.5.1.tgz", "integrity": "sha1-MAV0OOrGz3+MR2fzhkjWaX11yQM=", "requires": { "minimist": "0.0.8" @@ -4756,8 +4756,8 @@ "resolved": "https://registry.npmjs.org/mobx-react/-/mobx-react-5.4.3.tgz", "integrity": "sha512-WC8yFlwvJ91hy8j6CrydAuFteUafcuvdITFQeHl3LRIf5ayfT/4W3M/byhEYD2BcJWejeXr8y4Rh2H26RunCRQ==", "requires": { - "hoist-non-react-statics": "3.3.0", - "react-lifecycles-compat": "3.0.4" + "hoist-non-react-statics": "^3.0.0", + "react-lifecycles-compat": "^3.0.2" } }, "mobx-react-devtools": { @@ -4799,12 +4799,12 @@ "integrity": "sha512-MJTUg1kjuLeQCJ+ccE4Vpa6kKVXkPYJ2mOCQyUuKLcLQsdrMCpBPUi8qVE6+YuaJkozeA9NusTAw3hLr8Xe5EQ==", "dev": true, "requires": { - "fs.realpath": "1.0.0", - "inflight": "1.0.6", - "inherits": "2.0.3", - "minimatch": "3.0.4", - "once": "1.4.0", - "path-is-absolute": "1.0.1" + "fs.realpath": "^1.0.0", + "inflight": "^1.0.4", + "inherits": "2", + "minimatch": "^3.0.4", + "once": "^1.3.0", + "path-is-absolute": "^1.0.0" } }, "supports-color": { @@ -4813,7 +4813,7 @@ "integrity": "sha512-zjaXglF5nnWpsq470jSv6P9DwPvgLkuapYmfDm3JWOm0vkNTVF2tI4UrN2r6jH1qM/uc/WtxYY1hYoA2dOKj5w==", "dev": true, "requires": { - "has-flag": "3.0.0" + "has-flag": "^3.0.0" } } } @@ -4824,12 +4824,12 @@ "integrity": "sha1-viwAX9oy4LKa8fBdfEszIUxwH5I=", "dev": true, "requires": { - "aproba": "1.2.0", - "copy-concurrently": "1.0.5", - "fs-write-stream-atomic": "1.0.10", - "mkdirp": "0.5.1", - "rimraf": "2.6.3", - "run-queue": "1.0.3" + "aproba": "^1.1.1", + "copy-concurrently": "^1.0.0", + "fs-write-stream-atomic": "^1.0.8", + "mkdirp": "^0.5.1", + "rimraf": "^2.5.4", + "run-queue": "^1.0.3" } }, "ms": { @@ -4843,8 +4843,8 @@ "integrity": "sha512-ji6J5enbMyGRHIAkAOu3WdV8nggqviKCEKtXcOqfphZZtQrmHKycfynJ2V7eVPUA4NhJ6V7Wf4TmGbTwKE9B6g==", "dev": true, "requires": { - "dns-packet": "1.3.1", - "thunky": "1.0.3" + "dns-packet": "^1.3.1", + "thunky": "^1.0.2" } }, "multicast-dns-service-types": { @@ -4863,17 +4863,17 @@ "resolved": "https://registry.npmjs.org/nanomatch/-/nanomatch-1.2.13.tgz", "integrity": "sha512-fpoe2T0RbHwBTBUOftAfBPaDEi06ufaUai0mE6Yn1kacc3SnTErfb/h+X94VXzI64rKFHYImXSvdwGGCmwOqCA==", "requires": { - "arr-diff": "4.0.0", - "array-unique": "0.3.2", - "define-property": "2.0.2", - "extend-shallow": "3.0.2", - "fragment-cache": "0.2.1", - "is-windows": "1.0.2", - "kind-of": "6.0.2", - "object.pick": "1.3.0", - "regex-not": "1.0.2", - "snapdragon": "0.8.2", - "to-regex": "3.0.2" + "arr-diff": "^4.0.0", + "array-unique": "^0.3.2", + "define-property": "^2.0.2", + "extend-shallow": "^3.0.2", + "fragment-cache": "^0.2.1", + "is-windows": "^1.0.2", + "kind-of": "^6.0.2", + "object.pick": "^1.3.0", + "regex-not": "^1.0.0", + "snapdragon": "^0.8.1", + "to-regex": "^3.0.1" } }, "native-promise-only": { @@ -4894,7 +4894,7 @@ }, "next-tick": { "version": "1.0.0", - "resolved": "http://registry.npmjs.org/next-tick/-/next-tick-1.0.0.tgz", + "resolved": "https://registry.npmjs.org/next-tick/-/next-tick-1.0.0.tgz", "integrity": "sha1-yobR/ogoFpsBICCOPchCS524NCw=", "dev": true }, @@ -4915,23 +4915,23 @@ "resolved": "https://registry.npmjs.org/node-gyp/-/node-gyp-3.8.0.tgz", "integrity": "sha512-3g8lYefrRRzvGeSowdJKAKyks8oUpLEd/DyPV4eMhVlhJ0aNaZqIrNUIPuEWWTAoPqyFkfGrM67MC69baqn6vA==", "requires": { - "fstream": "1.0.11", - "glob": "7.1.3", - "graceful-fs": "4.1.15", - "mkdirp": "0.5.1", - "nopt": "3.0.6", - "npmlog": "4.1.2", - "osenv": "0.1.5", - "request": "2.88.0", - "rimraf": "2.6.3", - "semver": "5.3.0", - "tar": "2.2.1", - "which": "1.3.1" + "fstream": "^1.0.0", + "glob": "^7.0.3", + "graceful-fs": "^4.1.2", + "mkdirp": "^0.5.0", + "nopt": "2 || 3", + "npmlog": "0 || 1 || 2 || 3 || 4", + "osenv": "0", + "request": "^2.87.0", + "rimraf": "2", + "semver": "~5.3.0", + "tar": "^2.0.0", + "which": "1" }, "dependencies": { "semver": { "version": "5.3.0", - "resolved": "http://registry.npmjs.org/semver/-/semver-5.3.0.tgz", + "resolved": "https://registry.npmjs.org/semver/-/semver-5.3.0.tgz", "integrity": "sha1-myzl094C0XxgEq0yaqa00M9U+U8=" } } @@ -4942,28 +4942,28 @@ "integrity": "sha512-5MQunG/oyOaBdttrL40dA7bUfPORLRWMUJLQtMg7nluxUvk5XwnLdL9twQHFAjRx/y7mIMkLKT9++qPbbk6BZA==", "dev": true, "requires": { - "assert": "1.4.1", - "browserify-zlib": "0.2.0", - "buffer": "4.9.1", - "console-browserify": "1.1.0", - "constants-browserify": "1.0.0", - "crypto-browserify": "3.12.0", - "domain-browser": "1.2.0", - "events": "3.0.0", - "https-browserify": "1.0.0", - "os-browserify": "0.3.0", + "assert": "^1.1.1", + "browserify-zlib": "^0.2.0", + "buffer": "^4.3.0", + "console-browserify": "^1.1.0", + "constants-browserify": "^1.0.0", + "crypto-browserify": "^3.11.0", + "domain-browser": "^1.1.1", + "events": "^3.0.0", + "https-browserify": "^1.0.0", + "os-browserify": "^0.3.0", "path-browserify": "0.0.0", - "process": "0.11.10", - "punycode": "1.4.1", - "querystring-es3": "0.2.1", - "readable-stream": "2.3.6", - "stream-browserify": "2.0.2", - "stream-http": "2.8.3", - "string_decoder": "1.1.1", - "timers-browserify": "2.0.10", + "process": "^0.11.10", + "punycode": "^1.2.4", + "querystring-es3": "^0.2.0", + "readable-stream": "^2.3.3", + "stream-browserify": "^2.0.1", + "stream-http": "^2.7.2", + "string_decoder": "^1.0.0", + "timers-browserify": "^2.0.4", "tty-browserify": "0.0.0", - "url": "0.11.0", - "util": "0.11.1", + "url": "^0.11.0", + "util": "^0.11.0", "vm-browserify": "0.0.4" }, "dependencies": { @@ -4980,25 +4980,25 @@ "resolved": "https://registry.npmjs.org/node-sass/-/node-sass-4.11.0.tgz", "integrity": "sha512-bHUdHTphgQJZaF1LASx0kAviPH7sGlcyNhWade4eVIpFp6tsn7SV8xNMTbsQFpEV9VXpnwTTnNYlfsZXgGgmkA==", "requires": { - "async-foreach": "0.1.3", - "chalk": "1.1.3", - "cross-spawn": "3.0.1", - "gaze": "1.1.3", - "get-stdin": "4.0.1", - "glob": "7.1.3", - "in-publish": "2.0.0", - "lodash.assign": "4.2.0", - "lodash.clonedeep": "4.5.0", - "lodash.mergewith": "4.6.1", - "meow": "3.7.0", - "mkdirp": "0.5.1", - "nan": "2.12.1", - "node-gyp": "3.8.0", - "npmlog": "4.1.2", - "request": "2.88.0", - "sass-graph": "2.2.4", - "stdout-stream": "1.4.1", - "true-case-path": "1.0.3" + "async-foreach": "^0.1.3", + "chalk": "^1.1.1", + "cross-spawn": "^3.0.0", + "gaze": "^1.0.0", + "get-stdin": "^4.0.1", + "glob": "^7.0.3", + "in-publish": "^2.0.0", + "lodash.assign": "^4.2.0", + "lodash.clonedeep": "^4.3.2", + "lodash.mergewith": "^4.6.0", + "meow": "^3.7.0", + "mkdirp": "^0.5.1", + "nan": "^2.10.0", + "node-gyp": "^3.8.0", + "npmlog": "^4.0.0", + "request": "^2.88.0", + "sass-graph": "^2.2.4", + "stdout-stream": "^1.4.0", + "true-case-path": "^1.0.2" } }, "nodemon": { @@ -5006,16 +5006,16 @@ "resolved": "https://registry.npmjs.org/nodemon/-/nodemon-1.18.10.tgz", "integrity": "sha512-we51yBb1TfEvZamFchRgcfLbVYgg0xlGbyXmOtbBzDwxwgewYS/YbZ5tnlnsH51+AoSTTsT3A2E/FloUbtH8cQ==", "requires": { - "chokidar": "2.1.0", - "debug": "3.2.6", - "ignore-by-default": "1.0.1", - "minimatch": "3.0.4", - "pstree.remy": "1.1.6", - "semver": "5.6.0", - "supports-color": "5.5.0", - "touch": "3.1.0", - "undefsafe": "2.0.2", - "update-notifier": "2.5.0" + "chokidar": "^2.1.0", + "debug": "^3.1.0", + "ignore-by-default": "^1.0.1", + "minimatch": "^3.0.4", + "pstree.remy": "^1.1.6", + "semver": "^5.5.0", + "supports-color": "^5.2.0", + "touch": "^3.1.0", + "undefsafe": "^2.0.2", + "update-notifier": "^2.5.0" }, "dependencies": { "chokidar": { @@ -5023,18 +5023,18 @@ "resolved": "https://registry.npmjs.org/chokidar/-/chokidar-2.1.0.tgz", "integrity": "sha512-5t6G2SH8eO6lCvYOoUpaRnF5Qfd//gd7qJAkwRUw9qlGVkiQ13uwQngqbWWaurOsaAm9+kUGbITADxt6H0XFNQ==", "requires": { - "anymatch": "2.0.0", - "async-each": "1.0.1", - "braces": "2.3.2", - "fsevents": "1.2.7", - "glob-parent": "3.1.0", - "inherits": "2.0.3", - "is-binary-path": "1.0.1", - "is-glob": "4.0.0", - "normalize-path": "3.0.0", - "path-is-absolute": "1.0.1", - "readdirp": "2.2.1", - "upath": "1.1.0" + "anymatch": "^2.0.0", + "async-each": "^1.0.1", + "braces": "^2.3.2", + "fsevents": "^1.2.7", + "glob-parent": "^3.1.0", + "inherits": "^2.0.3", + "is-binary-path": "^1.0.0", + "is-glob": "^4.0.0", + "normalize-path": "^3.0.0", + "path-is-absolute": "^1.0.0", + "readdirp": "^2.2.1", + "upath": "^1.1.0" } }, "debug": { @@ -5042,7 +5042,7 @@ "resolved": "https://registry.npmjs.org/debug/-/debug-3.2.6.tgz", "integrity": "sha512-mel+jf7nrtEl5Pn1Qx46zARXKDpBbvzezse7p7LqINmdoIk8PYP5SySaxEmYv6TZ0JyEKA1hsCId6DIhgITtWQ==", "requires": { - "ms": "2.1.1" + "ms": "^2.1.1" } }, "ms": { @@ -5060,7 +5060,7 @@ "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz", "integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==", "requires": { - "has-flag": "3.0.0" + "has-flag": "^3.0.0" } } } @@ -5070,7 +5070,7 @@ "resolved": "https://registry.npmjs.org/nopt/-/nopt-3.0.6.tgz", "integrity": "sha1-xkZdvwirzU2zWTF/eaxopkayj/k=", "requires": { - "abbrev": "1.1.1" + "abbrev": "1" } }, "normalize-package-data": { @@ -5078,10 +5078,10 @@ "resolved": "https://registry.npmjs.org/normalize-package-data/-/normalize-package-data-2.4.2.tgz", "integrity": "sha512-YcMnjqeoUckXTPKZSAsPjUPLxH85XotbpqK3w4RyCwdFQSU5FxxBys8buehkSfg0j9fKvV1hn7O0+8reEgkAiw==", "requires": { - "hosted-git-info": "2.7.1", - "is-builtin-module": "1.0.0", - "semver": "5.6.0", - "validate-npm-package-license": "3.0.4" + "hosted-git-info": "^2.1.4", + "is-builtin-module": "^1.0.0", + "semver": "2 || 3 || 4 || 5", + "validate-npm-package-license": "^3.0.1" } }, "normalize-path": { @@ -5089,7 +5089,7 @@ "resolved": "https://registry.npmjs.org/normalize-path/-/normalize-path-2.1.1.tgz", "integrity": "sha1-GrKLVW4Zg2Oowab35vogE3/mrtk=", "requires": { - "remove-trailing-separator": "1.1.0" + "remove-trailing-separator": "^1.0.1" } }, "normalize.css": { @@ -5102,136 +5102,136 @@ "resolved": "https://registry.npmjs.org/npm/-/npm-6.7.0.tgz", "integrity": "sha512-OtxCLzx+pcsjMGrjZpBp214ZjxzHcAe3zLYIlaVpRYqFHff6bgggyTLf2OZPO8lfxN0RHLJnFFUU016JCzM/Ww==", "requires": { - "JSONStream": "1.3.5", - "abbrev": "1.1.1", - "ansicolors": "0.3.2", - "ansistyles": "0.1.3", - "aproba": "2.0.0", - "archy": "1.0.0", - "bin-links": "1.1.2", - "bluebird": "3.5.3", - "byte-size": "5.0.1", - "cacache": "11.3.2", - "call-limit": "1.1.0", - "chownr": "1.1.1", - "ci-info": "2.0.0", - "cli-columns": "3.1.2", - "cli-table3": "0.5.1", - "cmd-shim": "2.0.2", - "columnify": "1.5.4", - "config-chain": "1.1.12", - "debuglog": "1.0.1", - "detect-indent": "5.0.0", - "detect-newline": "2.1.0", - "dezalgo": "1.0.3", - "editor": "1.0.0", - "figgy-pudding": "3.5.1", - "find-npm-prefix": "1.0.2", - "fs-vacuum": "1.2.10", - "fs-write-stream-atomic": "1.0.10", - "gentle-fs": "2.0.1", - "glob": "7.1.3", - "graceful-fs": "4.1.15", - "has-unicode": "2.0.1", - "hosted-git-info": "2.7.1", - "iferr": "1.0.2", - "imurmurhash": "0.1.4", - "inflight": "1.0.6", - "inherits": "2.0.3", - "ini": "1.3.5", - "init-package-json": "1.10.3", - "is-cidr": "3.0.0", - "json-parse-better-errors": "1.0.2", - "lazy-property": "1.0.0", - "libcipm": "3.0.3", - "libnpm": "2.0.1", - "libnpmaccess": "3.0.1", - "libnpmhook": "5.0.2", - "libnpmorg": "1.0.0", - "libnpmsearch": "2.0.0", - "libnpmteam": "1.0.1", - "libnpx": "10.2.0", - "lock-verify": "2.0.2", - "lockfile": "1.0.4", - "lodash._baseindexof": "3.1.0", - "lodash._baseuniq": "4.6.0", - "lodash._bindcallback": "3.0.1", - "lodash._cacheindexof": "3.0.2", - "lodash._createcache": "3.1.2", - "lodash._getnative": "3.9.1", - "lodash.clonedeep": "4.5.0", - "lodash.restparam": "3.6.1", - "lodash.union": "4.6.0", - "lodash.uniq": "4.5.0", - "lodash.without": "4.4.0", - "lru-cache": "4.1.5", - "meant": "1.0.1", - "mississippi": "3.0.0", - "mkdirp": "0.5.1", - "move-concurrently": "1.0.1", - "node-gyp": "3.8.0", - "nopt": "4.0.1", - "normalize-package-data": "2.4.0", - "npm-audit-report": "1.3.2", - "npm-cache-filename": "1.0.2", - "npm-install-checks": "3.0.0", - "npm-lifecycle": "2.1.0", - "npm-package-arg": "6.1.0", - "npm-packlist": "1.2.0", - "npm-pick-manifest": "2.2.3", - "npm-profile": "4.0.1", - "npm-registry-fetch": "3.8.0", - "npm-user-validate": "1.0.0", - "npmlog": "4.1.2", - "once": "1.4.0", - "opener": "1.5.1", - "osenv": "0.1.5", - "pacote": "9.4.0", - "path-is-inside": "1.0.2", - "promise-inflight": "1.0.1", - "qrcode-terminal": "0.12.0", - "query-string": "6.2.0", - "qw": "1.0.1", - "read": "1.0.7", - "read-cmd-shim": "1.0.1", - "read-installed": "4.0.3", - "read-package-json": "2.0.13", - "read-package-tree": "5.2.1", - "readable-stream": "3.1.1", - "readdir-scoped-modules": "1.0.2", - "request": "2.88.0", - "retry": "0.12.0", - "rimraf": "2.6.3", - "safe-buffer": "5.1.2", - "semver": "5.6.0", - "sha": "2.0.1", - "slide": "1.1.6", - "sorted-object": "2.0.1", - "sorted-union-stream": "2.1.3", - "ssri": "6.0.1", - "stringify-package": "1.0.0", - "tar": "4.4.8", - "text-table": "0.2.0", - "tiny-relative-date": "1.3.0", + "JSONStream": "^1.3.5", + "abbrev": "~1.1.1", + "ansicolors": "~0.3.2", + "ansistyles": "~0.1.3", + "aproba": "^2.0.0", + "archy": "~1.0.0", + "bin-links": "^1.1.2", + "bluebird": "^3.5.3", + "byte-size": "^5.0.1", + "cacache": "^11.3.2", + "call-limit": "~1.1.0", + "chownr": "^1.1.1", + "ci-info": "^2.0.0", + "cli-columns": "^3.1.2", + "cli-table3": "^0.5.1", + "cmd-shim": "~2.0.2", + "columnify": "~1.5.4", + "config-chain": "^1.1.12", + "debuglog": "*", + "detect-indent": "~5.0.0", + "detect-newline": "^2.1.0", + "dezalgo": "~1.0.3", + "editor": "~1.0.0", + "figgy-pudding": "^3.5.1", + "find-npm-prefix": "^1.0.2", + "fs-vacuum": "~1.2.10", + "fs-write-stream-atomic": "~1.0.10", + "gentle-fs": "^2.0.1", + "glob": "^7.1.3", + "graceful-fs": "^4.1.15", + "has-unicode": "~2.0.1", + "hosted-git-info": "^2.7.1", + "iferr": "^1.0.2", + "imurmurhash": "*", + "inflight": "~1.0.6", + "inherits": "~2.0.3", + "ini": "^1.3.5", + "init-package-json": "^1.10.3", + "is-cidr": "^3.0.0", + "json-parse-better-errors": "^1.0.2", + "lazy-property": "~1.0.0", + "libcipm": "^3.0.3", + "libnpm": "^2.0.1", + "libnpmaccess": "*", + "libnpmhook": "^5.0.2", + "libnpmorg": "*", + "libnpmsearch": "*", + "libnpmteam": "*", + "libnpx": "^10.2.0", + "lock-verify": "^2.0.2", + "lockfile": "^1.0.4", + "lodash._baseindexof": "*", + "lodash._baseuniq": "~4.6.0", + "lodash._bindcallback": "*", + "lodash._cacheindexof": "*", + "lodash._createcache": "*", + "lodash._getnative": "*", + "lodash.clonedeep": "~4.5.0", + "lodash.restparam": "*", + "lodash.union": "~4.6.0", + "lodash.uniq": "~4.5.0", + "lodash.without": "~4.4.0", + "lru-cache": "^4.1.5", + "meant": "~1.0.1", + "mississippi": "^3.0.0", + "mkdirp": "~0.5.1", + "move-concurrently": "^1.0.1", + "node-gyp": "^3.8.0", + "nopt": "~4.0.1", + "normalize-package-data": "~2.4.0", + "npm-audit-report": "^1.3.2", + "npm-cache-filename": "~1.0.2", + "npm-install-checks": "~3.0.0", + "npm-lifecycle": "^2.1.0", + "npm-package-arg": "^6.1.0", + "npm-packlist": "^1.2.0", + "npm-pick-manifest": "^2.2.3", + "npm-profile": "*", + "npm-registry-fetch": "^3.8.0", + "npm-user-validate": "~1.0.0", + "npmlog": "~4.1.2", + "once": "~1.4.0", + "opener": "^1.5.1", + "osenv": "^0.1.5", + "pacote": "^9.4.0", + "path-is-inside": "~1.0.2", + "promise-inflight": "~1.0.1", + "qrcode-terminal": "^0.12.0", + "query-string": "^6.2.0", + "qw": "~1.0.1", + "read": "~1.0.7", + "read-cmd-shim": "~1.0.1", + "read-installed": "~4.0.3", + "read-package-json": "^2.0.13", + "read-package-tree": "^5.2.1", + "readable-stream": "^3.1.1", + "readdir-scoped-modules": "*", + "request": "^2.88.0", + "retry": "^0.12.0", + "rimraf": "^2.6.3", + "safe-buffer": "^5.1.2", + "semver": "^5.6.0", + "sha": "~2.0.1", + "slide": "~1.1.6", + "sorted-object": "~2.0.1", + "sorted-union-stream": "~2.1.3", + "ssri": "^6.0.1", + "stringify-package": "^1.0.0", + "tar": "^4.4.8", + "text-table": "~0.2.0", + "tiny-relative-date": "^1.3.0", "uid-number": "0.0.6", - "umask": "1.1.0", - "unique-filename": "1.1.1", - "unpipe": "1.0.0", - "update-notifier": "2.5.0", - "uuid": "3.3.2", - "validate-npm-package-license": "3.0.4", - "validate-npm-package-name": "3.0.0", - "which": "1.3.1", - "worker-farm": "1.6.0", - "write-file-atomic": "2.4.2" + "umask": "~1.1.0", + "unique-filename": "^1.1.1", + "unpipe": "~1.0.0", + "update-notifier": "^2.5.0", + "uuid": "^3.3.2", + "validate-npm-package-license": "^3.0.4", + "validate-npm-package-name": "~3.0.0", + "which": "^1.3.1", + "worker-farm": "^1.6.0", + "write-file-atomic": "^2.4.2" }, "dependencies": { "JSONStream": { "version": "1.3.5", "bundled": true, "requires": { - "jsonparse": "1.3.1", - "through": "2.3.8" + "jsonparse": "^1.2.0", + "through": ">=2.2.7 <3" } }, "abbrev": { @@ -5242,31 +5242,31 @@ "version": "4.2.0", "bundled": true, "requires": { - "es6-promisify": "5.0.0" + "es6-promisify": "^5.0.0" } }, "agentkeepalive": { "version": "3.4.1", "bundled": true, "requires": { - "humanize-ms": "1.2.1" + "humanize-ms": "^1.2.1" } }, "ajv": { "version": "5.5.2", "bundled": true, "requires": { - "co": "4.6.0", - "fast-deep-equal": "1.1.0", - "fast-json-stable-stringify": "2.0.0", - "json-schema-traverse": "0.3.1" + "co": "^4.6.0", + "fast-deep-equal": "^1.0.0", + "fast-json-stable-stringify": "^2.0.0", + "json-schema-traverse": "^0.3.0" } }, "ansi-align": { "version": "2.0.0", "bundled": true, "requires": { - "string-width": "2.1.1" + "string-width": "^2.0.0" } }, "ansi-regex": { @@ -5277,7 +5277,7 @@ "version": "3.2.1", "bundled": true, "requires": { - "color-convert": "1.9.1" + "color-convert": "^1.9.0" } }, "ansicolors": { @@ -5300,28 +5300,28 @@ "version": "1.1.4", "bundled": true, "requires": { - "delegates": "1.0.0", - "readable-stream": "2.3.6" + "delegates": "^1.0.0", + "readable-stream": "^2.0.6" }, "dependencies": { "readable-stream": { "version": "2.3.6", "bundled": true, "requires": { - "core-util-is": "1.0.2", - "inherits": "2.0.3", - "isarray": "1.0.0", - "process-nextick-args": "2.0.0", - "safe-buffer": "5.1.2", - "string_decoder": "1.1.1", - "util-deprecate": "1.0.2" + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" } }, "string_decoder": { "version": "1.1.1", "bundled": true, "requires": { - "safe-buffer": "5.1.2" + "safe-buffer": "~5.1.0" } } } @@ -5334,7 +5334,7 @@ "version": "0.2.4", "bundled": true, "requires": { - "safer-buffer": "2.1.2" + "safer-buffer": "~2.1.0" } }, "assert-plus": { @@ -5362,25 +5362,25 @@ "bundled": true, "optional": true, "requires": { - "tweetnacl": "0.14.5" + "tweetnacl": "^0.14.3" } }, "bin-links": { "version": "1.1.2", "bundled": true, "requires": { - "bluebird": "3.5.3", - "cmd-shim": "2.0.2", - "gentle-fs": "2.0.1", - "graceful-fs": "4.1.15", - "write-file-atomic": "2.4.2" + "bluebird": "^3.5.0", + "cmd-shim": "^2.0.2", + "gentle-fs": "^2.0.0", + "graceful-fs": "^4.1.11", + "write-file-atomic": "^2.3.0" } }, "block-stream": { "version": "0.0.9", "bundled": true, "requires": { - "inherits": "2.0.3" + "inherits": "~2.0.0" } }, "bluebird": { @@ -5391,20 +5391,20 @@ "version": "1.3.0", "bundled": true, "requires": { - "ansi-align": "2.0.0", - "camelcase": "4.1.0", - "chalk": "2.4.1", - "cli-boxes": "1.0.0", - "string-width": "2.1.1", - "term-size": "1.2.0", - "widest-line": "2.0.0" + "ansi-align": "^2.0.0", + "camelcase": "^4.0.0", + "chalk": "^2.0.1", + "cli-boxes": "^1.0.0", + "string-width": "^2.0.0", + "term-size": "^1.2.0", + "widest-line": "^2.0.0" } }, "brace-expansion": { "version": "1.1.11", "bundled": true, "requires": { - "balanced-match": "1.0.0", + "balanced-match": "^1.0.0", "concat-map": "0.0.1" } }, @@ -5432,20 +5432,20 @@ "version": "11.3.2", "bundled": true, "requires": { - "bluebird": "3.5.3", - "chownr": "1.1.1", - "figgy-pudding": "3.5.1", - "glob": "7.1.3", - "graceful-fs": "4.1.15", - "lru-cache": "5.1.1", - "mississippi": "3.0.0", - "mkdirp": "0.5.1", - "move-concurrently": "1.0.1", - "promise-inflight": "1.0.1", - "rimraf": "2.6.3", - "ssri": "6.0.1", - "unique-filename": "1.1.1", - "y18n": "4.0.0" + "bluebird": "^3.5.3", + "chownr": "^1.1.1", + "figgy-pudding": "^3.5.1", + "glob": "^7.1.3", + "graceful-fs": "^4.1.15", + "lru-cache": "^5.1.1", + "mississippi": "^3.0.0", + "mkdirp": "^0.5.1", + "move-concurrently": "^1.0.1", + "promise-inflight": "^1.0.1", + "rimraf": "^2.6.2", + "ssri": "^6.0.1", + "unique-filename": "^1.1.1", + "y18n": "^4.0.0" }, "dependencies": { "chownr": { @@ -5456,14 +5456,14 @@ "version": "5.1.1", "bundled": true, "requires": { - "yallist": "3.0.3" + "yallist": "^3.0.2" } }, "unique-filename": { "version": "1.1.1", "bundled": true, "requires": { - "unique-slug": "2.0.0" + "unique-slug": "^2.0.0" } }, "yallist": { @@ -5492,9 +5492,9 @@ "version": "2.4.1", "bundled": true, "requires": { - "ansi-styles": "3.2.1", - "escape-string-regexp": "1.0.5", - "supports-color": "5.4.0" + "ansi-styles": "^3.2.1", + "escape-string-regexp": "^1.0.5", + "supports-color": "^5.3.0" } }, "chownr": { @@ -5509,7 +5509,7 @@ "version": "2.0.10", "bundled": true, "requires": { - "ip-regex": "2.1.0" + "ip-regex": "^2.1.0" } }, "cli-boxes": { @@ -5520,26 +5520,26 @@ "version": "3.1.2", "bundled": true, "requires": { - "string-width": "2.1.1", - "strip-ansi": "3.0.1" + "string-width": "^2.0.0", + "strip-ansi": "^3.0.1" } }, "cli-table3": { "version": "0.5.1", "bundled": true, "requires": { - "colors": "1.3.3", - "object-assign": "4.1.1", - "string-width": "2.1.1" + "colors": "^1.1.2", + "object-assign": "^4.1.0", + "string-width": "^2.1.1" } }, "cliui": { "version": "4.1.0", "bundled": true, "requires": { - "string-width": "2.1.1", - "strip-ansi": "4.0.0", - "wrap-ansi": "2.1.0" + "string-width": "^2.1.1", + "strip-ansi": "^4.0.0", + "wrap-ansi": "^2.0.0" }, "dependencies": { "ansi-regex": { @@ -5550,7 +5550,7 @@ "version": "4.0.0", "bundled": true, "requires": { - "ansi-regex": "3.0.0" + "ansi-regex": "^3.0.0" } } } @@ -5563,8 +5563,8 @@ "version": "2.0.2", "bundled": true, "requires": { - "graceful-fs": "4.1.15", - "mkdirp": "0.5.1" + "graceful-fs": "^4.1.2", + "mkdirp": "~0.5.0" } }, "co": { @@ -5579,7 +5579,7 @@ "version": "1.9.1", "bundled": true, "requires": { - "color-name": "1.1.3" + "color-name": "^1.1.1" } }, "color-name": { @@ -5595,15 +5595,15 @@ "version": "1.5.4", "bundled": true, "requires": { - "strip-ansi": "3.0.1", - "wcwidth": "1.0.1" + "strip-ansi": "^3.0.0", + "wcwidth": "^1.0.0" } }, "combined-stream": { "version": "1.0.6", "bundled": true, "requires": { - "delayed-stream": "1.0.0" + "delayed-stream": "~1.0.0" } }, "concat-map": { @@ -5614,30 +5614,30 @@ "version": "1.6.2", "bundled": true, "requires": { - "buffer-from": "1.0.0", - "inherits": "2.0.3", - "readable-stream": "2.3.6", - "typedarray": "0.0.6" + "buffer-from": "^1.0.0", + "inherits": "^2.0.3", + "readable-stream": "^2.2.2", + "typedarray": "^0.0.6" }, "dependencies": { "readable-stream": { "version": "2.3.6", "bundled": true, "requires": { - "core-util-is": "1.0.2", - "inherits": "2.0.3", - "isarray": "1.0.0", - "process-nextick-args": "2.0.0", - "safe-buffer": "5.1.2", - "string_decoder": "1.1.1", - "util-deprecate": "1.0.2" + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" } }, "string_decoder": { "version": "1.1.1", "bundled": true, "requires": { - "safe-buffer": "5.1.2" + "safe-buffer": "~5.1.0" } } } @@ -5646,20 +5646,20 @@ "version": "1.1.12", "bundled": true, "requires": { - "ini": "1.3.5", - "proto-list": "1.2.4" + "ini": "^1.3.4", + "proto-list": "~1.2.1" } }, "configstore": { "version": "3.1.2", "bundled": true, "requires": { - "dot-prop": "4.2.0", - "graceful-fs": "4.1.15", - "make-dir": "1.3.0", - "unique-string": "1.0.0", - "write-file-atomic": "2.4.2", - "xdg-basedir": "3.0.0" + "dot-prop": "^4.1.0", + "graceful-fs": "^4.1.2", + "make-dir": "^1.0.0", + "unique-string": "^1.0.0", + "write-file-atomic": "^2.0.0", + "xdg-basedir": "^3.0.0" } }, "console-control-strings": { @@ -5670,12 +5670,12 @@ "version": "1.0.5", "bundled": true, "requires": { - "aproba": "1.2.0", - "fs-write-stream-atomic": "1.0.10", - "iferr": "0.1.5", - "mkdirp": "0.5.1", - "rimraf": "2.6.3", - "run-queue": "1.0.3" + "aproba": "^1.1.1", + "fs-write-stream-atomic": "^1.0.8", + "iferr": "^0.1.5", + "mkdirp": "^0.5.1", + "rimraf": "^2.5.4", + "run-queue": "^1.0.0" }, "dependencies": { "aproba": { @@ -5696,16 +5696,16 @@ "version": "3.0.2", "bundled": true, "requires": { - "capture-stack-trace": "1.0.0" + "capture-stack-trace": "^1.0.0" } }, "cross-spawn": { "version": "5.1.0", "bundled": true, "requires": { - "lru-cache": "4.1.5", - "shebang-command": "1.2.0", - "which": "1.3.1" + "lru-cache": "^4.0.1", + "shebang-command": "^1.2.0", + "which": "^1.2.9" } }, "crypto-random-string": { @@ -5720,7 +5720,7 @@ "version": "1.14.1", "bundled": true, "requires": { - "assert-plus": "1.0.0" + "assert-plus": "^1.0.0" } }, "debug": { @@ -5756,7 +5756,7 @@ "version": "1.0.3", "bundled": true, "requires": { - "clone": "1.0.4" + "clone": "^1.0.2" } }, "delayed-stream": { @@ -5779,15 +5779,15 @@ "version": "1.0.3", "bundled": true, "requires": { - "asap": "2.0.6", - "wrappy": "1.0.2" + "asap": "^2.0.0", + "wrappy": "1" } }, "dot-prop": { "version": "4.2.0", "bundled": true, "requires": { - "is-obj": "1.0.1" + "is-obj": "^1.0.0" } }, "dotenv": { @@ -5802,30 +5802,30 @@ "version": "3.6.0", "bundled": true, "requires": { - "end-of-stream": "1.4.1", - "inherits": "2.0.3", - "readable-stream": "2.3.6", - "stream-shift": "1.0.0" + "end-of-stream": "^1.0.0", + "inherits": "^2.0.1", + "readable-stream": "^2.0.0", + "stream-shift": "^1.0.0" }, "dependencies": { "readable-stream": { "version": "2.3.6", "bundled": true, "requires": { - "core-util-is": "1.0.2", - "inherits": "2.0.3", - "isarray": "1.0.0", - "process-nextick-args": "2.0.0", - "safe-buffer": "5.1.2", - "string_decoder": "1.1.1", - "util-deprecate": "1.0.2" + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" } }, "string_decoder": { "version": "1.1.1", "bundled": true, "requires": { - "safe-buffer": "5.1.2" + "safe-buffer": "~5.1.0" } } } @@ -5835,8 +5835,8 @@ "bundled": true, "optional": true, "requires": { - "jsbn": "0.1.1", - "safer-buffer": "2.1.2" + "jsbn": "~0.1.0", + "safer-buffer": "^2.1.0" } }, "editor": { @@ -5847,14 +5847,14 @@ "version": "0.1.12", "bundled": true, "requires": { - "iconv-lite": "0.4.23" + "iconv-lite": "~0.4.13" } }, "end-of-stream": { "version": "1.4.1", "bundled": true, "requires": { - "once": "1.4.0" + "once": "^1.4.0" } }, "err-code": { @@ -5865,7 +5865,7 @@ "version": "0.1.7", "bundled": true, "requires": { - "prr": "1.0.1" + "prr": "~1.0.1" } }, "es6-promise": { @@ -5876,7 +5876,7 @@ "version": "5.0.0", "bundled": true, "requires": { - "es6-promise": "4.2.4" + "es6-promise": "^4.0.3" } }, "escape-string-regexp": { @@ -5887,13 +5887,13 @@ "version": "0.7.0", "bundled": true, "requires": { - "cross-spawn": "5.1.0", - "get-stream": "3.0.0", - "is-stream": "1.1.0", - "npm-run-path": "2.0.2", - "p-finally": "1.0.0", - "signal-exit": "3.0.2", - "strip-eof": "1.0.0" + "cross-spawn": "^5.0.1", + "get-stream": "^3.0.0", + "is-stream": "^1.1.0", + "npm-run-path": "^2.0.0", + "p-finally": "^1.0.0", + "signal-exit": "^3.0.0", + "strip-eof": "^1.0.0" }, "dependencies": { "get-stream": { @@ -5930,35 +5930,35 @@ "version": "2.1.0", "bundled": true, "requires": { - "locate-path": "2.0.0" + "locate-path": "^2.0.0" } }, "flush-write-stream": { "version": "1.0.3", "bundled": true, "requires": { - "inherits": "2.0.3", - "readable-stream": "2.3.6" + "inherits": "^2.0.1", + "readable-stream": "^2.0.4" }, "dependencies": { "readable-stream": { "version": "2.3.6", "bundled": true, "requires": { - "core-util-is": "1.0.2", - "inherits": "2.0.3", - "isarray": "1.0.0", - "process-nextick-args": "2.0.0", - "safe-buffer": "5.1.2", - "string_decoder": "1.1.1", - "util-deprecate": "1.0.2" + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" } }, "string_decoder": { "version": "1.1.1", "bundled": true, "requires": { - "safe-buffer": "5.1.2" + "safe-buffer": "~5.1.0" } } } @@ -5971,37 +5971,37 @@ "version": "2.3.2", "bundled": true, "requires": { - "asynckit": "0.4.0", + "asynckit": "^0.4.0", "combined-stream": "1.0.6", - "mime-types": "2.1.19" + "mime-types": "^2.1.12" } }, "from2": { "version": "2.3.0", "bundled": true, "requires": { - "inherits": "2.0.3", - "readable-stream": "2.3.6" + "inherits": "^2.0.1", + "readable-stream": "^2.0.0" }, "dependencies": { "readable-stream": { "version": "2.3.6", "bundled": true, "requires": { - "core-util-is": "1.0.2", - "inherits": "2.0.3", - "isarray": "1.0.0", - "process-nextick-args": "2.0.0", - "safe-buffer": "5.1.2", - "string_decoder": "1.1.1", - "util-deprecate": "1.0.2" + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" } }, "string_decoder": { "version": "1.1.1", "bundled": true, "requires": { - "safe-buffer": "5.1.2" + "safe-buffer": "~5.1.0" } } } @@ -6010,26 +6010,26 @@ "version": "1.2.5", "bundled": true, "requires": { - "minipass": "2.3.3" + "minipass": "^2.2.1" } }, "fs-vacuum": { "version": "1.2.10", "bundled": true, "requires": { - "graceful-fs": "4.1.15", - "path-is-inside": "1.0.2", - "rimraf": "2.6.3" + "graceful-fs": "^4.1.2", + "path-is-inside": "^1.0.1", + "rimraf": "^2.5.2" } }, "fs-write-stream-atomic": { "version": "1.0.10", "bundled": true, "requires": { - "graceful-fs": "4.1.15", - "iferr": "0.1.5", - "imurmurhash": "0.1.4", - "readable-stream": "2.3.6" + "graceful-fs": "^4.1.2", + "iferr": "^0.1.5", + "imurmurhash": "^0.1.4", + "readable-stream": "1 || 2" }, "dependencies": { "iferr": { @@ -6040,20 +6040,20 @@ "version": "2.3.6", "bundled": true, "requires": { - "core-util-is": "1.0.2", - "inherits": "2.0.3", - "isarray": "1.0.0", - "process-nextick-args": "2.0.0", - "safe-buffer": "5.1.2", - "string_decoder": "1.1.1", - "util-deprecate": "1.0.2" + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" } }, "string_decoder": { "version": "1.1.1", "bundled": true, "requires": { - "safe-buffer": "5.1.2" + "safe-buffer": "~5.1.0" } } } @@ -6066,24 +6066,24 @@ "version": "1.0.11", "bundled": true, "requires": { - "graceful-fs": "4.1.15", - "inherits": "2.0.3", - "mkdirp": "0.5.1", - "rimraf": "2.6.3" + "graceful-fs": "^4.1.2", + "inherits": "~2.0.0", + "mkdirp": ">=0.5 0", + "rimraf": "2" } }, "gauge": { "version": "2.7.4", "bundled": true, "requires": { - "aproba": "1.2.0", - "console-control-strings": "1.1.0", - "has-unicode": "2.0.1", - "object-assign": "4.1.1", - "signal-exit": "3.0.2", - "string-width": "1.0.2", - "strip-ansi": "3.0.1", - "wide-align": "1.1.2" + "aproba": "^1.0.3", + "console-control-strings": "^1.0.0", + "has-unicode": "^2.0.0", + "object-assign": "^4.1.0", + "signal-exit": "^3.0.0", + "string-width": "^1.0.1", + "strip-ansi": "^3.0.1", + "wide-align": "^1.1.0" }, "dependencies": { "aproba": { @@ -6094,9 +6094,9 @@ "version": "1.0.2", "bundled": true, "requires": { - "code-point-at": "1.1.0", - "is-fullwidth-code-point": "1.0.0", - "strip-ansi": "3.0.1" + "code-point-at": "^1.0.0", + "is-fullwidth-code-point": "^1.0.0", + "strip-ansi": "^3.0.0" } } } @@ -6109,14 +6109,14 @@ "version": "2.0.1", "bundled": true, "requires": { - "aproba": "1.2.0", - "fs-vacuum": "1.2.10", - "graceful-fs": "4.1.15", - "iferr": "0.1.5", - "mkdirp": "0.5.1", - "path-is-inside": "1.0.2", - "read-cmd-shim": "1.0.1", - "slide": "1.1.6" + "aproba": "^1.1.2", + "fs-vacuum": "^1.2.10", + "graceful-fs": "^4.1.11", + "iferr": "^0.1.5", + "mkdirp": "^0.5.1", + "path-is-inside": "^1.0.2", + "read-cmd-shim": "^1.0.1", + "slide": "^1.1.6" }, "dependencies": { "aproba": { @@ -6137,50 +6137,50 @@ "version": "4.1.0", "bundled": true, "requires": { - "pump": "3.0.0" + "pump": "^3.0.0" } }, "getpass": { "version": "0.1.7", "bundled": true, "requires": { - "assert-plus": "1.0.0" + "assert-plus": "^1.0.0" } }, "glob": { "version": "7.1.3", "bundled": true, "requires": { - "fs.realpath": "1.0.0", - "inflight": "1.0.6", - "inherits": "2.0.3", - "minimatch": "3.0.4", - "once": "1.4.0", - "path-is-absolute": "1.0.1" + "fs.realpath": "^1.0.0", + "inflight": "^1.0.4", + "inherits": "2", + "minimatch": "^3.0.4", + "once": "^1.3.0", + "path-is-absolute": "^1.0.0" } }, "global-dirs": { "version": "0.1.1", "bundled": true, "requires": { - "ini": "1.3.5" + "ini": "^1.3.4" } }, "got": { "version": "6.7.1", "bundled": true, "requires": { - "create-error-class": "3.0.2", - "duplexer3": "0.1.4", - "get-stream": "3.0.0", - "is-redirect": "1.0.0", - "is-retry-allowed": "1.1.0", - "is-stream": "1.1.0", - "lowercase-keys": "1.0.1", - "safe-buffer": "5.1.2", - "timed-out": "4.0.1", - "unzip-response": "2.0.1", - "url-parse-lax": "1.0.0" + "create-error-class": "^3.0.0", + "duplexer3": "^0.1.4", + "get-stream": "^3.0.0", + "is-redirect": "^1.0.0", + "is-retry-allowed": "^1.0.0", + "is-stream": "^1.0.0", + "lowercase-keys": "^1.0.0", + "safe-buffer": "^5.0.1", + "timed-out": "^4.0.0", + "unzip-response": "^2.0.1", + "url-parse-lax": "^1.0.0" }, "dependencies": { "get-stream": { @@ -6201,8 +6201,8 @@ "version": "5.1.0", "bundled": true, "requires": { - "ajv": "5.5.2", - "har-schema": "2.0.0" + "ajv": "^5.3.0", + "har-schema": "^2.0.0" } }, "has-flag": { @@ -6225,7 +6225,7 @@ "version": "2.1.0", "bundled": true, "requires": { - "agent-base": "4.2.0", + "agent-base": "4", "debug": "3.1.0" } }, @@ -6233,31 +6233,31 @@ "version": "1.2.0", "bundled": true, "requires": { - "assert-plus": "1.0.0", - "jsprim": "1.4.1", - "sshpk": "1.14.2" + "assert-plus": "^1.0.0", + "jsprim": "^1.2.2", + "sshpk": "^1.7.0" } }, "https-proxy-agent": { "version": "2.2.1", "bundled": true, "requires": { - "agent-base": "4.2.0", - "debug": "3.1.0" + "agent-base": "^4.1.0", + "debug": "^3.1.0" } }, "humanize-ms": { "version": "1.2.1", "bundled": true, "requires": { - "ms": "2.1.1" + "ms": "^2.0.0" } }, "iconv-lite": { "version": "0.4.23", "bundled": true, "requires": { - "safer-buffer": "2.1.2" + "safer-buffer": ">= 2.1.2 < 3" } }, "iferr": { @@ -6268,7 +6268,7 @@ "version": "3.0.1", "bundled": true, "requires": { - "minimatch": "3.0.4" + "minimatch": "^3.0.4" } }, "import-lazy": { @@ -6283,8 +6283,8 @@ "version": "1.0.6", "bundled": true, "requires": { - "once": "1.4.0", - "wrappy": "1.0.2" + "once": "^1.3.0", + "wrappy": "1" } }, "inherits": { @@ -6299,14 +6299,14 @@ "version": "1.10.3", "bundled": true, "requires": { - "glob": "7.1.3", - "npm-package-arg": "6.1.0", - "promzard": "0.3.0", - "read": "1.0.7", - "read-package-json": "2.0.13", - "semver": "5.6.0", - "validate-npm-package-license": "3.0.4", - "validate-npm-package-name": "3.0.0" + "glob": "^7.1.1", + "npm-package-arg": "^4.0.0 || ^5.0.0 || ^6.0.0", + "promzard": "^0.3.0", + "read": "~1.0.1", + "read-package-json": "1 || 2", + "semver": "2.x || 3.x || 4 || 5", + "validate-npm-package-license": "^3.0.1", + "validate-npm-package-name": "^3.0.0" } }, "invert-kv": { @@ -6325,14 +6325,14 @@ "version": "1.0.0", "bundled": true, "requires": { - "builtin-modules": "1.1.1" + "builtin-modules": "^1.0.0" } }, "is-ci": { "version": "1.1.0", "bundled": true, "requires": { - "ci-info": "1.6.0" + "ci-info": "^1.0.0" }, "dependencies": { "ci-info": { @@ -6345,22 +6345,22 @@ "version": "3.0.0", "bundled": true, "requires": { - "cidr-regex": "2.0.10" + "cidr-regex": "^2.0.10" } }, "is-fullwidth-code-point": { "version": "1.0.0", "bundled": true, "requires": { - "number-is-nan": "1.0.1" + "number-is-nan": "^1.0.0" } }, "is-installed-globally": { "version": "0.1.0", "bundled": true, "requires": { - "global-dirs": "0.1.1", - "is-path-inside": "1.0.1" + "global-dirs": "^0.1.0", + "is-path-inside": "^1.0.0" } }, "is-npm": { @@ -6375,7 +6375,7 @@ "version": "1.0.1", "bundled": true, "requires": { - "path-is-inside": "1.0.2" + "path-is-inside": "^1.0.1" } }, "is-redirect": { @@ -6445,7 +6445,7 @@ "version": "3.1.0", "bundled": true, "requires": { - "package-json": "4.0.1" + "package-json": "^4.0.0" } }, "lazy-property": { @@ -6456,64 +6456,64 @@ "version": "1.0.0", "bundled": true, "requires": { - "invert-kv": "1.0.0" + "invert-kv": "^1.0.0" } }, "libcipm": { "version": "3.0.3", "bundled": true, "requires": { - "bin-links": "1.1.2", - "bluebird": "3.5.3", - "figgy-pudding": "3.5.1", - "find-npm-prefix": "1.0.2", - "graceful-fs": "4.1.15", - "ini": "1.3.5", - "lock-verify": "2.0.2", - "mkdirp": "0.5.1", - "npm-lifecycle": "2.1.0", - "npm-logical-tree": "1.2.1", - "npm-package-arg": "6.1.0", - "pacote": "9.4.0", - "read-package-json": "2.0.13", - "rimraf": "2.6.3", - "worker-farm": "1.6.0" + "bin-links": "^1.1.2", + "bluebird": "^3.5.1", + "figgy-pudding": "^3.5.1", + "find-npm-prefix": "^1.0.2", + "graceful-fs": "^4.1.11", + "ini": "^1.3.5", + "lock-verify": "^2.0.2", + "mkdirp": "^0.5.1", + "npm-lifecycle": "^2.0.3", + "npm-logical-tree": "^1.2.1", + "npm-package-arg": "^6.1.0", + "pacote": "^9.1.0", + "read-package-json": "^2.0.13", + "rimraf": "^2.6.2", + "worker-farm": "^1.6.0" } }, "libnpm": { "version": "2.0.1", "bundled": true, "requires": { - "bin-links": "1.1.2", - "bluebird": "3.5.3", - "find-npm-prefix": "1.0.2", - "libnpmaccess": "3.0.1", - "libnpmconfig": "1.2.1", - "libnpmhook": "5.0.2", - "libnpmorg": "1.0.0", - "libnpmpublish": "1.1.1", - "libnpmsearch": "2.0.0", - "libnpmteam": "1.0.1", - "lock-verify": "2.0.2", - "npm-lifecycle": "2.1.0", - "npm-logical-tree": "1.2.1", - "npm-package-arg": "6.1.0", - "npm-profile": "4.0.1", - "npm-registry-fetch": "3.8.0", - "npmlog": "4.1.2", - "pacote": "9.4.0", - "read-package-json": "2.0.13", - "stringify-package": "1.0.0" + "bin-links": "^1.1.2", + "bluebird": "^3.5.3", + "find-npm-prefix": "^1.0.2", + "libnpmaccess": "^3.0.1", + "libnpmconfig": "^1.2.1", + "libnpmhook": "^5.0.2", + "libnpmorg": "^1.0.0", + "libnpmpublish": "^1.1.0", + "libnpmsearch": "^2.0.0", + "libnpmteam": "^1.0.1", + "lock-verify": "^2.0.2", + "npm-lifecycle": "^2.1.0", + "npm-logical-tree": "^1.2.1", + "npm-package-arg": "^6.1.0", + "npm-profile": "^4.0.1", + "npm-registry-fetch": "^3.8.0", + "npmlog": "^4.1.2", + "pacote": "^9.2.3", + "read-package-json": "^2.0.13", + "stringify-package": "^1.0.0" } }, "libnpmaccess": { "version": "3.0.1", "bundled": true, "requires": { - "aproba": "2.0.0", - "get-stream": "4.1.0", - "npm-package-arg": "6.1.0", - "npm-registry-fetch": "3.8.0" + "aproba": "^2.0.0", + "get-stream": "^4.0.0", + "npm-package-arg": "^6.1.0", + "npm-registry-fetch": "^3.8.0" }, "dependencies": { "aproba": { @@ -6526,38 +6526,38 @@ "version": "1.2.1", "bundled": true, "requires": { - "figgy-pudding": "3.5.1", - "find-up": "3.0.0", - "ini": "1.3.5" + "figgy-pudding": "^3.5.1", + "find-up": "^3.0.0", + "ini": "^1.3.5" }, "dependencies": { "find-up": { "version": "3.0.0", "bundled": true, "requires": { - "locate-path": "3.0.0" + "locate-path": "^3.0.0" } }, "locate-path": { "version": "3.0.0", "bundled": true, "requires": { - "p-locate": "3.0.0", - "path-exists": "3.0.0" + "p-locate": "^3.0.0", + "path-exists": "^3.0.0" } }, "p-limit": { "version": "2.1.0", "bundled": true, "requires": { - "p-try": "2.0.0" + "p-try": "^2.0.0" } }, "p-locate": { "version": "3.0.0", "bundled": true, "requires": { - "p-limit": "2.1.0" + "p-limit": "^2.0.0" } }, "p-try": { @@ -6570,20 +6570,20 @@ "version": "5.0.2", "bundled": true, "requires": { - "aproba": "2.0.0", - "figgy-pudding": "3.5.1", - "get-stream": "4.1.0", - "npm-registry-fetch": "3.8.0" + "aproba": "^2.0.0", + "figgy-pudding": "^3.4.1", + "get-stream": "^4.0.0", + "npm-registry-fetch": "^3.8.0" } }, "libnpmorg": { "version": "1.0.0", "bundled": true, "requires": { - "aproba": "2.0.0", - "figgy-pudding": "3.5.1", - "get-stream": "4.1.0", - "npm-registry-fetch": "3.8.0" + "aproba": "^2.0.0", + "figgy-pudding": "^3.4.1", + "get-stream": "^4.0.0", + "npm-registry-fetch": "^3.8.0" }, "dependencies": { "aproba": { @@ -6596,34 +6596,34 @@ "version": "1.1.1", "bundled": true, "requires": { - "aproba": "2.0.0", - "figgy-pudding": "3.5.1", - "get-stream": "4.1.0", - "lodash.clonedeep": "4.5.0", - "normalize-package-data": "2.4.0", - "npm-package-arg": "6.1.0", - "npm-registry-fetch": "3.8.0", - "semver": "5.6.0", - "ssri": "6.0.1" + "aproba": "^2.0.0", + "figgy-pudding": "^3.5.1", + "get-stream": "^4.0.0", + "lodash.clonedeep": "^4.5.0", + "normalize-package-data": "^2.4.0", + "npm-package-arg": "^6.1.0", + "npm-registry-fetch": "^3.8.0", + "semver": "^5.5.1", + "ssri": "^6.0.1" } }, "libnpmsearch": { "version": "2.0.0", "bundled": true, "requires": { - "figgy-pudding": "3.5.1", - "get-stream": "4.1.0", - "npm-registry-fetch": "3.8.0" + "figgy-pudding": "^3.5.1", + "get-stream": "^4.0.0", + "npm-registry-fetch": "^3.8.0" } }, "libnpmteam": { "version": "1.0.1", "bundled": true, "requires": { - "aproba": "2.0.0", - "figgy-pudding": "3.5.1", - "get-stream": "4.1.0", - "npm-registry-fetch": "3.8.0" + "aproba": "^2.0.0", + "figgy-pudding": "^3.4.1", + "get-stream": "^4.0.0", + "npm-registry-fetch": "^3.8.0" }, "dependencies": { "aproba": { @@ -6636,37 +6636,37 @@ "version": "10.2.0", "bundled": true, "requires": { - "dotenv": "5.0.1", - "npm-package-arg": "6.1.0", - "rimraf": "2.6.3", - "safe-buffer": "5.1.2", - "update-notifier": "2.5.0", - "which": "1.3.1", - "y18n": "4.0.0", - "yargs": "11.0.0" + "dotenv": "^5.0.1", + "npm-package-arg": "^6.0.0", + "rimraf": "^2.6.2", + "safe-buffer": "^5.1.0", + "update-notifier": "^2.3.0", + "which": "^1.3.0", + "y18n": "^4.0.0", + "yargs": "^11.0.0" } }, "locate-path": { "version": "2.0.0", "bundled": true, "requires": { - "p-locate": "2.0.0", - "path-exists": "3.0.0" + "p-locate": "^2.0.0", + "path-exists": "^3.0.0" } }, "lock-verify": { "version": "2.0.2", "bundled": true, "requires": { - "npm-package-arg": "6.1.0", - "semver": "5.6.0" + "npm-package-arg": "^5.1.2 || 6", + "semver": "^5.4.1" } }, "lockfile": { "version": "1.0.4", "bundled": true, "requires": { - "signal-exit": "3.0.2" + "signal-exit": "^3.0.2" } }, "lodash._baseindexof": { @@ -6677,8 +6677,8 @@ "version": "4.6.0", "bundled": true, "requires": { - "lodash._createset": "4.0.3", - "lodash._root": "3.0.1" + "lodash._createset": "~4.0.0", + "lodash._root": "~3.0.0" } }, "lodash._bindcallback": { @@ -6693,7 +6693,7 @@ "version": "3.1.2", "bundled": true, "requires": { - "lodash._getnative": "3.9.1" + "lodash._getnative": "^3.0.0" } }, "lodash._createset": { @@ -6736,32 +6736,32 @@ "version": "4.1.5", "bundled": true, "requires": { - "pseudomap": "1.0.2", - "yallist": "2.1.2" + "pseudomap": "^1.0.2", + "yallist": "^2.1.2" } }, "make-dir": { "version": "1.3.0", "bundled": true, "requires": { - "pify": "3.0.0" + "pify": "^3.0.0" } }, "make-fetch-happen": { "version": "4.0.1", "bundled": true, "requires": { - "agentkeepalive": "3.4.1", - "cacache": "11.3.2", - "http-cache-semantics": "3.8.1", - "http-proxy-agent": "2.1.0", - "https-proxy-agent": "2.2.1", - "lru-cache": "4.1.5", - "mississippi": "3.0.0", - "node-fetch-npm": "2.0.2", - "promise-retry": "1.1.1", - "socks-proxy-agent": "4.0.1", - "ssri": "6.0.1" + "agentkeepalive": "^3.4.1", + "cacache": "^11.0.1", + "http-cache-semantics": "^3.8.1", + "http-proxy-agent": "^2.1.0", + "https-proxy-agent": "^2.2.1", + "lru-cache": "^4.1.2", + "mississippi": "^3.0.0", + "node-fetch-npm": "^2.0.2", + "promise-retry": "^1.1.1", + "socks-proxy-agent": "^4.0.0", + "ssri": "^6.0.0" } }, "meant": { @@ -6772,7 +6772,7 @@ "version": "1.1.0", "bundled": true, "requires": { - "mimic-fn": "1.2.0" + "mimic-fn": "^1.0.0" } }, "mime-db": { @@ -6783,7 +6783,7 @@ "version": "2.1.19", "bundled": true, "requires": { - "mime-db": "1.35.0" + "mime-db": "~1.35.0" } }, "mimic-fn": { @@ -6794,7 +6794,7 @@ "version": "3.0.4", "bundled": true, "requires": { - "brace-expansion": "1.1.11" + "brace-expansion": "^1.1.7" } }, "minimist": { @@ -6805,8 +6805,8 @@ "version": "2.3.3", "bundled": true, "requires": { - "safe-buffer": "5.1.2", - "yallist": "3.0.2" + "safe-buffer": "^5.1.2", + "yallist": "^3.0.0" }, "dependencies": { "yallist": { @@ -6819,23 +6819,23 @@ "version": "1.1.1", "bundled": true, "requires": { - "minipass": "2.3.3" + "minipass": "^2.2.1" } }, "mississippi": { "version": "3.0.0", "bundled": true, "requires": { - "concat-stream": "1.6.2", - "duplexify": "3.6.0", - "end-of-stream": "1.4.1", - "flush-write-stream": "1.0.3", - "from2": "2.3.0", - "parallel-transform": "1.1.0", - "pump": "3.0.0", - "pumpify": "1.5.1", - "stream-each": "1.2.2", - "through2": "2.0.3" + "concat-stream": "^1.5.0", + "duplexify": "^3.4.2", + "end-of-stream": "^1.1.0", + "flush-write-stream": "^1.0.0", + "from2": "^2.1.0", + "parallel-transform": "^1.1.0", + "pump": "^3.0.0", + "pumpify": "^1.3.3", + "stream-each": "^1.1.0", + "through2": "^2.0.0" } }, "mkdirp": { @@ -6849,12 +6849,12 @@ "version": "1.0.1", "bundled": true, "requires": { - "aproba": "1.2.0", - "copy-concurrently": "1.0.5", - "fs-write-stream-atomic": "1.0.10", - "mkdirp": "0.5.1", - "rimraf": "2.6.3", - "run-queue": "1.0.3" + "aproba": "^1.1.1", + "copy-concurrently": "^1.0.0", + "fs-write-stream-atomic": "^1.0.8", + "mkdirp": "^0.5.1", + "rimraf": "^2.5.4", + "run-queue": "^1.0.3" }, "dependencies": { "aproba": { @@ -6875,34 +6875,34 @@ "version": "2.0.2", "bundled": true, "requires": { - "encoding": "0.1.12", - "json-parse-better-errors": "1.0.2", - "safe-buffer": "5.1.2" + "encoding": "^0.1.11", + "json-parse-better-errors": "^1.0.0", + "safe-buffer": "^5.1.1" } }, "node-gyp": { "version": "3.8.0", "bundled": true, "requires": { - "fstream": "1.0.11", - "glob": "7.1.3", - "graceful-fs": "4.1.15", - "mkdirp": "0.5.1", - "nopt": "3.0.6", - "npmlog": "4.1.2", - "osenv": "0.1.5", - "request": "2.88.0", - "rimraf": "2.6.3", - "semver": "5.3.0", - "tar": "2.2.1", - "which": "1.3.1" + "fstream": "^1.0.0", + "glob": "^7.0.3", + "graceful-fs": "^4.1.2", + "mkdirp": "^0.5.0", + "nopt": "2 || 3", + "npmlog": "0 || 1 || 2 || 3 || 4", + "osenv": "0", + "request": "^2.87.0", + "rimraf": "2", + "semver": "~5.3.0", + "tar": "^2.0.0", + "which": "1" }, "dependencies": { "nopt": { "version": "3.0.6", "bundled": true, "requires": { - "abbrev": "1.1.1" + "abbrev": "1" } }, "semver": { @@ -6913,9 +6913,9 @@ "version": "2.2.1", "bundled": true, "requires": { - "block-stream": "0.0.9", - "fstream": "1.0.11", - "inherits": "2.0.3" + "block-stream": "*", + "fstream": "^1.0.2", + "inherits": "2" } } } @@ -6924,26 +6924,26 @@ "version": "4.0.1", "bundled": true, "requires": { - "abbrev": "1.1.1", - "osenv": "0.1.5" + "abbrev": "1", + "osenv": "^0.1.4" } }, "normalize-package-data": { "version": "2.4.0", "bundled": true, "requires": { - "hosted-git-info": "2.7.1", - "is-builtin-module": "1.0.0", - "semver": "5.6.0", - "validate-npm-package-license": "3.0.4" + "hosted-git-info": "^2.1.4", + "is-builtin-module": "^1.0.0", + "semver": "2 || 3 || 4 || 5", + "validate-npm-package-license": "^3.0.1" } }, "npm-audit-report": { "version": "1.3.2", "bundled": true, "requires": { - "cli-table3": "0.5.1", - "console-control-strings": "1.1.0" + "cli-table3": "^0.5.0", + "console-control-strings": "^1.1.0" } }, "npm-bundled": { @@ -6958,21 +6958,21 @@ "version": "3.0.0", "bundled": true, "requires": { - "semver": "5.6.0" + "semver": "^2.3.0 || 3.x || 4 || 5" } }, "npm-lifecycle": { "version": "2.1.0", "bundled": true, "requires": { - "byline": "5.0.0", - "graceful-fs": "4.1.15", - "node-gyp": "3.8.0", - "resolve-from": "4.0.0", - "slide": "1.1.6", + "byline": "^5.0.0", + "graceful-fs": "^4.1.11", + "node-gyp": "^3.8.0", + "resolve-from": "^4.0.0", + "slide": "^1.1.6", "uid-number": "0.0.6", - "umask": "1.1.0", - "which": "1.3.1" + "umask": "^1.1.0", + "which": "^1.3.1" } }, "npm-logical-tree": { @@ -6983,55 +6983,55 @@ "version": "6.1.0", "bundled": true, "requires": { - "hosted-git-info": "2.7.1", - "osenv": "0.1.5", - "semver": "5.6.0", - "validate-npm-package-name": "3.0.0" + "hosted-git-info": "^2.6.0", + "osenv": "^0.1.5", + "semver": "^5.5.0", + "validate-npm-package-name": "^3.0.0" } }, "npm-packlist": { "version": "1.2.0", "bundled": true, "requires": { - "ignore-walk": "3.0.1", - "npm-bundled": "1.0.5" + "ignore-walk": "^3.0.1", + "npm-bundled": "^1.0.1" } }, "npm-pick-manifest": { "version": "2.2.3", "bundled": true, "requires": { - "figgy-pudding": "3.5.1", - "npm-package-arg": "6.1.0", - "semver": "5.6.0" + "figgy-pudding": "^3.5.1", + "npm-package-arg": "^6.0.0", + "semver": "^5.4.1" } }, "npm-profile": { "version": "4.0.1", "bundled": true, "requires": { - "aproba": "2.0.0", - "figgy-pudding": "3.5.1", - "npm-registry-fetch": "3.8.0" + "aproba": "^1.1.2 || 2", + "figgy-pudding": "^3.4.1", + "npm-registry-fetch": "^3.8.0" } }, "npm-registry-fetch": { "version": "3.8.0", "bundled": true, "requires": { - "JSONStream": "1.3.5", - "bluebird": "3.5.3", - "figgy-pudding": "3.5.1", - "lru-cache": "4.1.5", - "make-fetch-happen": "4.0.1", - "npm-package-arg": "6.1.0" + "JSONStream": "^1.3.4", + "bluebird": "^3.5.1", + "figgy-pudding": "^3.4.1", + "lru-cache": "^4.1.3", + "make-fetch-happen": "^4.0.1", + "npm-package-arg": "^6.1.0" } }, "npm-run-path": { "version": "2.0.2", "bundled": true, "requires": { - "path-key": "2.0.1" + "path-key": "^2.0.0" } }, "npm-user-validate": { @@ -7042,10 +7042,10 @@ "version": "4.1.2", "bundled": true, "requires": { - "are-we-there-yet": "1.1.4", - "console-control-strings": "1.1.0", - "gauge": "2.7.4", - "set-blocking": "2.0.0" + "are-we-there-yet": "~1.1.2", + "console-control-strings": "~1.1.0", + "gauge": "~2.7.3", + "set-blocking": "~2.0.0" } }, "number-is-nan": { @@ -7064,7 +7064,7 @@ "version": "1.4.0", "bundled": true, "requires": { - "wrappy": "1.0.2" + "wrappy": "1" } }, "opener": { @@ -7079,9 +7079,9 @@ "version": "2.1.0", "bundled": true, "requires": { - "execa": "0.7.0", - "lcid": "1.0.0", - "mem": "1.1.0" + "execa": "^0.7.0", + "lcid": "^1.0.0", + "mem": "^1.1.0" } }, "os-tmpdir": { @@ -7092,8 +7092,8 @@ "version": "0.1.5", "bundled": true, "requires": { - "os-homedir": "1.0.2", - "os-tmpdir": "1.0.2" + "os-homedir": "^1.0.0", + "os-tmpdir": "^1.0.0" } }, "p-finally": { @@ -7104,14 +7104,14 @@ "version": "1.2.0", "bundled": true, "requires": { - "p-try": "1.0.0" + "p-try": "^1.0.0" } }, "p-locate": { "version": "2.0.0", "bundled": true, "requires": { - "p-limit": "1.2.0" + "p-limit": "^1.1.0" } }, "p-try": { @@ -7122,58 +7122,58 @@ "version": "4.0.1", "bundled": true, "requires": { - "got": "6.7.1", - "registry-auth-token": "3.3.2", - "registry-url": "3.1.0", - "semver": "5.6.0" + "got": "^6.7.1", + "registry-auth-token": "^3.0.1", + "registry-url": "^3.0.3", + "semver": "^5.1.0" } }, "pacote": { "version": "9.4.0", "bundled": true, "requires": { - "bluebird": "3.5.3", - "cacache": "11.3.2", - "figgy-pudding": "3.5.1", - "get-stream": "4.1.0", - "glob": "7.1.3", - "lru-cache": "5.1.1", - "make-fetch-happen": "4.0.1", - "minimatch": "3.0.4", - "minipass": "2.3.5", - "mississippi": "3.0.0", - "mkdirp": "0.5.1", - "normalize-package-data": "2.4.0", - "npm-package-arg": "6.1.0", - "npm-packlist": "1.2.0", - "npm-pick-manifest": "2.2.3", - "npm-registry-fetch": "3.8.0", - "osenv": "0.1.5", - "promise-inflight": "1.0.1", - "promise-retry": "1.1.1", - "protoduck": "5.0.1", - "rimraf": "2.6.3", - "safe-buffer": "5.1.2", - "semver": "5.6.0", - "ssri": "6.0.1", - "tar": "4.4.8", - "unique-filename": "1.1.1", - "which": "1.3.1" + "bluebird": "^3.5.3", + "cacache": "^11.3.2", + "figgy-pudding": "^3.5.1", + "get-stream": "^4.1.0", + "glob": "^7.1.3", + "lru-cache": "^5.1.1", + "make-fetch-happen": "^4.0.1", + "minimatch": "^3.0.4", + "minipass": "^2.3.5", + "mississippi": "^3.0.0", + "mkdirp": "^0.5.1", + "normalize-package-data": "^2.4.0", + "npm-package-arg": "^6.1.0", + "npm-packlist": "^1.1.12", + "npm-pick-manifest": "^2.2.3", + "npm-registry-fetch": "^3.8.0", + "osenv": "^0.1.5", + "promise-inflight": "^1.0.1", + "promise-retry": "^1.1.1", + "protoduck": "^5.0.1", + "rimraf": "^2.6.2", + "safe-buffer": "^5.1.2", + "semver": "^5.6.0", + "ssri": "^6.0.1", + "tar": "^4.4.8", + "unique-filename": "^1.1.1", + "which": "^1.3.1" }, "dependencies": { "lru-cache": { "version": "5.1.1", "bundled": true, "requires": { - "yallist": "3.0.3" + "yallist": "^3.0.2" } }, "minipass": { "version": "2.3.5", "bundled": true, "requires": { - "safe-buffer": "5.1.2", - "yallist": "3.0.3" + "safe-buffer": "^5.1.2", + "yallist": "^3.0.0" } }, "yallist": { @@ -7186,29 +7186,29 @@ "version": "1.1.0", "bundled": true, "requires": { - "cyclist": "0.2.2", - "inherits": "2.0.3", - "readable-stream": "2.3.6" + "cyclist": "~0.2.2", + "inherits": "^2.0.3", + "readable-stream": "^2.1.5" }, "dependencies": { "readable-stream": { "version": "2.3.6", "bundled": true, "requires": { - "core-util-is": "1.0.2", - "inherits": "2.0.3", - "isarray": "1.0.0", - "process-nextick-args": "2.0.0", - "safe-buffer": "5.1.2", - "string_decoder": "1.1.1", - "util-deprecate": "1.0.2" + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" } }, "string_decoder": { "version": "1.1.1", "bundled": true, "requires": { - "safe-buffer": "5.1.2" + "safe-buffer": "~5.1.0" } } } @@ -7253,8 +7253,8 @@ "version": "1.1.1", "bundled": true, "requires": { - "err-code": "1.1.2", - "retry": "0.10.1" + "err-code": "^1.0.0", + "retry": "^0.10.0" }, "dependencies": { "retry": { @@ -7267,7 +7267,7 @@ "version": "0.3.0", "bundled": true, "requires": { - "read": "1.0.7" + "read": "1" } }, "proto-list": { @@ -7278,7 +7278,7 @@ "version": "5.0.1", "bundled": true, "requires": { - "genfun": "5.0.0" + "genfun": "^5.0.0" } }, "prr": { @@ -7297,25 +7297,25 @@ "version": "3.0.0", "bundled": true, "requires": { - "end-of-stream": "1.4.1", - "once": "1.4.0" + "end-of-stream": "^1.1.0", + "once": "^1.3.1" } }, "pumpify": { "version": "1.5.1", "bundled": true, "requires": { - "duplexify": "3.6.0", - "inherits": "2.0.3", - "pump": "2.0.1" + "duplexify": "^3.6.0", + "inherits": "^2.0.3", + "pump": "^2.0.0" }, "dependencies": { "pump": { "version": "2.0.1", "bundled": true, "requires": { - "end-of-stream": "1.4.1", - "once": "1.4.0" + "end-of-stream": "^1.1.0", + "once": "^1.3.1" } } } @@ -7336,8 +7336,8 @@ "version": "6.2.0", "bundled": true, "requires": { - "decode-uri-component": "0.2.0", - "strict-uri-encode": "2.0.0" + "decode-uri-component": "^0.2.0", + "strict-uri-encode": "^2.0.0" } }, "qw": { @@ -7348,10 +7348,10 @@ "version": "1.2.7", "bundled": true, "requires": { - "deep-extend": "0.5.1", - "ini": "1.3.5", - "minimist": "1.2.0", - "strip-json-comments": "2.0.1" + "deep-extend": "^0.5.1", + "ini": "~1.3.0", + "minimist": "^1.2.0", + "strip-json-comments": "~2.0.1" }, "dependencies": { "minimist": { @@ -7364,109 +7364,109 @@ "version": "1.0.7", "bundled": true, "requires": { - "mute-stream": "0.0.7" + "mute-stream": "~0.0.4" } }, "read-cmd-shim": { "version": "1.0.1", "bundled": true, "requires": { - "graceful-fs": "4.1.15" + "graceful-fs": "^4.1.2" } }, "read-installed": { "version": "4.0.3", "bundled": true, "requires": { - "debuglog": "1.0.1", - "graceful-fs": "4.1.15", - "read-package-json": "2.0.13", - "readdir-scoped-modules": "1.0.2", - "semver": "5.6.0", - "slide": "1.1.6", - "util-extend": "1.0.3" + "debuglog": "^1.0.1", + "graceful-fs": "^4.1.2", + "read-package-json": "^2.0.0", + "readdir-scoped-modules": "^1.0.0", + "semver": "2 || 3 || 4 || 5", + "slide": "~1.1.3", + "util-extend": "^1.0.1" } }, "read-package-json": { "version": "2.0.13", "bundled": true, "requires": { - "glob": "7.1.3", - "graceful-fs": "4.1.15", - "json-parse-better-errors": "1.0.2", - "normalize-package-data": "2.4.0", - "slash": "1.0.0" + "glob": "^7.1.1", + "graceful-fs": "^4.1.2", + "json-parse-better-errors": "^1.0.1", + "normalize-package-data": "^2.0.0", + "slash": "^1.0.0" } }, "read-package-tree": { "version": "5.2.1", "bundled": true, "requires": { - "debuglog": "1.0.1", - "dezalgo": "1.0.3", - "once": "1.4.0", - "read-package-json": "2.0.13", - "readdir-scoped-modules": "1.0.2" + "debuglog": "^1.0.1", + "dezalgo": "^1.0.0", + "once": "^1.3.0", + "read-package-json": "^2.0.0", + "readdir-scoped-modules": "^1.0.0" } }, "readable-stream": { "version": "3.1.1", "bundled": true, "requires": { - "inherits": "2.0.3", - "string_decoder": "1.2.0", - "util-deprecate": "1.0.2" + "inherits": "^2.0.3", + "string_decoder": "^1.1.1", + "util-deprecate": "^1.0.1" } }, "readdir-scoped-modules": { "version": "1.0.2", "bundled": true, "requires": { - "debuglog": "1.0.1", - "dezalgo": "1.0.3", - "graceful-fs": "4.1.15", - "once": "1.4.0" + "debuglog": "^1.0.1", + "dezalgo": "^1.0.0", + "graceful-fs": "^4.1.2", + "once": "^1.3.0" } }, "registry-auth-token": { "version": "3.3.2", "bundled": true, "requires": { - "rc": "1.2.7", - "safe-buffer": "5.1.2" + "rc": "^1.1.6", + "safe-buffer": "^5.0.1" } }, "registry-url": { "version": "3.1.0", "bundled": true, "requires": { - "rc": "1.2.7" + "rc": "^1.0.1" } }, "request": { "version": "2.88.0", "bundled": true, "requires": { - "aws-sign2": "0.7.0", - "aws4": "1.8.0", - "caseless": "0.12.0", - "combined-stream": "1.0.6", - "extend": "3.0.2", - "forever-agent": "0.6.1", - "form-data": "2.3.2", - "har-validator": "5.1.0", - "http-signature": "1.2.0", - "is-typedarray": "1.0.0", - "isstream": "0.1.2", - "json-stringify-safe": "5.0.1", - "mime-types": "2.1.19", - "oauth-sign": "0.9.0", - "performance-now": "2.1.0", - "qs": "6.5.2", - "safe-buffer": "5.1.2", - "tough-cookie": "2.4.3", - "tunnel-agent": "0.6.0", - "uuid": "3.3.2" + "aws-sign2": "~0.7.0", + "aws4": "^1.8.0", + "caseless": "~0.12.0", + "combined-stream": "~1.0.6", + "extend": "~3.0.2", + "forever-agent": "~0.6.1", + "form-data": "~2.3.2", + "har-validator": "~5.1.0", + "http-signature": "~1.2.0", + "is-typedarray": "~1.0.0", + "isstream": "~0.1.2", + "json-stringify-safe": "~5.0.1", + "mime-types": "~2.1.19", + "oauth-sign": "~0.9.0", + "performance-now": "^2.1.0", + "qs": "~6.5.2", + "safe-buffer": "^5.1.2", + "tough-cookie": "~2.4.3", + "tunnel-agent": "^0.6.0", + "uuid": "^3.3.2" } }, "require-directory": { @@ -7489,14 +7489,14 @@ "version": "2.6.3", "bundled": true, "requires": { - "glob": "7.1.3" + "glob": "^7.1.3" } }, "run-queue": { "version": "1.0.3", "bundled": true, "requires": { - "aproba": "1.2.0" + "aproba": "^1.1.1" }, "dependencies": { "aproba": { @@ -7521,7 +7521,7 @@ "version": "2.1.0", "bundled": true, "requires": { - "semver": "5.6.0" + "semver": "^5.0.3" } }, "set-blocking": { @@ -7532,28 +7532,28 @@ "version": "2.0.1", "bundled": true, "requires": { - "graceful-fs": "4.1.15", - "readable-stream": "2.3.6" + "graceful-fs": "^4.1.2", + "readable-stream": "^2.0.2" }, "dependencies": { "readable-stream": { "version": "2.3.6", "bundled": true, "requires": { - "core-util-is": "1.0.2", - "inherits": "2.0.3", - "isarray": "1.0.0", - "process-nextick-args": "2.0.0", - "safe-buffer": "5.1.2", - "string_decoder": "1.1.1", - "util-deprecate": "1.0.2" + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" } }, "string_decoder": { "version": "1.1.1", "bundled": true, "requires": { - "safe-buffer": "5.1.2" + "safe-buffer": "~5.1.0" } } } @@ -7562,7 +7562,7 @@ "version": "1.2.0", "bundled": true, "requires": { - "shebang-regex": "1.0.0" + "shebang-regex": "^1.0.0" } }, "shebang-regex": { @@ -7589,16 +7589,16 @@ "version": "2.2.0", "bundled": true, "requires": { - "ip": "1.1.5", - "smart-buffer": "4.0.1" + "ip": "^1.1.5", + "smart-buffer": "^4.0.1" } }, "socks-proxy-agent": { "version": "4.0.1", "bundled": true, "requires": { - "agent-base": "4.2.0", - "socks": "2.2.0" + "agent-base": "~4.2.0", + "socks": "~2.2.0" } }, "sorted-object": { @@ -7609,16 +7609,16 @@ "version": "2.1.3", "bundled": true, "requires": { - "from2": "1.3.0", - "stream-iterate": "1.2.0" + "from2": "^1.3.0", + "stream-iterate": "^1.1.0" }, "dependencies": { "from2": { "version": "1.3.0", "bundled": true, "requires": { - "inherits": "2.0.3", - "readable-stream": "1.1.14" + "inherits": "~2.0.1", + "readable-stream": "~1.1.10" } }, "isarray": { @@ -7629,10 +7629,10 @@ "version": "1.1.14", "bundled": true, "requires": { - "core-util-is": "1.0.2", - "inherits": "2.0.3", + "core-util-is": "~1.0.0", + "inherits": "~2.0.1", "isarray": "0.0.1", - "string_decoder": "0.10.31" + "string_decoder": "~0.10.x" } }, "string_decoder": { @@ -7645,8 +7645,8 @@ "version": "3.0.0", "bundled": true, "requires": { - "spdx-expression-parse": "3.0.0", - "spdx-license-ids": "3.0.3" + "spdx-expression-parse": "^3.0.0", + "spdx-license-ids": "^3.0.0" } }, "spdx-exceptions": { @@ -7657,8 +7657,8 @@ "version": "3.0.0", "bundled": true, "requires": { - "spdx-exceptions": "2.1.0", - "spdx-license-ids": "3.0.3" + "spdx-exceptions": "^2.1.0", + "spdx-license-ids": "^3.0.0" } }, "spdx-license-ids": { @@ -7669,58 +7669,58 @@ "version": "1.14.2", "bundled": true, "requires": { - "asn1": "0.2.4", - "assert-plus": "1.0.0", - "bcrypt-pbkdf": "1.0.2", - "dashdash": "1.14.1", - "ecc-jsbn": "0.1.2", - "getpass": "0.1.7", - "jsbn": "0.1.1", - "safer-buffer": "2.1.2", - "tweetnacl": "0.14.5" + "asn1": "~0.2.3", + "assert-plus": "^1.0.0", + "bcrypt-pbkdf": "^1.0.0", + "dashdash": "^1.12.0", + "ecc-jsbn": "~0.1.1", + "getpass": "^0.1.1", + "jsbn": "~0.1.0", + "safer-buffer": "^2.0.2", + "tweetnacl": "~0.14.0" } }, "ssri": { "version": "6.0.1", "bundled": true, "requires": { - "figgy-pudding": "3.5.1" + "figgy-pudding": "^3.5.1" } }, "stream-each": { "version": "1.2.2", "bundled": true, "requires": { - "end-of-stream": "1.4.1", - "stream-shift": "1.0.0" + "end-of-stream": "^1.1.0", + "stream-shift": "^1.0.0" } }, "stream-iterate": { "version": "1.2.0", "bundled": true, "requires": { - "readable-stream": "2.3.6", - "stream-shift": "1.0.0" + "readable-stream": "^2.1.5", + "stream-shift": "^1.0.0" }, "dependencies": { "readable-stream": { "version": "2.3.6", "bundled": true, "requires": { - "core-util-is": "1.0.2", - "inherits": "2.0.3", - "isarray": "1.0.0", - "process-nextick-args": "2.0.0", - "safe-buffer": "5.1.2", - "string_decoder": "1.1.1", - "util-deprecate": "1.0.2" + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" } }, "string_decoder": { "version": "1.1.1", "bundled": true, "requires": { - "safe-buffer": "5.1.2" + "safe-buffer": "~5.1.0" } } } @@ -7737,8 +7737,8 @@ "version": "2.1.1", "bundled": true, "requires": { - "is-fullwidth-code-point": "2.0.0", - "strip-ansi": "4.0.0" + "is-fullwidth-code-point": "^2.0.0", + "strip-ansi": "^4.0.0" }, "dependencies": { "ansi-regex": { @@ -7753,7 +7753,7 @@ "version": "4.0.0", "bundled": true, "requires": { - "ansi-regex": "3.0.0" + "ansi-regex": "^3.0.0" } } } @@ -7762,7 +7762,7 @@ "version": "1.2.0", "bundled": true, "requires": { - "safe-buffer": "5.1.2" + "safe-buffer": "~5.1.0" } }, "stringify-package": { @@ -7773,7 +7773,7 @@ "version": "3.0.1", "bundled": true, "requires": { - "ansi-regex": "2.1.1" + "ansi-regex": "^2.0.0" } }, "strip-eof": { @@ -7788,20 +7788,20 @@ "version": "5.4.0", "bundled": true, "requires": { - "has-flag": "3.0.0" + "has-flag": "^3.0.0" } }, "tar": { "version": "4.4.8", "bundled": true, "requires": { - "chownr": "1.1.1", - "fs-minipass": "1.2.5", - "minipass": "2.3.5", - "minizlib": "1.1.1", - "mkdirp": "0.5.1", - "safe-buffer": "5.1.2", - "yallist": "3.0.3" + "chownr": "^1.1.1", + "fs-minipass": "^1.2.5", + "minipass": "^2.3.4", + "minizlib": "^1.1.1", + "mkdirp": "^0.5.0", + "safe-buffer": "^5.1.2", + "yallist": "^3.0.2" }, "dependencies": { "chownr": { @@ -7812,8 +7812,8 @@ "version": "2.3.5", "bundled": true, "requires": { - "safe-buffer": "5.1.2", - "yallist": "3.0.3" + "safe-buffer": "^5.1.2", + "yallist": "^3.0.0" } }, "yallist": { @@ -7826,7 +7826,7 @@ "version": "1.2.0", "bundled": true, "requires": { - "execa": "0.7.0" + "execa": "^0.7.0" } }, "text-table": { @@ -7841,28 +7841,28 @@ "version": "2.0.3", "bundled": true, "requires": { - "readable-stream": "2.3.6", - "xtend": "4.0.1" + "readable-stream": "^2.1.5", + "xtend": "~4.0.1" }, "dependencies": { "readable-stream": { "version": "2.3.6", "bundled": true, "requires": { - "core-util-is": "1.0.2", - "inherits": "2.0.3", - "isarray": "1.0.0", - "process-nextick-args": "2.0.0", - "safe-buffer": "5.1.2", - "string_decoder": "1.1.1", - "util-deprecate": "1.0.2" + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" } }, "string_decoder": { "version": "1.1.1", "bundled": true, "requires": { - "safe-buffer": "5.1.2" + "safe-buffer": "~5.1.0" } } } @@ -7879,15 +7879,15 @@ "version": "2.4.3", "bundled": true, "requires": { - "psl": "1.1.29", - "punycode": "1.4.1" + "psl": "^1.1.24", + "punycode": "^1.4.1" } }, "tunnel-agent": { "version": "0.6.0", "bundled": true, "requires": { - "safe-buffer": "5.1.2" + "safe-buffer": "^5.0.1" } }, "tweetnacl": { @@ -7911,21 +7911,21 @@ "version": "1.1.1", "bundled": true, "requires": { - "unique-slug": "2.0.0" + "unique-slug": "^2.0.0" } }, "unique-slug": { "version": "2.0.0", "bundled": true, "requires": { - "imurmurhash": "0.1.4" + "imurmurhash": "^0.1.4" } }, "unique-string": { "version": "1.0.0", "bundled": true, "requires": { - "crypto-random-string": "1.0.0" + "crypto-random-string": "^1.0.0" } }, "unpipe": { @@ -7940,23 +7940,23 @@ "version": "2.5.0", "bundled": true, "requires": { - "boxen": "1.3.0", - "chalk": "2.4.1", - "configstore": "3.1.2", - "import-lazy": "2.1.0", - "is-ci": "1.1.0", - "is-installed-globally": "0.1.0", - "is-npm": "1.0.0", - "latest-version": "3.1.0", - "semver-diff": "2.1.0", - "xdg-basedir": "3.0.0" + "boxen": "^1.2.1", + "chalk": "^2.0.1", + "configstore": "^3.0.0", + "import-lazy": "^2.1.0", + "is-ci": "^1.0.10", + "is-installed-globally": "^0.1.0", + "is-npm": "^1.0.0", + "latest-version": "^3.0.0", + "semver-diff": "^2.0.0", + "xdg-basedir": "^3.0.0" } }, "url-parse-lax": { "version": "1.0.0", "bundled": true, "requires": { - "prepend-http": "1.0.4" + "prepend-http": "^1.0.1" } }, "util-deprecate": { @@ -7975,38 +7975,38 @@ "version": "3.0.4", "bundled": true, "requires": { - "spdx-correct": "3.0.0", - "spdx-expression-parse": "3.0.0" + "spdx-correct": "^3.0.0", + "spdx-expression-parse": "^3.0.0" } }, "validate-npm-package-name": { "version": "3.0.0", "bundled": true, "requires": { - "builtins": "1.0.3" + "builtins": "^1.0.3" } }, "verror": { "version": "1.10.0", "bundled": true, "requires": { - "assert-plus": "1.0.0", + "assert-plus": "^1.0.0", "core-util-is": "1.0.2", - "extsprintf": "1.3.0" + "extsprintf": "^1.2.0" } }, "wcwidth": { "version": "1.0.1", "bundled": true, "requires": { - "defaults": "1.0.3" + "defaults": "^1.0.3" } }, "which": { "version": "1.3.1", "bundled": true, "requires": { - "isexe": "2.0.0" + "isexe": "^2.0.0" } }, "which-module": { @@ -8017,16 +8017,16 @@ "version": "1.1.2", "bundled": true, "requires": { - "string-width": "1.0.2" + "string-width": "^1.0.2" }, "dependencies": { "string-width": { "version": "1.0.2", "bundled": true, "requires": { - "code-point-at": "1.1.0", - "is-fullwidth-code-point": "1.0.0", - "strip-ansi": "3.0.1" + "code-point-at": "^1.0.0", + "is-fullwidth-code-point": "^1.0.0", + "strip-ansi": "^3.0.0" } } } @@ -8035,31 +8035,31 @@ "version": "2.0.0", "bundled": true, "requires": { - "string-width": "2.1.1" + "string-width": "^2.1.1" } }, "worker-farm": { "version": "1.6.0", "bundled": true, "requires": { - "errno": "0.1.7" + "errno": "~0.1.7" } }, "wrap-ansi": { "version": "2.1.0", "bundled": true, "requires": { - "string-width": "1.0.2", - "strip-ansi": "3.0.1" + "string-width": "^1.0.1", + "strip-ansi": "^3.0.1" }, "dependencies": { "string-width": { "version": "1.0.2", "bundled": true, "requires": { - "code-point-at": "1.1.0", - "is-fullwidth-code-point": "1.0.0", - "strip-ansi": "3.0.1" + "code-point-at": "^1.0.0", + "is-fullwidth-code-point": "^1.0.0", + "strip-ansi": "^3.0.0" } } } @@ -8072,9 +8072,9 @@ "version": "2.4.2", "bundled": true, "requires": { - "graceful-fs": "4.1.15", - "imurmurhash": "0.1.4", - "signal-exit": "3.0.2" + "graceful-fs": "^4.1.11", + "imurmurhash": "^0.1.4", + "signal-exit": "^3.0.2" } }, "xdg-basedir": { @@ -8097,18 +8097,18 @@ "version": "11.0.0", "bundled": true, "requires": { - "cliui": "4.1.0", - "decamelize": "1.2.0", - "find-up": "2.1.0", - "get-caller-file": "1.0.2", - "os-locale": "2.1.0", - "require-directory": "2.1.1", - "require-main-filename": "1.0.1", - "set-blocking": "2.0.0", - "string-width": "2.1.1", - "which-module": "2.0.0", - "y18n": "3.2.1", - "yargs-parser": "9.0.2" + "cliui": "^4.0.0", + "decamelize": "^1.1.1", + "find-up": "^2.1.0", + "get-caller-file": "^1.0.1", + "os-locale": "^2.0.0", + "require-directory": "^2.1.1", + "require-main-filename": "^1.0.1", + "set-blocking": "^2.0.0", + "string-width": "^2.0.0", + "which-module": "^2.0.0", + "y18n": "^3.2.1", + "yargs-parser": "^9.0.2" }, "dependencies": { "y18n": { @@ -8121,7 +8121,7 @@ "version": "9.0.2", "bundled": true, "requires": { - "camelcase": "4.1.0" + "camelcase": "^4.1.0" } } } @@ -8131,7 +8131,7 @@ "resolved": "https://registry.npmjs.org/npm-run-path/-/npm-run-path-2.0.2.tgz", "integrity": "sha1-NakjLfo11wZ7TLLd8jV7GHFTbF8=", "requires": { - "path-key": "2.0.1" + "path-key": "^2.0.0" } }, "npmlog": { @@ -8139,10 +8139,10 @@ "resolved": "https://registry.npmjs.org/npmlog/-/npmlog-4.1.2.tgz", "integrity": "sha512-2uUqazuKlTaSI/dC8AzicUck7+IrEaOnN/e0jd3Xtt1KcGpwx30v50mL7oPyr/h9bL3E4aZccVwpwP+5W9Vjkg==", "requires": { - "are-we-there-yet": "1.1.5", - "console-control-strings": "1.1.0", - "gauge": "2.7.4", - "set-blocking": "2.0.0" + "are-we-there-yet": "~1.1.2", + "console-control-strings": "~1.1.0", + "gauge": "~2.7.3", + "set-blocking": "~2.0.0" } }, "number-is-nan": { @@ -8165,9 +8165,9 @@ "resolved": "https://registry.npmjs.org/object-copy/-/object-copy-0.1.0.tgz", "integrity": "sha1-fn2Fi3gb18mRpBupde04EnVOmYw=", "requires": { - "copy-descriptor": "0.1.1", - "define-property": "0.2.5", - "kind-of": "3.2.2" + "copy-descriptor": "^0.1.0", + "define-property": "^0.2.5", + "kind-of": "^3.0.3" }, "dependencies": { "define-property": { @@ -8175,7 +8175,7 @@ "resolved": "https://registry.npmjs.org/define-property/-/define-property-0.2.5.tgz", "integrity": "sha1-w1se+RjsPJkPmlvFe+BKrOxcgRY=", "requires": { - "is-descriptor": "0.1.6" + "is-descriptor": "^0.1.0" } }, "kind-of": { @@ -8183,7 +8183,7 @@ "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz", "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=", "requires": { - "is-buffer": "1.1.6" + "is-buffer": "^1.1.5" } } } @@ -8199,7 +8199,7 @@ "resolved": "https://registry.npmjs.org/object-visit/-/object-visit-1.0.1.tgz", "integrity": "sha1-95xEk68MU3e1n+OdOV5BBC3QRbs=", "requires": { - "isobject": "3.0.1" + "isobject": "^3.0.0" } }, "object.assign": { @@ -8208,10 +8208,10 @@ "integrity": "sha512-exHJeq6kBKj58mqGyTQ9DFvrZC/eR6OwxzoM9YRoGBqrXYonaFyGiFMuc9VZrXf7DarreEwMpurG3dd+CNyW5w==", "dev": true, "requires": { - "define-properties": "1.1.3", - "function-bind": "1.1.1", - "has-symbols": "1.0.0", - "object-keys": "1.0.12" + "define-properties": "^1.1.2", + "function-bind": "^1.1.1", + "has-symbols": "^1.0.0", + "object-keys": "^1.0.11" } }, "object.pick": { @@ -8219,7 +8219,7 @@ "resolved": "https://registry.npmjs.org/object.pick/-/object.pick-1.3.0.tgz", "integrity": "sha1-h6EKxMFpS9Lhy/U1kaZhQftd10c=", "requires": { - "isobject": "3.0.1" + "isobject": "^3.0.1" } }, "obuf": { @@ -8247,7 +8247,7 @@ "resolved": "https://registry.npmjs.org/once/-/once-1.4.0.tgz", "integrity": "sha1-WDsap3WWHUsROsF9nFC6753Xa9E=", "requires": { - "wrappy": "1.0.2" + "wrappy": "1" } }, "opn": { @@ -8256,7 +8256,7 @@ "integrity": "sha512-YF9MNdVy/0qvJvDtunAOzFw9iasOQHpVthTCvGzxt61Il64AYSGdK+rYwld7NAfk9qJ7dt+hymBNSc9LNYS+Sw==", "dev": true, "requires": { - "is-wsl": "1.1.0" + "is-wsl": "^1.1.0" } }, "orderedmap": { @@ -8270,7 +8270,7 @@ "integrity": "sha512-hyBVl6iqqUOJ8FqRe+l/gS8H+kKYjrEndd5Pm1MfBtsEKA038HkkdbAl/72EAXGyonD/PFsvmVG+EvcIpliMBg==", "dev": true, "requires": { - "url-parse": "1.4.4" + "url-parse": "^1.4.3" } }, "os-browserify": { @@ -8281,7 +8281,7 @@ }, "os-homedir": { "version": "1.0.2", - "resolved": "http://registry.npmjs.org/os-homedir/-/os-homedir-1.0.2.tgz", + "resolved": "https://registry.npmjs.org/os-homedir/-/os-homedir-1.0.2.tgz", "integrity": "sha1-/7xJiDNuDoM94MFox+8VISGqf7M=" }, "os-locale": { @@ -8289,12 +8289,12 @@ "resolved": "https://registry.npmjs.org/os-locale/-/os-locale-1.4.0.tgz", "integrity": "sha1-IPnxeuKe00XoveWDsT0gCYA8FNk=", "requires": { - "lcid": "1.0.0" + "lcid": "^1.0.0" } }, "os-tmpdir": { "version": "1.0.2", - "resolved": "http://registry.npmjs.org/os-tmpdir/-/os-tmpdir-1.0.2.tgz", + "resolved": "https://registry.npmjs.org/os-tmpdir/-/os-tmpdir-1.0.2.tgz", "integrity": "sha1-u+Z0BseaqFxc/sdm/lc0VV36EnQ=" }, "osenv": { @@ -8302,8 +8302,8 @@ "resolved": "https://registry.npmjs.org/osenv/-/osenv-0.1.5.tgz", "integrity": "sha512-0CWcCECdMVc2Rw3U5w9ZjqX6ga6ubk1xDVKxtBQPK7wis/0F2r9T6k4ydGYhecl7YUBxBVxhL5oisPsNxAPe2g==", "requires": { - "os-homedir": "1.0.2", - "os-tmpdir": "1.0.2" + "os-homedir": "^1.0.0", + "os-tmpdir": "^1.0.0" } }, "p-defer": { @@ -8329,7 +8329,7 @@ "integrity": "sha512-vvcXsLAJ9Dr5rQOPk7toZQZJApBl2K4J6dANSsEuh6QI41JYcsS/qhTGa9ErIUUgK3WNQoJYvylxvjqmiqEA9Q==", "dev": true, "requires": { - "p-try": "1.0.0" + "p-try": "^1.0.0" } }, "p-locate": { @@ -8338,7 +8338,7 @@ "integrity": "sha1-IKAQOyIqcMj9OcwuWAaA893l7EM=", "dev": true, "requires": { - "p-limit": "1.3.0" + "p-limit": "^1.1.0" } }, "p-map": { @@ -8358,10 +8358,10 @@ "resolved": "https://registry.npmjs.org/package-json/-/package-json-4.0.1.tgz", "integrity": "sha1-iGmgQBJTZhxMTKPabCEh7VVfXu0=", "requires": { - "got": "6.7.1", - "registry-auth-token": "3.3.2", - "registry-url": "3.1.0", - "semver": "5.6.0" + "got": "^6.7.1", + "registry-auth-token": "^3.0.1", + "registry-url": "^3.0.3", + "semver": "^5.1.0" } }, "pako": { @@ -8376,9 +8376,9 @@ "integrity": "sha1-1BDwZbBdojCB/NEPKIVMKb2jOwY=", "dev": true, "requires": { - "cyclist": "0.2.2", - "inherits": "2.0.3", - "readable-stream": "2.3.6" + "cyclist": "~0.2.2", + "inherits": "^2.0.3", + "readable-stream": "^2.1.5" } }, "parse-asn1": { @@ -8387,12 +8387,12 @@ "integrity": "sha512-VrPoetlz7B/FqjBLD2f5wBVZvsZVLnRUrxVLfRYhGXCODa/NWE4p3Wp+6+aV3ZPL3KM7/OZmxDIwwijD7yuucg==", "dev": true, "requires": { - "asn1.js": "4.10.1", - "browserify-aes": "1.2.0", - "create-hash": "1.2.0", - "evp_bytestokey": "1.0.3", - "pbkdf2": "3.0.17", - "safe-buffer": "5.1.2" + "asn1.js": "^4.0.0", + "browserify-aes": "^1.0.0", + "create-hash": "^1.1.0", + "evp_bytestokey": "^1.0.0", + "pbkdf2": "^3.0.3", + "safe-buffer": "^5.1.1" } }, "parse-json": { @@ -8400,7 +8400,7 @@ "resolved": "https://registry.npmjs.org/parse-json/-/parse-json-2.2.0.tgz", "integrity": "sha1-9ID0BDTvgHQfhGkJn43qGPVaTck=", "requires": { - "error-ex": "1.3.2" + "error-ex": "^1.2.0" } }, "parse-passwd": { @@ -8421,7 +8421,7 @@ }, "path-browserify": { "version": "0.0.0", - "resolved": "http://registry.npmjs.org/path-browserify/-/path-browserify-0.0.0.tgz", + "resolved": "https://registry.npmjs.org/path-browserify/-/path-browserify-0.0.0.tgz", "integrity": "sha1-oLhwcpquIUAFt9UDLsLLuw+0RRo=", "dev": true }, @@ -8435,12 +8435,12 @@ "resolved": "https://registry.npmjs.org/path-exists/-/path-exists-2.1.0.tgz", "integrity": "sha1-D+tsZPD8UY2adU3V77YscCJ2H0s=", "requires": { - "pinkie-promise": "2.0.1" + "pinkie-promise": "^2.0.0" } }, "path-is-absolute": { "version": "1.0.1", - "resolved": "http://registry.npmjs.org/path-is-absolute/-/path-is-absolute-1.0.1.tgz", + "resolved": "https://registry.npmjs.org/path-is-absolute/-/path-is-absolute-1.0.1.tgz", "integrity": "sha1-F0uSaHNVNP+8es5r9TpanhtcX18=" }, "path-is-inside": { @@ -8463,9 +8463,9 @@ "resolved": "https://registry.npmjs.org/path-type/-/path-type-1.1.0.tgz", "integrity": "sha1-WcRPfuSR2nBNpBXaWkBwuk+P5EE=", "requires": { - "graceful-fs": "4.1.15", - "pify": "2.3.0", - "pinkie-promise": "2.0.1" + "graceful-fs": "^4.1.2", + "pify": "^2.0.0", + "pinkie-promise": "^2.0.0" } }, "pathval": { @@ -8480,11 +8480,11 @@ "integrity": "sha512-U/il5MsrZp7mGg3mSQfn742na2T+1/vHDCG5/iTI3X9MKUuYUZVLQhyRsg06mCgDBTd57TxzgZt7P+fYfjRLtA==", "dev": true, "requires": { - "create-hash": "1.2.0", - "create-hmac": "1.1.7", - "ripemd160": "2.0.2", - "safe-buffer": "5.1.2", - "sha.js": "2.4.11" + "create-hash": "^1.1.2", + "create-hmac": "^1.1.4", + "ripemd160": "^2.0.1", + "safe-buffer": "^5.0.1", + "sha.js": "^2.4.8" } }, "performance-now": { @@ -8507,7 +8507,7 @@ "resolved": "https://registry.npmjs.org/pinkie-promise/-/pinkie-promise-2.0.1.tgz", "integrity": "sha1-ITXW36ejWMBprJsXh3YogihFD/o=", "requires": { - "pinkie": "2.0.4" + "pinkie": "^2.0.0" } }, "pkg-dir": { @@ -8516,7 +8516,7 @@ "integrity": "sha1-9tXREJ4Z1j7fQo4L1X4Sd3YVM0s=", "dev": true, "requires": { - "find-up": "2.1.0" + "find-up": "^2.1.0" }, "dependencies": { "find-up": { @@ -8525,7 +8525,7 @@ "integrity": "sha1-RdG35QbHF93UgndaK3eSCjwMV6c=", "dev": true, "requires": { - "locate-path": "2.0.0" + "locate-path": "^2.0.0" } } } @@ -8536,9 +8536,9 @@ "integrity": "sha512-Yxe4mTyDzTd59PZJY4ojZR8F+E5e97iq2ZOHPz3HDgSvYC5siNad2tLooQ5y5QHyQhc3xVqvyk/eNA3wuoa7Sw==", "dev": true, "requires": { - "async": "1.5.2", - "debug": "2.6.9", - "mkdirp": "0.5.1" + "async": "^1.5.2", + "debug": "^2.2.0", + "mkdirp": "0.5.x" } }, "posix-character-classes": { @@ -8552,9 +8552,9 @@ "integrity": "sha512-NsbD6XUUMZvBxtQAJuWDJeeC4QFsmWsfozWxCJPWf3M55K9iu2iMDaKqyoOdTJ1R4usBXuxlVFAIo8rZPQD4Bg==", "dev": true, "requires": { - "chalk": "2.4.2", - "source-map": "0.6.1", - "supports-color": "6.1.0" + "chalk": "^2.4.2", + "source-map": "^0.6.1", + "supports-color": "^6.1.0" }, "dependencies": { "ansi-styles": { @@ -8563,7 +8563,7 @@ "integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==", "dev": true, "requires": { - "color-convert": "1.9.3" + "color-convert": "^1.9.0" } }, "chalk": { @@ -8572,9 +8572,9 @@ "integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==", "dev": true, "requires": { - "ansi-styles": "3.2.1", - "escape-string-regexp": "1.0.5", - "supports-color": "5.5.0" + "ansi-styles": "^3.2.1", + "escape-string-regexp": "^1.0.5", + "supports-color": "^5.3.0" }, "dependencies": { "supports-color": { @@ -8583,7 +8583,7 @@ "integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==", "dev": true, "requires": { - "has-flag": "3.0.0" + "has-flag": "^3.0.0" } } } @@ -8600,7 +8600,7 @@ "integrity": "sha512-qe1jfm1Mg7Nq/NSh6XE24gPXROEVsWHxC1LIx//XNlD9iw7YZQGjZNjYN7xGaEG6iKdA8EtNFW6R0gjnVXp+wQ==", "dev": true, "requires": { - "has-flag": "3.0.0" + "has-flag": "^3.0.0" } } } @@ -8611,7 +8611,7 @@ "integrity": "sha512-LaYLDNS4SG8Q5WAWqIJgdHPJrDDr/Lv775rMBFUbgjTz6j34lUznACHcdRWroPvXANP2Vj7yNK57vp9eFqzLWQ==", "dev": true, "requires": { - "postcss": "7.0.14" + "postcss": "^7.0.5" } }, "postcss-modules-local-by-default": { @@ -8620,9 +8620,9 @@ "integrity": "sha512-WvuSaTKXUqYJbnT7R3YrsNrHv/C5vRfr5VglS4bFOk0MYT4CLBfc/xgExA+x2RftlYgiBDvWmVs191Xv8S8gZQ==", "dev": true, "requires": { - "css-selector-tokenizer": "0.7.1", - "postcss": "7.0.14", - "postcss-value-parser": "3.3.1" + "css-selector-tokenizer": "^0.7.0", + "postcss": "^7.0.6", + "postcss-value-parser": "^3.3.1" } }, "postcss-modules-scope": { @@ -8631,8 +8631,8 @@ "integrity": "sha512-7+6k9c3/AuZ5c596LJx9n923A/j3nF3ormewYBF1RrIQvjvjXe1xE8V8A1KFyFwXbvnshT6FBZFX0k/F1igneg==", "dev": true, "requires": { - "css-selector-tokenizer": "0.7.1", - "postcss": "7.0.14" + "css-selector-tokenizer": "^0.7.0", + "postcss": "^7.0.6" } }, "postcss-modules-values": { @@ -8641,8 +8641,8 @@ "integrity": "sha512-Ki7JZa7ff1N3EIMlPnGTZfUMe69FFwiQPnVSXC9mnn3jozCRBYIxiZd44yJOV2AmabOo4qFf8s0dC/+lweG7+w==", "dev": true, "requires": { - "icss-replace-symbols": "1.1.0", - "postcss": "7.0.14" + "icss-replace-symbols": "^1.1.0", + "postcss": "^7.0.6" } }, "postcss-value-parser": { @@ -8677,7 +8677,7 @@ "resolved": "https://registry.npmjs.org/promise/-/promise-7.3.1.tgz", "integrity": "sha512-nolQXZ/4L+bP/UGlkfaIujX9BKxGwmQ9OT4mOt5yvy8iK1h3wqTEJCijzGANTCCl9nWjY41juyAn2K3Q1hLLTg==", "requires": { - "asap": "2.0.6" + "asap": "~2.0.3" } }, "promise-inflight": { @@ -8691,8 +8691,8 @@ "resolved": "https://registry.npmjs.org/prop-types/-/prop-types-15.6.2.tgz", "integrity": "sha512-3pboPvLiWD7dkI3qf3KbUe6hKFKa52w+AE0VCqECtf+QHAKgOL37tTaNCnuX1nAAQ4ZhyP+kYVKf8rLmJ/feDQ==", "requires": { - "loose-envify": "1.4.0", - "object-assign": "4.1.1" + "loose-envify": "^1.3.1", + "object-assign": "^4.1.1" } }, "prosemirror-commands": { @@ -8700,9 +8700,9 @@ "resolved": "https://registry.npmjs.org/prosemirror-commands/-/prosemirror-commands-1.0.7.tgz", "integrity": "sha512-IR8yMSdw7XlKuF68tydAak1J9P/lLD5ohsrL7pzoLsJAJAQU7mVPDXtGbQrrm0mesddFjcc1zNo/cJQN3lRYnA==", "requires": { - "prosemirror-model": "1.7.0", - "prosemirror-state": "1.2.2", - "prosemirror-transform": "1.1.3" + "prosemirror-model": "^1.0.0", + "prosemirror-state": "^1.0.0", + "prosemirror-transform": "^1.0.0" } }, "prosemirror-history": { @@ -8710,9 +8710,9 @@ "resolved": "https://registry.npmjs.org/prosemirror-history/-/prosemirror-history-1.0.3.tgz", "integrity": "sha512-IfFGbhafSx+R3aq7nLJGkXeu2iaUiP8mkU3aRu2uQcIIjU8Fq7RJfuvhIOJ2RNUoSyqF/ANkdTjnZ74F5eHs1Q==", "requires": { - "prosemirror-state": "1.2.2", - "prosemirror-transform": "1.1.3", - "rope-sequence": "1.2.2" + "prosemirror-state": "^1.2.2", + "prosemirror-transform": "^1.0.0", + "rope-sequence": "^1.2.0" } }, "prosemirror-keymap": { @@ -8720,8 +8720,8 @@ "resolved": "https://registry.npmjs.org/prosemirror-keymap/-/prosemirror-keymap-1.0.1.tgz", "integrity": "sha512-e79ApE7PXXZMFtPz7WbjycjAFd1NPjgY1MkecVz98tqwlBSggXWXYQnWFk6x7UkmnBYRHHbXHkR/RXmu2wyBJg==", "requires": { - "prosemirror-state": "1.2.2", - "w3c-keyname": "1.1.8" + "prosemirror-state": "^1.0.0", + "w3c-keyname": "^1.1.8" } }, "prosemirror-model": { @@ -8729,7 +8729,7 @@ "resolved": "https://registry.npmjs.org/prosemirror-model/-/prosemirror-model-1.7.0.tgz", "integrity": "sha512-/6ul6guiqyAl5I+0qbnL7SlmuX0DEfYqjvzeLUVEnb7nwF/vmKZuWqbjEG2tqi/9SSudvd3UxQTBDHvxy9hQwA==", "requires": { - "orderedmap": "1.0.0" + "orderedmap": "^1.0.0" } }, "prosemirror-schema-basic": { @@ -8737,7 +8737,7 @@ "resolved": "https://registry.npmjs.org/prosemirror-schema-basic/-/prosemirror-schema-basic-1.0.0.tgz", "integrity": "sha512-xTFjtuLZgcRS4MoDbUyI9NSk/k/ACLGKZQcDXH18ctM9BOmP4z5rGZcA014fCF2FnMFOU+lKwusL0JjVrEectQ==", "requires": { - "prosemirror-model": "1.7.0" + "prosemirror-model": "^1.0.0" } }, "prosemirror-state": { @@ -8745,8 +8745,8 @@ "resolved": "https://registry.npmjs.org/prosemirror-state/-/prosemirror-state-1.2.2.tgz", "integrity": "sha512-j8aC/kf9BJSCQau485I/9pj39XQoce+TqH5xzekT7WWFARTsRYFLJtiXBcCKakv1VSeev+sC3bJP0pLfz7Ft8g==", "requires": { - "prosemirror-model": "1.7.0", - "prosemirror-transform": "1.1.3" + "prosemirror-model": "^1.0.0", + "prosemirror-transform": "^1.0.0" } }, "prosemirror-transform": { @@ -8754,7 +8754,7 @@ "resolved": "https://registry.npmjs.org/prosemirror-transform/-/prosemirror-transform-1.1.3.tgz", "integrity": "sha512-1O6Di5lOL1mp4nuCnQNkHY7l2roIW5y8RH4ZG3hMYmkmDEWzTaFFnxxAAHsE5ipGLBSRcTlP7SsDhYBIdSuLpQ==", "requires": { - "prosemirror-model": "1.7.0" + "prosemirror-model": "^1.0.0" } }, "prosemirror-view": { @@ -8762,9 +8762,9 @@ "resolved": "https://registry.npmjs.org/prosemirror-view/-/prosemirror-view-1.7.1.tgz", "integrity": "sha512-UFY/h4i5H1Yen8u2ZTve0WL+nh/y1qU3geC3SrWl5yIKSgGbvllD5vr5LxmeRgVsY8hb+oDXRHk5KvLwqmu7Lg==", "requires": { - "prosemirror-model": "1.7.0", - "prosemirror-state": "1.2.2", - "prosemirror-transform": "1.1.3" + "prosemirror-model": "^1.1.0", + "prosemirror-state": "^1.0.0", + "prosemirror-transform": "^1.1.0" } }, "proxy-addr": { @@ -8772,7 +8772,7 @@ "resolved": "https://registry.npmjs.org/proxy-addr/-/proxy-addr-2.0.4.tgz", "integrity": "sha512-5erio2h9jp5CHGwcybmxmVqHmnCBZeewlfJ0pex+UW7Qny7OOZXTtH56TGNyBizkgiOwhJtMKrVzDTeKcySZwA==", "requires": { - "forwarded": "0.1.2", + "forwarded": "~0.1.2", "ipaddr.js": "1.8.0" } }, @@ -8803,12 +8803,12 @@ "integrity": "sha512-zVpa8oKZSz5bTMTFClc1fQOnyyEzpl5ozpi1B5YcvBrdohMjH2rfsBtyXcuNuwjsDIXmBYlF2N5FlJYhR29t8Q==", "dev": true, "requires": { - "bn.js": "4.11.8", - "browserify-rsa": "4.0.1", - "create-hash": "1.2.0", - "parse-asn1": "5.1.3", - "randombytes": "2.0.6", - "safe-buffer": "5.1.2" + "bn.js": "^4.1.0", + "browserify-rsa": "^4.0.0", + "create-hash": "^1.1.0", + "parse-asn1": "^5.0.0", + "randombytes": "^2.0.1", + "safe-buffer": "^5.1.2" } }, "pump": { @@ -8817,8 +8817,8 @@ "integrity": "sha512-ruPMNRkN3MHP1cWJc9OWr+T/xDP0jhXYCLfJcBuX54hhfIBnaQmAUMfDcG4DM5UMWByBbJY69QSphm3jtDKIkA==", "dev": true, "requires": { - "end-of-stream": "1.4.1", - "once": "1.4.0" + "end-of-stream": "^1.1.0", + "once": "^1.3.1" } }, "pumpify": { @@ -8827,9 +8827,9 @@ "integrity": "sha512-oClZI37HvuUJJxSKKrC17bZ9Cu0ZYhEAGPsPUy9KlMUmv9dKX2o77RUmq7f3XjIxbwyGwYzbzQ1L2Ks8sIradQ==", "dev": true, "requires": { - "duplexify": "3.7.1", - "inherits": "2.0.3", - "pump": "2.0.1" + "duplexify": "^3.6.0", + "inherits": "^2.0.3", + "pump": "^2.0.0" } }, "punycode": { @@ -8871,7 +8871,7 @@ "integrity": "sha512-CIQ5OFxf4Jou6uOKe9t1AOgqpeU5fd70A8NPdHSGeYXqXsPe6peOwI0cUl88RWZ6sP1vPMV3avd/R6cZ5/sP1A==", "dev": true, "requires": { - "safe-buffer": "5.1.2" + "safe-buffer": "^5.1.0" } }, "randomfill": { @@ -8880,8 +8880,8 @@ "integrity": "sha512-87lcbR8+MhcWcUiQ+9e+Rwx8MyR2P7qnt15ynUlbm3TU/fjbgz4GsvfSUDTemtCCtVCqb4ZcEFlyPNTh9bBTLw==", "dev": true, "requires": { - "randombytes": "2.0.6", - "safe-buffer": "5.1.2" + "randombytes": "^2.0.5", + "safe-buffer": "^5.1.0" } }, "range-parser": { @@ -8905,10 +8905,10 @@ "resolved": "https://registry.npmjs.org/rc/-/rc-1.2.8.tgz", "integrity": "sha512-y3bGgqKj3QBdxLbLkomlohkvsA8gdAiUQlSBJnBhfn+BPxg4bc62d8TcBW15wavDfgexCgccckhcZvywyQYPOw==", "requires": { - "deep-extend": "0.6.0", - "ini": "1.3.5", - "minimist": "1.2.0", - "strip-json-comments": "2.0.1" + "deep-extend": "^0.6.0", + "ini": "~1.3.0", + "minimist": "^1.2.0", + "strip-json-comments": "~2.0.1" } }, "react": { @@ -8916,10 +8916,10 @@ "resolved": "https://registry.npmjs.org/react/-/react-16.7.0.tgz", "integrity": "sha512-StCz3QY8lxTb5cl2HJxjwLFOXPIFQp+p+hxQfc8WE0QiLfCtIlKj8/+5tjjKm8uSTlAW+fCPaavGFS06V9Ar3A==", "requires": { - "loose-envify": "1.4.0", - "object-assign": "4.1.1", - "prop-types": "15.6.2", - "scheduler": "0.12.0" + "loose-envify": "^1.1.0", + "object-assign": "^4.1.1", + "prop-types": "^15.6.2", + "scheduler": "^0.12.0" } }, "react-dimensions": { @@ -8927,7 +8927,7 @@ "resolved": "https://registry.npmjs.org/react-dimensions/-/react-dimensions-1.3.1.tgz", "integrity": "sha512-go5vMuGUxaB5PiTSIk+ZfAxLbHwcIgIfLhkBZ2SIMQjaCgnpttxa30z5ijEzfDjeOCTGRpxvkzcmE4Vt4Ppvyw==", "requires": { - "element-resize-event": "2.0.9" + "element-resize-event": "^2.0.4" } }, "react-dom": { @@ -8935,10 +8935,10 @@ "resolved": "https://registry.npmjs.org/react-dom/-/react-dom-16.7.0.tgz", "integrity": "sha512-D0Ufv1ExCAmF38P2Uh1lwpminZFRXEINJe53zRAbm4KPwSyd6DY/uDoS0Blj9jvPpn1+wivKpZYc8aAAN/nAkg==", "requires": { - "loose-envify": "1.4.0", - "object-assign": "4.1.1", - "prop-types": "15.6.2", - "scheduler": "0.12.0" + "loose-envify": "^1.1.0", + "object-assign": "^4.1.1", + "prop-types": "^15.6.2", + "scheduler": "^0.12.0" } }, "react-golden-layout": { @@ -8946,9 +8946,9 @@ "resolved": "https://registry.npmjs.org/react-golden-layout/-/react-golden-layout-1.0.6.tgz", "integrity": "sha512-KZQ17Bnd+LfyCqe2scVMznrGKTciX3VwoT3y4xn3Qok9hknCvVXZfXe2RSX5zNG7FlLJzWt0VWqy8qZBHpQVuQ==", "requires": { - "golden-layout": "1.5.9", - "react": "16.7.0", - "react-dom": "16.7.0" + "golden-layout": "^1.5.9", + "react": "^16.3.0", + "react-dom": "^16.3.0" } }, "react-image-lightbox": { @@ -8956,8 +8956,8 @@ "resolved": "https://registry.npmjs.org/react-image-lightbox/-/react-image-lightbox-5.1.0.tgz", "integrity": "sha512-R46QvffoDBscLQgTl4s3kFxVbnP7a+nIh7AXJNS0EXVeDaa6zKDKtIT+jFeEvs+F9oUHtZfenG1NHhTkO4hEOA==", "requires": { - "prop-types": "15.6.2", - "react-modal": "3.8.1" + "prop-types": "^15.6.2", + "react-modal": "^3.6.1" } }, "react-is": { @@ -8970,8 +8970,8 @@ "resolved": "https://registry.npmjs.org/react-jsx-parser/-/react-jsx-parser-1.13.0.tgz", "integrity": "sha512-oypIhM30ESZ8UkU0xDmzSV2Mtb2mVvtVnyNzjDxx2h2PCHpYFdDVLx1c15E3ot6nTIVlIh072tWwS3iJ7VVgmg==", "requires": { - "acorn-jsx": "4.1.1", - "react": "16.7.0" + "acorn-jsx": "^4.1.1", + "react": "^16.4.0" } }, "react-lifecycles-compat": { @@ -8984,10 +8984,10 @@ "resolved": "https://registry.npmjs.org/react-measure/-/react-measure-2.2.4.tgz", "integrity": "sha512-gpZA4J8sKy1TzTfnOXiiTu01GV8B5OyfF9k7Owt38T6Xxlll19PBE13HKTtauEmDdJO5u4o3XcTiGqCw5wpfjw==", "requires": { - "@babel/runtime": "7.3.1", - "get-node-dimensions": "1.2.1", - "prop-types": "15.6.2", - "resize-observer-polyfill": "1.5.1" + "@babel/runtime": "^7.2.0", + "get-node-dimensions": "^1.2.1", + "prop-types": "^15.6.2", + "resize-observer-polyfill": "^1.5.0" } }, "react-modal": { @@ -8995,10 +8995,10 @@ "resolved": "https://registry.npmjs.org/react-modal/-/react-modal-3.8.1.tgz", "integrity": "sha512-aLKeZM9pgXpIKVwopRHMuvqKWiBajkqisDA8UzocdCF6S4fyKVfLWmZR5G1Q0ODBxxxxf2XIwiCP8G/11GJAuw==", "requires": { - "exenv": "1.2.2", - "prop-types": "15.6.2", - "react-lifecycles-compat": "3.0.4", - "warning": "3.0.0" + "exenv": "^1.2.0", + "prop-types": "^15.5.10", + "react-lifecycles-compat": "^3.0.0", + "warning": "^3.0.0" } }, "react-mosaic": { @@ -9006,8 +9006,8 @@ "resolved": "https://registry.npmjs.org/react-mosaic/-/react-mosaic-0.0.20.tgz", "integrity": "sha1-pSSr8uzyi5r2sh1NNQ/veCLvMJ4=", "requires": { - "prop-types": "15.6.2", - "threads": "0.8.1" + "prop-types": "^15.6.0", + "threads": "^0.8.0" } }, "react-split-pane": { @@ -9015,11 +9015,11 @@ "resolved": "https://registry.npmjs.org/react-split-pane/-/react-split-pane-0.1.85.tgz", "integrity": "sha512-3GhaYs6+eVNrewgN4eQKJoNMQ4pcegNMTMhR5bO/NFO91K6/98qdD1sCuWPpsefCjzxNTjkvVYWQC0bMaC45mA==", "requires": { - "prop-types": "15.6.2", - "react": "16.7.0", - "react-dom": "16.7.0", - "react-lifecycles-compat": "3.0.4", - "react-style-proptype": "3.2.2" + "prop-types": "^15.5.10", + "react": "^16.6.3", + "react-dom": "^16.6.3", + "react-lifecycles-compat": "^3.0.4", + "react-style-proptype": "^3.0.0" } }, "react-style-proptype": { @@ -9027,7 +9027,7 @@ "resolved": "https://registry.npmjs.org/react-style-proptype/-/react-style-proptype-3.2.2.tgz", "integrity": "sha512-ywYLSjNkxKHiZOqNlso9PZByNEY+FTyh3C+7uuziK0xFXu9xzdyfHwg4S9iyiRRoPCR4k2LqaBBsWVmSBwCWYQ==", "requires": { - "prop-types": "15.6.2" + "prop-types": "^15.5.4" } }, "react-table": { @@ -9035,7 +9035,7 @@ "resolved": "https://registry.npmjs.org/react-table/-/react-table-6.9.0.tgz", "integrity": "sha512-sATtBTyXlQlqSaPayDv66e5JAS8zv1BmaCAm7UT8VzDD9Cvei90Lgx2Cn0HdGMh7BGDNUiVTSGRaNAzejs/Ohg==", "requires": { - "classnames": "2.2.6" + "classnames": "^2.2.5" } }, "read-pkg": { @@ -9043,9 +9043,9 @@ "resolved": "https://registry.npmjs.org/read-pkg/-/read-pkg-1.1.0.tgz", "integrity": "sha1-9f+qXs0pyzHAR0vKfXVra7KePyg=", "requires": { - "load-json-file": "1.1.0", - "normalize-package-data": "2.4.2", - "path-type": "1.1.0" + "load-json-file": "^1.0.0", + "normalize-package-data": "^2.3.2", + "path-type": "^1.0.0" } }, "read-pkg-up": { @@ -9053,22 +9053,22 @@ "resolved": "https://registry.npmjs.org/read-pkg-up/-/read-pkg-up-1.0.1.tgz", "integrity": "sha1-nWPBMnbAZZGNV/ACpX9AobZD+wI=", "requires": { - "find-up": "1.1.2", - "read-pkg": "1.1.0" + "find-up": "^1.0.0", + "read-pkg": "^1.0.0" } }, "readable-stream": { "version": "2.3.6", - "resolved": "http://registry.npmjs.org/readable-stream/-/readable-stream-2.3.6.tgz", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.6.tgz", "integrity": "sha512-tQtKA9WIAhBF3+VLAseyMqZeBjW0AHJoxOtYqSUZNJxauErmLbVm2FW1y+J/YA9dUrAC39ITejlZWhVIwawkKw==", "requires": { - "core-util-is": "1.0.2", - "inherits": "2.0.3", - "isarray": "1.0.0", - "process-nextick-args": "2.0.0", - "safe-buffer": "5.1.2", - "string_decoder": "1.1.1", - "util-deprecate": "1.0.2" + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" } }, "readdirp": { @@ -9076,9 +9076,9 @@ "resolved": "https://registry.npmjs.org/readdirp/-/readdirp-2.2.1.tgz", "integrity": "sha512-1JU/8q+VgFZyxwrJ+SVIOsh+KywWGpds3NTqikiKpDMZWScmAYyKIgqkO+ARvNWJfXeXR1zxz7aHF4u4CyH6vQ==", "requires": { - "graceful-fs": "4.1.15", - "micromatch": "3.1.10", - "readable-stream": "2.3.6" + "graceful-fs": "^4.1.11", + "micromatch": "^3.1.10", + "readable-stream": "^2.0.2" } }, "recast": { @@ -9087,9 +9087,9 @@ "integrity": "sha1-RR/TAEqx5N+bTktmN2sqIZEkYtM=", "requires": { "ast-types": "0.9.6", - "esprima": "3.1.3", - "private": "0.1.8", - "source-map": "0.5.7" + "esprima": "~3.1.0", + "private": "~0.1.5", + "source-map": "~0.5.0" }, "dependencies": { "esprima": { @@ -9109,8 +9109,8 @@ "resolved": "https://registry.npmjs.org/redent/-/redent-1.0.0.tgz", "integrity": "sha1-z5Fqsf1fHxbfsggi3W7H9zDCr94=", "requires": { - "indent-string": "2.1.0", - "strip-indent": "1.0.1" + "indent-string": "^2.1.0", + "strip-indent": "^1.0.1" } }, "regenerate": { @@ -9129,19 +9129,19 @@ "resolved": "https://registry.npmjs.org/regex-not/-/regex-not-1.0.2.tgz", "integrity": "sha512-J6SDjUgDxQj5NusnOtdFxDwN/+HWykR8GELwctJ7mdqhcyy1xEc4SRFHUXvxTp661YaVKAjfRLZ9cCqS6tn32A==", "requires": { - "extend-shallow": "3.0.2", - "safe-regex": "1.1.0" + "extend-shallow": "^3.0.2", + "safe-regex": "^1.1.0" } }, "regexpu-core": { "version": "1.0.0", - "resolved": "http://registry.npmjs.org/regexpu-core/-/regexpu-core-1.0.0.tgz", + "resolved": "https://registry.npmjs.org/regexpu-core/-/regexpu-core-1.0.0.tgz", "integrity": "sha1-hqdj9Y7k18L2sQLkdkBQ3n7ZDGs=", "dev": true, "requires": { - "regenerate": "1.4.0", - "regjsgen": "0.2.0", - "regjsparser": "0.1.5" + "regenerate": "^1.2.1", + "regjsgen": "^0.2.0", + "regjsparser": "^0.1.4" } }, "registry-auth-token": { @@ -9149,8 +9149,8 @@ "resolved": "https://registry.npmjs.org/registry-auth-token/-/registry-auth-token-3.3.2.tgz", "integrity": "sha512-JL39c60XlzCVgNrO+qq68FoNb56w/m7JYvGR2jT5iR1xBrUA3Mfx5Twk5rqTThPmQKMWydGmq8oFtDlxfrmxnQ==", "requires": { - "rc": "1.2.8", - "safe-buffer": "5.1.2" + "rc": "^1.1.6", + "safe-buffer": "^5.0.1" } }, "registry-url": { @@ -9158,12 +9158,12 @@ "resolved": "https://registry.npmjs.org/registry-url/-/registry-url-3.1.0.tgz", "integrity": "sha1-PU74cPc93h138M+aOBQyRE4XSUI=", "requires": { - "rc": "1.2.8" + "rc": "^1.0.1" } }, "regjsgen": { "version": "0.2.0", - "resolved": "http://registry.npmjs.org/regjsgen/-/regjsgen-0.2.0.tgz", + "resolved": "https://registry.npmjs.org/regjsgen/-/regjsgen-0.2.0.tgz", "integrity": "sha1-bAFq3qxVT3WCP+N6wFuS1aTtsfc=", "dev": true }, @@ -9173,7 +9173,7 @@ "integrity": "sha1-fuj4Tcb6eS0/0K4ijSS9lJ6tIFw=", "dev": true, "requires": { - "jsesc": "0.5.0" + "jsesc": "~0.5.0" } }, "remove-trailing-separator": { @@ -9196,7 +9196,7 @@ "resolved": "https://registry.npmjs.org/repeating/-/repeating-2.0.1.tgz", "integrity": "sha1-UhTFOpJtNVJwdSf7q0FdvAjQbdo=", "requires": { - "is-finite": "1.0.2" + "is-finite": "^1.0.0" } }, "request": { @@ -9204,26 +9204,26 @@ "resolved": "https://registry.npmjs.org/request/-/request-2.88.0.tgz", "integrity": "sha512-NAqBSrijGLZdM0WZNsInLJpkJokL72XYjUpnB0iwsRgxh7dB6COrHnTBNwN0E+lHDAJzu7kLAkDeY08z2/A0hg==", "requires": { - "aws-sign2": "0.7.0", - "aws4": "1.8.0", - "caseless": "0.12.0", - "combined-stream": "1.0.7", - "extend": "3.0.2", - "forever-agent": "0.6.1", - "form-data": "2.3.3", - "har-validator": "5.1.3", - "http-signature": "1.2.0", - "is-typedarray": "1.0.0", - "isstream": "0.1.2", - "json-stringify-safe": "5.0.1", - "mime-types": "2.1.21", - "oauth-sign": "0.9.0", - "performance-now": "2.1.0", - "qs": "6.5.2", - "safe-buffer": "5.1.2", - "tough-cookie": "2.4.3", - "tunnel-agent": "0.6.0", - "uuid": "3.3.2" + "aws-sign2": "~0.7.0", + "aws4": "^1.8.0", + "caseless": "~0.12.0", + "combined-stream": "~1.0.6", + "extend": "~3.0.2", + "forever-agent": "~0.6.1", + "form-data": "~2.3.2", + "har-validator": "~5.1.0", + "http-signature": "~1.2.0", + "is-typedarray": "~1.0.0", + "isstream": "~0.1.2", + "json-stringify-safe": "~5.0.1", + "mime-types": "~2.1.19", + "oauth-sign": "~0.9.0", + "performance-now": "^2.1.0", + "qs": "~6.5.2", + "safe-buffer": "^5.1.2", + "tough-cookie": "~2.4.3", + "tunnel-agent": "^0.6.0", + "uuid": "^3.3.2" } }, "require-directory": { @@ -9253,7 +9253,7 @@ "integrity": "sha1-AKn3OHVW4nA46uIyyqNypqWbZlo=", "dev": true, "requires": { - "resolve-from": "3.0.0" + "resolve-from": "^3.0.0" } }, "resolve-dir": { @@ -9262,8 +9262,8 @@ "integrity": "sha1-eaQGRMNivoLybv/nOcm7U4IEb0M=", "dev": true, "requires": { - "expand-tilde": "2.0.2", - "global-modules": "1.0.0" + "expand-tilde": "^2.0.0", + "global-modules": "^1.0.0" } }, "resolve-from": { @@ -9287,7 +9287,7 @@ "resolved": "https://registry.npmjs.org/rimraf/-/rimraf-2.6.3.tgz", "integrity": "sha512-mwqeW5XsA2qAejG46gYdENaxXjx9onRNCfn7L0duuP4hCuTIi/QO7PDK07KJfp1d+izWPrzEJDcSqBa0OZQriA==", "requires": { - "glob": "7.1.3" + "glob": "^7.1.3" } }, "ripemd160": { @@ -9296,8 +9296,8 @@ "integrity": "sha512-ii4iagi25WusVoiC4B4lq7pbXfAp3D9v5CwfkY33vffw2+pkDjY1D8GaN7spsxvCSx8dkPqOZCEZyfxcmJG2IA==", "dev": true, "requires": { - "hash-base": "3.0.4", - "inherits": "2.0.3" + "hash-base": "^3.0.0", + "inherits": "^2.0.1" } }, "rope-sequence": { @@ -9311,7 +9311,7 @@ "integrity": "sha1-6Eg5bwV9Ij8kOGkkYY4laUFh7Ec=", "dev": true, "requires": { - "aproba": "1.2.0" + "aproba": "^1.1.1" } }, "safe-buffer": { @@ -9321,10 +9321,10 @@ }, "safe-regex": { "version": "1.1.0", - "resolved": "http://registry.npmjs.org/safe-regex/-/safe-regex-1.1.0.tgz", + "resolved": "https://registry.npmjs.org/safe-regex/-/safe-regex-1.1.0.tgz", "integrity": "sha1-QKNmnzsHfR6UPURinhV91IAjvy4=", "requires": { - "ret": "0.1.15" + "ret": "~0.1.10" } }, "safer-buffer": { @@ -9337,10 +9337,10 @@ "resolved": "https://registry.npmjs.org/sass-graph/-/sass-graph-2.2.4.tgz", "integrity": "sha1-E/vWPNHK8JCLn9k0dq1DpR0eC0k=", "requires": { - "glob": "7.1.3", - "lodash": "4.17.11", - "scss-tokenizer": "0.2.3", - "yargs": "7.1.0" + "glob": "^7.0.0", + "lodash": "^4.0.0", + "scss-tokenizer": "^0.2.3", + "yargs": "^7.0.0" } }, "sass-loader": { @@ -9349,12 +9349,12 @@ "integrity": "sha512-+G+BKGglmZM2GUSfT9TLuEp6tzehHPjAMoRRItOojWIqIGPloVCMhNIQuG639eJ+y033PaGTSjLaTHts8Kw79w==", "dev": true, "requires": { - "clone-deep": "2.0.2", - "loader-utils": "1.2.3", - "lodash.tail": "4.1.1", - "neo-async": "2.6.0", - "pify": "3.0.0", - "semver": "5.6.0" + "clone-deep": "^2.0.1", + "loader-utils": "^1.0.1", + "lodash.tail": "^4.1.1", + "neo-async": "^2.5.0", + "pify": "^3.0.0", + "semver": "^5.5.0" }, "dependencies": { "pify": { @@ -9370,8 +9370,8 @@ "resolved": "https://registry.npmjs.org/scheduler/-/scheduler-0.12.0.tgz", "integrity": "sha512-t7MBR28Akcp4Jm+QoR63XgAi9YgCUmgvDHqf5otgAj4QvdoBE4ImCX0ffehefePPG+aitiYHp0g/mW6s4Tp+dw==", "requires": { - "loose-envify": "1.4.0", - "object-assign": "4.1.1" + "loose-envify": "^1.1.0", + "object-assign": "^4.1.1" } }, "schema-utils": { @@ -9379,9 +9379,9 @@ "resolved": "https://registry.npmjs.org/schema-utils/-/schema-utils-1.0.0.tgz", "integrity": "sha512-i27Mic4KovM/lnGsy8whRCHhc7VicJajAjTrYg11K9zfZXnYIt4k5F+kZkwjnrhKzLic/HLU4j11mjsz2G/75g==", "requires": { - "ajv": "6.8.1", - "ajv-errors": "1.0.1", - "ajv-keywords": "3.3.0" + "ajv": "^6.1.0", + "ajv-errors": "^1.0.0", + "ajv-keywords": "^3.1.0" } }, "scss-loader": { @@ -9395,8 +9395,8 @@ "resolved": "https://registry.npmjs.org/scss-tokenizer/-/scss-tokenizer-0.2.3.tgz", "integrity": "sha1-jrBtualyMzOCTT9VMGQRSYR85dE=", "requires": { - "js-base64": "2.5.1", - "source-map": "0.4.4" + "js-base64": "^2.1.8", + "source-map": "^0.4.2" } }, "select-hose": { @@ -9424,7 +9424,7 @@ "resolved": "https://registry.npmjs.org/semver-diff/-/semver-diff-2.1.0.tgz", "integrity": "sha1-S7uEN8jTfksM8aaP1ybsbWRdbTY=", "requires": { - "semver": "5.6.0" + "semver": "^5.0.3" } }, "send": { @@ -9433,18 +9433,18 @@ "integrity": "sha512-E64YFPUssFHEFBvpbbjr44NCLtI1AohxQ8ZSiJjQLskAdKuriYEP6VyGEsRDH8ScozGpkaX1BGvhanqCwkcEZw==", "requires": { "debug": "2.6.9", - "depd": "1.1.2", - "destroy": "1.0.4", - "encodeurl": "1.0.2", - "escape-html": "1.0.3", - "etag": "1.8.1", + "depd": "~1.1.2", + "destroy": "~1.0.4", + "encodeurl": "~1.0.2", + "escape-html": "~1.0.3", + "etag": "~1.8.1", "fresh": "0.5.2", - "http-errors": "1.6.3", + "http-errors": "~1.6.2", "mime": "1.4.1", "ms": "2.0.0", - "on-finished": "2.3.0", - "range-parser": "1.2.0", - "statuses": "1.4.0" + "on-finished": "~2.3.0", + "range-parser": "~1.2.0", + "statuses": "~1.4.0" }, "dependencies": { "mime": { @@ -9466,13 +9466,13 @@ "integrity": "sha1-03aNabHn2C5c4FD/9bRTvqEqkjk=", "dev": true, "requires": { - "accepts": "1.3.5", + "accepts": "~1.3.4", "batch": "0.6.1", "debug": "2.6.9", - "escape-html": "1.0.3", - "http-errors": "1.6.3", - "mime-types": "2.1.21", - "parseurl": "1.3.2" + "escape-html": "~1.0.3", + "http-errors": "~1.6.2", + "mime-types": "~2.1.17", + "parseurl": "~1.3.2" } }, "serve-static": { @@ -9480,9 +9480,9 @@ "resolved": "https://registry.npmjs.org/serve-static/-/serve-static-1.13.2.tgz", "integrity": "sha512-p/tdJrO4U387R9oMjb1oj7qSMaMfmOyd4j9hOFoxZe2baQszgHcSWjuya/CiT5kgZZKRudHNOA0pYXOl8rQ5nw==", "requires": { - "encodeurl": "1.0.2", - "escape-html": "1.0.3", - "parseurl": "1.3.2", + "encodeurl": "~1.0.2", + "escape-html": "~1.0.3", + "parseurl": "~1.3.2", "send": "0.16.2" } }, @@ -9496,10 +9496,10 @@ "resolved": "https://registry.npmjs.org/set-value/-/set-value-2.0.0.tgz", "integrity": "sha512-hw0yxk9GT/Hr5yJEYnHNKYXkIA8mVJgd9ditYZCe16ZczcaELYYcfvaXesNACk2O8O0nTiPQcQhGUQj8JLzeeg==", "requires": { - "extend-shallow": "2.0.1", - "is-extendable": "0.1.1", - "is-plain-object": "2.0.4", - "split-string": "3.1.0" + "extend-shallow": "^2.0.1", + "is-extendable": "^0.1.1", + "is-plain-object": "^2.0.3", + "split-string": "^3.0.1" }, "dependencies": { "extend-shallow": { @@ -9507,7 +9507,7 @@ "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz", "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=", "requires": { - "is-extendable": "0.1.1" + "is-extendable": "^0.1.0" } } } @@ -9529,8 +9529,8 @@ "integrity": "sha512-QMEp5B7cftE7APOjk5Y6xgrbWu+WkLVQwk8JNjZ8nKRciZaByEW6MubieAiToS7+dwvrjGhH8jRXz3MVd0AYqQ==", "dev": true, "requires": { - "inherits": "2.0.3", - "safe-buffer": "5.1.2" + "inherits": "^2.0.1", + "safe-buffer": "^5.0.1" } }, "shallow-clone": { @@ -9539,9 +9539,9 @@ "integrity": "sha512-oeXreoKR/SyNJtRJMAKPDSvd28OqEwG4eR/xc856cRGBII7gX9lvAqDxusPm0846z/w/hWYjI1NpKwJ00NHzRA==", "dev": true, "requires": { - "is-extendable": "0.1.1", - "kind-of": "5.1.0", - "mixin-object": "2.0.1" + "is-extendable": "^0.1.1", + "kind-of": "^5.0.0", + "mixin-object": "^2.0.1" }, "dependencies": { "kind-of": { @@ -9557,7 +9557,7 @@ "resolved": "https://registry.npmjs.org/shebang-command/-/shebang-command-1.2.0.tgz", "integrity": "sha1-RKrGW2lbAzmJaMOfNj/uXer98eo=", "requires": { - "shebang-regex": "1.0.0" + "shebang-regex": "^1.0.0" } }, "shebang-regex": { @@ -9581,14 +9581,14 @@ "resolved": "https://registry.npmjs.org/snapdragon/-/snapdragon-0.8.2.tgz", "integrity": "sha512-FtyOnWN/wCHTVXOMwvSv26d+ko5vWlIDD6zoUJ7LW8vh+ZBC8QdljveRP+crNrtBwioEUWy/4dMtbBjA4ioNlg==", "requires": { - "base": "0.11.2", - "debug": "2.6.9", - "define-property": "0.2.5", - "extend-shallow": "2.0.1", - "map-cache": "0.2.2", - "source-map": "0.5.7", - "source-map-resolve": "0.5.2", - "use": "3.1.1" + "base": "^0.11.1", + "debug": "^2.2.0", + "define-property": "^0.2.5", + "extend-shallow": "^2.0.1", + "map-cache": "^0.2.2", + "source-map": "^0.5.6", + "source-map-resolve": "^0.5.0", + "use": "^3.1.0" }, "dependencies": { "define-property": { @@ -9596,7 +9596,7 @@ "resolved": "https://registry.npmjs.org/define-property/-/define-property-0.2.5.tgz", "integrity": "sha1-w1se+RjsPJkPmlvFe+BKrOxcgRY=", "requires": { - "is-descriptor": "0.1.6" + "is-descriptor": "^0.1.0" } }, "extend-shallow": { @@ -9604,7 +9604,7 @@ "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz", "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=", "requires": { - "is-extendable": "0.1.1" + "is-extendable": "^0.1.0" } }, "source-map": { @@ -9619,9 +9619,9 @@ "resolved": "https://registry.npmjs.org/snapdragon-node/-/snapdragon-node-2.1.1.tgz", "integrity": "sha512-O27l4xaMYt/RSQ5TR3vpWCAB5Kb/czIcqUFOM/C4fYcLnbZUc1PkjTAMjof2pBWaSTwOUd6qUHcFGVGj7aIwnw==", "requires": { - "define-property": "1.0.0", - "isobject": "3.0.1", - "snapdragon-util": "3.0.1" + "define-property": "^1.0.0", + "isobject": "^3.0.0", + "snapdragon-util": "^3.0.1" }, "dependencies": { "define-property": { @@ -9629,7 +9629,7 @@ "resolved": "https://registry.npmjs.org/define-property/-/define-property-1.0.0.tgz", "integrity": "sha1-dp66rz9KY6rTr56NMEybvnm/sOY=", "requires": { - "is-descriptor": "1.0.2" + "is-descriptor": "^1.0.0" } }, "is-accessor-descriptor": { @@ -9637,7 +9637,7 @@ "resolved": "https://registry.npmjs.org/is-accessor-descriptor/-/is-accessor-descriptor-1.0.0.tgz", "integrity": "sha512-m5hnHTkcVsPfqx3AKlyttIPb7J+XykHvJP2B9bZDjlhLIoEq4XoK64Vg7boZlVWYK6LUY94dYPEE7Lh0ZkZKcQ==", "requires": { - "kind-of": "6.0.2" + "kind-of": "^6.0.0" } }, "is-data-descriptor": { @@ -9645,7 +9645,7 @@ "resolved": "https://registry.npmjs.org/is-data-descriptor/-/is-data-descriptor-1.0.0.tgz", "integrity": "sha512-jbRXy1FmtAoCjQkVmIVYwuuqDFUbaOeDjmed1tOGPrsMhtJA4rD9tkgA0F1qJ3gRFRXcHYVkdeaP50Q5rE/jLQ==", "requires": { - "kind-of": "6.0.2" + "kind-of": "^6.0.0" } }, "is-descriptor": { @@ -9653,9 +9653,9 @@ "resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-1.0.2.tgz", "integrity": "sha512-2eis5WqQGV7peooDyLmNEPUrps9+SXX5c9pL3xEB+4e9HnGuDa7mB7kHxHw4CbqS9k1T2hOH3miL8n8WtiYVtg==", "requires": { - "is-accessor-descriptor": "1.0.0", - "is-data-descriptor": "1.0.0", - "kind-of": "6.0.2" + "is-accessor-descriptor": "^1.0.0", + "is-data-descriptor": "^1.0.0", + "kind-of": "^6.0.2" } } } @@ -9665,7 +9665,7 @@ "resolved": "https://registry.npmjs.org/snapdragon-util/-/snapdragon-util-3.0.1.tgz", "integrity": "sha512-mbKkMdQKsjX4BAL4bRYTj21edOf8cN7XHdYUJEe+Zn99hVEYcMvKPct1IqNe7+AZPirn8BCDOQBHQZknqmKlZQ==", "requires": { - "kind-of": "3.2.2" + "kind-of": "^3.2.0" }, "dependencies": { "kind-of": { @@ -9673,7 +9673,7 @@ "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz", "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=", "requires": { - "is-buffer": "1.1.6" + "is-buffer": "^1.1.5" } } } @@ -9684,8 +9684,8 @@ "integrity": "sha512-V48klKZl8T6MzatbLlzzRNhMepEys9Y4oGFpypBFFn1gLI/QQ9HtLLyWJNbPlwGLelOVOEijUbTTJeLLI59jLw==", "dev": true, "requires": { - "faye-websocket": "0.10.0", - "uuid": "3.3.2" + "faye-websocket": "^0.10.0", + "uuid": "^3.0.1" } }, "sockjs-client": { @@ -9694,12 +9694,12 @@ "integrity": "sha512-R9jxEzhnnrdxLCNln0xg5uGHqMnkhPSTzUZH2eXcR03S/On9Yvoq2wyUZILRUhZCNVu2PmwWVoyuiPz8th8zbg==", "dev": true, "requires": { - "debug": "3.2.6", - "eventsource": "1.0.7", - "faye-websocket": "0.11.1", - "inherits": "2.0.3", - "json3": "3.3.2", - "url-parse": "1.4.4" + "debug": "^3.2.5", + "eventsource": "^1.0.7", + "faye-websocket": "~0.11.1", + "inherits": "^2.0.3", + "json3": "^3.3.2", + "url-parse": "^1.4.3" }, "dependencies": { "debug": { @@ -9708,7 +9708,7 @@ "integrity": "sha512-mel+jf7nrtEl5Pn1Qx46zARXKDpBbvzezse7p7LqINmdoIk8PYP5SySaxEmYv6TZ0JyEKA1hsCId6DIhgITtWQ==", "dev": true, "requires": { - "ms": "2.1.1" + "ms": "^2.1.1" } }, "faye-websocket": { @@ -9717,7 +9717,7 @@ "integrity": "sha1-8O/hjE9W5PQK/H4Gxxn9XuYYjzg=", "dev": true, "requires": { - "websocket-driver": "0.7.0" + "websocket-driver": ">=0.5.1" } }, "ms": { @@ -9739,7 +9739,7 @@ "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.4.4.tgz", "integrity": "sha1-66T12pwNyZneaAMti092FzZSA2s=", "requires": { - "amdefine": "1.0.1" + "amdefine": ">=0.0.4" } }, "source-map-resolve": { @@ -9747,11 +9747,11 @@ "resolved": "https://registry.npmjs.org/source-map-resolve/-/source-map-resolve-0.5.2.tgz", "integrity": "sha512-MjqsvNwyz1s0k81Goz/9vRBe9SZdB09Bdw+/zYyO+3CuPk6fouTaxscHkgtE8jKvf01kVfl8riHzERQ/kefaSA==", "requires": { - "atob": "2.1.2", - "decode-uri-component": "0.2.0", - "resolve-url": "0.2.1", - "source-map-url": "0.4.0", - "urix": "0.1.0" + "atob": "^2.1.1", + "decode-uri-component": "^0.2.0", + "resolve-url": "^0.2.1", + "source-map-url": "^0.4.0", + "urix": "^0.1.0" } }, "source-map-support": { @@ -9760,8 +9760,8 @@ "integrity": "sha512-YfQ3tQFTK/yzlGJuX8pTwa4tifQj4QS2Mj7UegOu8jAz59MqIiMGPXxQhVQiIMNzayuUSF/jEuVnfFF5JqybmQ==", "dev": true, "requires": { - "buffer-from": "1.1.1", - "source-map": "0.6.1" + "buffer-from": "^1.0.0", + "source-map": "^0.6.0" }, "dependencies": { "source-map": { @@ -9782,8 +9782,8 @@ "resolved": "https://registry.npmjs.org/spdx-correct/-/spdx-correct-3.1.0.tgz", "integrity": "sha512-lr2EZCctC2BNR7j7WzJ2FpDznxky1sjfxvvYEyzxNyb6lZXHODmEoJeFu4JupYlkfha1KZpJyoqiJ7pgA1qq8Q==", "requires": { - "spdx-expression-parse": "3.0.0", - "spdx-license-ids": "3.0.3" + "spdx-expression-parse": "^3.0.0", + "spdx-license-ids": "^3.0.0" } }, "spdx-exceptions": { @@ -9796,8 +9796,8 @@ "resolved": "https://registry.npmjs.org/spdx-expression-parse/-/spdx-expression-parse-3.0.0.tgz", "integrity": "sha512-Yg6D3XpRD4kkOmTpdgbUiEJFKghJH03fiC1OPll5h/0sO6neh2jqRDVHOQ4o/LMea0tgCkbMgea5ip/e+MkWyg==", "requires": { - "spdx-exceptions": "2.2.0", - "spdx-license-ids": "3.0.3" + "spdx-exceptions": "^2.1.0", + "spdx-license-ids": "^3.0.0" } }, "spdx-license-ids": { @@ -9811,11 +9811,11 @@ "integrity": "sha512-ot0oEGT/PGUpzf/6uk4AWLqkq+irlqHXkrdbk51oWONh3bxQmBuljxPNl66zlRRcIJStWq0QkLUCPOPjgjvU0Q==", "dev": true, "requires": { - "debug": "4.1.1", - "handle-thing": "2.0.0", - "http-deceiver": "1.2.7", - "select-hose": "2.0.0", - "spdy-transport": "3.0.0" + "debug": "^4.1.0", + "handle-thing": "^2.0.0", + "http-deceiver": "^1.2.7", + "select-hose": "^2.0.0", + "spdy-transport": "^3.0.0" }, "dependencies": { "debug": { @@ -9824,7 +9824,7 @@ "integrity": "sha512-pYAIzeRo8J6KPEaJ0VWOh5Pzkbw/RetuzehGM7QRRX5he4fPHx2rdKMB256ehJCkX+XRQm16eZLqLNS8RSZXZw==", "dev": true, "requires": { - "ms": "2.1.1" + "ms": "^2.1.1" } }, "ms": { @@ -9841,12 +9841,12 @@ "integrity": "sha512-hsLVFE5SjA6TCisWeJXFKniGGOpBgMLmerfO2aCyCU5s7nJ/rpAepqmFifv/GCbSbueEeAJJnmSQ2rKC/g8Fcw==", "dev": true, "requires": { - "debug": "4.1.1", - "detect-node": "2.0.4", - "hpack.js": "2.1.6", - "obuf": "1.1.2", - "readable-stream": "3.1.1", - "wbuf": "1.7.3" + "debug": "^4.1.0", + "detect-node": "^2.0.4", + "hpack.js": "^2.1.6", + "obuf": "^1.1.2", + "readable-stream": "^3.0.6", + "wbuf": "^1.7.3" }, "dependencies": { "debug": { @@ -9855,7 +9855,7 @@ "integrity": "sha512-pYAIzeRo8J6KPEaJ0VWOh5Pzkbw/RetuzehGM7QRRX5he4fPHx2rdKMB256ehJCkX+XRQm16eZLqLNS8RSZXZw==", "dev": true, "requires": { - "ms": "2.1.1" + "ms": "^2.1.1" } }, "ms": { @@ -9870,9 +9870,9 @@ "integrity": "sha512-DkN66hPyqDhnIQ6Jcsvx9bFjhw214O4poMBcIMgPVpQvNy9a0e0Uhg5SqySyDKAmUlwt8LonTBz1ezOnM8pUdA==", "dev": true, "requires": { - "inherits": "2.0.3", - "string_decoder": "1.1.1", - "util-deprecate": "1.0.2" + "inherits": "^2.0.3", + "string_decoder": "^1.1.1", + "util-deprecate": "^1.0.1" } } } @@ -9882,7 +9882,7 @@ "resolved": "https://registry.npmjs.org/split-string/-/split-string-3.1.0.tgz", "integrity": "sha512-NzNVhJDYpwceVVii8/Hu6DKfD2G+NrQHlS/V/qgv763EYudVwEcMQNxd2lh+0VrUByXN/oJkl5grOhYWvQUYiw==", "requires": { - "extend-shallow": "3.0.2" + "extend-shallow": "^3.0.0" } }, "sshpk": { @@ -9890,15 +9890,15 @@ "resolved": "https://registry.npmjs.org/sshpk/-/sshpk-1.16.1.tgz", "integrity": "sha512-HXXqVUq7+pcKeLqqZj6mHFUMvXtOJt1uoUx09pFW6011inTMxqI8BA8PM95myrIyyKwdnzjdFjLiE6KBPVtJIg==", "requires": { - "asn1": "0.2.4", - "assert-plus": "1.0.0", - "bcrypt-pbkdf": "1.0.2", - "dashdash": "1.14.1", - "ecc-jsbn": "0.1.2", - "getpass": "0.1.7", - "jsbn": "0.1.1", - "safer-buffer": "2.1.2", - "tweetnacl": "0.14.5" + "asn1": "~0.2.3", + "assert-plus": "^1.0.0", + "bcrypt-pbkdf": "^1.0.0", + "dashdash": "^1.12.0", + "ecc-jsbn": "~0.1.1", + "getpass": "^0.1.1", + "jsbn": "~0.1.0", + "safer-buffer": "^2.0.2", + "tweetnacl": "~0.14.0" } }, "ssri": { @@ -9907,7 +9907,7 @@ "integrity": "sha512-XRSIPqLij52MtgoQavH/x/dU1qVKtWUAAZeOHsR9c2Ddi4XerFy3mc1alf+dLJKl9EUIm/Ht+EowFkTUOA6GAQ==", "dev": true, "requires": { - "safe-buffer": "5.1.2" + "safe-buffer": "^5.1.1" } }, "static-extend": { @@ -9915,8 +9915,8 @@ "resolved": "https://registry.npmjs.org/static-extend/-/static-extend-0.1.2.tgz", "integrity": "sha1-YICcOcv/VTNyJv1eC1IPNB8ftcY=", "requires": { - "define-property": "0.2.5", - "object-copy": "0.1.0" + "define-property": "^0.2.5", + "object-copy": "^0.1.0" }, "dependencies": { "define-property": { @@ -9924,7 +9924,7 @@ "resolved": "https://registry.npmjs.org/define-property/-/define-property-0.2.5.tgz", "integrity": "sha1-w1se+RjsPJkPmlvFe+BKrOxcgRY=", "requires": { - "is-descriptor": "0.1.6" + "is-descriptor": "^0.1.0" } } } @@ -9939,7 +9939,7 @@ "resolved": "https://registry.npmjs.org/stdout-stream/-/stdout-stream-1.4.1.tgz", "integrity": "sha512-j4emi03KXqJWcIeF8eIXkjMFN1Cmb8gUlDYGeBALLPo5qdyTfA9bOtl8m33lRoC+vFMkP3gl0WsDr6+gzxbbTA==", "requires": { - "readable-stream": "2.3.6" + "readable-stream": "^2.0.1" } }, "stream-browserify": { @@ -9948,8 +9948,8 @@ "integrity": "sha512-nX6hmklHs/gr2FuxYDltq8fJA1GDlxKQCz8O/IM4atRqBH8OORmBNgfvW5gG10GT/qQ9u0CzIvr2X5Pkt6ntqg==", "dev": true, "requires": { - "inherits": "2.0.3", - "readable-stream": "2.3.6" + "inherits": "~2.0.1", + "readable-stream": "^2.0.2" } }, "stream-each": { @@ -9958,8 +9958,8 @@ "integrity": "sha512-vlMC2f8I2u/bZGqkdfLQW/13Zihpej/7PmSiMQsbYddxuTsJp8vRe2x2FvVExZg7FaOds43ROAuFJwPR4MTZLw==", "dev": true, "requires": { - "end-of-stream": "1.4.1", - "stream-shift": "1.0.0" + "end-of-stream": "^1.1.0", + "stream-shift": "^1.0.0" } }, "stream-http": { @@ -9968,11 +9968,11 @@ "integrity": "sha512-+TSkfINHDo4J+ZobQLWiMouQYB+UVYFttRA94FpEzzJ7ZdqcL4uUUQ7WkdkI4DSozGmgBUE/a47L+38PenXhUw==", "dev": true, "requires": { - "builtin-status-codes": "3.0.0", - "inherits": "2.0.3", - "readable-stream": "2.3.6", - "to-arraybuffer": "1.0.1", - "xtend": "4.0.1" + "builtin-status-codes": "^3.0.0", + "inherits": "^2.0.1", + "readable-stream": "^2.3.6", + "to-arraybuffer": "^1.0.0", + "xtend": "^4.0.0" } }, "stream-shift": { @@ -9986,25 +9986,25 @@ "resolved": "https://registry.npmjs.org/string-width/-/string-width-1.0.2.tgz", "integrity": "sha1-EYvfW4zcUaKn5w0hHgfisLmxB9M=", "requires": { - "code-point-at": "1.1.0", - "is-fullwidth-code-point": "1.0.0", - "strip-ansi": "3.0.1" + "code-point-at": "^1.0.0", + "is-fullwidth-code-point": "^1.0.0", + "strip-ansi": "^3.0.0" } }, "string_decoder": { "version": "1.1.1", - "resolved": "http://registry.npmjs.org/string_decoder/-/string_decoder-1.1.1.tgz", + "resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-1.1.1.tgz", "integrity": "sha512-n/ShnvDi6FHbbVfviro+WojiFzv+s8MPMHBczVePfUpDJLwoLT0ht1l4YwBCbi8pJAveEEdnkHyPyTP/mzRfwg==", "requires": { - "safe-buffer": "5.1.2" + "safe-buffer": "~5.1.0" } }, "strip-ansi": { "version": "3.0.1", - "resolved": "http://registry.npmjs.org/strip-ansi/-/strip-ansi-3.0.1.tgz", + "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-3.0.1.tgz", "integrity": "sha1-ajhfuIU9lS1f8F0Oiq+UJ43GPc8=", "requires": { - "ansi-regex": "2.1.1" + "ansi-regex": "^2.0.0" } }, "strip-bom": { @@ -10012,7 +10012,7 @@ "resolved": "https://registry.npmjs.org/strip-bom/-/strip-bom-2.0.0.tgz", "integrity": "sha1-YhmoVhZSBJHzV4i9vxRHqZx+aw4=", "requires": { - "is-utf8": "0.2.1" + "is-utf8": "^0.2.0" } }, "strip-eof": { @@ -10025,7 +10025,7 @@ "resolved": "https://registry.npmjs.org/strip-indent/-/strip-indent-1.0.1.tgz", "integrity": "sha1-DHlipq3vp7vUrDZkYKY4VSrhoKI=", "requires": { - "get-stdin": "4.0.1" + "get-stdin": "^4.0.1" } }, "strip-json-comments": { @@ -10039,8 +10039,8 @@ "integrity": "sha512-XK+uv9kWwhZMZ1y7mysB+zoihsEj4wneFWAS5qoiLwzW0WzSqMrrsIy+a3zkQJq0ipFtBpX5W3MqyRIBF/WFGg==", "dev": true, "requires": { - "loader-utils": "1.2.3", - "schema-utils": "1.0.0" + "loader-utils": "^1.1.0", + "schema-utils": "^1.0.0" } }, "supports-color": { @@ -10056,12 +10056,12 @@ }, "tar": { "version": "2.2.1", - "resolved": "http://registry.npmjs.org/tar/-/tar-2.2.1.tgz", + "resolved": "https://registry.npmjs.org/tar/-/tar-2.2.1.tgz", "integrity": "sha1-jk0qJWwOIYXGsYrWlK7JaLg8sdE=", "requires": { - "block-stream": "0.0.9", - "fstream": "1.0.11", - "inherits": "2.0.3" + "block-stream": "*", + "fstream": "^1.0.2", + "inherits": "2" } }, "term-size": { @@ -10069,7 +10069,7 @@ "resolved": "https://registry.npmjs.org/term-size/-/term-size-1.2.0.tgz", "integrity": "sha1-RYuDiH8oj8Vtb/+/rSYuJmOO+mk=", "requires": { - "execa": "0.7.0" + "execa": "^0.7.0" }, "dependencies": { "cross-spawn": { @@ -10077,9 +10077,9 @@ "resolved": "https://registry.npmjs.org/cross-spawn/-/cross-spawn-5.1.0.tgz", "integrity": "sha1-6L0O/uWPz/b4+UUQoKVUu/ojVEk=", "requires": { - "lru-cache": "4.1.5", - "shebang-command": "1.2.0", - "which": "1.3.1" + "lru-cache": "^4.0.1", + "shebang-command": "^1.2.0", + "which": "^1.2.9" } }, "execa": { @@ -10087,13 +10087,13 @@ "resolved": "https://registry.npmjs.org/execa/-/execa-0.7.0.tgz", "integrity": "sha1-lEvs00zEHuMqY6n68nrVpl/Fl3c=", "requires": { - "cross-spawn": "5.1.0", - "get-stream": "3.0.0", - "is-stream": "1.1.0", - "npm-run-path": "2.0.2", - "p-finally": "1.0.0", - "signal-exit": "3.0.2", - "strip-eof": "1.0.0" + "cross-spawn": "^5.0.1", + "get-stream": "^3.0.0", + "is-stream": "^1.1.0", + "npm-run-path": "^2.0.0", + "p-finally": "^1.0.0", + "signal-exit": "^3.0.0", + "strip-eof": "^1.0.0" } }, "get-stream": { @@ -10109,9 +10109,9 @@ "integrity": "sha512-JDJjgleBROeek2iBcSNzOHLKsB/MdDf+E/BOAJ0Tk9r7p9/fVobfv7LMJ/g/k3v9SXdmjZnIlFd5nfn/Rt0Xow==", "dev": true, "requires": { - "commander": "2.17.1", - "source-map": "0.6.1", - "source-map-support": "0.5.10" + "commander": "~2.17.1", + "source-map": "~0.6.1", + "source-map-support": "~0.5.9" }, "dependencies": { "commander": { @@ -10134,14 +10134,14 @@ "integrity": "sha512-1DMkTk286BzmfylAvLXwpJrI7dWa5BnFmscV/2dCr8+c56egFcbaeFAl7+sujAjdmpLam21XRdhA4oifLyiWWg==", "dev": true, "requires": { - "cacache": "11.3.2", - "find-cache-dir": "2.0.0", - "schema-utils": "1.0.0", - "serialize-javascript": "1.6.1", - "source-map": "0.6.1", - "terser": "3.16.1", - "webpack-sources": "1.3.0", - "worker-farm": "1.6.0" + "cacache": "^11.0.2", + "find-cache-dir": "^2.0.0", + "schema-utils": "^1.0.0", + "serialize-javascript": "^1.4.0", + "source-map": "^0.6.1", + "terser": "^3.16.1", + "webpack-sources": "^1.1.0", + "worker-farm": "^1.5.2" }, "dependencies": { "cacache": { @@ -10150,20 +10150,20 @@ "integrity": "sha512-E0zP4EPGDOaT2chM08Als91eYnf8Z+eH1awwwVsngUmgppfM5jjJ8l3z5vO5p5w/I3LsiXawb1sW0VY65pQABg==", "dev": true, "requires": { - "bluebird": "3.5.3", - "chownr": "1.1.1", - "figgy-pudding": "3.5.1", - "glob": "7.1.3", - "graceful-fs": "4.1.15", - "lru-cache": "5.1.1", - "mississippi": "3.0.0", - "mkdirp": "0.5.1", - "move-concurrently": "1.0.1", - "promise-inflight": "1.0.1", - "rimraf": "2.6.3", - "ssri": "6.0.1", - "unique-filename": "1.1.1", - "y18n": "4.0.0" + "bluebird": "^3.5.3", + "chownr": "^1.1.1", + "figgy-pudding": "^3.5.1", + "glob": "^7.1.3", + "graceful-fs": "^4.1.15", + "lru-cache": "^5.1.1", + "mississippi": "^3.0.0", + "mkdirp": "^0.5.1", + "move-concurrently": "^1.0.1", + "promise-inflight": "^1.0.1", + "rimraf": "^2.6.2", + "ssri": "^6.0.1", + "unique-filename": "^1.1.1", + "y18n": "^4.0.0" } }, "find-cache-dir": { @@ -10172,9 +10172,9 @@ "integrity": "sha512-LDUY6V1Xs5eFskUVYtIwatojt6+9xC9Chnlk/jYOOvn3FAFfSaWddxahDGyNHh0b2dMXa6YW2m0tk8TdVaXHlA==", "dev": true, "requires": { - "commondir": "1.0.1", - "make-dir": "1.3.0", - "pkg-dir": "3.0.0" + "commondir": "^1.0.1", + "make-dir": "^1.0.0", + "pkg-dir": "^3.0.0" } }, "find-up": { @@ -10183,7 +10183,7 @@ "integrity": "sha512-1yD6RmLI1XBfxugvORwlck6f75tYL+iR0jqwsOrOxMZyGYqUuDhJ0l4AXdO1iX/FTs9cBAMEk1gWSEx1kSbylg==", "dev": true, "requires": { - "locate-path": "3.0.0" + "locate-path": "^3.0.0" } }, "locate-path": { @@ -10192,8 +10192,8 @@ "integrity": "sha512-7AO748wWnIhNqAuaty2ZWHkQHRSNfPVIsPIfwEOWO22AmaoVrWavlOcMR5nzTLNYvp36X220/maaRsrec1G65A==", "dev": true, "requires": { - "p-locate": "3.0.0", - "path-exists": "3.0.0" + "p-locate": "^3.0.0", + "path-exists": "^3.0.0" } }, "lru-cache": { @@ -10202,7 +10202,7 @@ "integrity": "sha512-KpNARQA3Iwv+jTA0utUVVbrh+Jlrr1Fv0e56GGzAFOXN7dk/FviaDW8LHmK52DlcH4WP2n6gI8vN1aesBFgo9w==", "dev": true, "requires": { - "yallist": "3.0.3" + "yallist": "^3.0.2" } }, "mississippi": { @@ -10211,16 +10211,16 @@ "integrity": "sha512-x471SsVjUtBRtcvd4BzKE9kFC+/2TeWgKCgw0bZcw1b9l2X3QX5vCWgF+KaZaYm87Ss//rHnWryupDrgLvmSkA==", "dev": true, "requires": { - "concat-stream": "1.6.2", - "duplexify": "3.7.1", - "end-of-stream": "1.4.1", - "flush-write-stream": "1.1.0", - "from2": "2.3.0", - "parallel-transform": "1.1.0", - "pump": "3.0.0", - "pumpify": "1.5.1", - "stream-each": "1.2.3", - "through2": "2.0.5" + "concat-stream": "^1.5.0", + "duplexify": "^3.4.2", + "end-of-stream": "^1.1.0", + "flush-write-stream": "^1.0.0", + "from2": "^2.1.0", + "parallel-transform": "^1.1.0", + "pump": "^3.0.0", + "pumpify": "^1.3.3", + "stream-each": "^1.1.0", + "through2": "^2.0.0" } }, "p-limit": { @@ -10229,7 +10229,7 @@ "integrity": "sha512-NhURkNcrVB+8hNfLuysU8enY5xn2KXphsHBaC2YmRNTZRc7RWusw6apSpdEj3jo4CMb6W9nrF6tTnsJsJeyu6g==", "dev": true, "requires": { - "p-try": "2.0.0" + "p-try": "^2.0.0" } }, "p-locate": { @@ -10238,7 +10238,7 @@ "integrity": "sha512-x+12w/To+4GFfgJhBEpiDcLozRJGegY+Ei7/z0tSLkMmxGZNybVMSfWj9aJn8Z5Fc7dBUNJOOVgPv2H7IwulSQ==", "dev": true, "requires": { - "p-limit": "2.1.0" + "p-limit": "^2.0.0" } }, "p-try": { @@ -10259,7 +10259,7 @@ "integrity": "sha512-/E57AYkoeQ25qkxMj5PBOVgF8Kiu/h7cYS30Z5+R7WaiCCBfLq58ZI/dSeaEKb9WVJV5n/03QwrN3IeWIFllvw==", "dev": true, "requires": { - "find-up": "3.0.0" + "find-up": "^3.0.0" } }, "pump": { @@ -10268,8 +10268,8 @@ "integrity": "sha512-LwZy+p3SFs1Pytd/jYct4wpv49HiYCqd9Rlc5ZVdk0V+8Yzv6jR5Blk3TRmPL1ft69TxP0IMZGJ+WPFU2BFhww==", "dev": true, "requires": { - "end-of-stream": "1.4.1", - "once": "1.4.0" + "end-of-stream": "^1.1.0", + "once": "^1.3.1" } }, "source-map": { @@ -10284,7 +10284,7 @@ "integrity": "sha512-3Wge10hNcT1Kur4PDFwEieXSCMCJs/7WvSACcrMYrNp+b8kDL1/0wJch5Ni2WrtwEa2IO8OsVfeKIciKCDx/QA==", "dev": true, "requires": { - "figgy-pudding": "3.5.1" + "figgy-pudding": "^3.5.1" } }, "y18n": { @@ -10306,8 +10306,8 @@ "resolved": "https://registry.npmjs.org/threads/-/threads-0.8.1.tgz", "integrity": "sha1-40ARW1lHMW0vfuMSPEwsW/nHbXI=", "requires": { - "eventemitter3": "2.0.3", - "native-promise-only": "0.8.1" + "eventemitter3": "^2.0.2", + "native-promise-only": "^0.8.1" } }, "through": { @@ -10321,8 +10321,8 @@ "integrity": "sha512-/mrRod8xqpA+IHSLyGCQ2s8SPHiCDEeQJSep1jqLYeEUClOFG2Qsh+4FU6G9VeqpZnGW/Su8LQGc4YKni5rYSQ==", "dev": true, "requires": { - "readable-stream": "2.3.6", - "xtend": "4.0.1" + "readable-stream": "~2.3.6", + "xtend": "~4.0.1" } }, "thunky": { @@ -10342,7 +10342,7 @@ "integrity": "sha512-YvC1SV1XdOUaL6gx5CoGroT3Gu49pK9+TZ38ErPldOWW4j49GI1HKs9DV+KGq/w6y+LZ72W1c8cKz2vzY+qpzg==", "dev": true, "requires": { - "setimmediate": "1.0.5" + "setimmediate": "^1.0.4" } }, "to-arraybuffer": { @@ -10356,7 +10356,7 @@ "resolved": "https://registry.npmjs.org/to-object-path/-/to-object-path-0.3.0.tgz", "integrity": "sha1-KXWIt7Dn4KwI4E5nL4XB9JmeF68=", "requires": { - "kind-of": "3.2.2" + "kind-of": "^3.0.2" }, "dependencies": { "kind-of": { @@ -10364,7 +10364,7 @@ "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz", "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=", "requires": { - "is-buffer": "1.1.6" + "is-buffer": "^1.1.5" } } } @@ -10374,10 +10374,10 @@ "resolved": "https://registry.npmjs.org/to-regex/-/to-regex-3.0.2.tgz", "integrity": "sha512-FWtleNAtZ/Ki2qtqej2CXTOayOH9bHDQF+Q48VpWyDXjbYxA4Yz8iDB31zXOBUlOHHKidDbqGVrTUvQMPmBGBw==", "requires": { - "define-property": "2.0.2", - "extend-shallow": "3.0.2", - "regex-not": "1.0.2", - "safe-regex": "1.1.0" + "define-property": "^2.0.2", + "extend-shallow": "^3.0.2", + "regex-not": "^1.0.2", + "safe-regex": "^1.1.0" } }, "to-regex-range": { @@ -10385,8 +10385,8 @@ "resolved": "https://registry.npmjs.org/to-regex-range/-/to-regex-range-2.1.1.tgz", "integrity": "sha1-fIDBe53+vlmeJzZ+DU3VWQFB2zg=", "requires": { - "is-number": "3.0.0", - "repeat-string": "1.6.1" + "is-number": "^3.0.0", + "repeat-string": "^1.6.1" } }, "touch": { @@ -10394,7 +10394,7 @@ "resolved": "https://registry.npmjs.org/touch/-/touch-3.1.0.tgz", "integrity": "sha512-WBx8Uy5TLtOSRtIq+M03/sKDrXCLHxwDcquSP2c43Le03/9serjQBIztjRz6FkJez9D/hleyAXTBGLwwZUw9lA==", "requires": { - "nopt": "1.0.10" + "nopt": "~1.0.10" }, "dependencies": { "nopt": { @@ -10402,7 +10402,7 @@ "resolved": "https://registry.npmjs.org/nopt/-/nopt-1.0.10.tgz", "integrity": "sha1-bd0hvSoxQXuScn3Vhfim83YI6+4=", "requires": { - "abbrev": "1.1.1" + "abbrev": "1" } } } @@ -10412,8 +10412,8 @@ "resolved": "https://registry.npmjs.org/tough-cookie/-/tough-cookie-2.4.3.tgz", "integrity": "sha512-Q5srk/4vDM54WJsJio3XNn6K2sCG+CQ8G5Wz6bZhRZoAe/+TxjWB/GlFAnYEbkYVlON9FMk/fE3h2RLpPXo4lQ==", "requires": { - "psl": "1.1.31", - "punycode": "1.4.1" + "psl": "^1.1.24", + "punycode": "^1.4.1" }, "dependencies": { "punycode": { @@ -10433,7 +10433,7 @@ "resolved": "https://registry.npmjs.org/true-case-path/-/true-case-path-1.0.3.tgz", "integrity": "sha512-m6s2OdQe5wgpFMC+pAJ+q9djG82O2jcHPOI6RNg1yy9rCYR+WD6Nbpl32fDpfC56nirdRy+opFa/Vk7HYhqaew==", "requires": { - "glob": "7.1.3" + "glob": "^7.1.2" } }, "ts-node": { @@ -10442,14 +10442,14 @@ "integrity": "sha512-BVwVbPJRspzNh2yfslyT1PSbl5uIk03EZlb493RKHN4qej/D06n1cEhjlOJG69oFsE7OT8XjpTUcYf6pKTLMhw==", "dev": true, "requires": { - "arrify": "1.0.1", - "buffer-from": "1.1.1", - "diff": "3.5.0", - "make-error": "1.3.5", - "minimist": "1.2.0", - "mkdirp": "0.5.1", - "source-map-support": "0.5.10", - "yn": "2.0.0" + "arrify": "^1.0.0", + "buffer-from": "^1.1.0", + "diff": "^3.1.0", + "make-error": "^1.1.1", + "minimist": "^1.2.0", + "mkdirp": "^0.5.1", + "source-map-support": "^0.5.6", + "yn": "^2.0.0" } }, "tslib": { @@ -10460,7 +10460,7 @@ }, "tty-browserify": { "version": "0.0.0", - "resolved": "http://registry.npmjs.org/tty-browserify/-/tty-browserify-0.0.0.tgz", + "resolved": "https://registry.npmjs.org/tty-browserify/-/tty-browserify-0.0.0.tgz", "integrity": "sha1-oVe6QC2iTpv5V/mqadUk7tQpAaY=", "dev": true }, @@ -10469,7 +10469,7 @@ "resolved": "https://registry.npmjs.org/tunnel-agent/-/tunnel-agent-0.6.0.tgz", "integrity": "sha1-J6XeoGs2sEoKmWZ3SykIaPD8QP0=", "requires": { - "safe-buffer": "5.1.2" + "safe-buffer": "^5.0.1" } }, "tweetnacl": { @@ -10489,7 +10489,7 @@ "integrity": "sha512-HRkVv/5qY2G6I8iab9cI7v1bOIdhm94dVjQCPFElW9W+3GeDOSHmy2EBYe4VTApuzolPcmgFTN3ftVJRKR2J9Q==", "requires": { "media-typer": "0.3.0", - "mime-types": "2.1.21" + "mime-types": "~2.1.18" } }, "typedarray": { @@ -10513,7 +10513,7 @@ "resolved": "https://registry.npmjs.org/undefsafe/-/undefsafe-2.0.2.tgz", "integrity": "sha1-Il9rngM3Zj4Njnz9aG/Cg2zKznY=", "requires": { - "debug": "2.6.9" + "debug": "^2.2.0" } }, "union-value": { @@ -10521,10 +10521,10 @@ "resolved": "https://registry.npmjs.org/union-value/-/union-value-1.0.0.tgz", "integrity": "sha1-XHHDTLW61dzr4+oM0IIHulqhrqQ=", "requires": { - "arr-union": "3.1.0", - "get-value": "2.0.6", - "is-extendable": "0.1.1", - "set-value": "0.4.3" + "arr-union": "^3.1.0", + "get-value": "^2.0.6", + "is-extendable": "^0.1.1", + "set-value": "^0.4.3" }, "dependencies": { "extend-shallow": { @@ -10532,7 +10532,7 @@ "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz", "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=", "requires": { - "is-extendable": "0.1.1" + "is-extendable": "^0.1.0" } }, "set-value": { @@ -10540,10 +10540,10 @@ "resolved": "https://registry.npmjs.org/set-value/-/set-value-0.4.3.tgz", "integrity": "sha1-fbCPnT0i3H945Trzw79GZuzfzPE=", "requires": { - "extend-shallow": "2.0.1", - "is-extendable": "0.1.1", - "is-plain-object": "2.0.4", - "to-object-path": "0.3.0" + "extend-shallow": "^2.0.1", + "is-extendable": "^0.1.1", + "is-plain-object": "^2.0.1", + "to-object-path": "^0.3.0" } } } @@ -10554,7 +10554,7 @@ "integrity": "sha512-Vmp0jIp2ln35UTXuryvjzkjGdRyf9b2lTXuSYUiPmzRcl3FDtYqAwOnTJkAngD9SWhnoJzDbTKwaOrZ+STtxNQ==", "dev": true, "requires": { - "unique-slug": "2.0.1" + "unique-slug": "^2.0.0" } }, "unique-slug": { @@ -10563,7 +10563,7 @@ "integrity": "sha512-n9cU6+gITaVu7VGj1Z8feKMmfAjEAQGhwD9fE3zvpRRa0wEIx8ODYkVGfSc94M2OX00tUFV8wH3zYbm1I8mxFg==", "dev": true, "requires": { - "imurmurhash": "0.1.4" + "imurmurhash": "^0.1.4" } }, "unique-string": { @@ -10571,7 +10571,7 @@ "resolved": "https://registry.npmjs.org/unique-string/-/unique-string-1.0.0.tgz", "integrity": "sha1-nhBXzKhRq7kzmPizOuGHuZyuwRo=", "requires": { - "crypto-random-string": "1.0.0" + "crypto-random-string": "^1.0.0" } }, "unpipe": { @@ -10584,8 +10584,8 @@ "resolved": "https://registry.npmjs.org/unset-value/-/unset-value-1.0.0.tgz", "integrity": "sha1-g3aHP30jNRef+x5vw6jtDfyKtVk=", "requires": { - "has-value": "0.3.1", - "isobject": "3.0.1" + "has-value": "^0.3.1", + "isobject": "^3.0.0" }, "dependencies": { "has-value": { @@ -10593,9 +10593,9 @@ "resolved": "https://registry.npmjs.org/has-value/-/has-value-0.3.1.tgz", "integrity": "sha1-ex9YutpiyoJ+wKIHgCVlSEWZXh8=", "requires": { - "get-value": "2.0.6", - "has-values": "0.1.4", - "isobject": "2.1.0" + "get-value": "^2.0.3", + "has-values": "^0.1.4", + "isobject": "^2.0.0" }, "dependencies": { "isobject": { @@ -10630,16 +10630,16 @@ "resolved": "https://registry.npmjs.org/update-notifier/-/update-notifier-2.5.0.tgz", "integrity": "sha512-gwMdhgJHGuj/+wHJJs9e6PcCszpxR1b236igrOkUofGhqJuG+amlIKwApH1IW1WWl7ovZxsX49lMBWLxSdm5Dw==", "requires": { - "boxen": "1.3.0", - "chalk": "2.4.2", - "configstore": "3.1.2", - "import-lazy": "2.1.0", - "is-ci": "1.2.1", - "is-installed-globally": "0.1.0", - "is-npm": "1.0.0", - "latest-version": "3.1.0", - "semver-diff": "2.1.0", - "xdg-basedir": "3.0.0" + "boxen": "^1.2.1", + "chalk": "^2.0.1", + "configstore": "^3.0.0", + "import-lazy": "^2.1.0", + "is-ci": "^1.0.10", + "is-installed-globally": "^0.1.0", + "is-npm": "^1.0.0", + "latest-version": "^3.0.0", + "semver-diff": "^2.0.0", + "xdg-basedir": "^3.0.0" }, "dependencies": { "ansi-styles": { @@ -10647,7 +10647,7 @@ "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz", "integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==", "requires": { - "color-convert": "1.9.3" + "color-convert": "^1.9.0" } }, "chalk": { @@ -10655,9 +10655,9 @@ "resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz", "integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==", "requires": { - "ansi-styles": "3.2.1", - "escape-string-regexp": "1.0.5", - "supports-color": "5.5.0" + "ansi-styles": "^3.2.1", + "escape-string-regexp": "^1.0.5", + "supports-color": "^5.3.0" } }, "supports-color": { @@ -10665,7 +10665,7 @@ "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz", "integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==", "requires": { - "has-flag": "3.0.0" + "has-flag": "^3.0.0" } } } @@ -10675,7 +10675,7 @@ "resolved": "https://registry.npmjs.org/uri-js/-/uri-js-4.2.2.tgz", "integrity": "sha512-KY9Frmirql91X2Qgjry0Wd4Y+YTdrdZheS8TFwvkbLWf/G5KNJDCh6pKL5OZctEW4+0Baa5idK2ZQuELRwPznQ==", "requires": { - "punycode": "2.1.1" + "punycode": "^2.1.0" } }, "urix": { @@ -10706,9 +10706,9 @@ "resolved": "https://registry.npmjs.org/url-loader/-/url-loader-1.1.2.tgz", "integrity": "sha512-dXHkKmw8FhPqu8asTc1puBfe3TehOCo2+RmOOev5suNCIYBcT626kxiWg1NBVkwc4rO8BGa7gP70W7VXuqHrjg==", "requires": { - "loader-utils": "1.2.3", - "mime": "2.4.0", - "schema-utils": "1.0.0" + "loader-utils": "^1.1.0", + "mime": "^2.0.3", + "schema-utils": "^1.0.0" } }, "url-parse": { @@ -10717,8 +10717,8 @@ "integrity": "sha512-/92DTTorg4JjktLNLe6GPS2/RvAd/RGr6LuktmWSMLEOa6rjnlrFXNgSbSmkNvCoL2T028A0a1JaJLzRMlFoHg==", "dev": true, "requires": { - "querystringify": "2.1.0", - "requires-port": "1.0.0" + "querystringify": "^2.0.0", + "requires-port": "^1.0.0" } }, "url-parse-lax": { @@ -10726,7 +10726,7 @@ "resolved": "https://registry.npmjs.org/url-parse-lax/-/url-parse-lax-1.0.0.tgz", "integrity": "sha1-evjzA2Rem9eaJy56FKxovAYJ2nM=", "requires": { - "prepend-http": "1.0.4" + "prepend-http": "^1.0.1" } }, "use": { @@ -10769,8 +10769,8 @@ "resolved": "https://registry.npmjs.org/validate-npm-package-license/-/validate-npm-package-license-3.0.4.tgz", "integrity": "sha512-DpKm2Ui/xN7/HQKCtpZxoRWBhZ9Z0kqtygG8XCgNQ8ZlDnxuQmWhj566j8fN4Cu3/JmbhsDo7fcAJq4s9h27Ew==", "requires": { - "spdx-correct": "3.1.0", - "spdx-expression-parse": "3.0.0" + "spdx-correct": "^3.0.0", + "spdx-expression-parse": "^3.0.0" } }, "vary": { @@ -10783,14 +10783,14 @@ "resolved": "https://registry.npmjs.org/verror/-/verror-1.10.0.tgz", "integrity": "sha1-OhBcoXBTr1XW4nDB+CiGguGNpAA=", "requires": { - "assert-plus": "1.0.0", + "assert-plus": "^1.0.0", "core-util-is": "1.0.2", - "extsprintf": "1.3.0" + "extsprintf": "^1.2.0" } }, "vm-browserify": { "version": "0.0.4", - "resolved": "http://registry.npmjs.org/vm-browserify/-/vm-browserify-0.0.4.tgz", + "resolved": "https://registry.npmjs.org/vm-browserify/-/vm-browserify-0.0.4.tgz", "integrity": "sha1-XX6kW7755Kb/ZflUOOCofDV9WnM=", "dev": true, "requires": { @@ -10807,7 +10807,7 @@ "resolved": "https://registry.npmjs.org/warning/-/warning-3.0.0.tgz", "integrity": "sha1-MuU3fLVy3kqwR1O9+IIcAe1gW3w=", "requires": { - "loose-envify": "1.4.0" + "loose-envify": "^1.0.0" } }, "watchpack": { @@ -10816,9 +10816,9 @@ "integrity": "sha512-i6dHe3EyLjMmDlU1/bGQpEw25XSjkJULPuAVKCbNRefQVq48yXKUpwg538F7AZTf9kyr57zj++pQFltUa5H7yA==", "dev": true, "requires": { - "chokidar": "2.0.4", - "graceful-fs": "4.1.15", - "neo-async": "2.6.0" + "chokidar": "^2.0.2", + "graceful-fs": "^4.1.2", + "neo-async": "^2.5.0" } }, "wbuf": { @@ -10827,7 +10827,7 @@ "integrity": "sha512-O84QOnr0icsbFGLS0O3bI5FswxzRr8/gHwWkDlQFskhSPryQXvrTMxjxGP4+iWYoauLoBvfDpkrOauZ+0iZpDA==", "dev": true, "requires": { - "minimalistic-assert": "1.0.1" + "minimalistic-assert": "^1.0.0" } }, "webpack": { @@ -10840,26 +10840,26 @@ "@webassemblyjs/helper-module-context": "1.7.11", "@webassemblyjs/wasm-edit": "1.7.11", "@webassemblyjs/wasm-parser": "1.7.11", - "acorn": "6.0.7", - "acorn-dynamic-import": "4.0.0", - "ajv": "6.8.1", - "ajv-keywords": "3.3.0", - "chrome-trace-event": "1.0.0", - "enhanced-resolve": "4.1.0", - "eslint-scope": "4.0.0", - "json-parse-better-errors": "1.0.2", - "loader-runner": "2.4.0", - "loader-utils": "1.2.3", - "memory-fs": "0.4.1", - "micromatch": "3.1.10", - "mkdirp": "0.5.1", - "neo-async": "2.6.0", - "node-libs-browser": "2.2.0", - "schema-utils": "0.4.7", - "tapable": "1.1.1", - "terser-webpack-plugin": "1.2.2", - "watchpack": "1.6.0", - "webpack-sources": "1.3.0" + "acorn": "^6.0.5", + "acorn-dynamic-import": "^4.0.0", + "ajv": "^6.1.0", + "ajv-keywords": "^3.1.0", + "chrome-trace-event": "^1.0.0", + "enhanced-resolve": "^4.1.0", + "eslint-scope": "^4.0.0", + "json-parse-better-errors": "^1.0.2", + "loader-runner": "^2.3.0", + "loader-utils": "^1.1.0", + "memory-fs": "~0.4.1", + "micromatch": "^3.1.8", + "mkdirp": "~0.5.0", + "neo-async": "^2.5.0", + "node-libs-browser": "^2.0.0", + "schema-utils": "^0.4.4", + "tapable": "^1.1.0", + "terser-webpack-plugin": "^1.1.0", + "watchpack": "^1.5.0", + "webpack-sources": "^1.3.0" }, "dependencies": { "acorn": { @@ -10874,8 +10874,8 @@ "integrity": "sha512-v/iwU6wvwGK8HbU9yi3/nhGzP0yGSuhQMzL6ySiec1FSrZZDkhm4noOSWzrNFo/jEc+SJY6jRTwuwbSXJPDUnQ==", "dev": true, "requires": { - "ajv": "6.8.1", - "ajv-keywords": "3.3.0" + "ajv": "^6.1.0", + "ajv-keywords": "^3.1.0" } } } @@ -10886,19 +10886,19 @@ "integrity": "sha512-jeJveHwz/vwpJ3B8bxEL5a/rVKIpRNJDsKggfKnxuYeohNDW4Y/wB9N/XHJA093qZyS0r6mYL+/crLsIol4WKA==", "dev": true, "requires": { - "chalk": "2.4.2", - "cross-spawn": "6.0.5", - "enhanced-resolve": "4.1.0", - "findup-sync": "2.0.0", - "global-modules": "1.0.0", - "global-modules-path": "2.3.1", - "import-local": "2.0.0", - "interpret": "1.2.0", - "lightercollective": "0.1.0", - "loader-utils": "1.2.3", - "supports-color": "5.5.0", - "v8-compile-cache": "2.0.2", - "yargs": "12.0.5" + "chalk": "^2.4.1", + "cross-spawn": "^6.0.5", + "enhanced-resolve": "^4.1.0", + "findup-sync": "^2.0.0", + "global-modules": "^1.0.0", + "global-modules-path": "^2.3.0", + "import-local": "^2.0.0", + "interpret": "^1.1.0", + "lightercollective": "^0.1.0", + "loader-utils": "^1.1.0", + "supports-color": "^5.5.0", + "v8-compile-cache": "^2.0.2", + "yargs": "^12.0.4" }, "dependencies": { "ansi-regex": { @@ -10913,7 +10913,7 @@ "integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==", "dev": true, "requires": { - "color-convert": "1.9.3" + "color-convert": "^1.9.0" } }, "camelcase": { @@ -10928,9 +10928,9 @@ "integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==", "dev": true, "requires": { - "ansi-styles": "3.2.1", - "escape-string-regexp": "1.0.5", - "supports-color": "5.5.0" + "ansi-styles": "^3.2.1", + "escape-string-regexp": "^1.0.5", + "supports-color": "^5.3.0" } }, "cliui": { @@ -10939,9 +10939,9 @@ "integrity": "sha512-4FG+RSG9DL7uEwRUZXZn3SS34DiDPfzP0VOiEwtUWlE+AR2EIg+hSyvrIgUUfhdgR/UkAeW2QHgeP+hWrXs7jQ==", "dev": true, "requires": { - "string-width": "2.1.1", - "strip-ansi": "4.0.0", - "wrap-ansi": "2.1.0" + "string-width": "^2.1.1", + "strip-ansi": "^4.0.0", + "wrap-ansi": "^2.0.0" } }, "cross-spawn": { @@ -10950,11 +10950,11 @@ "integrity": "sha512-eTVLrBSt7fjbDygz805pMnstIs2VTBNkRm0qxZd+M7A5XDdxVRWO5MxGBXZhjY4cqLYLdtrGqRf8mBPmzwSpWQ==", "dev": true, "requires": { - "nice-try": "1.0.5", - "path-key": "2.0.1", - "semver": "5.6.0", - "shebang-command": "1.2.0", - "which": "1.3.1" + "nice-try": "^1.0.4", + "path-key": "^2.0.1", + "semver": "^5.5.0", + "shebang-command": "^1.2.0", + "which": "^1.2.9" } }, "find-up": { @@ -10963,7 +10963,7 @@ "integrity": "sha512-1yD6RmLI1XBfxugvORwlck6f75tYL+iR0jqwsOrOxMZyGYqUuDhJ0l4AXdO1iX/FTs9cBAMEk1gWSEx1kSbylg==", "dev": true, "requires": { - "locate-path": "3.0.0" + "locate-path": "^3.0.0" } }, "invert-kv": { @@ -10984,7 +10984,7 @@ "integrity": "sha512-avPEb8P8EGnwXKClwsNUgryVjllcRqtMYa49NTsbQagYuT1DcXnl1915oxWjoyGrXR6zH/Y0Zc96xWsPcoDKeA==", "dev": true, "requires": { - "invert-kv": "2.0.0" + "invert-kv": "^2.0.0" } }, "locate-path": { @@ -10993,8 +10993,8 @@ "integrity": "sha512-7AO748wWnIhNqAuaty2ZWHkQHRSNfPVIsPIfwEOWO22AmaoVrWavlOcMR5nzTLNYvp36X220/maaRsrec1G65A==", "dev": true, "requires": { - "p-locate": "3.0.0", - "path-exists": "3.0.0" + "p-locate": "^3.0.0", + "path-exists": "^3.0.0" } }, "os-locale": { @@ -11003,9 +11003,9 @@ "integrity": "sha512-Z8l3R4wYWM40/52Z+S265okfFj8Kt2cC2MKY+xNi3kFs+XGI7WXu/I309QQQYbRW4ijiZ+yxs9pqEhJh0DqW3Q==", "dev": true, "requires": { - "execa": "1.0.0", - "lcid": "2.0.0", - "mem": "4.1.0" + "execa": "^1.0.0", + "lcid": "^2.0.0", + "mem": "^4.0.0" } }, "p-limit": { @@ -11014,7 +11014,7 @@ "integrity": "sha512-NhURkNcrVB+8hNfLuysU8enY5xn2KXphsHBaC2YmRNTZRc7RWusw6apSpdEj3jo4CMb6W9nrF6tTnsJsJeyu6g==", "dev": true, "requires": { - "p-try": "2.0.0" + "p-try": "^2.0.0" } }, "p-locate": { @@ -11023,7 +11023,7 @@ "integrity": "sha512-x+12w/To+4GFfgJhBEpiDcLozRJGegY+Ei7/z0tSLkMmxGZNybVMSfWj9aJn8Z5Fc7dBUNJOOVgPv2H7IwulSQ==", "dev": true, "requires": { - "p-limit": "2.1.0" + "p-limit": "^2.0.0" } }, "p-try": { @@ -11044,8 +11044,8 @@ "integrity": "sha512-nOqH59deCq9SRHlxq1Aw85Jnt4w6KvLKqWVik6oA9ZklXLNIOlqg4F2yrT1MVaTjAqvVwdfeZ7w7aCvJD7ugkw==", "dev": true, "requires": { - "is-fullwidth-code-point": "2.0.0", - "strip-ansi": "4.0.0" + "is-fullwidth-code-point": "^2.0.0", + "strip-ansi": "^4.0.0" } }, "strip-ansi": { @@ -11054,7 +11054,7 @@ "integrity": "sha1-qEeQIusaw2iocTibY1JixQXuNo8=", "dev": true, "requires": { - "ansi-regex": "3.0.0" + "ansi-regex": "^3.0.0" } }, "supports-color": { @@ -11063,7 +11063,7 @@ "integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==", "dev": true, "requires": { - "has-flag": "3.0.0" + "has-flag": "^3.0.0" } }, "which-module": { @@ -11078,18 +11078,18 @@ "integrity": "sha512-Lhz8TLaYnxq/2ObqHDql8dX8CJi97oHxrjUcYtzKbbykPtVW9WB+poxI+NM2UIzsMgNCZTIf0AQwsjK5yMAqZw==", "dev": true, "requires": { - "cliui": "4.1.0", - "decamelize": "1.2.0", - "find-up": "3.0.0", - "get-caller-file": "1.0.3", - "os-locale": "3.1.0", - "require-directory": "2.1.1", - "require-main-filename": "1.0.1", - "set-blocking": "2.0.0", - "string-width": "2.1.1", - "which-module": "2.0.0", - "y18n": "3.2.1", - "yargs-parser": "11.1.1" + "cliui": "^4.0.0", + "decamelize": "^1.2.0", + "find-up": "^3.0.0", + "get-caller-file": "^1.0.1", + "os-locale": "^3.0.0", + "require-directory": "^2.1.1", + "require-main-filename": "^1.0.1", + "set-blocking": "^2.0.0", + "string-width": "^2.0.0", + "which-module": "^2.0.0", + "y18n": "^3.2.1 || ^4.0.0", + "yargs-parser": "^11.1.1" } }, "yargs-parser": { @@ -11098,8 +11098,8 @@ "integrity": "sha512-C6kB/WJDiaxONLJQnF8ccx9SEeoTTLek8RVbaOIsrAUS8VrBEXfmeSnCZxygc+XC2sNMBIwOOnfcxiynjHsVSQ==", "dev": true, "requires": { - "camelcase": "5.0.0", - "decamelize": "1.2.0" + "camelcase": "^5.0.0", + "decamelize": "^1.2.0" } } } @@ -11110,10 +11110,10 @@ "integrity": "sha512-nPmshdt1ckcwWjI0Ubrdp8KroeuprW6xFKYqk0u3MflNMBXvHPnMATsC7/L/enwav2zvLCfj/Usr47qnF3KQyA==", "dev": true, "requires": { - "memory-fs": "0.4.1", - "mime": "2.4.0", - "range-parser": "1.2.0", - "webpack-log": "2.0.0" + "memory-fs": "~0.4.1", + "mime": "^2.3.1", + "range-parser": "^1.0.3", + "webpack-log": "^2.0.0" }, "dependencies": { "webpack-log": { @@ -11122,8 +11122,8 @@ "integrity": "sha512-cX8G2vR/85UYG59FgkoMamwHUIkSSlV3bBMRsbxVXVUk2j6NleCKjQ/WE9eYg9WY4w25O9w8wKP4rzNZFmUcUg==", "dev": true, "requires": { - "ansi-colors": "3.2.3", - "uuid": "3.3.2" + "ansi-colors": "^3.0.0", + "uuid": "^3.3.2" } } } @@ -11135,34 +11135,34 @@ "dev": true, "requires": { "ansi-html": "0.0.7", - "bonjour": "3.5.0", - "chokidar": "2.0.4", - "compression": "1.7.3", - "connect-history-api-fallback": "1.6.0", - "debug": "3.2.6", - "del": "3.0.0", - "express": "4.16.4", - "html-entities": "1.2.1", - "http-proxy-middleware": "0.18.0", - "import-local": "2.0.0", - "internal-ip": "3.0.1", - "ip": "1.1.5", - "killable": "1.0.1", - "loglevel": "1.6.1", - "opn": "5.4.0", - "portfinder": "1.0.20", - "schema-utils": "1.0.0", - "selfsigned": "1.10.4", - "semver": "5.6.0", - "serve-index": "1.9.1", + "bonjour": "^3.5.0", + "chokidar": "^2.0.0", + "compression": "^1.5.2", + "connect-history-api-fallback": "^1.3.0", + "debug": "^3.1.0", + "del": "^3.0.0", + "express": "^4.16.2", + "html-entities": "^1.2.0", + "http-proxy-middleware": "~0.18.0", + "import-local": "^2.0.0", + "internal-ip": "^3.0.1", + "ip": "^1.1.5", + "killable": "^1.0.0", + "loglevel": "^1.4.1", + "opn": "^5.1.0", + "portfinder": "^1.0.9", + "schema-utils": "^1.0.0", + "selfsigned": "^1.9.1", + "semver": "^5.6.0", + "serve-index": "^1.7.2", "sockjs": "0.3.19", "sockjs-client": "1.3.0", - "spdy": "4.0.0", - "strip-ansi": "3.0.1", - "supports-color": "5.5.0", - "url": "0.11.0", + "spdy": "^4.0.0", + "strip-ansi": "^3.0.0", + "supports-color": "^5.1.0", + "url": "^0.11.0", "webpack-dev-middleware": "3.4.0", - "webpack-log": "2.0.0", + "webpack-log": "^2.0.0", "yargs": "12.0.2" }, "dependencies": { @@ -11184,9 +11184,9 @@ "integrity": "sha512-4FG+RSG9DL7uEwRUZXZn3SS34DiDPfzP0VOiEwtUWlE+AR2EIg+hSyvrIgUUfhdgR/UkAeW2QHgeP+hWrXs7jQ==", "dev": true, "requires": { - "string-width": "2.1.1", - "strip-ansi": "4.0.0", - "wrap-ansi": "2.1.0" + "string-width": "^2.1.1", + "strip-ansi": "^4.0.0", + "wrap-ansi": "^2.0.0" }, "dependencies": { "strip-ansi": { @@ -11195,7 +11195,7 @@ "integrity": "sha1-qEeQIusaw2iocTibY1JixQXuNo8=", "dev": true, "requires": { - "ansi-regex": "3.0.0" + "ansi-regex": "^3.0.0" } } } @@ -11206,7 +11206,7 @@ "integrity": "sha512-mel+jf7nrtEl5Pn1Qx46zARXKDpBbvzezse7p7LqINmdoIk8PYP5SySaxEmYv6TZ0JyEKA1hsCId6DIhgITtWQ==", "dev": true, "requires": { - "ms": "2.1.1" + "ms": "^2.1.1" } }, "decamelize": { @@ -11224,7 +11224,7 @@ "integrity": "sha512-1yD6RmLI1XBfxugvORwlck6f75tYL+iR0jqwsOrOxMZyGYqUuDhJ0l4AXdO1iX/FTs9cBAMEk1gWSEx1kSbylg==", "dev": true, "requires": { - "locate-path": "3.0.0" + "locate-path": "^3.0.0" } }, "invert-kv": { @@ -11245,7 +11245,7 @@ "integrity": "sha512-avPEb8P8EGnwXKClwsNUgryVjllcRqtMYa49NTsbQagYuT1DcXnl1915oxWjoyGrXR6zH/Y0Zc96xWsPcoDKeA==", "dev": true, "requires": { - "invert-kv": "2.0.0" + "invert-kv": "^2.0.0" } }, "locate-path": { @@ -11254,8 +11254,8 @@ "integrity": "sha512-7AO748wWnIhNqAuaty2ZWHkQHRSNfPVIsPIfwEOWO22AmaoVrWavlOcMR5nzTLNYvp36X220/maaRsrec1G65A==", "dev": true, "requires": { - "p-locate": "3.0.0", - "path-exists": "3.0.0" + "p-locate": "^3.0.0", + "path-exists": "^3.0.0" } }, "ms": { @@ -11270,9 +11270,9 @@ "integrity": "sha512-Z8l3R4wYWM40/52Z+S265okfFj8Kt2cC2MKY+xNi3kFs+XGI7WXu/I309QQQYbRW4ijiZ+yxs9pqEhJh0DqW3Q==", "dev": true, "requires": { - "execa": "1.0.0", - "lcid": "2.0.0", - "mem": "4.1.0" + "execa": "^1.0.0", + "lcid": "^2.0.0", + "mem": "^4.0.0" } }, "p-limit": { @@ -11281,7 +11281,7 @@ "integrity": "sha512-NhURkNcrVB+8hNfLuysU8enY5xn2KXphsHBaC2YmRNTZRc7RWusw6apSpdEj3jo4CMb6W9nrF6tTnsJsJeyu6g==", "dev": true, "requires": { - "p-try": "2.0.0" + "p-try": "^2.0.0" } }, "p-locate": { @@ -11290,7 +11290,7 @@ "integrity": "sha512-x+12w/To+4GFfgJhBEpiDcLozRJGegY+Ei7/z0tSLkMmxGZNybVMSfWj9aJn8Z5Fc7dBUNJOOVgPv2H7IwulSQ==", "dev": true, "requires": { - "p-limit": "2.1.0" + "p-limit": "^2.0.0" } }, "p-try": { @@ -11311,8 +11311,8 @@ "integrity": "sha512-nOqH59deCq9SRHlxq1Aw85Jnt4w6KvLKqWVik6oA9ZklXLNIOlqg4F2yrT1MVaTjAqvVwdfeZ7w7aCvJD7ugkw==", "dev": true, "requires": { - "is-fullwidth-code-point": "2.0.0", - "strip-ansi": "4.0.0" + "is-fullwidth-code-point": "^2.0.0", + "strip-ansi": "^4.0.0" }, "dependencies": { "strip-ansi": { @@ -11321,7 +11321,7 @@ "integrity": "sha1-qEeQIusaw2iocTibY1JixQXuNo8=", "dev": true, "requires": { - "ansi-regex": "3.0.0" + "ansi-regex": "^3.0.0" } } } @@ -11332,7 +11332,7 @@ "integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==", "dev": true, "requires": { - "has-flag": "3.0.0" + "has-flag": "^3.0.0" } }, "webpack-dev-middleware": { @@ -11341,10 +11341,10 @@ "integrity": "sha512-Q9Iyc0X9dP9bAsYskAVJ/hmIZZQwf/3Sy4xCAZgL5cUkjZmUZLt4l5HpbST/Pdgjn3u6pE7u5OdGd1apgzRujA==", "dev": true, "requires": { - "memory-fs": "0.4.1", - "mime": "2.4.0", - "range-parser": "1.2.0", - "webpack-log": "2.0.0" + "memory-fs": "~0.4.1", + "mime": "^2.3.1", + "range-parser": "^1.0.3", + "webpack-log": "^2.0.0" } }, "webpack-log": { @@ -11353,8 +11353,8 @@ "integrity": "sha512-cX8G2vR/85UYG59FgkoMamwHUIkSSlV3bBMRsbxVXVUk2j6NleCKjQ/WE9eYg9WY4w25O9w8wKP4rzNZFmUcUg==", "dev": true, "requires": { - "ansi-colors": "3.2.3", - "uuid": "3.3.2" + "ansi-colors": "^3.0.0", + "uuid": "^3.3.2" } }, "which-module": { @@ -11369,18 +11369,18 @@ "integrity": "sha512-e7SkEx6N6SIZ5c5H22RTZae61qtn3PYUE8JYbBFlK9sYmh3DMQ6E5ygtaG/2BW0JZi4WGgTR2IV5ChqlqrDGVQ==", "dev": true, "requires": { - "cliui": "4.1.0", - "decamelize": "2.0.0", - "find-up": "3.0.0", - "get-caller-file": "1.0.3", - "os-locale": "3.1.0", - "require-directory": "2.1.1", - "require-main-filename": "1.0.1", - "set-blocking": "2.0.0", - "string-width": "2.1.1", - "which-module": "2.0.0", - "y18n": "3.2.1", - "yargs-parser": "10.1.0" + "cliui": "^4.0.0", + "decamelize": "^2.0.0", + "find-up": "^3.0.0", + "get-caller-file": "^1.0.1", + "os-locale": "^3.0.0", + "require-directory": "^2.1.1", + "require-main-filename": "^1.0.1", + "set-blocking": "^2.0.0", + "string-width": "^2.0.0", + "which-module": "^2.0.0", + "y18n": "^3.2.1 || ^4.0.0", + "yargs-parser": "^10.1.0" } }, "yargs-parser": { @@ -11389,7 +11389,7 @@ "integrity": "sha512-VCIyR1wJoEBZUqk5PA+oOBF6ypbwh5aNB3I50guxAL/quggdfs4TtNHQrSazFA3fYZ+tEqfs0zIGlv0c/rgjbQ==", "dev": true, "requires": { - "camelcase": "4.1.0" + "camelcase": "^4.1.0" } } } @@ -11401,9 +11401,9 @@ "dev": true, "requires": { "ansi-html": "0.0.7", - "html-entities": "1.2.1", - "querystring": "0.2.0", - "strip-ansi": "3.0.1" + "html-entities": "^1.2.0", + "querystring": "^0.2.0", + "strip-ansi": "^3.0.0" } }, "webpack-log": { @@ -11412,10 +11412,10 @@ "integrity": "sha512-U9AnICnu50HXtiqiDxuli5gLB5PGBo7VvcHx36jRZHwK4vzOYLbImqT4lwWwoMHdQWwEKw736fCHEekokTEKHA==", "dev": true, "requires": { - "chalk": "2.4.2", - "log-symbols": "2.2.0", - "loglevelnext": "1.0.5", - "uuid": "3.3.2" + "chalk": "^2.1.0", + "log-symbols": "^2.1.0", + "loglevelnext": "^1.0.1", + "uuid": "^3.1.0" }, "dependencies": { "ansi-styles": { @@ -11424,7 +11424,7 @@ "integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==", "dev": true, "requires": { - "color-convert": "1.9.3" + "color-convert": "^1.9.0" } }, "chalk": { @@ -11433,9 +11433,9 @@ "integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==", "dev": true, "requires": { - "ansi-styles": "3.2.1", - "escape-string-regexp": "1.0.5", - "supports-color": "5.5.0" + "ansi-styles": "^3.2.1", + "escape-string-regexp": "^1.0.5", + "supports-color": "^5.3.0" } }, "supports-color": { @@ -11444,7 +11444,7 @@ "integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==", "dev": true, "requires": { - "has-flag": "3.0.0" + "has-flag": "^3.0.0" } } } @@ -11455,8 +11455,8 @@ "integrity": "sha512-OiVgSrbGu7NEnEvQJJgdSFPl2qWKkWq5lHMhgiToIiN9w34EBnjYzSYs+VbL5KoYiLNtFFa7BZIKxRED3I32pA==", "dev": true, "requires": { - "source-list-map": "2.0.1", - "source-map": "0.6.1" + "source-list-map": "^2.0.0", + "source-map": "~0.6.1" }, "dependencies": { "source-map": { @@ -11473,8 +11473,8 @@ "integrity": "sha1-DK+dLXVdk67gSdS90NP+LMoqJOs=", "dev": true, "requires": { - "http-parser-js": "0.5.0", - "websocket-extensions": "0.1.3" + "http-parser-js": ">=0.4.0", + "websocket-extensions": ">=0.1.1" } }, "websocket-extensions": { @@ -11493,7 +11493,7 @@ "resolved": "https://registry.npmjs.org/which/-/which-1.3.1.tgz", "integrity": "sha512-HxJdYWq1MTIQbJ3nw0cqssHoTNU267KlrDuGZ1WYlxDStUtKUhOaJmh112/TZmHxxUfuJqPXSOm7tDyas0OSIQ==", "requires": { - "isexe": "2.0.0" + "isexe": "^2.0.0" } }, "which-module": { @@ -11506,7 +11506,7 @@ "resolved": "https://registry.npmjs.org/wide-align/-/wide-align-1.1.3.tgz", "integrity": "sha512-QGkOQc8XL6Bt5PwnsExKBPuMKBxnGxWWW3fU55Xt4feHozMUhdUMaBCk290qpm/wG5u/RSKzwdAC4i51YigihA==", "requires": { - "string-width": "1.0.2" + "string-width": "^1.0.2 || 2" } }, "widest-line": { @@ -11514,7 +11514,7 @@ "resolved": "https://registry.npmjs.org/widest-line/-/widest-line-2.0.1.tgz", "integrity": "sha512-Ba5m9/Fa4Xt9eb2ELXt77JxVDV8w7qQrH0zS/TWSJdLyAwQjWoOzpzj5lwVftDz6n/EOu3tNACS84v509qwnJA==", "requires": { - "string-width": "2.1.1" + "string-width": "^2.1.1" }, "dependencies": { "ansi-regex": { @@ -11532,8 +11532,8 @@ "resolved": "https://registry.npmjs.org/string-width/-/string-width-2.1.1.tgz", "integrity": "sha512-nOqH59deCq9SRHlxq1Aw85Jnt4w6KvLKqWVik6oA9ZklXLNIOlqg4F2yrT1MVaTjAqvVwdfeZ7w7aCvJD7ugkw==", "requires": { - "is-fullwidth-code-point": "2.0.0", - "strip-ansi": "4.0.0" + "is-fullwidth-code-point": "^2.0.0", + "strip-ansi": "^4.0.0" } }, "strip-ansi": { @@ -11541,7 +11541,7 @@ "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-4.0.0.tgz", "integrity": "sha1-qEeQIusaw2iocTibY1JixQXuNo8=", "requires": { - "ansi-regex": "3.0.0" + "ansi-regex": "^3.0.0" } } } @@ -11552,16 +11552,16 @@ "integrity": "sha512-6w+3tHbM87WnSWnENBUvA2pxJPLhQUg5LKwUQHq3r+XPhIM+Gh2R5ycbwPCyuGbNg+lPgdcnQUhuC02kJCvffQ==", "dev": true, "requires": { - "errno": "0.1.7" + "errno": "~0.1.7" } }, "wrap-ansi": { "version": "2.1.0", - "resolved": "http://registry.npmjs.org/wrap-ansi/-/wrap-ansi-2.1.0.tgz", + "resolved": "https://registry.npmjs.org/wrap-ansi/-/wrap-ansi-2.1.0.tgz", "integrity": "sha1-2Pw9KE3QV5T+hJc8rs3Rz4JP3YU=", "requires": { - "string-width": "1.0.2", - "strip-ansi": "3.0.1" + "string-width": "^1.0.1", + "strip-ansi": "^3.0.1" } }, "wrappy": { @@ -11574,9 +11574,9 @@ "resolved": "https://registry.npmjs.org/write-file-atomic/-/write-file-atomic-2.4.2.tgz", "integrity": "sha512-s0b6vB3xIVRLWywa6X9TOMA7k9zio0TMOsl9ZnDkliA/cfJlpHXAscj0gbHVJiTdIuAYpIyqS5GW91fqm6gG5g==", "requires": { - "graceful-fs": "4.1.15", - "imurmurhash": "0.1.4", - "signal-exit": "3.0.2" + "graceful-fs": "^4.1.11", + "imurmurhash": "^0.1.4", + "signal-exit": "^3.0.2" } }, "xdg-basedir": { @@ -11611,19 +11611,19 @@ "resolved": "https://registry.npmjs.org/yargs/-/yargs-7.1.0.tgz", "integrity": "sha1-a6MY6xaWFyf10oT46gA+jWFU0Mg=", "requires": { - "camelcase": "3.0.0", - "cliui": "3.2.0", - "decamelize": "1.2.0", - "get-caller-file": "1.0.3", - "os-locale": "1.4.0", - "read-pkg-up": "1.0.1", - "require-directory": "2.1.1", - "require-main-filename": "1.0.1", - "set-blocking": "2.0.0", - "string-width": "1.0.2", - "which-module": "1.0.0", - "y18n": "3.2.1", - "yargs-parser": "5.0.0" + "camelcase": "^3.0.0", + "cliui": "^3.2.0", + "decamelize": "^1.1.1", + "get-caller-file": "^1.0.1", + "os-locale": "^1.4.0", + "read-pkg-up": "^1.0.1", + "require-directory": "^2.1.1", + "require-main-filename": "^1.0.1", + "set-blocking": "^2.0.0", + "string-width": "^1.0.2", + "which-module": "^1.0.0", + "y18n": "^3.2.1", + "yargs-parser": "^5.0.0" }, "dependencies": { "camelcase": { @@ -11638,7 +11638,7 @@ "resolved": "https://registry.npmjs.org/yargs-parser/-/yargs-parser-5.0.0.tgz", "integrity": "sha1-J17PDX/+Bcd+ZOfIbkzZS/DhIoo=", "requires": { - "camelcase": "3.0.0" + "camelcase": "^3.0.0" }, "dependencies": { "camelcase": { diff --git a/src/client/views/nodes/DocumentView.tsx b/src/client/views/nodes/DocumentView.tsx index d06423755..9d5548525 100644 --- a/src/client/views/nodes/DocumentView.tsx +++ b/src/client/views/nodes/DocumentView.tsx @@ -11,12 +11,8 @@ import { CollectionSchemaView } from "../collections/CollectionSchemaView"; import { CollectionViewBase, COLLECTION_BORDER_WIDTH } from "../collections/CollectionViewBase"; import { FormattedTextBox } from "../nodes/FormattedTextBox"; import { ImageBox } from "../nodes/ImageBox"; -<<<<<<< HEAD import { WebBox } from "../nodes/WebBox"; -import "./NodeView.scss"; -======= import "./DocumentView.scss"; ->>>>>>> 3f98d6ec6050e7faa15179871f0d9669c1188a78 import React = require("react"); import { Transform } from "../../util/Transform"; const JsxParser = require('react-jsx-parser').default;//TODO Why does this need to be imported like this? -- cgit v1.2.3-70-g09d2 From d091617fa9a8c43914fb754ca170cb3b2750d1af Mon Sep 17 00:00:00 2001 From: madelinegr Date: Mon, 18 Feb 2019 18:33:08 -0500 Subject: webbox in doc view --- src/client/views/nodes/DocumentView.tsx | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) (limited to 'src/client/views/nodes') diff --git a/src/client/views/nodes/DocumentView.tsx b/src/client/views/nodes/DocumentView.tsx index 9d5548525..1088e732c 100644 --- a/src/client/views/nodes/DocumentView.tsx +++ b/src/client/views/nodes/DocumentView.tsx @@ -161,7 +161,7 @@ export class DocumentView extends React.Component { } if (this.backgroundLayout) { var backgroundview = Date: Tue, 19 Feb 2019 18:24:41 -0500 Subject: Different options based on selection --- src/client/views/ContextMenu.scss | 7 +++---- src/client/views/ContextMenu.tsx | 6 ++++-- src/client/views/nodes/CollectionFreeFormDocumentView.tsx | 2 -- src/client/views/nodes/FormattedTextBox.tsx | 12 +++++++++++- src/client/views/nodes/ImageBox.tsx | 11 ++++++++++- 5 files changed, 28 insertions(+), 10 deletions(-) (limited to 'src/client/views/nodes') diff --git a/src/client/views/ContextMenu.scss b/src/client/views/ContextMenu.scss index dc5907f14..2ac5d3b52 100644 --- a/src/client/views/ContextMenu.scss +++ b/src/client/views/ContextMenu.scss @@ -13,7 +13,6 @@ display: flex; justify-content: center; align-items: center; - flex-direction: column; -webkit-touch-callout: none; -webkit-user-select: none; -khtml-user-select: none; @@ -34,6 +33,6 @@ width: 8vw; } -// #mySearch { -// font-size: 1.5vw; -// } \ No newline at end of file +#mySearch { + font-size: 1.4vw; +} \ No newline at end of file diff --git a/src/client/views/ContextMenu.tsx b/src/client/views/ContextMenu.tsx index 4a216ca21..2359c673d 100644 --- a/src/client/views/ContextMenu.tsx +++ b/src/client/views/ContextMenu.tsx @@ -1,6 +1,6 @@ import React = require("react"); import { ContextMenuItem, ContextMenuProps } from "./ContextMenuItem"; -import { observable } from "mobx"; +import { observable, action } from "mobx"; import { observer } from "mobx-react"; import "./ContextMenu.scss" @@ -23,11 +23,13 @@ export class ContextMenu extends React.Component { ContextMenu.Instance = this; } + @action clearItems() { this._items = [] this._display = "none" } + @action addItem(item: ContextMenuProps) { if (this._items.indexOf(item) === -1) { this._items.push(item); @@ -58,7 +60,7 @@ export class ContextMenu extends React.Component { render() { return ( -
+
{this._items.map(prop => { return diff --git a/src/client/views/nodes/CollectionFreeFormDocumentView.tsx b/src/client/views/nodes/CollectionFreeFormDocumentView.tsx index 54d3a1b56..f37232c08 100644 --- a/src/client/views/nodes/CollectionFreeFormDocumentView.tsx +++ b/src/client/views/nodes/CollectionFreeFormDocumentView.tsx @@ -203,7 +203,6 @@ export class CollectionFreeFormDocumentView extends DocumentView { } if (this.topMost) { - ContextMenu.Instance.clearItems() ContextMenu.Instance.addItem({ description: "Full Screen", event: this.fullScreenClicked }) ContextMenu.Instance.displayMenu(e.pageX - 15, e.pageY - 15) } @@ -211,7 +210,6 @@ export class CollectionFreeFormDocumentView extends DocumentView { // DocumentViews should stop propogation of this event e.stopPropagation(); - ContextMenu.Instance.clearItems(); ContextMenu.Instance.addItem({ description: "Full Screen", event: this.fullScreenClicked }) ContextMenu.Instance.addItem({ description: "Open Right", event: this.openRight }) ContextMenu.Instance.addItem({ description: "Delete", event: this.deleteClicked }) diff --git a/src/client/views/nodes/FormattedTextBox.tsx b/src/client/views/nodes/FormattedTextBox.tsx index 8f959762a..0fe6befda 100644 --- a/src/client/views/nodes/FormattedTextBox.tsx +++ b/src/client/views/nodes/FormattedTextBox.tsx @@ -13,6 +13,7 @@ import { RichTextField } from "../../../fields/RichTextField"; import { FieldViewProps, FieldView } from "./FieldView"; import { CollectionFreeFormDocumentView } from "./CollectionFreeFormDocumentView"; import { observer } from "mobx-react"; +import { ContextMenu } from "../../views/ContextMenu"; // FormattedTextBox: Displays an editable plain text node that maps to a specified Key of a Document @@ -114,6 +115,15 @@ export class FormattedTextBox extends React.Component { e.stopPropagation(); } } + + //REPLACE THIS WITH CAPABILITIES SPECIFC TO THIS TYPE OF NODE + textCapability = (e: React.MouseEvent): void => { + } + + specificContextMenu = (e: React.MouseEvent): void => { + ContextMenu.Instance.addItem({ description: "Text Capability", event: this.textCapability }); + } + render() { return (
{ whiteSpace: "initial" }} onPointerDown={this.onPointerDown} - ref={this._ref} />) + ref={this._ref} onContextMenu={this.specificContextMenu} />) } } \ No newline at end of file diff --git a/src/client/views/nodes/ImageBox.tsx b/src/client/views/nodes/ImageBox.tsx index 60be5f94d..f363487c3 100644 --- a/src/client/views/nodes/ImageBox.tsx +++ b/src/client/views/nodes/ImageBox.tsx @@ -11,6 +11,7 @@ import { FieldWaiting } from '../../../fields/Field'; import { observer } from "mobx-react" import { observable, action, spy } from 'mobx'; import { KeyStore } from '../../../fields/Key'; +import { ContextMenu } from "../../views/ContextMenu"; @observer export class ImageBox extends React.Component { @@ -81,13 +82,21 @@ export class ImageBox extends React.Component { } } + //REPLACE THIS WITH CAPABILITIES SPECIFC TO THIS TYPE OF NODE + imageCapability = (e: React.MouseEvent): void => { + } + + specificContextMenu = (e: React.MouseEvent): void => { + ContextMenu.Instance.addItem({ description: "Image Capability", event: this.imageCapability }); + } + render() { let field = this.props.doc.Get(this.props.fieldKey); let path = field == FieldWaiting ? "https://image.flaticon.com/icons/svg/66/66163.svg" : field instanceof ImageField ? field.Data.href : "http://www.cs.brown.edu/~bcz/face.gif"; return ( -
+
Image not found {this.lightbox(path)}
) -- cgit v1.2.3-70-g09d2 From f2bdae28c9fcd5306b0d14e1bbfafc2bb232aed8 Mon Sep 17 00:00:00 2001 From: Monika Hedman Date: Tue, 19 Feb 2019 19:01:28 -0500 Subject: got width and height!!! --- src/client/views/DocumentManager.tsx | 57 +++++++--------------- src/client/views/Main.tsx | 4 +- src/client/views/TempTreeView.scss | 2 +- src/client/views/TempTreeView.tsx | 26 ++++------ .../views/collections/CollectionViewBase.tsx | 1 - src/client/views/nodes/DocumentView.tsx | 22 ++++++--- 6 files changed, 45 insertions(+), 67 deletions(-) (limited to 'src/client/views/nodes') diff --git a/src/client/views/DocumentManager.tsx b/src/client/views/DocumentManager.tsx index 81231bf13..3aa185dd3 100644 --- a/src/client/views/DocumentManager.tsx +++ b/src/client/views/DocumentManager.tsx @@ -12,7 +12,7 @@ export class DocumentManager { //global holds all of the nodes (regardless of which collection they're in) @observable - public DocumentViews: DocumentView[]; + public DocumentViews: DocumentView[] = []; // singleton instance private static _instance: DocumentManager; @@ -24,7 +24,7 @@ export class DocumentManager { //private constructor so no other class can create a nodemanager private constructor() { - this.DocumentViews = new Array(); + // this.DocumentViews = new Array(); } public getDocumentView(toFind: Document): DocumentView | null { @@ -91,17 +91,12 @@ export class DocumentManager { let height: number; //if the view exists in a freeform collection - if (docView != null) { - //view.props.GetTransform().TranslateX - width = docView.props.Document.GetNumber(KeyStore.Width, 0) - height = docView.props.Document.GetNumber(KeyStore.Height, 0) + if (docView && docView.MainContent.current) { + width = docView.MainContent.current.clientWidth + height = docView.MainContent.current.clientHeight //base case: parent of parent does not exist if (docView.props.ContainingCollectionView == null) { - // scale = RootStore.Instance.MainNodeCollection.Scale; - // XView = (-node.X * scale) + (window.innerWidth / 2) - (node.Width * scale / 2); - // YView = (-node.Y * scale) + (window.innerHeight / 2) - (node.Height * scale / 2); - // RootStore.Instance.MainNodeCollection.SetViewportXY(XView, YView); scale = docView.props.ScreenToLocalTransform().Scale XView = (-docView.props.ScreenToLocalTransform().TranslateX * scale) + (window.innerWidth / 2) - (width * scale / 2) YView = (-docView.props.ScreenToLocalTransform().TranslateY * scale) + (window.innerHeight / 2) - (height * scale / 2) @@ -109,37 +104,17 @@ export class DocumentManager { } //parent is not main, parent is centered and calls itself else { - console.log("------------------------------------------") - console.log(docView.props.ContainingCollectionView.props.DocumentForCollection.Title) - console.log("------------------------------------------") - console.log("parent does exist") - if (docView.props.ContainingCollectionView.props.DocumentForCollection != null) { - console.log("view of parent exists") + if (docView.props.ContainingCollectionView.props.ContainingDocumentView && docView.props.ContainingCollectionView.props.ContainingDocumentView.MainContent.current) { + //view of parent + let tempCollectionView = docView.props.ContainingCollectionView.props.ContainingDocumentView - let tempView = this.getDocumentView(docView.props.ContainingCollectionView.props.DocumentForCollection) + let parentWidth = docView.props.ContainingCollectionView.props.ContainingDocumentView.MainContent.current.clientWidth + let parentHeight = docView.props.ContainingCollectionView.props.ContainingDocumentView.MainContent.current.clientHeight - //console.log(docView.props.ContainingCollectionView.props.DocumentForCollection.GetNumber(KeyStore.NativeWidth, 0)) - - // let parentWidth = docView.props.ContainingCollectionView.props.DocumentForCollection.GetNumber(KeyStore.Width, 0) - // let parentHeight = docView.props.ContainingCollectionView.props.DocumentForCollection.GetNumber(KeyStore.Height, 0) - - let parentWidth = docView.props.ContainingCollectionView.props.DocumentForCollection.GetNumber(KeyStore.Width, 0) - let parentHeight = docView.props.ContainingCollectionView.props.DocumentForCollection.GetNumber(KeyStore.Height, 0) - //_htmlElement!.clientWidth - - // console.log("window width: " + window.innerWidth + ", window height: " + window.innerHeight) - // console.log("parent width: " + parentWidth + ", parent height: " + parentHeight) - - - if (tempView != null) { - console.log("View is NOT null") - scale = tempView.props.ScreenToLocalTransform().Scale - - parentWidth *= scale - parentHeight *= scale - - console.log("window width: " + window.innerWidth + ", window height: " + window.innerHeight) - console.log("parent width: " + parentWidth + ", parent height: " + parentHeight) + //make sure to test if the parent view is a freeform view + if (tempCollectionView) { + //scale of parent + scale = tempCollectionView.props.ScreenToLocalTransform().Scale XView = (-docView.props.ScreenToLocalTransform().TranslateX * scale) + (parentWidth / 2) - (width * scale / 2); YView = (-docView.props.ScreenToLocalTransform().TranslateY * scale) + (parentHeight / 2) - (height * scale / 2); @@ -153,6 +128,10 @@ export class DocumentManager { } } + parentIsFreeform(node: any): boolean { + return node.props.ContainingCollectionView instanceof CollectionFreeFormView + } + private setViewportXY(collection: CollectionViewBase, x: number, y: number) { if (collection.props.BackgroundView != null) { collection.props.ScreenToLocalTransform().center(x, y) diff --git a/src/client/views/Main.tsx b/src/client/views/Main.tsx index 0532cbc1f..5f7590f8d 100644 --- a/src/client/views/Main.tsx +++ b/src/client/views/Main.tsx @@ -72,11 +72,11 @@ let mainNodes = mainContainer.GetOrCreate>(KeyStore.Data, Li // mainNodes.Data.push(doc6); // mainNodes.Data.push(doc2); mainNodes.Data.push(doc4); -mainNodes.Data.push(doc3); +// mainNodes.Data.push(doc3); // mainNodes.Data.push(doc5); // mainNodes.Data.push(doc1); // mainNodes.Data.push(doc2); -mainNodes.Data.push(doc6); +// mainNodes.Data.push(doc6); //} //); diff --git a/src/client/views/TempTreeView.scss b/src/client/views/TempTreeView.scss index c50b5be2c..fe8cf4da8 100644 --- a/src/client/views/TempTreeView.scss +++ b/src/client/views/TempTreeView.scss @@ -1,7 +1,7 @@ .temptree { background: #ADD8E6; width: 300px; - height: 100px; + height: 200px; z-index: 100; position: fixed; bottom: 0px; diff --git a/src/client/views/TempTreeView.tsx b/src/client/views/TempTreeView.tsx index 2d02f3fde..4b1650ac5 100644 --- a/src/client/views/TempTreeView.tsx +++ b/src/client/views/TempTreeView.tsx @@ -1,4 +1,4 @@ -import { observable, computed } from "mobx"; +import { action, observable, computed } from "mobx"; import React = require("react"); import { observer } from "mobx-react"; import { Document } from "../../fields/Document"; @@ -13,23 +13,16 @@ export interface IProps { @observer export class TempTreeView extends React.Component{ + @action onClick(doc: Document) { + let view = DocumentManager.Instance.getDocumentView(doc); if (view != null) { - //console.log(view.Id) - //console.log(view.props.GetTransform().TranslateX) - DocumentManager.Instance.centerNode(view); - console.log(view.props.Document.Title) - if (view.props.ContainingCollectionView != undefined) { - //console.log(view.props.ContainingCollectionView.Id) - // view.props.ContainingCollectionView - } - else { - console.log("containing collection is undefined") + if (DocumentManager.Instance.parentIsFreeform(view)) { + view.switchColor() } - - view.switchColor(); + DocumentManager.Instance.centerNode(view); } } @@ -37,10 +30,10 @@ export class TempTreeView extends React.Component{ return (
- {this.props.mainCollection.map(doc => { + {DocumentManager.Instance.DocumentViews.map(doc => { return ( -
{ this.onClick(doc) }}> - {doc.Title} +
{ this.onClick(doc.props.Document) }}> + {doc.props.Document.Title}
) } @@ -49,5 +42,4 @@ export class TempTreeView extends React.Component{
); } - } \ No newline at end of file diff --git a/src/client/views/collections/CollectionViewBase.tsx b/src/client/views/collections/CollectionViewBase.tsx index 4cbafe950..35ba227e9 100644 --- a/src/client/views/collections/CollectionViewBase.tsx +++ b/src/client/views/collections/CollectionViewBase.tsx @@ -12,7 +12,6 @@ import { CollectionDockingView } from "./CollectionDockingView"; import { CollectionFreeFormDocumentView } from "../nodes/CollectionFreeFormDocumentView"; import { Transform } from "../../util/Transform"; - export interface CollectionViewProps { CollectionFieldKey: Key; DocumentForCollection: Document; diff --git a/src/client/views/nodes/DocumentView.tsx b/src/client/views/nodes/DocumentView.tsx index 9bd8c0288..8e2f1afe7 100644 --- a/src/client/views/nodes/DocumentView.tsx +++ b/src/client/views/nodes/DocumentView.tsx @@ -1,4 +1,4 @@ -import { action, computed } from "mobx"; +import { action, computed, runInAction } from "mobx"; import { observer } from "mobx-react"; import { observable } from "mobx"; import { Document } from "../../../fields/Document"; @@ -179,11 +179,11 @@ export class DocumentView extends React.Component { ContextMenu.Instance.displayMenu(e.pageX - 15, e.pageY - 15) } + //TODO Monika @action Center = (e: React.MouseEvent): void => { DocumentManager.Instance.centerNode(this.props.Document) DocumentManager.Instance.centerNode(this) - //console.log(this.props.ContainingCollectionView.props.) } @action @@ -230,17 +230,23 @@ export class DocumentView extends React.Component { } //adds doc to global list + @action componentDidMount: () => void = () => { - DocumentManager.Instance.DocumentViews.push(this); + runInAction(() => { + DocumentManager.Instance.DocumentViews.push(this); + }) } //removes doc from global list + @action componentWillUnmount: () => void = () => { - for (let node of DocumentManager.Instance.DocumentViews) { - if (Object.is(node, this)) { - DocumentManager.Instance.DocumentViews.splice(DocumentManager.Instance.DocumentViews.indexOf(this), 1); + runInAction(() => { + for (let node of DocumentManager.Instance.DocumentViews) { + if (Object.is(node, this)) { + DocumentManager.Instance.DocumentViews.splice(DocumentManager.Instance.DocumentViews.indexOf(this), 1); + } } - } + }) } isSelected = () => { return SelectionManager.IsSelected(this); @@ -278,6 +284,8 @@ export class DocumentView extends React.Component { bindings.BackgroundView = backgroundView; } + bindings.DocumentView = this; + var width = this.props.Document.GetNumber(KeyStore.NativeWidth, 0); var strwidth = width > 0 ? width.toString() + "px" : "100%"; var height = this.props.Document.GetNumber(KeyStore.NativeHeight, 0); -- cgit v1.2.3-70-g09d2 From 93c5e7c323113bf8beeb6207ba22fbbb4ab71796 Mon Sep 17 00:00:00 2001 From: Monika Hedman Date: Sun, 24 Feb 2019 17:03:19 -0500 Subject: Fixed stuff from the merge --- src/client/views/DocumentManager.tsx | 37 +++++++++++----------- src/client/views/collections/CollectionView.tsx | 2 +- .../views/collections/CollectionViewBase.tsx | 6 ++-- src/client/views/nodes/DocumentView.tsx | 6 ++-- 4 files changed, 27 insertions(+), 24 deletions(-) (limited to 'src/client/views/nodes') diff --git a/src/client/views/DocumentManager.tsx b/src/client/views/DocumentManager.tsx index ab54a7955..35064d830 100644 --- a/src/client/views/DocumentManager.tsx +++ b/src/client/views/DocumentManager.tsx @@ -4,8 +4,9 @@ import { observable, action } from 'mobx'; import { DocumentView } from './nodes/DocumentView'; import { Document } from "../../fields/Document" import { CollectionFreeFormView } from './collections/CollectionFreeFormView'; -import { KeyStore } from '../../fields/Key'; +import { KeyStore } from '../../fields/KeyStore'; import { CollectionViewBase } from './collections/CollectionViewBase'; +import { CollectionViewType, CollectionView } from './collections/CollectionView'; export class DocumentManager { @@ -60,7 +61,7 @@ export class DocumentManager { //gets document view that is in a freeform canvas collection DocumentManager.Instance.DocumentViews.map(view => { let doc = view.props.Document; - if (view.props.ContainingCollectionView instanceof CollectionFreeFormView) { + if (view.props.ContainingCollectionView && view.props.ContainingCollectionView.collectionViewType == CollectionViewType.Freeform) { if (Object.is(doc, toFind)) { toReturn = view; return; @@ -88,16 +89,13 @@ export class DocumentManager { let scale: number; let XView: number; let YView: number; - let width: number; - let height: number; //if the view exists in a freeform collection - if (docView && docView.MainContent.current) { - width = docView.MainContent.current.clientWidth - height = docView.MainContent.current.clientHeight + if (docView) { + let { width, height } = docView.size(); //base case: parent of parent does not exist - if (docView.props.ContainingCollectionView == null) { + if (!docView.props.ContainingCollectionView) { scale = docView.props.ScreenToLocalTransform().Scale let doc = docView.props.Document; @@ -105,34 +103,32 @@ export class DocumentManager { XView = (-doc.GetNumber(KeyStore.X, 0) * scale) + (window.innerWidth / 2) - (width * scale / 2) YView = (-doc.GetNumber(KeyStore.Y, 0) * scale) + (window.innerHeight / 2) - (height * scale / 2) //set x and y view of parent - if (docView instanceof CollectionFreeFormView) { + if (docView instanceof CollectionView) { DocumentManager.Instance.setViewportXY(docView, XView, YView) } } //parent is not main, parent is centered and calls itself else { - if (docView.props.ContainingCollectionView.props.ContainingDocumentView && docView.props.ContainingCollectionView.props.ContainingDocumentView.MainContent.current) { + if (true) { //view of parent - let tempCollectionView = docView.props.ContainingCollectionView.props.ContainingDocumentView + let { width: parentWidth, height: parentHeight } = docView.props.ContainingCollectionView.props.documentSize(); + let scale = docView.props.ContainingCollectionView.props.ScreenToLocalTransform().Scale; let doc = docView.props.Document - let parentWidth = docView.props.ContainingCollectionView.props.ContainingDocumentView.MainContent.current.clientWidth - let parentHeight = docView.props.ContainingCollectionView.props.ContainingDocumentView.MainContent.current.clientHeight //TODO: make sure to test if the parent view is a freeform view. if not, just skip to the next level - if (docView.props.ContainingCollectionView instanceof CollectionFreeFormView) { + if (docView.props.ContainingCollectionView.collectionViewType == CollectionViewType.Freeform) { //scale of parent - scale = tempCollectionView.props.ScreenToLocalTransform().Scale XView = (-doc.GetNumber(KeyStore.X, 0) * scale) + (parentWidth / 2) - (width * scale / 2); YView = (-doc.GetNumber(KeyStore.Y, 0) * scale) + (parentHeight / 2) - (height * scale / 2); // //node.Parent.setViewportXY(XView, YView); DocumentManager.Instance.setViewportXY(docView.props.ContainingCollectionView, XView, YView) - return DocumentManager.Instance.centerNode(docView.props.ContainingCollectionView.props.DocumentForCollection); + return DocumentManager.Instance.centerNode(docView.props.ContainingCollectionView.props.Document); } } else { - return DocumentManager.Instance.centerNode(docView.props.ContainingCollectionView.props.DocumentForCollection) + // return DocumentManager.Instance.centerNode(docView.props.ContainingCollectionView.props.Document) } } } @@ -143,9 +139,12 @@ export class DocumentManager { } @action - private setViewportXY(collection: CollectionFreeFormView, x: number, y: number) { + private setViewportXY(collection: CollectionView, x: number, y: number) { + if (collection.collectionViewType !== CollectionViewType.Freeform) { + return; + } console.log("viewport is setting") - let doc = collection.props.DocumentForCollection; + let doc = collection.props.Document; doc.SetNumber(KeyStore.PanX, x); doc.SetNumber(KeyStore.PanY, y); } diff --git a/src/client/views/collections/CollectionView.tsx b/src/client/views/collections/CollectionView.tsx index 90080ab43..7f1390ae2 100644 --- a/src/client/views/collections/CollectionView.tsx +++ b/src/client/views/collections/CollectionView.tsx @@ -28,7 +28,7 @@ export class CollectionView extends React.Component { public static LayoutString(fieldKey: string = "DataKey") { return ``; } public active = () => { diff --git a/src/client/views/collections/CollectionViewBase.tsx b/src/client/views/collections/CollectionViewBase.tsx index 0658c8af0..948472275 100644 --- a/src/client/views/collections/CollectionViewBase.tsx +++ b/src/client/views/collections/CollectionViewBase.tsx @@ -6,10 +6,11 @@ import { KeyStore } from "../../../fields/KeyStore"; import { Opt, FieldWaiting } from "../../../fields/Field"; import { undoBatch } from "../../util/UndoManager"; import { DragManager } from "../../util/DragManager"; -import { DocumentView } from "../nodes/DocumentView"; +import { DocumentView, JsxArgs } from "../nodes/DocumentView"; import { Documents, DocumentOptions } from "../../documents/Documents"; import { Key } from "../../../fields/Key"; import { Transform } from "../../util/Transform"; +import { CollectionView } from "./CollectionView"; export interface CollectionViewProps { fieldKey: Key; @@ -18,13 +19,14 @@ export interface CollectionViewProps { isSelected: () => boolean; isTopMost: boolean; select: (ctrlPressed: boolean) => void; + documentSize: () => { width: number, height: number }; bindings: any; } export interface SubCollectionViewProps extends CollectionViewProps { active: () => boolean; addDocument: (doc: Document) => void; removeDocument: (doc: Document) => boolean; - CollectionView: any; + CollectionView: CollectionView; } export class CollectionViewBase extends React.Component { diff --git a/src/client/views/nodes/DocumentView.tsx b/src/client/views/nodes/DocumentView.tsx index d8e2f3401..40cf8d9e2 100644 --- a/src/client/views/nodes/DocumentView.tsx +++ b/src/client/views/nodes/DocumentView.tsx @@ -21,6 +21,7 @@ import "./DocumentView.scss"; import React = require("react"); import { DocumentManager } from "../DocumentManager"; import { TextField } from "../../../fields/TextField"; +import { Utils } from "../../../Utils"; const JsxParser = require('react-jsx-parser').default;//TODO Why does this need to be imported like this? export interface DocumentViewProps { @@ -104,6 +105,7 @@ export class DocumentView extends React.Component { @computed get layoutFields(): Key[] { return this.props.Document.GetData(KeyStore.LayoutFields, ListField, new Array()); } screenRect = (): ClientRect | DOMRect => this._mainCont.current ? this._mainCont.current.getBoundingClientRect() : new DOMRect(); + size = (): { width: number, height: number } => this._mainCont.current ? { width: this._mainCont.current.clientWidth, height: this._mainCont.current.clientHeight } : { width: 0, height: 0 }; onPointerDown = (e: React.PointerEvent): void => { this._downX = e.clientX; @@ -182,7 +184,6 @@ export class DocumentView extends React.Component { //TODO Monika @action Center = (e: React.MouseEvent): void => { - DocumentManager.Instance.centerNode(this.props.Document) DocumentManager.Instance.centerNode(this) } @@ -261,7 +262,8 @@ export class DocumentView extends React.Component { this._documentBindings = { ...this.props, isSelected: this.isSelected, - select: this.select + select: this.select, + documentSize: this.size }; for (const key of this.layoutKeys) { this._documentBindings[key.Name + "Key"] = key; // this maps string values of the form Key to an actual key Kestore.keyname e.g, "DataKey" => KeyStore.Data -- cgit v1.2.3-70-g09d2 From efe5d9515c88f6e0963ae1c04545b7bbbd8beb55 Mon Sep 17 00:00:00 2001 From: madelinegr Date: Mon, 25 Feb 2019 17:51:40 -0500 Subject: fixed some of bugs caused by pulling from master --- src/client/documents/Documents.ts | 27 --------------------------- src/client/views/nodes/FieldView.tsx | 5 ----- src/client/views/nodes/WebBox.tsx | 8 ++++---- src/fields/WebField.ts | 15 ++++++++++++--- src/server/Message.ts | 2 +- 5 files changed, 17 insertions(+), 40 deletions(-) (limited to 'src/client/views/nodes') diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts index 398c6f1a2..5c73c6b87 100644 --- a/src/client/documents/Documents.ts +++ b/src/client/documents/Documents.ts @@ -7,17 +7,12 @@ import { ListField } from "../../fields/ListField"; import { FormattedTextBox } from "../views/nodes/FormattedTextBox"; import { ImageField } from "../../fields/ImageField"; import { ImageBox } from "../views/nodes/ImageBox"; -<<<<<<< HEAD import { WebField } from "../../fields/WebField"; import { WebBox } from "../views/nodes/WebBox"; import { CollectionFreeFormView } from "../views/collections/CollectionFreeFormView"; import { FieldId } from "../../fields/Field"; -======= import { CollectionView, CollectionViewType } from "../views/collections/CollectionView"; import { FieldView } from "../views/nodes/FieldView"; -import { HtmlField } from "../../fields/HtmlField"; -import { WebView } from "../views/nodes/WebView"; ->>>>>>> bb418216efa9cc2e191b970e4cbe5080f4fd2b87 export interface DocumentOptions { x?: number; @@ -88,28 +83,6 @@ export namespace Documents { return doc; } - let htmlProto: Document; - const htmlProtoId = "htmlProto"; - function GetHtmlPrototype(): Document { - if (!htmlProto) { - htmlProto = new Document(htmlProtoId); - htmlProto.Set(KeyStore.X, new NumberField(0)); - htmlProto.Set(KeyStore.Y, new NumberField(0)); - htmlProto.Set(KeyStore.Width, new NumberField(300)); - htmlProto.Set(KeyStore.Height, new NumberField(150)); - htmlProto.Set(KeyStore.Layout, new TextField(WebView.LayoutString())); - htmlProto.Set(KeyStore.LayoutKeys, new ListField([KeyStore.Data])); - } - return htmlProto; - } - - export function HtmlDocument(html: string, options: DocumentOptions = {}): Document { - let doc = GetHtmlPrototype().MakeDelegate(); - setupOptions(doc, options); - doc.Set(KeyStore.Data, new HtmlField(html)); - return doc; - } - let imageProto: Document; const imageProtoId = "imageProto"; function GetImagePrototype(): Document { diff --git a/src/client/views/nodes/FieldView.tsx b/src/client/views/nodes/FieldView.tsx index 368ad049d..978cfe196 100644 --- a/src/client/views/nodes/FieldView.tsx +++ b/src/client/views/nodes/FieldView.tsx @@ -11,13 +11,10 @@ import { WebField } from "../../../fields/WebField"; import { Key } from "../../../fields/Key"; import { FormattedTextBox } from "./FormattedTextBox"; import { ImageBox } from "./ImageBox"; -<<<<<<< HEAD import { WebBox } from "./WebBox"; import { DocumentView } from "./DocumentView"; -======= import { HtmlField } from "../../../fields/HtmlField"; import { WebView } from "./WebView"; ->>>>>>> bb418216efa9cc2e191b970e4cbe5080f4fd2b87 // // these properties get assigned through the render() method of the DocumentView when it creates this node. @@ -61,8 +58,6 @@ export class FieldView extends React.Component { } else if (field instanceof NumberField) { return

{field.Data}

- } else if (field instanceof HtmlField) { - return } else if (field != FieldWaiting) { return

{field.GetValue}

} else diff --git a/src/client/views/nodes/WebBox.tsx b/src/client/views/nodes/WebBox.tsx index b9d0853b9..4f774bae2 100644 --- a/src/client/views/nodes/WebBox.tsx +++ b/src/client/views/nodes/WebBox.tsx @@ -9,12 +9,12 @@ import { CollectionFreeFormDocumentView } from './CollectionFreeFormDocumentView import { FieldWaiting } from '../../../fields/Field'; import { observer } from "mobx-react" import { observable, action, spy } from 'mobx'; -import { KeyStore } from '../../../fields/Key'; +import { KeyStore } from '../../../fields/KeyStore'; @observer export class WebBox extends React.Component { - public static LayoutString() { return FieldView.LayoutString("WebBox"); } + public static LayoutString() { return FieldView.LayoutString(WebBox); } private _ref: React.RefObject; private _downX: number = 0; private _downY: number = 0; @@ -38,8 +38,7 @@ export class WebBox extends React.Component { onPointerDown = (e: React.PointerEvent): void => { if (Date.now() - this._lastTap < 300) { - if (e.buttons === 1 && this.props.DocumentViewForField instanceof CollectionFreeFormDocumentView && - SelectionManager.IsSelected(this.props.DocumentViewForField)) { + if (e.buttons === 1 && this.props.isSelected()) { e.stopPropagation(); this._downX = e.clientX; this._downY = e.clientY; @@ -50,6 +49,7 @@ export class WebBox extends React.Component { this._lastTap = Date.now(); } } + @action onPointerUp = (e: PointerEvent): void => { document.removeEventListener("pointerup", this.onPointerUp); diff --git a/src/fields/WebField.ts b/src/fields/WebField.ts index cd3519128..8f945d686 100644 --- a/src/fields/WebField.ts +++ b/src/fields/WebField.ts @@ -1,9 +1,10 @@ import { BasicField } from "./BasicField"; -import { Field } from "./Field"; +import { Field, FieldId } from "./Field"; +import { Types } from "../server/Message"; export class WebField extends BasicField { - constructor(data: URL | undefined = undefined) { - super(data == undefined ? new URL("https://crossorigin.me/" + "https://cs.brown.edu/") : data); + constructor(data: URL | undefined = undefined, id?: FieldId, save: boolean = true) { + super(data == undefined ? new URL("https://crossorigin.me/" + "https://cs.brown.edu/") : data, save, id); } toString(): string { @@ -18,4 +19,12 @@ export class WebField extends BasicField { return new WebField(this.Data); } + ToJson(): { type: Types, data: URL, _id: string } { + return { + type: Types.Web, + data: this.Data, + _id: this.Id + } + } + } \ No newline at end of file diff --git a/src/server/Message.ts b/src/server/Message.ts index 80fc9a80d..148e6e723 100644 --- a/src/server/Message.ts +++ b/src/server/Message.ts @@ -45,7 +45,7 @@ export class GetFieldArgs { } export enum Types { - Number, List, Key, Image, Document, Text, RichText, DocumentReference, Html + Number, List, Key, Image, Web, Document, Text, RichText, DocumentReference, Html } export class DocumentTransfer implements Transferable { -- cgit v1.2.3-70-g09d2 From 8772cc68e850653af72dbd9aced73d529900173b Mon Sep 17 00:00:00 2001 From: Eleanor Eng Date: Mon, 25 Feb 2019 18:24:46 -0500 Subject: No wrapping --- src/client/views/ContextMenu.scss | 21 +++++++++++++++------ .../views/collections/CollectionSchemaView.tsx | 11 ++++++++++- src/client/views/collections/CollectionViewBase.tsx | 11 ++++++++++- src/client/views/nodes/FormattedTextBox.tsx | 11 +++-------- src/client/views/nodes/ImageBox.tsx | 2 +- 5 files changed, 39 insertions(+), 17 deletions(-) (limited to 'src/client/views/nodes') diff --git a/src/client/views/ContextMenu.scss b/src/client/views/ContextMenu.scss index 2ac5d3b52..c810aef3e 100644 --- a/src/client/views/ContextMenu.scss +++ b/src/client/views/ContextMenu.scss @@ -4,14 +4,15 @@ z-index: 1000; box-shadow: #AAAAAA .2vw .2vw .4vw; flex-direction: column; //E + // border-radius: 20px; } .contextMenu-item { - width: 10vw; - height: 4vh; - background: #DDDDDD; + width: auto; //10vw + height: auto; //4vh + background: #F0F8FF; // background: #DDDDDD; display: flex; - justify-content: center; + justify-content: left; //center align-items: center; -webkit-touch-callout: none; -webkit-user-select: none; @@ -20,11 +21,17 @@ -ms-user-select: none; user-select: none; transition: all .1s; + border-width: .11px; + border-color: rgb(187, 186, 186); + border-bottom-style: solid; + border-top-style: none; + padding: 10px; + white-space: nowrap; } .contextMenu-item:hover { transition: all .1s; - background: #AAAAAA + background: #B0E0E6; // background: #AAAAAA } .contextMenu-description { @@ -34,5 +41,7 @@ } #mySearch { - font-size: 1.4vw; + font-size: 1.5vw; + border-left-style: none; + border-right-style: none; } \ No newline at end of file diff --git a/src/client/views/collections/CollectionSchemaView.tsx b/src/client/views/collections/CollectionSchemaView.tsx index 331c4f6fe..d924cb163 100644 --- a/src/client/views/collections/CollectionSchemaView.tsx +++ b/src/client/views/collections/CollectionSchemaView.tsx @@ -15,6 +15,7 @@ import { KeyStore as KS, Key } from "../../../fields/Key"; import { Document } from "../../../fields/Document"; import { Field } from "../../../fields/Field"; import { Transform } from "../../util/Transform"; +import { ContextMenu } from "../ContextMenu"; @observer export class CollectionSchemaView extends CollectionViewBase { @@ -98,6 +99,14 @@ export class CollectionSchemaView extends CollectionViewBase { } } + //REPLACE THIS WITH CAPABILITIES SPECIFIC TO THIS TYPE OF NODE + collectionCapability = (e: React.MouseEvent): void => { + } + + specificContextMenu = (e: React.MouseEvent): void => { + ContextMenu.Instance.addItem({ description: "Collection Capability", event: this.collectionCapability }); + } + render() { const { DocumentForCollection: Document, CollectionFieldKey: fieldKey } = this.props; const children = Document.GetList(fieldKey, []); @@ -116,7 +125,7 @@ export class CollectionSchemaView extends CollectionViewBase { content =
} return ( -
+
{ public static LayoutString(collectionType: string) { - return `<${collectionType} DocumentForCollection={Document} CollectionFieldKey={DataKey} ContainingDocumentView={DocumentView}/>`; + return `<${collectionType} onContextMenu={this.specificContextMenu} DocumentForCollection={Document} CollectionFieldKey={DataKey} ContainingDocumentView={DocumentView}/>`; } + + //REPLACE THIS WITH CAPABILITIES SPECIFIC TO THIS TYPE OF NODE + collectionCapability = (e: React.MouseEvent): void => { + } + + specificContextMenu = (e: React.MouseEvent): void => { + ContextMenu.Instance.addItem({ description: "Collection Capability", event: this.collectionCapability }); + } + @computed public get active(): boolean { var isSelected = (this.props.ContainingDocumentView instanceof CollectionFreeFormDocumentView && SelectionManager.IsSelected(this.props.ContainingDocumentView)); diff --git a/src/client/views/nodes/FormattedTextBox.tsx b/src/client/views/nodes/FormattedTextBox.tsx index 0fe6befda..23eca4e24 100644 --- a/src/client/views/nodes/FormattedTextBox.tsx +++ b/src/client/views/nodes/FormattedTextBox.tsx @@ -116,7 +116,7 @@ export class FormattedTextBox extends React.Component { } } - //REPLACE THIS WITH CAPABILITIES SPECIFC TO THIS TYPE OF NODE + //REPLACE THIS WITH CAPABILITIES SPECIFIC TO THIS TYPE OF NODE textCapability = (e: React.MouseEvent): void => { } @@ -125,12 +125,7 @@ export class FormattedTextBox extends React.Component { } render() { - return (
) + return (
) } } \ No newline at end of file diff --git a/src/client/views/nodes/ImageBox.tsx b/src/client/views/nodes/ImageBox.tsx index f363487c3..0f10ef0ef 100644 --- a/src/client/views/nodes/ImageBox.tsx +++ b/src/client/views/nodes/ImageBox.tsx @@ -82,7 +82,7 @@ export class ImageBox extends React.Component { } } - //REPLACE THIS WITH CAPABILITIES SPECIFC TO THIS TYPE OF NODE + //REPLACE THIS WITH CAPABILITIES SPECIFIC TO THIS TYPE OF NODE imageCapability = (e: React.MouseEvent): void => { } -- cgit v1.2.3-70-g09d2 From bd54526065428de2e931d7254776352199f6e55a Mon Sep 17 00:00:00 2001 From: bob Date: Tue, 26 Feb 2019 16:56:04 -0500 Subject: fixed shift-dragging!! --- src/client/util/DragManager.ts | 8 ++-- src/client/views/Main.tsx | 33 +++-------------- .../views/collections/CollectionDockingView.tsx | 43 ++++------------------ .../views/collections/CollectionSchemaView.tsx | 4 +- .../views/collections/CollectionTreeView.tsx | 2 +- src/client/views/nodes/DocumentView.tsx | 2 +- 6 files changed, 21 insertions(+), 71 deletions(-) (limited to 'src/client/views/nodes') diff --git a/src/client/util/DragManager.ts b/src/client/util/DragManager.ts index 8adadee0f..0d76d2640 100644 --- a/src/client/util/DragManager.ts +++ b/src/client/util/DragManager.ts @@ -3,14 +3,14 @@ import { CollectionDockingView } from "../views/collections/CollectionDockingVie import { Document } from "../../fields/Document" import { action } from "mobx"; -export function setupDrag(_reference: React.RefObject, _dragDocument: Document) { +export function setupDrag(_reference: React.RefObject, docFunc: () => Document) { let onRowMove = action((e: PointerEvent): void => { e.stopPropagation(); e.preventDefault(); document.removeEventListener("pointermove", onRowMove); document.removeEventListener('pointerup', onRowUp); - DragManager.StartDrag(_reference.current!, { document: _dragDocument }); + DragManager.StartDrag(_reference.current!, { document: docFunc() }); }); let onRowUp = action((e: PointerEvent): void => { document.removeEventListener("pointermove", onRowMove); @@ -20,10 +20,10 @@ export function setupDrag(_reference: React.RefObject, _dragDocu // if (this.props.isSelected() || this.props.isTopMost) { if (e.button == 0) { e.stopPropagation(); - e.preventDefault(); if (e.shiftKey) { - CollectionDockingView.Instance.StartOtherDrag(_reference.current!, _dragDocument); + CollectionDockingView.Instance.StartOtherDrag(docFunc(), e); } else { + e.preventDefault(); document.addEventListener("pointermove", onRowMove); document.addEventListener('pointerup', onRowUp); } diff --git a/src/client/views/Main.tsx b/src/client/views/Main.tsx index 17dda899d..7ef4b6132 100644 --- a/src/client/views/Main.tsx +++ b/src/client/views/Main.tsx @@ -15,9 +15,8 @@ import { ServerUtils } from '../../server/ServerUtil'; import { MessageStore, DocumentTransfer } from '../../server/Message'; import { Transform } from '../util/Transform'; import { CollectionDockingView } from './collections/CollectionDockingView'; -import { FieldWaiting } from '../../fields/Field'; import { UndoManager } from '../util/UndoManager'; -import { DragManager } from '../util/DragManager'; +import { setupDrag } from '../util/DragManager'; configure({ @@ -30,7 +29,6 @@ window.addEventListener("dragover", function (e) { e.preventDefault(); }, false) document.addEventListener("pointerdown", action(function (e: PointerEvent) { - console.log(ContextMenu); if (!ContextMenu.Instance.intersects(e.pageX, e.pageY)) { ContextMenu.Instance.clearItems() } @@ -98,28 +96,7 @@ Documents.initProtos(() => { let textRef = React.createRef(); let schemaRef = React.createRef(); let colRef = React.createRef(); - let curMoveListener: any = null - let onRowMove = (creator: any, dragRef: any) => action((e: PointerEvent): void => { - e.stopPropagation(); - e.preventDefault(); - document.removeEventListener("pointermove", curMoveListener); - document.removeEventListener('pointerup', onRowUp); - DragManager.StartDrag(dragRef.current!, { document: creator() }); - }); - let onRowUp = action((e: PointerEvent): void => { - document.removeEventListener("pointermove", curMoveListener); - document.removeEventListener('pointerup', onRowUp); - }); - let onRowDown = (creator: any, dragRef: any) => (e: React.PointerEvent) => { - if (e.shiftKey) { - CollectionDockingView.Instance.StartOtherDrag(dragRef.current!, creator()); - e.stopPropagation(); - } else { - document.addEventListener("pointermove", curMoveListener = onRowMove(creator, dragRef)); - document.addEventListener('pointerup', onRowUp); - } - } ReactDOM.render((
{
-
+
-
+
-
+
-
+
diff --git a/src/client/views/collections/CollectionDockingView.tsx b/src/client/views/collections/CollectionDockingView.tsx index 5fb632469..3d7e46a01 100644 --- a/src/client/views/collections/CollectionDockingView.tsx +++ b/src/client/views/collections/CollectionDockingView.tsx @@ -10,7 +10,6 @@ import { FieldId, Opt, Field } from "../../../fields/Field"; import { KeyStore } from "../../../fields/KeyStore"; import { Utils } from "../../../Utils"; import { Server } from "../../Server"; -import { DragManager } from "../../util/DragManager"; import { undoBatch } from "../../util/UndoManager"; import { DocumentView } from "../nodes/DocumentView"; import "./CollectionDockingView.scss"; @@ -34,10 +33,6 @@ export class CollectionDockingView extends React.Component(); private _fullScreen: any = null; @@ -47,28 +42,8 @@ export class CollectionDockingView extends React.Component { }, button: e.button }) } @action @@ -98,7 +73,7 @@ export class CollectionDockingView extends React.Component { - if (this._dragDiv) { - this._dragDiv.removeChild(this._dragElement); - this._dragParent!.removeChild(this._dragFakeElement!); - this._dragParent!.appendChild(this._dragElement!); - DragManager.Root().removeChild(this._dragDiv); - this._dragDiv = null; - } tab.closeElement.off('click') //unbind the current click handler .click(function () { tab.contentItem.remove(); diff --git a/src/client/views/collections/CollectionSchemaView.tsx b/src/client/views/collections/CollectionSchemaView.tsx index 106a5c4f5..03110a9c7 100644 --- a/src/client/views/collections/CollectionSchemaView.tsx +++ b/src/client/views/collections/CollectionSchemaView.tsx @@ -45,9 +45,9 @@ export class CollectionSchemaView extends CollectionViewBase { ) let reference = React.createRef(); - let onItemDown = setupDrag(reference, props.doc); + let onItemDown = setupDrag(reference, () => props.doc); return ( -
+
{ let field = props.doc.Get(props.fieldKey); diff --git a/src/client/views/collections/CollectionTreeView.tsx b/src/client/views/collections/CollectionTreeView.tsx index 64f4c0970..55c804337 100644 --- a/src/client/views/collections/CollectionTreeView.tsx +++ b/src/client/views/collections/CollectionTreeView.tsx @@ -33,7 +33,7 @@ class TreeView extends React.Component { var children = childDocument.GetT>(KeyStore.Data, ListField); let title = childDocument.GetT(KeyStore.Title, TextField); - let onItemDown = setupDrag(reference, childDocument); + let onItemDown = setupDrag(reference, () => childDocument); if (title && title != FieldWaiting) { let subView = !children || this.collapsed || children === FieldWaiting ? (null) : diff --git a/src/client/views/nodes/DocumentView.tsx b/src/client/views/nodes/DocumentView.tsx index c579b7142..feecde921 100644 --- a/src/client/views/nodes/DocumentView.tsx +++ b/src/client/views/nodes/DocumentView.tsx @@ -96,7 +96,7 @@ export class DocumentView extends React.Component { this._downX = e.clientX; this._downY = e.clientY; if (e.shiftKey && e.buttons === 1) { - CollectionDockingView.Instance.StartOtherDrag(this._mainCont.current!, this.props.Document); + CollectionDockingView.Instance.StartOtherDrag(this.props.Document, e); e.stopPropagation(); } else { this._contextMenuCanOpen = true; -- cgit v1.2.3-70-g09d2 From 183cff4ed4c4a5f20abcb7b56a9921c1f0a33089 Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Tue, 26 Feb 2019 19:27:34 -0500 Subject: removed WebView --- .../views/collections/CollectionFreeFormView.tsx | 5 ++--- src/client/views/nodes/DocumentView.tsx | 3 +-- src/client/views/nodes/FieldView.tsx | 5 ----- src/client/views/nodes/WebView.tsx | 20 -------------------- 4 files changed, 3 insertions(+), 30 deletions(-) delete mode 100644 src/client/views/nodes/WebView.tsx (limited to 'src/client/views/nodes') diff --git a/src/client/views/collections/CollectionFreeFormView.tsx b/src/client/views/collections/CollectionFreeFormView.tsx index c454d62b3..2edd5d953 100644 --- a/src/client/views/collections/CollectionFreeFormView.tsx +++ b/src/client/views/collections/CollectionFreeFormView.tsx @@ -13,7 +13,6 @@ import { CollectionSchemaView } from "../collections/CollectionSchemaView"; import { CollectionView } from "../collections/CollectionView"; import { CollectionFreeFormDocumentView } from "../nodes/CollectionFreeFormDocumentView"; import { DocumentView } from "../nodes/DocumentView"; -import { WebView } from "../nodes/WebView"; import { FormattedTextBox } from "../nodes/FormattedTextBox"; import { ImageBox } from "../nodes/ImageBox"; import { WebBox } from "../nodes/WebBox"; @@ -200,7 +199,7 @@ export class CollectionFreeFormView extends CollectionViewBase { get backgroundView() { return !this.backgroundLayout ? (null) : ( { @computed get mainContent() { var val = this.props.Document.Id; return { else if (field instanceof NumberField) { return

{field.Data}

} - else if (field instanceof WebField) { - return - } else if (field != FieldWaiting) { return

{JSON.stringify(field.GetValue())}

} diff --git a/src/client/views/nodes/WebView.tsx b/src/client/views/nodes/WebView.tsx deleted file mode 100644 index 5cc85eb28..000000000 --- a/src/client/views/nodes/WebView.tsx +++ /dev/null @@ -1,20 +0,0 @@ -import { FieldViewProps, FieldView } from "./FieldView"; -import { computed } from "mobx"; -import { observer } from "mobx-react"; -import { KeyStore } from "../../../fields/KeyStore"; -import React = require('react') -import { HtmlField } from "../../../fields/HtmlField"; - -@observer -export class WebView extends React.Component { - public static LayoutString(fieldStr: string = "DataKey") { return FieldView.LayoutString(WebView, fieldStr) } - - @computed - get html(): string { - return this.props.doc.GetData(KeyStore.Data, HtmlField, "" as string); - } - - render() { - return - } -} \ No newline at end of file -- cgit v1.2.3-70-g09d2 From a7dda508e0cb7b4262df19635e497bc90cccbd46 Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Tue, 26 Feb 2019 19:28:25 -0500 Subject: from last --- src/client/views/nodes/DocumentView.tsx | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) (limited to 'src/client/views/nodes') diff --git a/src/client/views/nodes/DocumentView.tsx b/src/client/views/nodes/DocumentView.tsx index 2355313c4..8e5a0d17e 100644 --- a/src/client/views/nodes/DocumentView.tsx +++ b/src/client/views/nodes/DocumentView.tsx @@ -195,7 +195,7 @@ export class DocumentView extends React.Component { @computed get mainContent() { var val = this.props.Document.Id; return Date: Tue, 26 Feb 2019 19:35:26 -0500 Subject: simplified WebBox. --- src/client/views/nodes/WebBox.tsx | 50 +++------------------------------------ src/fields/Document.ts | 5 ++++ 2 files changed, 8 insertions(+), 47 deletions(-) (limited to 'src/client/views/nodes') diff --git a/src/client/views/nodes/WebBox.tsx b/src/client/views/nodes/WebBox.tsx index 0a198f059..2ca8d49ce 100644 --- a/src/client/views/nodes/WebBox.tsx +++ b/src/client/views/nodes/WebBox.tsx @@ -4,63 +4,19 @@ import { WebField } from '../../../fields/WebField'; import { FieldViewProps, FieldView } from './FieldView'; import { FieldWaiting } from '../../../fields/Field'; import { observer } from "mobx-react" -import { observable, action, spy, computed } from 'mobx'; +import { computed } from 'mobx'; import { KeyStore } from '../../../fields/KeyStore'; -import { HtmlField } from "../../../fields/HtmlField"; @observer export class WebBox extends React.Component { public static LayoutString() { return FieldView.LayoutString(WebBox); } - private _ref: React.RefObject; - private _downX: number = 0; - private _downY: number = 0; - private _lastTap: number = 0; - @observable private _isOpen: boolean = false; constructor(props: FieldViewProps) { super(props); - - this._ref = React.createRef(); - this.state = { - isOpen: false, - }; - } - - componentDidMount() { - } - - componentWillUnmount() { - } - - onPointerDown = (e: React.PointerEvent): void => { - if (Date.now() - this._lastTap < 300) { - if (e.buttons === 1 && this.props.isSelected()) { - e.stopPropagation(); - this._downX = e.clientX; - this._downY = e.clientY; - document.removeEventListener("pointerup", this.onPointerUp); - document.addEventListener("pointerup", this.onPointerUp); - } - } else { - this._lastTap = Date.now(); - } - } - - @action - onPointerUp = (e: PointerEvent): void => { - document.removeEventListener("pointerup", this.onPointerUp); - if (Math.abs(e.clientX - this._downX) < 2 && Math.abs(e.clientY - this._downY) < 2) { - this._isOpen = true; - } - e.stopPropagation(); - } - - @computed - get html(): string { - return this.props.doc.GetData(KeyStore.Data, HtmlField, "" as string); } + @computed get html(): string { return this.props.doc.GetHtml(KeyStore.Data, ""); } render() { let field = this.props.doc.Get(this.props.fieldKey); @@ -75,7 +31,7 @@ export class WebBox extends React.Component {
; return ( -
+
{content}
) } diff --git a/src/fields/Document.ts b/src/fields/Document.ts index 6193ea56c..5b91de6ed 100644 --- a/src/fields/Document.ts +++ b/src/fields/Document.ts @@ -8,6 +8,7 @@ import { ListField } from "./ListField"; import { Server } from "../client/Server"; import { Types } from "../server/Message"; import { UndoManager } from "../client/util/UndoManager"; +import { HtmlField } from "./HtmlField"; export class Document extends Field { public fields: ObservableMap = new ObservableMap(); @@ -125,6 +126,10 @@ export class Document extends Field { return vval; } + GetHtml(key: Key, defaultVal: string): string { + return this.GetData(key, HtmlField, defaultVal); + } + GetNumber(key: Key, defaultVal: number): number { return this.GetData(key, NumberField, defaultVal); } -- cgit v1.2.3-70-g09d2 From 98ade639c6ffa6cc704cc310af506973d83e494b Mon Sep 17 00:00:00 2001 From: Monika Hedman Date: Tue, 26 Feb 2019 20:44:32 -0500 Subject: what is going ON --- src/client/views/DocumentManager.tsx | 267 ++++++++++++++------- src/client/views/Main.tsx | 4 +- src/client/views/TempTreeView.tsx | 5 +- .../views/collections/CollectionDockingView.tsx | 4 +- .../views/collections/CollectionFreeFormView.tsx | 10 +- .../views/collections/CollectionSchemaView.tsx | 4 +- src/client/views/collections/CollectionView.tsx | 2 +- .../views/collections/CollectionViewBase.tsx | 1 + src/client/views/nodes/DocumentView.tsx | 6 +- 9 files changed, 210 insertions(+), 93 deletions(-) (limited to 'src/client/views/nodes') diff --git a/src/client/views/DocumentManager.tsx b/src/client/views/DocumentManager.tsx index bd3c4abfd..750b7aecf 100644 --- a/src/client/views/DocumentManager.tsx +++ b/src/client/views/DocumentManager.tsx @@ -53,7 +53,27 @@ export class DocumentManager { return (toReturn); } - public getDocumentViewFreeform(toFind: Document): DocumentView | null { + // public getDocumentViewFreeform2(toFind: Document): DocumentView | null { + + // let toReturn: DocumentView | null; + // toReturn = null; + + // //gets document view that is in a freeform canvas collection + // DocumentManager.Instance.DocumentViews.map(view => { + // let doc = view.props.Document; + // if (view.props.ContainingCollectionView && view.props.ContainingCollectionView.collectionViewType == CollectionViewType.Freeform) { + // if (Object.is(doc, toFind)) { + // console.log("finding view") + // toReturn = view; + // return; + // } + // } + // }) + + // return (toReturn); + // } + + public getCollectionView(toFind: Document): DocumentView | null { let toReturn: DocumentView | null; toReturn = null; @@ -61,7 +81,8 @@ export class DocumentManager { //gets document view that is in a freeform canvas collection DocumentManager.Instance.DocumentViews.map(view => { let doc = view.props.Document; - if (view.props.ContainingCollectionView && view.props.ContainingCollectionView.collectionViewType == CollectionViewType.Freeform) { + if (view instanceof CollectionView) { + console.log("finding view") if (Object.is(doc, toFind)) { toReturn = view; return; @@ -72,113 +93,189 @@ export class DocumentManager { return (toReturn); } - @action - public centerNode2(doc: Document | DocumentView): any { - //console.log(doc.Title) - //gets document view that is in freeform collection - - let docView: DocumentView | null; - - if (doc instanceof Document) { - docView = DocumentManager.Instance.getDocumentViewFreeform(doc) - } - else { - docView = doc - } - - let scale: number; - let XView: number; - let YView: number; - - //if the view exists in a freeform collection - if (docView) { - let { width, height } = docView.size(); - - //base case: parent of parent does not exist - if (!docView.props.ContainingCollectionView) { - scale = docView.props.ScreenToLocalTransform().Scale - let doc = docView.props.Document; - console.log("hello") - XView = (-doc.GetNumber(KeyStore.X, 0) * scale) - (width * scale / 2) - YView = (-doc.GetNumber(KeyStore.Y, 0) * scale) - (height * scale / 2) - //set x and y view of parent - if (docView instanceof CollectionView) { - console.log("here") - DocumentManager.Instance.setViewportXY(docView, XView, YView) - } - } - //parent is not main, parent is centered and calls itself - else { - if (true) { - //view of parent - let scale = docView.props.ContainingCollectionView.props.Document.GetNumber(KeyStore.Scale, 1) - let doc = docView.props.Document - - //TODO: make sure to test if the parent view is a freeform view. if not, just skip to the next level - if (docView.props.ContainingCollectionView.collectionViewType == CollectionViewType.Freeform) { - //scale of parent - console.log("scale: " + scale) - XView = (-doc.GetNumber(KeyStore.X, 0) * scale) - (width * scale / 2); - YView = (-doc.GetNumber(KeyStore.Y, 0) * scale) - (height * scale / 2); - // //node.Parent.setViewportXY(XView, YView); - DocumentManager.Instance.setViewportXY(docView.props.ContainingCollectionView, XView, YView) - return DocumentManager.Instance.centerNode2(docView.props.ContainingCollectionView.props.Document) - } - else { return DocumentManager.Instance.centerNode2(docView.props.ContainingCollectionView.props.Document) } - } - else { - // return DocumentManager.Instance.centerNode2(docView.props.ContainingCollectionView.props.Document) - } - } - } - } + // @action + // public centerNode2(doc: Document | DocumentView): any { + // //console.log(doc.Title) + // //gets document view that is in freeform collection + + // let docView: DocumentView | null; + + // if (doc instanceof Document) { + // docView = DocumentManager.Instance.getDocumentViewFreeform(doc) + // } + // else { + // docView = doc + // } + + // let scale: number; + // let XView: number; + // let YView: number; + + // //if the view exists in a freeform collection + // if (docView) { + // let { width, height } = docView.size(); + + // //base case: parent of parent does not exist + // if (!docView.props.ContainingCollectionView) { + // scale = docView.props.ScreenToLocalTransform().Scale + // let doc = docView.props.Document; + // console.log("hello") + // XView = (-doc.GetNumber(KeyStore.X, 0) * scale) - (width * scale / 2) + // YView = (-doc.GetNumber(KeyStore.Y, 0) * scale) - (height * scale / 2) + // //set x and y view of parent + // if (docView instanceof CollectionView) { + // console.log("here") + // DocumentManager.Instance.setViewportXY(docView, XView, YView) + // } + // } + // //parent is not main, parent is centered and calls itself + // else { + // if (true) { + // //view of parent + // let scale = docView.props.ContainingCollectionView.props.Document.GetNumber(KeyStore.Scale, 1) + // let doc = docView.props.Document + + // //TODO: make sure to test if the parent view is a freeform view. if not, just skip to the next level + // if (docView.props.ContainingCollectionView.collectionViewType == CollectionViewType.Freeform) { + // //scale of parent + // console.log("scale: " + scale) + // XView = (-doc.GetNumber(KeyStore.X, 0) * scale) - (width * scale / 2); + // YView = (-doc.GetNumber(KeyStore.Y, 0) * scale) - (height * scale / 2); + // // //node.Parent.setViewportXY(XView, YView); + // DocumentManager.Instance.setViewportXY(docView.props.ContainingCollectionView, XView, YView) + // return DocumentManager.Instance.centerNode2(docView.props.ContainingCollectionView.props.Document) + // } + // else { return DocumentManager.Instance.centerNode2(docView.props.ContainingCollectionView.props.Document) } + // } + // else { + // // return DocumentManager.Instance.centerNode2(docView.props.ContainingCollectionView.props.Document) + // } + // } + // } + // } + + // @action + // public centerNode4(doc: Document | DocumentView): any { + // //console.log(doc.Title) + // //gets document view that is in freeform collection + + // console.log("things are happening") + + // let docView: DocumentView | null; + + // if (doc instanceof Document) { + // console.log(doc.Title) + // docView = DocumentManager.Instance.getDocumentViewFreeform(doc) + // } + // else { + // docView = doc + // console.log(docView.props.Document.Title) + // } + + // let scale: number; + // let XView: number; + // let YView: number; + + // //if the view exists in a freeform collection + // if (docView) { + // let { width, height } = docView.size(); + + // if (docView.props.ContainingCollectionView) { + // //view of parent + // let scale = docView.props.ContainingCollectionView.props.Document.GetNumber(KeyStore.Scale, 1) + // let doc = docView.props.Document + + // if (docView.props.ContainingCollectionView.collectionViewType == CollectionViewType.Freeform) { + // //scale of parent + // XView = (-doc.GetNumber(KeyStore.X, 0) * scale) - (width * scale / 2); + // YView = (-doc.GetNumber(KeyStore.Y, 0) * scale) - (height * scale / 2); + // DocumentManager.Instance.setViewportXY(docView.props.ContainingCollectionView, XView, YView) + // return DocumentManager.Instance.centerNode4(docView.props.ContainingCollectionView.props.Document) + // } + // else { return DocumentManager.Instance.centerNode4(docView.props.ContainingCollectionView.props.Document) } + // } + // } + // } @action - public centerNode(doc: Document | DocumentView): any { + public centerNode(doc: Document | DocumentView, x: number, y: number): any { //console.log(doc.Title) - //gets document view that is in freeform collection - + //gets document view that is in freeform collection let docView: DocumentView | null; if (doc instanceof Document) { - docView = DocumentManager.Instance.getDocumentViewFreeform(doc) + console.log(doc.Title) + docView = DocumentManager.Instance.getDocumentView(doc) } else { docView = doc + console.log(docView.props.Document.Title) } let scale: number; let XView: number; let YView: number; - //if the view exists in a freeform collection if (docView) { let { width, height } = docView.size(); + let scale = docView.props.Document.GetNumber(KeyStore.Scale, 1) + let doc = docView.props.Document - //parent is not main, parent is centered and calls itself - if (docView.props.ContainingCollectionView) { - //view of parent - let scale = docView.props.ContainingCollectionView.props.Document.GetNumber(KeyStore.Scale, 1) - let doc = docView.props.Document - - if (docView.props.ContainingCollectionView.collectionViewType == CollectionViewType.Freeform) { - //scale of parent - XView = (-doc.GetNumber(KeyStore.X, 0) * scale) - (width * scale / 2); - YView = (-doc.GetNumber(KeyStore.Y, 0) * scale) - (height * scale / 2); - DocumentManager.Instance.setViewportXY(docView.props.ContainingCollectionView, XView, YView) - return DocumentManager.Instance.centerNode(docView.props.ContainingCollectionView.props.Document) - } - else { return DocumentManager.Instance.centerNode(docView.props.ContainingCollectionView.props.Document) } + if (x && y) { + XView = (-x * scale) - (width * scale / 2); + YView = (-y * scale) - (height * scale / 2); + DocumentManager.Instance.setViewportXY(docView, XView, YView) } + } } + // @action + // public centerNode3(doc: Document | DocumentView): any { + // //console.log(doc.Title) + // //gets document view that is in freeform collection + + // let docView: DocumentView | null; + + // if (doc instanceof Document) { + // docView = DocumentManager.Instance.getDocumentViewFreeform(doc) + // } + // else { + // docView = doc + // } + + // let scale: number; + // let XView: number; + // let YView: number; + + // //if the view exists in a freeform collection + // if (docView) { + // let { width, height } = docView.size(); + + // //parent is not main, parent is centered and calls itself + // if (docView.props.ContainingCollectionView) { + // //view of parent + // let scale = docView.props.ContainingCollectionView.props.Document.GetNumber(KeyStore.Scale, 1) + // let doc = docView.props.Document + + // if (docView.props.ContainingCollectionView.collectionViewType == CollectionViewType.Freeform) { + // //scale of parent + // XView = doc.GetNumber(KeyStore.X, 0) - width / 2 + // YView = doc.GetNumber(KeyStore.Y, 0) - height / 2 + // // console.log("X location: " + XView) + // // console.log("Y location: " + YView) + // DocumentManager.Instance.setViewportXY(docView.props.ContainingCollectionView, XView, YView) + // return DocumentManager.Instance.centerNode3(docView.props.ContainingCollectionView.props.Document) + // } + // else { return DocumentManager.Instance.centerNode3(docView.props.ContainingCollectionView.props.Document) } + // } + // } + // } + @action - private setViewportXY(collection: CollectionView, x: number, y: number) { - if (collection.collectionViewType !== CollectionViewType.Freeform) { - return - } + private setViewportXY(collection: DocumentView, x: number, y: number) { + console.log("setting") let doc = collection.props.Document; doc.SetNumber(KeyStore.PanX, x); doc.SetNumber(KeyStore.PanY, y); diff --git a/src/client/views/Main.tsx b/src/client/views/Main.tsx index 64bcbc24f..da78dcfba 100644 --- a/src/client/views/Main.tsx +++ b/src/client/views/Main.tsx @@ -131,7 +131,9 @@ Documents.initProtos(() => { PanelWidth={() => 0} PanelHeight={() => 0} isTopMost={true} - ContainingCollectionView={undefined} /> + ContainingCollectionView={undefined} + focus={(doc, x, y) => { }} + /> diff --git a/src/client/views/TempTreeView.tsx b/src/client/views/TempTreeView.tsx index f852224e9..bd73ef887 100644 --- a/src/client/views/TempTreeView.tsx +++ b/src/client/views/TempTreeView.tsx @@ -5,6 +5,7 @@ import { Document } from "../../fields/Document"; import { ListField } from "../../fields/ListField"; import "./TempTreeView.scss" import { DocumentManager } from "./DocumentManager"; +import { KeyStore } from "../../fields/KeyStore"; @observer @@ -15,7 +16,9 @@ export class TempTreeView extends React.Component { let view = DocumentManager.Instance.getDocumentView(doc); if (view != null) { - DocumentManager.Instance.centerNode(view); + // DocumentManager.Instance.centerNode(view); + doc = view.props.Document + view.props.focus(doc, doc.GetNumber(KeyStore.X, 0), doc.GetNumber(KeyStore.Y, 0)) } } diff --git a/src/client/views/collections/CollectionDockingView.tsx b/src/client/views/collections/CollectionDockingView.tsx index 5393ac06e..9c1f1a56d 100644 --- a/src/client/views/collections/CollectionDockingView.tsx +++ b/src/client/views/collections/CollectionDockingView.tsx @@ -298,7 +298,9 @@ export class DockedFrameRenderer extends React.Component { PanelHeight={this._nativeHeight} ScreenToLocalTransform={this.ScreenToLocalTransform} isTopMost={true} - ContainingCollectionView={undefined} /> + ContainingCollectionView={undefined} + focus={(doc: Document, x: number, y: number) => { }} + />
return { this._panelWidth = r.entry.width; this._panelHeight = r.entry.height; })}> diff --git a/src/client/views/collections/CollectionFreeFormView.tsx b/src/client/views/collections/CollectionFreeFormView.tsx index ac14811a5..fe2fc42ad 100644 --- a/src/client/views/collections/CollectionFreeFormView.tsx +++ b/src/client/views/collections/CollectionFreeFormView.tsx @@ -21,6 +21,7 @@ import "./CollectionFreeFormView.scss"; import { COLLECTION_BORDER_WIDTH } from "./CollectionView"; import { CollectionViewBase } from "./CollectionViewBase"; import React = require("react"); +import { DocumentManager } from "../DocumentManager"; const JsxParser = require('react-jsx-parser').default;//TODO Why does this need to be imported like this? @observer @@ -191,7 +192,14 @@ export class CollectionFreeFormView extends CollectionViewBase { ContentScaling={this.noScaling} PanelWidth={doc.Width} PanelHeight={doc.Height} - ContainingCollectionView={this.props.CollectionView} />); + ContainingCollectionView={this.props.CollectionView} + focus={(doc: Document, x: number, y: number) => { + //set pan of colleciton freeform and then call parent + console.log("calling...") + DocumentManager.Instance.centerNode(doc, doc.GetNumber(KeyStore.X, 0), doc.GetNumber(KeyStore.Y, 0)) + this.props.focus(this.props.Document, doc.GetNumber(KeyStore.X, 0), doc.GetNumber(KeyStore.Y, 0)) + }} + />); }) } return null; diff --git a/src/client/views/collections/CollectionSchemaView.tsx b/src/client/views/collections/CollectionSchemaView.tsx index 38217d7c4..4eaf585ce 100644 --- a/src/client/views/collections/CollectionSchemaView.tsx +++ b/src/client/views/collections/CollectionSchemaView.tsx @@ -211,7 +211,9 @@ export class CollectionSchemaView extends CollectionViewBase { ContentScaling={this.getContentScaling} PanelWidth={this.getPanelWidth} PanelHeight={this.getPanelHeight} - ContainingCollectionView={this.props.CollectionView} /> + ContainingCollectionView={this.props.CollectionView} + focus={(doc, x, y) => this.props.focus(this.props.Document, x, y)} + />
} diff --git a/src/client/views/collections/CollectionView.tsx b/src/client/views/collections/CollectionView.tsx index 03e1f1fa4..e6a8d2448 100644 --- a/src/client/views/collections/CollectionView.tsx +++ b/src/client/views/collections/CollectionView.tsx @@ -30,7 +30,7 @@ export class CollectionView extends React.Component { public static LayoutString(fieldKey: string = "DataKey") { return ``; + isTopMost={isTopMost} BackgroundView={BackgroundView} focus={focus}/>`; } public active = () => { var isSelected = this.props.isSelected(); diff --git a/src/client/views/collections/CollectionViewBase.tsx b/src/client/views/collections/CollectionViewBase.tsx index e38258e0b..d9e43c0dc 100644 --- a/src/client/views/collections/CollectionViewBase.tsx +++ b/src/client/views/collections/CollectionViewBase.tsx @@ -23,6 +23,7 @@ export interface CollectionViewProps { bindings: any; panelWidth: () => number; panelHeight: () => number; + focus: (doc: Document, x: number, y: number) => void; } export interface SubCollectionViewProps extends CollectionViewProps { active: () => boolean; diff --git a/src/client/views/nodes/DocumentView.tsx b/src/client/views/nodes/DocumentView.tsx index 21f64ef35..90699cd2e 100644 --- a/src/client/views/nodes/DocumentView.tsx +++ b/src/client/views/nodes/DocumentView.tsx @@ -36,6 +36,7 @@ export interface DocumentViewProps { ContentScaling: () => number; PanelWidth: () => number; PanelHeight: () => number; + focus: (doc: Document, x: number, y: number) => void; } export interface JsxArgs extends DocumentViewProps { Keys: { [name: string]: Key } @@ -184,7 +185,7 @@ export class DocumentView extends React.Component { //TODO Monika @action Center = (e: React.MouseEvent): void => { - DocumentManager.Instance.centerNode(this) + this.props.focus(this.props.Document, this.props.Document.GetNumber(KeyStore.X, 0), this.props.Document.GetNumber(KeyStore.Y, 0)) } @action @@ -265,7 +266,8 @@ export class DocumentView extends React.Component { ...this.props, isSelected: this.isSelected, select: this.select, - documentSize: this.size + documentSize: this.size, + focus: this.props.focus }; for (const key of this.layoutKeys) { this._documentBindings[key.Name + "Key"] = key; // this maps string values of the form Key to an actual key Kestore.keyname e.g, "DataKey" => KeyStore.Data -- cgit v1.2.3-70-g09d2 From faccb013ad0265d1507e0b5c59cabb42aedbb88c Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Tue, 26 Feb 2019 23:54:07 -0500 Subject: fixed some drag problems. cleaned up Documents.ts --- src/client/documents/Documents.ts | 229 ++++++++++++-------------------- src/client/util/DragManager.ts | 8 +- src/client/views/nodes/DocumentView.tsx | 2 + 3 files changed, 95 insertions(+), 144 deletions(-) (limited to 'src/client/views/nodes') diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts index e5154737e..8b733507b 100644 --- a/src/client/documents/Documents.ts +++ b/src/client/documents/Documents.ts @@ -11,6 +11,8 @@ import { WebField } from "../../fields/WebField"; import { WebBox } from "../views/nodes/WebBox"; import { CollectionView, CollectionViewType } from "../views/collections/CollectionView"; import { HtmlField } from "../../fields/HtmlField"; +import { Key } from "../../fields/Key" +import { Field } from "../../fields/Field"; export interface DocumentOptions { x?: number; @@ -20,87 +22,110 @@ export interface DocumentOptions { nativeWidth?: number; nativeHeight?: number; title?: string; + panx?: number; + pany?: number; + scale?: number; + layout?: string; + layoutKeys?: Key[]; + viewType?: number; } export namespace Documents { + let textProto: Document; + let imageProto: Document; + let webProto: Document; + let collProto: Document; + const textProtoId = "textProto"; + const imageProtoId = "imageProto"; + const webProtoId = "webProto"; + const collProtoId = "collectionProto"; + export function initProtos(callback: () => void) { - Server.GetFields([collectionProtoId, textProtoId, imageProtoId], (fields) => { - collectionProto = fields[collectionProtoId] as Document; + Server.GetFields([collProtoId, textProtoId, imageProtoId], (fields) => { + collProto = fields[collProtoId] as Document; imageProto = fields[imageProtoId] as Document; textProto = fields[textProtoId] as Document; + webProto = fields[webProtoId] as Document; callback() }); } - - function setupOptions(doc: Document, options: DocumentOptions): void { - if (options.x !== undefined) { - doc.SetData(KeyStore.X, options.x, NumberField); - } - if (options.y !== undefined) { - doc.SetData(KeyStore.Y, options.y, NumberField); - } - if (options.width !== undefined) { - doc.SetData(KeyStore.Width, options.width, NumberField); - } - if (options.height !== undefined) { - doc.SetData(KeyStore.Height, options.height, NumberField); - } - if (options.nativeWidth !== undefined) { - doc.SetData(KeyStore.NativeWidth, options.nativeWidth, NumberField); - } - if (options.nativeHeight !== undefined) { - doc.SetData(KeyStore.NativeHeight, options.nativeHeight, NumberField); - } - if (options.title !== undefined) { - doc.SetData(KeyStore.Title, options.title, TextField); - } - doc.SetData(KeyStore.Scale, 1, NumberField); - doc.SetData(KeyStore.PanX, 0, NumberField); - doc.SetData(KeyStore.PanY, 0, NumberField); + function assignOptions(doc: Document, options: DocumentOptions): Document { + if (options.x !== undefined) { doc.SetNumber(KeyStore.X, options.x); } + if (options.y !== undefined) { doc.SetNumber(KeyStore.Y, options.y); } + if (options.width !== undefined) { doc.SetNumber(KeyStore.Width, options.width); } + if (options.height !== undefined) { doc.SetNumber(KeyStore.Height, options.height); } + if (options.nativeWidth !== undefined) { doc.SetNumber(KeyStore.NativeWidth, options.nativeWidth); } + if (options.nativeHeight !== undefined) { doc.SetNumber(KeyStore.NativeHeight, options.nativeHeight); } + if (options.title !== undefined) { doc.SetText(KeyStore.Title, options.title); } + if (options.panx !== undefined) { doc.SetNumber(KeyStore.PanX, options.panx); } + if (options.pany !== undefined) { doc.SetNumber(KeyStore.PanY, options.pany); } + if (options.scale !== undefined) { doc.SetNumber(KeyStore.Scale, options.scale); } + if (options.viewType !== undefined) { doc.SetNumber(KeyStore.ViewType, options.viewType); } + if (options.layout !== undefined) { doc.SetText(KeyStore.Layout, options.layout); } + if (options.layoutKeys !== undefined) { doc.Set(KeyStore.LayoutKeys, new ListField(options.layoutKeys)); } + return doc; } - - let textProto: Document; - const textProtoId = "textProto"; - function GetTextPrototype(): Document { - if (!textProto) { - textProto = new Document(textProtoId); - textProto.Set(KeyStore.X, new NumberField(0)); - textProto.Set(KeyStore.Y, new NumberField(0)); - textProto.Set(KeyStore.Width, new NumberField(300)); - textProto.Set(KeyStore.Height, new NumberField(150)); - textProto.Set(KeyStore.Layout, new TextField(FormattedTextBox.LayoutString())); - textProto.Set(KeyStore.LayoutKeys, new ListField([KeyStore.Data])); - } - return textProto; + function setupPrototypeOptions(protoId: string, title: string, layout: string, options: DocumentOptions): Document { + return assignOptions(new Document(protoId), { ...options, title: title, layout: layout }); } - - export function TextDocument(options: DocumentOptions = {}): Document { - let doc = GetTextPrototype().MakeDelegate(); - setupOptions(doc, options); - // doc.Set(KeyStore.Data, new RichTextField()); - return doc; + function SetInstanceOptions(doc: Document, options: DocumentOptions, value: T, ctor: { new(): U }, id?: string) { + var deleg = doc.MakeDelegate(id); + deleg.SetData(KeyStore.Data, value, ctor); + return assignOptions(deleg, options); } - let imageProto: Document; - const imageProtoId = "imageProto"; function GetImagePrototype(): Document { if (!imageProto) { - imageProto = new Document(imageProtoId); - imageProto.Set(KeyStore.Title, new TextField("IMAGE PROTO")); - imageProto.Set(KeyStore.X, new NumberField(0)); - imageProto.Set(KeyStore.Y, new NumberField(0)); - imageProto.Set(KeyStore.NativeWidth, new NumberField(300)); - imageProto.Set(KeyStore.Width, new NumberField(300)); - imageProto.Set(KeyStore.Layout, new TextField(CollectionView.LayoutString("AnnotationsKey"))); - imageProto.SetNumber(KeyStore.ViewType, CollectionViewType.Freeform) - imageProto.Set(KeyStore.BackgroundLayout, new TextField(ImageBox.LayoutString())); - // imageProto.Set(KeyStore.Layout, new TextField('
')); - imageProto.Set(KeyStore.LayoutKeys, new ListField([KeyStore.Data, KeyStore.Annotations])); - return imageProto; + imageProto = setupPrototypeOptions(imageProtoId, "IMAGE_PROTO", CollectionView.LayoutString("AnnotationsKey"), + { x: 0, y: 0, nativeWidth: 300, width: 300, layoutKeys: [KeyStore.Data, KeyStore.Annotations] }); + imageProto.SetText(KeyStore.BackgroundLayout, ImageBox.LayoutString()); } return imageProto; + } + function GetTextPrototype(): Document { + return textProto ? textProto : + textProto = setupPrototypeOptions(textProtoId, "TEXT_PROTO", FormattedTextBox.LayoutString(), + { x: 0, y: 0, width: 300, height: 150, layoutKeys: [KeyStore.Data] }); + } + function GetWebPrototype(): Document { + return webProto ? webProto : + webProto = setupPrototypeOptions(webProtoId, "WEB_PROTO", WebBox.LayoutString(), + { x: 0, y: 0, width: 300, height: 300, layoutKeys: [KeyStore.Data] }); + } + function GetCollectionPrototype(): Document { + return collProto ? collProto : + collProto = setupPrototypeOptions(collProtoId, "COLLECTION_PROTO", CollectionView.LayoutString("DataKey"), + { panx: 0, pany: 0, scale: 1, layoutKeys: [KeyStore.Data] }); + } + export function ImageDocument(url: string, options: DocumentOptions = {}) { + let doc = SetInstanceOptions(GetImagePrototype(), { ...options, layoutKeys: [KeyStore.Data, KeyStore.Annotations, KeyStore.Caption] }, + new URL(url), ImageField); + doc.SetText(KeyStore.Caption, "my caption..."); + doc.SetText(KeyStore.BackgroundLayout, EmbeddedCaption()); + doc.SetText(KeyStore.OverlayLayout, FixedCaption()); + return doc; + } + export function TextDocument(options: DocumentOptions = {}) { + return SetInstanceOptions(GetTextPrototype(), options, "", TextField); + } + export function WebDocument(url: string, options: DocumentOptions = {}) { + return SetInstanceOptions(GetWebPrototype(), options, new URL(url), WebField); + } + export function HtmlDocument(html: string, options: DocumentOptions = {}) { + return SetInstanceOptions(GetWebPrototype(), options, html, HtmlField); + } + export function FreeformDocument(documents: Array, options: DocumentOptions, id?: string) { + return SetInstanceOptions(GetCollectionPrototype(), { ...options, viewType: CollectionViewType.Freeform }, documents, ListField, id) } + export function SchemaDocument(documents: Array, options: DocumentOptions, id?: string) { + return SetInstanceOptions(GetCollectionPrototype(), { ...options, viewType: CollectionViewType.Schema }, documents, ListField, id) + } + export function DockDocument(config: string, options: DocumentOptions, id?: string) { + return SetInstanceOptions(GetCollectionPrototype(), { ...options, viewType: CollectionViewType.Docking }, config, TextField, id) + } + + // example of custom display string for an image that shows a caption. function EmbeddedCaption() { @@ -118,84 +143,4 @@ export namespace Documents { + FormattedTextBox.LayoutString("CaptionKey") + `
` }; - - export function ImageDocument(url: string, options: DocumentOptions = {}): Document { - let doc = GetImagePrototype().MakeDelegate(); - setupOptions(doc, options); - doc.Set(KeyStore.Data, new ImageField(new URL(url))); - doc.Set(KeyStore.Caption, new TextField("my caption...")); - doc.Set(KeyStore.BackgroundLayout, new TextField(EmbeddedCaption())); - doc.Set(KeyStore.OverlayLayout, new TextField(FixedCaption())); - doc.Set(KeyStore.LayoutKeys, new ListField([KeyStore.Data, KeyStore.Annotations, KeyStore.Caption])); - console.log("" + doc.GetNumber(KeyStore.Height, 311)); - return doc; - } - - let webProto: Document; - const webProtoId = "webProto"; - function GetWebPrototype(): Document { - if (!webProto) { - webProto = new Document(webProtoId); - webProto.Set(KeyStore.Title, new TextField("WEB PROTO")); - webProto.Set(KeyStore.X, new NumberField(0)); - webProto.Set(KeyStore.Y, new NumberField(0)); - webProto.Set(KeyStore.Width, new NumberField(300)); - webProto.Set(KeyStore.Height, new NumberField(300)); - //webProto.Set(KeyStore.Layout, new TextField(CollectionView.LayoutString("AnnotationsKey"))); - webProto.Set(KeyStore.Layout, new TextField(WebBox.LayoutString())); - webProto.Set(KeyStore.LayoutKeys, new ListField([KeyStore.Data, KeyStore.Annotations])); - } - return webProto; - } - - export function WebDocument(url: string, options: DocumentOptions = {}): Document { - let doc = GetWebPrototype().MakeDelegate(); - setupOptions(doc, options); - doc.Set(KeyStore.Data, new WebField(new URL(url))); - return doc; - } - export function HtmlDocument(html: string, options: DocumentOptions = {}): Document { - let doc = GetWebPrototype().MakeDelegate(); - setupOptions(doc, options); - doc.Set(KeyStore.Data, new HtmlField(html)); - return doc; - } - - let collectionProto: Document; - const collectionProtoId = "collectionProto"; - function GetCollectionPrototype(): Document { - if (!collectionProto) { - collectionProto = new Document(collectionProtoId); - collectionProto.Set(KeyStore.Scale, new NumberField(1)); - collectionProto.Set(KeyStore.PanX, new NumberField(0)); - collectionProto.Set(KeyStore.PanY, new NumberField(0)); - collectionProto.Set(KeyStore.Layout, new TextField(CollectionView.LayoutString("DataKey"))); - collectionProto.Set(KeyStore.LayoutKeys, new ListField([KeyStore.Data])); - } - return collectionProto; - } - - export function CollectionDocument(data: Array | string, viewType: CollectionViewType, options: DocumentOptions = {}, id?: string): Document { - let doc = GetCollectionPrototype().MakeDelegate(id); - setupOptions(doc, options); - if (typeof data === "string") { - doc.SetText(KeyStore.Data, data); - } else { - doc.SetData(KeyStore.Data, data, ListField); - } - doc.SetNumber(KeyStore.ViewType, viewType); - return doc; - } - - export function FreeformDocument(documents: Array, options: DocumentOptions, id?: string) { - return CollectionDocument(documents, CollectionViewType.Freeform, options, id) - } - - export function SchemaDocument(documents: Array, options: DocumentOptions, id?: string) { - return CollectionDocument(documents, CollectionViewType.Schema, options, id) - } - - export function DockDocument(config: string, options: DocumentOptions, id?: string) { - return CollectionDocument(config, CollectionViewType.Docking, options, id) - } } \ No newline at end of file diff --git a/src/client/util/DragManager.ts b/src/client/util/DragManager.ts index 6b4b8ca57..60910a40b 100644 --- a/src/client/util/DragManager.ts +++ b/src/client/util/DragManager.ts @@ -133,7 +133,6 @@ export namespace DragManager { if (hideSource) { ele.hidden = true; } - const moveHandler = (e: PointerEvent) => { e.stopPropagation(); e.preventDefault(); @@ -158,14 +157,19 @@ export namespace DragManager { } const upHandler = (e: PointerEvent) => { abortDrag(); - FinishDrag(dragElement, e, dragData, options); + FinishDrag(ele, e, dragData, options); }; document.addEventListener("pointermove", moveHandler, true); document.addEventListener("pointerup", upHandler); } function FinishDrag(dragEle: HTMLElement, e: PointerEvent, dragData: { [index: string]: any }, options?: DragOptions) { + let parent = dragEle.parentElement; + if (parent) + parent.removeChild(dragEle); const target = document.elementFromPoint(e.x, e.y); + if (parent) + parent.appendChild(dragEle); if (!target) { return; } diff --git a/src/client/views/nodes/DocumentView.tsx b/src/client/views/nodes/DocumentView.tsx index 8e5a0d17e..c929f9d54 100644 --- a/src/client/views/nodes/DocumentView.tsx +++ b/src/client/views/nodes/DocumentView.tsx @@ -119,6 +119,8 @@ export class DocumentView extends React.Component { return; } if (Math.abs(this._downX - e.clientX) > 3 || Math.abs(this._downY - e.clientY) > 3) { + document.removeEventListener("pointermove", this.onPointerMove) + document.removeEventListener("pointerup", this.onPointerUp) this._contextMenuCanOpen = false; if (this._mainCont.current != null && !this.topMost) { this._contextMenuCanOpen = false; -- cgit v1.2.3-70-g09d2 From 14d6495e4d4b9d38a37187a50ebeb84057abbc20 Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Tue, 26 Feb 2019 23:59:38 -0500 Subject: from last --- src/client/views/Main.tsx | 2 +- src/client/views/nodes/FieldView.tsx | 5 +++++ 2 files changed, 6 insertions(+), 1 deletion(-) (limited to 'src/client/views/nodes') diff --git a/src/client/views/Main.tsx b/src/client/views/Main.tsx index af4db521c..578aecd1e 100644 --- a/src/client/views/Main.tsx +++ b/src/client/views/Main.tsx @@ -85,7 +85,7 @@ Documents.initProtos(() => { width: 200, height: 200, title: "an image of a cat" })); let addWebNode = action(() => Documents.WebDocument("https://cs.brown.edu/courses/cs166/", { - width: 200, height: 200, title: "an image of a cat" + width: 200, height: 200, title: "a sample web page" })); let addClick = (creator: any) => action(() => { diff --git a/src/client/views/nodes/FieldView.tsx b/src/client/views/nodes/FieldView.tsx index f34574234..a883fa672 100644 --- a/src/client/views/nodes/FieldView.tsx +++ b/src/client/views/nodes/FieldView.tsx @@ -12,6 +12,7 @@ import { Key } from "../../../fields/Key"; import { FormattedTextBox } from "./FormattedTextBox"; import { ImageBox } from "./ImageBox"; import { WebBox } from "./WebBox"; +import { HtmlField } from "../../../fields/HtmlField"; // // these properties get assigned through the render() method of the DocumentView when it creates this node. @@ -53,6 +54,10 @@ export class FieldView extends React.Component { else if (field instanceof WebField) { return } + // bcz: this belongs here, but it doesn't render well so taking it out for now + // else if (field instanceof HtmlField) { + // return + // } else if (field instanceof NumberField) { return

{field.Data}

} -- cgit v1.2.3-70-g09d2 From f90b7ca17a9f45aa6c47f1d7a37d09af4d44d2ad Mon Sep 17 00:00:00 2001 From: madelinegr Date: Wed, 27 Feb 2019 00:38:39 -0500 Subject: kvp almost done --- .../views/collections/CollectionFreeFormView.tsx | 6 + src/client/views/collections/CollectionView.tsx | 2 + src/client/views/nodes/DocumentView.tsx | 16 +++ src/client/views/nodes/KeyValuePane.scss | 0 src/client/views/nodes/KeyValuePane.tsx | 124 +++++++++++++++++++++ 5 files changed, 148 insertions(+) create mode 100644 src/client/views/nodes/KeyValuePane.scss create mode 100644 src/client/views/nodes/KeyValuePane.tsx (limited to 'src/client/views/nodes') diff --git a/src/client/views/collections/CollectionFreeFormView.tsx b/src/client/views/collections/CollectionFreeFormView.tsx index 12909c151..ded1e3785 100644 --- a/src/client/views/collections/CollectionFreeFormView.tsx +++ b/src/client/views/collections/CollectionFreeFormView.tsx @@ -163,6 +163,11 @@ export class CollectionFreeFormView extends CollectionViewBase { }); } + @action + addKVP(doc: Document) { + let fields = doc.fields; + // aefawefwaef + } @computed get backgroundLayout(): string | undefined { let field = this.props.Document.GetT(KeyStore.BackgroundLayout, TextField); @@ -241,6 +246,7 @@ export class CollectionFreeFormView extends CollectionViewBase { {this.backgroundView} {this.views}
+