aboutsummaryrefslogtreecommitdiff
path: root/src/client/views
diff options
context:
space:
mode:
authormehekj <mehek.jethani@gmail.com>2021-07-31 15:39:27 -0400
committermehekj <mehek.jethani@gmail.com>2021-07-31 15:39:27 -0400
commit2e1f7c626306a054c036c91a98e5dabee3b39ef8 (patch)
tree9a08876f93ecffbcc5f2cbd31b0797289fb188d2 /src/client/views
parent11e95e35cde6e0c2390380975327f20eb5f3d1a4 (diff)
parent41ccf50f2b551edd6827c9fd6296b9ff87a65915 (diff)
Merge branch 'master' into temporalmedia-mehek
Diffstat (limited to 'src/client/views')
-rw-r--r--src/client/views/AntimodeMenu.scss4
-rw-r--r--src/client/views/DocumentButtonBar.scss15
-rw-r--r--src/client/views/DocumentButtonBar.tsx9
-rw-r--r--src/client/views/DocumentDecorations.scss4
-rw-r--r--src/client/views/LightboxView.scss30
-rw-r--r--src/client/views/LightboxView.tsx22
-rw-r--r--src/client/views/MainView.scss57
-rw-r--r--src/client/views/MainView.tsx76
-rw-r--r--src/client/views/MarqueeAnnotator.tsx10
-rw-r--r--src/client/views/PropertiesView.tsx2
-rw-r--r--src/client/views/SidebarAnnos.tsx2
-rw-r--r--src/client/views/StyleProvider.tsx3
-rw-r--r--src/client/views/_nodeModuleOverrides.scss51
-rw-r--r--src/client/views/collections/CollectionDockingView.scss100
-rw-r--r--src/client/views/collections/CollectionDockingView.tsx2
-rw-r--r--src/client/views/collections/CollectionLinearView.scss23
-rw-r--r--src/client/views/collections/CollectionLinearView.tsx10
-rw-r--r--src/client/views/collections/CollectionMenu.scss4
-rw-r--r--src/client/views/collections/CollectionMenu.tsx2
-rw-r--r--src/client/views/collections/CollectionSubView.tsx2
-rw-r--r--src/client/views/collections/CollectionTimeView.tsx2
-rw-r--r--src/client/views/collections/TabDocView.scss59
-rw-r--r--src/client/views/collections/TabDocView.tsx114
-rw-r--r--src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx14
-rw-r--r--src/client/views/collections/collectionFreeForm/MarqueeView.tsx7
-rw-r--r--src/client/views/collections/collectionSchema/CollectionSchemaCells.tsx21
-rw-r--r--src/client/views/global/globalCssVariables.scss9
-rw-r--r--src/client/views/global/globalEnums.tsx4
-rw-r--r--src/client/views/linking/LinkEditor.scss8
-rw-r--r--src/client/views/linking/LinkMenu.scss26
-rw-r--r--src/client/views/linking/LinkMenu.tsx8
-rw-r--r--src/client/views/linking/LinkMenuGroup.tsx2
-rw-r--r--src/client/views/linking/LinkMenuItem.scss8
-rw-r--r--src/client/views/linking/LinkPopup.scss45
-rw-r--r--src/client/views/linking/LinkPopup.tsx114
-rw-r--r--src/client/views/nodes/DocumentContentsView.tsx4
-rw-r--r--src/client/views/nodes/DocumentLinksButton.scss25
-rw-r--r--src/client/views/nodes/DocumentLinksButton.tsx94
-rw-r--r--src/client/views/nodes/DocumentView.scss2
-rw-r--r--src/client/views/nodes/DocumentView.tsx2
-rw-r--r--src/client/views/nodes/FontIconBox.tsx3
-rw-r--r--src/client/views/nodes/ImageBox.tsx2
-rw-r--r--src/client/views/nodes/WebBox.tsx3
-rw-r--r--src/client/views/nodes/formattedText/FormattedTextBox.tsx3
-rw-r--r--src/client/views/nodes/formattedText/RichTextMenu.tsx11
-rw-r--r--src/client/views/nodes/trails/PresBox.scss (renamed from src/client/views/nodes/PresBox.scss)6
-rw-r--r--src/client/views/nodes/trails/PresBox.tsx (renamed from src/client/views/nodes/PresBox.tsx)184
-rw-r--r--src/client/views/nodes/trails/PresElementBox.scss (renamed from src/client/views/presentationview/PresElementBox.scss)0
-rw-r--r--src/client/views/nodes/trails/PresElementBox.tsx (renamed from src/client/views/presentationview/PresElementBox.tsx)50
-rw-r--r--src/client/views/nodes/trails/PresEnums.ts28
-rw-r--r--src/client/views/nodes/trails/index.ts3
-rw-r--r--src/client/views/pdf/AnchorMenu.tsx18
-rw-r--r--src/client/views/pdf/PDFViewer.tsx3
-rw-r--r--src/client/views/topbar/TopBar.scss213
-rw-r--r--src/client/views/topbar/TopBar.tsx67
55 files changed, 1139 insertions, 451 deletions
diff --git a/src/client/views/AntimodeMenu.scss b/src/client/views/AntimodeMenu.scss
index 2bac03af4..8a0e5480e 100644
--- a/src/client/views/AntimodeMenu.scss
+++ b/src/client/views/AntimodeMenu.scss
@@ -6,9 +6,9 @@
z-index: 10001;
height: $antimodemenu-height;
background: $dark-gray;
- box-shadow: 3px 3px 3px rgba(0, 0, 0, 0.25);
+ border-bottom: $standard-border;
+ // box-shadow: 3px 3px 3px rgba(0, 0, 0, 0.25);
// border-radius: 0px 6px 6px 6px;
- z-index: 1001;
display: flex;
&.with-rows {
diff --git a/src/client/views/DocumentButtonBar.scss b/src/client/views/DocumentButtonBar.scss
index 2a0b494f5..157f3a4f2 100644
--- a/src/client/views/DocumentButtonBar.scss
+++ b/src/client/views/DocumentButtonBar.scss
@@ -44,18 +44,19 @@ $linkGap : 3px;
}
.documentButtonBar {
- margin-top: $linkGap;
- grid-column: 1/4;
- width: max-content;
- height: auto;
display: flex;
flex-direction: row;
+ gap: 3px;
}
.documentButtonBar-button {
- pointer-events: auto;
- padding-right: 5px;
- width: 25px;
+ cursor: pointer;
+ display: flex;
+ width: 30px;
+ height: 30px;
+ align-content: center;
+ justify-content: center;
+ align-items: center;
}
.documentButtonBar-linker {
diff --git a/src/client/views/DocumentButtonBar.tsx b/src/client/views/DocumentButtonBar.tsx
index a5d80cd22..1e5380971 100644
--- a/src/client/views/DocumentButtonBar.tsx
+++ b/src/client/views/DocumentButtonBar.tsx
@@ -3,7 +3,7 @@ import { FontAwesomeIcon } from "@fortawesome/react-fontawesome";
import { Tooltip } from '@material-ui/core';
import { action, computed, observable, runInAction } from "mobx";
import { observer } from "mobx-react";
-import { Doc } from "../../fields/Doc";
+import { Doc, DocCastAsync } from "../../fields/Doc";
import { RichTextField } from '../../fields/RichTextField';
import { Cast, NumCast, StrCast } from "../../fields/Types";
import { emptyFunction, setupMoveUpEvents, simulateMouseClick } from "../../Utils";
@@ -24,7 +24,7 @@ import { DocumentView } from './nodes/DocumentView';
import { GoogleRef } from "./nodes/formattedText/FormattedTextBox";
import { TemplateMenu } from "./TemplateMenu";
import React = require("react");
-import { PresBox } from './nodes/PresBox';
+import { PresBox } from './nodes/trails/PresBox';
import { undoBatch } from '../util/UndoManager';
import { CollectionViewType } from './collections/CollectionView';
const higflyout = require("@hig/flyout");
@@ -348,16 +348,17 @@ export class DocumentButtonBar extends React.Component<{ views: () => (DocumentV
if (!this.view0) return (null);
const isText = this.view0.props.Document[this.view0.LayoutFieldKey] instanceof RichTextField;
+ const doc = this.view0?.props.Document;
const considerPull = isText && this.considerGoogleDocsPull;
const considerPush = isText && this.considerGoogleDocsPush;
return <div className="documentButtonBar">
<div className="documentButtonBar-button">
<DocumentLinksButton View={this.view0} AlwaysOn={true} InMenu={true} StartLink={true} />
</div>
- {DocumentLinksButton.StartLink || !Doc.UserDoc()["documentLinksButton-fullMenu"] ? <div className="documentButtonBar-button">
+ {(DocumentLinksButton.StartLink || Doc.UserDoc()["documentLinksButton-fullMenu"]) && DocumentLinksButton.StartLink != doc ? <div className="documentButtonBar-button">
<DocumentLinksButton View={this.view0} AlwaysOn={true} InMenu={true} StartLink={false} />
</div> : (null)}
- {!Doc.UserDoc()["documentLinksButton-fullMenu"] ? (null) : <div className="documentButtonBar-button">
+ {/*!Doc.UserDoc()["documentLinksButton-fullMenu"] ? (null) : <div className="documentButtonBar-button">
{this.templateButton}
</div>
/*<div className="documentButtonBar-button">
diff --git a/src/client/views/DocumentDecorations.scss b/src/client/views/DocumentDecorations.scss
index 1715f35e7..952d8d150 100644
--- a/src/client/views/DocumentDecorations.scss
+++ b/src/client/views/DocumentDecorations.scss
@@ -263,7 +263,6 @@ $linkGap : 3px;
}
.link-button-container {
- padding: $linkGap;
border-radius: 10px;
width: max-content;
height: auto;
@@ -271,6 +270,9 @@ $linkGap : 3px;
flex-direction: row;
z-index: 998;
position: absolute;
+ justify-content: center;
+ align-items: center;
+ gap: 5px;
background: $medium-gray;
}
diff --git a/src/client/views/LightboxView.scss b/src/client/views/LightboxView.scss
index 4ea2dc2d6..5d42cd97f 100644
--- a/src/client/views/LightboxView.scss
+++ b/src/client/views/LightboxView.scss
@@ -1,3 +1,32 @@
+
+ .lightboxView-navBtn {
+ margin: auto;
+ position: absolute;
+ right: 10;
+ top: 10;
+ background: transparent;
+ border-radius: 8;
+ color:white;
+ opacity: 0.7;
+ width: 35;
+ &:hover {
+ opacity: 1;
+ }
+ }
+ .lightboxView-tabBtn {
+ margin: auto;
+ position: absolute;
+ right: 35;
+ top: 10;
+ background: transparent;
+ border-radius: 8;
+ color:white;
+ opacity: 0.7;
+ width: 35;
+ &:hover {
+ opacity: 1;
+ }
+ }
.lightboxView-frame {
position: absolute;
top: 0; left: 0;
@@ -15,7 +44,6 @@
position: relative;
background: transparent;
border-radius: 8;
- color:white;
opacity: 0.7;
width: 35;
&:hover {
diff --git a/src/client/views/LightboxView.tsx b/src/client/views/LightboxView.tsx
index ce36d9182..88739fe91 100644
--- a/src/client/views/LightboxView.tsx
+++ b/src/client/views/LightboxView.tsx
@@ -1,19 +1,20 @@
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome';
-import { action, computed, observable, trace } from 'mobx';
+import { action, computed, observable } from 'mobx';
import { observer } from 'mobx-react';
import "normalize.css";
import * as React from 'react';
import { Doc, DocListCast, Opt } from '../../fields/Doc';
import { Cast, NumCast, StrCast } from '../../fields/Types';
-import { emptyFunction, returnEmptyDoclist, returnEmptyFilter, returnTrue, returnFalse } from '../../Utils';
+import { emptyFunction, returnEmptyDoclist, returnEmptyFilter, returnFalse, returnTrue } from '../../Utils';
import { DocUtils } from '../documents/Documents';
import { DocumentManager } from '../util/DocumentManager';
import { LinkManager } from '../util/LinkManager';
import { SelectionManager } from '../util/SelectionManager';
import { Transform } from '../util/Transform';
+import { CollectionDockingView } from './collections/CollectionDockingView';
import { TabDocView } from './collections/TabDocView';
import "./LightboxView.scss";
-import { DocumentView, ViewAdjustment } from './nodes/DocumentView';
+import { DocumentView } from './nodes/DocumentView';
import { DefaultStyleProvider, wavyBorderPath } from './StyleProvider';
interface LightboxViewProps {
@@ -160,7 +161,7 @@ export class LightboxView extends React.Component<LightboxViewProps> {
const { doc, target } = LightboxView._history?.lastElement();
const docView = DocumentManager.Instance.getLightboxDocumentView(target || doc);
if (docView) {
- LightboxView._docTarget = undefined;
+ LightboxView._docTarget = target;
const focusSpeed = 1000;
doc._viewTransition = `transform ${focusSpeed}ms`;
if (!target) docView.ComponentView?.shrinkWrap?.();
@@ -197,7 +198,6 @@ export class LightboxView extends React.Component<LightboxViewProps> {
TabDocView.PinDoc(coll, { hidePresBox: true });
}
}
- setTimeout(LightboxView.Next);
}
future = () => LightboxView._future;
@@ -228,7 +228,6 @@ export class LightboxView extends React.Component<LightboxViewProps> {
const targetView = target && DocumentManager.Instance.getLightboxDocumentView(target);
if (doc === r.props.Document && (!target || target === doc)) r.ComponentView?.shrinkWrap?.();
else target && targetView?.focus(target, { willZoom: true, scale: 0.9, instant: true });
- LightboxView._docTarget = undefined;
}));
})}
Document={LightboxView.LightboxDoc}
@@ -270,7 +269,16 @@ export class LightboxView extends React.Component<LightboxViewProps> {
LightboxView.Next();
})}
<LightboxTourBtn navBtn={this.navBtn} future={this.future} stepInto={this.stepInto} tourMap={this.tourMap} />
- <div className="lightboxView-navBtn" title={"toggle fit width"} style={{ position: "absolute", right: 10, top: 10, color: "white" }}
+ <div className="lightboxView-tabBtn" title={"open in tab"}
+ onClick={e => {
+ e.stopPropagation();
+ CollectionDockingView.AddSplit(LightboxView._docTarget || LightboxView._doc!, "onRight");
+ SelectionManager.DeselectAll();
+ LightboxView.SetLightboxDoc(undefined);
+ }}>
+ <FontAwesomeIcon icon={"file-download"} size="2x" />
+ </div>
+ <div className="lightboxView-navBtn" title={"toggle fit width"}
onClick={e => { e.stopPropagation(); LightboxView.LightboxDoc!._fitWidth = !LightboxView.LightboxDoc!._fitWidth; }}>
<FontAwesomeIcon icon={"arrows-alt-h"} size="2x" />
</div>
diff --git a/src/client/views/MainView.scss b/src/client/views/MainView.scss
index 07ca0257c..d913f2069 100644
--- a/src/client/views/MainView.scss
+++ b/src/client/views/MainView.scss
@@ -22,10 +22,6 @@
height: 100%;
}
-.mainContent-div-flyout {
- left: calc(-1 * var(--flyoutHandleWidth));
-}
-
// add nodes menu. Note that the + button is actually an input label, not an actual button.
.mainView-docButtons {
position: absolute;
@@ -111,6 +107,14 @@
user-select: none;
}
+.properties-container {
+ height: 100%;
+ position: relative;
+ left: 100%;
+ top: calc(-100% - 36px);
+ z-index: 3000;
+}
+
.mainView-propertiesDragger {
//background-color: rgb(140, 139, 139);
background-color: $light-gray;
@@ -118,7 +122,6 @@
width: 17px;
position: absolute;
top: 50%;
- border: 1px black solid;
border-radius: 0;
border-top-left-radius: 10px;
border-bottom-left-radius: 10px;
@@ -141,18 +144,6 @@
}
}
-.mainiView-propertiesView {
- display: flex;
- flex-direction: column;
- height: 100%;
- position: absolute;
- right: 0;
- top: 0;
- border-left: solid 1px;
- z-index: 100000;
- cursor: auto;
-}
-
.mainView-innerContent, .mainView-innerContent-dark {
display: contents;
flex-direction: row;
@@ -171,10 +162,10 @@
}
.propertiesView {
- right: 0;
+ left: 0;
position: absolute;
z-index: 2;
- background-color: $medium-gray;
+ background-color: $light-gray;
.editable-title {
background-color: $light-gray;
}
@@ -220,6 +211,7 @@
.mainView-menuPanel {
min-width: var(--menuPanelWidth);
background-color: $dark-gray;
+ border-right: $standard-border;
.collectionStackingView {
scrollbar-width: none;
@@ -419,31 +411,4 @@
display: block;
width: 500px;
height: 1000px;
-}
-
-.lm_drag_tab {
- padding: 0;
- width: 15px !important;
- height: 15px !important;
- position: relative !important;
- display: inline-flex !important;
- align-items: center;
- top: 0 !important;
- right: unset !important;
- left: 0 !important;
-}
-.lm_close_tab {
- padding: 0;
- width: 15px !important;
- height: 15px !important;
- position: relative !important;
- display: inline-flex !important;
- align-items: center;
- top: 0 !important;
- right: unset !important;
- left: 0 !important;
-}
-.lm_tab, .lm_tab_active {
- display: flex !important;
- padding-right: 0 !important;
} \ No newline at end of file
diff --git a/src/client/views/MainView.tsx b/src/client/views/MainView.tsx
index f34851b00..49f4f7a6e 100644
--- a/src/client/views/MainView.tsx
+++ b/src/client/views/MainView.tsx
@@ -63,6 +63,8 @@ import { PreviewCursor } from './PreviewCursor';
import { PropertiesView } from './PropertiesView';
import { SearchBox } from './search/SearchBox';
import { DefaultStyleProvider, DashboardStyleProvider, StyleProp } from './StyleProvider';
+import { TopBar } from './topbar/TopBar';
+import { Colors } from './global/globalEnums';
const _global = (window /* browser */ || global /* node */) as any;
@observer
@@ -78,7 +80,7 @@ export class MainView extends React.Component {
@observable private _sidebarContent: any = this.userDoc?.sidebar;
@observable private _flyoutWidth: number = 0;
- @computed private get topOffset() { return (CollectionMenu.Instance?.Pinned ? 35 : 0) + Number(SEARCH_PANEL_HEIGHT.replace("px", "")); }
+ @computed private get topOffset() { return Number(SEARCH_PANEL_HEIGHT.replace("px", "")); } //TODO remove
@computed private get leftOffset() { return this.menuPanelWidth() - 2; }
@computed private get userDoc() { return Doc.UserDoc(); }
@computed private get darkScheme() { return BoolCast(CurrentUserUtils.ActiveDashboard?.darkScheme); }
@@ -178,12 +180,12 @@ export class MainView extends React.Component {
const targets = document.elementsFromPoint(e.x, e.y);
if (targets.length) {
const targClass = targets[0].className.toString();
- if (SearchBox.Instance._searchbarOpen || SearchBox.Instance.open) {
- const check = targets.some((thing) =>
- (thing.className === "collectionSchemaView-searchContainer" || (thing as any)?.dataset.icon === "filter" ||
- thing.className === "collectionSchema-header-menuOptions"));
- !check && SearchBox.Instance.resetSearch(true);
- }
+ // if (SearchBox.Instance._searchbarOpen || SearchBox.Instance.open) {
+ // const check = targets.some((thing) =>
+ // (thing.className === "collectionSchemaView-searchContainer" || (thing as any)?.dataset.icon === "filter" ||
+ // thing.className === "collectionSchema-header-menuOptions"));
+ // !check && SearchBox.Instance.resetSearch(true);
+ // }
!targClass.includes("contextMenu") && ContextMenu.Instance.closeMenu();
!["timeline-menu-desc", "timeline-menu-item", "timeline-menu-input"].includes(targClass) && TimelineMenu.Instance.closeMenu();
}
@@ -192,7 +194,7 @@ export class MainView extends React.Component {
initEventListeners = () => {
window.addEventListener("drop", e => e.preventDefault(), false); // prevent default behavior of navigating to a new web page
window.addEventListener("dragover", e => e.preventDefault(), false);
- document.addEventListener("pointermove", action(e => SearchBox.Instance._undoBackground = UndoManager.batchCounter ? "#000000a8" : undefined));
+ // document.addEventListener("pointermove", action(e => SearchBox.Instance._undoBackground = UndoManager.batchCounter ? "#000000a8" : undefined));
document.addEventListener("pointerdown", this.globalPointerDown);
document.addEventListener("click", (e: MouseEvent) => {
if (!e.cancelBubble) {
@@ -242,8 +244,9 @@ export class MainView extends React.Component {
}
getPWidth = () => this._panelWidth - this.propertiesWidth();
- getPHeight = () => this._panelHeight;
+ getPHeight = () => this._panelHeight - (CollectionMenu.Instance?.Pinned ? 35 : 0);
getContentsHeight = () => this._panelHeight;
+ getMenuPanelHeight = () => this._panelHeight + (CollectionMenu.Instance?.Pinned ? 35 : 0);
@computed get mainDocView() {
return <DocumentView key="main"
@@ -275,10 +278,12 @@ export class MainView extends React.Component {
@computed get dockingContent() {
return <div key="docking" className={`mainContent-div${this._flyoutWidth ? "-flyout" : ""}`} onDrop={e => { e.stopPropagation(); e.preventDefault(); }}
+ // style={{ minWidth: `calc(100% - ${this._flyoutWidth + this.menuPanelWidth() + this.propertiesWidth()}px)`, width: `calc(100% - ${this._flyoutWidth + this.propertiesWidth()}px)` }}>
+ // FIXME update with property panel width
style={{
minWidth: `calc(100% - ${this._flyoutWidth + this.menuPanelWidth() + this.propertiesWidth()}px)`,
transform: LightboxView.LightboxDoc ? "scale(0.0001)" : undefined,
- width: `calc(100% - ${this._flyoutWidth + this.menuPanelWidth() + this.propertiesWidth()}px)`
+ //TODO:glr width: `calc(100% - ${this._flyoutWidth + this.menuPanelWidth() + this.propertiesWidth()}px)`
}}>
{!this.mainContainer ? (null) : this.mainDocView}
</div>;
@@ -358,7 +363,7 @@ export class MainView extends React.Component {
removeDocument={returnFalse}
ScreenToLocalTransform={this.sidebarScreenToLocal}
PanelWidth={this.menuPanelWidth}
- PanelHeight={this.getContentsHeight}
+ PanelHeight={this.getMenuPanelHeight}
renderDepth={0}
docViewPath={returnEmptyDoclist}
focus={DocUtils.DefaultFocus}
@@ -401,20 +406,27 @@ export class MainView extends React.Component {
}
@computed get mainInnerContent() {
+ const width = this.propertiesWidth() + this._flyoutWidth + this.menuPanelWidth();
+ const transform = this._flyoutWidth ? 'translate(-28px, 0px)' : undefined;
return <>
{this.menuPanel}
<div key="inner" className={`mainView-innerContent${this.darkScheme ? "-dark" : ""}`}>
{this.flyout}
- <div className="mainView-libraryHandle" style={{ display: !this._flyoutWidth ? "none" : undefined, }} onPointerDown={this.onFlyoutPointerDown} >
+ <div className="mainView-libraryHandle" style={{ display: !this._flyoutWidth ? "none" : undefined }} onPointerDown={this.onFlyoutPointerDown} >
<FontAwesomeIcon icon="chevron-left" color={this.darkScheme ? "white" : "black"} style={{ opacity: "50%" }} size="sm" />
</div>
+ <div className="mainView-innerContainer" style={{ width: `calc(100% - ${width}px)`, transform: transform }}>
+ <CollectionMenu />
- {this.dockingContent}
+ {this.dockingContent}
- <div className="mainView-propertiesDragger" key="props" onPointerDown={this.onPropertiesPointerDown} style={{ right: this.propertiesWidth() - 1 }}>
- <FontAwesomeIcon icon={this.propertiesWidth() < 10 ? "chevron-left" : "chevron-right"} color={this.darkScheme ? "white" : "black"} size="sm" />
+ <div className="mainView-propertiesDragger" key="props" onPointerDown={this.onPropertiesPointerDown} style={{ right: this._flyoutWidth ? 0 : this.propertiesWidth() - 1 }}>
+ <FontAwesomeIcon icon={this.propertiesWidth() < 10 ? "chevron-left" : "chevron-right"} color={this.darkScheme ? Colors.WHITE : Colors.BLACK} size="sm" />
+ </div>
+ <div className="properties-container">
+ {this.propertiesWidth() < 10 ? (null) : <PropertiesView styleProvider={DefaultStyleProvider} width={this.propertiesWidth()} height={this.getContentsHeight()} />}
+ </div>
</div>
- {this.propertiesWidth() < 10 ? (null) : <PropertiesView styleProvider={DefaultStyleProvider} width={this.propertiesWidth()} height={this.getContentsHeight()} />}
</div>
</>;
}
@@ -525,35 +537,8 @@ export class MainView extends React.Component {
@computed get search() {
TraceMobx();
- return <div className="mainView-searchPanel">
- <SearchBox Document={CurrentUserUtils.MySearchPanelDoc}
- DataDoc={CurrentUserUtils.MySearchPanelDoc}
- fieldKey="data"
- dropAction="move"
- isSelected={returnTrue}
- isContentActive={returnTrue}
- select={returnTrue}
- setHeight={returnFalse}
- addDocument={undefined}
- addDocTab={this.addDocTabFunc}
- pinToPres={emptyFunction}
- rootSelected={returnTrue}
- styleProvider={DefaultStyleProvider}
- layerProvider={undefined}
- removeDocument={undefined}
- ScreenToLocalTransform={Transform.Identity}
- PanelWidth={this.getPWidth}
- PanelHeight={this.getPHeight}
- renderDepth={0}
- focus={DocUtils.DefaultFocus}
- docViewPath={returnEmptyDoclist}
- whenChildContentsActiveChanged={emptyFunction}
- bringToFront={emptyFunction}
- docFilters={returnEmptyFilter}
- docRangeFilters={returnEmptyFilter}
- searchFilterDocs={returnEmptyDoclist}
- ContainingCollectionView={undefined}
- ContainingCollectionDoc={undefined} />
+ return <div className="mainView-topbar">
+ <TopBar />
</div>;
}
@@ -605,7 +590,6 @@ export class MainView extends React.Component {
<GoogleAuthenticationManager />
<DocumentDecorations boundsLeft={this.leftOffset} boundsTop={this.topOffset} />
{this.search}
- <CollectionMenu />
{LinkDescriptionPopup.descriptionPopup ? <LinkDescriptionPopup /> : null}
{DocumentLinksButton.LinkEditorDocView ? <LinkMenu docView={DocumentLinksButton.LinkEditorDocView} changeFlyout={emptyFunction} /> : (null)}
{LinkDocPreview.LinkInfo ? <LinkDocPreview {...LinkDocPreview.LinkInfo} /> : (null)}
diff --git a/src/client/views/MarqueeAnnotator.tsx b/src/client/views/MarqueeAnnotator.tsx
index 717bd0768..805cda95c 100644
--- a/src/client/views/MarqueeAnnotator.tsx
+++ b/src/client/views/MarqueeAnnotator.tsx
@@ -120,9 +120,11 @@ export class MarqueeAnnotator extends React.Component<MarqueeAnnotatorProps> {
return marqueeAnno;
}
- const textRegionAnno = Docs.Create.HTMLAnchorDocument([], { annotationOn: this.props.rootDoc, title: "Selection on " + this.props.rootDoc.title, _width: 1, _height: 1 });
+ const textRegionAnno = Docs.Create.HTMLAnchorDocument([], { annotationOn: this.props.rootDoc, backgroundColor: "transparent", title: "Selection on " + this.props.rootDoc.title });
+ let minX = Number.MAX_VALUE;
let maxX = -Number.MAX_VALUE;
let minY = Number.MAX_VALUE;
+ let maxY = -Number.MIN_VALUE;
const annoDocs: Doc[] = [];
savedAnnoMap.forEach((value: HTMLDivElement[], key: number) => value.map(anno => {
const textRegion = new Doc();
@@ -135,12 +137,16 @@ export class MarqueeAnnotator extends React.Component<MarqueeAnnotatorProps> {
annoDocs.push(textRegion);
anno.remove();
minY = Math.min(NumCast(textRegion.y), minY);
+ minX = Math.min(NumCast(textRegion.x), minX);
+ maxY = Math.max(NumCast(textRegion.y) + NumCast(textRegion._height), maxY);
maxX = Math.max(NumCast(textRegion.x) + NumCast(textRegion._width), maxX);
}));
const textRegionAnnoProto = Doc.GetProto(textRegionAnno);
textRegionAnnoProto.y = Math.max(minY, 0);
- textRegionAnnoProto.x = Math.max(maxX, 0);
+ textRegionAnnoProto.x = Math.max(minX, 0);
+ textRegionAnnoProto.height = Math.max(maxY, 0) - Math.max(minY, 0);
+ textRegionAnnoProto.width = Math.max(maxX, 0) - Math.max(minX, 0);
// mainAnnoDocProto.text = this._selectionText;
textRegionAnnoProto.textInlineAnnotations = new List<Doc>(annoDocs);
savedAnnoMap.clear();
diff --git a/src/client/views/PropertiesView.tsx b/src/client/views/PropertiesView.tsx
index 4df3e4f00..8136edf04 100644
--- a/src/client/views/PropertiesView.tsx
+++ b/src/client/views/PropertiesView.tsx
@@ -24,7 +24,7 @@ import { EditableView } from "./EditableView";
import { InkStrokeProperties } from "./InkStrokeProperties";
import { DocumentView, StyleProviderFunc } from "./nodes/DocumentView";
import { KeyValueBox } from "./nodes/KeyValueBox";
-import { PresBox } from "./nodes/PresBox";
+import { PresBox } from "./nodes/trails/PresBox";
import { PropertiesButtons } from "./PropertiesButtons";
import { PropertiesDocContextSelector } from "./PropertiesDocContextSelector";
import "./PropertiesView.scss";
diff --git a/src/client/views/SidebarAnnos.tsx b/src/client/views/SidebarAnnos.tsx
index 9c5a54574..c5ae82c61 100644
--- a/src/client/views/SidebarAnnos.tsx
+++ b/src/client/views/SidebarAnnos.tsx
@@ -79,7 +79,7 @@ export class SidebarAnnos extends React.Component<FieldViewProps & ExtraProps> {
sidebarStyleProvider = (doc: Opt<Doc>, props: Opt<FieldViewProps | DocumentViewProps>, property: string) => {
if (property === StyleProp.ShowTitle) {
- return doc === this.props.rootDoc ? 0 : StrCast(this.props.layoutDoc["sidebar-childShowTitle"], "title");
+ return doc === this.props.rootDoc ? undefined : StrCast(this.props.layoutDoc["sidebar-childShowTitle"], "title");
}
return this.props.styleProvider?.(doc, props, property);
}
diff --git a/src/client/views/StyleProvider.tsx b/src/client/views/StyleProvider.tsx
index 6b94539c9..c9e532745 100644
--- a/src/client/views/StyleProvider.tsx
+++ b/src/client/views/StyleProvider.tsx
@@ -101,7 +101,7 @@ export function DefaultStyleProvider(doc: Opt<Doc>, props: Opt<DocumentViewProps
const backColor = backgroundCol();
if (!backColor) return undefined;
const nonAlphaColor = backColor.startsWith("#") ? (backColor as string).substring(0, 7) :
- backColor.startsWith("rgba") ? backColor.replace(/,.[^,]*\)/, ")").replace("rgba", "rgb") : backColor
+ backColor.startsWith("rgba") ? backColor.replace(/,.[^,]*\)/, ")").replace("rgba", "rgb") : backColor;
const col = Color(nonAlphaColor).rgb();
const colsum = (col.red() + col.green() + col.blue());
if (colsum / col.alpha() > 400 || col.alpha() < 0.25) return Colors.DARK_GRAY;
@@ -174,6 +174,7 @@ export function DefaultStyleProvider(doc: Opt<Doc>, props: Opt<DocumentViewProps
}
}
case StyleProp.PointerEvents:
+ if (doc?.type === DocumentType.MARKER) return "none";
if (props?.pointerEvents === "none") return "none";
const layer = doc && props?.layerProvider?.(doc);
if (opacity() === 0 || (doc?.type === DocumentType.INK && !docProps?.treeViewDoc) || doc?.isInkMask) return "none";
diff --git a/src/client/views/_nodeModuleOverrides.scss b/src/client/views/_nodeModuleOverrides.scss
index 56346b68b..fd0ac9d5c 100644
--- a/src/client/views/_nodeModuleOverrides.scss
+++ b/src/client/views/_nodeModuleOverrides.scss
@@ -1,8 +1,50 @@
+@import "./global/globalCssVariables";
// this file is for overriding all the css from installed node modules
// goldenlayout stuff
div .lm_header {
background: $dark-gray;
+ overflow: hidden;
+ height: 27px !important;
+}
+
+/* Width */
+.lm_header::-webkit-scrollbar {
+ -webkit-appearance: none;
+ display: none;
+}
+
+/* Width */
+.lm_header:hover::-webkit-scrollbar {
+ -webkit-appearance: none;
+ display: block;
+ height: 0px;
+}
+
+/* Track */
+.lm_header:hover::-webkit-scrollbar-track {
+ -webkit-appearance: none;
+ display: none;
+}
+
+/* Handle */
+.lm_header:hover::-webkit-scrollbar-thumb {
+ -webkit-appearance: none;
+ background: $dark-gray;
+}
+
+/* Handle on hover */
+.lm_header:hover::-webkit-scrollbar-thumb:hover {
+ -webkit-appearance: none;
+ background: $dark-gray;
+}
+
+.lm_tabs {
+ display: flex;
+ position: absolute;
+ width: calc(100% - 60px);
+ overflow: scroll;
+ background: $dark-gray;
}
.lm_tab {
@@ -15,7 +57,14 @@ div .lm_header {
}
.lm_header .lm_controls {
- right: 1em !important;
+ align-items: center;
+ position: absolute;
+ background-color: $dark-gray;
+ border-radius: 5px;
+ display: flex;
+ justify-content: space-evenly;
+ height: 23px;
+ width: 65px;
}
// @TODO the ril__navgiation buttons in the img gallery are a lil messed up but I can't figure out
diff --git a/src/client/views/collections/CollectionDockingView.scss b/src/client/views/collections/CollectionDockingView.scss
index a054f0ae1..77e7b86ea 100644
--- a/src/client/views/collections/CollectionDockingView.scss
+++ b/src/client/views/collections/CollectionDockingView.scss
@@ -1,40 +1,46 @@
-@import "../../views/global/globalCssVariables.scss";
+@import "../global/globalCssVariables.scss";
.lm_title {
- margin-top: 3px;
- border-radius: 5px;
- border: solid 0px dimgray;
- border-width: 2px 2px 0px;
- height: 20px;
- transform: translate(0px, -3px);
+ -webkit-appearance: none;
+ display: inline-block;
+ align-self: center;
+ align-items: center;
+ height: 100%;
+ overflow: hidden;
+ text-overflow: ellipsis;
+ background: transparent;
+ border: solid 0px transparent;
cursor: grab;
+ color: $black;
}
.lm_title.focus-visible {
+ -webkit-appearance: none;
cursor: text;
}
.lm_title_wrap {
overflow: hidden;
- height: 19px;
- margin-top: -2px;
- display: inline-block;
+ align-items: center;
+ align-self: center;
+ background: transparent;
+ width: max-content;
+ height: 100%;
+ display: flex;
}
.lm_active .lm_title {
- border: solid 1px lightgray;
-}
-
-.lm_header .lm_tab .lm_close_tab {
- position: absolute;
- text-align: center;
+ -webkit-appearance: none;
+ // font-weight: 700;
}
.lm_header .lm_tab {
- padding-right: 20px;
- margin-top: -1px;
- border-bottom: 1px black;
+ padding: 0px;
+ opacity: 0.7;
+ box-shadow: none;
+ height: 24px;
+ // border-bottom: 1px black;
.collectionDockingView-gear {
display: none;
@@ -42,9 +48,13 @@
}
.lm_header .lm_tab.lm_active {
- padding-right: 20px;
- margin-top: 1px;
- border-bottom: unset;
+ padding: 0;
+ opacity: 1;
+ margin: 0;
+ box-shadow: none;
+ height: 27px;
+ margin-right: 2px;
+ // border-bottom: unset;
.collectionDockingView-gear {
display: inline-block;
@@ -55,6 +65,41 @@
display: inline;
}
+.lm_drag_tab {
+ padding: 0;
+ width: 15px !important;
+ height: 15px !important;
+ position: relative !important;
+ display: inline-flex !important;
+ align-items: center;
+ top: 0 !important;
+ right: unset !important;
+ left: 0 !important;
+}
+
+.lm_close_tab {
+ padding: 0;
+ align-self: center;
+ margin-right: 5px;
+ background-color: black;
+ border-radius: 3px;
+ opacity: 1 !important;
+ width: 15px !important;
+ height: 15px !important;
+ position: relative !important;
+ display: inline-flex !important;
+ align-items: center;
+ top: 0 !important;
+ right: unset !important;
+ left: 0 !important;
+}
+
+.lm_tab,
+.lm_tab_active {
+ display: flex !important;
+ padding-right: 0 !important;
+}
+
.collectiondockingview-container {
width: 100%;
height: 100%;
@@ -82,16 +127,17 @@
}
.lm_content {
- background: white;
+ background: $white;
}
.lm_controls>li {
- opacity: 0.6;
- transform: scale(1.2);
+ opacity: 1;
+ transform: scale(1);
}
.lm_controls .lm_popout {
- background-image: url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAABUAAAAUCAAAAABHICnvAAAABGdBTUEAALGPC/xhBQAAACBjSFJNAAB6JgAAgIQAAPoAAACA6AAAdTAAAOpgAAA6mAAAF3CculE8AAAAAmJLR0QAAKqNIzIAAAAHdElNRQfkCBsXMgbrEyzaAAAAT0lEQVQY02NgIAcIu8tgEW3/u4IDQ5B14/8LQlhFhckVFfCJjIyIOfP/QWpEZGSQJFS05s9fIPj3/z+YmseCTxS7CZS7DI+PsYcOjpAkDAA6H0KZxzDzlgAAACV0RVh0ZGF0ZTpjcmVhdGUAMjAyMC0wOC0yN1QyMzo1MDowNi0wNDowMDvgVpQAAAAldEVYdGRhdGU6bW9kaWZ5ADIwMjAtMDgtMjdUMjM6NTA6MDYtMDQ6MDBKve4oAAAAAElFTkSuQmCC)
+ transform: rotate(45deg);
+ background-image: url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAAkAAAAJCAYAAADgkQYQAAAAQUlEQVR4nHXOQQ4AMAgCQeT/f6aXpsGK3jSTuCVJAAr7iBdoAwCKd0nwfaAdHbYERw5b44+E8JoBjEYGMBq5gAYP3usUDu2IvoUAAAAASUVORK5CYII=);
}
.lm_maximised .lm_controls .lm_maximise {
@@ -311,8 +357,6 @@
background: transparent url("../../../../node_modules/flexlayout-react/images/restore.png") no-repeat center;
}
- .flexlayout__popup_menu {}
-
.flexlayout__popup_menu_item {
padding: 2px 10px 2px 10px;
color: #ddd;
diff --git a/src/client/views/collections/CollectionDockingView.tsx b/src/client/views/collections/CollectionDockingView.tsx
index 388f9a909..a8471f8e2 100644
--- a/src/client/views/collections/CollectionDockingView.tsx
+++ b/src/client/views/collections/CollectionDockingView.tsx
@@ -445,4 +445,4 @@ Scripting.addGlobal(function openInLightbox(doc: any) { LightboxView.AddDocTab(d
"opens up document in a lightbox", "(doc: any)");
Scripting.addGlobal(function openOnRight(doc: any) { return CollectionDockingView.AddSplit(doc, "right"); },
"opens up document in tab on right side of the screen", "(doc: any)");
-Scripting.addGlobal(function useRightSplit(doc: any, shiftKey?: boolean) { CollectionDockingView.ReplaceTab(doc, "right", undefined, shiftKey); });
+Scripting.addGlobal(function useRightSplit(doc: any, shiftKey?: boolean) { CollectionDockingView.ReplaceTab(doc, "right", undefined, shiftKey); }); \ No newline at end of file
diff --git a/src/client/views/collections/CollectionLinearView.scss b/src/client/views/collections/CollectionLinearView.scss
index ec8805907..86610ac20 100644
--- a/src/client/views/collections/CollectionLinearView.scss
+++ b/src/client/views/collections/CollectionLinearView.scss
@@ -20,19 +20,21 @@
}
.bottomPopup-background {
- padding-right: 14px;
+ background: $light-blue;
+ display: flex;
height: 35;
- transform: translate3d(6px, 5px, 0px);
- padding-top: 6.5px;
- padding-bottom: 7px;
- padding-left: 5px;
+ transform: translate3d(6px, 0px, 0px);
+ align-content: center;
+ justify-content: center;
+ align-items: center;
}
.bottomPopup-text {
+ color: black;
display: inline;
white-space: nowrap;
padding-left: 8px;
- padding-right: 4px;
+ padding-right: 20px;
vertical-align: middle;
font-size: 12.5px;
}
@@ -43,8 +45,8 @@
padding-left: 8px;
padding-right: 8px;
vertical-align: middle;
- background-color: lightgrey;
- border-radius: 5.5px;
+ background-color: #efefef;
+ border-radius: 3px;
color: black;
margin-right: 5px;
}
@@ -52,11 +54,12 @@
.bottomPopup-exit {
display: inline;
white-space: nowrap;
+ margin-right: 10px;
padding-left: 8px;
padding-right: 8px;
vertical-align: middle;
- background-color: lightgrey;
- border-radius: 5.5px;
+ background-color: #f3b6b6;
+ border-radius: 3px;
color: black;
}
diff --git a/src/client/views/collections/CollectionLinearView.tsx b/src/client/views/collections/CollectionLinearView.tsx
index e0b90304b..52c836556 100644
--- a/src/client/views/collections/CollectionLinearView.tsx
+++ b/src/client/views/collections/CollectionLinearView.tsx
@@ -167,24 +167,22 @@ export class CollectionLinearView extends CollectionSubView(LinearDocument) {
})}
</div>
{DocumentLinksButton.StartLink ? <span className="bottomPopup-background" style={{
- background: backgroundColor === color ? "black" : backgroundColor,
pointerEvents: "all"
}}
onPointerDown={e => e.stopPropagation()} >
<span className="bottomPopup-text" >
- Creating link from: {DocumentLinksButton.AnnotationId ? "Annotation in " : " "} {StrCast(DocumentLinksButton.StartLink.title).length < 51 ? DocumentLinksButton.StartLink.title : StrCast(DocumentLinksButton.StartLink.title).slice(0, 50) + '...'}
+ Creating link from: <b>{DocumentLinksButton.AnnotationId ? "Annotation in " : " "} {StrCast(DocumentLinksButton.StartLink.title).length < 51 ? DocumentLinksButton.StartLink.title : StrCast(DocumentLinksButton.StartLink.title).slice(0, 50) + '...'}</b>
</span>
- <Tooltip title={<><div className="dash-tooltip">{LinkDescriptionPopup.showDescriptions ? "Turn off description pop-up" :
- "Turn on description pop-up"} </div></>} placement="top">
+ <Tooltip title={<><div className="dash-tooltip">{"Toggle description pop-up"} </div></>} placement="top">
<span className="bottomPopup-descriptions" onClick={this.changeDescriptionSetting}>
Labels: {LinkDescriptionPopup.showDescriptions ? LinkDescriptionPopup.showDescriptions : "ON"}
</span>
</Tooltip>
- <Tooltip title={<><div className="dash-tooltip">Exit link clicking mode </div></>} placement="top">
+ <Tooltip title={<><div className="dash-tooltip">Exit linking mode</div></>} placement="top">
<span className="bottomPopup-exit" onClick={this.exitLongLinks}>
- Clear
+ Stop
</span>
</Tooltip>
diff --git a/src/client/views/collections/CollectionMenu.scss b/src/client/views/collections/CollectionMenu.scss
index c0fc774d3..f04b19ef7 100644
--- a/src/client/views/collections/CollectionMenu.scss
+++ b/src/client/views/collections/CollectionMenu.scss
@@ -38,10 +38,10 @@
border: unset;
.collectionMenu-divider {
- height: 85%;
+ height: 100%;
margin-left: 3px;
margin-right: 3px;
- width: 1.5px;
+ width: 2px;
background-color: $medium-gray;
}
diff --git a/src/client/views/collections/CollectionMenu.tsx b/src/client/views/collections/CollectionMenu.tsx
index 6e6fabd0d..a9b978c4e 100644
--- a/src/client/views/collections/CollectionMenu.tsx
+++ b/src/client/views/collections/CollectionMenu.tsx
@@ -29,7 +29,7 @@ import { ActiveFillColor, ActiveInkColor, SetActiveArrowEnd, SetActiveArrowStart
import { CollectionFreeFormDocumentView } from "../nodes/CollectionFreeFormDocumentView";
import { DocumentView } from "../nodes/DocumentView";
import { RichTextMenu } from "../nodes/formattedText/RichTextMenu";
-import { PresBox } from "../nodes/PresBox";
+import { PresBox } from "../nodes/trails/PresBox";
import "./CollectionMenu.scss";
import { CollectionViewType, COLLECTION_BORDER_WIDTH } from "./CollectionView";
import { TabDocView } from "./TabDocView";
diff --git a/src/client/views/collections/CollectionSubView.tsx b/src/client/views/collections/CollectionSubView.tsx
index f39443ae2..a5d27f038 100644
--- a/src/client/views/collections/CollectionSubView.tsx
+++ b/src/client/views/collections/CollectionSubView.tsx
@@ -454,7 +454,7 @@ export function CollectionSubView<T, X>(schemaCtor: (doc: Doc) => T, moreProps?:
if (completed) completed(set);
else {
if (isFreeformView && generatedDocuments.length > 1) {
- addDocument(DocUtils.pileup(generatedDocuments, options.x!, options.y!)!);
+ addDocument(DocUtils.pileup(generatedDocuments, options.x!, options.y!));
} else {
generatedDocuments.forEach(addDocument);
}
diff --git a/src/client/views/collections/CollectionTimeView.tsx b/src/client/views/collections/CollectionTimeView.tsx
index f41043179..339163510 100644
--- a/src/client/views/collections/CollectionTimeView.tsx
+++ b/src/client/views/collections/CollectionTimeView.tsx
@@ -37,7 +37,7 @@ export class CollectionTimeView extends CollectionSubView(doc => doc) {
@observable _focusRangeFilters: Opt<string[]>;
getAnchor = () => {
- const anchor = Docs.Create.TextanchorDocument({
+ const anchor = Docs.Create.HTMLAnchorDocument({
title: ComputedField.MakeFunction(`"${this.pivotField}"])`) as any,
annotationOn: this.rootDoc
});
diff --git a/src/client/views/collections/TabDocView.scss b/src/client/views/collections/TabDocView.scss
index 9acbc4f85..a963f1cb9 100644
--- a/src/client/views/collections/TabDocView.scss
+++ b/src/client/views/collections/TabDocView.scss
@@ -1,19 +1,62 @@
input.lm_title:focus,
-input.lm_title
-{
+input.lm_title {
max-width: unset !important;
+ outline: none;
transition-delay: unset;
- width: 100%;
+ width: max-content;
cursor: text;
}
+
input.lm_title {
transition-delay: 0.35s;
- width: 100px;
+ width: max-content;
cursor: pointer;
}
-.tabDocView-drag {
- margin: auto;
+
+.lm_iconWrap {
+ display: flex;
+ color: black;
+ width: 15px;
+ height: 15px;
+ align-items: center;
+ align-self: center;
+ justify-content: center;
+ margin: 3px;
+ border-radius: 20%;
+
+ .moreInfoDot {
+ background-color: white;
+ border-radius: 100%;
+ width: 3px;
+ height: 3px;
+ margin: 0.5px;
+ }
+}
+
+.ffMenu {
+ display: grid;
+ grid-auto-rows: 35px;
+ grid-auto-columns: auto auto auto auto auto;
+ right: 10px;
+ bottom: 50px;
+ position: absolute;
+ min-height: 35px;
+ height: max-content;
+ border: solid 2px black;
+ border-radius: 5px;
+ background-color: #bddbe6;
+ width: max-content;
+ min-width: 35px;
+
+ .ffMenuButton {
+ display: flex;
+ width: 35px;
+ height: 35px;
+ align-items: center;
+ justify-content: center;
+ }
}
+
.miniMap-hidden,
.miniMap {
position: absolute;
@@ -37,6 +80,7 @@ input.lm_title {
}
}
}
+
.miniMap-hidden {
position: absolute;
bottom: 0;
@@ -46,7 +90,8 @@ input.lm_title {
transform: translate(20px, 20px) rotate(45deg);
border-radius: 30px;
padding: 2px;
- > svg {
+
+ >svg {
margin-top: 3px;
transform: translate(0px, 7px);
}
diff --git a/src/client/views/collections/TabDocView.tsx b/src/client/views/collections/TabDocView.tsx
index 7e2f7811e..a24f1eb7a 100644
--- a/src/client/views/collections/TabDocView.tsx
+++ b/src/client/views/collections/TabDocView.tsx
@@ -1,3 +1,4 @@
+import { IconProp } from '@fortawesome/fontawesome-svg-core';
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome';
import { Tooltip } from '@material-ui/core';
import 'golden-layout/src/css/goldenlayout-base.css';
@@ -9,9 +10,9 @@ import * as ReactDOM from 'react-dom';
import { DataSym, Doc, DocListCast, DocListCastAsync, HeightSym, Opt, WidthSym } from "../../../fields/Doc";
import { Id } from '../../../fields/FieldSymbols';
import { FieldId } from "../../../fields/RefField";
-import { Cast, NumCast, StrCast, BoolCast } from "../../../fields/Types";
+import { BoolCast, Cast, NumCast, StrCast } from "../../../fields/Types";
import { TraceMobx } from '../../../fields/util';
-import { emptyFunction, returnEmptyDoclist, returnFalse, returnTrue, setupMoveUpEvents, Utils } from "../../../Utils";
+import { emptyFunction, lightOrDark, returnEmptyDoclist, returnFalse, returnTrue, setupMoveUpEvents, Utils } from "../../../Utils";
import { DocServer } from "../../DocServer";
import { DocUtils } from '../../documents/Documents';
import { DocumentType } from '../../documents/DocumentTypes';
@@ -24,15 +25,15 @@ import { Transform } from '../../util/Transform';
import { undoBatch, UndoManager } from "../../util/UndoManager";
import { LightboxView } from '../LightboxView';
import { DocFocusOptions, DocumentView, DocumentViewProps } from "../nodes/DocumentView";
-import { FieldViewProps } from '../nodes/FieldView';
-import { PinProps, PresBox, PresMovement } from '../nodes/PresBox';
+import { PinProps, PresBox, PresMovement } from '../nodes/trails';
import { DefaultLayerProvider, DefaultStyleProvider, StyleLayers, StyleProp } from '../StyleProvider';
import { CollectionDockingView } from './CollectionDockingView';
import { CollectionDockingViewMenu } from './CollectionDockingViewMenu';
import { CollectionFreeFormView } from './collectionFreeForm/CollectionFreeFormView';
-import { CollectionViewType, CollectionView } from './CollectionView';
+import { CollectionView, CollectionViewType } from './CollectionView';
import "./TabDocView.scss";
import React = require("react");
+import Color = require('color');
const _global = (window /* browser */ || global /* node */) as any;
interface TabDocViewProps {
@@ -52,6 +53,14 @@ export class TabDocView extends React.Component<TabDocViewProps> {
@computed get layoutDoc() { return this._document && Doc.Layout(this._document); }
@computed get tabColor() { return StrCast(this._document?._backgroundColor, StrCast(this._document?.backgroundColor, DefaultStyleProvider(this._document, undefined, StyleProp.BackgroundColor))); }
+ @computed get tabTextColor() { return this._document?.type === DocumentType.PRES ? "black" : StrCast(this._document?._color, StrCast(this._document?.color, DefaultStyleProvider(this._document, undefined, StyleProp.Color))); }
+ // @computed get renderBounds() {
+ // const bounds = this._document ? Cast(this._document._renderContentBounds, listSpec("number"), [0, 0, this.returnMiniSize(), this.returnMiniSize()]) : [0, 0, 0, 0];
+ // const xbounds = bounds[2] - bounds[0];
+ // const ybounds = bounds[3] - bounds[1];
+ // const dim = Math.max(xbounds, ybounds);
+ // return { l: bounds[0] + xbounds / 2 - dim / 2, t: bounds[1] + ybounds / 2 - dim / 2, cx: bounds[0] + xbounds / 2, cy: bounds[1] + ybounds / 2, dim };
+ // }
get stack() { return (this.props as any).glContainer.parent.parent; }
get tab() { return (this.props as any).glContainer.tab; }
@@ -65,15 +74,25 @@ export class TabDocView extends React.Component<TabDocViewProps> {
tab.contentItem.config.fixed && (tab.contentItem.parent.config.fixed = true);
tab.DashDoc = doc;
CollectionDockingView.Instance.tabMap.add(tab);
-
+ const iconType: IconProp = Doc.toIcon(doc);
// setup the title element and set its size according to the # of chars in the title. Show the full title when clicked.
const titleEle = tab.titleElement[0];
+ const iconWrap = document.createElement("div");
+ const closeWrap = document.createElement("div");
+
+
titleEle.size = StrCast(doc.title).length + 3;
titleEle.value = doc.title;
titleEle.onchange = undoBatch(action((e: any) => {
titleEle.size = e.currentTarget.value.length + 3;
Doc.GetProto(doc).title = e.currentTarget.value;
}));
+
+ const dragBtnDown = (e: React.PointerEvent) => {
+ setupMoveUpEvents(this, e, e => !e.defaultPrevented && DragManager.StartDocumentDrag([iconWrap], new DragManager.DocumentDragData([doc], doc.dropAction as dropActionType), e.clientX, e.clientY), returnFalse, emptyFunction);
+ };
+
+
if (tab.element[0].children[1].children.length === 1) {
const toggle = document.createElement("div");
toggle.style.width = "10px";
@@ -83,18 +102,42 @@ export class TabDocView extends React.Component<TabDocViewProps> {
toggle.style.borderTopRightRadius = "7px";
toggle.style.position = "relative";
toggle.style.display = "inline-block";
- toggle.style.background = "gray";
- toggle.style.borderLeft = "solid 1px black";
+ toggle.style.background = "transparent";
toggle.onclick = (e: MouseEvent) => {
if (tab.contentItem === tab.header.parent.getActiveContentItem()) {
tab.DashDoc.activeLayer = tab.DashDoc.activeLayer ? undefined : StyleLayers.Background;
}
};
- tab.element[0].style.borderTopRightRadius = "8px";
- tab.element[0].children[1].appendChild(toggle);
- tab._disposers.layerDisposer = reaction(() =>
- ({ layer: tab.DashDoc.activeLayer, color: this.tabColor }),
- ({ layer, color }) => toggle.style.background = !layer ? color : "dimgrey", { fireImmediately: true });
+ iconWrap.className = "lm_iconWrap";
+ iconWrap.id = "lm_iconWrap";
+ closeWrap.className = "lm_iconWrap";
+ closeWrap.id = "lm_closeWrap";
+ closeWrap.onclick = (e: MouseEvent) => {
+ tab.header.parent.contentItem.remove();
+ Doc.AddDocToList(CurrentUserUtils.MyRecentlyClosed, "data", tab.DashDoc, undefined, true, true);
+ };
+ const docIcon = <FontAwesomeIcon onPointerDown={dragBtnDown} icon={iconType} />;
+ const closeIcon = <FontAwesomeIcon icon={"times"} />;
+ ReactDOM.render(docIcon, iconWrap);
+ ReactDOM.render(closeIcon, closeWrap);
+ // tab.element[0].append(closeWrap);
+ tab.element[0].prepend(iconWrap);
+ tab._disposers.layerDisposer = reaction(() => ({ layer: tab.DashDoc.activeLayer, color: this.tabColor }),
+ ({ layer, color }) => {
+ const textColor = lightOrDark(this.tabColor); //not working with StyleProp.Color
+ titleEle.style.color = textColor;
+ titleEle.style.backgroundColor = "transparent";
+ iconWrap.style.color = textColor;
+ closeWrap.style.color = textColor;
+ moreInfoDrag.style.backgroundColor = textColor;
+ tab.element[0].style.background = !layer ? color : "dimgrey";
+ }, { fireImmediately: true });
+ // TODO:glr fix
+ // tab.element[0].style.borderTopRightRadius = "8px";
+ // tab.element[0].children[1].appendChild(toggle);
+ // tab._disposers.layerDisposer = reaction(() =>
+ // ({ layer: tab.DashDoc.activeLayer, color: this.tabColor }),
+ // ({ layer, color }) => toggle.style.background = !layer ? color : "dimgrey", { fireImmediately: true });
}
// shifts the focus to this tab when another tab is dragged over it
tab.element[0].onmouseenter = (e: MouseEvent) => {
@@ -103,13 +146,11 @@ export class TabDocView extends React.Component<TabDocViewProps> {
tab.setActive(true);
}
};
- const dragBtnDown = (e: React.PointerEvent) => {
- setupMoveUpEvents(this, e, e => !e.defaultPrevented && DragManager.StartDocumentDrag([dragHdl], new DragManager.DocumentDragData([doc], doc.dropAction as dropActionType), e.clientX, e.clientY), returnFalse, emptyFunction);
- };
+
// select the tab document when the tab is directly clicked and activate the tab whenver the tab document is selected
titleEle.onpointerdown = action((e: any) => {
- if (e.target.className !== "lm_close_tab") {
+ if (e.target.className !== "lm_iconWrap") {
if (this.view) SelectionManager.SelectView(this.view, false);
else this._activated = true;
if (Date.now() - titleEle.lastClick < 1000) titleEle.select();
@@ -123,25 +164,30 @@ export class TabDocView extends React.Component<TabDocViewProps> {
const toggle = tab.element[0].children[1].children[0] as HTMLInputElement;
selected && tab.contentItem !== tab.header.parent.getActiveContentItem() &&
UndoManager.RunInBatch(() => tab.header.parent.setActiveContentItem(tab.contentItem), "tab switch");
- toggle.style.fontWeight = selected ? "bold" : "";
- toggle.style.textTransform = selected ? "uppercase" : "";
+ // toggle.style.fontWeight = selected ? "bold" : "";
+ // toggle.style.textTransform = selected ? "uppercase" : "";
}));
//attach the selection doc buttons menu to the drag handle
- const stack = tab.contentItem.parent;
- const dragHdl = document.createElement("div");
- dragHdl.className = "lm_drag_tab";
+ const stack: HTMLDivElement = tab.contentItem.parent;
+ const header: HTMLDivElement = tab;
+ console.log("Stack: " + stack.id, stack.className)
+ stack.onscroll = action((e: any) => {
+ console.log('scrolling...')
+ })
+ const moreInfoDrag = document.createElement("div");
+ moreInfoDrag.className = "lm_iconWrap";
tab._disposers.buttonDisposer = reaction(() => this.view, view =>
- view && [ReactDOM.render(<span className="tabDocView-drag" onPointerDown={dragBtnDown}><CollectionDockingViewMenu views={() => [view]} Stack={stack} /></span>, dragHdl), tab._disposers.buttonDisposer?.()],
+ view && [ReactDOM.render(<span><CollectionDockingViewMenu views={() => [view]} Stack={stack} /></span>, moreInfoDrag), tab._disposers.buttonDisposer?.()],
{ fireImmediately: true });
- tab.reactComponents = [dragHdl];
- tab.closeElement.before(dragHdl);
+ // tab.reactComponents = [moreInfoDrag];
+ // tab.element[0].children[3].before(moreInfoDrag);
// highlight the tab when the tab document is brushed in any part of the UI
tab._disposers.reactionDisposer = reaction(() => ({ title: doc.title, degree: Doc.IsBrushedDegree(doc) }), ({ title, degree }) => {
titleEle.value = title;
- titleEle.style.padding = degree ? 0 : 2;
- titleEle.style.border = `${["gray", "gray", "gray"][degree]} ${["none", "dashed", "solid"][degree]} 2px`;
+ // titleEle.style.padding = degree ? 0 : 2;
+ // titleEle.style.border = `${["gray", "gray", "gray"][degree]} ${["none", "dashed", "solid"][degree]} 2px`;
}, { fireImmediately: true });
// clean up the tab when it is closed
@@ -221,9 +267,9 @@ export class TabDocView extends React.Component<TabDocViewProps> {
})).observe(this.props.glContainer._element[0]);
this.props.glContainer.layoutManager.on("activeContentItemChanged", this.onActiveContentItemChanged);
this.props.glContainer.tab?.isActive && this.onActiveContentItemChanged(undefined);
- this._tabReaction = reaction(() => ({ selected: this.active(), title: this.tab?.titleElement[0] }),
- ({ selected, title }) => title && (title.style.backgroundColor = selected ? "white" : ""),
- { fireImmediately: true });
+ // this._tabReaction = reaction(() => ({ selected: this.active(), title: this.tab?.titleElement[0] }),
+ // ({ selected, title }) => title && (title.style.backgroundColor = selected ? "white" : ""),
+ // { fireImmediately: true });
}
componentWillUnmount() {
@@ -243,10 +289,10 @@ export class TabDocView extends React.Component<TabDocViewProps> {
}
// adds a tab to the layout based on the locaiton parameter which can be:
- // close[:{left,right,top,bottom}] - e.g., "close" will close the tab, "close:left" will close the left tab,
+ // close[:{left,right,top,bottom}] - e.g., "close" will close the tab, "close:left" will close the left tab,
// add[:{left,right,top,bottom}] - e.g., "add" will add a tab to the current stack, "add:right" will add a tab on the right
- // replace[:{left,right,top,bottom,<any string>}] - e.g., "replace" will replace the current stack contents,
- // "replace:right" - will replace the stack on the right named "right" if it exists, or create a stack on the right with that name,
+ // replace[:{left,right,top,bottom,<any string>}] - e.g., "replace" will replace the current stack contents,
+ // "replace:right" - will replace the stack on the right named "right" if it exists, or create a stack on the right with that name,
// "replace:monkeys" - will replace any tab that has the label 'monkeys', or a tab with that label will be created by default on the right
// inPlace - will add the document to any collection along the path from the document to the docking view that has a field isInPlaceContainer. if none is found, inPlace adds a tab to current stack
addDocTab = (doc: Doc, location: string) => {
@@ -460,4 +506,4 @@ export class TabMinimapView extends React.Component<TabMinimapViewProps> {
</div>
</div>;
}
-} \ No newline at end of file
+}
diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx
index a4e310e6c..143d8e070 100644
--- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx
+++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx
@@ -38,7 +38,7 @@ import { CollectionFreeFormDocumentView } from "../../nodes/CollectionFreeFormDo
import { DocFocusOptions, DocumentView, DocumentViewProps, ViewAdjustment, ViewSpecPrefix } from "../../nodes/DocumentView";
import { FormattedTextBox } from "../../nodes/formattedText/FormattedTextBox";
import { pageSchema } from "../../nodes/ImageBox";
-import { PresBox } from "../../nodes/PresBox";
+import { PresBox } from "../../nodes/trails/PresBox";
import { StyleLayers, StyleProp } from "../../StyleProvider";
import { CollectionDockingView } from "../CollectionDockingView";
import { CollectionSubView } from "../CollectionSubView";
@@ -48,6 +48,7 @@ import { CollectionFreeFormRemoteCursors } from "./CollectionFreeFormRemoteCurso
import "./CollectionFreeFormView.scss";
import { MarqueeView } from "./MarqueeView";
import React = require("react");
+import { DocumentType } from "../../../documents/DocumentTypes";
export const panZoomSchema = createSchema({
_panX: "number",
@@ -834,10 +835,10 @@ export class CollectionFreeFormView extends CollectionSubView<PanZoomDocument, P
map(doc => ({ ...this.childDataProvider(doc, ""), ...this.childSizeProvider(doc, "") }));
if (measuredDocs.length) {
const ranges = measuredDocs.reduce(({ xrange, yrange }, { x, y, width, height }) => // computes range of content
- ({
- xrange: { min: Math.min(xrange.min, x), max: Math.max(xrange.max, x + width) },
- yrange: { min: Math.min(yrange.min, y), max: Math.max(yrange.max, y + height) }
- })
+ ({
+ xrange: { min: Math.min(xrange.min, x), max: Math.max(xrange.max, x + width) },
+ yrange: { min: Math.min(yrange.min, y), max: Math.max(yrange.max, y + height) }
+ })
, {
xrange: { min: Number.MAX_VALUE, max: -Number.MAX_VALUE },
yrange: { min: Number.MAX_VALUE, max: -Number.MAX_VALUE }
@@ -1486,7 +1487,8 @@ export class CollectionFreeFormView extends CollectionSubView<PanZoomDocument, P
onDragOver={e => e.preventDefault()}
onContextMenu={this.onContextMenu}
style={{
- pointerEvents: this.backgroundEvents ? "all" : this.props.pointerEvents as any,
+ pointerEvents: this.props.Document.type === DocumentType.MARKER ? "none" : // bcz: ugh.. this is here to prevent markers, which render as freeform views, from grabbing events -- need a better approach.
+ this.backgroundEvents ? "all" : this.props.pointerEvents as any,
transform: `scale(${this.contentScaling || 1})`,
width: `${100 / (this.contentScaling || 1)}%`,
height: this.isAnnotationOverlay && this.Document.scrollHeight ? this.Document.scrollHeight : `${100 / (this.contentScaling || 1)}%`// : this.isAnnotationOverlay ? (this.Document.scrollHeight ? this.Document.scrollHeight : "100%") : this.props.PanelHeight()
diff --git a/src/client/views/collections/collectionFreeForm/MarqueeView.tsx b/src/client/views/collections/collectionFreeForm/MarqueeView.tsx
index b1f2750c3..846d28214 100644
--- a/src/client/views/collections/collectionFreeForm/MarqueeView.tsx
+++ b/src/client/views/collections/collectionFreeForm/MarqueeView.tsx
@@ -19,7 +19,8 @@ import { Transform } from "../../../util/Transform";
import { undoBatch, UndoManager } from "../../../util/UndoManager";
import { ContextMenu } from "../../ContextMenu";
import { FormattedTextBox } from "../../nodes/formattedText/FormattedTextBox";
-import { PresBox, PresMovement } from "../../nodes/PresBox";
+import { PresBox } from "../../nodes/trails/PresBox";
+import { PresMovement } from "../../nodes/trails/PresEnums";
import { PreviewCursor } from "../../PreviewCursor";
import { CollectionDockingView } from "../CollectionDockingView";
import { SubCollectionViewProps } from "../CollectionSubView";
@@ -368,8 +369,8 @@ export class MarqueeView extends React.Component<SubCollectionViewProps & Marque
SelectionManager.DeselectAll();
selected.forEach(d => this.props.removeDocument?.(d));
const newCollection = DocUtils.pileup(selected, this.Bounds.left + this.Bounds.width / 2, this.Bounds.top + this.Bounds.height / 2);
- this.props.addDocument?.(newCollection!);
- this.props.selectDocuments([newCollection!]);
+ this.props.addDocument?.(newCollection);
+ this.props.selectDocuments([newCollection]);
MarqueeOptionsMenu.Instance.fadeOut(true);
this.hideMarquee();
}
diff --git a/src/client/views/collections/collectionSchema/CollectionSchemaCells.tsx b/src/client/views/collections/collectionSchema/CollectionSchemaCells.tsx
index 90f64f163..fd99abce5 100644
--- a/src/client/views/collections/collectionSchema/CollectionSchemaCells.tsx
+++ b/src/client/views/collections/collectionSchema/CollectionSchemaCells.tsx
@@ -103,6 +103,7 @@ export class CollectionSchemaCell extends React.Component<CellProps> {
this.props.changeFocusedCellByIndex(this.props.row, this.props.col);
this.props.setPreviewDoc(this.props.rowProps.original);
+ console.log("click cell");
let url: string;
if (url = StrCast(this.props.rowProps.row.href)) {
try {
@@ -246,13 +247,13 @@ export class CollectionSchemaCell extends React.Component<CellProps> {
} else {
// check if the input is a number
let inputIsNum = true;
- for (let s of value) {
- if (isNaN(parseInt(s)) && !(s == ".") && !(s == ",")) {
+ for (const s of value) {
+ if (isNaN(parseInt(s)) && !(s === ".") && !(s === ",")) {
inputIsNum = false;
}
}
// check if the input is a boolean
- let inputIsBool: boolean = value == "false" || value == "true";
+ const inputIsBool: boolean = value === "false" || value === "true";
// what to do in the case
if (!inputIsNum && !inputIsBool && !value.startsWith("=")) {
// if it's not a number, it's a string, and should be processed as such
@@ -263,12 +264,12 @@ export class CollectionSchemaCell extends React.Component<CellProps> {
const vsqLength = valueSansQuotes.length;
// get rid of outer quotes
valueSansQuotes = valueSansQuotes.substring(value.startsWith("\"") ? 1 : 0,
- valueSansQuotes.charAt(vsqLength - 1) == "\"" ? vsqLength - 1 : vsqLength);
+ valueSansQuotes.charAt(vsqLength - 1) === "\"" ? vsqLength - 1 : vsqLength);
}
let inputAsString = '"';
// escape any quotes in the string
for (const i of valueSansQuotes) {
- if (i == '"') {
+ if (i === '"') {
inputAsString += '\\"';
} else {
inputAsString += i;
@@ -278,7 +279,7 @@ export class CollectionSchemaCell extends React.Component<CellProps> {
inputAsString += '"';
//two options here: we can strip off outer quotes or we can figure out what's going on with the script
const script = CompileScript(inputAsString, { requiredType: type, typecheck: false, editable: true, addReturn: true, params: { this: Doc.name, $r: "number", $c: "number", $: "any" } });
- const changeMade = inputAsString.length !== value.length || inputAsString.length - 2 !== value.length
+ const changeMade = inputAsString.length !== value.length || inputAsString.length - 2 !== value.length;
script.compiled && (retVal = this.applyToDoc(changeMade ? this._rowDoc : this._rowDataDoc, this.props.row, this.props.col, script.run));
// handle numbers and expressions
} else if (inputIsNum || value.startsWith("=")) {
@@ -286,18 +287,18 @@ export class CollectionSchemaCell extends React.Component<CellProps> {
const inputscript = value.substring(value.startsWith("=") ? 1 : 0);
// if commas are not stripped, the parser only considers the numbers after the last comma
let inputSansCommas = "";
- for (let s of inputscript) {
- if (!(s == ",")) {
+ for (const s of inputscript) {
+ if (!(s === ",")) {
inputSansCommas += s;
}
}
const script = CompileScript(inputSansCommas, { requiredType: type, typecheck: false, editable: true, addReturn: true, params: { this: Doc.name, $r: "number", $c: "number", $: "any" } });
- const changeMade = value.length !== value.length || value.length - 2 !== value.length
+ const changeMade = value.length !== value.length || value.length - 2 !== value.length;
script.compiled && (retVal = this.applyToDoc(changeMade ? this._rowDoc : this._rowDataDoc, this.props.row, this.props.col, script.run));
// handle booleans
} else if (inputIsBool) {
const script = CompileScript(value, { requiredType: type, typecheck: false, editable: true, addReturn: true, params: { this: Doc.name, $r: "number", $c: "number", $: "any" } });
- const changeMade = value.length !== value.length || value.length - 2 !== value.length
+ const changeMade = value.length !== value.length || value.length - 2 !== value.length;
script.compiled && (retVal = this.applyToDoc(changeMade ? this._rowDoc : this._rowDataDoc, this.props.row, this.props.col, script.run));
}
}
diff --git a/src/client/views/global/globalCssVariables.scss b/src/client/views/global/globalCssVariables.scss
index ead5e166e..a9f33c4da 100644
--- a/src/client/views/global/globalCssVariables.scss
+++ b/src/client/views/global/globalCssVariables.scss
@@ -11,6 +11,8 @@ $medium-blue: #4476F7;
$pink: #E0217D;
$yellow: #F5D747;
+$logout-red: #ca4444;
+
$drop-shadow: "#32323215";
//padding
@@ -21,8 +23,6 @@ $large-padding: 32px;
//icon sizes
$icon-size: 28px;
-$antimodemenu-height: 36px;
-
// fonts
$sans-serif: "Noto Sans", sans-serif;
$large-header: 16px;
@@ -33,11 +33,16 @@ $small-text: 9px;
// misc values
$border-radius: 0.3em;
$search-thumnail-size: 130;
+$topbar-height: 32px;
+$antimodemenu-height: 36px;
// dragged items
$contextMenu-zindex: 100000; // context menu shows up over everything
$radialMenu-zindex: 100000; // context menu shows up over everything
+// borders
+$standard-border: solid 1px #9F9F9F;
+
$searchpanel-height: 32px;
$mainTextInput-zindex: 999; // then text input overlay so that it's context menu will appear over decorations, etc
$docDecorations-zindex: 998; // then doc decorations appear over everything else
diff --git a/src/client/views/global/globalEnums.tsx b/src/client/views/global/globalEnums.tsx
index 1e0381c33..2aeb8e338 100644
--- a/src/client/views/global/globalEnums.tsx
+++ b/src/client/views/global/globalEnums.tsx
@@ -31,4 +31,8 @@ export enum Padding {
export enum IconSizes {
ICON_SIZE = "28px",
+}
+
+export enum Borders {
+ STANDARD = "solid 1px #9F9F9F"
} \ No newline at end of file
diff --git a/src/client/views/linking/LinkEditor.scss b/src/client/views/linking/LinkEditor.scss
index 839ebf894..e45a91d57 100644
--- a/src/client/views/linking/LinkEditor.scss
+++ b/src/client/views/linking/LinkEditor.scss
@@ -22,7 +22,7 @@
.linkEditor-info {
//border-bottom: 0.5px solid $light-gray;
//padding-bottom: 1px;
- padding-top: 5px;
+ padding: 12px;
padding-left: 5px;
//margin-bottom: 6px;
display: flex;
@@ -61,7 +61,7 @@
}
.linkEditor-description {
- padding-left: 6.5px;
+ padding-left: 26px;
padding-right: 6.5px;
padding-bottom: 3.5px;
@@ -107,9 +107,9 @@
}
.linkEditor-followingDropdown {
- padding-left: 6.5px;
+ padding-left: 26px;
padding-right: 6.5px;
- padding-bottom: 6px;
+ padding-bottom: 15px;
&:hover {
cursor: pointer;
diff --git a/src/client/views/linking/LinkMenu.scss b/src/client/views/linking/LinkMenu.scss
index a2ea42999..19c6463d3 100644
--- a/src/client/views/linking/LinkMenu.scss
+++ b/src/client/views/linking/LinkMenu.scss
@@ -7,20 +7,19 @@
z-index: 2001;
.linkMenu-list,
- .linkMenu-listEditor
- {
+ .linkMenu-listEditor {
display: inline-block;
position: relative;
- border: 1px solid black;
- box-shadow: 3px 3px 1.5px grey;
+ border: 1px solid #e4e4e4;
+ box-shadow: 0 10px 20px rgba(0, 0, 0, 0.19), 0 6px 6px rgba(0, 0, 0, 0.23);
background: white;
-
min-width: 170px;
- max-height: 170px;
+ max-height: 230px;
overflow-y: scroll;
z-index: 10;
- }
- .linkMenu-list {
+ }
+
+ .linkMenu-list {
white-space: nowrap;
overflow-x: hidden;
width: 240px;
@@ -46,13 +45,13 @@
}
.linkMenu-group-name {
+ padding: 10px;
&:hover {
- p {
- background-color: lightgray;
-
- }
+ // p {
+ // background-color: lightgray;
+ // }
p.expand-one {
width: calc(100% + 20px);
@@ -65,10 +64,9 @@
p {
width: 100%;
- //padding: 4px 6px;
line-height: 12px;
border-radius: 5px;
- font-weight: bold;
+ text-transform: capitalize;
}
.linkEditor-tableButton {
diff --git a/src/client/views/linking/LinkMenu.tsx b/src/client/views/linking/LinkMenu.tsx
index c7888c5ee..6fc860447 100644
--- a/src/client/views/linking/LinkMenu.tsx
+++ b/src/client/views/linking/LinkMenu.tsx
@@ -15,6 +15,9 @@ interface Props {
changeFlyout: () => void;
}
+/**
+ * the outermost component for the link menu of a node that contains a list of its linked nodes
+ */
@observer
export class LinkMenu extends React.Component<Props> {
private _editorRef = React.createRef<HTMLDivElement>();
@@ -36,6 +39,11 @@ export class LinkMenu extends React.Component<Props> {
}
}
+ /**
+ * maps each link to a JSX element to be rendered
+ * @param groups LinkManager containing info of all of the links
+ * @returns list of link JSX elements if there at least one linked element
+ */
renderAllGroups = (groups: Map<string, Array<Doc>>): Array<JSX.Element> => {
const linkItems = Array.from(groups.entries()).map(group =>
<LinkMenuGroup
diff --git a/src/client/views/linking/LinkMenuGroup.tsx b/src/client/views/linking/LinkMenuGroup.tsx
index 74af78234..c7586a467 100644
--- a/src/client/views/linking/LinkMenuGroup.tsx
+++ b/src/client/views/linking/LinkMenuGroup.tsx
@@ -40,7 +40,7 @@ export class LinkMenuGroup extends React.Component<LinkMenuGroupProps> {
return (
<div className="linkMenu-group" ref={this._menuRef}>
<div className="linkMenu-group-name">
- <p className={this.props.groupType === "*" || this.props.groupType === "" ? "" : "expand-one"} > {this.props.groupType}:</p>
+ <p className={this.props.groupType === "*" || this.props.groupType === "" ? "" : "expand-one"}> {this.props.groupType}:</p>
</div>
<div className="linkMenu-group-wrapper">
{groupItems}
diff --git a/src/client/views/linking/LinkMenuItem.scss b/src/client/views/linking/LinkMenuItem.scss
index 4f9881565..90722daf9 100644
--- a/src/client/views/linking/LinkMenuItem.scss
+++ b/src/client/views/linking/LinkMenuItem.scss
@@ -4,7 +4,7 @@
// border-top: 0.5px solid $medium-gray;
position: relative;
display: flex;
- border-bottom: 0.5px solid black;
+ border-top: 0.5px solid #cdcdcd;
padding-left: 6.5px;
padding-right: 2px;
@@ -55,8 +55,8 @@
.linkMenu-destination-title {
text-decoration: none;
- color: rgb(85, 120, 196);
- font-size: 14px;
+ color: #4476F7;
+ font-size: 16px;
padding-bottom: 2px;
padding-right: 4px;
margin-right: 4px;
@@ -76,7 +76,7 @@
text-decoration: none;
font-style: italic;
color: rgb(95, 97, 102);
- font-size: 10px;
+ font-size: 9px;
margin-left: 20px;
max-width: 125px;
height: auto;
diff --git a/src/client/views/linking/LinkPopup.scss b/src/client/views/linking/LinkPopup.scss
new file mode 100644
index 000000000..8ae65158d
--- /dev/null
+++ b/src/client/views/linking/LinkPopup.scss
@@ -0,0 +1,45 @@
+.linkPopup-container {
+ background: white;
+ box-shadow: 0 10px 20px rgba(0, 0, 0, 0.19), 0 6px 6px rgba(0, 0, 0, 0.23);
+ top: 35px;
+ height: 200px;
+ width: 200px;
+ position: absolute;
+ padding: 15px;
+ border-radius: 3px;
+
+ input {
+ border: 1px solid #b9b9b9;
+ border-radius: 20px;
+ height: 25px;
+ width: 100%;
+ padding-left: 10px;
+ }
+
+ .divider {
+ margin: 10px 0;
+ height: 20px;
+ width: 100%;
+
+ .line {
+ height: 1px;
+ background-color: #b9b9b9;
+ width: 100%;
+ position: relative;
+ top: 12px;
+ }
+
+ .divider-text {
+ width: 20px;
+ background-color: white;
+ text-align: center;
+ position: relative;
+ margin: auto;
+ }
+ }
+
+
+ .searchBox-container {
+ background: pink;
+ }
+} \ No newline at end of file
diff --git a/src/client/views/linking/LinkPopup.tsx b/src/client/views/linking/LinkPopup.tsx
new file mode 100644
index 000000000..2c4b718f4
--- /dev/null
+++ b/src/client/views/linking/LinkPopup.tsx
@@ -0,0 +1,114 @@
+import { IconProp } from '@fortawesome/fontawesome-svg-core';
+import { FontAwesomeIcon } from '@fortawesome/react-fontawesome';
+import { Tooltip } from '@material-ui/core';
+import { action, observable, runInAction } from 'mobx';
+import { observer } from "mobx-react";
+import { Doc, DocListCast } from '../../../fields/Doc';
+import { Cast, StrCast } from '../../../fields/Types';
+import { WebField } from '../../../fields/URLField';
+import { emptyFunction, setupMoveUpEvents, returnFalse, returnTrue, returnEmptyDoclist, returnEmptyFilter } from '../../../Utils';
+import { DocumentType } from '../../documents/DocumentTypes';
+import { DocumentManager } from '../../util/DocumentManager';
+import { DragManager } from '../../util/DragManager';
+import { Hypothesis } from '../../util/HypothesisUtils';
+import { LinkManager } from '../../util/LinkManager';
+import { undoBatch } from '../../util/UndoManager';
+import { DocumentLinksButton } from '../nodes/DocumentLinksButton';
+import { DocumentView, DocumentViewSharedProps } from '../nodes/DocumentView';
+import { LinkDocPreview } from '../nodes/LinkDocPreview';
+import './LinkPopup.scss';
+import React = require("react");
+import { CurrentUserUtils } from '../../util/CurrentUserUtils';
+import { DefaultStyleProvider } from '../StyleProvider';
+import { Transform } from '../../util/Transform';
+import { DocUtils } from '../../documents/Documents';
+import { SearchBox } from '../search/SearchBox';
+import { EditorView } from 'prosemirror-view';
+import { FormattedTextBox } from '../nodes/formattedText/FormattedTextBox';
+
+interface LinkPopupProps {
+ showPopup: boolean;
+ // groupType: string;
+ // linkDoc: Doc;
+ // docView: DocumentView;
+ // sourceDoc: Doc;
+}
+
+/**
+ * Popup component for creating links from text to Dash documents
+ */
+
+@observer
+export class LinkPopup extends React.Component<LinkPopupProps> {
+ @observable private linkURL: string = "";
+ @observable public view?: EditorView;
+
+
+
+ // TODO: should check for valid URL
+ @undoBatch
+ makeLinkToURL = (target: string, lcoation: string) => {
+ ((this.view as any)?.TextView as FormattedTextBox).makeLinkAnchor(undefined, "onRadd:rightight", target, target);
+ }
+
+ @action
+ onLinkChange = (e: React.ChangeEvent<HTMLInputElement>) => {
+ this.linkURL = e.target.value;
+ console.log(this.linkURL)
+ }
+
+
+ getPWidth = () => 500;
+ getPHeight = () => 500;
+
+ render() {
+ const popupVisibility = this.props.showPopup ? "block" : "none";
+ return (
+ <div className="linkPopup-container" style={{ display: popupVisibility }}>
+ <div className="linkPopup-url-container">
+ <input autoComplete="off" type="text" value={this.linkURL} placeholder="Enter URL..." onChange={this.onLinkChange} />
+ <button onPointerDown={e => this.makeLinkToURL(this.linkURL, "add:right")}
+ style={{ display: "block", margin: "10px auto", }}>Apply hyperlink</button>
+ </div>
+ <div className="divider">
+ <div className="line"></div>
+ <p className="divider-text">or</p>
+ </div>
+ <div className="linkPopup-document-search-container">
+ {/* <i></i>
+ <input defaultValue={""} autoComplete="off" type="text" placeholder="Search for Document..." id="search-input"
+ className="linkPopup-searchBox searchBox-input" /> */}
+
+ <SearchBox Document={CurrentUserUtils.MySearchPanelDoc}
+ DataDoc={CurrentUserUtils.MySearchPanelDoc}
+ fieldKey="data"
+ dropAction="move"
+ isSelected={returnTrue}
+ isContentActive={returnTrue}
+ select={returnTrue}
+ setHeight={returnFalse}
+ addDocument={undefined}
+ addDocTab={returnTrue}
+ pinToPres={emptyFunction}
+ rootSelected={returnTrue}
+ styleProvider={DefaultStyleProvider}
+ layerProvider={undefined}
+ removeDocument={undefined}
+ ScreenToLocalTransform={Transform.Identity}
+ PanelWidth={this.getPWidth}
+ PanelHeight={this.getPHeight}
+ renderDepth={0}
+ focus={DocUtils.DefaultFocus}
+ docViewPath={returnEmptyDoclist}
+ whenChildContentsActiveChanged={emptyFunction}
+ bringToFront={emptyFunction}
+ docFilters={returnEmptyFilter}
+ docRangeFilters={returnEmptyFilter}
+ searchFilterDocs={returnEmptyDoclist}
+ ContainingCollectionView={undefined}
+ ContainingCollectionDoc={undefined} />
+ </div>
+ </div>
+ );
+ }
+} \ No newline at end of file
diff --git a/src/client/views/nodes/DocumentContentsView.tsx b/src/client/views/nodes/DocumentContentsView.tsx
index 9b75cd8f9..3d2cdf5a4 100644
--- a/src/client/views/nodes/DocumentContentsView.tsx
+++ b/src/client/views/nodes/DocumentContentsView.tsx
@@ -11,7 +11,7 @@ import { CollectionFreeFormView } from "../collections/collectionFreeForm/Collec
import { CollectionSchemaView } from "../collections/collectionSchema/CollectionSchemaView";
import { CollectionView } from "../collections/CollectionView";
import { InkingStroke } from "../InkingStroke";
-import { PresElementBox } from "../presentationview/PresElementBox";
+import { PresElementBox } from "../nodes/trails/PresElementBox";
import { SearchBox } from "../search/SearchBox";
import { DashWebRTCVideo } from "../webcam/DashWebRTCVideo";
import { YoutubeBox } from "./../../apis/youtube/YoutubeBox";
@@ -32,7 +32,7 @@ import { LabelBox } from "./LabelBox";
import { LinkAnchorBox } from "./LinkAnchorBox";
import { LinkBox } from "./LinkBox";
import { PDFBox } from "./PDFBox";
-import { PresBox } from "./PresBox";
+import { PresBox } from "./trails/PresBox";
import { ScreenshotBox } from "./ScreenshotBox";
import { ScriptingBox } from "./ScriptingBox";
import { SliderBox } from "./SliderBox";
diff --git a/src/client/views/nodes/DocumentLinksButton.scss b/src/client/views/nodes/DocumentLinksButton.scss
index daffaf9e7..9bab72d55 100644
--- a/src/client/views/nodes/DocumentLinksButton.scss
+++ b/src/client/views/nodes/DocumentLinksButton.scss
@@ -1,16 +1,27 @@
@import "../global/globalCssVariables.scss";
+.documentLinksButton-menu {
+ width: 100%;
+ height: 100%;
+ position: relative;
+ display: flex;
+ align-content: center;
+ justify-content: center;
+ align-items: center;
+}
+
.documentLinksButton-cont {
min-width: 20;
min-height: 20;
position: absolute;
}
+
.documentLinksButton,
.documentLinksButton-endLink,
.documentLinksButton-startLink {
- height: 20px;
- width: 20px;
+ height: 25px;
+ width: 25px;
position: absolute;
border-radius: 50%;
opacity: 0.9;
@@ -37,23 +48,21 @@
font-weight: bold;
&:hover {
- background: $medium-gray;
transform: scale(1.05);
cursor: pointer;
}
}
.documentLinksButton-endLink {
- border: red solid 2px;
-
+ border: $medium-blue 2px dashed;
+ color: $medium-blue;
&:hover {
- background: deepskyblue;
+ background: $light-gray;
transform: scale(1.05);
cursor: pointer;
}
}
.documentLinksButton-startLink {
- border: red solid 2px;
- background-color: rgba(255, 192, 203, 0.5);
+ background-color: $medium-blue;
} \ No newline at end of file
diff --git a/src/client/views/nodes/DocumentLinksButton.tsx b/src/client/views/nodes/DocumentLinksButton.tsx
index a6d07374a..cec06d2d4 100644
--- a/src/client/views/nodes/DocumentLinksButton.tsx
+++ b/src/client/views/nodes/DocumentLinksButton.tsx
@@ -20,6 +20,7 @@ import './DocumentLinksButton.scss';
import { DocServer } from "../../DocServer";
import { LightboxView } from "../LightboxView";
import { cat } from "shelljs";
+import { Colors } from "../global/globalEnums";
const higflyout = require("@hig/flyout");
export const { anchorPoints } = higflyout;
@@ -30,12 +31,12 @@ interface DocumentLinksButtonProps {
Offset?: (number | undefined)[];
AlwaysOn?: boolean;
InMenu?: boolean;
- StartLink?: boolean;
+ StartLink?: boolean; //whether the link HAS been started (i.e. now needs to be completed)
}
@observer
export class DocumentLinksButton extends React.Component<DocumentLinksButtonProps, {}> {
private _linkButton = React.createRef<HTMLDivElement>();
- @observable public static StartLink: Doc | undefined;
+ @observable public static StartLink: Doc | undefined; //origin's Doc, if defined
@observable public static StartLinkView: DocumentView | undefined;
@observable public static AnnotationId: string | undefined;
@observable public static AnnotationUri: string | undefined;
@@ -45,6 +46,7 @@ export class DocumentLinksButton extends React.Component<DocumentLinksButtonProp
public static invisibleWebRef = React.createRef<HTMLDivElement>();
@action public static ClearLinkEditor() { DocumentLinksButton.LinkEditorDocView = undefined; }
+
@action @undoBatch
onLinkButtonMoved = (e: PointerEvent) => {
if (this.props.InMenu && this.props.StartLink) {
@@ -120,7 +122,7 @@ export class DocumentLinksButton extends React.Component<DocumentLinksButtonProp
if (DocumentLinksButton.StartLink === this.props.View.props.Document) {
DocumentLinksButton.StartLink = undefined;
DocumentLinksButton.StartLinkView = undefined;
- } else {
+ } else { //if this LinkButton's Document is undefined
DocumentLinksButton.StartLink = this.props.View.props.Document;
DocumentLinksButton.StartLinkView = this.props.View;
}
@@ -131,6 +133,7 @@ export class DocumentLinksButton extends React.Component<DocumentLinksButtonProp
}
}
+
completeLink = (e: React.PointerEvent): void => {
setupMoveUpEvents(this, e, returnFalse, emptyFunction, undoBatch(action((e, doubleTap) => {
if (doubleTap && !this.props.StartLink) {
@@ -141,7 +144,7 @@ export class DocumentLinksButton extends React.Component<DocumentLinksButtonProp
} else if (DocumentLinksButton.StartLink && DocumentLinksButton.StartLink !== this.props.View.props.Document) {
const sourceDoc = DocumentLinksButton.StartLink;
const targetDoc = this.props.View.ComponentView?.getAnchor?.() || this.props.View.Document;
- const linkDoc = DocUtils.MakeLink({ doc: sourceDoc }, { doc: targetDoc }, "long drag");
+ const linkDoc = DocUtils.MakeLink({ doc: sourceDoc }, { doc: targetDoc }, "links"); //why is long drag here when this is used for completing links by clicking?
LinkManager.currentLink = linkDoc;
@@ -184,7 +187,7 @@ export class DocumentLinksButton extends React.Component<DocumentLinksButtonProp
} else if (startLink !== endLink) {
endLink = endLinkView?.docView?._componentView?.getAnchor?.() || endLink;
startLink = DocumentLinksButton.StartLinkView?.docView?._componentView?.getAnchor?.() || startLink;
- const linkDoc = DocUtils.MakeLink({ doc: startLink }, { doc: endLink }, DocumentLinksButton.AnnotationId ? "hypothes.is annotation" : "long drag", undefined, undefined, true);
+ const linkDoc = DocUtils.MakeLink({ doc: startLink }, { doc: endLink }, DocumentLinksButton.AnnotationId ? "hypothes.is annotation" : "link", undefined, undefined, true);
LinkManager.currentLink = linkDoc;
@@ -242,45 +245,57 @@ export class DocumentLinksButton extends React.Component<DocumentLinksButtonProp
return results;
}
+ /**
+ * gets the JSX of the link button (btn used to start/complete links) OR the link-view button (btn on bottom left of each linked node)
+ */
@computed get linkButtonInner() {
const btnDim = this.props.InMenu ? "20px" : "30px";
const link = <img style={{ width: "22px", height: "16px" }} src={`/assets/${"link.png"}`} />;
- return <div className="documentLinksButton-cont" ref={this._linkButton}
- style={{ left: this.props.Offset?.[0], top: this.props.Offset?.[1], right: this.props.Offset?.[2], bottom: this.props.Offset?.[3] }}
- >
- <div className={"documentLinksButton"}
- onPointerDown={this.onLinkButtonDown} onClick={this.onLinkClick}
- style={{
- backgroundColor: this.props.InMenu ? "" : "#add8e6",
- color: this.props.InMenu ? "white" : "black",
- width: btnDim,
- height: btnDim,
- }} >
- {this.props.InMenu ?
- this.props.StartLink ?
- <FontAwesomeIcon className="documentdecorations-icon" icon="link" size="sm" />
- : link
- : Array.from(this.filteredLinks).length}
- </div>
- {this.props.InMenu && !this.props.StartLink && DocumentLinksButton.StartLink !== this.props.View.props.Document ?
- <div className={"documentLinksButton-endLink"}
+ return (!this.props.InMenu ?
+ <div className="documentLinksButton-cont" ref={this._linkButton}
+ style={{ left: this.props.Offset?.[0], top: this.props.Offset?.[1], right: this.props.Offset?.[2], bottom: this.props.Offset?.[3] }}
+ >
+ <div className={"documentLinksButton"}
+ onPointerDown={this.onLinkButtonDown} onClick={this.onLinkClick}
style={{
- width: btnDim, height: btnDim,
- backgroundColor: DocumentLinksButton.StartLink ? "" : "grey",
- opacity: DocumentLinksButton.StartLink ? "" : "50%",
- border: DocumentLinksButton.StartLink ? "" : "none",
- cursor: DocumentLinksButton.StartLink ? "pointer" : "default"
- }}
- onPointerDown={DocumentLinksButton.StartLink && this.completeLink}
- onClick={e => DocumentLinksButton.StartLink && DocumentLinksButton.finishLinkClick(e.clientX, e.clientY, DocumentLinksButton.StartLink, this.props.View.props.Document, true, this.props.View)} />
- : (null)
- }
- {DocumentLinksButton.StartLink === this.props.View.props.Document && this.props.InMenu && this.props.StartLink ?
- <div className={"documentLinksButton-startLink"} onPointerDown={this.clearLinks} onClick={this.clearLinks} style={{ width: btnDim, height: btnDim }} />
- : (null)
- }
- </div >;
+ backgroundColor: Colors.LIGHT_BLUE,
+ color: Colors.BLACK,
+ width: btnDim,
+ height: btnDim,
+ }}>
+ {Array.from(this.filteredLinks).length}
+ </div>
+ </div>
+ :
+ <div className="documentLinksButton-menu">
+ {this.props.InMenu && !this.props.StartLink && DocumentLinksButton.StartLink !== this.props.View.props.Document ? //if the origin node is not this node
+ <div className={"documentLinksButton-endLink"}
+ style={{
+ width: btnDim, height: btnDim,
+ backgroundColor: DocumentLinksButton.StartLink ? "" : Colors.LIGHT_GRAY,
+ opacity: DocumentLinksButton.StartLink ? "" : "50%",
+ border: DocumentLinksButton.StartLink ? "" : "none",
+ cursor: DocumentLinksButton.StartLink ? "pointer" : "default"
+ }}
+ onPointerDown={DocumentLinksButton.StartLink && this.completeLink}
+ onClick={e => DocumentLinksButton.StartLink && DocumentLinksButton.finishLinkClick(e.clientX, e.clientY, DocumentLinksButton.StartLink, this.props.View.props.Document, true, this.props.View)}>
+ {this.props.StartLink ?
+ <FontAwesomeIcon className="documentdecorations-icon" icon="link" size="sm" />
+ : link}
+ </div>
+ : (null)
+ }
+ {
+ this.props.InMenu ? //if link has been started from current node, then set behavior of link button to deactivate linking when clicked again
+ <div className={'documentLinksButton' + (DocumentLinksButton.StartLink === this.props.View.props.Document && this.props.StartLink) ? '-startLink' : ''} onPointerDown={this.clearLinks} onClick={this.clearLinks} style={{ width: btnDim, height: btnDim }}>
+ {this.props.StartLink ?
+ <FontAwesomeIcon className="documentdecorations-icon" icon="link" size="sm" />
+ : link}
+ </div>
+ : (null)}
+ </div>
+ )
}
render() {
@@ -290,6 +305,7 @@ export class DocumentLinksButton extends React.Component<DocumentLinksButtonProp
const buttonTitle = "Tap to view links; double tap to open link collection";
const title = this.props.InMenu ? menuTitle : buttonTitle;
+ //render circular tooltip if it isn't set to invisible and show the number of doc links the node has, and render inner-menu link button for starting/stopping links if currently in menu
return !Array.from(this.filteredLinks).length && !this.props.AlwaysOn ? (null) :
this.props.InMenu && (DocumentLinksButton.StartLink || this.props.StartLink) ?
<Tooltip title={<div className="dash-tooltip">{title}</div>}>
diff --git a/src/client/views/nodes/DocumentView.scss b/src/client/views/nodes/DocumentView.scss
index 8f86417d6..7f164ca48 100644
--- a/src/client/views/nodes/DocumentView.scss
+++ b/src/client/views/nodes/DocumentView.scss
@@ -147,7 +147,7 @@
.documentView-titleWrapper,
.documentView-titleWrapper-hover {
overflow: hidden;
- color: white;
+ color: $black;
transform-origin: top left;
top: 0;
width: 100%;
diff --git a/src/client/views/nodes/DocumentView.tsx b/src/client/views/nodes/DocumentView.tsx
index 60fa462ad..80a014926 100644
--- a/src/client/views/nodes/DocumentView.tsx
+++ b/src/client/views/nodes/DocumentView.tsx
@@ -43,7 +43,7 @@ import { DocumentLinksButton } from './DocumentLinksButton';
import "./DocumentView.scss";
import { LinkAnchorBox } from './LinkAnchorBox';
import { LinkDocPreview } from "./LinkDocPreview";
-import { PresBox } from './PresBox';
+import { PresBox } from './trails/PresBox';
import { RadialMenu } from './RadialMenu';
import React = require("react");
import { ScriptingBox } from "./ScriptingBox";
diff --git a/src/client/views/nodes/FontIconBox.tsx b/src/client/views/nodes/FontIconBox.tsx
index 6ae4b9726..0d415e238 100644
--- a/src/client/views/nodes/FontIconBox.tsx
+++ b/src/client/views/nodes/FontIconBox.tsx
@@ -14,6 +14,7 @@ import { DocComponent } from '../DocComponent';
import { StyleProp } from '../StyleProvider';
import { FieldView, FieldViewProps } from './FieldView';
import './FontIconBox.scss';
+import { Colors } from '../global/globalEnums';
const FontIconSchema = createSchema({
icon: "string",
});
@@ -47,7 +48,7 @@ export class FontIconBox extends DocComponent<FieldViewProps, FontIconDocument>(
const icon = StrCast(this.dataDoc.icon, "user") as any;
const presSize = shape === 'round' ? 25 : 30;
const presTrailsIcon = <img src={`/assets/${"presTrails.png"}`}
- style={{ width: presSize, height: presSize, filter: `invert(${color === "white" ? "100%" : "0%"})`, marginBottom: "5px" }} />;
+ style={{ width: presSize, height: presSize, filter: `invert(${color === Colors.DARK_GRAY ? "0%" : "100%"})`, marginBottom: "5px" }} />;
const button = <button className={`menuButton-${shape}`} onContextMenu={this.specificContextMenu}
style={{ backgroundColor: backgroundColor, }}>
<div className="menuButton-wrap">
diff --git a/src/client/views/nodes/ImageBox.tsx b/src/client/views/nodes/ImageBox.tsx
index d876ae818..cfd43bb62 100644
--- a/src/client/views/nodes/ImageBox.tsx
+++ b/src/client/views/nodes/ImageBox.tsx
@@ -340,7 +340,7 @@ export class ImageBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp
@action
finishMarquee = () => {
this._marqueeing = undefined;
- this.props.select(false)
+ this.props.select(false);
}
render() {
diff --git a/src/client/views/nodes/WebBox.tsx b/src/client/views/nodes/WebBox.tsx
index 88e38712a..f5b1f96f2 100644
--- a/src/client/views/nodes/WebBox.tsx
+++ b/src/client/views/nodes/WebBox.tsx
@@ -162,7 +162,8 @@ export class WebBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps
scrollFocus = (doc: Doc, smooth: boolean) => {
if (this._sidebarRef?.current?.makeDocUnfiltered(doc)) return 1;
if (doc !== this.rootDoc && this._outerRef.current) {
- const scrollTo = doc.type === DocumentType.TEXTANCHOR ? NumCast(doc.y) : Utils.scrollIntoView(NumCast(doc.y), doc[HeightSym](), NumCast(this.layoutDoc._scrollTop), this.props.PanelHeight() / (this.props.scaling?.() || 1));
+ const windowHeight = this.props.PanelHeight() / (this.props.scaling?.() || 1);
+ const scrollTo = Utils.scrollIntoView(NumCast(doc.y), doc[HeightSym](), NumCast(this.layoutDoc._scrollTop), windowHeight, windowHeight * .1);
if (scrollTo !== undefined) {
const focusSpeed = smooth ? 500 : 0;
this._initialScroll !== undefined && (this._initialScroll = scrollTo);
diff --git a/src/client/views/nodes/formattedText/FormattedTextBox.tsx b/src/client/views/nodes/formattedText/FormattedTextBox.tsx
index 6dd63fb47..140d39929 100644
--- a/src/client/views/nodes/formattedText/FormattedTextBox.tsx
+++ b/src/client/views/nodes/formattedText/FormattedTextBox.tsx
@@ -215,6 +215,7 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
AnchorMenu.Instance.Status = "marquee";
AnchorMenu.Instance.Highlight = action((color: string, isLinkButton: boolean) => {
this._editorView?.state && RichTextMenu.Instance.insertHighlight(color, this._editorView.state, this._editorView?.dispatch);
+ console.log("highlight")
return undefined;
});
/**
@@ -787,7 +788,7 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
}
componentDidMount() {
- this.props.setContentView?.(this); // this tells the DocumentView that this AudioBox is the "content" of the document. this allows the DocumentView to indirectly call getAnchor() on the AudioBox when making a link.
+ !this.props.dontSelectOnLoad && this.props.setContentView?.(this); // this tells the DocumentView that this AudioBox is the "content" of the document. this allows the DocumentView to indirectly call getAnchor() on the AudioBox when making a link.
this._cachedLinks = DocListCast(this.Document.links);
this._disposers.breakupDictation = reaction(() => DocumentManager.Instance.RecordingEvent, this.breakupDictation);
this._disposers.autoHeight = reaction(() => this.autoHeight, autoHeight => autoHeight && this.tryUpdateScrollHeight());
diff --git a/src/client/views/nodes/formattedText/RichTextMenu.tsx b/src/client/views/nodes/formattedText/RichTextMenu.tsx
index 59b2d3753..2523dda38 100644
--- a/src/client/views/nodes/formattedText/RichTextMenu.tsx
+++ b/src/client/views/nodes/formattedText/RichTextMenu.tsx
@@ -852,6 +852,7 @@ export class RichTextMenu extends AntimodeMenu<AntimodeMenuProps> {
@undoBatch
makeLinkToURL = (target: string, lcoation: string) => {
((this.view as any)?.TextView as FormattedTextBox).makeLinkAnchor(undefined, "onRadd:rightight", target, target);
+ console.log((this.view as any)?.TextView);
}
@undoBatch
@@ -963,7 +964,7 @@ export class RichTextMenu extends AntimodeMenu<AntimodeMenuProps> {
this.createHighlighterButton(),
this.createLinkButton(),
this.createBrushButton(),
- <div className="richTextMenu-divider" key="divider 2" />,
+ <div className="collectionMenu-divider" key="divider 2" />,
this.createButton("align-left", "Align Left", this.activeAlignment === "left", this.alignLeft),
this.createButton("align-center", "Align Center", this.activeAlignment === "center", this.alignCenter),
this.createButton("align-right", "Align Right", this.activeAlignment === "right", this.alignRight),
@@ -976,7 +977,7 @@ export class RichTextMenu extends AntimodeMenu<AntimodeMenuProps> {
const row2 = <div className="antimodeMenu-row row-2" key="row2">
{this.collapsed ? this.getDragger() : (null)}
<div key="row 2" style={{ display: this.collapsed ? "none" : undefined }}>
- <div className="richTextMenu-divider" key="divider 3" />
+ <div className="collectionMenu-divider" key="divider 3" />
{[this.createMarksDropdown(this.activeFontSize, this.fontSizeOptions, "font size", action((val: string) => {
this.activeFontSize = val;
SelectionManager.Views().map(dv => dv.props.Document._fontSize = val);
@@ -985,12 +986,12 @@ export class RichTextMenu extends AntimodeMenu<AntimodeMenuProps> {
this.activeFontFamily = val;
SelectionManager.Views().map(dv => dv.props.Document._fontFamily = val);
})),
- <div className="richTextMenu-divider" key="divider 4" />,
+ <div className="collectionMenu-divider" key="divider 4" />,
this.createNodesDropdown(this.activeListType, this.listTypeOptions, "list type", () => ({})),
this.createButton("sort-amount-down", "Summarize", undefined, this.insertSummarizer),
this.createButton("quote-left", "Blockquote", undefined, this.insertBlockquote),
- this.createButton("minus", "Horizontal Rule", undefined, this.insertHorizontalRule),
- <div className="richTextMenu-divider" key="divider 5" />,]}
+ this.createButton("minus", "Horizontal Rule", undefined, this.insertHorizontalRule)
+ ]}
</div>
{/* <div key="collapser">
{<div key="collapser">
diff --git a/src/client/views/nodes/PresBox.scss b/src/client/views/nodes/trails/PresBox.scss
index 5d1c5f4eb..06932d145 100644
--- a/src/client/views/nodes/PresBox.scss
+++ b/src/client/views/nodes/trails/PresBox.scss
@@ -1,4 +1,4 @@
-@import "../global/globalCssVariables";
+@import "../../global/globalCssVariables";
.presBox-cont {
cursor: auto;
@@ -889,7 +889,7 @@
height: 13;
font-size: 12;
display: flex;
- background-color: #white;
+ background-color: $white;
}
.subtitle {
@@ -926,7 +926,7 @@
.presBox-buttons {
position: relative;
width: 100%;
- background: gray;
+ background: $medium-gray;
min-height: 35px;
padding-top: 5px;
padding-bottom: 5px;
diff --git a/src/client/views/nodes/PresBox.tsx b/src/client/views/nodes/trails/PresBox.tsx
index f3fb6ff17..5cb9866f8 100644
--- a/src/client/views/nodes/PresBox.tsx
+++ b/src/client/views/nodes/trails/PresBox.tsx
@@ -5,67 +5,33 @@ import { action, computed, IReactionDisposer, observable, ObservableMap, reactio
import { observer } from "mobx-react";
import { ColorState, SketchPicker } from "react-color";
import { Bounce, Fade, Flip, LightSpeed, Roll, Rotate, Zoom } from 'react-reveal';
-import { Doc, DocListCast, DocListCastAsync, FieldResult } from "../../../fields/Doc";
-import { documentSchema } from "../../../fields/documentSchemas";
-import { InkTool } from "../../../fields/InkField";
-import { List } from "../../../fields/List";
-import { PrefetchProxy } from "../../../fields/Proxy";
-import { listSpec, makeInterface } from "../../../fields/Schema";
-import { ScriptField } from "../../../fields/ScriptField";
-import { BoolCast, Cast, NumCast, StrCast } from "../../../fields/Types";
-import { returnFalse, returnOne, returnTrue, emptyFunction } from '../../../Utils';
-import { Docs } from "../../documents/Documents";
-import { DocumentType } from "../../documents/DocumentTypes";
-import { CurrentUserUtils } from "../../util/CurrentUserUtils";
-import { DocumentManager } from "../../util/DocumentManager";
-import { Scripting } from "../../util/Scripting";
-import { SelectionManager } from "../../util/SelectionManager";
-import { undoBatch, UndoManager } from "../../util/UndoManager";
-import { CollectionDockingView } from "../collections/CollectionDockingView";
-import { CollectionView, CollectionViewType } from "../collections/CollectionView";
-import { TabDocView } from "../collections/TabDocView";
-import { ViewBoxBaseComponent } from "../DocComponent";
-import { CollectionFreeFormDocumentView } from "./CollectionFreeFormDocumentView";
-import { FieldView, FieldViewProps } from './FieldView';
+import { Doc, DocListCast, DocListCastAsync, FieldResult } from "../../../../fields/Doc";
+import { documentSchema } from "../../../../fields/documentSchemas";
+import { InkTool } from "../../../../fields/InkField";
+import { List } from "../../../../fields/List";
+import { PrefetchProxy } from "../../../../fields/Proxy";
+import { listSpec, makeInterface } from "../../../../fields/Schema";
+import { ScriptField } from "../../../../fields/ScriptField";
+import { BoolCast, Cast, NumCast, StrCast } from "../../../../fields/Types";
+import { emptyFunction, returnFalse, returnOne, returnTrue } from '../../../../Utils';
+import { Docs } from "../../../documents/Documents";
+import { DocumentType } from "../../../documents/DocumentTypes";
+import { CurrentUserUtils } from "../../../util/CurrentUserUtils";
+import { DocumentManager } from "../../../util/DocumentManager";
+import { Scripting } from "../../../util/Scripting";
+import { SelectionManager } from "../../../util/SelectionManager";
+import { undoBatch, UndoManager } from "../../../util/UndoManager";
+import { CollectionDockingView } from "../../collections/CollectionDockingView";
+import { CollectionView, CollectionViewType } from "../../collections/CollectionView";
+import { TabDocView } from "../../collections/TabDocView";
+import { ViewBoxBaseComponent } from "../../DocComponent";
+import { Colors } from "../../global/globalEnums";
+import { LightboxView } from "../../LightboxView";
+import { CollectionFreeFormDocumentView } from "../CollectionFreeFormDocumentView";
+import { FieldView, FieldViewProps } from '../FieldView';
import "./PresBox.scss";
import Color = require("color");
-import { LightboxView } from "../LightboxView";
-
-export enum PresMovement {
- Zoom = "zoom",
- Pan = "pan",
- Jump = "jump",
- None = "none",
-}
-
-export enum PresEffect {
- Zoom = "Zoom",
- Lightspeed = "Lightspeed",
- Fade = "Fade in",
- Flip = "Flip",
- Rotate = "Rotate",
- Bounce = "Bounce",
- Roll = "Roll",
- None = "None",
- Left = "left",
- Right = "right",
- Center = "center",
- Top = "top",
- Bottom = "bottom"
-}
-
-enum PresStatus {
- Autoplay = "auto",
- Manual = "manual",
- Edit = "edit"
-}
-
-export enum PresColor {
- LightBlue = "#AEDDF8",
- DarkBlue = "#5B9FDD",
- LightBackground = "#ececec",
- SlideBackground = "#d5dce2",
-}
+import { PresEffect, PresStatus, PresMovement } from "./PresEnums";
export class PinProps {
audioRange?: boolean;
@@ -1198,9 +1164,9 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
{this.scrollable ? "Scroll to pinned view" : !isPinWithView ? "No movement" : "Pan & Zoom to pinned view"}
</div>
:
- <div className="presBox-dropdown" onClick={action(e => { e.stopPropagation(); this.openMovementDropdown = !this.openMovementDropdown; })} style={{ borderBottomLeftRadius: this.openMovementDropdown ? 0 : 5, border: this.openMovementDropdown ? `solid 2px ${PresColor.DarkBlue}` : 'solid 1px black' }}>
+ <div className="presBox-dropdown" onClick={action(e => { e.stopPropagation(); this.openMovementDropdown = !this.openMovementDropdown; })} style={{ borderBottomLeftRadius: this.openMovementDropdown ? 0 : 5, border: this.openMovementDropdown ? `solid 2px ${Colors.MEDIUM_BLUE}` : 'solid 1px black' }}>
{this.setMovementName(activeItem.presMovement, activeItem)}
- <FontAwesomeIcon className='presBox-dropdownIcon' style={{ gridColumn: 2, color: this.openMovementDropdown ? PresColor.DarkBlue : 'black' }} icon={"angle-down"} />
+ <FontAwesomeIcon className='presBox-dropdownIcon' style={{ gridColumn: 2, color: this.openMovementDropdown ? Colors.MEDIUM_BLUE : 'black' }} icon={"angle-down"} />
<div className={'presBox-dropdownOptions'} id={'presBoxMovementDropdown'} onPointerDown={e => e.stopPropagation()} style={{ display: this.openMovementDropdown ? "grid" : "none" }}>
<div className={`presBox-dropdownOption ${activeItem.presMovement === PresMovement.None ? "active" : ""}`} onPointerDown={e => e.stopPropagation()} onClick={() => this.updateMovement(PresMovement.None)}>None</div>
<div className={`presBox-dropdownOption ${activeItem.presMovement === PresMovement.Zoom ? "active" : ""}`} onPointerDown={e => e.stopPropagation()} onClick={() => this.updateMovement(PresMovement.Zoom)}>Pan {"&"} Zoom</div>
@@ -1245,7 +1211,7 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
<div className="ribbon-doubleButton">
{isPresCollection ? (null) : <Tooltip title={<><div className="dash-tooltip">{"Hide before presented"}</div></>}><div className={`ribbon-toggle ${activeItem.presHideBefore ? "active" : ""}`} onClick={() => this.updateHideBefore(activeItem)}>Hide before</div></Tooltip>}
{isPresCollection ? (null) : <Tooltip title={<><div className="dash-tooltip">{"Hide after presented"}</div></>}><div className={`ribbon-toggle ${activeItem.presHideAfter ? "active" : ""}`} onClick={() => this.updateHideAfter(activeItem)}>Hide after</div></Tooltip>}
- <Tooltip title={<><div className="dash-tooltip">{"Open in lightbox view"}</div></>}><div className="ribbon-toggle" style={{ backgroundColor: activeItem.openDocument ? PresColor.LightBlue : "" }} onClick={() => this.updateOpenDoc(activeItem)}>Lightbox</div></Tooltip>
+ <Tooltip title={<><div className="dash-tooltip">{"Open in lightbox view"}</div></>}><div className="ribbon-toggle" style={{ backgroundColor: activeItem.openDocument ? Colors.LIGHT_BLUE : "" }} onClick={() => this.updateOpenDoc(activeItem)}>Lightbox</div></Tooltip>
</div>
{(type === DocumentType.AUDIO || type === DocumentType.VID) ? (null) : <>
<div className="ribbon-doubleButton" >
@@ -1280,9 +1246,9 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
</div>
{isPresCollection ? (null) : <div className="ribbon-box">
Effects
- <div className="presBox-dropdown" onClick={action(e => { e.stopPropagation(); this.openEffectDropdown = !this.openEffectDropdown; })} style={{ borderBottomLeftRadius: this.openEffectDropdown ? 0 : 5, border: this.openEffectDropdown ? `solid 2px ${PresColor.DarkBlue}` : 'solid 1px black' }}>
+ <div className="presBox-dropdown" onClick={action(e => { e.stopPropagation(); this.openEffectDropdown = !this.openEffectDropdown; })} style={{ borderBottomLeftRadius: this.openEffectDropdown ? 0 : 5, border: this.openEffectDropdown ? `solid 2px ${Colors.MEDIUM_BLUE}` : 'solid 1px black' }}>
{effect}
- <FontAwesomeIcon className='presBox-dropdownIcon' style={{ gridColumn: 2, color: this.openEffectDropdown ? PresColor.DarkBlue : 'black' }} icon={"angle-down"} />
+ <FontAwesomeIcon className='presBox-dropdownIcon' style={{ gridColumn: 2, color: this.openEffectDropdown ? Colors.MEDIUM_BLUE : 'black' }} icon={"angle-down"} />
<div className={'presBox-dropdownOptions'} id={'presBoxMovementDropdown'} style={{ display: this.openEffectDropdown ? "grid" : "none" }} onPointerDown={e => e.stopPropagation()}>
<div className={`presBox-dropdownOption ${targetDoc.presEffect === PresEffect.None || !targetDoc.presEffect ? "active" : ""}`} onPointerDown={e => e.stopPropagation()} onClick={() => this.updateEffect(PresEffect.None)}>None</div>
<div className={`presBox-dropdownOption ${targetDoc.presEffect === PresEffect.Fade ? "active" : ""}`} onPointerDown={e => e.stopPropagation()} onClick={() => this.updateEffect(PresEffect.Fade)}>Fade In</div>
@@ -1299,11 +1265,11 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
</div>
</div>
<div className="effectDirection" style={{ display: effect === 'None' ? "none" : "grid", width: 40 }}>
- <Tooltip title={<><div className="dash-tooltip">{"Enter from left"}</div></>}><div style={{ gridColumn: 1, gridRow: 2, justifySelf: 'center', color: targetDoc.presEffectDirection === PresEffect.Left ? PresColor.LightBlue : "black", cursor: "pointer" }} onClick={() => this.updateEffectDirection(PresEffect.Left)}><FontAwesomeIcon icon={"angle-right"} /></div></Tooltip>
- <Tooltip title={<><div className="dash-tooltip">{"Enter from right"}</div></>}><div style={{ gridColumn: 3, gridRow: 2, justifySelf: 'center', color: targetDoc.presEffectDirection === PresEffect.Right ? PresColor.LightBlue : "black", cursor: "pointer" }} onClick={() => this.updateEffectDirection(PresEffect.Right)}><FontAwesomeIcon icon={"angle-left"} /></div></Tooltip>
- <Tooltip title={<><div className="dash-tooltip">{"Enter from top"}</div></>}><div style={{ gridColumn: 2, gridRow: 1, justifySelf: 'center', color: targetDoc.presEffectDirection === PresEffect.Top ? PresColor.LightBlue : "black", cursor: "pointer" }} onClick={() => this.updateEffectDirection(PresEffect.Top)}><FontAwesomeIcon icon={"angle-down"} /></div></Tooltip>
- <Tooltip title={<><div className="dash-tooltip">{"Enter from bottom"}</div></>}><div style={{ gridColumn: 2, gridRow: 3, justifySelf: 'center', color: targetDoc.presEffectDirection === PresEffect.Bottom ? PresColor.LightBlue : "black", cursor: "pointer" }} onClick={() => this.updateEffectDirection(PresEffect.Bottom)}><FontAwesomeIcon icon={"angle-up"} /></div></Tooltip>
- <Tooltip title={<><div className="dash-tooltip">{"Enter from center"}</div></>}><div style={{ gridColumn: 2, gridRow: 2, width: 10, height: 10, alignSelf: 'center', justifySelf: 'center', border: targetDoc.presEffectDirection === PresEffect.Center || !targetDoc.presEffectDirection ? `solid 2px ${PresColor.LightBlue}` : "solid 2px black", borderRadius: "100%", cursor: "pointer" }} onClick={() => this.updateEffectDirection(PresEffect.Center)}></div></Tooltip>
+ <Tooltip title={<><div className="dash-tooltip">{"Enter from left"}</div></>}><div style={{ gridColumn: 1, gridRow: 2, justifySelf: 'center', color: targetDoc.presEffectDirection === PresEffect.Left ? Colors.LIGHT_BLUE : "black", cursor: "pointer" }} onClick={() => this.updateEffectDirection(PresEffect.Left)}><FontAwesomeIcon icon={"angle-right"} /></div></Tooltip>
+ <Tooltip title={<><div className="dash-tooltip">{"Enter from right"}</div></>}><div style={{ gridColumn: 3, gridRow: 2, justifySelf: 'center', color: targetDoc.presEffectDirection === PresEffect.Right ? Colors.LIGHT_BLUE : "black", cursor: "pointer" }} onClick={() => this.updateEffectDirection(PresEffect.Right)}><FontAwesomeIcon icon={"angle-left"} /></div></Tooltip>
+ <Tooltip title={<><div className="dash-tooltip">{"Enter from top"}</div></>}><div style={{ gridColumn: 2, gridRow: 1, justifySelf: 'center', color: targetDoc.presEffectDirection === PresEffect.Top ? Colors.LIGHT_BLUE : "black", cursor: "pointer" }} onClick={() => this.updateEffectDirection(PresEffect.Top)}><FontAwesomeIcon icon={"angle-down"} /></div></Tooltip>
+ <Tooltip title={<><div className="dash-tooltip">{"Enter from bottom"}</div></>}><div style={{ gridColumn: 2, gridRow: 3, justifySelf: 'center', color: targetDoc.presEffectDirection === PresEffect.Bottom ? Colors.LIGHT_BLUE : "black", cursor: "pointer" }} onClick={() => this.updateEffectDirection(PresEffect.Bottom)}><FontAwesomeIcon icon={"angle-up"} /></div></Tooltip>
+ <Tooltip title={<><div className="dash-tooltip">{"Enter from center"}</div></>}><div style={{ gridColumn: 2, gridRow: 2, width: 10, height: 10, alignSelf: 'center', justifySelf: 'center', border: targetDoc.presEffectDirection === PresEffect.Center || !targetDoc.presEffectDirection ? `solid 2px ${Colors.LIGHT_BLUE}` : "solid 2px black", borderRadius: "100%", cursor: "pointer" }} onClick={() => this.updateEffectDirection(PresEffect.Center)}></div></Tooltip>
</div>
</div>}
<div className="ribbon-final-box">
@@ -1356,7 +1322,7 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
<>
{this.panable || this.scrollable || this.targetDoc.type === DocumentType.COMPARISON ? 'Pinned view' : (null)}
<div className="ribbon-doubleButton">
- <Tooltip title={<><div className="dash-tooltip">{activeItem.presPinView ? "Turn off pin with view" : "Turn on pin with view"}</div></>}><div className="ribbon-toggle" style={{ width: 20, padding: 0, backgroundColor: activeItem.presPinView ? PresColor.LightBlue : "" }}
+ <Tooltip title={<><div className="dash-tooltip">{activeItem.presPinView ? "Turn off pin with view" : "Turn on pin with view"}</div></>}><div className="ribbon-toggle" style={{ width: 20, padding: 0, backgroundColor: activeItem.presPinView ? Colors.LIGHT_BLUE : "" }}
onClick={() => {
activeItem.presPinView = !activeItem.presPinView;
targetDoc.presPinView = activeItem.presPinView;
@@ -1496,7 +1462,7 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
<div className="slider-text" style={{ fontWeight: 500 }}>
Start time (s)
</div>
- <div id={"startTime"} className="slider-number" style={{ backgroundColor: PresColor.LightBackground }}>
+ <div id={"startTime"} className="slider-number" style={{ backgroundColor: Colors.LIGHT_GRAY }}>
<input className="presBox-input"
style={{ textAlign: 'center', width: 30, height: 15, fontSize: 10 }}
type="number" value={NumCast(activeItem.presStartTime)}
@@ -1508,7 +1474,7 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
<div className="slider-text" style={{ fontWeight: 500 }}>
Duration (s)
</div>
- <div className="slider-number" style={{ backgroundColor: PresColor.LightBlue }}>
+ <div className="slider-number" style={{ backgroundColor: Colors.LIGHT_BLUE }}>
{Math.round((NumCast(activeItem.presEndTime) - NumCast(activeItem.presStartTime)) * 10) / 10}
</div>
</div>
@@ -1516,7 +1482,7 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
<div className="slider-text" style={{ fontWeight: 500 }}>
End time (s)
</div>
- <div id={"endTime"} className="slider-number" style={{ backgroundColor: PresColor.LightBackground }}>
+ <div id={"endTime"} className="slider-number" style={{ backgroundColor: Colors.LIGHT_GRAY }}>
<input className="presBox-input"
style={{ textAlign: 'center', width: 30, height: 15, fontSize: 10 }}
type="number" value={NumCast(activeItem.presEndTime)}
@@ -1534,16 +1500,16 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
this._batch = UndoManager.StartBatch("presEndTime");
const endBlock = document.getElementById("endTime");
if (endBlock) {
- endBlock.style.color = PresColor.LightBackground;
- endBlock.style.backgroundColor = PresColor.DarkBlue;
+ endBlock.style.color = Colors.LIGHT_GRAY;
+ endBlock.style.backgroundColor = Colors.MEDIUM_BLUE;
}
}}
onPointerUp={() => {
this._batch?.end();
const endBlock = document.getElementById("endTime");
if (endBlock) {
- endBlock.style.color = "black";
- endBlock.style.backgroundColor = PresColor.LightBackground;
+ endBlock.style.color = Colors.BLACK;
+ endBlock.style.backgroundColor = Colors.LIGHT_GRAY;
}
}}
onChange={(e: React.ChangeEvent<HTMLInputElement>) => {
@@ -1558,16 +1524,16 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
this._batch = UndoManager.StartBatch("presStartTime");
const startBlock = document.getElementById("startTime");
if (startBlock) {
- startBlock.style.color = PresColor.LightBackground;
- startBlock.style.backgroundColor = PresColor.DarkBlue;
+ startBlock.style.color = Colors.LIGHT_GRAY;
+ startBlock.style.backgroundColor = Colors.MEDIUM_BLUE;
}
}}
onPointerUp={() => {
this._batch?.end();
const startBlock = document.getElementById("startTime");
if (startBlock) {
- startBlock.style.color = "black";
- startBlock.style.backgroundColor = PresColor.LightBackground;
+ startBlock.style.color = Colors.BLACK;
+ startBlock.style.backgroundColor = Colors.LIGHT_GRAY;
}
}}
onChange={(e: React.ChangeEvent<HTMLInputElement>) => {
@@ -1651,15 +1617,15 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
<div>
<div className={'presBox-toolbar-dropdown'} style={{ display: this.newDocumentTools && this.layoutDoc.presStatus === "edit" ? "inline-flex" : "none" }} onClick={e => e.stopPropagation()} onPointerUp={e => e.stopPropagation()} onPointerDown={e => e.stopPropagation()}>
<div className="layout-container" style={{ height: 'max-content' }}>
- <div className="layout" style={{ border: this.layout === 'blank' ? `solid 2px ${PresColor.DarkBlue}` : '' }} onClick={action(() => { this.layout = 'blank'; this.createNewSlide(this.layout); })} />
- <div className="layout" style={{ border: this.layout === 'title' ? `solid 2px ${PresColor.DarkBlue}` : '' }} onClick={action(() => { this.layout = 'title'; this.createNewSlide(this.layout); })}>
+ <div className="layout" style={{ border: this.layout === 'blank' ? `solid 2px ${Colors.MEDIUM_BLUE}` : '' }} onClick={action(() => { this.layout = 'blank'; this.createNewSlide(this.layout); })} />
+ <div className="layout" style={{ border: this.layout === 'title' ? `solid 2px ${Colors.MEDIUM_BLUE}` : '' }} onClick={action(() => { this.layout = 'title'; this.createNewSlide(this.layout); })}>
<div className="title">Title</div>
<div className="subtitle">Subtitle</div>
</div>
- <div className="layout" style={{ border: this.layout === 'header' ? `solid 2px ${PresColor.DarkBlue}` : '' }} onClick={action(() => { this.layout = 'header'; this.createNewSlide(this.layout); })}>
+ <div className="layout" style={{ border: this.layout === 'header' ? `solid 2px ${Colors.MEDIUM_BLUE}` : '' }} onClick={action(() => { this.layout = 'header'; this.createNewSlide(this.layout); })}>
<div className="title" style={{ alignSelf: 'center', fontSize: 10 }}>Section header</div>
</div>
- <div className="layout" style={{ border: this.layout === 'content' ? `solid 2px ${PresColor.DarkBlue}` : '' }} onClick={action(() => { this.layout = 'content'; this.createNewSlide(this.layout); })}>
+ <div className="layout" style={{ border: this.layout === 'content' ? `solid 2px ${Colors.MEDIUM_BLUE}` : '' }} onClick={action(() => { this.layout = 'content'; this.createNewSlide(this.layout); })}>
<div className="title" style={{ alignSelf: 'center' }}>Title</div>
<div className="content">Text goes here</div>
</div>
@@ -1691,26 +1657,26 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
<div className="ribbon-box">
Choose type:
<div className="ribbon-doubleButton">
- <div title="Text" className={'ribbon-toggle'} style={{ background: this.addFreeform ? "" : PresColor.LightBlue }} onClick={action(() => this.addFreeform = !this.addFreeform)}>Text</div>
- <div title="Freeform" className={'ribbon-toggle'} style={{ background: this.addFreeform ? PresColor.LightBlue : "" }} onClick={action(() => this.addFreeform = !this.addFreeform)}>Freeform</div>
+ <div title="Text" className={'ribbon-toggle'} style={{ background: this.addFreeform ? "" : Colors.LIGHT_BLUE }} onClick={action(() => this.addFreeform = !this.addFreeform)}>Text</div>
+ <div title="Freeform" className={'ribbon-toggle'} style={{ background: this.addFreeform ? Colors.LIGHT_BLUE : "" }} onClick={action(() => this.addFreeform = !this.addFreeform)}>Freeform</div>
</div>
</div>
<div className="ribbon-box" style={{ display: this.addFreeform ? "grid" : "none" }}>
Preset layouts:
<div className="layout-container" style={{ height: this.openLayouts ? 'max-content' : '75px' }}>
- <div className="layout" style={{ border: this.layout === 'blank' ? `solid 2px ${PresColor.DarkBlue}` : '' }} onClick={action(() => this.layout = 'blank')} />
- <div className="layout" style={{ border: this.layout === 'title' ? `solid 2px ${PresColor.DarkBlue}` : '' }} onClick={action(() => this.layout = 'title')}>
+ <div className="layout" style={{ border: this.layout === 'blank' ? `solid 2px ${Colors.MEDIUM_BLUE}` : '' }} onClick={action(() => this.layout = 'blank')} />
+ <div className="layout" style={{ border: this.layout === 'title' ? `solid 2px ${Colors.MEDIUM_BLUE}` : '' }} onClick={action(() => this.layout = 'title')}>
<div className="title">Title</div>
<div className="subtitle">Subtitle</div>
</div>
- <div className="layout" style={{ border: this.layout === 'header' ? `solid 2px ${PresColor.DarkBlue}` : '' }} onClick={action(() => this.layout = 'header')}>
+ <div className="layout" style={{ border: this.layout === 'header' ? `solid 2px ${Colors.MEDIUM_BLUE}` : '' }} onClick={action(() => this.layout = 'header')}>
<div className="title" style={{ alignSelf: 'center', fontSize: 10 }}>Section header</div>
</div>
- <div className="layout" style={{ border: this.layout === 'content' ? `solid 2px ${PresColor.DarkBlue}` : '' }} onClick={action(() => this.layout = 'content')}>
+ <div className="layout" style={{ border: this.layout === 'content' ? `solid 2px ${Colors.MEDIUM_BLUE}` : '' }} onClick={action(() => this.layout = 'content')}>
<div className="title" style={{ alignSelf: 'center' }}>Title</div>
<div className="content">Text goes here</div>
</div>
- <div className="layout" style={{ border: this.layout === 'twoColumns' ? `solid 2px ${PresColor.DarkBlue}` : '' }} onClick={action(() => this.layout = 'twoColumns')}>
+ <div className="layout" style={{ border: this.layout === 'twoColumns' ? `solid 2px ${Colors.MEDIUM_BLUE}` : '' }} onClick={action(() => this.layout = 'twoColumns')}>
<div className="title" style={{ alignSelf: 'center', gridColumn: '1/3' }}>Title</div>
<div className="content" style={{ gridColumn: 1, gridRow: 2 }}>Column one text</div>
<div className="content" style={{ gridColumn: 2, gridRow: 2 }}>Column two text</div>
@@ -1869,8 +1835,8 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
<div className="ribbon-box">
{this.stringType} selected
<div className="ribbon-doubleButton" style={{ borderTop: 'solid 1px darkgrey', display: (targetDoc.type === DocumentType.COL && targetDoc._viewType === 'freeform') || targetDoc.type === DocumentType.IMG || targetDoc.type === DocumentType.RTF ? "inline-flex" : "none" }}>
- <div className="ribbon-toggle" style={{ backgroundColor: activeItem.presProgressivize ? PresColor.LightBlue : "" }} onClick={this.progressivizeChild}>Contents</div>
- <div className="ribbon-toggle" style={{ opacity: activeItem.presProgressivize ? 1 : 0.4, backgroundColor: targetDoc.editProgressivize ? PresColor.LightBlue : "" }} onClick={this.editProgressivize}>Edit</div>
+ <div className="ribbon-toggle" style={{ backgroundColor: activeItem.presProgressivize ? Colors.LIGHT_BLUE : "" }} onClick={this.progressivizeChild}>Contents</div>
+ <div className="ribbon-toggle" style={{ opacity: activeItem.presProgressivize ? 1 : 0.4, backgroundColor: targetDoc.editProgressivize ? Colors.LIGHT_BLUE : "" }} onClick={this.editProgressivize}>Edit</div>
</div>
<div className="ribbon-doubleButton" style={{ display: activeItem.presProgressivize ? "inline-flex" : "none" }}>
<div className="presBox-subheading">Active text color</div>
@@ -1885,12 +1851,12 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
</div>
{this.viewedColorPicker}
<div className="ribbon-doubleButton" style={{ borderTop: 'solid 1px darkgrey', display: (targetDoc.type === DocumentType.COL && targetDoc._viewType === 'freeform') || targetDoc.type === DocumentType.IMG ? "inline-flex" : "none" }}>
- <div className="ribbon-toggle" style={{ backgroundColor: activeItem.zoomProgressivize ? PresColor.LightBlue : "" }} onClick={this.progressivizeZoom}>Zoom</div>
- <div className="ribbon-toggle" style={{ opacity: activeItem.zoomProgressivize ? 1 : 0.4, backgroundColor: activeItem.editZoomProgressivize ? PresColor.LightBlue : "" }} onClick={this.editZoomProgressivize}>Edit</div>
+ <div className="ribbon-toggle" style={{ backgroundColor: activeItem.zoomProgressivize ? Colors.LIGHT_BLUE : "" }} onClick={this.progressivizeZoom}>Zoom</div>
+ <div className="ribbon-toggle" style={{ opacity: activeItem.zoomProgressivize ? 1 : 0.4, backgroundColor: activeItem.editZoomProgressivize ? Colors.LIGHT_BLUE : "" }} onClick={this.editZoomProgressivize}>Edit</div>
</div>
<div className="ribbon-doubleButton" style={{ borderTop: 'solid 1px darkgrey', display: targetDoc._viewType === "stacking" || targetDoc.type === DocumentType.PDF || targetDoc.type === DocumentType.WEB || targetDoc.type === DocumentType.RTF ? "inline-flex" : "none" }}>
- <div className="ribbon-toggle" style={{ backgroundColor: activeItem.scrollProgressivize ? PresColor.LightBlue : "" }} onClick={this.progressivizeScroll}>Scroll</div>
- <div className="ribbon-toggle" style={{ opacity: activeItem.scrollProgressivize ? 1 : 0.4, backgroundColor: targetDoc.editScrollProgressivize ? PresColor.LightBlue : "" }} onClick={this.editScrollProgressivize}>Edit</div>
+ <div className="ribbon-toggle" style={{ backgroundColor: activeItem.scrollProgressivize ? Colors.LIGHT_BLUE : "" }} onClick={this.progressivizeScroll}>Scroll</div>
+ <div className="ribbon-toggle" style={{ opacity: activeItem.scrollProgressivize ? 1 : 0.4, backgroundColor: targetDoc.editScrollProgressivize ? Colors.LIGHT_BLUE : "" }} onClick={this.editScrollProgressivize}>Edit</div>
</div>
</div>
<div className="ribbon-final-box">
@@ -1900,7 +1866,7 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
<div key="back" title="back frame" className="backKeyframe" onClick={e => { e.stopPropagation(); this.prevKeyframe(targetDoc, activeItem); }}>
<FontAwesomeIcon icon={"caret-left"} size={"lg"} />
</div>
- <div key="num" title="toggle view all" className="numKeyframe" style={{ color: targetDoc.keyFrameEditing ? "white" : "black", backgroundColor: targetDoc.keyFrameEditing ? PresColor.DarkBlue : PresColor.LightBlue }}
+ <div key="num" title="toggle view all" className="numKeyframe" style={{ color: targetDoc.keyFrameEditing ? "white" : "black", backgroundColor: targetDoc.keyFrameEditing ? Colors.MEDIUM_BLUE : Colors.LIGHT_BLUE }}
onClick={action(() => targetDoc.keyFrameEditing = !targetDoc.keyFrameEditing)} >
{NumCast(targetDoc._currentFrame)}
</div>
@@ -1914,7 +1880,7 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
{this.frameListHeader}
{this.frameList}
</div>
- <div className="ribbon-toggle" style={{ height: 20, backgroundColor: PresColor.LightBlue }} onClick={() => console.log(" TODO: play frames")}>Play</div>
+ <div className="ribbon-toggle" style={{ height: 20, backgroundColor: Colors.LIGHT_BLUE }} onClick={() => console.log(" TODO: play frames")}>Play</div>
</div>
</div>
</div>
@@ -2130,7 +2096,7 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
tags.push(<div style={{ position: 'absolute', display: doc.displayMovement ? "block" : "none" }}>{this.checkMovementLists(doc, doc["x-indexed"], doc["y-indexed"])}</div>);
}
tags.push(
- <div className="progressivizeButton" key={index} onPointerLeave={() => { if (NumCast(targetDoc._currentFrame) < NumCast(doc.appearFrame)) doc.opacity = 0; }} onPointerOver={() => { if (NumCast(targetDoc._currentFrame) < NumCast(doc.appearFrame)) doc.opacity = 0.5; }} onClick={e => { this.toggleDisplayMovement(doc); e.stopPropagation(); }} style={{ backgroundColor: doc.displayMovement ? PresColor.LightBlue : "#c8c8c8", top: NumCast(doc.y), left: NumCast(doc.x) }}>
+ <div className="progressivizeButton" key={index} onPointerLeave={() => { if (NumCast(targetDoc._currentFrame) < NumCast(doc.appearFrame)) doc.opacity = 0; }} onPointerOver={() => { if (NumCast(targetDoc._currentFrame) < NumCast(doc.appearFrame)) doc.opacity = 0.5; }} onClick={e => { this.toggleDisplayMovement(doc); e.stopPropagation(); }} style={{ backgroundColor: doc.displayMovement ? Colors.LIGHT_BLUE : "#c8c8c8", top: NumCast(doc.y), left: NumCast(doc.x) }}>
<div className="progressivizeButton-prev"><FontAwesomeIcon icon={"caret-left"} size={"lg"} onClick={e => { e.stopPropagation(); this.prevAppearFrame(doc, index); }} /></div>
<div className="progressivizeButton-frame">{doc.appearFrame}</div>
<div className="progressivizeButton-next"><FontAwesomeIcon icon={"caret-right"} size={"lg"} onClick={e => { e.stopPropagation(); this.nextAppearFrame(doc, index); }} /></div>
@@ -2213,6 +2179,8 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
const mode = StrCast(this.rootDoc._viewType) as CollectionViewType;
const isMini: boolean = this.toolbarWidth <= 100;
const presKeyEvents: boolean = (this.isPres && this._presKeyEventsActive && this.rootDoc === Doc.UserDoc().activePresentation);
+ const activeColor = Colors.LIGHT_BLUE;
+ const inactiveColor = Colors.WHITE;
return (mode === CollectionViewType.Carousel3D) ? (null) : (
<div id="toolbarContainer" className={'presBox-toolbar'}>
{/* <Tooltip title={<><div className="dash-tooltip">{"Add new slide"}</div></>}><div className={`toolbar-button ${this.newDocumentTools ? "active" : ""}`} onClick={action(() => this.newDocumentTools = !this.newDocumentTools)}>
@@ -2220,7 +2188,7 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
<FontAwesomeIcon className={`dropdown ${this.newDocumentTools ? "active" : ""}`} icon={"angle-down"} />
</div></Tooltip> */}
<Tooltip title={<><div className="dash-tooltip">{"View paths"}</div></>}>
- <div style={{ opacity: this.childDocs.length > 1 && this.layoutDoc.presCollection ? 1 : 0.3, color: this._pathBoolean ? PresColor.DarkBlue : 'white', width: isMini ? "100%" : undefined }} className={"toolbar-button"} onClick={this.childDocs.length > 1 && this.layoutDoc.presCollection ? this.viewPaths : undefined}>
+ <div style={{ opacity: this.childDocs.length > 1 && this.layoutDoc.presCollection ? 1 : 0.3, color: this._pathBoolean ? Colors.MEDIUM_BLUE : 'white', width: isMini ? "100%" : undefined }} className={"toolbar-button"} onClick={this.childDocs.length > 1 && this.layoutDoc.presCollection ? this.viewPaths : undefined}>
<FontAwesomeIcon icon={"exchange-alt"} />
</div>
</Tooltip>
@@ -2229,7 +2197,7 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
<div className="toolbar-divider" />
{/* <Tooltip title={<><div className="dash-tooltip">{this._expandBoolean ? "Minimize all" : "Expand all"}</div></>}>
<div className={"toolbar-button"}
- style={{ color: this._expandBoolean ? PresColors.DarkBlue : 'white' }}
+ style={{ color: this._expandBoolean ? Colors.MEDIUM_BLUE : 'white' }}
onClick={this.toggleExpandMode}>
<FontAwesomeIcon icon={"eye"} />
</div>
@@ -2237,12 +2205,12 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
<div className="toolbar-divider" /> */}
<Tooltip title={<><div className="dash-tooltip">{presKeyEvents ? "Keys are active" : "Keys are not active - click anywhere on the presentation trail to activate keys"}</div></>}>
<div className="toolbar-button" style={{ cursor: presKeyEvents ? 'default' : 'pointer', position: 'absolute', right: 30, fontSize: 16 }}>
- <FontAwesomeIcon className={"toolbar-thumbtack"} icon={"keyboard"} style={{ color: presKeyEvents ? PresColor.DarkBlue : 'white' }} />
+ <FontAwesomeIcon className={"toolbar-thumbtack"} icon={"keyboard"} style={{ color: presKeyEvents ? activeColor : inactiveColor }} />
</div>
</Tooltip>
<Tooltip title={<><div className="dash-tooltip">{propTitle}</div></>}>
<div className="toolbar-button" style={{ position: 'absolute', right: 4, fontSize: 16 }} onClick={this.toggleProperties}>
- <FontAwesomeIcon className={"toolbar-thumbtack"} icon={propIcon} style={{ color: CurrentUserUtils.propertiesWidth > 0 ? PresColor.DarkBlue : 'white' }} />
+ <FontAwesomeIcon className={"toolbar-thumbtack"} icon={propIcon} style={{ color: CurrentUserUtils.propertiesWidth > 0 ? activeColor : inactiveColor }} />
</div>
</Tooltip>
</>
@@ -2379,7 +2347,7 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
const presStart: boolean = !this.layoutDoc.presLoop && (this.itemIndex === 0);
// Case 1: There are still other frames and should go through all frames before going to next slide
return (<div className="presPanelOverlay" style={{ display: this.layoutDoc.presStatus !== "edit" ? "inline-flex" : "none" }}>
- <Tooltip title={<><div className="dash-tooltip">{"Loop"}</div></>}><div className="presPanel-button" style={{ color: this.layoutDoc.presLoop ? PresColor.DarkBlue : 'white' }} onClick={() => this.layoutDoc.presLoop = !this.layoutDoc.presLoop}><FontAwesomeIcon icon={"redo-alt"} /></div></Tooltip>
+ <Tooltip title={<><div className="dash-tooltip">{"Loop"}</div></>}><div className="presPanel-button" style={{ color: this.layoutDoc.presLoop ? Colors.MEDIUM_BLUE : 'white' }} onClick={() => this.layoutDoc.presLoop = !this.layoutDoc.presLoop}><FontAwesomeIcon icon={"redo-alt"} /></div></Tooltip>
<div className="presPanel-divider"></div>
<div className="presPanel-button" style={{ opacity: presStart ? 0.4 : 1 }} onClick={() => { this.back(); if (this._presTimer) { clearTimeout(this._presTimer); this.layoutDoc.presStatus = PresStatus.Manual; } }}><FontAwesomeIcon icon={"arrow-left"} /></div>
<Tooltip title={<><div className="dash-tooltip">{this.layoutDoc.presStatus === PresStatus.Autoplay ? "Pause" : "Autoplay"}</div></>}><div className="presPanel-button" onClick={this.startOrPause}><FontAwesomeIcon icon={this.layoutDoc.presStatus === PresStatus.Autoplay ? "pause" : "play"} /></div></Tooltip>
@@ -2418,8 +2386,8 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
const presStart: boolean = !this.layoutDoc.presLoop && (this.itemIndex === 0);
return CurrentUserUtils.OverlayDocs.includes(this.rootDoc) ?
<div className="miniPres">
- <div className="presPanelOverlay" style={{ display: "inline-flex", height: 30, background: '#323232', top: 0, zIndex: 3000000, boxShadow: presKeyEvents ? '0 0 0px 3px ' + PresColor.DarkBlue : undefined }}>
- <Tooltip title={<><div className="dash-tooltip">{"Loop"}</div></>}><div className="presPanel-button" style={{ color: this.layoutDoc.presLoop ? PresColor.DarkBlue : undefined }} onClick={() => this.layoutDoc.presLoop = !this.layoutDoc.presLoop}><FontAwesomeIcon icon={"redo-alt"} /></div></Tooltip>
+ <div className="presPanelOverlay" style={{ display: "inline-flex", height: 30, background: '#323232', top: 0, zIndex: 3000000, boxShadow: presKeyEvents ? '0 0 0px 3px ' + Colors.MEDIUM_BLUE : undefined }}>
+ <Tooltip title={<><div className="dash-tooltip">{"Loop"}</div></>}><div className="presPanel-button" style={{ color: this.layoutDoc.presLoop ? Colors.MEDIUM_BLUE : undefined }} onClick={() => this.layoutDoc.presLoop = !this.layoutDoc.presLoop}><FontAwesomeIcon icon={"redo-alt"} /></div></Tooltip>
<div className="presPanel-divider"></div>
<div className="presPanel-button" style={{ opacity: presStart ? 0.4 : 1 }} onClick={() => { this.back(); if (this._presTimer) { clearTimeout(this._presTimer); this.layoutDoc.presStatus = PresStatus.Manual; } }}><FontAwesomeIcon icon={"arrow-left"} /></div>
<Tooltip title={<><div className="dash-tooltip">{this.layoutDoc.presStatus === PresStatus.Autoplay ? "Pause" : "Autoplay"}</div></>}><div className="presPanel-button" onClick={this.startOrPause}><FontAwesomeIcon icon={this.layoutDoc.presStatus === "auto" ? "pause" : "play"} /></div></Tooltip>
diff --git a/src/client/views/presentationview/PresElementBox.scss b/src/client/views/nodes/trails/PresElementBox.scss
index 1ad4b820e..1ad4b820e 100644
--- a/src/client/views/presentationview/PresElementBox.scss
+++ b/src/client/views/nodes/trails/PresElementBox.scss
diff --git a/src/client/views/presentationview/PresElementBox.tsx b/src/client/views/nodes/trails/PresElementBox.tsx
index f15d51764..5e713c3cf 100644
--- a/src/client/views/presentationview/PresElementBox.tsx
+++ b/src/client/views/nodes/trails/PresElementBox.tsx
@@ -2,27 +2,29 @@ import { FontAwesomeIcon } from "@fortawesome/react-fontawesome";
import { Tooltip } from "@material-ui/core";
import { action, computed, IReactionDisposer, observable, reaction } from "mobx";
import { observer } from "mobx-react";
-import { DataSym, Doc, Opt } from "../../../fields/Doc";
-import { documentSchema } from '../../../fields/documentSchemas';
-import { Id } from "../../../fields/FieldSymbols";
-import { createSchema, makeInterface } from '../../../fields/Schema';
-import { Cast, NumCast, StrCast } from "../../../fields/Types";
-import { emptyFunction, returnFalse, returnTrue, setupMoveUpEvents, emptyPath, returnEmptyDoclist } from "../../../Utils";
-import { DocumentType } from "../../documents/DocumentTypes";
-import { CurrentUserUtils } from "../../util/CurrentUserUtils";
-import { DocumentManager } from "../../util/DocumentManager";
-import { DragManager } from "../../util/DragManager";
-import { Transform } from "../../util/Transform";
-import { undoBatch } from "../../util/UndoManager";
-import { ViewBoxBaseComponent } from '../DocComponent';
-import { EditableView } from "../EditableView";
-import { DocumentView, DocumentViewProps } from "../nodes/DocumentView";
-import { FieldView, FieldViewProps } from '../nodes/FieldView';
-import { PresBox, PresColor, PresMovement } from "../nodes/PresBox";
-import { StyleProp } from "../StyleProvider";
+import { DataSym, Doc, Opt } from "../../../../fields/Doc";
+import { documentSchema } from '../../../../fields/documentSchemas';
+import { Id } from "../../../../fields/FieldSymbols";
+import { createSchema, makeInterface } from '../../../../fields/Schema';
+import { Cast, NumCast, StrCast } from "../../../../fields/Types";
+import { emptyFunction, returnFalse, returnTrue, setupMoveUpEvents, emptyPath, returnEmptyDoclist } from "../../../../Utils";
+import { DocumentType } from "../../../documents/DocumentTypes";
+import { CurrentUserUtils } from "../../../util/CurrentUserUtils";
+import { DocumentManager } from "../../../util/DocumentManager";
+import { DragManager } from "../../../util/DragManager";
+import { Transform } from "../../../util/Transform";
+import { undoBatch } from "../../../util/UndoManager";
+import { ViewBoxBaseComponent } from '../../DocComponent';
+import { EditableView } from "../../EditableView";
+import { DocumentView, DocumentViewProps } from "../../nodes/DocumentView";
+import { FieldView, FieldViewProps } from '../../nodes/FieldView';
+import { PresBox } from "./PresBox";
+import { Colors } from "../../global/globalEnums";
+import { StyleProp } from "../../StyleProvider";
import "./PresElementBox.scss";
import React = require("react");
-import { DocUtils } from "../../documents/Documents";
+import { DocUtils } from "../../../documents/Documents";
+import { PresMovement } from "./PresEnums";
export const presSchema = createSchema({
presentationTargetDoc: Doc,
@@ -210,11 +212,11 @@ export class PresElementBox extends ViewBoxBaseComponent<FieldViewProps, PresDoc
const height = slide.clientHeight;
const halfLine = height / 2;
if (y <= halfLine) {
- slide.style.borderTop = "solid 2px #5B9FDD";
+ slide.style.borderTop = `solid 2px ${Colors.MEDIUM_BLUE}`;
slide.style.borderBottom = "0px";
} else if (y > halfLine) {
slide.style.borderTop = "0px";
- slide.style.borderBottom = "solid 2px #5B9FDD";
+ slide.style.borderBottom = `solid 2px ${Colors.MEDIUM_BLUE}`;
}
}
document.removeEventListener("pointermove", this.onPointerMove);
@@ -292,7 +294,7 @@ export class PresElementBox extends ViewBoxBaseComponent<FieldViewProps, PresDoc
const miniView: boolean = this.toolbarWidth <= 110;
const presBox: Doc = this.presBox; //presBox
const presBoxColor: string = StrCast(presBox._backgroundColor);
- const presColorBool: boolean = presBoxColor ? (presBoxColor !== "white" && presBoxColor !== "transparent") : false;
+ const presColorBool: boolean = presBoxColor ? (presBoxColor !== Colors.WHITE && presBoxColor !== "transparent") : false;
const targetDoc: Doc = this.targetDoc;
const activeItem: Doc = this.rootDoc;
return (
@@ -300,7 +302,7 @@ export class PresElementBox extends ViewBoxBaseComponent<FieldViewProps, PresDoc
key={this.props.Document[Id] + this.indexInPres}
ref={this._itemRef}
style={{
- backgroundColor: presColorBool ? isSelected ? "rgba(250,250,250,0.3)" : "transparent" : isSelected ? "#AEDDF8" : "transparent",
+ backgroundColor: presColorBool ? isSelected ? "rgba(250,250,250,0.3)" : "transparent" : isSelected ? Colors.LIGHT_BLUE : "transparent",
opacity: this._dragging ? 0.3 : 1
}}
onClick={e => {
@@ -356,7 +358,7 @@ export class PresElementBox extends ViewBoxBaseComponent<FieldViewProps, PresDoc
style={{
zIndex: 1000 - this.indexInPres,
fontWeight: 700,
- backgroundColor: activeItem.groupWithUp ? presColorBool ? presBoxColor : PresColor.DarkBlue : undefined,
+ backgroundColor: activeItem.groupWithUp ? presColorBool ? presBoxColor : Colors.MEDIUM_BLUE : undefined,
height: activeItem.groupWithUp ? 53 : 18,
transform: activeItem.groupWithUp ? "translate(0, -17px)" : undefined
}}>
diff --git a/src/client/views/nodes/trails/PresEnums.ts b/src/client/views/nodes/trails/PresEnums.ts
new file mode 100644
index 000000000..93ab323fb
--- /dev/null
+++ b/src/client/views/nodes/trails/PresEnums.ts
@@ -0,0 +1,28 @@
+export enum PresMovement {
+ Zoom = "zoom",
+ Pan = "pan",
+ Jump = "jump",
+ None = "none",
+}
+
+export enum PresEffect {
+ Zoom = "Zoom",
+ Lightspeed = "Lightspeed",
+ Fade = "Fade in",
+ Flip = "Flip",
+ Rotate = "Rotate",
+ Bounce = "Bounce",
+ Roll = "Roll",
+ None = "None",
+ Left = "left",
+ Right = "right",
+ Center = "center",
+ Top = "top",
+ Bottom = "bottom"
+}
+
+export enum PresStatus {
+ Autoplay = "auto",
+ Manual = "manual",
+ Edit = "edit"
+} \ No newline at end of file
diff --git a/src/client/views/nodes/trails/index.ts b/src/client/views/nodes/trails/index.ts
new file mode 100644
index 000000000..8f3f7b03a
--- /dev/null
+++ b/src/client/views/nodes/trails/index.ts
@@ -0,0 +1,3 @@
+export * from "./PresBox";
+export * from "./PresElementBox";
+export * from "./PresEnums"; \ No newline at end of file
diff --git a/src/client/views/pdf/AnchorMenu.tsx b/src/client/views/pdf/AnchorMenu.tsx
index c24c4eaaf..70ca19842 100644
--- a/src/client/views/pdf/AnchorMenu.tsx
+++ b/src/client/views/pdf/AnchorMenu.tsx
@@ -10,6 +10,7 @@ import { AntimodeMenu, AntimodeMenuProps } from "../AntimodeMenu";
import { ButtonDropdown } from "../nodes/formattedText/RichTextMenu";
import "./AnchorMenu.scss";
import { SelectionManager } from "../../util/SelectionManager";
+import { LinkPopup } from "../linking/LinkPopup";
@observer
export class AnchorMenu extends AntimodeMenu<AntimodeMenuProps> {
@@ -38,6 +39,7 @@ export class AnchorMenu extends AntimodeMenu<AntimodeMenuProps> {
@observable private _valueValue: string = "";
@observable private _added: boolean = false;
@observable private highlightColor: string = "rgba(245, 230, 95, 0.616)";
+ @observable private _showLinkPopup: boolean = false;
@observable public _colorBtn = false;
@observable public Highlighting: boolean = false;
@@ -80,6 +82,14 @@ export class AnchorMenu extends AntimodeMenu<AntimodeMenuProps> {
}
}
+ @action
+ toggleLinkPopup = (e: React.MouseEvent) => {
+ //ignore the potential null type error because this method cannot be called unless the user selects text and clicks the link button
+ console.log(window.getSelection().toString())
+ //change popup visibility field to visible
+ this._showLinkPopup = !this._showLinkPopup;
+ }
+
@computed get highlighter() {
const button =
<button className="antimodeMenu-button color-preview-button" title="" key="highlighter-button" onClick={this.highlightClicked}>
@@ -136,6 +146,14 @@ export class AnchorMenu extends AntimodeMenu<AntimodeMenuProps> {
<FontAwesomeIcon icon="comment-alt" size="lg" />
</button>
</Tooltip>,
+
+ //NOTE: link popup is currently incomplete
+ // <Tooltip key="link" title={<div className="dash-tooltip">{"Link selected text to document or URL"}</div>}>
+ // <button className="antimodeMenu-button link" onPointerDown={this.toggleLinkPopup} style={{}}>
+ // <FontAwesomeIcon icon="link" size="lg" />
+ // </button>
+ // </Tooltip>,
+ // <LinkPopup showPopup={this._showLinkPopup} />
] : [
<Tooltip key="trash" title={<div className="dash-tooltip">{"Remove Link Anchor"}</div>}>
<button className="antimodeMenu-button" onPointerDown={this.Delete}>
diff --git a/src/client/views/pdf/PDFViewer.tsx b/src/client/views/pdf/PDFViewer.tsx
index 4a50dccf3..e8c7a4ab0 100644
--- a/src/client/views/pdf/PDFViewer.tsx
+++ b/src/client/views/pdf/PDFViewer.tsx
@@ -184,7 +184,8 @@ export class PDFViewer extends React.Component<IViewerProps> {
const mainCont = this._mainCont.current;
let focusSpeed: Opt<number>;
if (doc !== this.props.rootDoc && mainCont && this._pdfViewer) {
- const scrollTo = Utils.scrollIntoView(NumCast(doc.y), doc[HeightSym](), NumCast(this.props.layoutDoc._scrollTop), this.props.PanelHeight() / (this.props.scaling?.() || 1));
+ const windowHeight = this.props.PanelHeight() / (this.props.scaling?.() || 1);
+ const scrollTo = Utils.scrollIntoView(NumCast(doc.y), doc[HeightSym](), NumCast(this.props.layoutDoc._scrollTop), windowHeight, .1 * windowHeight);
if (scrollTo !== undefined) {
focusSpeed = 500;
diff --git a/src/client/views/topbar/TopBar.scss b/src/client/views/topbar/TopBar.scss
new file mode 100644
index 000000000..ebdf030e7
--- /dev/null
+++ b/src/client/views/topbar/TopBar.scss
@@ -0,0 +1,213 @@
+@import "../global/globalCssVariables";
+
+.topbar-container {
+ display: flex;
+ flex-direction: column;
+ width: 100%;
+ position: relative;
+ font-size: 10px;
+ line-height: 1;
+ overflow-y: auto;
+ overflow-x: visible;
+ background: $dark-gray;
+ overflow: visible;
+ z-index: 1000;
+
+ .topbar-bar {
+ height: $topbar-height;
+ display: grid;
+ grid-auto-columns: 33.3% 33.3% 33.3%;
+ align-items: center;
+ background-color: $dark-gray;
+
+ .topBar-icon {
+ cursor: pointer;
+ font-size: 12px;
+ width: fit-content;
+ display: flex;
+ justify-content: center;
+ gap: 4px;
+ align-items: center;
+ justify-self: center;
+ align-self: center;
+ border-radius: 5px;
+ padding: 5px;
+ transition: linear 0.1s;
+ color: $black;
+ background-color: $light-gray;
+ }
+
+ .topBar-icon:hover {
+ background-color: $light-blue;
+ }
+
+
+ .topbar-center {
+ grid-column: 2;
+ display: inline-flex;
+ justify-content: center;
+ align-items: center;
+ gap: 5px;
+
+ .topbar-lozenge-dashboard {
+ display: flex;
+
+ .topbar-dashboards {
+ display: inline-flex;
+ }
+
+ .topbar-dashSelect {
+ border: none;
+ background-color: $dark-gray;
+ color: $white;
+ font-family: 'Roboto';
+ font-size: 17;
+ font-weight: 500;
+
+ &:hover {
+ cursor: pointer;
+ }
+ }
+ }
+ }
+
+
+ .topbar-right {
+ grid-column: 3;
+ position: relative;
+ display: flex;
+ justify-content: flex-end;
+ gap: 5px;
+ margin-right: 5px;
+ }
+
+ .topbar-left {
+ grid-column: 1;
+ color: black;
+ font-family: 'Roboto';
+ position: relative;
+ display: flex;
+ width: 450;
+ gap: 5px;
+
+ .topBar-icon:hover {
+ background-color: $logout-red;
+ }
+
+ .topbar-lozenge-user,
+ .topbar-lozenge {
+ height: 23;
+ font-size: 12;
+ color: white;
+ font-family: 'Roboto';
+ font-weight: 400;
+ padding: 4px;
+ align-self: center;
+ margin-left: 7px;
+ display: flex;
+ align-items: center;
+
+ .topbar-dashSelect {
+ border: none;
+ background-color: transparent;
+ color: black;
+ font-family: 'Roboto';
+ font-size: 17;
+ font-weight: 500;
+
+ &:hover {
+ cursor: pointer;
+ }
+ }
+ }
+
+ .topbar-logoff {
+ border-radius: 3px;
+ background: olivedrab;
+ color: white;
+ display: none;
+ margin-left: 5px;
+ padding: 1px 2px 1px 2px;
+ cursor: pointer;
+ }
+
+ .topbar-logoff {
+ background: red;
+ }
+
+ .topbar-lozenge-user:hover {
+ .topbar-logoff {
+ display: inline-block;
+ }
+ }
+ }
+
+ .topbar-barChild {
+
+ &.topbar-collection {
+ flex: 0 1 auto;
+ margin-left: 2px;
+ margin-right: 2px
+ }
+
+ &.topbar-input {
+ margin:5px;
+ border-radius:20px;
+ border:$dark-gray;
+ display: block;
+ width: 130px;
+ -webkit-transition: width 0.4s;
+ transition: width 0.4s;
+ /* align-self: stretch; */
+ outline: none;
+
+ &:focus {
+ width: 500px;
+ outline: none;
+ }
+ }
+
+ &.topbar-filter {
+ align-self: stretch;
+
+ button {
+ transform: none;
+
+ &:hover {
+ transform: none;
+ }
+ }
+ }
+
+ &.topbar-submit {
+ margin-left: 2px;
+ margin-right: 2px
+ }
+
+ &.topbar-close {
+ color: $white;
+ max-height: $topbar-height;
+ }
+ }
+ }
+}
+
+.topbar-results {
+ display: flex;
+ flex-direction: column;
+ top: 300px;
+ display: flex;
+ flex-direction: column;
+ height: 100%;
+ overflow: visible;
+
+ .no-result {
+ width: 500px;
+ background: $light-gray;
+ padding: 10px;
+ height: 50px;
+ text-transform: uppercase;
+ text-align: left;
+ font-weight: bold;
+ }
+} \ No newline at end of file
diff --git a/src/client/views/topbar/TopBar.tsx b/src/client/views/topbar/TopBar.tsx
new file mode 100644
index 000000000..bd9935333
--- /dev/null
+++ b/src/client/views/topbar/TopBar.tsx
@@ -0,0 +1,67 @@
+import { FontAwesomeIcon } from "@fortawesome/react-fontawesome";
+import { observer } from "mobx-react";
+import * as React from 'react';
+import { Doc, DocListCast } from '../../../fields/Doc';
+import { Id } from '../../../fields/FieldSymbols';
+import { StrCast } from '../../../fields/Types';
+import { Utils } from '../../../Utils';
+import { CurrentUserUtils } from "../../util/CurrentUserUtils";
+import { SettingsManager } from "../../util/SettingsManager";
+import { undoBatch } from "../../util/UndoManager";
+import { Borders, Colors } from "../global/globalEnums";
+import "./TopBar.scss";
+
+/**
+ * REACT TYPE: FUNCTIONAL
+ * ABOUT: This is the topbar in Dash, which included the current Dashboard as well as access to information on the user
+ * and settings and help buttons. Future scope for this bar is to include the collaborators that are on the same Dashboard.
+ */
+@observer
+export class TopBar extends React.Component {
+ render() {
+ const myDashboards = DocListCast(CurrentUserUtils.MyDashboards.data);
+ return (
+ //TODO:glr Add support for light / dark mode
+ <div style={{ pointerEvents: "all" }} className="topbar-container">
+ <div className="topbar-bar" style={{ background: Colors.DARK_GRAY, borderBottom: Borders.STANDARD }}>
+ <div className="topbar-left">
+ <div className="topbar-lozenge-user">
+ {`${Doc.CurrentUserEmail}`}
+ </div>
+ <div className="topbar-icon" onClick={() => window.location.assign(Utils.prepend("/logout"))}>
+ {"Sign out"}
+ </div>
+ </div>
+ <div className="topbar-center" >
+ <div className="topbar-lozenge-dashboard">
+ <select className="topbar-dashSelect" onChange={e => CurrentUserUtils.openDashboard(Doc.UserDoc(), myDashboards[Number(e.target.value)])}
+ value={myDashboards.indexOf(CurrentUserUtils.ActiveDashboard)}
+ style={{ color: Colors.WHITE }}>
+ {myDashboards.map((dash, i) => <option key={dash[Id]} value={i}> {StrCast(dash.title)} </option>)}
+ </select>
+ </div>
+ <div className="topbar-dashboards">
+ <div className="topbar-icon" onClick={undoBatch(() => CurrentUserUtils.createNewDashboard(Doc.UserDoc()))}
+ >
+ {"New"}<FontAwesomeIcon icon="plus"></FontAwesomeIcon>
+ </div>
+ {Doc.UserDoc().noviceMode ? (null) : <div className="topbar-icon" onClick={undoBatch(() => CurrentUserUtils.snapshotDashboard(Doc.UserDoc()))}
+ >
+ {"Snapshot"}<FontAwesomeIcon icon="camera"></FontAwesomeIcon>
+ </div>}
+ </div>
+ </div>
+ <div className="topbar-right" >
+ <div className="topbar-icon">
+ {"Help"}<FontAwesomeIcon icon="question-circle"></FontAwesomeIcon>
+ </div>
+ <div className="topbar-icon" onClick={() => SettingsManager.Instance.open()}>
+ {"Settings"}<FontAwesomeIcon icon="cog"></FontAwesomeIcon>
+ </div>
+
+ </div>
+ </div>
+ </div >
+ );
+ }
+} \ No newline at end of file