diff options
author | geireann <geireann.lindfield@gmail.com> | 2021-07-31 00:28:06 -0400 |
---|---|---|
committer | geireann <geireann.lindfield@gmail.com> | 2021-07-31 00:28:06 -0400 |
commit | fc10b0e4be1f10864dc2f38b40c20e3e82ba54d0 (patch) | |
tree | 22db1339070014311f08f1aaf2494ce7ddb10b1b /src/client/views | |
parent | b44c8e15662b26a1f848fd241a4e13ef4312c877 (diff) | |
parent | b6b2057cf28e8c0d3c22b9056074fe5155602d0a (diff) |
Merge branch 'master' into tab_updates
Diffstat (limited to 'src/client/views')
-rw-r--r-- | src/client/views/LightboxView.scss | 30 | ||||
-rw-r--r-- | src/client/views/LightboxView.tsx | 22 | ||||
-rw-r--r-- | src/client/views/MarqueeAnnotator.tsx | 10 | ||||
-rw-r--r-- | src/client/views/SidebarAnnos.tsx | 2 | ||||
-rw-r--r-- | src/client/views/StyleProvider.tsx | 3 | ||||
-rw-r--r-- | src/client/views/collections/CollectionSubView.tsx | 2 | ||||
-rw-r--r-- | src/client/views/collections/CollectionTimeView.tsx | 2 | ||||
-rw-r--r-- | src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx | 4 | ||||
-rw-r--r-- | src/client/views/collections/collectionFreeForm/MarqueeView.tsx | 4 | ||||
-rw-r--r-- | src/client/views/collections/collectionSchema/CollectionSchemaCells.tsx | 20 | ||||
-rw-r--r-- | src/client/views/nodes/DocumentView.scss | 2 | ||||
-rw-r--r-- | src/client/views/nodes/ImageBox.tsx | 2 | ||||
-rw-r--r-- | src/client/views/nodes/WebBox.tsx | 3 | ||||
-rw-r--r-- | src/client/views/nodes/formattedText/FormattedTextBox.tsx | 2 | ||||
-rw-r--r-- | src/client/views/pdf/PDFViewer.tsx | 3 |
15 files changed, 79 insertions, 32 deletions
diff --git a/src/client/views/LightboxView.scss b/src/client/views/LightboxView.scss index 4ea2dc2d6..5d42cd97f 100644 --- a/src/client/views/LightboxView.scss +++ b/src/client/views/LightboxView.scss @@ -1,3 +1,32 @@ + + .lightboxView-navBtn { + margin: auto; + position: absolute; + right: 10; + top: 10; + background: transparent; + border-radius: 8; + color:white; + opacity: 0.7; + width: 35; + &:hover { + opacity: 1; + } + } + .lightboxView-tabBtn { + margin: auto; + position: absolute; + right: 35; + top: 10; + background: transparent; + border-radius: 8; + color:white; + opacity: 0.7; + width: 35; + &:hover { + opacity: 1; + } + } .lightboxView-frame { position: absolute; top: 0; left: 0; @@ -15,7 +44,6 @@ position: relative; background: transparent; border-radius: 8; - color:white; opacity: 0.7; width: 35; &:hover { diff --git a/src/client/views/LightboxView.tsx b/src/client/views/LightboxView.tsx index ce36d9182..88739fe91 100644 --- a/src/client/views/LightboxView.tsx +++ b/src/client/views/LightboxView.tsx @@ -1,19 +1,20 @@ import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'; -import { action, computed, observable, trace } from 'mobx'; +import { action, computed, observable } from 'mobx'; import { observer } from 'mobx-react'; import "normalize.css"; import * as React from 'react'; import { Doc, DocListCast, Opt } from '../../fields/Doc'; import { Cast, NumCast, StrCast } from '../../fields/Types'; -import { emptyFunction, returnEmptyDoclist, returnEmptyFilter, returnTrue, returnFalse } from '../../Utils'; +import { emptyFunction, returnEmptyDoclist, returnEmptyFilter, returnFalse, returnTrue } from '../../Utils'; import { DocUtils } from '../documents/Documents'; import { DocumentManager } from '../util/DocumentManager'; import { LinkManager } from '../util/LinkManager'; import { SelectionManager } from '../util/SelectionManager'; import { Transform } from '../util/Transform'; +import { CollectionDockingView } from './collections/CollectionDockingView'; import { TabDocView } from './collections/TabDocView'; import "./LightboxView.scss"; -import { DocumentView, ViewAdjustment } from './nodes/DocumentView'; +import { DocumentView } from './nodes/DocumentView'; import { DefaultStyleProvider, wavyBorderPath } from './StyleProvider'; interface LightboxViewProps { @@ -160,7 +161,7 @@ export class LightboxView extends React.Component<LightboxViewProps> { const { doc, target } = LightboxView._history?.lastElement(); const docView = DocumentManager.Instance.getLightboxDocumentView(target || doc); if (docView) { - LightboxView._docTarget = undefined; + LightboxView._docTarget = target; const focusSpeed = 1000; doc._viewTransition = `transform ${focusSpeed}ms`; if (!target) docView.ComponentView?.shrinkWrap?.(); @@ -197,7 +198,6 @@ export class LightboxView extends React.Component<LightboxViewProps> { TabDocView.PinDoc(coll, { hidePresBox: true }); } } - setTimeout(LightboxView.Next); } future = () => LightboxView._future; @@ -228,7 +228,6 @@ export class LightboxView extends React.Component<LightboxViewProps> { const targetView = target && DocumentManager.Instance.getLightboxDocumentView(target); if (doc === r.props.Document && (!target || target === doc)) r.ComponentView?.shrinkWrap?.(); else target && targetView?.focus(target, { willZoom: true, scale: 0.9, instant: true }); - LightboxView._docTarget = undefined; })); })} Document={LightboxView.LightboxDoc} @@ -270,7 +269,16 @@ export class LightboxView extends React.Component<LightboxViewProps> { LightboxView.Next(); })} <LightboxTourBtn navBtn={this.navBtn} future={this.future} stepInto={this.stepInto} tourMap={this.tourMap} /> - <div className="lightboxView-navBtn" title={"toggle fit width"} style={{ position: "absolute", right: 10, top: 10, color: "white" }} + <div className="lightboxView-tabBtn" title={"open in tab"} + onClick={e => { + e.stopPropagation(); + CollectionDockingView.AddSplit(LightboxView._docTarget || LightboxView._doc!, "onRight"); + SelectionManager.DeselectAll(); + LightboxView.SetLightboxDoc(undefined); + }}> + <FontAwesomeIcon icon={"file-download"} size="2x" /> + </div> + <div className="lightboxView-navBtn" title={"toggle fit width"} onClick={e => { e.stopPropagation(); LightboxView.LightboxDoc!._fitWidth = !LightboxView.LightboxDoc!._fitWidth; }}> <FontAwesomeIcon icon={"arrows-alt-h"} size="2x" /> </div> diff --git a/src/client/views/MarqueeAnnotator.tsx b/src/client/views/MarqueeAnnotator.tsx index 717bd0768..805cda95c 100644 --- a/src/client/views/MarqueeAnnotator.tsx +++ b/src/client/views/MarqueeAnnotator.tsx @@ -120,9 +120,11 @@ export class MarqueeAnnotator extends React.Component<MarqueeAnnotatorProps> { return marqueeAnno; } - const textRegionAnno = Docs.Create.HTMLAnchorDocument([], { annotationOn: this.props.rootDoc, title: "Selection on " + this.props.rootDoc.title, _width: 1, _height: 1 }); + const textRegionAnno = Docs.Create.HTMLAnchorDocument([], { annotationOn: this.props.rootDoc, backgroundColor: "transparent", title: "Selection on " + this.props.rootDoc.title }); + let minX = Number.MAX_VALUE; let maxX = -Number.MAX_VALUE; let minY = Number.MAX_VALUE; + let maxY = -Number.MIN_VALUE; const annoDocs: Doc[] = []; savedAnnoMap.forEach((value: HTMLDivElement[], key: number) => value.map(anno => { const textRegion = new Doc(); @@ -135,12 +137,16 @@ export class MarqueeAnnotator extends React.Component<MarqueeAnnotatorProps> { annoDocs.push(textRegion); anno.remove(); minY = Math.min(NumCast(textRegion.y), minY); + minX = Math.min(NumCast(textRegion.x), minX); + maxY = Math.max(NumCast(textRegion.y) + NumCast(textRegion._height), maxY); maxX = Math.max(NumCast(textRegion.x) + NumCast(textRegion._width), maxX); })); const textRegionAnnoProto = Doc.GetProto(textRegionAnno); textRegionAnnoProto.y = Math.max(minY, 0); - textRegionAnnoProto.x = Math.max(maxX, 0); + textRegionAnnoProto.x = Math.max(minX, 0); + textRegionAnnoProto.height = Math.max(maxY, 0) - Math.max(minY, 0); + textRegionAnnoProto.width = Math.max(maxX, 0) - Math.max(minX, 0); // mainAnnoDocProto.text = this._selectionText; textRegionAnnoProto.textInlineAnnotations = new List<Doc>(annoDocs); savedAnnoMap.clear(); diff --git a/src/client/views/SidebarAnnos.tsx b/src/client/views/SidebarAnnos.tsx index 9c5a54574..c5ae82c61 100644 --- a/src/client/views/SidebarAnnos.tsx +++ b/src/client/views/SidebarAnnos.tsx @@ -79,7 +79,7 @@ export class SidebarAnnos extends React.Component<FieldViewProps & ExtraProps> { sidebarStyleProvider = (doc: Opt<Doc>, props: Opt<FieldViewProps | DocumentViewProps>, property: string) => { if (property === StyleProp.ShowTitle) { - return doc === this.props.rootDoc ? 0 : StrCast(this.props.layoutDoc["sidebar-childShowTitle"], "title"); + return doc === this.props.rootDoc ? undefined : StrCast(this.props.layoutDoc["sidebar-childShowTitle"], "title"); } return this.props.styleProvider?.(doc, props, property); } diff --git a/src/client/views/StyleProvider.tsx b/src/client/views/StyleProvider.tsx index 6b94539c9..c9e532745 100644 --- a/src/client/views/StyleProvider.tsx +++ b/src/client/views/StyleProvider.tsx @@ -101,7 +101,7 @@ export function DefaultStyleProvider(doc: Opt<Doc>, props: Opt<DocumentViewProps const backColor = backgroundCol(); if (!backColor) return undefined; const nonAlphaColor = backColor.startsWith("#") ? (backColor as string).substring(0, 7) : - backColor.startsWith("rgba") ? backColor.replace(/,.[^,]*\)/, ")").replace("rgba", "rgb") : backColor + backColor.startsWith("rgba") ? backColor.replace(/,.[^,]*\)/, ")").replace("rgba", "rgb") : backColor; const col = Color(nonAlphaColor).rgb(); const colsum = (col.red() + col.green() + col.blue()); if (colsum / col.alpha() > 400 || col.alpha() < 0.25) return Colors.DARK_GRAY; @@ -174,6 +174,7 @@ export function DefaultStyleProvider(doc: Opt<Doc>, props: Opt<DocumentViewProps } } case StyleProp.PointerEvents: + if (doc?.type === DocumentType.MARKER) return "none"; if (props?.pointerEvents === "none") return "none"; const layer = doc && props?.layerProvider?.(doc); if (opacity() === 0 || (doc?.type === DocumentType.INK && !docProps?.treeViewDoc) || doc?.isInkMask) return "none"; diff --git a/src/client/views/collections/CollectionSubView.tsx b/src/client/views/collections/CollectionSubView.tsx index f39443ae2..a5d27f038 100644 --- a/src/client/views/collections/CollectionSubView.tsx +++ b/src/client/views/collections/CollectionSubView.tsx @@ -454,7 +454,7 @@ export function CollectionSubView<T, X>(schemaCtor: (doc: Doc) => T, moreProps?: if (completed) completed(set); else { if (isFreeformView && generatedDocuments.length > 1) { - addDocument(DocUtils.pileup(generatedDocuments, options.x!, options.y!)!); + addDocument(DocUtils.pileup(generatedDocuments, options.x!, options.y!)); } else { generatedDocuments.forEach(addDocument); } diff --git a/src/client/views/collections/CollectionTimeView.tsx b/src/client/views/collections/CollectionTimeView.tsx index f41043179..339163510 100644 --- a/src/client/views/collections/CollectionTimeView.tsx +++ b/src/client/views/collections/CollectionTimeView.tsx @@ -37,7 +37,7 @@ export class CollectionTimeView extends CollectionSubView(doc => doc) { @observable _focusRangeFilters: Opt<string[]>; getAnchor = () => { - const anchor = Docs.Create.TextanchorDocument({ + const anchor = Docs.Create.HTMLAnchorDocument({ title: ComputedField.MakeFunction(`"${this.pivotField}"])`) as any, annotationOn: this.rootDoc }); diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx index c5f6f7bf2..143d8e070 100644 --- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx +++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx @@ -48,6 +48,7 @@ import { CollectionFreeFormRemoteCursors } from "./CollectionFreeFormRemoteCurso import "./CollectionFreeFormView.scss"; import { MarqueeView } from "./MarqueeView"; import React = require("react"); +import { DocumentType } from "../../../documents/DocumentTypes"; export const panZoomSchema = createSchema({ _panX: "number", @@ -1486,7 +1487,8 @@ export class CollectionFreeFormView extends CollectionSubView<PanZoomDocument, P onDragOver={e => e.preventDefault()} onContextMenu={this.onContextMenu} style={{ - pointerEvents: this.backgroundEvents ? "all" : this.props.pointerEvents as any, + pointerEvents: this.props.Document.type === DocumentType.MARKER ? "none" : // bcz: ugh.. this is here to prevent markers, which render as freeform views, from grabbing events -- need a better approach. + this.backgroundEvents ? "all" : this.props.pointerEvents as any, transform: `scale(${this.contentScaling || 1})`, width: `${100 / (this.contentScaling || 1)}%`, height: this.isAnnotationOverlay && this.Document.scrollHeight ? this.Document.scrollHeight : `${100 / (this.contentScaling || 1)}%`// : this.isAnnotationOverlay ? (this.Document.scrollHeight ? this.Document.scrollHeight : "100%") : this.props.PanelHeight() diff --git a/src/client/views/collections/collectionFreeForm/MarqueeView.tsx b/src/client/views/collections/collectionFreeForm/MarqueeView.tsx index 4fae961b1..846d28214 100644 --- a/src/client/views/collections/collectionFreeForm/MarqueeView.tsx +++ b/src/client/views/collections/collectionFreeForm/MarqueeView.tsx @@ -369,8 +369,8 @@ export class MarqueeView extends React.Component<SubCollectionViewProps & Marque SelectionManager.DeselectAll(); selected.forEach(d => this.props.removeDocument?.(d)); const newCollection = DocUtils.pileup(selected, this.Bounds.left + this.Bounds.width / 2, this.Bounds.top + this.Bounds.height / 2); - this.props.addDocument?.(newCollection!); - this.props.selectDocuments([newCollection!]); + this.props.addDocument?.(newCollection); + this.props.selectDocuments([newCollection]); MarqueeOptionsMenu.Instance.fadeOut(true); this.hideMarquee(); } diff --git a/src/client/views/collections/collectionSchema/CollectionSchemaCells.tsx b/src/client/views/collections/collectionSchema/CollectionSchemaCells.tsx index 90f64f163..0c434eae5 100644 --- a/src/client/views/collections/collectionSchema/CollectionSchemaCells.tsx +++ b/src/client/views/collections/collectionSchema/CollectionSchemaCells.tsx @@ -246,13 +246,13 @@ export class CollectionSchemaCell extends React.Component<CellProps> { } else { // check if the input is a number let inputIsNum = true; - for (let s of value) { - if (isNaN(parseInt(s)) && !(s == ".") && !(s == ",")) { + for (const s of value) { + if (isNaN(parseInt(s)) && !(s === ".") && !(s === ",")) { inputIsNum = false; } } // check if the input is a boolean - let inputIsBool: boolean = value == "false" || value == "true"; + const inputIsBool: boolean = value === "false" || value === "true"; // what to do in the case if (!inputIsNum && !inputIsBool && !value.startsWith("=")) { // if it's not a number, it's a string, and should be processed as such @@ -263,12 +263,12 @@ export class CollectionSchemaCell extends React.Component<CellProps> { const vsqLength = valueSansQuotes.length; // get rid of outer quotes valueSansQuotes = valueSansQuotes.substring(value.startsWith("\"") ? 1 : 0, - valueSansQuotes.charAt(vsqLength - 1) == "\"" ? vsqLength - 1 : vsqLength); + valueSansQuotes.charAt(vsqLength - 1) === "\"" ? vsqLength - 1 : vsqLength); } let inputAsString = '"'; // escape any quotes in the string for (const i of valueSansQuotes) { - if (i == '"') { + if (i === '"') { inputAsString += '\\"'; } else { inputAsString += i; @@ -278,7 +278,7 @@ export class CollectionSchemaCell extends React.Component<CellProps> { inputAsString += '"'; //two options here: we can strip off outer quotes or we can figure out what's going on with the script const script = CompileScript(inputAsString, { requiredType: type, typecheck: false, editable: true, addReturn: true, params: { this: Doc.name, $r: "number", $c: "number", $: "any" } }); - const changeMade = inputAsString.length !== value.length || inputAsString.length - 2 !== value.length + const changeMade = inputAsString.length !== value.length || inputAsString.length - 2 !== value.length; script.compiled && (retVal = this.applyToDoc(changeMade ? this._rowDoc : this._rowDataDoc, this.props.row, this.props.col, script.run)); // handle numbers and expressions } else if (inputIsNum || value.startsWith("=")) { @@ -286,18 +286,18 @@ export class CollectionSchemaCell extends React.Component<CellProps> { const inputscript = value.substring(value.startsWith("=") ? 1 : 0); // if commas are not stripped, the parser only considers the numbers after the last comma let inputSansCommas = ""; - for (let s of inputscript) { - if (!(s == ",")) { + for (const s of inputscript) { + if (!(s === ",")) { inputSansCommas += s; } } const script = CompileScript(inputSansCommas, { requiredType: type, typecheck: false, editable: true, addReturn: true, params: { this: Doc.name, $r: "number", $c: "number", $: "any" } }); - const changeMade = value.length !== value.length || value.length - 2 !== value.length + const changeMade = value.length !== value.length || value.length - 2 !== value.length; script.compiled && (retVal = this.applyToDoc(changeMade ? this._rowDoc : this._rowDataDoc, this.props.row, this.props.col, script.run)); // handle booleans } else if (inputIsBool) { const script = CompileScript(value, { requiredType: type, typecheck: false, editable: true, addReturn: true, params: { this: Doc.name, $r: "number", $c: "number", $: "any" } }); - const changeMade = value.length !== value.length || value.length - 2 !== value.length + const changeMade = value.length !== value.length || value.length - 2 !== value.length; script.compiled && (retVal = this.applyToDoc(changeMade ? this._rowDoc : this._rowDataDoc, this.props.row, this.props.col, script.run)); } } diff --git a/src/client/views/nodes/DocumentView.scss b/src/client/views/nodes/DocumentView.scss index 8f86417d6..281f25fb3 100644 --- a/src/client/views/nodes/DocumentView.scss +++ b/src/client/views/nodes/DocumentView.scss @@ -147,7 +147,7 @@ .documentView-titleWrapper, .documentView-titleWrapper-hover { overflow: hidden; - color: white; + color: gray; transform-origin: top left; top: 0; width: 100%; diff --git a/src/client/views/nodes/ImageBox.tsx b/src/client/views/nodes/ImageBox.tsx index d876ae818..cfd43bb62 100644 --- a/src/client/views/nodes/ImageBox.tsx +++ b/src/client/views/nodes/ImageBox.tsx @@ -340,7 +340,7 @@ export class ImageBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp @action finishMarquee = () => { this._marqueeing = undefined; - this.props.select(false) + this.props.select(false); } render() { diff --git a/src/client/views/nodes/WebBox.tsx b/src/client/views/nodes/WebBox.tsx index 88e38712a..f5b1f96f2 100644 --- a/src/client/views/nodes/WebBox.tsx +++ b/src/client/views/nodes/WebBox.tsx @@ -162,7 +162,8 @@ export class WebBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps scrollFocus = (doc: Doc, smooth: boolean) => { if (this._sidebarRef?.current?.makeDocUnfiltered(doc)) return 1; if (doc !== this.rootDoc && this._outerRef.current) { - const scrollTo = doc.type === DocumentType.TEXTANCHOR ? NumCast(doc.y) : Utils.scrollIntoView(NumCast(doc.y), doc[HeightSym](), NumCast(this.layoutDoc._scrollTop), this.props.PanelHeight() / (this.props.scaling?.() || 1)); + const windowHeight = this.props.PanelHeight() / (this.props.scaling?.() || 1); + const scrollTo = Utils.scrollIntoView(NumCast(doc.y), doc[HeightSym](), NumCast(this.layoutDoc._scrollTop), windowHeight, windowHeight * .1); if (scrollTo !== undefined) { const focusSpeed = smooth ? 500 : 0; this._initialScroll !== undefined && (this._initialScroll = scrollTo); diff --git a/src/client/views/nodes/formattedText/FormattedTextBox.tsx b/src/client/views/nodes/formattedText/FormattedTextBox.tsx index 6dd63fb47..8cac21927 100644 --- a/src/client/views/nodes/formattedText/FormattedTextBox.tsx +++ b/src/client/views/nodes/formattedText/FormattedTextBox.tsx @@ -787,7 +787,7 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp } componentDidMount() { - this.props.setContentView?.(this); // this tells the DocumentView that this AudioBox is the "content" of the document. this allows the DocumentView to indirectly call getAnchor() on the AudioBox when making a link. + !this.props.dontSelectOnLoad && this.props.setContentView?.(this); // this tells the DocumentView that this AudioBox is the "content" of the document. this allows the DocumentView to indirectly call getAnchor() on the AudioBox when making a link. this._cachedLinks = DocListCast(this.Document.links); this._disposers.breakupDictation = reaction(() => DocumentManager.Instance.RecordingEvent, this.breakupDictation); this._disposers.autoHeight = reaction(() => this.autoHeight, autoHeight => autoHeight && this.tryUpdateScrollHeight()); diff --git a/src/client/views/pdf/PDFViewer.tsx b/src/client/views/pdf/PDFViewer.tsx index 4a50dccf3..e8c7a4ab0 100644 --- a/src/client/views/pdf/PDFViewer.tsx +++ b/src/client/views/pdf/PDFViewer.tsx @@ -184,7 +184,8 @@ export class PDFViewer extends React.Component<IViewerProps> { const mainCont = this._mainCont.current; let focusSpeed: Opt<number>; if (doc !== this.props.rootDoc && mainCont && this._pdfViewer) { - const scrollTo = Utils.scrollIntoView(NumCast(doc.y), doc[HeightSym](), NumCast(this.props.layoutDoc._scrollTop), this.props.PanelHeight() / (this.props.scaling?.() || 1)); + const windowHeight = this.props.PanelHeight() / (this.props.scaling?.() || 1); + const scrollTo = Utils.scrollIntoView(NumCast(doc.y), doc[HeightSym](), NumCast(this.props.layoutDoc._scrollTop), windowHeight, .1 * windowHeight); if (scrollTo !== undefined) { focusSpeed = 500; |