diff options
author | Tyler Schicke <tyler_schicke@brown.edu> | 2019-01-28 01:55:22 -0500 |
---|---|---|
committer | Tyler Schicke <tyler_schicke@brown.edu> | 2019-01-28 01:55:22 -0500 |
commit | db241485f4f9dff0f43cf5e8059ccb7bd8df5b15 (patch) | |
tree | 789aa71a15151ae9c180200414b8089084a497dc /src/views/nodes/FieldTextBox.tsx | |
parent | b6ae466668086bee68014a3fb0c7df75ff7df4ca (diff) |
Formatted all files
Diffstat (limited to 'src/views/nodes/FieldTextBox.tsx')
-rw-r--r-- | src/views/nodes/FieldTextBox.tsx | 40 |
1 files changed, 20 insertions, 20 deletions
diff --git a/src/views/nodes/FieldTextBox.tsx b/src/views/nodes/FieldTextBox.tsx index 3b8743627..4539bbab0 100644 --- a/src/views/nodes/FieldTextBox.tsx +++ b/src/views/nodes/FieldTextBox.tsx @@ -5,19 +5,19 @@ import { TextField } from "../../fields/TextField"; import React = require("react") import { action, observable, reaction, IReactionDisposer } from "mobx"; -import {schema} from "prosemirror-schema-basic"; -import {EditorState, Transaction} from "prosemirror-state" -import {EditorView} from "prosemirror-view" -import {keymap} from "prosemirror-keymap" -import {baseKeymap} from "prosemirror-commands" -import {undo, redo, history} from "prosemirror-history" +import { schema } from "prosemirror-schema-basic"; +import { EditorState, Transaction } from "prosemirror-state" +import { EditorView } from "prosemirror-view" +import { keymap } from "prosemirror-keymap" +import { baseKeymap } from "prosemirror-commands" +import { undo, redo, history } from "prosemirror-history" import { Opt } from "../../fields/Field"; import "./FieldTextBox.scss" interface IProps { - fieldKey:Key; - doc:Document; + fieldKey: Key; + doc: Document; } // FieldTextBox: Displays an editable plain text node that maps to a specified Key of a Document @@ -41,7 +41,7 @@ export class FieldTextBox extends React.Component<IProps> { private _editorView: Opt<EditorView>; private _reactionDisposer: Opt<IReactionDisposer>; - constructor(props:IProps) { + constructor(props: IProps) { super(props); this._ref = React.createRef(); @@ -50,33 +50,33 @@ export class FieldTextBox extends React.Component<IProps> { } dispatchTransaction = (tx: Transaction) => { - if(this._editorView) { + if (this._editorView) { const state = this._editorView.state.apply(tx); this._editorView.updateState(state); - const {doc, fieldKey} = this.props; + const { doc, fieldKey } = this.props; doc.SetFieldValue(fieldKey, JSON.stringify(state.toJSON()), TextField); } } componentDidMount() { - let state:EditorState; - const {doc, fieldKey} = this.props; + let state: EditorState; + const { doc, fieldKey } = this.props; const config = { schema, plugins: [ history(), - keymap({"Mod-z": undo, "Mod-y": redo}), + keymap({ "Mod-z": undo, "Mod-y": redo }), keymap(baseKeymap) ] }; let field = doc.GetFieldT(fieldKey, TextField); - if(field) { + if (field) { state = EditorState.fromJSON(config, JSON.parse(field.Data)); } else { state = EditorState.create(config); } - if(this._ref.current) { + if (this._ref.current) { this._editorView = new EditorView(this._ref.current, { state, dispatchTransaction: this.dispatchTransaction @@ -87,17 +87,17 @@ export class FieldTextBox extends React.Component<IProps> { const field = this.props.doc.GetFieldT(this.props.fieldKey, TextField); return field ? field.Data : undefined; }, (field) => { - if(field && this._editorView) { + if (field && this._editorView) { this._editorView.updateState(EditorState.fromJSON(config, JSON.parse(field))); } }) } componentWillUnmount() { - if(this._editorView) { + if (this._editorView) { this._editorView.destroy(); } - if(this._reactionDisposer) { + if (this._reactionDisposer) { this._reactionDisposer(); } } @@ -108,7 +108,7 @@ export class FieldTextBox extends React.Component<IProps> { @action onChange(e: React.ChangeEvent<HTMLInputElement>) { - const {fieldKey, doc} = this.props; + const { fieldKey, doc } = this.props; doc.SetFieldValue(fieldKey, e.target.value, TextField); } |