aboutsummaryrefslogtreecommitdiff
diff options
context:
space:
mode:
-rw-r--r--src/Utils.ts111
-rw-r--r--src/client/documents/Documents.ts143
-rw-r--r--src/client/util/CurrentUserUtils.ts516
-rw-r--r--src/client/util/DocumentManager.ts60
-rw-r--r--src/client/util/DragManager.ts16
-rw-r--r--src/client/util/HypothesisUtils.ts2
-rw-r--r--src/client/util/InteractionUtils.tsx10
-rw-r--r--src/client/util/LinkManager.ts38
-rw-r--r--src/client/util/Scripting.ts12
-rw-r--r--src/client/util/SelectionManager.ts14
-rw-r--r--src/client/util/SettingsManager.scss5
-rw-r--r--src/client/views/AudioWaveform.tsx119
-rw-r--r--src/client/views/ComponentDecorations.scss0
-rw-r--r--src/client/views/ComponentDecorations.tsx14
-rw-r--r--src/client/views/ContextMenu.scss12
-rw-r--r--src/client/views/ContextMenu.tsx15
-rw-r--r--src/client/views/ContextMenuItem.tsx6
-rw-r--r--src/client/views/DocComponent.tsx37
-rw-r--r--src/client/views/DocumentButtonBar.tsx7
-rw-r--r--src/client/views/DocumentDecorations.scss451
-rw-r--r--src/client/views/DocumentDecorations.tsx52
-rw-r--r--src/client/views/EditableView.scss1
-rw-r--r--src/client/views/EditableView.tsx4
-rw-r--r--src/client/views/GestureOverlay.tsx34
-rw-r--r--src/client/views/GlobalKeyHandler.ts4
-rw-r--r--src/client/views/InkControls.tsx120
-rw-r--r--src/client/views/InkHandles.tsx25
-rw-r--r--src/client/views/InkStroke.scss14
-rw-r--r--src/client/views/InkStrokeProperties.ts7
-rw-r--r--src/client/views/InkingStroke.tsx197
-rw-r--r--src/client/views/LightboxView.tsx3
-rw-r--r--src/client/views/MainView.scss67
-rw-r--r--src/client/views/MainView.tsx161
-rw-r--r--src/client/views/MainViewModal.scss7
-rw-r--r--src/client/views/MarqueeAnnotator.tsx22
-rw-r--r--src/client/views/PreviewCursor.tsx2
-rw-r--r--src/client/views/PropertiesButtons.scss50
-rw-r--r--src/client/views/PropertiesButtons.tsx75
-rw-r--r--src/client/views/PropertiesView.scss5
-rw-r--r--src/client/views/PropertiesView.tsx23
-rw-r--r--src/client/views/SidebarAnnos.tsx33
-rw-r--r--src/client/views/StyleProvider.tsx24
-rw-r--r--src/client/views/TemplateMenu.tsx1
-rw-r--r--src/client/views/collections/CollectionDockingView.tsx4
-rw-r--r--src/client/views/collections/CollectionLinearView.tsx193
-rw-r--r--src/client/views/collections/CollectionMenu.scss1255
-rw-r--r--src/client/views/collections/CollectionMenu.tsx175
-rw-r--r--src/client/views/collections/CollectionSchemaView.tsx4
-rw-r--r--src/client/views/collections/CollectionStackedTimeline.scss142
-rw-r--r--src/client/views/collections/CollectionStackedTimeline.tsx773
-rw-r--r--src/client/views/collections/CollectionStackingView.scss24
-rw-r--r--src/client/views/collections/CollectionStackingView.tsx121
-rw-r--r--src/client/views/collections/CollectionStackingViewFieldColumn.tsx2
-rw-r--r--src/client/views/collections/CollectionSubView.tsx65
-rw-r--r--src/client/views/collections/CollectionTreeView.scss8
-rw-r--r--src/client/views/collections/CollectionTreeView.tsx139
-rw-r--r--src/client/views/collections/CollectionView.tsx23
-rw-r--r--src/client/views/collections/TabDocView.scss30
-rw-r--r--src/client/views/collections/TabDocView.tsx37
-rw-r--r--src/client/views/collections/TreeView.tsx40
-rw-r--r--src/client/views/collections/collectionFreeForm/CollectionFreeFormLinkView.tsx32
-rw-r--r--src/client/views/collections/collectionFreeForm/CollectionFreeFormLinksView.tsx18
-rw-r--r--src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx85
-rw-r--r--src/client/views/collections/collectionFreeForm/MarqueeView.tsx19
-rw-r--r--src/client/views/collections/collectionFreeForm/index.ts7
-rw-r--r--src/client/views/collections/collectionGrid/index.ts2
-rw-r--r--src/client/views/collections/collectionLinear/CollectionLinearView.scss (renamed from src/client/views/collections/CollectionLinearView.scss)63
-rw-r--r--src/client/views/collections/collectionLinear/CollectionLinearView.tsx226
-rw-r--r--src/client/views/collections/collectionLinear/index.ts1
-rw-r--r--src/client/views/collections/collectionSchema/CollectionSchemaCells.tsx4
-rw-r--r--src/client/views/collections/collectionSchema/CollectionSchemaHeaders.tsx10
-rw-r--r--src/client/views/collections/collectionSchema/CollectionSchemaMovableRow.tsx6
-rw-r--r--src/client/views/collections/collectionSchema/CollectionSchemaView.scss120
-rw-r--r--src/client/views/collections/collectionSchema/CollectionSchemaView.tsx2
-rw-r--r--src/client/views/collections/collectionSchema/SchemaTable.tsx6
-rw-r--r--src/client/views/global/globalCssVariables.scss23
-rw-r--r--src/client/views/global/globalCssVariables.scss.d.ts4
-rw-r--r--src/client/views/global/globalEnums.tsx5
-rw-r--r--src/client/views/linking/LinkEditor.scss18
-rw-r--r--src/client/views/linking/LinkEditor.tsx103
-rw-r--r--src/client/views/linking/LinkMenu.tsx2
-rw-r--r--src/client/views/linking/LinkMenuGroup.tsx21
-rw-r--r--src/client/views/linking/LinkPopup.scss2
-rw-r--r--src/client/views/linking/LinkPopup.tsx44
-rw-r--r--src/client/views/linking/LinkRelationshipSearch.tsx63
-rw-r--r--src/client/views/nodes/AudioBox.scss92
-rw-r--r--src/client/views/nodes/AudioBox.tsx616
-rw-r--r--src/client/views/nodes/CollectionFreeFormDocumentView.tsx6
-rw-r--r--src/client/views/nodes/ComparisonBox.tsx17
-rw-r--r--src/client/views/nodes/DocumentContentsView.tsx6
-rw-r--r--src/client/views/nodes/DocumentLinksButton.scss1
-rw-r--r--src/client/views/nodes/DocumentLinksButton.tsx22
-rw-r--r--src/client/views/nodes/DocumentView.tsx184
-rw-r--r--src/client/views/nodes/FieldView.tsx5
-rw-r--r--src/client/views/nodes/FilterBox.tsx32
-rw-r--r--src/client/views/nodes/FontIconBox.scss103
-rw-r--r--src/client/views/nodes/FontIconBox.tsx96
-rw-r--r--src/client/views/nodes/ImageBox.tsx30
-rw-r--r--src/client/views/nodes/LabelBox.tsx21
-rw-r--r--src/client/views/nodes/LinkAnchorBox.tsx1
-rw-r--r--src/client/views/nodes/LinkBox.tsx1
-rw-r--r--src/client/views/nodes/LinkDescriptionPopup.tsx4
-rw-r--r--src/client/views/nodes/PDFBox.scss16
-rw-r--r--src/client/views/nodes/PDFBox.tsx42
-rw-r--r--src/client/views/nodes/ScreenshotBox.tsx3
-rw-r--r--src/client/views/nodes/VideoBox.scss67
-rw-r--r--src/client/views/nodes/VideoBox.tsx114
-rw-r--r--src/client/views/nodes/WebBox.scss9
-rw-r--r--src/client/views/nodes/WebBox.tsx165
-rw-r--r--src/client/views/nodes/button/ButtonInterface.ts12
-rw-r--r--src/client/views/nodes/button/ButtonScripts.ts14
-rw-r--r--src/client/views/nodes/button/FontIconBadge.scss11
-rw-r--r--src/client/views/nodes/button/FontIconBadge.tsx37
-rw-r--r--src/client/views/nodes/button/FontIconBox.scss411
-rw-r--r--src/client/views/nodes/button/FontIconBox.tsx904
-rw-r--r--src/client/views/nodes/button/colorDropdown/ColorDropdown.tsx75
-rw-r--r--src/client/views/nodes/button/colorDropdown/index.ts1
-rw-r--r--src/client/views/nodes/button/textButton/TextButton.tsx17
-rw-r--r--src/client/views/nodes/button/textButton/index.ts1
-rw-r--r--src/client/views/nodes/button/toggleButton/ToggleButton.tsx34
-rw-r--r--src/client/views/nodes/button/toggleButton/index.ts1
-rw-r--r--src/client/views/nodes/formattedText/DashFieldView.tsx2
-rw-r--r--src/client/views/nodes/formattedText/FormattedTextBox.scss29
-rw-r--r--src/client/views/nodes/formattedText/FormattedTextBox.tsx102
-rw-r--r--src/client/views/nodes/formattedText/RichTextMenu.scss1
-rw-r--r--src/client/views/nodes/formattedText/RichTextMenu.tsx520
-rw-r--r--src/client/views/nodes/trails/PresBox.tsx14
-rw-r--r--src/client/views/pdf/AnchorMenu.scss29
-rw-r--r--src/client/views/pdf/AnchorMenu.tsx37
-rw-r--r--src/client/views/pdf/PDFViewer.tsx59
-rw-r--r--src/client/views/search/SearchBox.scss6
-rw-r--r--src/client/views/search/SearchBox.tsx101
-rw-r--r--src/client/views/topbar/TopBar.scss25
-rw-r--r--src/client/views/topbar/TopBar.tsx5
-rw-r--r--src/fields/Doc.ts10
-rw-r--r--src/fields/InkField.ts6
-rw-r--r--src/fields/documentSchemas.ts1
-rw-r--r--src/server/DashUploadUtils.ts33
-rw-r--r--src/server/index.ts2
139 files changed, 6976 insertions, 3617 deletions
diff --git a/src/Utils.ts b/src/Utils.ts
index 194c38a6f..6eacd8296 100644
--- a/src/Utils.ts
+++ b/src/Utils.ts
@@ -3,6 +3,8 @@ import v5 = require("uuid/v5");
import { ColorState } from 'react-color';
import { Socket } from 'socket.io';
import { Message } from './server/Message';
+import { Colors } from './client/views/global/globalEnums';
+import Color = require('color');
export namespace Utils {
export let DRAG_THRESHOLD = 4;
@@ -80,15 +82,7 @@ export namespace Utils {
}
export function CopyText(text: string) {
- const textArea = document.createElement("textarea");
- textArea.value = text;
- document.body.appendChild(textArea);
- textArea.focus();
- textArea.select();
-
- try { document.execCommand('copy'); } catch (err) { }
-
- document.body.removeChild(textArea);
+ navigator.clipboard.writeText(text);
}
export function decimalToHexString(number: number) {
@@ -115,6 +109,24 @@ export namespace Utils {
return { r: r, g: g, b: b, a: a };
}
+ const isTransparentFunctionHack = "isTransparent(__value__)";
+ export const noRecursionHack = "__noRecursion";
+ export function IsRecursiveFilter(val: string) {
+ return !val.includes(noRecursionHack);
+ }
+ export function HasTransparencyFilter(val: string) {
+ return val.includes(isTransparentFunctionHack);
+ }
+ export function IsTransparentFilter() {
+ // bcz: isTransparent(__value__) is a hack. it would be nice to have acual functions be parsed, but now Doc.matchFieldValue is hardwired to recognize just this one
+ return `backgroundColor:${isTransparentFunctionHack},${noRecursionHack}:check`;// bcz: hack. noRecursion should probably be either another ':' delimited field, or it should be a modifier to the comparision (eg., check, x, etc) field
+ }
+ export function IsOpaqueFilter() {
+ // bcz: isTransparent(__value__) is a hack. it would be nice to have acual functions be parsed, but now Doc.matchFieldValue is hardwired to recognize just this one
+ return `backgroundColor:${isTransparentFunctionHack},${noRecursionHack}:x`;// bcz: hack. noRecursion should probably be either another ':' delimited field, or it should be a modifier to the comparision (eg., check, x, etc) field
+ }
+
+
export function toRGBAstr(col: { r: number, g: number, b: number, a?: number }) {
return "rgba(" + col.r + "," + col.g + "," + col.b + (col.a !== undefined ? "," + col.a : "") + ")";
}
@@ -390,8 +402,7 @@ export function formatTime(time: number) {
const hours = Math.floor(time / 60 / 60);
const minutes = Math.floor(time / 60) - (hours * 60);
const seconds = time % 60;
-
- return hours.toString().padStart(2, '0') + ':' + minutes.toString().padStart(2, '0') + ':' + seconds.toString().padStart(2, '0');
+ return (hours ? hours.toString() + ":" : "") + minutes.toString().padStart(2, '0') + ':' + seconds.toString().padStart(2, '0');
}
export function aggregateBounds(boundsList: { x: number, y: number, width?: number, height?: number }[], xpad: number, ypad: number) {
@@ -439,6 +450,7 @@ export function emptyFunction() { }
export function unimplementedFunction() { throw new Error("This function is not implemented, but should be."); }
+
export type Without<T, K extends keyof T> = Pick<T, Exclude<keyof T, K>>;
export type Predicate<K, V> = (entry: [K, V]) => boolean;
@@ -540,66 +552,37 @@ export function simulateMouseClick(element: Element | null | undefined, x: numbe
screenY: sy,
})));
- rightClick && element.dispatchEvent(
- new MouseEvent("contextmenu", {
- view: window,
- bubbles: true,
- cancelable: true,
- button: 2,
- clientX: x,
- clientY: y,
- movementX: 0,
- movementY: 0,
- screenX: sx,
- screenY: sy,
- }));
+ if (rightClick) {
+ const me =
+ new MouseEvent("contextmenu", {
+ view: window,
+ bubbles: true,
+ cancelable: true,
+ button: 2,
+ clientX: x,
+ clientY: y,
+ movementX: 0,
+ movementY: 0,
+ screenX: sx,
+ screenY: sy,
+ });
+ (me as any).dash = true;
+ element.dispatchEvent(me);
+ }
}
export function lightOrDark(color: any) {
-
- // Variables for red, green, blue values
- var r, g, b, hsp;
-
- // Check the format of the color, HEX or RGB?
- if (color.match(/^rgb/)) {
-
- // If RGB --> store the red, green, blue values in separate variables
- color = color.match(/^rgba?\((\d+),\s*(\d+),\s*(\d+)(?:,\s*(\d+(?:\.\d+)?))?\)$/);
-
- r = color[1];
- g = color[2];
- b = color[3];
- }
- else {
-
- // If hex --> Convert it to RGB: http://gist.github.com/983661
- color = +("0x" + color.slice(1).replace(
- color.length < 5 && /./g, '$&$&'));
-
- r = color >> 16;
- g = color >> 8 & 255;
- b = color & 255;
- }
-
- // HSP (Highly Sensitive Poo) equation from http://alienryderflex.com/hsp.html
- hsp = Math.sqrt(
- 0.299 * (r * r) +
- 0.587 * (g * g) +
- 0.114 * (b * b)
- );
-
- // Using the HSP value, determine whether the color is light or dark
- if (hsp > 127.5) {
- return 'light';
- }
- else {
-
- return 'dark';
- }
+ const nonAlphaColor = color.startsWith("#") ? (color as string).substring(0, 7) :
+ color.startsWith("rgba") ? color.replace(/,.[^,]*\)/, ")").replace("rgba", "rgb") : color;
+ const col = Color(nonAlphaColor).rgb();
+ const colsum = (col.red() + col.green() + col.blue());
+ if (colsum / col.alpha() > 400 || col.alpha() < 0.25) return Colors.DARK_GRAY;
+ else return Colors.WHITE;
}
export function getWordAtPoint(elem: any, x: number, y: number): string | undefined {
+ if (elem.tagName === "INPUT") return "input";
if (elem.nodeType === elem.TEXT_NODE) {
const range = elem.ownerDocument.createRange();
range.selectNodeContents(elem);
diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts
index f112bad38..369876428 100644
--- a/src/client/documents/Documents.ts
+++ b/src/client/documents/Documents.ts
@@ -1,7 +1,7 @@
import { action, runInAction } from "mobx";
-import { basename, extname } from "path";
+import { basename } from "path";
import { DateField } from "../../fields/DateField";
-import { Doc, DocListCast, DocListCastAsync, Field, HeightSym, Opt, WidthSym, Initializing, updateCachedAcls } from "../../fields/Doc";
+import { Doc, DocListCast, DocListCastAsync, Field, HeightSym, Initializing, Opt, updateCachedAcls, WidthSym } from "../../fields/Doc";
import { Id } from "../../fields/FieldSymbols";
import { HtmlField } from "../../fields/HtmlField";
import { InkField } from "../../fields/InkField";
@@ -13,20 +13,20 @@ import { ComputedField, ScriptField } from "../../fields/ScriptField";
import { Cast, NumCast, StrCast } from "../../fields/Types";
import { AudioField, ImageField, MapField, PdfField, VideoField, WebField, YoutubeField } from "../../fields/URLField";
import { SharingPermissions } from "../../fields/util";
-import { MessageStore } from "../../server/Message";
import { Upload } from "../../server/SharedMediaTypes";
import { OmitKeys, Utils } from "../../Utils";
import { YoutubeBox } from "../apis/youtube/YoutubeBox";
import { DocServer } from "../DocServer";
import { Networking } from "../Network";
+import { CurrentUserUtils } from "../util/CurrentUserUtils";
import { DocumentManager } from "../util/DocumentManager";
import { dropActionType } from "../util/DragManager";
import { DirectoryImportBox } from "../util/Import & Export/DirectoryImportBox";
import { LinkManager } from "../util/LinkManager";
import { Scripting } from "../util/Scripting";
import { undoBatch, UndoManager } from "../util/UndoManager";
-import { DimUnit } from "../views/collections/collectionMulticolumn/CollectionMulticolumnView";
import { CollectionDockingView } from "../views/collections/CollectionDockingView";
+import { DimUnit } from "../views/collections/collectionMulticolumn/CollectionMulticolumnView";
import { CollectionView, CollectionViewType } from "../views/collections/CollectionView";
import { ContextMenu } from "../views/ContextMenu";
import { ContextMenuProps } from "../views/ContextMenuItem";
@@ -36,30 +36,30 @@ import { AudioBox } from "../views/nodes/AudioBox";
import { ColorBox } from "../views/nodes/ColorBox";
import { ComparisonBox } from "../views/nodes/ComparisonBox";
import { DocFocusOptions } from "../views/nodes/DocumentView";
+import { EquationBox } from "../views/nodes/EquationBox";
+import { FieldViewProps } from "../views/nodes/FieldView";
import { FilterBox } from "../views/nodes/FilterBox";
-import { FontIconBox } from "../views/nodes/FontIconBox";
+import { FontIconBox } from "../views/nodes/button/FontIconBox";
import { FormattedTextBox } from "../views/nodes/formattedText/FormattedTextBox";
+import { FunctionPlotBox } from "../views/nodes/FunctionPlotBox";
import { ImageBox } from "../views/nodes/ImageBox";
import { KeyValueBox } from "../views/nodes/KeyValueBox";
import { LabelBox } from "../views/nodes/LabelBox";
import { LinkBox } from "../views/nodes/LinkBox";
import { LinkDescriptionPopup } from "../views/nodes/LinkDescriptionPopup";
import { PDFBox } from "../views/nodes/PDFBox";
-import { PresBox } from "../views/nodes/trails/PresBox";
import { ScreenshotBox } from "../views/nodes/ScreenshotBox";
import { ScriptingBox } from "../views/nodes/ScriptingBox";
import { SliderBox } from "../views/nodes/SliderBox";
import { TaskCompletionBox } from "../views/nodes/TaskCompletedBox";
+import { PresBox } from "../views/nodes/trails/PresBox";
+import { PresElementBox } from "../views/nodes/trails/PresElementBox";
import { VideoBox } from "../views/nodes/VideoBox";
import { WebBox } from "../views/nodes/WebBox";
-import { PresElementBox } from "../views/nodes/trails/PresElementBox";
import { SearchBox } from "../views/search/SearchBox";
import { DashWebRTCVideo } from "../views/webcam/DashWebRTCVideo";
import { DocumentType } from "./DocumentTypes";
-import { EquationBox } from "../views/nodes/EquationBox";
-import { FunctionPlotBox } from "../views/nodes/FunctionPlotBox";
-import { CurrentUserUtils } from "../util/CurrentUserUtils";
-import { FieldViewProps } from "../views/nodes/FieldView";
+import { IconProp } from "@fortawesome/fontawesome-svg-core";
import { MapBox } from "../views/nodes/MapBox/MapBox";
const path = require('path');
@@ -160,6 +160,7 @@ export class DocumentOptions {
lng?: number;
author?: string;
_layoutKey?: string;
+ unrendered?: boolean; // denotes an annotation that is not rendered with a DocumentView (e.g, rtf/pdf text selections and links to scroll locations in web/pdf)
type?: string;
title?: string;
"acl-Public"?: string; // public permissions
@@ -218,7 +219,33 @@ export class DocumentOptions {
annotationOn?: Doc;
isPushpin?: boolean;
_removeDropProperties?: List<string>; // list of properties that should be removed from a document when it is dropped. e.g., a creator button may be forceActive to allow it be dragged, but the forceActive property can be removed from the dropped document
+
+ // BACKGROUND GRID
+ _backgroundGridShow?: boolean;
+
+ //BUTTONS
+ buttonText?: string;
iconShape?: string; // shapes of the fonticon border
+ btnType?: string;
+ btnList?: List<string>;
+ docColorBtn?: string;
+ userColorBtn?: string;
+ canClick?: string;
+ script?: string;
+ numBtnType?: string;
+ numBtnMax?: number;
+ numBtnMin?: number;
+ switchToggle?: boolean;
+
+ //LINEAR VIEW
+ linearViewIsExpanded?: boolean; // is linear view expanded
+ linearViewExpandable?: boolean; // can linear view be expanded
+ linearViewToggleButton?: string; // button to open close linear view group
+ linearViewSubMenu?: boolean;
+ linearViewFloating?: boolean;
+ flexGap?: number; // Linear view flex gap
+ flexDirection?: "unset" | "row" | "column" | "row-reverse" | "column-reverse";
+
layout_linkView?: Doc; // view template for a link document
layout_keyValue?: string; // view tempalte for key value docs
linkRelationship?: string; // type of relatinoship a link represents
@@ -250,7 +277,12 @@ export class DocumentOptions {
treeViewHideTitle?: boolean; // whether to hide the top document title of a tree view
treeViewHideHeader?: boolean; // whether to hide the header for a document in a tree view
treeViewHideHeaderFields?: boolean; // whether to hide the drop down options for tree view items.
- treeViewShowClearButton?: boolean; // whether a clear button should be displayed
+
+ // Action Button
+ buttonMenu?: boolean; // whether a action button should be displayed
+ buttonMenuDoc?: Doc;
+ explainer?: string;
+
treeViewOpenIsTransient?: boolean; // ignores the treeViewOpen Doc flag, allowing a treeViewItem's expand/collapse state to be independent of other views of the same document in the same or any other tree view
_treeViewOpen?: boolean; // whether this document is expanded in a tree view (note: need _ and regular versions since this can be specified for both proto and layout docs)
treeViewOpen?: boolean; // whether this document is expanded in a tree view
@@ -265,14 +297,14 @@ export class DocumentOptions {
text?: string;
textTransform?: string; // is linear view expanded
letterSpacing?: string; // is linear view expanded
- flexDirection?: "unset" | "row" | "column" | "row-reverse" | "column-reverse";
selectedIndex?: number; // which item in a linear view has been selected using the "thumb doc" ui
clipboard?: Doc;
searchQuery?: string; // for quersyBox
- linearViewIsExpanded?: boolean; // is linear view expanded
useLinkSmallAnchor?: boolean; // whether links to this document should use a miniature linkAnchorBox
border?: string; //for searchbox
hoverBackgroundColor?: string; // background color of a label when hovered
+ linkRelationshipList?: List<string>; // for storing different link relationships (when set by user in the link editor)
+ linkColorList?: List<string>; // colors of links corresponding to specific link relationships
}
export namespace Docs {
@@ -359,7 +391,7 @@ export namespace Docs {
}],
[DocumentType.AUDIO, {
layout: { view: AudioBox, dataField: defaultDataKey },
- options: { _height: 35, backgroundColor: "lightGray", links: ComputedField.MakeFunction("links(self)") as any }
+ options: { _height: 100, backgroundColor: "lightGray", links: ComputedField.MakeFunction("links(self)") as any }
}],
[DocumentType.PDF, {
layout: { view: PDFBox, dataField: defaultDataKey },
@@ -685,14 +717,14 @@ export namespace Docs {
return linkDoc;
}
- export function InkDocument(color: string, tool: string, strokeWidth: string, strokeBezier: string, fillColor: string, arrowStart: string, arrowEnd: string, dash: string, points: { X: number, Y: number }[], options: DocumentOptions = {}) {
+ export function InkDocument(color: string, tool: string, strokeWidth: number, strokeBezier: string, fillColor: string, arrowStart: string, arrowEnd: string, dash: string, points: { X: number, Y: number }[], options: DocumentOptions = {}) {
const I = new Doc();
I[Initializing] = true;
I.type = DocumentType.INK;
I.layout = InkingStroke.LayoutString("data");
I.color = color;
I.fillColor = fillColor;
- I.strokeWidth = Number(strokeWidth);
+ I.strokeWidth = strokeWidth;
I.strokeBezier = strokeBezier;
I.strokeStartMarker = arrowStart;
I.strokeEndMarker = arrowEnd;
@@ -701,7 +733,6 @@ export namespace Docs {
I.title = "ink";
I.x = options.x;
I.y = options.y;
- I._backgroundColor = "transparent";
I._width = options._width as number;
I._height = options._height as number;
I._fontFamily = "cursive";
@@ -710,15 +741,26 @@ export namespace Docs {
I.data = new InkField(points);
I["acl-Public"] = Doc.UserDoc()?.defaultAclPrivate ? SharingPermissions.None : SharingPermissions.Augment;
I["acl-Override"] = "None";
+ I.links = ComputedField.MakeFunction("links(self)") as any;
I[Initializing] = false;
return I;
}
export function PdfDocument(url: string, options: DocumentOptions = {}) {
+ const width = options._width || undefined;
+ const height = options._height || undefined;
+ const nwid = options._nativeWidth || undefined;
+ const nhght = options._nativeHeight || undefined;
+ if (!nhght && width && height && nwid) options._nativeHeight = Number(nwid) * Number(height) / Number(width);
return InstanceFromProto(Prototypes.get(DocumentType.PDF), new PdfField(url), options);
}
export function WebDocument(url: string, options: DocumentOptions = {}) {
+ const width = options._width || undefined;
+ const height = options._height || undefined;
+ const nwid = options._nativeWidth || undefined;
+ const nhght = options._nativeHeight || undefined;
+ if (!nhght && width && height && nwid) options._nativeHeight = Number(nwid) * Number(height) / Number(width);
return InstanceFromProto(Prototypes.get(DocumentType.WEB), url ? new WebField(url) : undefined, options);
}
@@ -731,9 +773,9 @@ export namespace Docs {
}
export function MapMarkerDocument(lat: number, lng: number, documents: Array<Doc>, options: DocumentOptions, id?: string) {
- return InstanceFromProto(Prototypes.get(DocumentType.MARKER), new List(documents), {lat, lng, ...options}, id);
+ return InstanceFromProto(Prototypes.get(DocumentType.MARKER), new List(documents), { lat, lng, ...options }, id);
}
-
+
export function KVPDocument(document: Doc, options: DocumentOptions = {}) {
return InstanceFromProto(Prototypes.get(DocumentType.KVP), document, { title: document.title + ".kvp", ...options });
}
@@ -932,12 +974,16 @@ export namespace DocUtils {
// facets that have a check next to them
const checks = Object.keys(facet).filter(value => facet[value] === "check");
+ // metadata facets that exist
+ const exists = Object.keys(facet).filter(value => facet[value] === "exists");
+
// facets that have an x next to them
const xs = Object.keys(facet).filter(value => facet[value] === "x");
- if (!xs.length && !checks.length && !matches.length) return true;
+ if (!exists.length && !xs.length && !checks.length && !matches.length) return true;
const failsNotEqualFacets = !xs.length ? false : xs.some(value => Doc.matchFieldValue(d, facetKey, value));
const satisfiesCheckFacets = !checks.length ? true : checks.some(value => Doc.matchFieldValue(d, facetKey, value));
+ const satisfiesExistsFacets = !exists.length ? true : exists.some(value => d[facetKey] !== undefined);
const satisfiesMatchFacets = !matches.length ? true : matches.some(value => {
if (facetKey.startsWith("*")) { // fields starting with a '*' are used to match families of related fields. ie, *lastModified will match text-lastModified, data-lastModified, etc
const allKeys = Array.from(Object.keys(d));
@@ -949,11 +995,11 @@ export namespace DocUtils {
});
// if we're ORing them together, the default return is false, and we return true for a doc if it satisfies any one set of criteria
if ((parentCollection?.currentFilter as Doc)?.filterBoolean === "OR") {
- if (satisfiesCheckFacets && !failsNotEqualFacets && satisfiesMatchFacets) return true;
+ if (satisfiesExistsFacets && satisfiesCheckFacets && !failsNotEqualFacets && satisfiesMatchFacets) return true;
}
// if we're ANDing them together, the default return is true, and we return false for a doc if it doesn't satisfy any set of criteria
else {
- if (!satisfiesCheckFacets || failsNotEqualFacets || (matches.length && !satisfiesMatchFacets)) return false;
+ if (!satisfiesExistsFacets || !satisfiesCheckFacets || failsNotEqualFacets || (matches.length && !satisfiesMatchFacets)) return false;
}
}
@@ -1155,11 +1201,12 @@ export namespace DocUtils {
export function addDocumentCreatorMenuItems(docTextAdder: (d: Doc) => void, docAdder: (d: Doc) => void, x: number, y: number, simpleMenu: boolean = false): void {
!simpleMenu && ContextMenu.Instance.addItem({
- description: "Add Note ...",
+ description: "Quick Notes",
subitems: DocListCast((Doc.UserDoc()["template-notes"] as Doc).data).map((note, i) => ({
description: ":" + StrCast(note.title),
event: undoBatch((args: { x: number, y: number }) => {
const textDoc = Docs.Create.TextDocument("", {
+ _fontFamily: StrCast(Doc.UserDoc()._fontFamily), _fontSize: StrCast(Doc.UserDoc()._fontSize),
_width: 200, x, y, _autoHeight: note._autoHeight !== false,
title: StrCast(note.title) + "#" + (note.aliasCount = NumCast(note.aliasCount) + 1)
});
@@ -1167,12 +1214,12 @@ export namespace DocUtils {
textDoc[textDoc.layoutKey] = note;
docTextAdder(textDoc);
}),
- icon: "eye"
+ icon: StrCast(note.icon) as IconProp
})) as ContextMenuProps[],
- icon: "eye"
+ icon: "sticky-note"
});
- ContextMenu.Instance.addItem({
- description: ":=math", event: () => {
+ const math: ContextMenuProps = ({
+ description: ":Math", event: () => {
const created = Docs.Create.EquationDocument();
if (created) {
created.author = Doc.CurrentUserEmail;
@@ -1183,25 +1230,27 @@ export namespace DocUtils {
EquationBox.SelectOnLoad = created[Id];
docAdder?.(created);
}
- }, icon: "compress-arrows-alt"
+ }, icon: "calculator"
});
+ const documentList: ContextMenuProps[] = DocListCast(Cast(Doc.UserDoc().myItemCreators, Doc, null)?.data).filter(btnDoc => !btnDoc.hidden).map(btnDoc => Cast(btnDoc?.dragFactory, Doc, null)).filter(doc => doc && doc !== Doc.UserDoc().emptyPresentation).map((dragDoc, i) => ({
+ description: ":" + StrCast(dragDoc.title),
+ event: undoBatch((args: { x: number, y: number }) => {
+ const newDoc = Doc.copyDragFactory(dragDoc);
+ if (newDoc) {
+ newDoc.author = Doc.CurrentUserEmail;
+ newDoc.x = x;
+ newDoc.y = y;
+ if (newDoc.type === DocumentType.RTF) FormattedTextBox.SelectOnLoad = newDoc[Id];
+ docAdder?.(newDoc);
+ }
+ }),
+ icon: Doc.toIcon(dragDoc),
+ })) as ContextMenuProps[];
+ documentList.push(math);
ContextMenu.Instance.addItem({
- description: "Add Template Doc ...",
- subitems: DocListCast(Cast(Doc.UserDoc().myItemCreators, Doc, null)?.data).filter(btnDoc => !btnDoc.hidden).map(btnDoc => Cast(btnDoc?.dragFactory, Doc, null)).filter(doc => doc && doc !== Doc.UserDoc().emptyPresentation).map((dragDoc, i) => ({
- description: ":" + StrCast(dragDoc.title),
- event: undoBatch((args: { x: number, y: number }) => {
- const newDoc = Doc.copyDragFactory(dragDoc);
- if (newDoc) {
- newDoc.author = Doc.CurrentUserEmail;
- newDoc.x = x;
- newDoc.y = y;
- if (newDoc.type === DocumentType.RTF) FormattedTextBox.SelectOnLoad = newDoc[Id];
- docAdder?.(newDoc);
- }
- }),
- icon: "eye"
- })) as ContextMenuProps[],
- icon: "eye"
+ description: "Create document",
+ subitems: documentList,
+ icon: "file"
});
}// applies a custom template to a document. the template is identified by it's short name (e.g, slideView not layout_slideView)
export function makeCustomViewClicked(doc: Doc, creator: Opt<(documents: Array<Doc>, options: DocumentOptions, id?: string) => Doc>, templateSignature: string = "custom", docLayoutTemplate?: Doc) {
@@ -1345,12 +1394,12 @@ export namespace DocUtils {
let degrees = dms[0] / dms[1];
let minutes = dms[2] / dms[3] / 60.0;
let seconds = dms[4] / dms[5] / 3600.0;
-
+
if (['S', 'W'].includes(ref)) {
degrees = -degrees; minutes = -minutes; seconds = -seconds
}
return (degrees + minutes + seconds).toFixed(5);
- }
+ }
}
async function processFileupload(generatedDocuments: Doc[], name: string, type: string, result: Error | Upload.FileInformation, options: DocumentOptions) {
diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts
index b4e6d9be9..f40cae676 100644
--- a/src/client/util/CurrentUserUtils.ts
+++ b/src/client/util/CurrentUserUtils.ts
@@ -22,6 +22,7 @@ import { DimUnit } from "../views/collections/collectionMulticolumn/CollectionMu
import { CollectionView, CollectionViewType } from "../views/collections/CollectionView";
import { Colors } from "../views/global/globalEnums";
import { MainView } from "../views/MainView";
+import { ButtonType, NumButtonType } from "../views/nodes/button/FontIconBox";
import { FormattedTextBox } from "../views/nodes/formattedText/FormattedTextBox";
import { LabelBox } from "../views/nodes/LabelBox";
import { OverlayView } from "../views/OverlayView";
@@ -37,7 +38,25 @@ import { ColorScheme } from "./SettingsManager";
import { SharingManager } from "./SharingManager";
import { SnappingManager } from "./SnappingManager";
import { UndoManager } from "./UndoManager";
-
+import { TreeView } from "../views/collections/TreeView";
+
+interface Button {
+ title?: string;
+ toolTip?: string;
+ icon?: string;
+ btnType?: ButtonType;
+ click?: string;
+ numBtnType?: NumButtonType;
+ numBtnMin?: number;
+ numBtnMax?: number;
+ switchToggle?: boolean;
+ script?: string;
+ checkResult?: string;
+ width?: number;
+ list?: string[];
+ ignoreClick?: boolean;
+ buttonText?: string;
+}
export let resolvedPorts: { server: number, socket: number };
const headerViewVersion = "0.1";
@@ -66,16 +85,17 @@ export class CurrentUserUtils {
title: "NEW MOBILE BUTTON",
onClick: undefined,
},
- [this.ficon({
+ [this.createToolButton({
ignoreClick: true,
icon: "mobile",
+ btnType: ButtonType.ToolButton,
backgroundColor: "transparent"
}),
this.mobileTextContainer({},
[this.mobileButtonText({}, "NEW MOBILE BUTTON"), this.mobileButtonInfo({}, "You can customize this button and make it your own.")])]);
- doc["template-mobile-button"] = CurrentUserUtils.ficon({
+ doc["template-mobile-button"] = CurrentUserUtils.createToolButton({
onDragStart: ScriptField.MakeFunction('copyDragFactory(this.dragFactory)'),
- dragFactory: new PrefetchProxy(queryTemplate) as any as Doc, title: "mobile button", icon: "mobile"
+ dragFactory: new PrefetchProxy(queryTemplate) as any as Doc, title: "mobile button", icon: "mobile", btnType: ButtonType.ToolButton,
});
}
@@ -83,14 +103,15 @@ export class CurrentUserUtils {
const slideTemplate = Docs.Create.MultirowDocument(
[
Docs.Create.MulticolumnDocument([], { title: "data", _height: 200, system: true }),
- Docs.Create.TextDocument("", { title: "text", _height: 100, system: true })
+ Docs.Create.TextDocument("", { title: "text", _height: 100, system: true, _fontFamily: StrCast(Doc.UserDoc()._fontFamily), _fontSize: StrCast(Doc.UserDoc()._fontSize) })
],
{ _width: 400, _height: 300, title: "slideView", _xMargin: 3, _yMargin: 3, system: true }
);
slideTemplate.isTemplateDoc = makeTemplate(slideTemplate);
- doc["template-button-slides"] = CurrentUserUtils.ficon({
+ doc["template-button-slides"] = CurrentUserUtils.createToolButton({
onDragStart: ScriptField.MakeFunction('copyDragFactory(this.dragFactory)'),
- dragFactory: new PrefetchProxy(slideTemplate) as any as Doc, title: "presentation slide", icon: "address-card"
+ dragFactory: new PrefetchProxy(slideTemplate) as any as Doc, title: "presentation slide", icon: "address-card",
+ btnType: ButtonType.ToolButton
});
}
@@ -134,9 +155,10 @@ export class CurrentUserUtils {
};
linkTemplate.header = new RichTextField(JSON.stringify(rtf2), "");
- doc["template-button-link"] = CurrentUserUtils.ficon({
+ doc["template-button-link"] = CurrentUserUtils.createToolButton({
onDragStart: ScriptField.MakeFunction('copyDragFactory(this.dragFactory)'),
- dragFactory: new PrefetchProxy(linkTemplate) as any as Doc, title: "link view", icon: "window-maximize", system: true
+ dragFactory: new PrefetchProxy(linkTemplate) as any as Doc, title: "link view", icon: "window-maximize", system: true,
+ btnType: ButtonType.ToolButton
});
}
@@ -165,9 +187,10 @@ export class CurrentUserUtils {
const box = MulticolumnDocument([/*no, */ yes, name], { title: "value", _width: 120, _height: 35, system: true });
box.isTemplateDoc = makeTemplate(box, true, "switch");
- doc["template-button-switch"] = CurrentUserUtils.ficon({
+ doc["template-button-switch"] = CurrentUserUtils.createToolButton({
onDragStart: ScriptField.MakeFunction('copyDragFactory(this.dragFactory)'),
- dragFactory: new PrefetchProxy(box) as any as Doc, title: "data switch", icon: "toggle-on", system: true
+ dragFactory: new PrefetchProxy(box) as any as Doc, title: "data switch", icon: "toggle-on", system: true,
+ btnType: ButtonType.ToolButton
});
}
@@ -214,9 +237,13 @@ export class CurrentUserUtils {
short.title = "A Short Description";
long.title = "Long Description";
- doc["template-button-detail"] = CurrentUserUtils.ficon({
+ doc["template-button-detail"] = CurrentUserUtils.createToolButton({
onDragStart: ScriptField.MakeFunction('copyDragFactory(this.dragFactory)'),
- dragFactory: new PrefetchProxy(detailView) as any as Doc, title: "detailView", icon: "window-maximize", system: true
+ dragFactory: new PrefetchProxy(detailView) as any as Doc,
+ title: "detailView",
+ icon: "window-maximize",
+ system: true,
+ btnType: ButtonType.ToolButton,
});
}
@@ -231,7 +258,7 @@ export class CurrentUserUtils {
doc["template-buttons"] = new PrefetchProxy(Docs.Create.MasonryDocument(requiredTypes, {
title: "Advanced Item Prototypes", _xMargin: 0, _showTitle: "title", _chromeHidden: true,
hidden: ComputedField.MakeFunction("IsNoviceMode()") as any,
- _stayInCollection: true, _hideContextMenu: true,
+ _stayInCollection: true, _hideContextMenu: true, _forceActive: true,
_autoHeight: true, _width: 500, _height: 300, _fitWidth: true, _columnWidth: 35, ignoreClick: true, _lockedPosition: true,
dropConverter: ScriptField.MakeScript("convertToButtons(dragData)", { dragData: DragManager.DocumentDragData.name }), system: true
}));
@@ -248,37 +275,47 @@ export class CurrentUserUtils {
// setup the different note type skins
static setupNoteTemplates(doc: Doc) {
if (doc["template-note-Note"] === undefined) {
- const noteView = Docs.Create.TextDocument("", { title: "text", isTemplateDoc: true, backgroundColor: "yellow", system: true });
+ const noteView = Docs.Create.TextDocument("", {
+ title: "text", isTemplateDoc: true, backgroundColor: "yellow", system: true, icon: "sticky-note",
+ _fontFamily: StrCast(Doc.UserDoc()._fontFamily), _fontSize: StrCast(Doc.UserDoc()._fontSize),
+ });
noteView.isTemplateDoc = makeTemplate(noteView, true, "Note");
doc["template-note-Note"] = new PrefetchProxy(noteView);
}
if (doc["template-note-Idea"] === undefined) {
- const noteView = Docs.Create.TextDocument("", { title: "text", backgroundColor: "pink", system: true });
+ const noteView = Docs.Create.TextDocument("", {
+ title: "text", backgroundColor: "pink", system: true, icon: "lightbulb",
+ _fontFamily: StrCast(Doc.UserDoc()._fontFamily), _fontSize: StrCast(Doc.UserDoc()._fontSize),
+ });
noteView.isTemplateDoc = makeTemplate(noteView, true, "Idea");
doc["template-note-Idea"] = new PrefetchProxy(noteView);
}
if (doc["template-note-Topic"] === undefined) {
- const noteView = Docs.Create.TextDocument("", { title: "text", backgroundColor: "lightblue", system: true });
- noteView.isTemplateDoc = makeTemplate(noteView, true, "Topic");
- doc["template-note-Topic"] = new PrefetchProxy(noteView);
- }
- if (doc["template-note-Todo"] === undefined) {
const noteView = Docs.Create.TextDocument("", {
- title: "text", backgroundColor: "orange", _autoHeight: false, _height: 100, _showCaption: "caption",
- layout: FormattedTextBox.LayoutString("Todo"), caption: RichTextField.DashField("taskStatus"), system: true
+ title: "text", backgroundColor: "lightblue", system: true, icon: "book-open",
+ _fontFamily: StrCast(Doc.UserDoc()._fontFamily), _fontSize: StrCast(Doc.UserDoc()._fontSize),
});
- noteView.isTemplateDoc = makeTemplate(noteView, true, "Todo");
- doc["template-note-Todo"] = new PrefetchProxy(noteView);
- }
- const taskStatusValues = [
- { title: "todo", _backgroundColor: "blue", color: "white", system: true },
- { title: "in progress", _backgroundColor: "yellow", color: "black", system: true },
- { title: "completed", _backgroundColor: "green", color: "white", system: true }
- ];
- if (doc.fieldTypes === undefined) {
- doc.fieldTypes = Docs.Create.TreeDocument([], { title: "field enumerations", system: true });
- DocUtils.addFieldEnumerations(Doc.GetProto(doc["template-note-Todo"] as any as Doc), "taskStatus", taskStatusValues);
+ noteView.isTemplateDoc = makeTemplate(noteView, true, "Topic");
+ doc["template-note-Topic"] = new PrefetchProxy(noteView);
}
+ // if (doc["template-note-Todo"] === undefined) {
+ // const noteView = Docs.Create.TextDocument("", {
+ // title: "text", backgroundColor: "orange", _autoHeight: false, _height: 100, _showCaption: "caption",
+ // layout: FormattedTextBox.LayoutString("Todo"), caption: RichTextField.DashField("taskStatus"), system: true,
+ // _fontFamily: StrCast(Doc.UserDoc()._fontFamily), _fontSize: StrCast(Doc.UserDoc()._fontSize),
+ // });
+ // noteView.isTemplateDoc = makeTemplate(noteView, true, "Todo");
+ // doc["template-note-Todo"] = new PrefetchProxy(noteView);
+ // }
+ // const taskStatusValues = [
+ // { title: "todo", _backgroundColor: "blue", color: "white", system: true },
+ // { title: "in progress", _backgroundColor: "yellow", color: "black", system: true },
+ // { title: "completed", _backgroundColor: "green", color: "white", system: true }
+ // ];
+ // if (doc.fieldTypes === undefined) {
+ // doc.fieldTypes = Docs.Create.TreeDocument([], { title: "field enumerations", system: true });
+ // DocUtils.addFieldEnumerations(Doc.GetProto(doc["template-note-Todo"] as any as Doc), "taskStatus", taskStatusValues);
+ // }
if (doc["template-notes"] === undefined) {
doc["template-notes"] = new PrefetchProxy(Docs.Create.TreeDocument([doc["template-note-Note"] as any as Doc, doc["template-note-Idea"] as any as Doc, doc["template-note-Topic"] as any as Doc], // doc["template-note-Todo"] as any as Doc],
@@ -380,11 +417,11 @@ export class CurrentUserUtils {
((doc.emptyCollection as Doc).proto as Doc)["dragFactory-count"] = 0;
}
if (doc.emptyPane === undefined) {
- doc.emptyPane = Docs.Create.FreeformDocument([], { _nativeWidth: undefined, _nativeHeight: undefined, _width: 500, _height: 800, title: "Untitled Tab", system: true, cloneFieldFilter: new List<string>(["system"]) });
+ doc.emptyPane = Docs.Create.FreeformDocument([], { _nativeWidth: undefined, _backgroundGridShow: true, _nativeHeight: undefined, _width: 500, _height: 800, title: "Untitled Tab", system: true, cloneFieldFilter: new List<string>(["system"]) });
((doc.emptyPane as Doc).proto as Doc)["dragFactory-count"] = 0;
}
if (doc.emptySlide === undefined) {
- const textDoc = Docs.Create.TreeDocument([], { title: "Slide", _viewType: CollectionViewType.Tree, _fontSize: "20px", treeViewType: "outline", _xMargin: 0, _yMargin: 0, _width: 300, _height: 200, _singleLine: true, backgroundColor: "transparent", system: true, cloneFieldFilter: new List<string>(["system"]) });
+ const textDoc = Docs.Create.TreeDocument([], { title: "Slide", _viewType: CollectionViewType.Tree, _fontSize: "20px", _autoHeight: true, treeViewType: "outline", _xMargin: 0, _yMargin: 0, _width: 300, _height: 200, _singleLine: true, backgroundColor: "transparent", system: true, cloneFieldFilter: new List<string>(["system"]) });
Doc.GetProto(textDoc).title = ComputedField.MakeFunction('self.text?.Text');
FormattedTextBox.SelectOnLoad = textDoc[Id];
doc.emptySlide = textDoc;
@@ -410,16 +447,16 @@ export class CurrentUserUtils {
storedMarks: []
};
const headerTemplate = Docs.Create.RTFDocument(new RichTextField(JSON.stringify(json), ""), {
- title: "text", version: headerViewVersion, target: doc, _height: 70, _headerPointerEvents: "all",
+ title: "text", version: headerViewVersion, _height: 70, _headerPointerEvents: "all",
_headerHeight: 12, _headerFontSize: 9, _autoHeight: true, system: true, _fitWidth: true,
cloneFieldFilter: new List<string>(["system"])
}, "header");
const headerBtnHgt = 10;
headerTemplate[DataSym].layout =
"<HTMLdiv transformOrigin='top left' width='{100/scale}%' height='{100/scale}%' transform='scale({scale})'>" +
- ` <FormattedTextBox {...props} dontScale='true' fieldKey={'text'} height='calc(100% - ${headerBtnHgt}px - {this._headerHeight}px)'/>` +
- " <FormattedTextBox {...props} dontScale='true' fieldKey={'header'} dontSelectOnLoad='true' ignoreAutoHeight='true' fontSize='{this._headerFontSize}px' height='{(this._headerHeight||1)}px' background='{this._headerColor ||this.target.mySharedDocs.userColor||`lightGray`}' />" +
- ` <HTMLdiv fontSize='${headerBtnHgt - 1}px' height='${headerBtnHgt}px' background='yellow' onClick={‘(this._headerHeight=scale*Math.min(Math.max(1,this._height-30),this._headerHeight===1?50:1)) && (this._autoHeightMargins=this._headerHeight+${headerBtnHgt})’} >Metadata</HTMLdiv>` +
+ ` <FormattedTextBox {...props} dontScale='true' fieldKey={'text'} height='calc(100% - ${headerBtnHgt}px - {this._headerHeight||0}px)'/>` +
+ " <FormattedTextBox {...props} dontScale='true' fieldKey={'header'} dontSelectOnLoad='true' ignoreAutoHeight='true' fontSize='{this._headerFontSize||9}px' height='{(this._headerHeight||0)}px' background='{this._headerColor || MySharedDocs().userColor||`lightGray`}' />" +
+ ` <HTMLdiv fontSize='${headerBtnHgt - 1}px' height='${headerBtnHgt}px' background='yellow' onClick={‘(this._headerHeight=scale*Math.min(Math.max(0,this._height-30),this._headerHeight===0?50:0)) + (this._autoHeightMargins=this._headerHeight ? this._headerHeight+${headerBtnHgt}:0)’} >Metadata</HTMLdiv>` +
"</HTMLdiv>";
// "<div style={'height:100%'}>" +
@@ -431,25 +468,29 @@ export class CurrentUserUtils {
((doc.emptyHeader as Doc).proto as Doc)["dragFactory-count"] = 0;
}
if (doc.emptyComparison === undefined) {
- doc.emptyComparison = Docs.Create.ComparisonDocument({ title: "compare", _width: 300, _height: 300, system: true, cloneFieldFilter: new List<string>(["system"]) });
+ doc.emptyComparison = Docs.Create.ComparisonDocument({ title: "comparison box", _width: 300, _height: 300, system: true, cloneFieldFilter: new List<string>(["system"]) });
}
if (doc.emptyScript === undefined) {
doc.emptyScript = Docs.Create.ScriptingDocument(undefined, { _width: 200, _height: 250, title: "script", system: true, cloneFieldFilter: new List<string>(["system"]) });
((doc.emptyScript as Doc).proto as Doc)["dragFactory-count"] = 0;
}
if (doc.emptyScreenshot === undefined) {
- doc.emptyScreenshot = Docs.Create.ScreenshotDocument("empty screenshot", { _fitWidth: true, _width: 400, _height: 200, system: true, cloneFieldFilter: new List<string>(["system"]) });
+ doc.emptyScreenshot = Docs.Create.ScreenshotDocument("empty screenshot", { _fitWidth: true, title: "empty screenshot", _width: 400, _height: 200, system: true, cloneFieldFilter: new List<string>(["system"]) });
}
if (doc.emptyWall === undefined) {
doc.emptyWall = Docs.Create.ScreenshotDocument("", { _fitWidth: true, _width: 400, _height: 200, title: "screen snapshot", system: true, cloneFieldFilter: new List<string>(["system"]) });
(doc.emptyWall as Doc).videoWall = true;
}
if (doc.emptyAudio === undefined) {
- doc.emptyAudio = Docs.Create.AudioDocument(nullAudio, { _width: 200, title: "audio recording", system: true, cloneFieldFilter: new List<string>(["system"]) });
+ doc.emptyAudio = Docs.Create.AudioDocument(nullAudio, { _width: 200, _height: 100, title: "audio recording", system: true, cloneFieldFilter: new List<string>(["system"]) });
((doc.emptyAudio as Doc).proto as Doc)["dragFactory-count"] = 0;
}
if (doc.emptyNote === undefined) {
- doc.emptyNote = Docs.Create.TextDocument("", { _width: 200, title: "text note", _autoHeight: true, system: true, cloneFieldFilter: new List<string>(["system"]) });
+ doc.emptyNote = Docs.Create.TextDocument("", {
+ _width: 200, title: "text note", _autoHeight: true, system: true,
+ _fontFamily: StrCast(Doc.UserDoc()._fontFamily), _fontSize: StrCast(Doc.UserDoc()._fontSize),
+ cloneFieldFilter: new List<string>(["system"])
+ });
((doc.emptyNote as Doc).proto as Doc)["dragFactory-count"] = 0;
}
if (doc.emptyImage === undefined) {
@@ -460,7 +501,7 @@ export class CurrentUserUtils {
((doc.emptyButton as Doc).proto as Doc)["dragFactory-count"] = 0;
}
if (doc.emptyWebpage === undefined) {
- doc.emptyWebpage = Docs.Create.WebDocument("", { title: "webpage", _nativeWidth: 850, _height: 512, _width: 400, useCors: true, system: true, cloneFieldFilter: new List<string>(["system"]) });
+ doc.emptyWebpage = Docs.Create.WebDocument("http://www.bing.com/", { title: "webpage", _nativeWidth: 850, _height: 512, _width: 400, useCors: true, system: true, cloneFieldFilter: new List<string>(["system"]) });
}
if (doc.emptyMap === undefined) {
doc.emptyMap = Docs.Create.MapDocument([], { title: "map", _showSidebar: true, _width: 800, _height: 600, system: true, cloneFieldFilter: new List<string>(["system"]) });
@@ -473,10 +514,10 @@ export class CurrentUserUtils {
{ toolTip: "Tap to create a note in a new pane, drag for a note", title: "Note", icon: "sticky-note", click: 'openOnRight(copyDragFactory(this.clickFactory))', drag: 'copyDragFactory(this.dragFactory)', dragFactory: doc.emptyNote as Doc, noviceMode: true, clickFactory: doc.emptyNote as Doc, },
{ toolTip: "Tap to create a collection in a new pane, drag for a collection", title: "Col", icon: "folder", click: 'openOnRight(copyDragFactory(this.clickFactory))', drag: 'copyDragFactory(this.dragFactory)', dragFactory: doc.emptyCollection as Doc, noviceMode: true, clickFactory: doc.emptyPane as Doc, },
{ toolTip: "Tap to create a webpage in a new pane, drag for a webpage", title: "Web", icon: "globe-asia", click: 'openOnRight(copyDragFactory(this.dragFactory))', drag: 'copyDragFactory(this.dragFactory)', dragFactory: doc.emptyWebpage as Doc, noviceMode: true },
- { toolTip: "Tap to create a progressive slide", title: "Slide", icon: "file", click: 'openOnRight(copyDragFactory(this.dragFactory))', drag: 'copyDragFactory(this.dragFactory)', dragFactory: doc.emptySlide as Doc, noviceMode: true },
+ { toolTip: "Tap to create a progressive slide", title: "Slide", icon: "file", click: 'openOnRight(copyDragFactory(this.dragFactory))', drag: 'copyDragFactory(this.dragFactory)', dragFactory: doc.emptySlide as Doc },
{ toolTip: "Tap to create a cat image in a new pane, drag for a cat image", title: "Image", icon: "cat", click: 'openOnRight(copyDragFactory(this.dragFactory))', drag: 'copyDragFactory(this.dragFactory)', dragFactory: doc.emptyImage as Doc },
{ toolTip: "Tap to create a comparison box in a new pane, drag for a comparison box", title: "Compare", icon: "columns", click: 'openOnRight(copyDragFactory(this.dragFactory))', drag: 'copyDragFactory(this.dragFactory)', dragFactory: doc.emptyComparison as Doc, noviceMode: true },
- { toolTip: "Tap to create a screen grabber in a new pane, drag for a screen grabber", title: "Grab", icon: "photo-video", click: 'openOnRight(copyDragFactory(this.dragFactory))', drag: 'copyDragFactory(this.dragFactory)', dragFactory: doc.emptyScreenshot as Doc, noviceMode: true },
+ { toolTip: "Tap to create a screen grabber in a new pane, drag for a screen grabber", title: "Grab", icon: "photo-video", click: 'openOnRight(copyDragFactory(this.dragFactory))', drag: 'copyDragFactory(this.dragFactory)', dragFactory: doc.emptyScreenshot as Doc },
{ toolTip: "Tap to create a videoWall", title: "Wall", icon: "photo-video", click: 'openOnRight(copyDragFactory(this.dragFactory))', drag: 'copyDragFactory(this.dragFactory)', dragFactory: doc.emptyWall as Doc },
{ toolTip: "Tap to create an audio recorder in a new pane, drag for an audio recorder", title: "Audio", icon: "microphone", click: 'openOnRight(copyDragFactory(this.dragFactory))', drag: 'copyDragFactory(this.dragFactory)', dragFactory: doc.emptyAudio as Doc, noviceMode: true },
{ toolTip: "Tap to create a button in a new pane, drag for a button", title: "Button", icon: "bolt", click: 'openOnRight(copyDragFactory(this.dragFactory))', drag: 'copyDragFactory(this.dragFactory)', dragFactory: doc.emptyButton as Doc },
@@ -507,11 +548,13 @@ export class CurrentUserUtils {
icon,
title,
toolTip,
+ btnType: ButtonType.ToolButton,
ignoreClick,
_dropAction: "alias",
onDragStart: drag ? ScriptField.MakeFunction(drag) : undefined,
onClick: click ? ScriptField.MakeScript(click) : undefined,
- backgroundColor,
+ backgroundColor: backgroundColor ? backgroundColor : Colors.DARK_GRAY,
+ color: Colors.WHITE,
_hideContextMenu: true,
_removeDropProperties: new List<string>(["_stayInCollection"]),
_stayInCollection: true,
@@ -524,7 +567,7 @@ export class CurrentUserUtils {
if (dragCreatorSet === undefined) {
doc.myItemCreators = new PrefetchProxy(Docs.Create.MasonryDocument(creatorBtns, {
title: "Basic Item Creators", _showTitle: "title", _xMargin: 0, _stayInCollection: true, _hideContextMenu: true, _chromeHidden: true,
- _autoHeight: true, _width: 500, _height: 300, _fitWidth: true, _columnWidth: 35, ignoreClick: true, _lockedPosition: true,
+ _autoHeight: true, _width: 500, _height: 300, _fitWidth: true, _columnWidth: 40, ignoreClick: true, _lockedPosition: true, _forceActive: true,
dropConverter: ScriptField.MakeScript("convertToButtons(dragData)", { dragData: DragManager.DocumentDragData.name }), system: true
}));
} else {
@@ -537,31 +580,31 @@ export class CurrentUserUtils {
return [
{ title: "Dashboards", target: Cast(doc.myDashboards, Doc, null), icon: "desktop", click: 'selectMainMenu(self)' },
{ title: "Search", target: Cast(doc.mySearchPanel, Doc, null), icon: "search", click: 'selectMainMenu(self)' },
- { title: "My Files", target: Cast(doc.myFilesystem, Doc, null), icon: "file", click: 'selectMainMenu(self)' },
- { title: "Tools", target: Cast(doc.myTools, Doc, null), icon: "wrench", click: 'selectMainMenu(self)' },
- { title: "Import", target: Cast(doc.myImportPanel, Doc, null), icon: "upload", click: 'selectMainMenu(self)' },
+ { title: "Files", target: Cast(doc.myFilesystem, Doc, null), icon: "folder-open", click: 'selectMainMenu(self)' },
+ { title: "Tools", target: Cast(doc.myTools, Doc, null), icon: "wrench", click: 'selectMainMenu(self)', hidden: "IsNoviceMode()" },
+ { title: "Imports", target: Cast(doc.myImportDocs, Doc, null), icon: "upload", click: 'selectMainMenu(self)' },
{ title: "Recently Closed", target: Cast(doc.myRecentlyClosedDocs, Doc, null), icon: "archive", click: 'selectMainMenu(self)' },
- { title: "Sharing", target: Cast(doc.mySharedDocs, Doc, null), icon: "users", click: 'selectMainMenu(self)', watchedDocuments: doc.mySharedDocs as Doc },
- { title: "Pres. Trails", target: Cast(doc.myPresentations, Doc, null), icon: "pres-trail", click: 'selectMainMenu(self)' },
- // { title: "Help", target: undefined as any, icon: "question-circle", click: 'selectMainMenu(self)' },
- // { title: "Settings", target: undefined as any, icon: "cog", click: 'selectMainMenu(self)' },
- { title: "User Doc", target: Cast(doc.myUserDoc, Doc, null), icon: "address-card", click: 'selectMainMenu(self)' },
+ { title: "Shared with me", target: Cast(doc.mySharedDocs, Doc, null), icon: "users", click: 'selectMainMenu(self)', watchedDocuments: doc.mySharedDocs as Doc },
+ { title: "Trails", target: Cast(doc.myTrails, Doc, null), icon: "pres-trail", click: 'selectMainMenu(self)' },
+ { title: "User Doc", target: Cast(doc.myUserDoc, Doc, null), icon: "address-card", click: 'selectMainMenu(self)', hidden: "IsNoviceMode()" },
];
}
static async setupMenuPanel(doc: Doc, sharingDocumentId: string, linkDatabaseId: string) {
if (doc.menuStack === undefined) {
await this.setupSharingSidebar(doc, sharingDocumentId, linkDatabaseId); // sets up the right sidebar collection for mobile upload documents and sharing
- const menuBtns = (await CurrentUserUtils.menuBtnDescriptions(doc)).map(({ title, target, icon, click, watchedDocuments }) =>
+ const menuBtns = (await CurrentUserUtils.menuBtnDescriptions(doc)).map(({ title, target, icon, click, watchedDocuments, hidden }) =>
Docs.Create.FontIconDocument({
icon,
- iconShape: "square",
+ btnType: ButtonType.MenuButton,
_stayInCollection: true,
_hideContextMenu: true,
+ _chromeHidden: true,
system: true,
dontUndo: true,
title,
target,
+ hidden: hidden ? ComputedField.MakeFunction("IsNoviceMode()") as any : undefined,
_dropAction: "alias",
_removeDropProperties: new List<string>(["dropAction", "_stayInCollection"]),
_width: 60,
@@ -576,8 +619,6 @@ export class CurrentUserUtils {
this.searchBtn = menuBtn;
}
});
- // hack -- last button is assumed to be the userDoc
- menuBtns[menuBtns.length - 1].hidden = ComputedField.MakeFunction("IsNoviceMode()");
menuBtns.forEach(menuBtn => {
if (menuBtn.title === "Search") {
@@ -633,7 +674,7 @@ export class CurrentUserUtils {
// SEts up mobile buttons for inside mobile menu
static setupMobileButtons(doc?: Doc, buttons?: string[]) {
- const docProtoData: { title: string, icon: string, drag?: string, ignoreClick?: boolean, click?: string, activePen?: Doc, backgroundColor?: string, info: string, dragFactory?: Doc }[] = [
+ const docProtoData: { title: string, icon: string, drag?: string, ignoreClick?: boolean, click?: string, backgroundColor?: string, info: string, dragFactory?: Doc }[] = [
{ title: "DASHBOARDS", icon: "bars", click: 'switchToMobileLibrary()', backgroundColor: "lightgrey", info: "Access your Dashboards from your mobile, and navigate through all of your documents. " },
{ title: "UPLOAD", icon: "upload", click: 'openMobileUploads()', backgroundColor: "lightgrey", info: "Upload files from your mobile device so they can be accessed on Dash Web." },
{ title: "MOBILE UPLOAD", icon: "mobile", click: 'switchToMobileUploadCollection()', backgroundColor: "lightgrey", info: "Access the collection of your mobile uploads." },
@@ -649,7 +690,7 @@ export class CurrentUserUtils {
onClick: data.click ? ScriptField.MakeScript(data.click) : undefined,
backgroundColor: data.backgroundColor, system: true
},
- [this.ficon({ ignoreClick: true, icon: data.icon, backgroundColor: "rgba(0,0,0,0)", system: true }), this.mobileTextContainer({}, [this.mobileButtonText({}, data.title), this.mobileButtonInfo({}, data.info)])])
+ [this.createToolButton({ ignoreClick: true, icon: data.icon, backgroundColor: "rgba(0,0,0,0)", system: true, btnType: ButtonType.ClickButton, }), this.mobileTextContainer({}, [this.mobileButtonText({}, data.title), this.mobileButtonInfo({}, data.info)])])
);
}
@@ -758,8 +799,8 @@ export class CurrentUserUtils {
}
if (doc.myTools === undefined) {
- const toolsStack = new PrefetchProxy(Docs.Create.StackingDocument([doc.myCreators as Doc, doc.myColorPicker as Doc], {
- title: "My Tools", _width: 500, _yMargin: 20, ignoreClick: true, _lockedPosition: true, _forceActive: true,
+ const toolsStack = new PrefetchProxy(Docs.Create.StackingDocument([doc.myCreators as Doc], {
+ title: "My Tools", _showTitle: "title", _width: 500, _yMargin: 20, ignoreClick: true, _lockedPosition: true, _forceActive: true,
system: true, _stayInCollection: true, _hideContextMenu: true, _chromeHidden: true, boxShadow: "0 0",
})) as any as Doc;
@@ -771,69 +812,90 @@ export class CurrentUserUtils {
// setup dashboards library item
await doc.myDashboards;
if (doc.myDashboards === undefined) {
+ const newDashboard = ScriptField.MakeScript(`createNewDashboard(Doc.UserDoc())`);
+ const newDashboardButton: Doc = Docs.Create.FontIconDocument({ onClick: newDashboard, _forceActive: true, toolTip: "Create new dashboard", _stayInCollection: true, _hideContextMenu: true, title: "new dashboard", btnType: ButtonType.ClickButton, _width: 30, _height: 30, buttonText: "New trail", icon: "plus", system: true });
doc.myDashboards = new PrefetchProxy(Docs.Create.TreeDocument([], {
title: "My Dashboards", _showTitle: "title", _height: 400, childHideLinkButton: true,
treeViewHideTitle: true, _xMargin: 5, _yMargin: 5, _gridGap: 5, _forceActive: true, childDropAction: "alias",
- treeViewTruncateTitleWidth: 150, ignoreClick: true,
- _lockedPosition: true, boxShadow: "0 0", childDontRegisterViews: true, targetDropAction: "same", treeViewType: "fileSystem", isFolder: true, system: true
+ treeViewTruncateTitleWidth: 150, ignoreClick: true, buttonMenu: true, buttonMenuDoc: newDashboardButton,
+ _lockedPosition: true, boxShadow: "0 0", childDontRegisterViews: true, targetDropAction: "same", treeViewType: "fileSystem", isFolder: true, system: true,
+ explainer: "This is your collection of dashboards. A dashboard represents the tab configuration of your workspace. To manage documents as folders, go to the Files."
}));
- const newDashboard = ScriptField.MakeScript(`createNewDashboard(Doc.UserDoc())`);
- const toggleTheme = ScriptField.MakeScript(`Doc.UserDoc().darkScheme = !Doc.UserDoc().darkScheme`);
- const toggleComic = ScriptField.MakeScript(`toggleComicMode()`);
- const snapshotDashboard = ScriptField.MakeScript(`snapshotDashboard()`);
+ // const toggleTheme = ScriptField.MakeScript(`Doc.UserDoc().darkScheme = !Doc.UserDoc().darkScheme`);
+ // const toggleComic = ScriptField.MakeScript(`toggleComicMode()`);
+ // const snapshotDashboard = ScriptField.MakeScript(`snapshotDashboard()`);
const shareDashboard = ScriptField.MakeScript(`shareDashboard(self)`);
const removeDashboard = ScriptField.MakeScript('removeDashboard(self)');
- (doc.myDashboards as any as Doc).childContextMenuScripts = new List<ScriptField>([newDashboard!, toggleTheme!, toggleComic!, snapshotDashboard!, shareDashboard!, removeDashboard!]);
- (doc.myDashboards as any as Doc).childContextMenuLabels = new List<string>(["Create New Dashboard", "Toggle Theme Colors", "Toggle Comic Mode", "Snapshot Dashboard", "Share Dashboard", "Remove Dashboard"]);
+ (doc.myDashboards as any as Doc).childContextMenuScripts = new List<ScriptField>([newDashboard!, shareDashboard!, removeDashboard!]);
+ (doc.myDashboards as any as Doc).childContextMenuLabels = new List<string>(["Create New Dashboard", "Share Dashboard", "Remove Dashboard"]);
+ (doc.myDashboards as any as Doc).childContextMenuIcons = new List<string>(["plus", "user-friends", "times"]);
+ // (doc.myDashboards as any as Doc).childContextMenuScripts = new List<ScriptField>([newDashboard!, toggleTheme!, toggleComic!, snapshotDashboard!, shareDashboard!, removeDashboard!]);
+ // (doc.myDashboards as any as Doc).childContextMenuLabels = new List<string>(["Create New Dashboard", "Toggle Theme Colors", "Toggle Comic Mode", "Snapshot Dashboard", "Share Dashboard", "Remove Dashboard"]);
}
return doc.myDashboards as any as Doc;
}
static async setupPresentations(doc: Doc) {
- await doc.myPresentations;
- if (doc.myPresentations === undefined) {
- doc.myPresentations = new PrefetchProxy(Docs.Create.TreeDocument([], {
+ await doc.myTrails;
+ if (doc.myTrails === undefined) {
+ const newTrail = ScriptField.MakeScript(`createNewPresentation()`);
+ const newTrailButton: Doc = Docs.Create.FontIconDocument({ onClick: newTrail, _forceActive: true, toolTip: "Create new trail", _stayInCollection: true, _hideContextMenu: true, title: "New trail", btnType: ButtonType.ClickButton, _width: 30, _height: 30, buttonText: "New trail", icon: "plus", system: true });
+ doc.myTrails = new PrefetchProxy(Docs.Create.TreeDocument([], {
title: "My Trails", _showTitle: "title", _height: 100,
- treeViewHideTitle: true, _xMargin: 5, _yMargin: 5, _gridGap: 5, _forceActive: true, childDropAction: "alias",
- treeViewTruncateTitleWidth: 150, ignoreClick: true,
- _lockedPosition: true, boxShadow: "0 0", childDontRegisterViews: true, targetDropAction: "same", system: true
+ treeViewHideTitle: true, _xMargin: 5, _yMargin: 5, _fitWidth: true, _gridGap: 5, _forceActive: true, childDropAction: "alias",
+ treeViewTruncateTitleWidth: 150, ignoreClick: true, buttonMenu: true, buttonMenuDoc: newTrailButton,
+ _lockedPosition: true, boxShadow: "0 0", childDontRegisterViews: true, targetDropAction: "same", system: true,
+ explainer: "All of the trails that you have created will appear here."
}));
- const newPresentations = ScriptField.MakeScript(`createNewPresentation()`);
- (doc.myPresentations as any as Doc).contextMenuScripts = new List<ScriptField>([newPresentations!]);
- (doc.myPresentations as any as Doc).contextMenuLabels = new List<string>(["Create New Presentation"]);
- const presentations = doc.myPresentations as any as Doc;
+ (doc.myTrails as any as Doc).contextMenuScripts = new List<ScriptField>([newTrail!]);
+ (doc.myTrails as any as Doc).contextMenuLabels = new List<string>(["Create New Trail"]);
+ (doc.myTrails as any as Doc).childContextMenuIcons = new List<string>(["plus"]);
}
- return doc.myPresentations as any as Doc;
+ return doc.myTrails as any as Doc;
}
static async setupFilesystem(doc: Doc) {
await doc.myFilesystem;
if (doc.myFilesystem === undefined) {
doc.myFileOrphans = Docs.Create.TreeDocument([], { title: "Unfiled", _stayInCollection: true, system: true, isFolder: true });
- doc.myFileRoot = Docs.Create.TreeDocument([], { title: "file root", _stayInCollection: true, system: true, isFolder: true });
- doc.myFilesystem = new PrefetchProxy(Docs.Create.TreeDocument([doc.myFileRoot as Doc, doc.myFileOrphans as Doc], {
- title: "My Documents", _showTitle: "title", _height: 100,
+ // doc.myFileRoot = Docs.Create.TreeDocument([], { title: "file root", _stayInCollection: true, system: true, isFolder: true });
+ const newFolder = ScriptField.MakeFunction(`makeTopLevelFolder()`, { scriptContext: "any" })!;
+ const newFolderButton: Doc = Docs.Create.FontIconDocument({
+ onClick: newFolder, _forceActive: true, toolTip: "Create new folder",
+ _stayInCollection: true, _hideContextMenu: true, title: "New folder", btnType: ButtonType.ClickButton, _width: 30, _height: 30,
+ buttonText: "New folder", icon: "folder-plus", system: true
+ });
+ doc.myFilesystem = new PrefetchProxy(Docs.Create.TreeDocument([doc.myFileOrphans as Doc], {
+ title: "My Documents", _showTitle: "title", buttonMenu: true, buttonMenuDoc: newFolderButton, _height: 100,
treeViewHideTitle: true, _xMargin: 5, _yMargin: 5, _gridGap: 5, _forceActive: true, childDropAction: "alias",
treeViewTruncateTitleWidth: 150, ignoreClick: true,
isFolder: true, treeViewType: "fileSystem", childHideLinkButton: true,
- _lockedPosition: true, boxShadow: "0 0", childDontRegisterViews: true, targetDropAction: "proto", system: true
+ _lockedPosition: true, boxShadow: "0 0", childDontRegisterViews: true, targetDropAction: "proto", system: true,
+ explainer: "This is your file manager where you can create folders to keep track of documents independently of your dashboard."
}));
+ (doc.myFilesystem as any as Doc).contextMenuScripts = new List<ScriptField>([newFolder]);
+ (doc.myFilesystem as any as Doc).contextMenuLabels = new List<string>(["Create new folder"]);
+ (doc.myFilesystem as any as Doc).childContextMenuIcons = new List<string>(["plus"]);
}
return doc.myFilesystem as any as Doc;
}
static setupRecentlyClosedDocs(doc: Doc) {
- // setup Recently Closed library item
if (doc.myRecentlyClosedDocs === undefined) {
+ const clearAll = ScriptField.MakeScript(`getProto(self).data = new List([])`);
+ const clearDocsButton: Doc = Docs.Create.FontIconDocument({ onClick: clearAll, _forceActive: true, toolTip: "Empty recently closed", _stayInCollection: true, _hideContextMenu: true, title: "Empty", btnType: ButtonType.ClickButton, _width: 30, _height: 30, buttonText: "Empty", icon: "trash", system: true });
doc.myRecentlyClosedDocs = new PrefetchProxy(Docs.Create.TreeDocument([], {
- title: "Recently Closed", _showTitle: "title", treeViewShowClearButton: true, childHideLinkButton: true,
+ title: "My Recently Closed", _showTitle: "title", buttonMenu: true, buttonMenuDoc: clearDocsButton, childHideLinkButton: true,
treeViewHideTitle: true, _xMargin: 5, _yMargin: 5, _gridGap: 5, _forceActive: true, childDropAction: "alias",
treeViewTruncateTitleWidth: 150, ignoreClick: true,
- _lockedPosition: true, boxShadow: "0 0", childDontRegisterViews: true, targetDropAction: "same", system: true
+ _lockedPosition: true, boxShadow: "0 0", childDontRegisterViews: true, targetDropAction: "same", system: true,
+ explainer: "Recently closed documents appear in this menu. They will only be deleted if you explicity empty this list."
+
}));
- const clearAll = ScriptField.MakeScript(`getProto(self).data = new List([])`);
(doc.myRecentlyClosedDocs as any as Doc).contextMenuScripts = new List<ScriptField>([clearAll!]);
- (doc.myRecentlyClosedDocs as any as Doc).contextMenuLabels = new List<string>(["Clear All"]);
+ (doc.myRecentlyClosedDocs as any as Doc).contextMenuLabels = new List<string>(["Empty recently closed"]);
+ (doc.myRecentlyClosedDocs as any as Doc).contextMenuIcons = new List<string>(["trash"]);
+
}
}
@@ -841,7 +903,7 @@ export class CurrentUserUtils {
// setup Filter item
if (doc.currentFilter === undefined) {
doc.currentFilter = Docs.Create.FilterDocument({
- title: "unnamed filter", _height: 150,
+ title: "Unnamed Filter", _height: 150,
treeViewHideTitle: true, _xMargin: 5, _yMargin: 5, _gridGap: 5, _forceActive: true, childDropAction: "none",
treeViewTruncateTitleWidth: 150, ignoreClick: true,
_lockedPosition: true, boxShadow: "0 0", childDontRegisterViews: true, targetDropAction: "same", system: true, _autoHeight: true, _fitWidth: true
@@ -886,31 +948,229 @@ export class CurrentUserUtils {
CurrentUserUtils.setupUserDoc(doc);
}
- static blist = (opts: DocumentOptions, docs: Doc[]) => new PrefetchProxy(Docs.Create.LinearDocument(docs, {
- ...opts, _gridGap: 5, _xMargin: 5, _yMargin: 5, _height: 42, _width: 100, boxShadow: "0 0", _forceActive: true,
+ static linearButtonList = (opts: DocumentOptions, docs: Doc[]) => new PrefetchProxy(Docs.Create.LinearDocument(docs, {
+ ...opts, _gridGap: 0, _xMargin: 5, _yMargin: 5, boxShadow: "0 0", _forceActive: true,
dropConverter: ScriptField.MakeScript("convertToButtons(dragData)", { dragData: DragManager.DocumentDragData.name }),
- backgroundColor: "black", _lockedPosition: true, linearViewIsExpanded: true, system: true
+ _lockedPosition: true, system: true, flexDirection: "row"
})) as any as Doc
- static ficon = (opts: DocumentOptions) => new PrefetchProxy(Docs.Create.FontIconDocument({
- ...opts, _dropAction: "alias", _removeDropProperties: new List<string>(["_dropAction", "stayInCollection"]), _nativeWidth: 40, _nativeHeight: 40, _width: 40, _height: 40, system: true
+ static createToolButton = (opts: DocumentOptions) => new PrefetchProxy(Docs.Create.FontIconDocument({
+ ...opts, btnType: ButtonType.ToolButton, _forceActive: true, _dropAction: "alias", _removeDropProperties: new List<string>(["_dropAction", "stayInCollection"]), _nativeWidth: 40, _nativeHeight: 40, _width: 40, _height: 40, system: true
})) as any as Doc
/// sets up the default list of buttons to be shown in the expanding button menu at the bottom of the Dash window
static setupDockedButtons(doc: Doc) {
if (doc["dockedBtn-undo"] === undefined) {
- doc["dockedBtn-undo"] = CurrentUserUtils.ficon({ onClick: ScriptField.MakeScript("undo()"), dontUndo: true, _stayInCollection: true, _dropAction: "alias", _hideContextMenu: true, _removeDropProperties: new List<string>(["dropAction", "_hideContextMenu", "stayInCollection"]), toolTip: "click to undo", title: "undo", icon: "undo-alt", system: true });
+ doc["dockedBtn-undo"] = CurrentUserUtils.createToolButton({ onClick: ScriptField.MakeScript("undo()"), _width: 30, _height: 30, dontUndo: true, _stayInCollection: true, btnType: ButtonType.ToolButton, _dropAction: "alias", _hideContextMenu: true, _removeDropProperties: new List<string>(["dropAction", "_hideContextMenu", "stayInCollection"]), toolTip: "Click to undo", title: "undo", icon: "undo-alt", system: true });
}
if (doc["dockedBtn-redo"] === undefined) {
- doc["dockedBtn-redo"] = CurrentUserUtils.ficon({ onClick: ScriptField.MakeScript("redo()"), dontUndo: true, _stayInCollection: true, _dropAction: "alias", _hideContextMenu: true, _removeDropProperties: new List<string>(["dropAction", "_hideContextMenu", "stayInCollection"]), toolTip: "click to redo", title: "redo", icon: "redo-alt", system: true });
+ doc["dockedBtn-redo"] = CurrentUserUtils.createToolButton({ onClick: ScriptField.MakeScript("redo()"), _width: 30, _height: 30, dontUndo: true, _stayInCollection: true, btnType: ButtonType.ToolButton, _dropAction: "alias", _hideContextMenu: true, _removeDropProperties: new List<string>(["dropAction", "_hideContextMenu", "stayInCollection"]), toolTip: "Click to redo", title: "redo", icon: "redo-alt", system: true });
}
if (doc.dockedBtns === undefined) {
- doc.dockedBtns = CurrentUserUtils.blist({ title: "docked buttons", ignoreClick: true }, [doc["dockedBtn-undo"] as Doc, doc["dockedBtn-redo"] as Doc]);
+ doc.dockedBtns = CurrentUserUtils.linearButtonList({ title: "docked buttons", _height: 40, flexGap: 0, linearViewFloating: true, linearViewIsExpanded: true, linearViewExpandable: true, ignoreClick: true }, [doc["dockedBtn-undo"] as Doc, doc["dockedBtn-redo"] as Doc]);
}
(doc["dockedBtn-undo"] as Doc).dontUndo = true;
(doc["dockedBtn-redo"] as Doc).dontUndo = true;
}
+ static textTools(doc: Doc) {
+ const tools: Button[] =
+ [
+ {
+ title: "Font", toolTip: "Font", width: 100, btnType: ButtonType.DropdownList, ignoreClick: true,
+ list: ["Roboto", "Roboto Mono", "Nunito", "Times New Roman", "Arial", "Georgia",
+ "Comic Sans MS", "Tahoma", "Impact", "Crimson Text"],
+ script: 'setFont'
+ },
+ { title: "Font size", toolTip: "Font size", width: 75, btnType: ButtonType.NumberButton, numBtnMax: 200, numBtnMin: 0, numBtnType: NumButtonType.DropdownOptions, ignoreClick: true, script: 'setFontSize' },
+ { title: "Font color", toolTip: "Font color", btnType: ButtonType.ColorButton, icon: "font", ignoreClick: true, script: 'setFontColor' },
+ { title: "Bold", toolTip: "Bold (Ctrl+B)", btnType: ButtonType.ToggleButton, icon: "bold", click: 'toggleBold()', checkResult: 'toggleBold(true)' },
+ { title: "Italic", toolTip: "Italic (Ctrl+I)", btnType: ButtonType.ToggleButton, icon: "italic", click: 'toggleItalic()', checkResult: 'toggleItalic(true)' },
+ { title: "Underline", toolTip: "Underline (Ctrl+U)", btnType: ButtonType.ToggleButton, icon: "underline", click: 'toggleUnderline()', checkResult: 'toggleUnderline(true)' },
+ { title: "Bullet List", toolTip: "Bullet", btnType: ButtonType.ToggleButton, icon: "list", click: 'setBulletList("bullet")', checkResult: 'setBulletList("bullet", true)' },
+ { title: "Number List", toolTip: "Number", btnType: ButtonType.ToggleButton, icon: "list-ol", click: 'setBulletList("decimal")', checkResult: 'setBulletList("decimal", true)' },
+
+ // { title: "Strikethrough", tooltip: "Strikethrough", btnType: ButtonType.ToggleButton, icon: "strikethrough", click: 'toggleStrikethrough()'},
+ // { title: "Superscript", tooltip: "Superscript", btnType: ButtonType.ToggleButton, icon: "superscript", click: 'toggleSuperscript()'},
+ // { title: "Subscript", tooltip: "Subscript", btnType: ButtonType.ToggleButton, icon: "subscript", click: 'toggleSubscript()'},
+ { title: "Left align", toolTip: "Left align", btnType: ButtonType.ToggleButton, icon: "align-left", click: 'setAlignment("left")', checkResult: 'setAlignment("left", true)' },
+ { title: "Center align", toolTip: "Center align", btnType: ButtonType.ToggleButton, icon: "align-center", click: 'setAlignment("center")', checkResult: 'setAlignment("center", true)' },
+ { title: "Right align", toolTip: "Right align", btnType: ButtonType.ToggleButton, icon: "align-right", click: 'setAlignment("right")', checkResult: 'setAlignment("right", true)' },
+ ];
+ return tools;
+ }
+
+ static inkTools(doc: Doc) {
+ const tools: Button[] = [
+ { title: "Pen", toolTip: "Pen (Ctrl+P)", btnType: ButtonType.ToggleButton, icon: "pen", click: 'setActiveInkTool("pen")', checkResult: 'setActiveInkTool("pen" , true)' },
+ // { title: "Highlighter", toolTip: "Highlighter (Ctrl+H)", btnType: ButtonType.ToggleButton, icon: "highlighter", click: 'setActiveInkTool("highlighter")', checkResult: 'setActiveInkTool("highlighter", true)' },
+ { title: "Circle", toolTip: "Circle (Ctrl+Shift+C)", btnType: ButtonType.ToggleButton, icon: "circle", click: 'setActiveInkTool("circle")', checkResult: 'setActiveInkTool("circle" , true)' },
+ // { title: "Square", toolTip: "Square (Ctrl+Shift+S)", btnType: ButtonType.ToggleButton, icon: "square", click: 'setActiveInkTool("square")', checkResult: 'setActiveInkTool("square" , true)' },
+ { title: "Line", toolTip: "Line (Ctrl+Shift+L)", btnType: ButtonType.ToggleButton, icon: "minus", click: 'setActiveInkTool("line")', checkResult: 'setActiveInkTool("line" , true)' },
+ { title: "Fill color", toolTip: "Fill color", btnType: ButtonType.ColorButton, ignoreClick: true, icon: "fill-drip", script: "setFillColor" },
+ { title: "Stroke width", toolTip: "Stroke width", btnType: ButtonType.NumberButton, numBtnType: NumButtonType.Slider, numBtnMin: 1, ignoreClick: true, script: 'setStrokeWidth' },
+ { title: "Stroke color", toolTip: "Stroke color", btnType: ButtonType.ColorButton, icon: "pen", ignoreClick: true, script: 'setStrokeColor' },
+ ];
+ return tools;
+ }
+
+ static schemaTools(doc: Doc) {
+ const tools: Button[] =
+ [
+ {
+ title: "Show preview",
+ toolTip: "Show preview of selected document",
+ btnType: ButtonType.ToggleButton,
+ switchToggle: true,
+ width: 100,
+ buttonText: "Show Preview",
+ icon: "eye",
+ click: 'toggleSchemaPreview()',
+ checkResult: 'toggleSchemaPreview(true)'
+ },
+ ];
+ return tools;
+ }
+
+ static webTools(doc: Doc) {
+ const tools: Button[] =
+ [
+ { title: "Back", toolTip: "Go back", btnType: ButtonType.ClickButton, icon: "arrow-left", click: 'webBack()' },
+ { title: "Forward", toolTip: "Go forward", btnType: ButtonType.ClickButton, icon: "arrow-right", click: 'webForward()' },
+ //{ title: "Reload", toolTip: "Reload webpage", btnType: ButtonType.ClickButton, icon: "redo-alt", click: 'webReload()' },
+ { title: "URL", toolTip: "URL", width: 250, btnType: ButtonType.EditableText, icon: "lock", ignoreClick: true, script: 'webSetURL' },
+ ];
+
+ return tools;
+ }
+
+ static async contextMenuTools(doc: Doc) {
+ return [
+ {
+ title: "Perspective", toolTip: "View", width: 100, btnType: ButtonType.DropdownList, ignoreClick: true,
+ list: [CollectionViewType.Freeform, CollectionViewType.Schema, CollectionViewType.Tree,
+ CollectionViewType.Stacking, CollectionViewType.Masonry, CollectionViewType.Multicolumn,
+ CollectionViewType.Multirow, CollectionViewType.Time, CollectionViewType.Carousel,
+ CollectionViewType.Carousel3D, CollectionViewType.Linear, CollectionViewType.Map,
+ CollectionViewType.Grid],
+ script: 'setView',
+ }, // Always show
+ {
+ title: "Background Color", toolTip: "Background Color", btnType: ButtonType.ColorButton, ignoreClick: true, icon: "fill-drip",
+ script: "setBackgroundColor", hidden: 'selectedDocumentType()'
+ }, // Only when a document is selected
+ {
+ title: "Header Color", toolTip: "Header Color", btnType: ButtonType.ColorButton, ignoreClick: true, icon: "heading",
+ script: "setHeaderColor", hidden: 'selectedDocumentType()',
+ }, // Only when a document is selected
+ { title: "Overlay", toolTip: "Overlay", btnType: ButtonType.ToggleButton, icon: "layer-group", click: 'toggleOverlay()', checkResult: 'toggleOverlay(true)', hidden: 'selectedDocumentType(undefined, "freeform", true)' }, // Only when floating document is selected in freeform
+ // { title: "Alias", btnType: ButtonType.ClickButton, icon: "copy", hidden: 'selectedDocumentType()' }, // Only when a document is selected
+ { title: "Text", type: "textTools", subMenu: true, expanded: 'selectedDocumentType("rtf")' }, // Always available
+ { title: "Ink", type: "inkTools", subMenu: true, expanded: 'selectedDocumentType("ink")' }, // Always available
+ { title: "Web", type: "webTools", subMenu: true, hidden: 'selectedDocumentType("web")' }, // Only when Web is selected
+ { title: "Schema", type: "schemaTools", subMenu: true, hidden: 'selectedDocumentType(undefined, "schema")' } // Only when Schema is selected
+ ];
+ }
+
+ // Sets up the default context menu buttons
+ static async setupContextMenuButtons(doc: Doc) {
+ if (doc.contextMenuBtns === undefined) {
+ const docList: Doc[] = [];
+
+ (await CurrentUserUtils.contextMenuTools(doc)).map(({ title, width, list, toolTip, ignoreClick, icon, type, btnType, click, script, subMenu, hidden, expanded, checkResult }) => {
+ const menuDocList: Doc[] = [];
+ if (subMenu) {
+ // default is textTools
+ let tools: Button[];
+ switch (type) {
+ case "inkTools":
+ tools = CurrentUserUtils.inkTools(doc);
+ break;
+ case "schemaTools":
+ tools = CurrentUserUtils.schemaTools(doc);
+ break;
+ case "webTools":
+ tools = CurrentUserUtils.webTools(doc);
+ break;
+ case "textTools":
+ tools = CurrentUserUtils.textTools(doc);
+ break;
+ default:
+ tools = CurrentUserUtils.textTools(doc);
+ break;
+ }
+ tools.map(({ title, toolTip, icon, btnType, numBtnType, numBtnMax, numBtnMin, click, script, width, list, ignoreClick, switchToggle, checkResult }) => {
+ menuDocList.push(Docs.Create.FontIconDocument({
+ _nativeWidth: width ? width : 25,
+ _nativeHeight: 25,
+ _width: width ? width : 25,
+ _height: 25,
+ icon,
+ toolTip,
+ numBtnType,
+ numBtnMin,
+ numBtnMax,
+ script,
+ btnType: btnType,
+ btnList: new List<string>(list),
+ ignoreClick: ignoreClick,
+ _stayInCollection: true,
+ _hideContextMenu: true,
+ _lockedPosition: true,
+ system: true,
+ dontUndo: true,
+ title,
+ switchToggle,
+ color: Colors.WHITE,
+ backgroundColor: checkResult ? ComputedField.MakeFunction(checkResult) as any : "transparent",
+ _dropAction: "alias",
+ _removeDropProperties: new List<string>(["dropAction", "_stayInCollection"]),
+ onClick: click ? ScriptField.MakeScript(click, { doc: Doc.name }) : undefined
+ }));
+ });
+ docList.push(CurrentUserUtils.linearButtonList({
+ linearViewSubMenu: true,
+ flexGap: 0,
+ ignoreClick: true,
+ linearViewExpandable: true,
+ icon: title,
+ _height: 30,
+ backgroundColor: checkResult ? ComputedField.MakeFunction(checkResult) as any : "transparent",
+ linearViewIsExpanded: expanded ? !(ComputedField.MakeFunction(expanded) as any) : undefined,
+ hidden: hidden ? ComputedField.MakeFunction(hidden) as any : undefined,
+ }, menuDocList));
+ } else {
+ docList.push(Docs.Create.FontIconDocument({
+ _nativeWidth: width ? width : 25,
+ _nativeHeight: 25,
+ _width: width ? width : 25,
+ _height: 25,
+ icon,
+ toolTip,
+ script,
+ btnType,
+ btnList: new List<string>(list),
+ ignoreClick,
+ _stayInCollection: true,
+ _hideContextMenu: true,
+ _lockedPosition: true,
+ system: true,
+ dontUndo: true,
+ title,
+ color: Colors.WHITE,
+ backgroundColor: "transparent",
+ _dropAction: "alias",
+ hidden: hidden ? ComputedField.MakeFunction(hidden) as any : undefined,
+ _removeDropProperties: new List<string>(["dropAction", "_stayInCollection"]),
+ onClick: click ? ScriptField.MakeScript(click, { scriptContext: "any" }) : undefined
+ }));
+ }
+ });
+
+ doc.contextMenuBtns = CurrentUserUtils.linearButtonList({ title: "menu buttons", flexGap: 0, linearViewIsExpanded: true, ignoreClick: true, linearViewExpandable: false, _height: 35 }, docList);
+ }
+ }
+
// sets up the default set of documents to be shown in the Overlay layer
static setupOverlays(doc: Doc) {
if (doc.myOverlayDocs === undefined) {
@@ -940,13 +1200,15 @@ export class CurrentUserUtils {
}
doc.myLinkDatabase = new PrefetchProxy(linkDocs);
}
+ // TODO:glr NOTE: treeViewHideTitle & _showTitle may be confusing, treeViewHideTitle is for the editable title (just for tree view), _showTitle is to show the Document title for any document
if (doc.mySharedDocs === undefined) {
let sharedDocs = Docs.newAccount ? undefined : await DocServer.GetRefField(sharingDocumentId + "outer");
if (!sharedDocs) {
sharedDocs = Docs.Create.TreeDocument([], {
title: "My SharedDocs", childDropAction: "alias", system: true, contentPointerEvents: "all", childLimitHeight: 0, _yMargin: 50, _gridGap: 15,
- _showTitle: "title", ignoreClick: true, _lockedPosition: true, "acl-Public": SharingPermissions.Augment, "_acl-Public": SharingPermissions.Augment,
+ _showTitle: "title", treeViewHideTitle: true, ignoreClick: true, _lockedPosition: true, "acl-Public": SharingPermissions.Augment, "_acl-Public": SharingPermissions.Augment,
_chromeHidden: true, boxShadow: "0 0",
+ explainer: "This is where documents or dashboards that other users have shared with you will appear. To share a document or dashboard right click and select 'Share'"
}, sharingDocumentId + "outer", sharingDocumentId);
(sharedDocs as Doc)["acl-Public"] = (sharedDocs as Doc)[DataSym]["acl-Public"] = SharingPermissions.Augment;
}
@@ -957,6 +1219,8 @@ export class CurrentUserUtils {
sharedDocs.childContextMenuFilters = new List<ScriptField>([dashboardFilter!,]);
sharedDocs.childContextMenuScripts = new List<ScriptField>([addToDashboards!,]);
sharedDocs.childContextMenuLabels = new List<string>(["Add to Dashboards",]);
+ sharedDocs.childContextMenuIcons = new List<string>(["user-plus",]);
+
}
doc.mySharedDocs = new PrefetchProxy(sharedDocs);
}
@@ -965,16 +1229,13 @@ export class CurrentUserUtils {
// Import sidebar is where shared documents are contained
static setupImportSidebar(doc: Doc) {
if (doc.myImportDocs === undefined) {
+ const newImportButton: Doc = Docs.Create.FontIconDocument({ onClick: ScriptField.MakeScript("importDocument()"), _forceActive: true, toolTip: "Import from computer", _width: 30, _height: 30, _stayInCollection: true, _hideContextMenu: true, title: "Import", btnType: ButtonType.ClickButton, buttonText: "Import", icon: "upload", system: true });
doc.myImportDocs = new PrefetchProxy(Docs.Create.StackingDocument([], {
- title: "My ImportDocuments", _forceActive: true, ignoreClick: true, _stayInCollection: true, _hideContextMenu: true, childLimitHeight: 0,
- childDropAction: "alias", _autoHeight: true, _yMargin: 50, _gridGap: 15, _lockedPosition: true, system: true, _chromeHidden: true,
+ title: "My Imports", _forceActive: true, buttonMenu: true, buttonMenuDoc: newImportButton, ignoreClick: true, _showTitle: "title", _stayInCollection: true, _hideContextMenu: true, childLimitHeight: 0,
+ childDropAction: "copy", _autoHeight: true, _yMargin: 50, _gridGap: 15, boxShadow: "0 0", _lockedPosition: true, system: true, _chromeHidden: true,
+ explainer: "This is where documents that are Imported into Dash will go."
}));
}
- if (doc.myImportPanel === undefined) {
- const uploads = Cast(doc.myImportDocs, Doc, null);
- const newUpload = CurrentUserUtils.ficon({ onClick: ScriptField.MakeScript("importDocument()"), toolTip: "Import External document", _stayInCollection: true, _hideContextMenu: true, title: "Import", icon: "upload", system: true });
- doc.myImportPanel = new PrefetchProxy(Docs.Create.StackingDocument([newUpload, uploads], { title: "My ImportPanel", _yMargin: 20, _showTitle: "title", ignoreClick: true, _chromeHidden: true, _stayInCollection: true, _hideContextMenu: true, _lockedPosition: true, system: true, boxShadow: "0 0" }));
- }
}
// Search sidebar is where searches within the document are performed
@@ -982,7 +1243,7 @@ export class CurrentUserUtils {
if (doc.mySearchPanel === undefined) {
doc.mySearchPanel = new PrefetchProxy(Docs.Create.SearchDocument({
backgroundColor: "dimGray", ignoreClick: true, _searchDoc: true,
- childDropAction: "alias", _lockedPosition: true, _viewType: CollectionViewType.Schema, title: "Search Sidebar", system: true
+ childDropAction: "alias", _lockedPosition: true, _viewType: CollectionViewType.Schema, title: "Search Panel", system: true
})) as any as Doc;
}
}
@@ -1052,8 +1313,9 @@ export class CurrentUserUtils {
doc._raiseWhenDragged = true;
doc._showLabel = false;
doc._showMenuLabel = true;
+ doc.textAlign = StrCast(doc.textAlign, "left");
doc.activeInkColor = StrCast(doc.activeInkColor, "rgb(0, 0, 0)");
- doc.activeInkWidth = StrCast(doc.activeInkWidth, "1");
+ doc.activeInkWidth = Number(StrCast(doc.activeInkWidth, "1"));
doc.activeInkBezier = StrCast(doc.activeInkBezier, "0");
doc.activeFillColor = StrCast(doc.activeFillColor, "");
doc.activeArrowStart = StrCast(doc.activeArrowStart, "");
@@ -1074,10 +1336,11 @@ export class CurrentUserUtils {
doc.filterDocCount = 0;
this.setupDefaultIconTemplates(doc); // creates a set of icon templates triggered by the document deoration icon
this.setupDocTemplates(doc); // sets up the template menu of templates
- this.setupImportSidebar(doc);
+ this.setupImportSidebar(doc); // sets up the import sidebar
this.setupSearchSidebar(doc); // sets up the search sidebar
this.setupActiveMobileMenu(doc); // sets up the current mobile menu for Dash Mobile
this.setupOverlays(doc); // documents in overlay layer
+ this.setupContextMenuButtons(doc); // set up context menu buttons
this.setupDockedButtons(doc); // the bottom bar of font icons
await this.setupSidebarButtons(doc); // the pop-out left sidebar of tools/panels
await this.setupMenuPanel(doc, sharingDocumentId, linkDatabaseId);
@@ -1224,7 +1487,6 @@ export class CurrentUserUtils {
}
public static createNewDashboard = async (userDoc: Doc, id?: string) => {
- const myPresentations = await userDoc.myPresentations as Doc;
const presentation = Doc.MakeCopy(userDoc.emptyPresentation as Doc, true);
const dashboards = await Cast(userDoc.myDashboards, Doc) as Doc;
const dashboardCount = DocListCast(dashboards.data).length + 1;
@@ -1236,6 +1498,7 @@ export class CurrentUserUtils {
_width: 1500,
_height: 1000,
_fitWidth: true,
+ _backgroundGridShow: true,
title: `Untitled Tab ${NumCast(emptyPane["dragFactory-count"])}`,
};
const freeformDoc = CurrentUserUtils.GuestTarget || Docs.Create.FreeformDocument([], freeformOptions);
@@ -1260,16 +1523,15 @@ export class CurrentUserUtils {
DocListCast(dashboardDoc.data).forEach(doc => doc.dashboard = dashboardDoc);
DocListCast(dashboardDoc.data)[1].data = ComputedField.MakeFunction(`dynamicOffScreenDocs(self.dashboard)`) as any;
- Doc.AddDocToList(myPresentations, "data", presentation);
userDoc.activePresentation = presentation;
Doc.AddDocToList(dashboards, "data", dashboardDoc);
CurrentUserUtils.openDashboard(userDoc, dashboardDoc);
}
- public static GetNewTextDoc(title: string, x: number, y: number, width?: number, height?: number, noMargins?: boolean, annotationOn?: Doc, maxHeight?: number) {
+ public static GetNewTextDoc(title: string, x: number, y: number, width?: number, height?: number, noMargins?: boolean, annotationOn?: Doc, maxHeight?: number, backgroundColor?: string) {
const tbox = Docs.Create.TextDocument("", {
- _xMargin: noMargins ? 0 : undefined, _yMargin: noMargins ? 0 : undefined, annotationOn, docMaxAutoHeight: maxHeight,
+ _xMargin: noMargins ? 0 : undefined, _yMargin: noMargins ? 0 : undefined, annotationOn, docMaxAutoHeight: maxHeight, backgroundColor: backgroundColor,
_width: width || 200, _height: height || 100, x: x, y: y, _fitWidth: true, _autoHeight: true, _fontSize: StrCast(Doc.UserDoc().fontSize),
_fontFamily: StrCast(Doc.UserDoc().fontFamily), title
});
@@ -1301,6 +1563,8 @@ Scripting.addGlobal(function openDragFactory(dragFactory: Doc) {
view && SelectionManager.SelectView(view, false);
}
});
+Scripting.addGlobal(function MySharedDocs() { return Doc.SharingDoc(); },
+ "document containing all shared Docs");
Scripting.addGlobal(function IsNoviceMode() { return Doc.UserDoc().noviceMode; },
"is Dash in novice mode");
Scripting.addGlobal(function snapshotDashboard() { CurrentUserUtils.snapshotDashboard(Doc.UserDoc()); },
@@ -1309,6 +1573,8 @@ Scripting.addGlobal(function createNewDashboard() { return CurrentUserUtils.crea
"creates a new dashboard when called");
Scripting.addGlobal(function createNewPresentation() { return MainView.Instance.createNewPresentation(); },
"creates a new presentation when called");
+Scripting.addGlobal(function createNewFolder() { return MainView.Instance.createNewFolder(); },
+ "creates a new folder in myFiles when called");
Scripting.addGlobal(function links(doc: any) { return new List(LinkManager.Instance.getAllRelatedLinks(doc)); },
"returns all the links to the document or its annotations", "(doc: any)");
Scripting.addGlobal(function importDocument() { return CurrentUserUtils.importDocument(); },
@@ -1361,3 +1627,19 @@ Scripting.addGlobal(function dynamicOffScreenDocs(dashboard: Doc) {
}
return [];
});
+Scripting.addGlobal(function selectedDocumentType(docType?: DocumentType, colType?: CollectionViewType, checkParent?: boolean) {
+ let selected = SelectionManager.Docs().length ? SelectionManager.Docs()[0] : undefined;
+ if (selected && checkParent) {
+ const parentDoc: Doc = Cast(selected.context, Doc, null);
+ selected = parentDoc;
+ }
+ if (selected && docType && selected.type === docType) return false;
+ else if (selected && colType && selected.viewType === colType) return false;
+ else if (selected && !colType && !docType) return false;
+ else return true;
+});
+Scripting.addGlobal(function makeTopLevelFolder() {
+ const folder = Docs.Create.TreeDocument([], { title: "Untitled folder", _stayInCollection: true, isFolder: true });
+ TreeView._editTitleOnLoad = { id: folder[Id], parent: undefined };
+ return Doc.AddDocToList(Doc.UserDoc().myFilesystem as Doc, "data", folder);
+}); \ No newline at end of file
diff --git a/src/client/util/DocumentManager.ts b/src/client/util/DocumentManager.ts
index cb0ee411c..dfec9823b 100644
--- a/src/client/util/DocumentManager.ts
+++ b/src/client/util/DocumentManager.ts
@@ -1,19 +1,21 @@
import { action, observable, runInAction } from 'mobx';
import { Doc, DocListCast, DocListCastAsync, Opt } from '../../fields/Doc';
import { Id } from '../../fields/FieldSymbols';
-import { Cast, NumCast, StrCast } from '../../fields/Types';
+import { Cast } from '../../fields/Types';
import { returnFalse } from '../../Utils';
import { DocumentType } from '../documents/DocumentTypes';
import { CollectionDockingView } from '../views/collections/CollectionDockingView';
import { CollectionView } from '../views/collections/CollectionView';
import { LightboxView } from '../views/LightboxView';
import { DocumentView, ViewAdjustment } from '../views/nodes/DocumentView';
+import { LinkAnchorBox } from '../views/nodes/LinkAnchorBox';
import { Scripting } from './Scripting';
export class DocumentManager {
//global holds all of the nodes (regardless of which collection they're in)
@observable public DocumentViews: DocumentView[] = [];
+ @observable public LinkAnchorBoxViews: DocumentView[] = [];
@observable public RecordingEvent = 0;
@observable public LinkedDocumentViews: { a: DocumentView, b: DocumentView, l: Doc }[] = [];
@@ -25,24 +27,41 @@ export class DocumentManager {
@action
public AddView = (view: DocumentView) => {
- DocListCast(view.rootDoc.links).forEach(link => {
- const whichOtherAnchor = view.props.LayoutTemplateString?.includes("anchor2") ? "anchor1" : "anchor2";
- const otherDoc = link && (link[whichOtherAnchor] as Doc);
- const otherDocAnno = DocumentType.MARKER === otherDoc?.type ? otherDoc.annotationOn as Doc : undefined;
- otherDoc && DocumentManager.Instance.DocumentViews?.filter(dv => Doc.AreProtosEqual(dv.rootDoc, otherDoc) || Doc.AreProtosEqual(dv.rootDoc, otherDocAnno)).
- forEach(otherView => {
- if (otherView.rootDoc.type !== DocumentType.LINK || otherView.props.LayoutTemplateString !== view.props.LayoutTemplateString) {
- this.LinkedDocumentViews.push({ a: whichOtherAnchor === "anchor1" ? otherView : view, b: whichOtherAnchor === "anchor1" ? view : otherView, l: link });
- }
- });
- });
- this.DocumentViews.push(view);
+ //console.log("MOUNT " + view.props.Document.title + "/" + view.props.LayoutTemplateString);
+ if (view.props.LayoutTemplateString?.includes(LinkAnchorBox.name)) {
+ const viewAnchorIndex = view.props.LayoutTemplateString.includes("anchor2") ? "anchor2" : "anchor1";
+ DocListCast(view.rootDoc.links).forEach(link => {
+ this.LinkAnchorBoxViews?.filter(dv => Doc.AreProtosEqual(dv.rootDoc, link) && !dv.props.LayoutTemplateString?.includes(viewAnchorIndex)).
+ forEach(otherView => this.LinkedDocumentViews.push(
+ {
+ a: viewAnchorIndex === "anchor2" ? otherView : view,
+ b: viewAnchorIndex === "anchor2" ? view : otherView,
+ l: link
+ })
+ );
+ });
+ this.LinkAnchorBoxViews.push(view);
+ // this.LinkedDocumentViews.forEach(view => console.log(" LV = " + view.a.props.Document.title + "/" + view.a.props.LayoutTemplateString + " --> " +
+ // view.b.props.Document.title + "/" + view.b.props.LayoutTemplateString));
+ } else {
+ this.DocumentViews.push(view);
+ }
}
public RemoveView = action((view: DocumentView) => {
- const index = this.DocumentViews.indexOf(view);
- index !== -1 && this.DocumentViews.splice(index, 1);
+ this.LinkedDocumentViews.slice().forEach(action(pair => {
+ if (pair.a === view || pair.b === view) {
+ const li = this.LinkedDocumentViews.indexOf(pair);
+ li !== -1 && this.LinkedDocumentViews.splice(li, 1);
+ }
+ }));
- this.LinkedDocumentViews.slice().forEach(action((pair, i) => pair.a === view || pair.b === view ? this.LinkedDocumentViews.splice(i, 1) : null));
+ if (view.props.LayoutTemplateString?.includes(LinkAnchorBox.name)) {
+ const index = this.LinkAnchorBoxViews.indexOf(view);
+ this.LinkAnchorBoxViews.splice(index, 1);
+ } else {
+ const index = this.DocumentViews.indexOf(view);
+ index !== -1 && this.DocumentViews.splice(index, 1);
+ }
});
//gets all views
@@ -139,7 +158,8 @@ export class DocumentManager {
closeContextIfNotFound: boolean = false, // after opening a context where the document should be, this determines whether the context should be closed if the Doc isn't actually there
originatingDoc: Opt<Doc> = undefined, // doc that initiated the display of the target odoc
finished?: () => void,
- originalTarget?: Doc
+ originalTarget?: Doc,
+ noSelect?: boolean
): Promise<void> => {
originalTarget = originalTarget ?? targetDoc;
const getFirstDocView = LightboxView.LightboxDoc ? DocumentManager.Instance.getLightboxDocumentView : DocumentManager.Instance.getFirstDocumentView;
@@ -153,7 +173,7 @@ export class DocumentManager {
}
} else {
targetDoc.hidden && (targetDoc.hidden = undefined);
- docView?.select(false);
+ !noSelect && docView?.select(false);
}
finished?.();
return false;
@@ -170,7 +190,7 @@ export class DocumentManager {
annoContainerView.focus(targetDoc); // this allows something like a PDF view to remove its doc filters to expose the target so that it can be found in the retry code below
}
if (focusView) {
- Doc.linkFollowHighlight(focusView.rootDoc);
+ !noSelect && Doc.linkFollowHighlight(focusView.rootDoc); //TODO:glr make this a setting in PresBox
focusView.focus(targetDoc, {
originalTarget, willZoom, afterFocus: (didFocus: boolean) =>
new Promise<ViewAdjustment>(res => {
@@ -203,7 +223,7 @@ export class DocumentManager {
retryDocView.props.focus(targetDoc, {
willZoom, afterFocus: (didFocus: boolean) =>
new Promise<ViewAdjustment>(res => {
- focusAndFinish(didFocus);
+ !noSelect && focusAndFinish(didFocus);
res();
})
}); // focus on the target in the context
diff --git a/src/client/util/DragManager.ts b/src/client/util/DragManager.ts
index 5e16de617..421e4c6bb 100644
--- a/src/client/util/DragManager.ts
+++ b/src/client/util/DragManager.ts
@@ -145,7 +145,7 @@ export namespace DragManager {
removeDropProperties?: string[];
moveDocument?: MoveFunction;
removeDocument?: RemoveFunction;
- isSelectionMove?: boolean; // indicates that an explicitly selected Document is being dragged. this will suppress onDragStart scripts
+ isDocDecorationMove?: boolean; // Flags that Document decorations are used to drag document which allows suppression of onDragStart scripts
}
export class LinkDragData {
constructor(dragView: DocumentView, linkSourceGetAnchor: () => Doc,) {
@@ -225,7 +225,7 @@ export namespace DragManager {
if (docDragData && !docDragData.droppedDocuments.length) {
docDragData.dropAction = dragData.userDropAction || dragData.dropAction;
docDragData.droppedDocuments =
- await Promise.all(dragData.draggedDocuments.map(async d => !dragData.isSelectionMove && !dragData.userDropAction && ScriptCast(d.onDragStart) ? addAudioTag(ScriptCast(d.onDragStart).script.run({ this: d }).result) :
+ await Promise.all(dragData.draggedDocuments.map(async d => !dragData.isDocDecorationMove && !dragData.userDropAction && ScriptCast(d.onDragStart) ? addAudioTag(ScriptCast(d.onDragStart).script.run({ this: d }).result) :
docDragData.dropAction === "alias" ? Doc.MakeAlias(d) :
docDragData.dropAction === "proto" ? Doc.GetProto(d) :
docDragData.dropAction === "copy" ? (await Doc.MakeClone(d)).clone : d));
@@ -425,10 +425,10 @@ export namespace DragManager {
AbortDrag = () => {
options?.dragComplete?.(new DragCompleteEvent(true, dragData));
- endDrag();
+ cleanupDrag();
};
- const endDrag = action(() => {
+ const cleanupDrag = action(() => {
hideDragShowOriginalElements(false);
document.removeEventListener("pointermove", moveHandler, true);
document.removeEventListener("pointerup", upHandler);
@@ -518,15 +518,14 @@ export namespace DragManager {
`translate(${(xs[i] += moveVec.x) + (options?.offsetX || 0)}px, ${(ys[i] += moveVec.y) + (options?.offsetY || 0)}px) scale(${scaleXs[i]}, ${scaleYs[i]})`)
);
};
- const upHandler = async (e: PointerEvent) => {
- dispatchDrag(document.elementFromPoint(e.x, e.y) || document.body, e, new DragCompleteEvent(false, dragData), snapDrag(e, xFromLeft, yFromTop, xFromRight, yFromBottom), finishDrag, options);
- endDrag();
+ const upHandler = (e: PointerEvent) => {
+ dispatchDrag(document.elementFromPoint(e.x, e.y) || document.body, e, new DragCompleteEvent(false, dragData), snapDrag(e, xFromLeft, yFromTop, xFromRight, yFromBottom), finishDrag, options, cleanupDrag);
};
document.addEventListener("pointermove", moveHandler, true);
document.addEventListener("pointerup", upHandler);
}
- async function dispatchDrag(target: Element, e: PointerEvent, complete: DragCompleteEvent, pos: { x: number, y: number }, finishDrag?: (e: DragCompleteEvent) => void, options?: DragOptions) {
+ async function dispatchDrag(target: Element, e: PointerEvent, complete: DragCompleteEvent, pos: { x: number, y: number }, finishDrag?: (e: DragCompleteEvent) => void, options?: DragOptions, endDrag?: () => void) {
const dropArgs = {
bubbles: true,
detail: {
@@ -543,5 +542,6 @@ export namespace DragManager {
await finishDrag?.(complete);
target.dispatchEvent(new CustomEvent<DropEvent>("dashOnDrop", dropArgs));
options?.dragComplete?.(complete);
+ endDrag?.();
}
} \ No newline at end of file
diff --git a/src/client/util/HypothesisUtils.ts b/src/client/util/HypothesisUtils.ts
index 635673025..e910a9118 100644
--- a/src/client/util/HypothesisUtils.ts
+++ b/src/client/util/HypothesisUtils.ts
@@ -29,7 +29,7 @@ export namespace Hypothesis {
* Search for a WebDocument whose url field matches the given uri, return undefined if not found
*/
export const findWebDoc = async (uri: string) => {
- const currentDoc = SelectionManager.Views().length && SelectionManager.Views()[0].props.Document;
+ const currentDoc = SelectionManager.Docs().lastElement();
if (currentDoc && Cast(currentDoc.data, WebField)?.url.href === uri) return currentDoc; // always check first whether the currently selected doc is the annotation's source, only use Search otherwise
const results: Doc[] = [];
diff --git a/src/client/util/InteractionUtils.tsx b/src/client/util/InteractionUtils.tsx
index e009fb3a9..4a8011e3c 100644
--- a/src/client/util/InteractionUtils.tsx
+++ b/src/client/util/InteractionUtils.tsx
@@ -3,6 +3,8 @@ import * as beziercurve from 'bezier-curve';
import * as fitCurve from 'fit-curve';
import "./InteractionUtils.scss";
import { Utils } from "../../Utils";
+import { CurrentUserUtils } from "./CurrentUserUtils";
+import { InkTool } from "../../fields/InkField";
export namespace InteractionUtils {
export const MOUSETYPE = "mouse";
@@ -139,7 +141,7 @@ export namespace InteractionUtils {
export function CreatePolyline(points: { X: number, Y: number }[], left: number, top: number,
color: string, width: number, strokeWidth: number, bezier: string, fill: string, arrowStart: string, arrowEnd: string,
- dash: string | undefined, scalex: number, scaley: number, shape: string, pevents: string, drawHalo: boolean, nodefs: boolean) {
+ dash: string | undefined, scalex: number, scaley: number, shape: string, pevents: string, opacity: number, nodefs: boolean) {
let pts: { X: number; Y: number; }[] = [];
if (shape) { //if any of the shape are true
pts = makePolygon(shape, points);
@@ -209,14 +211,14 @@ export namespace InteractionUtils {
points={strpts}
style={{
// filter: drawHalo ? "url(#inkSelectionHalo)" : undefined,
- fill: fill ? fill : "none",
+ fill: fill && fill !== "transparent" ? fill : "none",
opacity: 1.0,
// opacity: strokeWidth !== width ? 0.5 : undefined,
pointerEvents: pevents as any,
stroke: color ?? "rgb(0, 0, 0)",
strokeWidth: strokeWidth,
- strokeLinejoin: "round",
- strokeLinecap: "round",
+ strokeLinejoin: color === "rgba(245, 230, 95, 0.75)" ? "miter" : "round",
+ strokeLinecap: color === "rgba(245, 230, 95, 0.75)" ? "square" : "round",
strokeDasharray: dashArray
}}
markerStart={`url(#${arrowStart + "Start" + defGuid})`}
diff --git a/src/client/util/LinkManager.ts b/src/client/util/LinkManager.ts
index 3579083e4..64da68f59 100644
--- a/src/client/util/LinkManager.ts
+++ b/src/client/util/LinkManager.ts
@@ -1,13 +1,12 @@
-import { observable, observe, action, reaction, computed } from "mobx";
+import { action, observable, observe } from "mobx";
import { computedFn } from "mobx-utils";
import { DirectLinksSym, Doc, DocListCast, Field, Opt } from "../../fields/Doc";
import { List } from "../../fields/List";
import { ProxyField } from "../../fields/Proxy";
-import { BoolCast, Cast, PromiseValue, StrCast } from "../../fields/Types";
+import { BoolCast, Cast, StrCast } from "../../fields/Types";
import { LightboxView } from "../views/LightboxView";
import { DocumentViewSharedProps, ViewAdjustment } from "../views/nodes/DocumentView";
import { DocumentManager } from "./DocumentManager";
-import { SharingManager } from "./SharingManager";
import { UndoManager } from "./UndoManager";
type CreateViewFunc = (doc: Doc, followLinkLocation: string, finished?: () => void) => void;
@@ -33,6 +32,7 @@ export class LinkManager {
static links: Doc[] = [];
constructor() {
LinkManager._instance = this;
+ this.createLinkrelationshipLists();
setTimeout(() => {
LinkManager.userLinkDBs = [];
const addLinkToDoc = (link: Doc) => {
@@ -97,6 +97,17 @@ export class LinkManager {
});
}
+
+ public createLinkrelationshipLists = () => {
+ //create new lists for link relations and their associated colors if the lists don't already exist
+ if (!Doc.UserDoc().linkRelationshipList && !Doc.UserDoc().linkColorList) {
+ const linkRelationshipList = new List<string>();
+ const linkColorList = new List<string>();
+ Doc.UserDoc().linkRelationshipList = linkRelationshipList;
+ Doc.UserDoc().linkColorList = linkColorList;
+ }
+ }
+
public addLink(linkDoc: Doc, checkExists = false) {
if (!checkExists || !DocListCast(Doc.LinkDBDoc().data).includes(linkDoc)) {
Doc.AddDocToList(Doc.LinkDBDoc(), "data", linkDoc);
@@ -107,14 +118,29 @@ export class LinkManager {
public getAllRelatedLinks(anchor: Doc) { return this.relatedLinker(anchor); } // finds all links that contain the given anchor
public getAllDirectLinks(anchor: Doc): Doc[] {
- return Array.from(Doc.GetProto(anchor)[DirectLinksSym]);
+ // FIXME:glr Why is Doc undefined?
+ if (Doc.GetProto(anchor)[DirectLinksSym]) {
+ return Array.from(Doc.GetProto(anchor)[DirectLinksSym]);
+ } else {
+ return [];
+ }
} // finds all links that contain the given anchor
relatedLinker = computedFn(function relatedLinker(this: any, anchor: Doc): Doc[] {
const lfield = Doc.LayoutFieldKey(anchor);
- const related = DocListCast(anchor[lfield + "-annotations"]).concat(DocListCast(anchor[lfield + "-annotations-timeline"])).reduce((list, anno) =>
+ if (!anchor || anchor instanceof Promise || Doc.GetProto(anchor) instanceof Promise) {
+ console.log("WAITING FOR DOC/PROTO IN LINKMANAGER");
+ return [];
+ }
+ const dirLinks = Doc.GetProto(anchor)[DirectLinksSym];
+ const annos = DocListCast(anchor[lfield + "-annotations"]);
+ const timelineAnnos = DocListCast(anchor[lfield + "-annotations-timeline"]);
+ if (!annos || !timelineAnnos) {
+ debugger;
+ }
+ const related = [...annos, ...timelineAnnos].reduce((list, anno) =>
[...list, ...LinkManager.Instance.relatedLinker(anno)],
- Array.from(Doc.GetProto(anchor)[DirectLinksSym]).slice());
+ Array.from(dirLinks).slice());
return related;
}, true);
diff --git a/src/client/util/Scripting.ts b/src/client/util/Scripting.ts
index f981f84cd..40b94024e 100644
--- a/src/client/util/Scripting.ts
+++ b/src/client/util/Scripting.ts
@@ -12,7 +12,7 @@ export { ts };
import * as typescriptlib from '!!raw-loader!./type_decls.d';
import { Doc, Field } from '../../fields/Doc';
-export interface ScriptSucccess {
+export interface ScriptSuccess {
success: true;
result: any;
}
@@ -23,7 +23,7 @@ export interface ScriptError {
result: any;
}
-export type ScriptResult = ScriptSucccess | ScriptError;
+export type ScriptResult = ScriptSuccess | ScriptError;
export type ScriptParam = { [name: string]: string };
@@ -171,10 +171,12 @@ function Run(script: string | undefined, customParams: string[], diagnostics: an
if (!options.editable) {
batch = Doc.MakeReadOnly();
}
+
const result = compiledFunction.apply(thisParam, params).apply(thisParam, argsArray);
if (batch) {
batch.end();
}
+
return { success: true, result };
} catch (error) {
@@ -314,9 +316,9 @@ export function CompileScript(script: string, options: ScriptOptions = {}): Comp
paramList.push(`${key}: ${typeof val === "object" ? Object.getPrototypeOf(val).constructor.name : typeof val}`);
}
const paramString = paramList.join(", ");
- const funcScript = `(function(${paramString})${requiredType ? `: ${requiredType}` : ''} {
- ${addReturn ? `return ${script};` : script}
- })`;
+ const body = addReturn ? `return ${script};` : `return ${script};`;
+ const reqTypes = requiredType ? `: ${requiredType}` : '';
+ const funcScript = `(function(${paramString})${reqTypes} { ${body} })`;
host.writeFile("file.ts", funcScript);
if (typecheck) host.writeFile('node_modules/typescript/lib/lib.d.ts', typescriptlib);
diff --git a/src/client/util/SelectionManager.ts b/src/client/util/SelectionManager.ts
index dbcc49f3d..bac13373c 100644
--- a/src/client/util/SelectionManager.ts
+++ b/src/client/util/SelectionManager.ts
@@ -1,17 +1,17 @@
import { action, observable, ObservableMap } from "mobx";
import { computedFn } from "mobx-utils";
import { Doc, Opt } from "../../fields/Doc";
+import { DocumentType } from "../documents/DocumentTypes";
import { CollectionSchemaView } from "../views/collections/collectionSchema/CollectionSchemaView";
import { CollectionViewType } from "../views/collections/CollectionView";
import { DocumentView } from "../views/nodes/DocumentView";
-import { DocumentType } from "../documents/DocumentTypes";
export namespace SelectionManager {
class Manager {
@observable IsDragging: boolean = false;
- SelectedViews: ObservableMap<DocumentView, boolean> = new ObservableMap();
+ SelectedViews: ObservableMap<DocumentView, Doc> = new ObservableMap();
@observable SelectedSchemaDocument: Doc | undefined;
@observable SelectedSchemaCollection: CollectionSchemaView | undefined;
@@ -28,19 +28,18 @@ export namespace SelectionManager {
this.DeselectAll();
}
- manager.SelectedViews.set(docView, true);
+ manager.SelectedViews.set(docView, docView.rootDoc);
docView.props.whenChildContentsActiveChanged(true);
} else if (!ctrlPressed && Array.from(manager.SelectedViews.entries()).length > 1) {
Array.from(manager.SelectedViews.keys()).map(dv => dv !== docView && dv.props.whenChildContentsActiveChanged(false));
manager.SelectedSchemaDocument = undefined;
manager.SelectedSchemaCollection = undefined;
manager.SelectedViews.clear();
- manager.SelectedViews.set(docView, true);
+ manager.SelectedViews.set(docView, docView.rootDoc);
}
}
@action
DeselectView(docView: DocumentView): void {
-
if (manager.SelectedViews.get(docView)) {
manager.SelectedViews.delete(docView);
docView.props.whenChildContentsActiveChanged(false);
@@ -92,7 +91,7 @@ export namespace SelectionManager {
}
export function Views(): Array<DocumentView> {
- return Array.from(manager.SelectedViews.keys()).filter(dv => dv.props.Document._viewType !== CollectionViewType.Docking);
+ return Array.from(manager.SelectedViews.keys()).filter(dv => manager.SelectedViews.get(dv)?._viewType !== CollectionViewType.Docking);
}
export function SelectedSchemaDoc(): Doc | undefined {
return manager.SelectedSchemaDocument;
@@ -100,4 +99,7 @@ export namespace SelectionManager {
export function SelectedSchemaCollection(): CollectionSchemaView | undefined {
return manager.SelectedSchemaCollection;
}
+ export function Docs(): Doc[] {
+ return Array.from(manager.SelectedViews.values()).filter(doc => doc?._viewType !== CollectionViewType.Docking);
+ }
} \ No newline at end of file
diff --git a/src/client/util/SettingsManager.scss b/src/client/util/SettingsManager.scss
index c9db94419..b7199f433 100644
--- a/src/client/util/SettingsManager.scss
+++ b/src/client/util/SettingsManager.scss
@@ -360,17 +360,18 @@
flex-direction: row;
position: relative;
min-height: 250px;
+ height: 100%;
width: 100%;
.settings-content {
- background-color: #fdfdfd;
+ background-color: $off-white;
}
}
.settings-panel {
position: relative;
min-width: 150px;
- background-color: #e4e4e4;
+ background-color: $light-blue;
.settings-user {
position: absolute;
diff --git a/src/client/views/AudioWaveform.tsx b/src/client/views/AudioWaveform.tsx
index 7ff9c1071..8f3b7c2cd 100644
--- a/src/client/views/AudioWaveform.tsx
+++ b/src/client/views/AudioWaveform.tsx
@@ -6,56 +6,121 @@ import Waveform from "react-audio-waveform";
import { Doc } from "../../fields/Doc";
import { List } from "../../fields/List";
import { listSpec } from "../../fields/Schema";
-import { Cast } from "../../fields/Types";
+import { Cast, NumCast } from "../../fields/Types";
import { numberRange } from "../../Utils";
import "./AudioWaveform.scss";
+import { Colors } from "./global/globalEnums";
export interface AudioWaveformProps {
duration: number;
mediaPath: string;
- dataDoc: Doc;
+ layoutDoc: Doc;
+ trimming: boolean;
PanelHeight: () => number;
}
@observer
export class AudioWaveform extends React.Component<AudioWaveformProps> {
public static NUMBER_OF_BUCKETS = 100;
- @computed get _waveHeight() { return Math.max(50, this.props.PanelHeight()); }
+ @computed get _waveHeight() {
+ return Math.max(50, this.props.PanelHeight());
+ }
componentDidMount() {
- const audioBuckets = Cast(this.props.dataDoc.audioBuckets, listSpec("number"), []);
+ const audioBuckets = Cast(
+ this.props.layoutDoc.audioBuckets,
+ listSpec("number"),
+ []
+ );
if (!audioBuckets.length) {
- this.props.dataDoc.audioBuckets = new List<number>([0, 0]); /// "lock" to prevent other views from computing the same data
+ this.props.layoutDoc.audioBuckets = new List<number>([0, 0]); /// "lock" to prevent other views from computing the same data
setTimeout(this.createWaveformBuckets);
}
}
+
// decodes the audio file into peaks for generating the waveform
createWaveformBuckets = async () => {
- axios({ url: this.props.mediaPath, responseType: "arraybuffer" })
- .then(response => {
+ axios({ url: this.props.mediaPath, responseType: "arraybuffer" }).then(
+ (response) => {
const context = new window.AudioContext();
- context.decodeAudioData(response.data,
- action(buffer => {
+ context.decodeAudioData(
+ response.data,
+ action((buffer) => {
const decodedAudioData = buffer.getChannelData(0);
- const bucketDataSize = Math.floor(decodedAudioData.length / AudioWaveform.NUMBER_OF_BUCKETS);
+
+ const bucketDataSize = Math.floor(
+ decodedAudioData.length / AudioWaveform.NUMBER_OF_BUCKETS
+ );
const brange = Array.from(Array(bucketDataSize));
- this.props.dataDoc.audioBuckets = new List<number>(
- numberRange(AudioWaveform.NUMBER_OF_BUCKETS).map((i: number) =>
- brange.reduce((p, x, j) => Math.abs(Math.max(p, decodedAudioData[i * bucketDataSize + j])), 0) / 2));
- }));
- });
+ this.props.layoutDoc.audioBuckets = new List<number>(
+ numberRange(AudioWaveform.NUMBER_OF_BUCKETS).map(
+ (i: number) =>
+ brange.reduce(
+ (p, x, j) =>
+ Math.abs(
+ Math.max(p, decodedAudioData[i * bucketDataSize + j])
+ ),
+ 0
+ ) / 2
+ )
+ );
+ })
+ );
+ }
+ );
+ }
+
+ @action
+ createTrimBuckets = () => {
+ const audioBuckets = Cast(
+ this.props.layoutDoc.audioBuckets,
+ listSpec("number"),
+ []
+ );
+
+ const start = Math.floor(
+ (NumCast(this.props.layoutDoc.clipStart) / this.props.duration) * 100
+ );
+ const end = Math.floor(
+ (NumCast(this.props.layoutDoc.clipEnd) / this.props.duration) * 100
+ );
+ return audioBuckets.slice(start, end);
}
render() {
- const audioBuckets = Cast(this.props.dataDoc.audioBuckets, listSpec("number"), []);
- return <div className="audioWaveform">
- <Waveform
- color={"darkblue"}
- height={this._waveHeight}
- barWidth={0.1}
- pos={this.props.duration}
- duration={this.props.duration}
- peaks={audioBuckets.length === AudioWaveform.NUMBER_OF_BUCKETS ? audioBuckets : undefined}
- progressColor={"blue"} />
- </div>;
+ const audioBuckets = Cast(
+ this.props.layoutDoc.audioBuckets,
+ listSpec("number"),
+ []
+ );
+
+ return (
+ <div className="audioWaveform">
+ {this.props.trimming || !this.props.layoutDoc.clipEnd ? (
+ <Waveform
+ color={Colors.MEDIUM_BLUE}
+ height={this._waveHeight}
+ barWidth={0.1}
+ pos={this.props.duration}
+ duration={this.props.duration}
+ peaks={
+ audioBuckets.length === AudioWaveform.NUMBER_OF_BUCKETS
+ ? audioBuckets
+ : undefined
+ }
+ progressColor={Colors.MEDIUM_BLUE}
+ />
+ ) : (
+ <Waveform
+ color={Colors.MEDIUM_BLUE}
+ height={this._waveHeight}
+ barWidth={0.1}
+ pos={this.props.duration}
+ duration={this.props.duration}
+ peaks={this.createTrimBuckets()}
+ progressColor={Colors.MEDIUM_BLUE}
+ />
+ )}
+ </div>
+ );
}
-} \ No newline at end of file
+}
diff --git a/src/client/views/ComponentDecorations.scss b/src/client/views/ComponentDecorations.scss
new file mode 100644
index 000000000..e69de29bb
--- /dev/null
+++ b/src/client/views/ComponentDecorations.scss
diff --git a/src/client/views/ComponentDecorations.tsx b/src/client/views/ComponentDecorations.tsx
new file mode 100644
index 000000000..66d1bd63d
--- /dev/null
+++ b/src/client/views/ComponentDecorations.tsx
@@ -0,0 +1,14 @@
+import { observer } from "mobx-react";
+import { SelectionManager } from "../util/SelectionManager";
+import './ComponentDecorations.scss';
+import React = require("react");
+
+@observer
+export class ComponentDecorations extends React.Component<{ boundsTop: number, boundsLeft: number }, { value: string }> {
+ static Instance: ComponentDecorations;
+
+ render() {
+ const seldoc = SelectionManager.Views().lastElement();
+ return seldoc?.ComponentView?.componentUI?.(this.props.boundsLeft, this.props.boundsTop) ?? (null);
+ }
+} \ No newline at end of file
diff --git a/src/client/views/ContextMenu.scss b/src/client/views/ContextMenu.scss
index 795529780..47ae0424b 100644
--- a/src/client/views/ContextMenu.scss
+++ b/src/client/views/ContextMenu.scss
@@ -3,14 +3,12 @@
.contextMenu-cont {
position: absolute;
display: flex;
- z-index: $contextMenu-zindex;
- box-shadow: $medium-gray 0.2vw 0.2vw 0.4vw;
+ z-index: 100000;
+ box-shadow: 0px 3px 4px rgba(0,0,0,30%);
flex-direction: column;
background: whitesmoke;
- padding-top: 10px;
- padding-bottom: 10px;
- border-radius: 15px;
- border: solid #BBBBBBBB 1px;
+ border-radius: 3px;
+ border: solid $light-gray 1px;
}
// .contextMenu-item:first-child {
@@ -132,7 +130,7 @@
}
.contextMenu-inlineMenu {
- border-top: solid 1px;
+ // border-top: solid 1px; //TODO:glr clean
}
.contextMenu-item:hover {
diff --git a/src/client/views/ContextMenu.tsx b/src/client/views/ContextMenu.tsx
index c4fabbf99..78564a11b 100644
--- a/src/client/views/ContextMenu.tsx
+++ b/src/client/views/ContextMenu.tsx
@@ -47,11 +47,17 @@ export class ContextMenu extends React.Component {
this._mouseDown = false;
const curX = e.clientX;
const curY = e.clientY;
- if (this._mouseX !== curX || this._mouseY !== curY) {
+ if (Math.abs(this._mouseX - curX) > 1 || Math.abs(this._mouseY - curY) > 1) {
this._shouldDisplay = false;
}
- this._shouldDisplay && (this._display = true);
+ if (this._shouldDisplay) {
+ if (this._onDisplay) {
+ this._onDisplay();
+ } else {
+ this._display = true;
+ }
+ }
}
componentWillUnmount() {
document.removeEventListener("pointerdown", this.onPointerDown);
@@ -138,9 +144,9 @@ export class ContextMenu extends React.Component {
return y;
}
-
+ _onDisplay?: () => void = undefined;
@action
- displayMenu = (x: number, y: number, initSearch = "", showSearch = false) => {
+ displayMenu = (x: number, y: number, initSearch = "", showSearch = false, onDisplay?: () => void) => {
//maxX and maxY will change if the UI/font size changes, but will work for any amount
//of items added to the menu
@@ -149,6 +155,7 @@ export class ContextMenu extends React.Component {
this._pageY = y;
this._searchString = initSearch;
this._shouldDisplay = true;
+ this._onDisplay = onDisplay;
}
@action
diff --git a/src/client/views/ContextMenuItem.tsx b/src/client/views/ContextMenuItem.tsx
index 6fe2abd21..c3921d846 100644
--- a/src/client/views/ContextMenuItem.tsx
+++ b/src/client/views/ContextMenuItem.tsx
@@ -90,7 +90,7 @@ export class ContextMenuItem extends React.Component<ContextMenuProps & { select
</span>
) : null}
<div className="contextMenu-description">
- {this.props.description}
+ {this.props.description.replace(":","")}
</div>
</div>
);
@@ -116,12 +116,12 @@ export class ContextMenuItem extends React.Component<ContextMenuProps & { select
style={{ alignItems: where, borderTop: this.props.addDivider ? "solid 1px" : undefined }}
onMouseLeave={this.onPointerLeave} onMouseEnter={this.onPointerEnter}>
{this.props.icon ? (
- <span className="icon-background" onMouseEnter={this.onPointerLeave} style={{ alignItems: "center" }}>
+ <span className="icon-background" onMouseEnter={this.onPointerLeave} style={{ alignItems: "center", alignSelf: "center" }}>
<FontAwesomeIcon icon={this.props.icon} size="sm" />
</span>
) : null}
<div className="contextMenu-description" onMouseEnter={this.onPointerEnter}
- style={{ alignItems: "center" }} >
+ style={{ alignItems: "center", alignSelf: "center" }} >
{this.props.description}
<FontAwesomeIcon icon={"angle-right"} size="lg" style={{ position: "absolute", right: "10px" }} />
</div>
diff --git a/src/client/views/DocComponent.tsx b/src/client/views/DocComponent.tsx
index 14d32ef12..32c351bf5 100644
--- a/src/client/views/DocComponent.tsx
+++ b/src/client/views/DocComponent.tsx
@@ -1,17 +1,17 @@
-import { Doc, Opt, DataSym, AclReadonly, AclAugment, AclPrivate, AclEdit, AclSym, DocListCast, AclAdmin, AclSelfEdit } from '../../fields/Doc';
-import { Touchable } from './Touchable';
-import { computed, action, observable } from 'mobx';
-import { Cast, BoolCast, ScriptCast } from '../../fields/Types';
+import { action, computed, observable } from 'mobx';
+import { DateField } from '../../fields/DateField';
+import { AclAdmin, AclAugment, AclEdit, AclPrivate, AclReadonly, AclSym, DataSym, Doc, DocListCast, Opt } from '../../fields/Doc';
import { InkTool } from '../../fields/InkField';
-import { InteractionUtils } from '../util/InteractionUtils';
import { List } from '../../fields/List';
-import { DateField } from '../../fields/DateField';
import { ScriptField } from '../../fields/ScriptField';
-import { GetEffectiveAcl, SharingPermissions, distributeAcls, denormalizeEmail, inheritParentAcls } from '../../fields/util';
-import { CurrentUserUtils } from '../util/CurrentUserUtils';
-import { DocUtils } from '../documents/Documents';
+import { Cast, ScriptCast } from '../../fields/Types';
+import { denormalizeEmail, distributeAcls, GetEffectiveAcl, inheritParentAcls, SharingPermissions } from '../../fields/util';
import { returnFalse } from '../../Utils';
+import { DocUtils } from '../documents/Documents';
+import { CurrentUserUtils } from '../util/CurrentUserUtils';
+import { InteractionUtils } from '../util/InteractionUtils';
import { UndoManager } from '../util/UndoManager';
+import { Touchable } from './Touchable';
/// DocComponent returns a generic React base class used by views that don't have 'fieldKey' props (e.g.,CollectionFreeFormDocumentView, DocumentView)
@@ -90,9 +90,9 @@ export interface ViewBoxAnnotatableProps {
renderDepth: number;
isAnnotationOverlay?: boolean;
}
-export function ViewBoxAnnotatableComponent<P extends ViewBoxAnnotatableProps, T>(schemaCtor: (doc: Doc) => T, _annotationKey: string = "annotations") {
+export function ViewBoxAnnotatableComponent<P extends ViewBoxAnnotatableProps, T>(schemaCtor: (doc: Doc) => T) {
class Component extends Touchable<P> {
- @observable _annotationKey: string = _annotationKey;
+ @observable _annotationKeySuffix = () => "annotations";
@observable _isAnyChildContentActive = false;
//TODO This might be pretty inefficient if doc isn't observed, because computed doesn't cache then
@@ -107,6 +107,7 @@ export function ViewBoxAnnotatableComponent<P extends ViewBoxAnnotatableProps, T
// key where data is stored
@computed get fieldKey() { return this.props.fieldKey; }
+ isAnyChildContentActive = () => this._isAnyChildContentActive;
lookupField = (field: string) => ScriptCast((this.layoutDoc as any).lookupField)?.script.run({ self: this.layoutDoc, data: this.rootDoc, field: field }).result;
@@ -114,7 +115,7 @@ export function ViewBoxAnnotatableComponent<P extends ViewBoxAnnotatableProps, T
const style: { [key: string]: any } = {};
const divKeys = ["width", "height", "fontSize", "transform", "left", "background", "left", "right", "top", "bottom", "pointerEvents", "position"];
const replacer = (match: any, expr: string, offset: any, string: any) => { // bcz: this executes a script to convert a property expression string: { script } into a value
- return ScriptField.MakeFunction(expr, { self: Doc.name, this: Doc.name, scale: "number" })?.script.run({ self: this.rootDoc, this: this.layoutDoc, scale }).result as string || "";
+ return ScriptField.MakeFunction(expr, { self: Doc.name, this: Doc.name, scale: "number" })?.script.run({ self: this.rootDoc, this: this.layoutDoc, scale }).result?.toString() ?? "";
};
divKeys.map((prop: string) => {
const p = (this.props as any)[prop];
@@ -125,7 +126,7 @@ export function ViewBoxAnnotatableComponent<P extends ViewBoxAnnotatableProps, T
protected _multiTouchDisposer?: InteractionUtils.MultiTouchEventDisposer;
- @computed public get annotationKey() { return this.fieldKey + (this._annotationKey ? "-" + this._annotationKey : ""); }
+ @computed public get annotationKey() { return this.fieldKey + (this._annotationKeySuffix() ? "-" + this._annotationKeySuffix() : ""); }
@action.bound
removeDocument(doc: Doc | Doc[], annotationKey?: string, leavePushpin?: boolean): boolean {
@@ -175,7 +176,7 @@ export function ViewBoxAnnotatableComponent<P extends ViewBoxAnnotatableProps, T
return false;
}
@action.bound
- addDocument(doc: Doc | Doc[], annotationKey?: string): boolean {
+ addDocument = (doc: Doc | Doc[], annotationKey?: string): boolean => {
const docs = doc instanceof Doc ? [doc] : doc;
if (this.props.filterAddDocument?.(docs) === false ||
docs.find(doc => Doc.AreProtosEqual(doc, this.props.Document) && Doc.LayoutField(doc) === Doc.LayoutField(this.props.Document))) {
@@ -203,7 +204,7 @@ export function ViewBoxAnnotatableComponent<P extends ViewBoxAnnotatableProps, T
added.map(doc => {
if ([AclAdmin, AclEdit].includes(GetEffectiveAcl(doc))) inheritParentAcls(CurrentUserUtils.ActiveDashboard, doc);
doc.context = this.props.Document;
- if (annotationKey ?? this._annotationKey) Doc.GetProto(doc).annotationOn = this.props.Document;
+ if (annotationKey ?? this._annotationKeySuffix()) Doc.GetProto(doc).annotationOn = this.props.Document;
this.props.layerProvider?.(doc, true);
Doc.AddDocToList(targetDataDoc, annotationKey ?? this.annotationKey, doc);
});
@@ -214,7 +215,7 @@ export function ViewBoxAnnotatableComponent<P extends ViewBoxAnnotatableProps, T
//DocUtils.LeavePushpin(doc);
doc._stayInCollection = undefined;
doc.context = this.props.Document;
- if (annotationKey ?? this._annotationKey) Doc.GetProto(doc).annotationOn = this.props.Document;
+ if (annotationKey ?? this._annotationKeySuffix()) Doc.GetProto(doc).annotationOn = this.props.Document;
inheritParentAcls(CurrentUserUtils.ActiveDashboard, doc);
});
@@ -229,10 +230,6 @@ export function ViewBoxAnnotatableComponent<P extends ViewBoxAnnotatableProps, T
}
whenChildContentsActiveChanged = action((isActive: boolean) => this.props.whenChildContentsActiveChanged(this._isAnyChildContentActive = isActive));
- isContentActive = (outsideReaction?: boolean) => (CurrentUserUtils.SelectedTool !== InkTool.None ||
- (this.props.isContentActive?.() || this.props.Document.forceActive ||
- this.props.isSelected(outsideReaction) || this._isAnyChildContentActive ||
- this.props.rootSelected(outsideReaction)) ? true : false)
}
return Component;
} \ No newline at end of file
diff --git a/src/client/views/DocumentButtonBar.tsx b/src/client/views/DocumentButtonBar.tsx
index 5f09a322c..7f428a881 100644
--- a/src/client/views/DocumentButtonBar.tsx
+++ b/src/client/views/DocumentButtonBar.tsx
@@ -27,6 +27,7 @@ import React = require("react");
import { PresBox } from './nodes/trails/PresBox';
import { undoBatch } from '../util/UndoManager';
import { CollectionViewType } from './collections/CollectionView';
+import { Colors } from './global/globalEnums';
const higflyout = require("@hig/flyout");
export const { anchorPoints } = higflyout;
export const Flyout = higflyout.default;
@@ -187,9 +188,9 @@ export class DocumentButtonBar extends React.Component<{ views: () => (DocumentV
get followLinkButton() {
const targetDoc = this.view0?.props.Document;
return !targetDoc ? (null) : <Tooltip title={
- <div className="dash-tooltip">{"follow primary link on click"}</div>}>
+ <div className="dash-tooltip">{"Set onClick to follow primary link"}</div>}>
<div className="documentButtonBar-icon"
- style={{ color: targetDoc.isLinkButton ? "black" : "white" }}
+ style={{ backgroundColor: targetDoc.isLinkButton ? Colors.LIGHT_BLUE : Colors.DARK_GRAY, color: targetDoc.isLinkButton ? Colors.BLACK : Colors.WHITE }}
onClick={undoBatch(e => this.props.views().map(view => view?.docView?.toggleFollowLink(undefined, false, false)))}>
<FontAwesomeIcon className="documentdecorations-icon" size="sm" icon="hand-point-right" />
</div>
@@ -202,7 +203,7 @@ export class DocumentButtonBar extends React.Component<{ views: () => (DocumentV
<div className="dash-tooltip">{SelectionManager.Views().length > 1 ? "Pin multiple documents to presentation" : "Pin to presentation"}</div>}>
<div className="documentButtonBar-icon"
style={{ color: "white" }}
- onClick={undoBatch(e => this.props.views().map(view => view && TabDocView.PinDoc(view.props.Document, { setPosition: e.shiftKey ? true : undefined })))}>
+ onClick={undoBatch(e => this.props.views().map(view => view && this.pinWithView(view.props.Document)))}>
<FontAwesomeIcon className="documentdecorations-icon" size="sm" icon="map-pin" />
</div>
</Tooltip>;
diff --git a/src/client/views/DocumentDecorations.scss b/src/client/views/DocumentDecorations.scss
index 316f63240..a9f50f81b 100644
--- a/src/client/views/DocumentDecorations.scss
+++ b/src/client/views/DocumentDecorations.scss
@@ -1,12 +1,11 @@
@import "global/globalCssVariables";
-$linkGap : 3px;
+$linkGap: 3px;
.documentDecorations {
- position: absolute;
- z-index: 2000;
+ position: absolute;
+ z-index: 2000;
}
-
.documentDecorations-container {
z-index: $docDecorations-zindex;
position: absolute;
@@ -51,6 +50,7 @@ $linkGap : 3px;
pointer-events: auto;
background: $medium-gray;
opacity: 0.1;
+
&:hover {
opacity: 1;
}
@@ -94,6 +94,7 @@ $linkGap : 3px;
position: absolute;
}
}
+
.documentDecorations-rotation {
background: transparent;
right: -15;
@@ -122,61 +123,103 @@ $linkGap : 3px;
opacity: 1;
}
- .documentDecorations-bottomRightResizer {
- grid-row: 4;
- }
+ .documentDecorations-topLeftResizer,
+ .documentDecorations-leftResizer,
+ .documentDecorations-bottomLeftResizer {
+ grid-column: 1;
+ }
- .documentDecorations-topRightResizer,
- .documentDecorations-bottomLeftResizer {
- cursor: nesw-resize;
- background: unset;
- opacity: 1;
- }
+ .documentDecorations-topResizer,
+ .documentDecorations-bottomResizer {
+ grid-column-start: 2;
+ grid-column-end: 5;
+ }
- .documentDecorations-topRightResizer {
- border-right: 2px solid;
- border-top: 2px solid;
- }
+ .documentDecorations-bottomRightResizer,
+ .documentDecorations-topRightResizer,
+ .documentDecorations-rightResizer {
+ grid-column-start: 5;
+ grid-column-end: 7;
+ }
+
+ .documentDecorations-rotation,
+ .documentDecorations-borderRadius {
+ grid-column: 5;
+ grid-row: 4;
+ border-radius: 100%;
+ background: black;
+ height: 8;
+ right: -12;
+ top: 12;
+ position: relative;
+ pointer-events: all;
+ cursor: nwse-resize;
+
+ .borderRadiusTooltip {
+ width: 10px;
+ height: 10px;
+ position: absolute;
+ }
+ }
+ .documentDecorations-rotation {
+ background: transparent;
+ right: -15;
+ }
+
+ .documentDecorations-topLeftResizer,
+ .documentDecorations-bottomRightResizer {
+ cursor: nwse-resize;
+ background: unset;
+ opacity: 1;
+ }
- .documentDecorations-bottomLeftResizer {
- border-left: 2px solid;
- border-bottom: 2px solid;
- }
+ .documentDecorations-topLeftResizer {
+ border-left: 2px solid;
+ border-top: solid 2px;
+ }
- .documentDecorations-topRightResizer:hover,
- .documentDecorations-bottomLeftResizer:hover {
- cursor: nesw-resize;
- background: black;
- opacity: 1;
- }
+ .documentDecorations-bottomRightResizer {
+ border-right: 2px solid;
+ border-bottom: solid 2px;
+ }
- .documentDecorations-topResizer,
- .documentDecorations-bottomResizer {
- cursor: ns-resize;
- }
+ .documentDecorations-topLeftResizer:hover,
+ .documentDecorations-bottomRightResizer:hover {
+ opacity: 1;
+ }
- .documentDecorations-leftResizer,
- .documentDecorations-rightResizer {
- cursor: ew-resize;
- }
+ .documentDecorations-bottomRightResizer {
+ grid-row: 4;
+ }
- .documentDecorations-contextMenu {
- width: 25px;
- height: calc(100% + 8px); // 8px for the height of the top resizer bar
- grid-column-start: 2;
- grid-column-end: 2;
- pointer-events: all;
- padding-left: 5px;
- cursor: pointer;
- }
+ .documentDecorations-topRightResizer,
+ .documentDecorations-bottomLeftResizer {
+ cursor: nesw-resize;
+ background: unset;
+ opacity: 1;
+ }
+
+ .documentDecorations-topRightResizer {
+ border-right: 2px solid;
+ border-top: 2px solid;
+ }
+
+ .documentDecorations-bottomLeftResizer {
+ border-left: 2px solid;
+ border-bottom: 2px solid;
+ }
+
+ .documentDecorations-topRightResizer:hover,
+ .documentDecorations-bottomLeftResizer:hover {
+ cursor: nesw-resize;
+ background: black;
+ opacity: 1;
+ }
- .documentDecorations-titleBackground {
- background: #ffffffcf;
- border-radius: 8px;
- width: 100%;
- height: 100%;
- position: absolute;
- }
+ .documentDecorations-topResizer,
+ .documentDecorations-bottomResizer {
+ cursor: ns-resize;
+ }
.documentDecorations-title {
opacity: 1;
@@ -189,6 +232,7 @@ $linkGap : 3px;
margin-left: 5px;
height: 22px;
position: absolute;
+
.documentDecorations-titleSpan {
width: 100%;
border-radius: 8px;
@@ -199,71 +243,109 @@ $linkGap : 3px;
}
}
- .focus-visible {
- margin-left: 0px;
- }
-}
+ .documentDecorations-contextMenu {
+ width: 25px;
+ height: calc(100% + 8px); // 8px for the height of the top resizer bar
+ grid-column-start: 2;
+ grid-column-end: 2;
+ pointer-events: all;
+ padding-left: 5px;
+ cursor: pointer;
+ }
+ .documentDecorations-titleBackground {
+ background: #ffffffcf;
+ border-radius: 8px;
+ width: 100%;
+ height: 100%;
+ position: absolute;
+ }
-.documentDecorations-iconifyButton {
+ .documentDecorations-title {
opacity: 1;
- grid-column-start: 4;
+ grid-column-start: 2;
grid-column-end: 4;
- pointer-events: all;
- right: 0;
- cursor: pointer;
+ pointer-events: auto;
+ overflow: hidden;
+ text-align: center;
+ display: flex;
+ margin-left: 5px;
+ height: 22px;
position: absolute;
- width: 20px;
+ .documentDecorations-titleSpan {
+ width: 100%;
+ border-radius: 8px;
+ background: #ffffffcf;
+ position: absolute;
+ display: inline-block;
+ cursor: move;
+ }
+ }
+
+ .focus-visible {
+ margin-left: 0px;
+ }
+}
+
+.documentDecorations-iconifyButton {
+ opacity: 1;
+ grid-column-start: 4;
+ grid-column-end: 4;
+ pointer-events: all;
+ right: 0;
+ cursor: pointer;
+ position: absolute;
+ width: 20px;
}
.documentDecorations-openButton {
- display: flex;
- align-items: center;
- opacity: 1;
- grid-column-start: 5;
- grid-column-end: 5;
- pointer-events: all;
- cursor: pointer;
+ display: flex;
+ align-items: center;
+ opacity: 1;
+ grid-column-start: 5;
+ grid-column-end: 5;
+ pointer-events: all;
+ cursor: pointer;
}
.documentDecorations-closeButton {
- display: flex;
- align-items: center;
- opacity: 1;
- grid-column-start: 1;
- grid-column-end: 3;
- pointer-events: all;
- cursor: pointer;
-
- >svg {
- margin: 0;
- }
+ display: flex;
+ align-items: center;
+ opacity: 1;
+ grid-column-start: 1;
+ grid-column-end: 3;
+ pointer-events: all;
+ cursor: pointer;
+
+ > svg {
+ margin: 0;
+ }
}
.documentDecorations-background {
- background: lightblue;
- position: absolute;
- opacity: 0.1;
+ background: lightblue;
+ position: absolute;
+ opacity: 0.1;
}
.linkFlyout {
- grid-column: 2/4;
+ grid-column: 2/4;
}
.linkButton-empty:hover {
- background: $medium-gray;
- transform: scale(1.05);
- cursor: pointer;
+ background: $medium-gray;
+ transform: scale(1.05);
+ cursor: pointer;
}
.linkButton-nonempty:hover {
- background: $medium-gray;
- transform: scale(1.05);
- cursor: pointer;
+ background: $medium-gray;
+ transform: scale(1.05);
+ cursor: pointer;
}
.link-button-container {
- border-radius: 10px;
+ border-radius: 13px;
width: max-content;
height: auto;
display: flex;
@@ -277,135 +359,136 @@ $linkGap : 3px;
}
.linkButtonWrapper {
- pointer-events: auto;
- padding-right: 5px;
- width: 25px;
+ pointer-events: auto;
+ padding-right: 5px;
+ width: 25px;
}
.linkButton-linker {
- height: 20px;
- width: 20px;
- text-align: center;
- border-radius: 50%;
- pointer-events: auto;
- color: $dark-gray;
- border: $dark-gray 1px solid;
+ height: 20px;
+ width: 20px;
+ text-align: center;
+ border-radius: 50%;
+ pointer-events: auto;
+ color: $dark-gray;
+ border: $dark-gray 1px solid;
}
.linkButton-linker:hover {
- cursor: pointer;
- transform: scale(1.05);
+ cursor: pointer;
+ transform: scale(1.05);
}
.linkButton-empty,
.linkButton-nonempty {
- height: 20px;
- width: 20px;
- border-radius: 50%;
- opacity: 0.9;
- pointer-events: auto;
- background-color: $dark-gray;
- color: $white;
- text-transform: uppercase;
- letter-spacing: 2px;
- font-size: 75%;
- transition: transform 0.2s;
- text-align: center;
- display: flex;
- justify-content: center;
- align-items: center;
-
- &:hover {
- background: $medium-gray;
- transform: scale(1.05);
- cursor: pointer;
- }
+ height: 20px;
+ width: 20px;
+ border-radius: 50%;
+ opacity: 0.9;
+ pointer-events: auto;
+ background-color: $dark-gray;
+ color: $white;
+ text-transform: uppercase;
+ letter-spacing: 2px;
+ font-size: 75%;
+ transition: transform 0.2s;
+ text-align: center;
+ display: flex;
+ justify-content: center;
+ align-items: center;
+
+ &:hover {
+ background: $medium-gray;
+ transform: scale(1.05);
+ cursor: pointer;
+ }
}
.templating-menu {
- position: absolute;
- pointer-events: auto;
- text-transform: uppercase;
- letter-spacing: 2px;
- font-size: 75%;
- transition: transform 0.2s;
- text-align: center;
- display: flex;
- justify-content: center;
- align-items: center;
+ position: absolute;
+ pointer-events: auto;
+ text-transform: uppercase;
+ letter-spacing: 2px;
+ font-size: 75%;
+ transition: transform 0.2s;
+ text-align: center;
+ display: flex;
+ justify-content: center;
+ align-items: center;
}
.documentdecorations-icon {
- margin: 0px;
+ margin: 0px;
}
+
.templating-button,
.docDecs-tagButton {
- width: 20px;
- height: 20px;
- border-radius: 50%;
- opacity: 0.9;
- font-size: 14;
- background-color: $dark-gray;
- color: $white;
- text-align: center;
- cursor: pointer;
-
- &:hover {
- background: $medium-gray;
- transform: scale(1.05);
- }
+ width: 20px;
+ height: 20px;
+ border-radius: 50%;
+ opacity: 0.9;
+ font-size: 14;
+ background-color: $dark-gray;
+ color: $white;
+ text-align: center;
+ cursor: pointer;
+
+ &:hover {
+ background: $medium-gray;
+ transform: scale(1.05);
+ }
}
.documentDecorations-darkScheme {
- background: dimgray;
+ background: dimgray;
}
#template-list {
- position: absolute;
- top: 25px;
- left: 0px;
- width: max-content;
- font-family: $sans-serif;
- font-size: 12px;
- background-color: $light-gray;
- padding: 2px 12px;
- list-style: none;
-
- .templateToggle,
- .chromeToggle {
- text-align: left;
- }
-
- input {
- margin-right: 10px;
- }
+ position: absolute;
+ top: 25px;
+ left: 0px;
+ width: max-content;
+ font-family: $sans-serif;
+ font-size: 12px;
+ background-color: $light-gray;
+ padding: 2px 12px;
+ list-style: none;
+
+ .templateToggle,
+ .chromeToggle {
+ text-align: left;
+ }
+
+ input {
+ margin-right: 10px;
+ }
}
@-moz-keyframes spin {
- 100% {
- -moz-transform: rotate(360deg);
- }
+ 100% {
+ -moz-transform: rotate(360deg);
+ }
}
@-webkit-keyframes spin {
- 100% {
- -webkit-transform: rotate(360deg);
- }
+ 100% {
+ -webkit-transform: rotate(360deg);
+ }
}
@keyframes spin {
- 100% {
- -webkit-transform: rotate(360deg);
- transform: rotate(360deg);
- }
+ 100% {
+ -webkit-transform: rotate(360deg);
+ transform: rotate(360deg);
+ }
}
@keyframes shadow-pulse {
- 0% {
- box-shadow: 0 0 0 0px rgba(0, 0, 0, 0.8);
- }
+ 0% {
+ box-shadow: 0 0 0 0px rgba(0, 0, 0, 0.8);
+ }
- 100% {
- box-shadow: 0 0 0 10px rgba(0, 255, 0, 0);
- }
-} \ No newline at end of file
+ 100% {
+ box-shadow: 0 0 0 10px rgba(0, 255, 0, 0);
+ }
+}
diff --git a/src/client/views/DocumentDecorations.tsx b/src/client/views/DocumentDecorations.tsx
index 118d2e7c7..6f9697703 100644
--- a/src/client/views/DocumentDecorations.tsx
+++ b/src/client/views/DocumentDecorations.tsx
@@ -3,15 +3,15 @@ import { FontAwesomeIcon } from "@fortawesome/react-fontawesome";
import { Tooltip } from '@material-ui/core';
import { action, computed, observable, reaction, runInAction } from "mobx";
import { observer } from "mobx-react";
-import { AclAdmin, AclEdit, DataSym, Doc, Field, HeightSym, WidthSym } from "../../fields/Doc";
+import { DateField } from '../../fields/DateField';
+import { AclAdmin, AclEdit, DataSym, Doc, DocListCast, Field, HeightSym, WidthSym } from "../../fields/Doc";
import { Document } from '../../fields/documentSchemas';
-import { HtmlField } from '../../fields/HtmlField';
import { InkField } from "../../fields/InkField";
import { ScriptField } from '../../fields/ScriptField';
-import { Cast, NumCast, StrCast } from "../../fields/Types";
+import { Cast, NumCast } from "../../fields/Types";
import { GetEffectiveAcl } from '../../fields/util';
-import { setupMoveUpEvents, emptyFunction, returnFalse } from "../../Utils";
-import { Docs, DocUtils } from "../documents/Documents";
+import { emptyFunction, returnFalse, setupMoveUpEvents } from "../../Utils";
+import { Docs } from "../documents/Documents";
import { DocumentType } from '../documents/DocumentTypes';
import { CurrentUserUtils } from '../util/CurrentUserUtils';
import { DragManager } from "../util/DragManager";
@@ -25,12 +25,11 @@ import { KeyManager } from './GlobalKeyHandler';
import { InkStrokeProperties } from './InkStrokeProperties';
import { LightboxView } from './LightboxView';
import { DocumentView } from "./nodes/DocumentView";
-import React = require("react");
import { FormattedTextBox } from './nodes/formattedText/FormattedTextBox';
-import { DateField } from '../../fields/DateField';
+import React = require("react");
@observer
-export class DocumentDecorations extends React.Component<{ boundsLeft: number, boundsTop: number }, { value: string }> {
+export class DocumentDecorations extends React.Component<{ PanelWidth: number, PanelHeight: number, boundsLeft: number, boundsTop: number }, { value: string }> {
static Instance: DocumentDecorations;
private _resizeHdlId = "";
private _keyinput = React.createRef<HTMLInputElement>();
@@ -123,7 +122,7 @@ export class DocumentDecorations extends React.Component<{ boundsLeft: number, b
const dragData = new DragManager.DocumentDragData(SelectionManager.Views().map(dv => dv.props.Document), dragDocView.props.dropAction);
dragData.offset = dragDocView.props.ScreenToLocalTransform().transformDirection(e.x - left, e.y - top);
dragData.moveDocument = dragDocView.props.moveDocument;
- dragData.isSelectionMove = true;
+ dragData.isDocDecorationMove = true;
dragData.canEmbed = dragTitle;
this._hidden = this.Interacting = true;
DragManager.StartDocumentDrag(SelectionManager.Views().map(dv => dv.ContentDiv!), dragData, e.x, e.y, {
@@ -136,7 +135,6 @@ export class DocumentDecorations extends React.Component<{ boundsLeft: number, b
return true;
}
- @undoBatch
onCloseClick = () => {
const selected = SelectionManager.Views().slice();
SelectionManager.DeselectAll();
@@ -153,15 +151,13 @@ export class DocumentDecorations extends React.Component<{ boundsLeft: number, b
return true;
}, emptyFunction, this.onMaximizeClick, false, false);
}
- @undoBatch
- @action
+
onMaximizeClick = (e: any): void => {
const selectedDocs = SelectionManager.Views();
if (selectedDocs.length) {
if (e.ctrlKey) { // open an alias in a new tab with Ctrl Key
- selectedDocs[0].props.Document._fullScreenView = Doc.MakeAlias(selectedDocs[0].props.Document);
- (selectedDocs[0].props.Document._fullScreenView as Doc).context = undefined;
- CollectionDockingView.AddSplit(selectedDocs[0].props.Document._fullScreenView as Doc, "right");
+ const bestAlias = DocListCast(selectedDocs[0].props.Document.aliases).find(doc => !doc.context && doc.author === Doc.CurrentUserEmail);
+ CollectionDockingView.AddSplit(bestAlias ?? Doc.MakeAlias(selectedDocs[0].props.Document), "right");
} else if (e.shiftKey) { // open centered in a new workspace with Shift Key
const alias = Doc.MakeAlias(selectedDocs[0].props.Document);
alias.context = undefined;
@@ -169,7 +165,7 @@ export class DocumentDecorations extends React.Component<{ boundsLeft: number, b
alias.y = -alias[HeightSym]() / 2;
CollectionDockingView.AddSplit(Docs.Create.FreeformDocument([alias], { title: "Tab for " + alias.title }), "right");
} else if (e.altKey) { // open same document in new tab
- CollectionDockingView.ToggleSplit(Cast(selectedDocs[0].props.Document._fullScreenView, Doc, null) || selectedDocs[0].props.Document, "right");
+ CollectionDockingView.ToggleSplit(selectedDocs[0].props.Document, "right");
} else {
LightboxView.SetLightboxDoc(selectedDocs[0].props.Document, undefined, selectedDocs.slice(1).map(view => view.props.Document));
}
@@ -177,7 +173,6 @@ export class DocumentDecorations extends React.Component<{ boundsLeft: number, b
SelectionManager.DeselectAll();
}
- @undoBatch
onIconifyClick = (): void => {
SelectionManager.Views().forEach(dv => dv?.iconify());
SelectionManager.DeselectAll();
@@ -320,11 +315,12 @@ export class DocumentDecorations extends React.Component<{ boundsLeft: number, b
let height = (doc._height || (nheight / nwidth * width));
height = !height || isNaN(height) ? 20 : height;
const scale = docView.props.ScreenToLocalTransform().Scale;
+ const canModifyNativeDim = e.ctrlKey || doc.allowReflow;
if (nwidth && nheight) {
if (nwidth / nheight !== width / height && !dragBottom) {
height = nheight / nwidth * width;
}
- if (e.ctrlKey && !dragBottom) { // ctrl key enables modification of the nativeWidth or nativeHeight durin the interaction
+ if (canModifyNativeDim && !dragBottom) { // ctrl key enables modification of the nativeWidth or nativeHeight durin the interaction
if (Math.abs(dW) > Math.abs(dH)) dH = dW * nheight / nwidth;
else dW = dH * nwidth / nheight;
}
@@ -334,7 +330,7 @@ export class DocumentDecorations extends React.Component<{ boundsLeft: number, b
doc.x = (doc.x || 0) + dX * (actualdW - width);
doc.y = (doc.y || 0) + dY * (actualdH - height);
const fixedAspect = (nwidth && nheight);
- if (e.ctrlKey && [DocumentType.IMG, DocumentType.SCREENSHOT, DocumentType.VID].includes(doc.type as DocumentType)) {
+ if (canModifyNativeDim && [DocumentType.IMG, DocumentType.SCREENSHOT, DocumentType.VID].includes(doc.type as DocumentType)) {
dW !== 0 && runInAction(() => {
const dataDoc = doc[DataSym];
const nw = Doc.NativeWidth(dataDoc);
@@ -344,22 +340,22 @@ export class DocumentDecorations extends React.Component<{ boundsLeft: number, b
});
}
else if (fixedAspect) {
- if ((Math.abs(dW) > Math.abs(dH) && (!dragBottom || !e.ctrlKey)) || dragRight) {
- if (dragRight && e.ctrlKey) {
+ if ((Math.abs(dW) > Math.abs(dH) && (!dragBottom || !canModifyNativeDim)) || dragRight) {
+ if (dragRight && canModifyNativeDim) {
doc._nativeWidth = actualdW / (doc._width || 1) * Doc.NativeWidth(doc);
} else {
if (!doc._fitWidth) doc._height = nheight / nwidth * actualdW;
- else if (!e.ctrlKey || dragBotRight) doc._height = actualdH;
+ else if (!canModifyNativeDim || dragBotRight) doc._height = actualdH;
}
doc._width = actualdW;
}
else {
- if (dragBottom && (e.ctrlKey || docView.layoutDoc._fitWidth)) { // frozen web pages and others that fitWidth can't grow horizontally to match a vertical resize so the only choice is to change the nativeheight even if the ctrl key isn't used
+ if (dragBottom && (canModifyNativeDim || docView.layoutDoc._fitWidth)) { // frozen web pages and others that fitWidth can't grow horizontally to match a vertical resize so the only choice is to change the nativeheight even if the ctrl key isn't used
doc._nativeHeight = actualdH / (doc._height || 1) * Doc.NativeHeight(doc);
doc._autoHeight = false;
} else {
if (!doc._fitWidth) doc._width = nwidth / nheight * actualdH;
- else if (!e.ctrlKey || dragBotRight) doc._width = actualdW;
+ else if (!canModifyNativeDim || dragBotRight) doc._width = actualdW;
}
doc._height = actualdH;
}
@@ -404,6 +400,9 @@ export class DocumentDecorations extends React.Component<{ boundsLeft: number, b
get selectionTitle(): string {
if (SelectionManager.Views().length === 1) {
const selected = SelectionManager.Views()[0];
+ if (selected.ComponentView?.getTitle?.()) {
+ return selected.ComponentView.getTitle();
+ }
if (this._titleControlString.startsWith("=")) {
return ScriptField.MakeFunction(this._titleControlString.substring(1), { doc: Doc.name })!.script.run({ self: selected.rootDoc, this: selected.layoutDoc }, console.log).result?.toString() || "";
}
@@ -421,7 +420,7 @@ export class DocumentDecorations extends React.Component<{ boundsLeft: number, b
if (SnappingManager.GetIsDragging() || bounds.r - bounds.x < 1 || bounds.x === Number.MAX_VALUE || !seldoc || this._hidden || isNaN(bounds.r) || isNaN(bounds.b) || isNaN(bounds.x) || isNaN(bounds.y)) {
return (null);
}
- const canOpen = SelectionManager.Views().some(docView => !docView.props.Document._stayInCollection);
+ const canOpen = SelectionManager.Views().some(docView => !docView.props.Document._stayInCollection && !docView.props.Document.isGroup);
const canDelete = SelectionManager.Views().some(docView => {
const collectionAcl = docView.props.ContainingCollectionView ? GetEffectiveAcl(docView.props.ContainingCollectionDoc?.[DataSym]) : AclEdit;
return (!docView.rootDoc._stayInCollection || docView.rootDoc.isInkMask) &&
@@ -430,7 +429,7 @@ export class DocumentDecorations extends React.Component<{ boundsLeft: number, b
const topBtn = (key: string, icon: string, pointerDown: undefined | ((e: React.PointerEvent) => void), click: undefined | ((e: any) => void), title: string) => (
<Tooltip key={key} title={<div className="dash-tooltip">{title}</div>} placement="top">
<div className={`documentDecorations-${key}Button`} onContextMenu={e => e.preventDefault()}
- onPointerDown={pointerDown ?? (e => setupMoveUpEvents(this, e, returnFalse, click!, emptyFunction))} >
+ onPointerDown={pointerDown ?? (e => setupMoveUpEvents(this, e, returnFalse, emptyFunction, undoBatch(e => click!(e))))} >
<FontAwesomeIcon icon={icon as any} />
</div>
</Tooltip>);
@@ -453,6 +452,7 @@ export class DocumentDecorations extends React.Component<{ boundsLeft: number, b
const borderRadiusDraggerWidth = 15;
bounds.r = Math.max(bounds.x, Math.max(leftBounds, Math.min(window.innerWidth, bounds.r + borderRadiusDraggerWidth + this._resizeBorderWidth / 2) - this._resizeBorderWidth / 2 - borderRadiusDraggerWidth));
bounds.b = Math.max(bounds.y, Math.max(topBounds, Math.min(window.innerHeight, bounds.b + this._resizeBorderWidth / 2 + this._linkBoxHeight) - this._resizeBorderWidth / 2 - this._linkBoxHeight));
+
const useRotation = seldoc.rootDoc.type === DocumentType.INK;
return (<div className="documentDecorations" style={{ background: CurrentUserUtils.ActiveDashboard?.darkScheme ? "dimgray" : "" }} >
diff --git a/src/client/views/EditableView.scss b/src/client/views/EditableView.scss
index 1aebedf2e..ed7ec9dc1 100644
--- a/src/client/views/EditableView.scss
+++ b/src/client/views/EditableView.scss
@@ -5,6 +5,7 @@
hyphens: auto;
overflow: hidden;
min-width: 20;
+ text-overflow: ellipsis;
}
.editableView-container-editing-oneLine {
diff --git a/src/client/views/EditableView.tsx b/src/client/views/EditableView.tsx
index 03d9efff3..d7707a6fe 100644
--- a/src/client/views/EditableView.tsx
+++ b/src/client/views/EditableView.tsx
@@ -155,6 +155,8 @@ export class EditableView extends React.Component<EditableProps> {
return wasFocused !== this._editing;
}
+
+
renderEditor() {
return this.props.autosuggestProps
? <Autosuggest
@@ -197,7 +199,7 @@ export class EditableView extends React.Component<EditableProps> {
setTimeout(() => this.props.autosuggestProps?.resetValue());
return this.props.contents instanceof ObjectField ? (null) :
<div className={`editableView-container-editing${this.props.oneLine ? "-oneLine" : ""}`} ref={this._ref}
- style={{ display: this.props.display, textOverflow: this.props.overflow, minHeight: "17px", whiteSpace: "nowrap", height: this.props.height || "auto", maxHeight: this.props.maxHeight }}
+ style={{ display: this.props.display, textOverflow: this.props.overflow, minHeight: "10px", whiteSpace: "nowrap", height: this.props.height || "auto", maxHeight: this.props.maxHeight }}
onClick={this.onClick} placeholder={this.props.placeholder}>
<span style={{ fontStyle: this.props.fontStyle, fontSize: this.props.fontSize }} >
{this.props.contents ? this.props.contents?.valueOf() : this.props.placeholder?.valueOf()}
diff --git a/src/client/views/GestureOverlay.tsx b/src/client/views/GestureOverlay.tsx
index bbf21f22c..6ccbd3fd7 100644
--- a/src/client/views/GestureOverlay.tsx
+++ b/src/client/views/GestureOverlay.tsx
@@ -14,6 +14,7 @@ import { DocUtils } from "../documents/Documents";
import { CurrentUserUtils } from "../util/CurrentUserUtils";
import { InteractionUtils } from "../util/InteractionUtils";
import { Scripting } from "../util/Scripting";
+import { SelectionManager } from "../util/SelectionManager";
import { Transform } from "../util/Transform";
import { CollectionFreeFormViewChrome } from "./collections/CollectionMenu";
import "./GestureOverlay.scss";
@@ -23,7 +24,6 @@ import { RadialMenu } from "./nodes/RadialMenu";
import HorizontalPalette from "./Palette";
import { Touchable } from "./Touchable";
import TouchScrollableMenu, { TouchScrollableMenuItem } from "./TouchScrollableMenu";
-import { SelectionManager } from "../util/SelectionManager";
@observer
export class GestureOverlay extends Touchable {
@@ -31,7 +31,7 @@ export class GestureOverlay extends Touchable {
@observable public InkShape: string = "";
@observable public SavedColor?: string;
- @observable public SavedWidth?: string;
+ @observable public SavedWidth?: number;
@observable public Tool: ToolglassTools = ToolglassTools.None;
@observable private _thumbX?: number;
@@ -494,6 +494,7 @@ export class GestureOverlay extends Touchable {
if (InteractionUtils.IsType(e, InteractionUtils.PENTYPE) || [InkTool.Highlighter, InkTool.Pen].includes(CurrentUserUtils.SelectedTool)) {
this._points.push({ X: e.clientX, Y: e.clientY });
setupMoveUpEvents(this, e, this.onPointerMove, this.onPointerUp, emptyFunction);
+ // if (CurrentUserUtils.SelectedTool === InkTool.Highlighter) SetActiveInkColor("rgba(245, 230, 95, 0.75)");
}
}
@@ -588,8 +589,9 @@ export class GestureOverlay extends Touchable {
this.makePolygon(this.InkShape, false);
this.dispatchGesture(GestureUtils.Gestures.Stroke);
this._points = [];
- if (!CollectionFreeFormViewChrome.Instance._keepPrimitiveMode) {
+ if (!CollectionFreeFormViewChrome.Instance?._keepPrimitiveMode) {
this.InkShape = "";
+ Doc.UserDoc().activeInkTool = InkTool.None;
}
}
// if we're not drawing in a toolglass try to recognize as gesture
@@ -687,25 +689,26 @@ export class GestureOverlay extends Touchable {
case "rectangle":
this._points.push({ X: left, Y: top });
this._points.push({ X: left, Y: top });
-
this._points.push({ X: right, Y: top });
this._points.push({ X: right, Y: top });
+
this._points.push({ X: right, Y: top });
this._points.push({ X: right, Y: top });
-
this._points.push({ X: right, Y: bottom });
this._points.push({ X: right, Y: bottom });
+
this._points.push({ X: right, Y: bottom });
this._points.push({ X: right, Y: bottom });
-
this._points.push({ X: left, Y: bottom });
this._points.push({ X: left, Y: bottom });
+
this._points.push({ X: left, Y: bottom });
this._points.push({ X: left, Y: bottom });
-
this._points.push({ X: left, Y: top });
this._points.push({ X: left, Y: top });
+
break;
+
case "triangle":
this._points.push({ X: left, Y: bottom });
this._points.push({ X: left, Y: bottom });
@@ -733,12 +736,8 @@ export class GestureOverlay extends Touchable {
const centerX = (Math.max(left, right) + Math.min(left, right)) / 2;
const centerY = (Math.max(top, bottom) + Math.min(top, bottom)) / 2;
const radius = Math.max(centerX - Math.min(left, right), centerY - Math.min(top, bottom));
- // Dividing the circle into four equal sections, and fitting each section to a cubic Bézier curve.
- this._points.push({ X: centerX - radius, Y: centerY });
- this._points.push({ X: centerX - radius, Y: centerY + (c * radius) });
- this._points.push({ X: centerX - (c * radius), Y: centerY + radius });
- this._points.push({ X: centerX, Y: centerY + radius });
+ // Dividing the circle into four equal sections, and fitting each section to a cubic Bézier curve.
this._points.push({ X: centerX, Y: centerY + radius });
this._points.push({ X: centerX + (c * radius), Y: centerY + radius });
this._points.push({ X: centerX + radius, Y: centerY + (c * radius) });
@@ -754,6 +753,11 @@ export class GestureOverlay extends Touchable {
this._points.push({ X: centerX - radius, Y: centerY - (c * radius) });
this._points.push({ X: centerX - radius, Y: centerY });
+ this._points.push({ X: centerX - radius, Y: centerY });
+ this._points.push({ X: centerX - radius, Y: centerY + (c * radius) });
+ this._points.push({ X: centerX - (c * radius), Y: centerY + radius });
+ this._points.push({ X: centerX, Y: centerY + radius });
+
break;
case "line":
@@ -842,12 +846,12 @@ export class GestureOverlay extends Touchable {
return <svg key={i} width={b.width} height={b.height} style={{ transform: `translate(${b.left}px, ${b.top}px)`, pointerEvents: "none", position: "absolute", zIndex: 30000, overflow: "visible" }}>
{InteractionUtils.CreatePolyline(l, b.left, b.top, ActiveInkColor(), width, width,
ActiveInkBezierApprox(), ActiveFillColor(), ActiveArrowStart(), ActiveArrowEnd(),
- ActiveDash(), 1, 1, this.InkShape, "none", false, false)}
+ ActiveDash(), 1, 1, this.InkShape, "none", 1.0, false)}
</svg>;
}),
this._points.length <= 1 ? (null) : <svg key="svg" width={B.width} height={B.height}
style={{ transform: `translate(${B.left}px, ${B.top}px)`, pointerEvents: "none", position: "absolute", zIndex: 30000, overflow: "visible" }}>
- {InteractionUtils.CreatePolyline(this._points.map(p => ({ X: p.X, Y: p.Y - (rect?.y || 0) })), B.left, B.top, ActiveInkColor(), width, width, ActiveInkBezierApprox(), ActiveFillColor(), ActiveArrowStart(), ActiveArrowEnd(), ActiveDash(), 1, 1, this.InkShape, "none", false, false)}
+ {InteractionUtils.CreatePolyline(this._points.map(p => ({ X: p.X, Y: p.Y - (rect?.y || 0) })), B.left, B.top, ActiveInkColor(), width, width, ActiveInkBezierApprox(), ActiveFillColor(), ActiveArrowStart(), ActiveArrowEnd(), ActiveDash(), 1, 1, this.InkShape, "none", 1.0, false)}
</svg>]
];
}
@@ -952,7 +956,7 @@ Scripting.addGlobal(function setPen(width: any, color: any, fill: any, arrowStar
Scripting.addGlobal(function resetPen() {
runInAction(() => {
SetActiveInkColor(GestureOverlay.Instance.SavedColor ?? "rgb(0, 0, 0)");
- SetActiveInkWidth(GestureOverlay.Instance.SavedWidth ?? "2");
+ SetActiveInkWidth(GestureOverlay.Instance.SavedWidth?.toString() ?? "2");
});
}, "resets the pen tool");
Scripting.addGlobal(function createText(text: any, x: any, y: any) {
diff --git a/src/client/views/GlobalKeyHandler.ts b/src/client/views/GlobalKeyHandler.ts
index 0127d3080..f66c9c788 100644
--- a/src/client/views/GlobalKeyHandler.ts
+++ b/src/client/views/GlobalKeyHandler.ts
@@ -229,8 +229,8 @@ export class KeyManager {
}
break;
case "o":
- const target = SelectionManager.Views()[0];
- target && CollectionDockingView.OpenFullScreen(target.props.Document);
+ const target = SelectionManager.Docs().lastElement();
+ target && CollectionDockingView.OpenFullScreen(target);
break;
case "r":
preventDefault = false;
diff --git a/src/client/views/InkControls.tsx b/src/client/views/InkControls.tsx
index 6213a4075..4df7ee813 100644
--- a/src/client/views/InkControls.tsx
+++ b/src/client/views/InkControls.tsx
@@ -1,20 +1,22 @@
import React = require("react");
-import { observable, action } from "mobx";
+import { action, observable } from "mobx";
import { observer } from "mobx-react";
-import { InkStrokeProperties } from "./InkStrokeProperties";
-import { setupMoveUpEvents, emptyFunction } from "../../Utils";
-import { UndoManager } from "../util/UndoManager";
-import { ControlPoint, InkData, PointData } from "../../fields/InkField";
-import { Transform } from "../util/Transform";
-import { Colors } from "./global/globalEnums";
import { Doc } from "../../fields/Doc";
+import { ControlPoint, InkData, PointData } from "../../fields/InkField";
import { listSpec } from "../../fields/Schema";
import { Cast } from "../../fields/Types";
+import { setupMoveUpEvents } from "../../Utils";
+import { Transform } from "../util/Transform";
+import { UndoManager } from "../util/UndoManager";
+import { Colors } from "./global/globalEnums";
+import { InkStrokeProperties } from "./InkStrokeProperties";
export interface InkControlProps {
inkDoc: Doc;
- data: InkData;
- addedPoints: PointData[];
+ inkCtrlPoints: InkData;
+ screenCtrlPoints: InkData;
+ inkStrokeSamplePts: PointData[];
+ screenStrokeSamplePoints: PointData[];
format: number[];
ScreenToLocalTransform: () => Transform;
}
@@ -87,56 +89,60 @@ export class InkControls extends React.Component<InkControlProps> {
if (!formatInstance) return (null);
// Accessing the current ink's data and extracting all control points.
- const data = this.props.data;
- const controlPoints: ControlPoint[] = [];
- if (data.length >= 4) {
- for (let i = 0; i <= data.length - 4; i += 4) {
- controlPoints.push({ X: data[i].X, Y: data[i].Y, I: i });
- controlPoints.push({ X: data[i + 3].X, Y: data[i + 3].Y, I: i + 3 });
- }
+ const scrData = this.props.screenCtrlPoints;
+ const sreenCtrlPoints: ControlPoint[] = [];
+ for (let i = 0; i <= scrData.length - 4; i += 4) {
+ sreenCtrlPoints.push({ X: scrData[i].X, Y: scrData[i].Y, I: i });
+ sreenCtrlPoints.push({ X: scrData[i + 3].X, Y: scrData[i + 3].Y, I: i + 3 });
+ }
+
+ const inkData = this.props.inkCtrlPoints;
+ const inkCtrlPts: ControlPoint[] = [];
+ for (let i = 0; i <= inkData.length - 4; i += 4) {
+ inkCtrlPts.push({ X: inkData[i].X, Y: inkData[i].Y, I: i });
+ inkCtrlPts.push({ X: inkData[i + 3].X, Y: inkData[i + 3].Y, I: i + 3 });
}
- const addedPoints = this.props.addedPoints;
- const [left, top, scaleX, scaleY, strokeWidth] = this.props.format;
- return (
- <>
- {addedPoints.map((pts, i) =>
- <svg height="10" width="10" key={`add${i}`}>
- <circle
- cx={(pts.X - left - strokeWidth / 2) * scaleX + strokeWidth / 2}
- cy={(pts.Y - top - strokeWidth / 2) * scaleY + strokeWidth / 2}
- r={strokeWidth / 1.5}
- stroke={this._overAddPoint === i ? Colors.MEDIUM_BLUE : "transparent"}
- strokeWidth={0} fill={this._overAddPoint === i ? Colors.MEDIUM_BLUE : "transparent"}
- onPointerDown={() => { formatInstance?.addPoints(pts.X, pts.Y, addedPoints, i, controlPoints); }}
- onMouseEnter={() => this.onEnterAddPoint(i)}
- onMouseLeave={this.onLeaveAddPoint}
- pointerEvents="all"
- cursor="all-scroll"
- />
- </svg>
- )}
- {controlPoints.map((control, i) =>
- <svg height="10" width="10" key={`ctrl${i}`}>
- <rect
- x={(control.X - left - strokeWidth / 2) * scaleX}
- y={(control.Y - top - strokeWidth / 2) * scaleY}
- height={this._overControl === i ? strokeWidth * 1.5 : strokeWidth}
- width={this._overControl === i ? strokeWidth * 1.5 : strokeWidth}
- strokeWidth={strokeWidth / 6} stroke={Colors.MEDIUM_BLUE}
- fill={formatInstance?._currentPoint === control.I ? Colors.MEDIUM_BLUE : Colors.WHITE}
- onPointerDown={(e) => {
- this.changeCurrPoint(control.I);
- this.onControlDown(e, control.I);
- }}
- onMouseEnter={() => this.onEnterControl(i)}
- onMouseLeave={this.onLeaveControl}
- pointerEvents="all"
- cursor="default"
- />
- </svg>
- )}
- </>
+ const [left, top, scaleX, scaleY, strokeWidth, screenSpaceLineWidth] = this.props.format;
+ const rectHdlSize = (i: number) => this._overControl === i ? screenSpaceLineWidth * 6 : screenSpaceLineWidth * 4;
+ return (<svg>
+ {/* should really have just one circle here that represents the neqraest point on the stroke to the users hover point.
+ This points should be passed as a prop from InkingStroke's UI which should set it in its onPointerOver method */}
+ {this.props.screenStrokeSamplePoints.map((pts, i) =>
+ <circle key={i}
+ cx={(pts.X - left - strokeWidth / 2) * scaleX + strokeWidth / 2}
+ cy={(pts.Y - top - strokeWidth / 2) * scaleY + strokeWidth / 2}
+ r={screenSpaceLineWidth * 4}
+ fill={this._overAddPoint === i ? "#00007777" : "transparent"}
+ stroke={this._overAddPoint === i ? "#00007777" : "transparent"}
+ strokeWidth={0}
+ onPointerDown={() => formatInstance?.addPoints(this.props.inkStrokeSamplePts[i].X, this.props.inkStrokeSamplePts[i].Y, this.props.inkStrokeSamplePts, i, inkCtrlPts)}
+ onMouseEnter={() => this.onEnterAddPoint(i)}
+ onMouseLeave={this.onLeaveAddPoint}
+ pointerEvents="all"
+ cursor="all-scroll"
+ />
+ )}
+ {sreenCtrlPoints.map((control, i) =>
+ <rect key={i}
+ x={(control.X - left - strokeWidth / 2) * scaleX + strokeWidth / 2 - rectHdlSize(i) / 2}
+ y={(control.Y - top - strokeWidth / 2) * scaleY + strokeWidth / 2 - rectHdlSize(i) / 2}
+ height={rectHdlSize(i)}
+ width={rectHdlSize(i)}
+ strokeWidth={screenSpaceLineWidth / 2}
+ stroke={Colors.MEDIUM_BLUE}
+ fill={formatInstance?._currentPoint === control.I ? Colors.MEDIUM_BLUE : Colors.WHITE}
+ onPointerDown={(e) => {
+ this.changeCurrPoint(control.I);
+ this.onControlDown(e, control.I);
+ }}
+ onMouseEnter={() => this.onEnterControl(i)}
+ onMouseLeave={this.onLeaveControl}
+ pointerEvents="all"
+ cursor="default"
+ />
+ )}
+ </svg>
);
}
} \ No newline at end of file
diff --git a/src/client/views/InkHandles.tsx b/src/client/views/InkHandles.tsx
index 0b24c3c32..afe94cdfb 100644
--- a/src/client/views/InkHandles.tsx
+++ b/src/client/views/InkHandles.tsx
@@ -1,22 +1,20 @@
import React = require("react");
-import { observable, action } from "mobx";
+import { action } from "mobx";
import { observer } from "mobx-react";
-import { InkStrokeProperties } from "./InkStrokeProperties";
-import { setupMoveUpEvents, emptyFunction } from "../../Utils";
-import { UndoManager } from "../util/UndoManager";
-import { InkData, HandlePoint, HandleLine } from "../../fields/InkField";
-import { Transform } from "../util/Transform";
import { Doc } from "../../fields/Doc";
-import { listSpec } from "../../fields/Schema";
+import { HandleLine, HandlePoint, InkData } from "../../fields/InkField";
import { List } from "../../fields/List";
+import { listSpec } from "../../fields/Schema";
import { Cast } from "../../fields/Types";
+import { emptyFunction, setupMoveUpEvents } from "../../Utils";
+import { Transform } from "../util/Transform";
+import { UndoManager } from "../util/UndoManager";
import { Colors } from "./global/globalEnums";
-import { GestureOverlay } from "./GestureOverlay";
+import { InkStrokeProperties } from "./InkStrokeProperties";
export interface InkHandlesProps {
inkDoc: Doc;
data: InkData;
- shape?: string;
format: number[];
ScreenToLocalTransform: () => Transform;
}
@@ -70,7 +68,6 @@ export class InkHandles extends React.Component<InkHandlesProps> {
// Accessing the current ink's data and extracting all handle points and handle lines.
const data = this.props.data;
- const shape = this.props.shape;
const handlePoints: HandlePoint[] = [];
const handleLines: HandleLine[] = [];
if (data.length >= 4) {
@@ -85,7 +82,7 @@ export class InkHandles extends React.Component<InkHandlesProps> {
handleLines.push({ X1: data[i].X, Y1: data[i].Y, X2: data[i + 1].X, Y2: data[i + 1].Y, X3: data[i + 3].X, Y3: data[i + 3].Y, dot1: i + 1, dot2: i + 2 });
}
}
- const [left, top, scaleX, scaleY, strokeWidth] = this.props.format;
+ const [left, top, scaleX, scaleY, strokeWidth, screenSpaceLineWidth] = this.props.format;
return (
<>
@@ -94,7 +91,7 @@ export class InkHandles extends React.Component<InkHandlesProps> {
<circle
cx={(pts.X - left - strokeWidth / 2) * scaleX + strokeWidth / 2}
cy={(pts.Y - top - strokeWidth / 2) * scaleY + strokeWidth / 2}
- r={strokeWidth / 2}
+ r={screenSpaceLineWidth * 2}
strokeWidth={0}
fill={Colors.MEDIUM_BLUE}
onPointerDown={(e) => this.onHandleDown(e, pts.I)}
@@ -110,7 +107,7 @@ export class InkHandles extends React.Component<InkHandlesProps> {
x2={(pts.X2 - left - strokeWidth / 2) * scaleX + strokeWidth / 2}
y2={(pts.Y2 - top - strokeWidth / 2) * scaleY + strokeWidth / 2}
stroke={Colors.MEDIUM_BLUE}
- strokeWidth={strokeWidth / 4}
+ strokeWidth={screenSpaceLineWidth}
display={(pts.dot1 === formatInstance._currentPoint || pts.dot2 === formatInstance._currentPoint) ? "inherit" : "none"} />
<line
x1={(pts.X2 - left - strokeWidth / 2) * scaleX + strokeWidth / 2}
@@ -118,7 +115,7 @@ export class InkHandles extends React.Component<InkHandlesProps> {
x2={(pts.X3 - left - strokeWidth / 2) * scaleX + strokeWidth / 2}
y2={(pts.Y3 - top - strokeWidth / 2) * scaleY + strokeWidth / 2}
stroke={Colors.MEDIUM_BLUE}
- strokeWidth={strokeWidth / 4}
+ strokeWidth={screenSpaceLineWidth}
display={(pts.dot1 === formatInstance._currentPoint || pts.dot2 === formatInstance._currentPoint) ? "inherit" : "none"} />
</svg>)}
</>
diff --git a/src/client/views/InkStroke.scss b/src/client/views/InkStroke.scss
index 812a79bd5..53d27cd24 100644
--- a/src/client/views/InkStroke.scss
+++ b/src/client/views/InkStroke.scss
@@ -1,3 +1,17 @@
+.inkstroke-UI {
+ // transform-origin: top left;
+ position: absolute;
+ overflow: visible;
+ pointer-events: none;
+
+ svg:not(:root) {
+ overflow: visible !important;
+ position: absolute;
+ left:0;
+ top:0;
+ }
+}
+
.inkStroke {
mix-blend-mode: multiply;
stroke-linejoin: round;
diff --git a/src/client/views/InkStrokeProperties.ts b/src/client/views/InkStrokeProperties.ts
index d527b2a05..42190238e 100644
--- a/src/client/views/InkStrokeProperties.ts
+++ b/src/client/views/InkStrokeProperties.ts
@@ -1,13 +1,14 @@
-import { action, computed, observable } from "mobx";
+import { action, computed, observable, reaction } from "mobx";
import { Doc, DocListCast, Field, Opt } from "../../fields/Doc";
import { Document } from "../../fields/documentSchemas";
-import { InkField, InkData, PointData, ControlPoint } from "../../fields/InkField";
+import { InkField, InkData, PointData, ControlPoint, InkTool } from "../../fields/InkField";
import { List } from "../../fields/List";
import { listSpec } from "../../fields/Schema";
import { Cast, NumCast } from "../../fields/Types";
import { DocumentType } from "../documents/DocumentTypes";
import { SelectionManager } from "../util/SelectionManager";
import { undoBatch } from "../util/UndoManager";
+import { CurrentUserUtils } from "../util/CurrentUserUtils";
export class InkStrokeProperties {
static Instance: InkStrokeProperties | undefined;
@@ -18,6 +19,8 @@ export class InkStrokeProperties {
constructor() {
InkStrokeProperties.Instance = this;
+ reaction(() => this._controlButton, button => button && (CurrentUserUtils.SelectedTool = InkTool.None));
+ reaction(() => CurrentUserUtils.SelectedTool, tool => (tool !== InkTool.None) && (this._controlButton = false));
}
@computed get selectedInk() {
diff --git a/src/client/views/InkingStroke.tsx b/src/client/views/InkingStroke.tsx
index 5fc159f14..ca39bdaa1 100644
--- a/src/client/views/InkingStroke.tsx
+++ b/src/client/views/InkingStroke.tsx
@@ -1,26 +1,27 @@
import React = require("react");
-import { action, observable } from "mobx";
+import { action, IReactionDisposer, observable, reaction } from "mobx";
import { observer } from "mobx-react";
import { Doc } from "../../fields/Doc";
import { documentSchema } from "../../fields/documentSchemas";
import { InkData, InkField, InkTool } from "../../fields/InkField";
import { makeInterface } from "../../fields/Schema";
-import { Cast, StrCast } from "../../fields/Types";
+import { Cast, NumCast, StrCast } from "../../fields/Types";
import { TraceMobx } from "../../fields/util";
-import { setupMoveUpEvents, emptyFunction, returnFalse } from "../../Utils";
+import { emptyFunction, returnFalse, setupMoveUpEvents } from "../../Utils";
import { CognitiveServices } from "../cognitive_services/CognitiveServices";
+import { CurrentUserUtils } from "../util/CurrentUserUtils";
import { InteractionUtils } from "../util/InteractionUtils";
import { Scripting } from "../util/Scripting";
import { ContextMenu } from "./ContextMenu";
import { ViewBoxBaseComponent } from "./DocComponent";
-import "./InkStroke.scss";
-import { FieldView, FieldViewProps } from "./nodes/FieldView";
-import { InkStrokeProperties } from "./InkStrokeProperties";
-import { CurrentUserUtils } from "../util/CurrentUserUtils";
+import { Colors } from "./global/globalEnums";
import { InkControls } from "./InkControls";
import { InkHandles } from "./InkHandles";
-import { Colors } from "./global/globalEnums";
import { GestureOverlay } from "./GestureOverlay";
+import { isThisTypeNode } from "typescript";
+import "./InkStroke.scss";
+import { InkStrokeProperties } from "./InkStrokeProperties";
+import { FieldView, FieldViewProps } from "./nodes/FieldView";
type InkDocument = makeInterface<[typeof documentSchema]>;
const InkDocument = makeInterface(documentSchema);
@@ -29,11 +30,23 @@ const InkDocument = makeInterface(documentSchema);
export class InkingStroke extends ViewBoxBaseComponent<FieldViewProps, InkDocument>(InkDocument) {
static readonly MaskDim = 50000;
@observable private _properties?: InkStrokeProperties;
+ _handledClick = false; // flag denoting whether ink stroke has handled a psuedo-click onPointerUp so that the real onClick event can be stopPropagated
+ _selDisposer: IReactionDisposer | undefined;
constructor(props: FieldViewProps & InkDocument) {
super(props);
this._properties = InkStrokeProperties.Instance;
+ // this._previousColor = ActiveInkColor();
+ }
+
+ componentDidMount() {
+ this.props.setContentView?.(this);
+ this._selDisposer = reaction(() => this.props.isSelected(), // react to stroke being deselected by turning off ink handles
+ selected => !selected && this.toggleControlButton());
+ }
+ componentWillUnmount() {
+ this._selDisposer?.();
}
public static LayoutString(fieldStr: string) {
@@ -53,14 +66,26 @@ export class InkingStroke extends ViewBoxBaseComponent<FieldViewProps, InkDocume
inkDoc._stayInCollection = inkDoc.isInkMask ? true : undefined;
});
+ onClick = (e: React.MouseEvent) => {
+ if (this._handledClick) {
+ e.stopPropagation(); //stop the event so that docView won't open the lightbox
+ }
+ }
+
/**
* Handles the movement of the entire ink object when the user clicks and drags.
*/
onPointerDown = (e: React.PointerEvent) => {
+ this._handledClick = false;
if (this.props.isSelected(true)) {
setupMoveUpEvents(this, e, returnFalse, emptyFunction,
- action((e: PointerEvent, doubleTap: boolean | undefined) =>
- doubleTap && this._properties && (this._properties._controlButton = true))
+ action((e: PointerEvent, doubleTap: boolean | undefined) => {
+ doubleTap = doubleTap || this.props.docViewPath().lastElement()?.docView?._pendingDoubleClick;
+ if (doubleTap && this._properties) {
+ this._properties._controlButton = true;
+ this._handledClick = true; // mark the double-click pseudo pointerevent so we can block the real mouse event from propagating to DocumentView
+ }
+ }), this._properties?._controlButton, this._properties?._controlButton
);
}
}
@@ -75,52 +100,115 @@ export class InkingStroke extends ViewBoxBaseComponent<FieldViewProps, InkDocume
}
}
+ @action
+ checkHighlighter = () => {
+ if (CurrentUserUtils.SelectedTool === InkTool.Highlighter) {
+ // this._previousColor = ActiveInkColor();
+ SetActiveInkColor("rgba(245, 230, 95, 0.75)");
+ }
+ // } else {
+ // SetActiveInkColor(this._previousColor);
+ // }
+ }
+
+ inkScaledData = () => {
+ const inkData: InkData = Cast(this.dataDoc[this.fieldKey], InkField)?.inkData ?? [];
+ const inkStrokeWidth = NumCast(this.rootDoc.strokeWidth, 1);
+ const inkTop = Math.min(...inkData.map(p => p.Y)) - inkStrokeWidth / 2;
+ const inkBottom = Math.max(...inkData.map(p => p.Y)) + inkStrokeWidth / 2;
+ const inkLeft = Math.min(...inkData.map(p => p.X)) - inkStrokeWidth / 2;
+ const inkRight = Math.max(...inkData.map(p => p.X)) + inkStrokeWidth / 2;
+ const inkWidth = Math.max(1, inkRight - inkLeft);
+ const inkHeight = Math.max(1, inkBottom - inkTop);
+ return {
+ inkData,
+ inkStrokeWidth,
+ inkTop,
+ inkLeft,
+ inkWidth,
+ inkHeight,
+ inkScaleX: inkHeight === inkStrokeWidth ? 1 : (this.props.PanelWidth() - inkStrokeWidth) / (inkWidth - inkStrokeWidth),
+ inkScaleY: inkWidth === inkStrokeWidth ? 1 : (this.props.PanelHeight() - inkStrokeWidth) / (inkHeight - inkStrokeWidth)
+ };
+ }
+
+ componentUI = (boundsLeft: number, boundsTop: number) => {
+ const inkDoc = this.props.Document;
+ const screenSpaceCenterlineStrokeWidth = 3; // the width of the blue line widget that shows the centerline of the ink stroke
+ const { inkData, inkScaleX, inkScaleY, inkStrokeWidth, inkTop, inkLeft } = this.inkScaledData();
+
+ const screenInkWidth = this.props.ScreenToLocalTransform().inverse().transformDirection(inkStrokeWidth, inkStrokeWidth);
+ const screenPts = inkData.map(point => this.props.ScreenToLocalTransform().inverse().transformPoint(point.X, point.Y)).map(p => ({ X: p[0], Y: p[1] }));
+ const screenTop = Math.min(...screenPts.map(p => p.Y)) - screenInkWidth[0] / 2;
+ const screenLeft = Math.min(...screenPts.map(p => p.X)) - screenInkWidth[0] / 2;
+ const screenOrigin = this.props.ScreenToLocalTransform().inverse().transformPoint(0, 0);
+
+ const screenSpaceSamplePoints = InteractionUtils.CreatePoints(screenPts, screenLeft, screenTop, StrCast(inkDoc.strokeColor, "none"), screenInkWidth[0], screenSpaceCenterlineStrokeWidth,
+ StrCast(this.layoutDoc.strokeBezier), StrCast(this.layoutDoc.fillColor, "none"), StrCast(this.layoutDoc.strokeStartMarker),
+ StrCast(this.layoutDoc.strokeEndMarker), StrCast(this.layoutDoc.strokeDash), inkScaleX, inkScaleY, "", "none", this.props.isSelected() && inkStrokeWidth <= 5, false);
+ const inkSpaceSamplePoints = InteractionUtils.CreatePoints(inkData, inkLeft, inkTop, StrCast(inkDoc.strokeColor, "none"), inkStrokeWidth, screenSpaceCenterlineStrokeWidth,
+ StrCast(this.layoutDoc.strokeBezier), StrCast(this.layoutDoc.fillColor, "none"), StrCast(this.layoutDoc.strokeStartMarker),
+ StrCast(this.layoutDoc.strokeEndMarker), StrCast(this.layoutDoc.strokeDash), 1, 1, "", "none", this.props.isSelected() && inkStrokeWidth <= 5, false);
+
+ return <div className="inkstroke-UI" style={{
+ left: screenOrigin[0],
+ top: screenOrigin[1],
+ clip: `rect(${boundsTop - screenOrigin[1]}px, 10000px, 10000px, ${boundsLeft - screenOrigin[0]}px)`
+ }} >
+ {InteractionUtils.CreatePolyline(screenPts, screenLeft, screenTop, Colors.MEDIUM_BLUE, screenInkWidth[0], screenSpaceCenterlineStrokeWidth,
+ StrCast(inkDoc.strokeBezier), StrCast(inkDoc.fillColor, "none"),
+ StrCast(inkDoc.strokeStartMarker), StrCast(inkDoc.strokeEndMarker),
+ StrCast(inkDoc.strokeDash), inkScaleX, inkScaleY, "", "none", 1.0, false)}
+ {this._properties?._controlButton ?
+ <>
+ <InkControls
+ inkDoc={inkDoc}
+ inkCtrlPoints={inkData}
+ screenCtrlPoints={screenPts}
+ inkStrokeSamplePts={inkSpaceSamplePoints}
+ screenStrokeSamplePoints={screenSpaceSamplePoints}
+ format={[screenLeft, screenTop, inkScaleX, inkScaleY, screenInkWidth[0], screenSpaceCenterlineStrokeWidth]}
+ ScreenToLocalTransform={this.props.ScreenToLocalTransform} />
+ <InkHandles
+ inkDoc={inkDoc}
+ data={screenPts}
+ format={[screenLeft, screenTop, inkScaleX, inkScaleY, screenInkWidth[0], screenSpaceCenterlineStrokeWidth]}
+ ScreenToLocalTransform={this.props.ScreenToLocalTransform} />
+ </> : ""}
+ </div>;
+ }
+
render() {
TraceMobx();
- this.toggleControlButton();
// Extracting the ink data and formatting information of the current ink stroke.
- // console.log(InkingStroke.InkShape);
- const InkShape = GestureOverlay.Instance.InkShape;
- const data: InkData = Cast(this.dataDoc[this.fieldKey], InkField)?.inkData ?? [];
const inkDoc: Doc = this.layoutDoc;
- const strokeWidth = Number(this.layoutDoc.strokeWidth);
- const lineTop = Math.min(...data.map(p => p.Y));
- const lineBottom = Math.max(...data.map(p => p.Y));
- const lineLeft = Math.min(...data.map(p => p.X));
- const lineRight = Math.max(...data.map(p => p.X));
- const left = lineLeft - strokeWidth / 2;
- const top = lineTop - strokeWidth / 2;
- const right = lineRight + strokeWidth / 2;
- const bottom = lineBottom + strokeWidth / 2;
- const width = Math.max(1, right - left);
- const height = Math.max(1, bottom - top);
- const scaleX = width === strokeWidth ? 1 : (this.props.PanelWidth() - strokeWidth) / (width - strokeWidth);
- const scaleY = height === strokeWidth ? 1 : (this.props.PanelHeight() - strokeWidth) / (height - strokeWidth);
+
+ const { inkData, inkStrokeWidth, inkLeft, inkTop, inkScaleX, inkScaleY, inkWidth, inkHeight } = this.inkScaledData();
+
const strokeColor = StrCast(this.layoutDoc.color, "");
- const dotsize = Math.max(width * scaleX, height * scaleY) / 40;
+ const dotsize = Math.max(inkWidth * inkScaleX, inkHeight * inkScaleY) / 40;
// Visually renders the polygonal line made by the user.
- const inkLine = InteractionUtils.CreatePolyline(data, left, top, strokeColor, strokeWidth, strokeWidth, StrCast(this.layoutDoc.strokeBezier), StrCast(this.layoutDoc.fillColor, "none"), StrCast(this.layoutDoc.strokeStartMarker),
- StrCast(this.layoutDoc.strokeEndMarker), StrCast(this.layoutDoc.strokeDash), scaleX, scaleY, "", "none", this.props.isSelected() && strokeWidth <= 5 && lineBottom - lineTop > 1 && lineRight - lineLeft > 1, false);
+ const inkLine = InteractionUtils.CreatePolyline(inkData, inkLeft, inkTop, strokeColor, inkStrokeWidth, inkStrokeWidth, StrCast(this.layoutDoc.strokeBezier), StrCast(this.layoutDoc.fillColor, "none"), StrCast(this.layoutDoc.strokeStartMarker),
+ StrCast(this.layoutDoc.strokeEndMarker), StrCast(this.layoutDoc.strokeDash), inkScaleX, inkScaleY, "", "none", 1.0, false);
// Thin blue line indicating that the current ink stroke is selected.
- const selectedLine = InteractionUtils.CreatePolyline(data, left, top, Colors.MEDIUM_BLUE, strokeWidth, strokeWidth / 6, StrCast(this.layoutDoc.strokeBezier), StrCast(this.layoutDoc.fillColor, "none"),
- StrCast(this.layoutDoc.strokeStartMarker), StrCast(this.layoutDoc.strokeEndMarker), StrCast(this.layoutDoc.strokeDash), scaleX, scaleY, "", "none", this.props.isSelected() && strokeWidth <= 5 && lineBottom - lineTop > 1 && lineRight - lineLeft > 1, false);
+ // const selectedLine = InteractionUtils.CreatePolyline(data, left, top, Colors.MEDIUM_BLUE, strokeWidth, strokeWidth / 6, StrCast(this.layoutDoc.strokeBezier), StrCast(this.layoutDoc.fillColor, "none"),
+ // StrCast(this.layoutDoc.strokeStartMarker), StrCast(this.layoutDoc.strokeEndMarker), StrCast(this.layoutDoc.strokeDash), scaleX, scaleY, "", "none", 1.0, false);
// Invisible polygonal line that enables the ink to be selected by the user.
- const clickableLine = InteractionUtils.CreatePolyline(data, left, top, "transparent", strokeWidth, strokeWidth + 15, StrCast(this.layoutDoc.strokeBezier),
- StrCast(this.layoutDoc.fillColor, "none"), "none", "none", undefined, scaleX, scaleY, "", this.props.layerProvider?.(this.props.Document) === false ? "none" : "visiblepainted", false, true);
+ const clickableLine = InteractionUtils.CreatePolyline(inkData, inkLeft, inkTop, "transparent", inkStrokeWidth, inkStrokeWidth + 15, StrCast(this.layoutDoc.strokeBezier),
+ StrCast(this.layoutDoc.fillColor, "none"), "none", "none", undefined, inkScaleX, inkScaleY, "", this.props.layerProvider?.(this.props.Document) === false ? "none" : "visiblepainted", 0.0, true);
// Set of points rendered upon the ink that can be added if a user clicks on one.
- const addedPoints = InteractionUtils.CreatePoints(data, left, top, strokeColor, strokeWidth, strokeWidth, StrCast(this.layoutDoc.strokeBezier), StrCast(this.layoutDoc.fillColor, "none"), StrCast(this.layoutDoc.strokeStartMarker),
- StrCast(this.layoutDoc.strokeEndMarker), StrCast(this.layoutDoc.strokeDash), scaleX, scaleY, "", "none", this.props.isSelected() && strokeWidth <= 5, false);
return (
<svg className="inkStroke"
style={{
- pointerEvents: this.props.Document.isInkMask && this.props.layerProvider?.(this.props.Document) !== false ? "all" : "none",
+ pointerEvents: "none",
transform: this.props.Document.isInkMask ? `translate(${InkingStroke.MaskDim / 2}px, ${InkingStroke.MaskDim / 2}px)` : undefined,
mixBlendMode: this.layoutDoc.tool === InkTool.Highlighter ? "multiply" : "unset",
overflow: "visible",
}}
onPointerDown={this.onPointerDown}
+ onClick={this.onClick}
onContextMenu={() => {
const cm = ContextMenu.Instance;
if (cm) {
@@ -133,22 +221,21 @@ export class InkingStroke extends ViewBoxBaseComponent<FieldViewProps, InkDocume
{clickableLine}
{inkLine}
- {this.props.isSelected() ? selectedLine : ""}
- {this.props.isSelected() && this._properties?._controlButton ?
+ {/* {this.props.isSelected() ? selectedLine : ""} */}
+ {/* {this.props.isSelected() && this._properties?._controlButton ?
<>
<InkControls
inkDoc={inkDoc}
- data={data}
+ data={inkData}
addedPoints={addedPoints}
- format={[left, top, scaleX, scaleY, strokeWidth]}
+ format={[inkLeft, inkTop, inkScaleX, inkScaleY, inkStrokeWidth]}
ScreenToLocalTransform={this.props.ScreenToLocalTransform} />
<InkHandles
inkDoc={inkDoc}
- data={data}
- shape={InkShape}
- format={[left, top, scaleX, scaleY, strokeWidth]}
+ data={inkData}
+ format={[inkLeft, inkTop, inkScaleX, inkScaleY, inkStrokeWidth]}
ScreenToLocalTransform={this.props.ScreenToLocalTransform} />
- </> : ""}
+ </> : ""} */}
</svg>
);
}
@@ -168,23 +255,5 @@ export function ActiveFillColor(): string { return StrCast(ActiveInkPen()?.activ
export function ActiveArrowStart(): string { return StrCast(ActiveInkPen()?.activeArrowStart, ""); }
export function ActiveArrowEnd(): string { return StrCast(ActiveInkPen()?.activeArrowEnd, ""); }
export function ActiveDash(): string { return StrCast(ActiveInkPen()?.activeDash, "0"); }
-export function ActiveInkWidth(): string { return StrCast(ActiveInkPen()?.activeInkWidth, "1"); }
+export function ActiveInkWidth(): number { return Number(ActiveInkPen()?.activeInkWidth); }
export function ActiveInkBezierApprox(): string { return StrCast(ActiveInkPen()?.activeInkBezier); }
-Scripting.addGlobal(function activateBrush(pen: any, width: any, color: any, fill: any, arrowStart: any, arrowEnd: any, dash: any) {
- CurrentUserUtils.SelectedTool = pen ? InkTool.Highlighter : InkTool.None;
- SetActiveInkWidth(width);
- SetActiveInkColor(color);
- SetActiveFillColor(fill);
- SetActiveArrowStart(arrowStart);
- SetActiveArrowEnd(arrowEnd);
- SetActiveDash(dash);
-});
-Scripting.addGlobal(function activateEraser(pen: any) { return CurrentUserUtils.SelectedTool = pen ? InkTool.Eraser : InkTool.None; });
-Scripting.addGlobal(function activateStamp(pen: any) { return CurrentUserUtils.SelectedTool = pen ? InkTool.Stamp : InkTool.None; });
-Scripting.addGlobal(function deactivateInk() { return CurrentUserUtils.SelectedTool = InkTool.None; });
-Scripting.addGlobal(function setInkWidth(width: any) { return SetActiveInkWidth(width); });
-Scripting.addGlobal(function setInkColor(color: any) { return SetActiveInkColor(color); });
-Scripting.addGlobal(function setFillColor(fill: any) { return SetActiveFillColor(fill); });
-Scripting.addGlobal(function setActiveArrowStart(arrowStart: any) { return SetActiveArrowStart(arrowStart); });
-Scripting.addGlobal(function setActiveArrowEnd(arrowEnd: any) { return SetActiveArrowStart(arrowEnd); });
-Scripting.addGlobal(function setActiveDash(dash: any) { return SetActiveDash(dash); });
diff --git a/src/client/views/LightboxView.tsx b/src/client/views/LightboxView.tsx
index 88739fe91..ec30a6a5d 100644
--- a/src/client/views/LightboxView.tsx
+++ b/src/client/views/LightboxView.tsx
@@ -16,6 +16,7 @@ import { TabDocView } from './collections/TabDocView';
import "./LightboxView.scss";
import { DocumentView } from './nodes/DocumentView';
import { DefaultStyleProvider, wavyBorderPath } from './StyleProvider';
+import { CollectionMenu } from './collections/CollectionMenu';
interface LightboxViewProps {
PanelWidth: number;
@@ -213,6 +214,7 @@ export class LightboxView extends React.Component<LightboxViewProps> {
LightboxView.SetLightboxDoc(undefined);
}
}} >
+
<div className="lightboxView-contents" style={{
left: this.leftBorder,
top: this.topBorder,
@@ -220,6 +222,7 @@ export class LightboxView extends React.Component<LightboxViewProps> {
height: this.lightboxHeight(),
clipPath: `path('${Doc.UserDoc().renderStyle === "comic" ? wavyBorderPath(this.lightboxWidth(), this.lightboxHeight()) : undefined}')`
}}>
+ {/* <CollectionMenu /> TODO:glr This is where it would go*/}
<DocumentView ref={action((r: DocumentView | null) => {
LightboxView._docView = r !== null ? r : undefined;
r && setTimeout(action(() => {
diff --git a/src/client/views/MainView.scss b/src/client/views/MainView.scss
index d913f2069..4f871f5ec 100644
--- a/src/client/views/MainView.scss
+++ b/src/client/views/MainView.scss
@@ -15,8 +15,8 @@
margin-top: 10px;
}
-.mainContent-div-flyout,
-.mainContent-div {
+.mainView-dockingContent-flyout,
+.mainView-dockingContent {
position: relative;
width: 100%;
height: 100%;
@@ -99,7 +99,7 @@
}
}
-.mainView-mainContent {
+.mainView-dashboardArea {
width: 100%;
height: 100%;
position: absolute;
@@ -208,7 +208,7 @@
}
}
-.mainView-menuPanel {
+.mainView-leftMenuPanel {
min-width: var(--menuPanelWidth);
background-color: $dark-gray;
border-right: $standard-border;
@@ -220,65 +220,6 @@
::-webkit-scrollbar {
width: 0;
}
-
- .mainView-menuPanel-button {
- padding: 7px;
- padding-left: 7px;
- width: 100%;
- background: $dark-gray;
-
- .mainView-menuPanel-button-wrap {
- width: 45px;
- /* padding: 5px; */
- touch-action: none;
- background: $dark-gray;
- transform-origin: top left;
- /* margin-bottom: 5px; */
- margin-top: 5px;
- margin-right: 25px;
- border-radius: 8px;
-
- &:hover {
- background: $black;
- cursor: pointer;
- }
- }
- }
-
- .mainView-menuPanel-button-label {
- color: white;
- margin-left: px;
- margin-right: 4px;
- border-radius: 8px;
- width: 42px;
- position: relative;
- text-align: center;
- font-size: 8px;
- margin-top: 1px;
- letter-spacing: normal;
- padding: 3px;
- background-color: inherit;
- }
-
- .mainView-menuPanel-button-icon {
- width: auto;
- height: 35px;
- padding: 5px;
- }
-
- svg {
- width: 95% !important;
- height: 95%;
- }
-}
-
-.mainView-searchPanel {
- width: 100%;
- height: $searchpanel-height;
- background-color: black;
- color: white;
- text-align: center;
- vertical-align: middle;
}
.mainView-mainDiv {
diff --git a/src/client/views/MainView.tsx b/src/client/views/MainView.tsx
index f197f5f29..ea48a72b5 100644
--- a/src/client/views/MainView.tsx
+++ b/src/client/views/MainView.tsx
@@ -11,9 +11,10 @@ import * as ReactDOM from 'react-dom';
import { Doc, DocListCast, Opt } from '../../fields/Doc';
import { List } from '../../fields/List';
import { PrefetchProxy } from '../../fields/Proxy';
+import { ScriptField } from '../../fields/ScriptField';
import { BoolCast, PromiseValue, StrCast } from '../../fields/Types';
import { TraceMobx } from '../../fields/util';
-import { emptyFunction, returnEmptyDoclist, returnEmptyFilter, returnFalse, returnTrue, setupMoveUpEvents, simulateMouseClick, Utils } from '../../Utils';
+import { emptyFunction, returnEmptyDoclist, returnEmptyFilter, returnFalse, returnTrue, returnZero, setupMoveUpEvents, simulateMouseClick, Utils } from '../../Utils';
import { GoogleAuthenticationManager } from '../apis/GoogleAuthenticationManager';
import { DocServer } from '../DocServer';
import { Docs, DocUtils } from '../documents/Documents';
@@ -32,15 +33,16 @@ import { Transform } from '../util/Transform';
import { TimelineMenu } from './animationtimeline/TimelineMenu';
import { CollectionDockingView } from './collections/CollectionDockingView';
import { MarqueeOptionsMenu } from './collections/collectionFreeForm/MarqueeOptionsMenu';
-import { CollectionLinearView } from './collections/CollectionLinearView';
+import { CollectionLinearView } from './collections/collectionLinear';
import { CollectionMenu } from './collections/CollectionMenu';
import { CollectionViewType } from './collections/CollectionView';
import "./collections/TreeView.scss";
+import { ComponentDecorations } from './ComponentDecorations';
import { ContextMenu } from './ContextMenu';
import { DictationOverlay } from './DictationOverlay';
import { DocumentDecorations } from './DocumentDecorations';
import { GestureOverlay } from './GestureOverlay';
-import { MENU_PANEL_WIDTH, SEARCH_PANEL_HEIGHT } from './global/globalCssVariables.scss';
+import { DASHBOARD_SELECTOR_HEIGHT, LEFT_MENU_WIDTH } from './global/globalCssVariables.scss';
import { Colors } from './global/globalEnums';
import { KeyManager } from './GlobalKeyHandler';
import { InkStrokeProperties } from './InkStrokeProperties';
@@ -48,9 +50,11 @@ import { LightboxView } from './LightboxView';
import { LinkMenu } from './linking/LinkMenu';
import "./MainView.scss";
import { AudioBox } from './nodes/AudioBox';
+import { ButtonType } from './nodes/button/FontIconBox';
import { DocumentLinksButton } from './nodes/DocumentLinksButton';
import { DocumentView } from './nodes/DocumentView';
import { FormattedTextBox } from './nodes/formattedText/FormattedTextBox';
+import { RichTextMenu } from './nodes/formattedText/RichTextMenu';
import { LinkDescriptionPopup } from './nodes/LinkDescriptionPopup';
import { LinkDocPreview } from './nodes/LinkDocPreview';
import { RadialMenu } from './nodes/RadialMenu';
@@ -72,21 +76,32 @@ export class MainView extends React.Component {
@observable public LastButton: Opt<Doc>;
@observable private _windowWidth: number = 0;
@observable private _windowHeight: number = 0;
- @observable private _panelWidth: number = 0;
- @observable private _panelHeight: number = 0;
+ @observable private _dashUIWidth: number = 0; // width of entire main dashboard region including left menu buttons and properties panel (but not including the dashboard selector button row)
+ @observable private _dashUIHeight: number = 0; // height of entire main dashboard region including top menu buttons
@observable private _panelContent: string = "none";
@observable private _sidebarContent: any = this.userDoc?.sidebar;
- @observable private _flyoutWidth: number = 0;
+ @observable private _leftMenuFlyoutWidth: number = 0;
- @computed private get topOffset() { return Number(SEARCH_PANEL_HEIGHT.replace("px", "")); } //TODO remove
- @computed private get leftOffset() { return this.menuPanelWidth() - 2; }
+ @computed private get dashboardTabHeight() { return 27; } // 27 comes form lm.config.defaultConfig.dimensions.headerHeight in goldenlayout.js
+ @computed private get topOfDashUI() { return Number(DASHBOARD_SELECTOR_HEIGHT.replace("px", "")); }
+ @computed private get topOfMainDoc() { return this.topOfDashUI + this.topMenuHeight(); }
+ @computed private get topOfMainDocContent() { return this.topOfMainDoc + this.dashboardTabHeight; }
+ @computed private get leftScreenOffsetOfMainDocView() { return this.leftMenuWidth() - 2; }
@computed private get userDoc() { return Doc.UserDoc(); }
@computed private get darkScheme() { return BoolCast(CurrentUserUtils.ActiveDashboard?.darkScheme); }
@computed private get mainContainer() { return this.userDoc ? CurrentUserUtils.ActiveDashboard : CurrentUserUtils.GuestDashboard; }
- @computed public get mainFreeform(): Opt<Doc> { return (docs => (docs && docs.length > 1) ? docs[1] : undefined)(DocListCast(this.mainContainer!.data)); }
-
- menuPanelWidth = () => Number(MENU_PANEL_WIDTH.replace("px", ""));
- propertiesWidth = () => Math.max(0, Math.min(this._panelWidth - 50, CurrentUserUtils.propertiesWidth || 0));
+ @computed public get mainFreeform(): Opt<Doc> { return (docs => (docs?.length > 1) ? docs[1] : undefined)(DocListCast(this.mainContainer!.data)); }
+
+ topMenuHeight = () => 35;
+ topMenuWidth = returnZero; // value is ignored ...
+ leftMenuWidth = () => Number(LEFT_MENU_WIDTH.replace("px", ""));
+ leftMenuHeight = () => this._dashUIHeight;
+ leftMenuFlyoutWidth = () => this._leftMenuFlyoutWidth;
+ leftMenuFlyoutHeight = () => this._dashUIHeight;
+ propertiesWidth = () => Math.max(0, Math.min(this._dashUIWidth - 50, CurrentUserUtils.propertiesWidth || 0));
+ propertiesHeight = () => this._dashUIHeight;
+ mainDocViewWidth = () => this._dashUIWidth - this.propertiesWidth() - this.leftMenuWidth();
+ mainDocViewHeight = () => this._dashUIHeight - this.topMenuHeight();
componentDidMount() {
document.getElementById("root")?.addEventListener("scroll", e => ((ele) => ele.scrollLeft = ele.scrollTop = 0)(document.getElementById("root")!));
@@ -172,7 +187,7 @@ export class MainView extends React.Component {
fa.faArrowAltCircleDown, fa.faArrowAltCircleUp, fa.faArrowAltCircleLeft, fa.faArrowAltCircleRight, fa.faStopCircle, fa.faCheckCircle, fa.faGripVertical,
fa.faSortUp, fa.faSortDown, fa.faTable, fa.faTh, fa.faThList, fa.faProjectDiagram, fa.faSignature, fa.faColumns, fa.faChevronCircleUp, fa.faUpload, fa.faBorderAll,
fa.faBraille, fa.faChalkboard, fa.faPencilAlt, fa.faEyeSlash, fa.faSmile, fa.faIndent, fa.faOutdent, fa.faChartBar, fa.faBan, fa.faPhoneSlash, fa.faGripLines,
- fa.faSave, fa.faBookmark, fa.faMapMarkedAlt);
+ fa.faSave, fa.faBookmark, fa.faList, fa.faListOl, fa.faFolderPlus, fa.faLightbulb, fa.faBookOpen, fa.faMapMarkedAlt);
this.initAuthenticationRouters();
}
@@ -226,22 +241,39 @@ export class MainView extends React.Component {
@action
createNewPresentation = async () => {
- if (!await this.userDoc.myPresentations) {
- this.userDoc.myPresentations = new PrefetchProxy(Docs.Create.TreeDocument([], {
- title: "PRESENTATION TRAILS", childDontRegisterViews: true, _height: 100, _forceActive: true, boxShadow: "0 0", _lockedPosition: true, treeViewOpen: true, system: true
+ if (!await this.userDoc.myTrails) {
+ this.userDoc.myTrails = new PrefetchProxy(Docs.Create.TreeDocument([], {
+ title: "TRAILS", childDontRegisterViews: true, _height: 100, _forceActive: true, boxShadow: "0 0", _lockedPosition: true, treeViewOpen: true, system: true
}));
}
const pres = Docs.Create.PresDocument(new List<Doc>(),
- { title: "Untitled Presentation", _viewType: CollectionViewType.Stacking, _width: 400, _height: 500, targetDropAction: "alias", _chromeHidden: true, boxShadow: "0 0" });
+ { title: "Untitled Trail", _viewType: CollectionViewType.Stacking, _fitWidth: true, _width: 400, _height: 500, targetDropAction: "alias", _chromeHidden: true, boxShadow: "0 0" });
CollectionDockingView.AddSplit(pres, "right");
this.userDoc.activePresentation = pres;
- Doc.AddDocToList(this.userDoc.myPresentations as Doc, "data", pres);
+ Doc.AddDocToList(this.userDoc.myTrails as Doc, "data", pres);
}
- getPWidth = () => this._panelWidth - this.propertiesWidth();
- getPHeight = () => this._panelHeight - (CollectionMenu.Instance?.Pinned ? 35 : 0);
- getContentsHeight = () => this._panelHeight;
- getMenuPanelHeight = () => this._panelHeight + (CollectionMenu.Instance?.Pinned ? 35 : 0);
+ @action
+ createNewFolder = async () => {
+ if (!await this.userDoc.myFilesystem) {
+ this.userDoc.myFileOrphans = Docs.Create.TreeDocument([], { title: "Unfiled", _stayInCollection: true, system: true, isFolder: true });
+ const newFolder = ScriptField.MakeFunction(`createNewFolder()`, { scriptContext: "any" })!;
+ const newFolderButton: Doc = Docs.Create.FontIconDocument({
+ onClick: newFolder, _forceActive: true, toolTip: "New folder", _stayInCollection: true, _hideContextMenu: true, title: "New folder",
+ btnType: ButtonType.ClickButton, _width: 30, _height: 30, buttonText: "New folder", icon: "folder-plus", system: true
+ });
+ this.userDoc.myFilesystem = new PrefetchProxy(Docs.Create.TreeDocument([this.userDoc.myFileOrphans as Doc], {
+ title: "My Documents", _showTitle: "title", buttonMenu: true, buttonMenuDoc: newFolderButton, _height: 100,
+ treeViewHideTitle: true, _xMargin: 5, _yMargin: 5, _gridGap: 5, _forceActive: true, childDropAction: "alias",
+ treeViewTruncateTitleWidth: 150, ignoreClick: true,
+ isFolder: true, treeViewType: "fileSystem", childHideLinkButton: true,
+ _lockedPosition: true, boxShadow: "0 0", childDontRegisterViews: true, targetDropAction: "proto", system: true,
+ explainer: "This is your file manager where you can create folders to keep track of documents independently of your dashboard."
+ }));
+ }
+ const folder = Docs.Create.TreeDocument([], { title: "Untitled folder", _stayInCollection: true, isFolder: true });
+ Doc.AddDocToList(this.userDoc.myFilesystem as Doc, "data", folder);
+ }
@computed get mainDocView() {
return <DocumentView key="main"
@@ -257,8 +289,8 @@ export class MainView extends React.Component {
isContentActive={returnTrue}
removeDocument={undefined}
ScreenToLocalTransform={Transform.Identity}
- PanelWidth={this.getPWidth}
- PanelHeight={this.getPHeight}
+ PanelWidth={this.mainDocViewWidth}
+ PanelHeight={this.mainDocViewHeight}
focus={DocUtils.DefaultFocus}
whenChildContentsActiveChanged={emptyFunction}
bringToFront={emptyFunction}
@@ -272,13 +304,10 @@ export class MainView extends React.Component {
}
@computed get dockingContent() {
- return <div key="docking" className={`mainContent-div${this._flyoutWidth ? "-flyout" : ""}`} onDrop={e => { e.stopPropagation(); e.preventDefault(); }}
- // style={{ minWidth: `calc(100% - ${this._flyoutWidth + this.menuPanelWidth() + this.propertiesWidth()}px)`, width: `calc(100% - ${this._flyoutWidth + this.propertiesWidth()}px)` }}>
- // FIXME update with property panel width
+ return <div key="docking" className={`mainView-dockingContent${this._leftMenuFlyoutWidth ? "-flyout" : ""}`} onDrop={e => { e.stopPropagation(); e.preventDefault(); }}
style={{
- minWidth: `calc(100% - ${this._flyoutWidth + this.menuPanelWidth() + this.propertiesWidth()}px)`,
+ minWidth: `calc(100% - ${this._leftMenuFlyoutWidth + this.leftMenuWidth() + this.propertiesWidth()}px)`,
transform: LightboxView.LightboxDoc ? "scale(0.0001)" : undefined,
- //TODO:glr width: `calc(100% - ${this._flyoutWidth + this.menuPanelWidth() + this.propertiesWidth()}px)`
}}>
{!this.mainContainer ? (null) : this.mainDocView}
</div>;
@@ -287,22 +316,21 @@ export class MainView extends React.Component {
@action
onPropertiesPointerDown = (e: React.PointerEvent) => {
setupMoveUpEvents(this, e,
- action(e => (CurrentUserUtils.propertiesWidth = Math.max(0, this._panelWidth - e.clientX)) ? false : false),
+ action(e => (CurrentUserUtils.propertiesWidth = Math.max(0, this._dashUIWidth - e.clientX)) ? false : false),
action(() => CurrentUserUtils.propertiesWidth < 5 && (CurrentUserUtils.propertiesWidth = 0)),
- action(() => CurrentUserUtils.propertiesWidth = this.propertiesWidth() < 15 ? Math.min(this._panelWidth - 50, 250) : 0), false);
+ action(() => CurrentUserUtils.propertiesWidth = this.propertiesWidth() < 15 ? Math.min(this._dashUIWidth - 50, 250) : 0), false);
}
@action
onFlyoutPointerDown = (e: React.PointerEvent) => {
setupMoveUpEvents(this, e,
- action(e => (this._flyoutWidth = Math.max(e.clientX - 58, 0)) ? false : false),
- () => this._flyoutWidth < 5 && this.closeFlyout(),
+ action(e => (this._leftMenuFlyoutWidth = Math.max(e.clientX - 58, 0)) ? false : false),
+ () => this._leftMenuFlyoutWidth < 5 && this.closeFlyout(),
this.closeFlyout);
}
- flyoutWidthFunc = () => this._flyoutWidth;
- sidebarScreenToLocal = () => new Transform(0, -this.topOffset, 1);
- mainContainerXf = () => this.sidebarScreenToLocal().translate(-this.leftOffset, 0);
+ sidebarScreenToLocal = () => new Transform(0, -this.topOfMainDoc, 1);
+ mainContainerXf = () => this.sidebarScreenToLocal().translate(-this.leftScreenOffsetOfMainDocView, 0);
addDocTabFunc = (doc: Doc, where: string): boolean => {
return where === "close" ? CollectionDockingView.CloseSplit(doc) :
doc.dockingConfig ? CurrentUserUtils.openDashboard(Doc.UserDoc(), doc) : CollectionDockingView.AddSplit(doc, "right");
@@ -310,10 +338,10 @@ export class MainView extends React.Component {
@computed get flyout() {
- return !this._flyoutWidth ? <div key="flyout" className={`mainView-libraryFlyout-out`}>
+ return !this._leftMenuFlyoutWidth ? <div key="flyout" className={`mainView-libraryFlyout-out`}>
{this.docButtons}
</div> :
- <div key="libFlyout" className="mainView-libraryFlyout" style={{ minWidth: this._flyoutWidth, width: this._flyoutWidth }} >
+ <div key="libFlyout" className="mainView-libraryFlyout" style={{ minWidth: this._leftMenuFlyoutWidth, width: this._leftMenuFlyoutWidth }} >
<div className="mainView-contentArea" >
<DocumentView
Document={this._sidebarContent.proto || this._sidebarContent}
@@ -327,11 +355,11 @@ export class MainView extends React.Component {
rootSelected={returnTrue}
removeDocument={returnFalse}
ScreenToLocalTransform={this.mainContainerXf}
- PanelWidth={this.flyoutWidthFunc}
- PanelHeight={this.getContentsHeight}
+ PanelWidth={this.leftMenuFlyoutWidth}
+ PanelHeight={this.leftMenuFlyoutHeight}
renderDepth={0}
isContentActive={returnTrue}
- scriptContext={CollectionDockingView.Instance.props.Document}
+ scriptContext={CollectionDockingView.Instance?.props.Document}
focus={DocUtils.DefaultFocus}
whenChildContentsActiveChanged={emptyFunction}
bringToFront={emptyFunction}
@@ -346,8 +374,8 @@ export class MainView extends React.Component {
</div>;
}
- @computed get menuPanel() {
- return <div key="menu" className="mainView-menuPanel">
+ @computed get leftMenuPanel() {
+ return <div key="menu" className="mainView-leftMenuPanel">
<DocumentView
Document={Doc.UserDoc().menuStack as Doc}
DataDoc={undefined}
@@ -357,8 +385,8 @@ export class MainView extends React.Component {
rootSelected={returnTrue}
removeDocument={returnFalse}
ScreenToLocalTransform={this.sidebarScreenToLocal}
- PanelWidth={this.menuPanelWidth}
- PanelHeight={this.getMenuPanelHeight}
+ PanelWidth={this.leftMenuWidth}
+ PanelHeight={this.leftMenuHeight}
renderDepth={0}
docViewPath={returnEmptyDoclist}
focus={DocUtils.DefaultFocus}
@@ -380,7 +408,7 @@ export class MainView extends React.Component {
@action
selectMenu = (button: Doc) => {
const title = StrCast(Doc.GetProto(button).title);
- const willOpen = !this._flyoutWidth || this._panelContent !== title;
+ const willOpen = !this._leftMenuFlyoutWidth || this._panelContent !== title;
this.closeFlyout();
if (willOpen) {
switch (this._panelContent = title) {
@@ -397,38 +425,41 @@ export class MainView extends React.Component {
}
@computed get mainInnerContent() {
- const width = this.propertiesWidth() + this._flyoutWidth + this.menuPanelWidth();
- const transform = this._flyoutWidth ? 'translate(-28px, 0px)' : undefined;
+ const width = this.propertiesWidth() + this._leftMenuFlyoutWidth + this.leftMenuWidth();
+ const transform = this._leftMenuFlyoutWidth ? 'translate(-28px, 0px)' : undefined;
return <>
- {this.menuPanel}
+ {this.leftMenuPanel}
<div key="inner" className={`mainView-innerContent${this.darkScheme ? "-dark" : ""}`}>
{this.flyout}
- <div className="mainView-libraryHandle" style={{ display: !this._flyoutWidth ? "none" : undefined }} onPointerDown={this.onFlyoutPointerDown} >
+ <div className="mainView-libraryHandle" style={{ display: !this._leftMenuFlyoutWidth ? "none" : undefined }} onPointerDown={this.onFlyoutPointerDown} >
<FontAwesomeIcon icon="chevron-left" color={this.darkScheme ? "white" : "black"} style={{ opacity: "50%" }} size="sm" />
</div>
<div className="mainView-innerContainer" style={{ width: `calc(100% - ${width}px)`, transform: transform }}>
- <CollectionMenu />
+ <CollectionMenu panelWidth={this.topMenuWidth} panelHeight={this.topMenuHeight} />
{this.dockingContent}
- <div className="mainView-propertiesDragger" key="props" onPointerDown={this.onPropertiesPointerDown} style={{ right: this._flyoutWidth ? 0 : this.propertiesWidth() - 1 }}>
+ <div className="mainView-propertiesDragger" key="props" onPointerDown={this.onPropertiesPointerDown} style={{ right: this._leftMenuFlyoutWidth ? 0 : this.propertiesWidth() - 1 }}>
<FontAwesomeIcon icon={this.propertiesWidth() < 10 ? "chevron-left" : "chevron-right"} color={this.darkScheme ? Colors.WHITE : Colors.BLACK} size="sm" />
</div>
<div className="properties-container">
- {this.propertiesWidth() < 10 ? (null) : <PropertiesView styleProvider={DefaultStyleProvider} width={this.propertiesWidth()} height={this.getContentsHeight()} />}
+ {this.propertiesWidth() < 10 ? (null) : <PropertiesView styleProvider={DefaultStyleProvider} width={this.propertiesWidth()} height={this.propertiesHeight()} />}
</div>
</div>
</div>
</>;
}
- @computed get mainContent() {
+ @computed get mainDashboardArea() {
return !this.userDoc ? (null) :
- <div className="mainView-mainContent" ref={r => {
- r && new _global.ResizeObserver(action(() => { this._panelWidth = r.getBoundingClientRect().width; this._panelHeight = r.getBoundingClientRect().height; })).observe(r);
+ <div className="mainView-dashboardArea" ref={r => {
+ r && new _global.ResizeObserver(action(() => {
+ this._dashUIWidth = r.getBoundingClientRect().width;
+ this._dashUIHeight = r.getBoundingClientRect().height;
+ })).observe(r);
}} style={{
color: this.darkScheme ? "rgb(205,205,205)" : "black",
- height: `calc(100% - ${this.topOffset}px)`,
+ height: `calc(100% - ${this.topOfDashUI}px)`,
width: "100%",
}} >
{this.mainInnerContent}
@@ -436,16 +467,17 @@ export class MainView extends React.Component {
}
expandFlyout = action((button: Doc) => {
- this._flyoutWidth = (this._flyoutWidth || 250);
+ this._leftMenuFlyoutWidth = (this._leftMenuFlyoutWidth || 250);
this._sidebarContent.proto = button.target as any;
this.LastButton = button;
+ console.log(button.title);
});
closeFlyout = action(() => {
this.LastButton = undefined;
this._panelContent = "none";
this._sidebarContent.proto = undefined;
- this._flyoutWidth = 0;
+ this._leftMenuFlyoutWidth = 0;
});
remButtonDoc = (doc: Doc | Doc[]) => (doc instanceof Doc ? [doc] : doc).reduce((flg: boolean, doc) => flg && Doc.RemoveDocFromList(Doc.UserDoc().dockedBtns as Doc, "data", doc), true);
@@ -472,6 +504,7 @@ export class MainView extends React.Component {
rootSelected={returnTrue}
bringToFront={emptyFunction}
select={emptyFunction}
+ isAnyChildContentActive={returnFalse}
isContentActive={returnFalse}
isSelected={returnFalse}
docViewPath={returnEmptyDoclist}
@@ -482,8 +515,8 @@ export class MainView extends React.Component {
pinToPres={emptyFunction}
removeDocument={this.remButtonDoc}
ScreenToLocalTransform={this.buttonBarXf}
- PanelWidth={this.flyoutWidthFunc}
- PanelHeight={this.getContentsHeight}
+ PanelWidth={this.leftMenuFlyoutWidth}
+ PanelHeight={this.leftMenuFlyoutHeight}
renderDepth={0}
focus={DocUtils.DefaultFocus}
whenChildContentsActiveChanged={emptyFunction}
@@ -579,13 +612,14 @@ export class MainView extends React.Component {
<CaptureManager />
<GroupManager />
<GoogleAuthenticationManager />
- <DocumentDecorations boundsLeft={this.leftOffset} boundsTop={this.topOffset} />
+ <DocumentDecorations boundsLeft={this.leftScreenOffsetOfMainDocView} boundsTop={this.topOfMainDoc} PanelWidth={this._windowWidth} PanelHeight={this._windowHeight} />
+ <ComponentDecorations boundsLeft={this.leftScreenOffsetOfMainDocView} boundsTop={this.topOfMainDocContent} />
{this.topbar}
{LinkDescriptionPopup.descriptionPopup ? <LinkDescriptionPopup /> : null}
{DocumentLinksButton.LinkEditorDocView ? <LinkMenu docView={DocumentLinksButton.LinkEditorDocView} changeFlyout={emptyFunction} /> : (null)}
{LinkDocPreview.LinkInfo ? <LinkDocPreview {...LinkDocPreview.LinkInfo} /> : (null)}
<GestureOverlay >
- {this.mainContent}
+ {this.mainDashboardArea}
</GestureOverlay>
<PreviewCursor />
<TaskCompletionBox />
@@ -595,6 +629,7 @@ export class MainView extends React.Component {
<MarqueeOptionsMenu />
<OverlayView />
<TimelineMenu />
+ <RichTextMenu />
{this.snapLines}
<div className="mainView-webRef" ref={this.makeWebRef} />
<LightboxView PanelWidth={this._windowWidth} PanelHeight={this._windowHeight} maxBorder={[200, 50]} />
diff --git a/src/client/views/MainViewModal.scss b/src/client/views/MainViewModal.scss
index 5f19590b4..0648e31c5 100644
--- a/src/client/views/MainViewModal.scss
+++ b/src/client/views/MainViewModal.scss
@@ -4,18 +4,17 @@
z-index: 10000;
width: 100%;
height: 100%;
+
.dialogue-box {
+ padding: 10px;
position: absolute;
z-index: 1000;
text-align: center;
justify-content: center;
align-self: center;
align-content: center;
- padding: 20px;
- // background: gainsboro;
background: white;
- border-radius: 10px;
- border: 0.5px solid black;
+ // border-radius: 10px;
box-shadow: #00000044 5px 5px 10px;
transform: translate(-50%, -50%);
top: 50%;
diff --git a/src/client/views/MarqueeAnnotator.tsx b/src/client/views/MarqueeAnnotator.tsx
index a3a3bce56..26e76090a 100644
--- a/src/client/views/MarqueeAnnotator.tsx
+++ b/src/client/views/MarqueeAnnotator.tsx
@@ -43,15 +43,13 @@ export class MarqueeAnnotator extends React.Component<MarqueeAnnotatorProps> {
@observable private _width: number = 0;
@observable private _height: number = 0;
- constructor(props: any) {
- super(props);
- runInAction(() => {
- AnchorMenu.Instance.Status = "marquee";
- AnchorMenu.Instance.fadeOut(true);
- // clear out old marquees and initialize menu for new selection
- Array.from(this.props.savedAnnotations.values()).forEach(v => v.forEach(a => a.remove()));
- this.props.savedAnnotations.clear();
- });
+ @action
+ static clearAnnotations(savedAnnotations: ObservableMap<number, HTMLDivElement[]>) {
+ AnchorMenu.Instance.Status = "marquee";
+ AnchorMenu.Instance.fadeOut(true);
+ // clear out old marquees and initialize menu for new selection
+ Array.from(savedAnnotations.values()).forEach(v => v.forEach(a => a.remove()));
+ savedAnnotations.clear();
}
@action componentDidMount() {
@@ -68,6 +66,8 @@ export class MarqueeAnnotator extends React.Component<MarqueeAnnotatorProps> {
AnchorMenu.Instance.OnClick = (e: PointerEvent) => this.props.anchorMenuClick?.()?.(this.highlight("rgba(173, 216, 230, 0.75)", true));
AnchorMenu.Instance.Highlight = this.highlight;
AnchorMenu.Instance.GetAnchor = (savedAnnotations?: ObservableMap<number, HTMLDivElement[]>) => this.highlight("rgba(173, 216, 230, 0.75)", true, savedAnnotations);
+ AnchorMenu.Instance.onMakeAnchor = AnchorMenu.Instance.GetAnchor;
+
/**
* This function is used by the AnchorMenu to create an anchor highlight and a new linked text annotation.
* It also initiates a Drag/Drop interaction to place the text annotation.
@@ -77,11 +77,11 @@ export class MarqueeAnnotator extends React.Component<MarqueeAnnotatorProps> {
e.stopPropagation();
const sourceAnchorCreator = () => {
const annoDoc = this.highlight("rgba(173, 216, 230, 0.75)", true); // hyperlink color
- this.props.addDocument(annoDoc);
+ annoDoc && this.props.addDocument(annoDoc);
return annoDoc;
};
const targetCreator = (annotationOn: Doc | undefined) => {
- const target = CurrentUserUtils.GetNewTextDoc("Note linked to " + this.props.rootDoc.title, 0, 0, 100, 100, undefined, annotationOn);
+ const target = CurrentUserUtils.GetNewTextDoc("Note linked to " + this.props.rootDoc.title, 0, 0, 100, 100, undefined, annotationOn, undefined, "yellow");
FormattedTextBox.SelectOnLoad = target[Id];
return target;
};
diff --git a/src/client/views/PreviewCursor.tsx b/src/client/views/PreviewCursor.tsx
index 679a4b81e..2b82ef475 100644
--- a/src/client/views/PreviewCursor.tsx
+++ b/src/client/views/PreviewCursor.tsx
@@ -158,7 +158,7 @@ export class PreviewCursor extends React.Component<{}> {
}
render() {
return (!PreviewCursor._clickPoint || !PreviewCursor.Visible) ? (null) :
- <div className="previewCursor" onBlur={this.onBlur} tabIndex={0} ref={e => e && e.focus()}
+ <div className="previewCursor" onBlur={this.onBlur} tabIndex={0} ref={e => e?.focus()}
style={{ transform: `translate(${PreviewCursor._clickPoint[0]}px, ${PreviewCursor._clickPoint[1]}px)` }}>
I
</div >;
diff --git a/src/client/views/PropertiesButtons.scss b/src/client/views/PropertiesButtons.scss
index 484522bc7..36b2df73e 100644
--- a/src/client/views/PropertiesButtons.scss
+++ b/src/client/views/PropertiesButtons.scss
@@ -44,14 +44,15 @@ $linkGap : 3px;
}
}
.propertiesButtons-linkButton-empty.toggle-on {
- background-color: white;
- color: $dark-gray;
+ background-color: $medium-blue;
+ color: $white;
}
.propertiesButtons-linkButton-empty.toggle-hover {
- background-color: gray;
- color: $dark-gray;
+ background-color: $light-blue;
+ color: $black;
}
.propertiesButtons-linkButton-empty.toggle-off {
+ background-color: $dark-gray;
color: white;
}
@@ -67,10 +68,12 @@ $linkGap : 3px;
}
.onClickFlyout-editScript {
+ cursor: pointer;
text-align: center;
- border: 0.5px solid grey;
+ margin-top: 5px;
+ border: 0.5px solid $medium-gray;
background-color: rgb(230, 230, 230);
- border-radius: 9px;
+ border-radius: 5px;
padding: 4px;
}
@@ -84,9 +87,32 @@ $linkGap : 3px;
margin-bottom: 8px;
}
+.propertiesButton-dropdownList {
+ width: 100%;
+ height: fit-content;
+ top: 100%;
+ z-index: 21;
+
+ .list-item {
+ cursor: pointer;
+ color: $black;
+ width: 100%;
+ height: 25px;
+ font-weight: 400;
+ display: flex;
+ justify-content: left;
+ align-items: center;
+ padding-left: 5px;
+ }
+
+ .list-item:hover {
+ background-color: lightgrey;
+ }
+}
+
.propertiesButtons-title {
- background: #121721;
- color: white;
+ background: $dark-gray;
+ color: $white;
font-size: 6px;
width: 37px;
padding: 3px;
@@ -111,17 +137,11 @@ $linkGap : 3px;
margin-left: 4px;
&:hover {
- background: $medium-gray;
- transform: scale(1.05);
+ filter:brightness(0.85);
cursor: pointer;
}
}
-.propertiesButtons-linker:hover {
- cursor: pointer;
- transform: scale(1.05);
-}
-
@-moz-keyframes spin {
100% {
diff --git a/src/client/views/PropertiesButtons.tsx b/src/client/views/PropertiesButtons.tsx
index 5c41a96d0..378c67253 100644
--- a/src/client/views/PropertiesButtons.tsx
+++ b/src/client/views/PropertiesButtons.tsx
@@ -15,6 +15,9 @@ import { InkingStroke } from './InkingStroke';
import { DocumentView } from './nodes/DocumentView';
import './PropertiesButtons.scss';
import React = require("react");
+import { Colors } from "./global/globalEnums";
+import { CollectionFreeFormView } from "./collections/collectionFreeForm";
+import { DocumentManager } from "../util/DocumentManager";
const higflyout = require("@hig/flyout");
export const { anchorPoints } = higflyout;
export const Flyout = higflyout.default;
@@ -29,6 +32,7 @@ export class PropertiesButtons extends React.Component<{}, {}> {
@observable public static Instance: PropertiesButtons;
@computed get selectedDoc() { return SelectionManager.SelectedSchemaDoc() || SelectionManager.Views().lastElement()?.rootDoc; }
+ @computed get selectedTabView() { return !SelectionManager.SelectedSchemaDoc() && SelectionManager.Views().lastElement()?.topMost; }
propertyToggleBtn = (label: string, property: string, tooltip: (on?: any) => string, icon: (on: boolean) => string, onClick?: (dv: Opt<DocumentView>, doc: Doc, property: string) => void, useUserDoc?: boolean) => {
const targetDoc = useUserDoc ? Doc.UserDoc() : this.selectedDoc;
@@ -65,10 +69,10 @@ export class PropertiesButtons extends React.Component<{}, {}> {
return this.propertyToggleBtn("Lock\xA0View", "_lockedTransform", on => `${on ? "Unlock" : "Lock"} panning of view`, on => "lock");
}
@computed get fitContentButton() {
- return this.propertyToggleBtn("View All", "_fitToBox", on => `${on ? "Don't" : ""} fit content to container visible area`, on => "eye");
+ return this.propertyToggleBtn("View All", "_fitToBox", on => `${on ? "Don't" : "Do"} fit content to container visible area`, on => "eye");
}
@computed get fitWidthButton() {
- return this.propertyToggleBtn("Fit\xA0Width", "_fitWidth", on => `${on ? "Don't" : ""} fit content to width of container`, on => "arrows-alt-h");
+ return this.propertyToggleBtn("Fit\xA0Width", "_fitWidth", on => `${on ? "Don't" : "Do"} fit content to width of container`, on => "arrows-alt-h");
}
@computed get captionButton() {
return this.propertyToggleBtn("Caption", "_showCaption", on => `${on ? "Hide" : "Show"} caption footer`, on => "closed-captioning", (dv, doc) => (dv?.rootDoc || doc)._showCaption = (dv?.rootDoc || doc)._showCaption === undefined ? "caption" : undefined);
@@ -83,7 +87,10 @@ export class PropertiesButtons extends React.Component<{}, {}> {
return this.propertyToggleBtn("Auto\xA0Size", "_autoHeight", on => `Automatical vertical sizing to show all content`, on => "arrows-alt-v");
}
@computed get gridButton() {
- return this.propertyToggleBtn("Grid", "_backgroundGrid-show", on => `Display background grid in collection`, on => "border-all");
+ return this.propertyToggleBtn("Grid", "_backgroundGridShow", on => `Display background grid in collection`, on => "border-all");
+ }
+ @computed get groupButton() {
+ return this.propertyToggleBtn("Group", "isGroup", on => `Display collection as a Group`, on => "object-group", (dv, doc) => { doc.isGroup = !doc.isGroup; doc.forceActive = doc.isGroup; });
}
@computed get snapButton() {
return this.propertyToggleBtn("Snap\xA0Lines", "showSnapLines", on => `Display snapping lines when objects are dragged`, on => "border-all", undefined, true);
@@ -128,13 +135,13 @@ export class PropertiesButtons extends React.Component<{}, {}> {
@undoBatch
@action
- handleOptionChange = (e: any) => {
- this.selectedDoc && (this.selectedDoc.onClickBehavior = e.target.value);
+ handleOptionChange = (onClick: string) => {
+ this.selectedDoc && (this.selectedDoc.onClickBehavior = onClick);
SelectionManager.Views().filter(dv => dv.docView).map(dv => dv.docView!).forEach(docView => {
docView.noOnClick();
- switch (e.target.value) {
+ switch (onClick) {
case "enterPortal": docView.makeIntoPortal(); break;
- case "toggleDetail": docView.toggleDetail(); break;
+ case "toggleDetail": docView.setToggleDetail(); break;
case "linkInPlace": docView.toggleFollowLink("inPlace", true, false); break;
case "linkOnRight": docView.toggleFollowLink("add:right", false, false); break;
}
@@ -149,20 +156,34 @@ export class PropertiesButtons extends React.Component<{}, {}> {
@computed
get onClickFlyout() {
- const makeLabel = (value: string, label: string) => <div className="radio">
- <label>
- <input type="radio" value={value} checked={(this.selectedDoc?.onClickBehavior ?? "nothing") === value} onChange={this.handleOptionChange} />
- {label}
- </label>
- </div>;
+ const buttonList = [
+ ["nothing", "Select Document"],
+ ["enterPortal", "Enter Portal"],
+ ["toggleDetail", "Toggle Detail"],
+ ["linkInPlace", "Follow Link"],
+ ["linkOnRight", "Open Link on Right"]
+ ];
+ const currentSelection = this.selectedDoc.onClickBehavior;
+ // Get items to place into the list
+
+ const list = buttonList.map((value) => {
+ const click = () => {
+ this.handleOptionChange(value[0]);
+ };
+ return <div className="list-item" key={`${value}`}
+ style={{
+ backgroundColor: value[0] === currentSelection ? Colors.LIGHT_BLUE : undefined
+ }}
+ onClick={click}>
+ {value[1]}
+ </div>;
+ });
return <div>
- <form>
- {makeLabel("nothing", "Select Document")}
- {makeLabel("enterPortal", "Enter Portal")}
- {makeLabel("toggleDetail", "Toggle Detail")}
- {makeLabel("linkInPlace", "Follow Link")}
- {makeLabel("linkOnRight", "Open Link on Right")}
- </form>
+ <div>
+ <div className="propertiesButton-dropdownList">
+ {list}
+ </div>
+ </div>
{Doc.UserDoc().noviceMode ? (null) : <div onPointerDown={this.editOnClickScript} className="onClickFlyout-editScript"> Edit onClick Script</div>}
</div>;
}
@@ -189,25 +210,27 @@ export class PropertiesButtons extends React.Component<{}, {}> {
const isStacking = this.selectedDoc?._viewType === CollectionViewType.Stacking;
const isFreeForm = this.selectedDoc?._viewType === CollectionViewType.Freeform;
const isTree = this.selectedDoc?._viewType === CollectionViewType.Tree;
+ const isTabView = this.selectedTabView;
const toggle = (ele: JSX.Element | null, style?: React.CSSProperties) => <div className="propertiesButtons-button" style={style}> {ele} </div>;
-
+ const isNovice = Doc.UserDoc().noviceMode;
return !this.selectedDoc ? (null) :
<div className="propertiesButtons">
{toggle(this.titleButton)}
{toggle(this.captionButton)}
{toggle(this.lockButton)}
- {toggle(this.dictationButton)}
+ {toggle(this.dictationButton, { display: isNovice ? "none" : "" })}
{toggle(this.onClickButton)}
{toggle(this.fitWidthButton)}
{toggle(this.fitContentButton, { display: !isFreeForm ? "none" : "" })}
{toggle(this.autoHeightButton, { display: !isText && !isStacking && !isTree ? "none" : "" })}
{toggle(this.maskButton, { display: !isInk ? "none" : "" })}
- {toggle(this.chromeButton, { display: isCollection ? "" : "none" })}
- {toggle(this.gridButton, { display: isCollection ? "" : "none" })}
- {toggle(this.snapButton, { display: isCollection ? "" : "none" })}
+ {toggle(this.chromeButton, { display: !isCollection || isNovice ? "none" : "" })}
+ {toggle(this.gridButton, { display: !isCollection ? "none" : "" })}
+ {toggle(this.groupButton, { display: isTabView || !isCollection ? "none" : "" })}
+ {toggle(this.snapButton, { display: !isCollection ? "none" : "" })}
{toggle(this.clustersButton, { display: !isFreeForm ? "none" : "" })}
{toggle(this.panButton, { display: !isFreeForm ? "none" : "" })}
- {toggle(this.perspectiveButton, { display: !isCollection ? "none" : "" })}
+ {toggle(this.perspectiveButton, { display: !isCollection || isNovice ? "none" : "" })}
</div>;
}
} \ No newline at end of file
diff --git a/src/client/views/PropertiesView.scss b/src/client/views/PropertiesView.scss
index 321b83f52..554f137cb 100644
--- a/src/client/views/PropertiesView.scss
+++ b/src/client/views/PropertiesView.scss
@@ -825,9 +825,8 @@
}
.editable-title {
- padding: 6px;
- padding-bottom: 2px;
- border: solid 1px $dark-gray;
+ border: solid 1px #323232;
+ height: fit-content;
&:hover {
border: 0.75px solid $medium-blue;
diff --git a/src/client/views/PropertiesView.tsx b/src/client/views/PropertiesView.tsx
index de437e1df..ab9022a84 100644
--- a/src/client/views/PropertiesView.tsx
+++ b/src/client/views/PropertiesView.tsx
@@ -2,17 +2,19 @@ import React = require("react");
import { FontAwesomeIcon } from "@fortawesome/react-fontawesome";
import { Checkbox, Tooltip } from "@material-ui/core";
import { intersection } from "lodash";
-import { action, autorun, computed, Lambda, observable, reaction, runInAction } from "mobx";
+import { action, autorun, computed, Lambda, observable } from "mobx";
import { observer } from "mobx-react";
import { ColorState, SketchPicker } from "react-color";
-import { AclAugment, AclAdmin, AclEdit, AclPrivate, AclReadonly, AclSym, AclUnset, DataSym, Doc, Field, HeightSym, Opt, WidthSym, AclSelfEdit } from "../../fields/Doc";
+import { AclAdmin, AclAugment, AclEdit, AclPrivate, AclReadonly, AclSelfEdit, AclSym, AclUnset, DataSym, Doc, Field, HeightSym, Opt, WidthSym } from "../../fields/Doc";
import { Id } from "../../fields/FieldSymbols";
import { InkField } from "../../fields/InkField";
+import { List } from "../../fields/List";
import { ComputedField } from "../../fields/ScriptField";
-import { Cast, NumCast, StrCast } from "../../fields/Types";
+import { BoolCast, Cast, NumCast, StrCast } from "../../fields/Types";
import { denormalizeEmail, GetEffectiveAcl, SharingPermissions } from "../../fields/util";
import { emptyFunction, returnEmptyDoclist, returnEmptyFilter, returnFalse, returnTrue } from "../../Utils";
import { DocumentType } from "../documents/DocumentTypes";
+import { CurrentUserUtils } from "../util/CurrentUserUtils";
import { DocumentManager } from "../util/DocumentManager";
import { SelectionManager } from "../util/SelectionManager";
import { SharingManager } from "../util/SharingManager";
@@ -29,8 +31,6 @@ import { PropertiesButtons } from "./PropertiesButtons";
import { PropertiesDocContextSelector } from "./PropertiesDocContextSelector";
import "./PropertiesView.scss";
import { DefaultStyleProvider } from "./StyleProvider";
-import { CurrentUserUtils } from "../util/CurrentUserUtils";
-import { List } from "../../fields/List";
const higflyout = require("@hig/flyout");
export const { anchorPoints } = higflyout;
export const Flyout = higflyout.default;
@@ -366,7 +366,7 @@ export class PropertiesView extends React.Component<PropertiesViewProps> {
return <Tooltip title={<div className="dash-tooltip">{"Show more permissions"}</div>}>
<div className="expansion-button" onPointerDown={() => {
if (this.selectedDocumentView || this.selectedDoc) {
- SharingManager.Instance.open(this.selectedDocumentView?.props.Document === this.selectedDocumentView ? this.selectedDocumentView : undefined, this.selectedDoc);
+ SharingManager.Instance.open(this.selectedDocumentView?.props.Document === this.selectedDoc ? this.selectedDocumentView : undefined, this.selectedDoc);
}
}}>
<FontAwesomeIcon className="expansion-button-icon" icon="ellipsis-h" color="black" size="sm" />
@@ -903,7 +903,7 @@ export class PropertiesView extends React.Component<PropertiesViewProps> {
* If it doesn't exist, it creates it.
*/
checkFilterDoc() {
- if (this.selectedDoc.type === DocumentType.COL && !this.selectedDoc.currentFilter) CurrentUserUtils.setupFilterDocs(this.selectedDoc);
+ if (!this.selectedDoc.currentFilter) CurrentUserUtils.setupFilterDocs(this.selectedDoc);
}
/**
@@ -1086,6 +1086,7 @@ export class PropertiesView extends React.Component<PropertiesViewProps> {
// }
render() {
+ const isNovice = BoolCast(Doc.UserDoc().noviceMode);
if (!this.selectedDoc && !this.isPres) {
return <div className="propertiesView" style={{ width: this.props.width }}>
<div className="propertiesView-title" style={{ width: this.props.width }}>
@@ -1110,15 +1111,15 @@ export class PropertiesView extends React.Component<PropertiesViewProps> {
{this.sharingSubMenu}
- {this.filtersSubMenu}
+ {isNovice ? null : this.filtersSubMenu}
{this.inkSubMenu}
- {this.fieldsSubMenu}
+ {isNovice ? null : this.fieldsSubMenu}
- {this.contextsSubMenu}
+ {isNovice ? null : this.contextsSubMenu}
- {this.layoutSubMenu}
+ {isNovice ? null : this.layoutSubMenu}
</div>;
}
if (this.isPres) {
diff --git a/src/client/views/SidebarAnnos.tsx b/src/client/views/SidebarAnnos.tsx
index 417107978..b29953b19 100644
--- a/src/client/views/SidebarAnnos.tsx
+++ b/src/client/views/SidebarAnnos.tsx
@@ -39,10 +39,10 @@ export class SidebarAnnos extends React.Component<FieldViewProps & ExtraProps> {
// this.props.dataDoc[this.sidebarKey] = new List<Doc>(); // bcz: can't do this here. it blows away existing things and isn't a robust solution for making sure the field exists -- instead this should happen when the document is created and/or shared
}
_stackRef = React.createRef<CollectionStackingView>();
- @computed get allHashtags() {
+ @computed get allMetadata() {
const keys = new Set<string>();
DocListCast(this.props.rootDoc[this.sidebarKey]).forEach(doc => SearchBox.documentKeys(doc).forEach(key => keys.add(key)));
- return Array.from(keys.keys()).filter(key => key[0]).filter(key => !key.startsWith("_") && (key[0] === "#" || key[0] === key[0].toUpperCase())).sort();
+ return Array.from(keys.keys()).filter(key => key[0]).filter(key => key[0] !== "_" && (key[0] === key[0].toUpperCase())).sort();
}
@computed get allUsers() {
const keys = new Set<string>();
@@ -60,7 +60,7 @@ export class SidebarAnnos extends React.Component<FieldViewProps & ExtraProps> {
});
FormattedTextBox.SelectOnLoad = target[Id];
FormattedTextBox.DontSelectInitialText = true;
- this.allHashtags.map(tag => target[tag] = tag);
+ this.allMetadata.map(tag => target[tag] = tag);
DocUtils.MakeLink({ doc: anchor }, { doc: target }, "inline markup", "annotation");
this.addDocument(target);
this._stackRef.current?.focusDocument(target);
@@ -87,13 +87,8 @@ export class SidebarAnnos extends React.Component<FieldViewProps & ExtraProps> {
moveDocument = (doc: Doc | Doc[], targetCollection: Doc | undefined, addDocument: (doc: Doc | Doc[]) => boolean) => this.props.moveDocument(doc, targetCollection, addDocument, this.sidebarKey);
removeDocument = (doc: Doc | Doc[]) => this.props.removeDocument(doc, this.sidebarKey);
docFilters = () => [...StrListCast(this.props.layoutDoc._docFilters), ...StrListCast(this.props.layoutDoc[this.filtersKey])];
-
- sidebarStyleProvider = (doc: Opt<Doc>, props: Opt<FieldViewProps | DocumentViewProps>, property: string) => {
- if (property === StyleProp.ShowTitle) {
- return doc === this.props.rootDoc ? undefined : StrCast(this.props.layoutDoc["sidebar-childShowTitle"], "title");
- }
- return this.props.styleProvider?.(doc, props, property);
- }
+ showTitle = () => "title";
+ setHeightCallback = (height: number) => this.props.setHeight(height + this.filtersHeight());
render() {
const renderTag = (tag: string) => {
const active = StrListCast(this.props.rootDoc[this.filtersKey]).includes(`${tag}:${tag}:check`);
@@ -102,6 +97,13 @@ export class SidebarAnnos extends React.Component<FieldViewProps & ExtraProps> {
{tag}
</div>;
};
+ const renderMeta = (tag: string) => {
+ const active = StrListCast(this.props.rootDoc[this.filtersKey]).includes(`${tag}:${tag}:exists`);
+ return <div key={tag} className={`sidebarAnnos-filterTag${active ? "-active" : ""}`}
+ onClick={e => Doc.setDocFilter(this.props.rootDoc, tag, tag, "exists", true, this.sidebarKey, e.shiftKey)}>
+ {tag}
+ </div>;
+ };
const renderUsers = (user: string) => {
const active = StrListCast(this.props.rootDoc[this.filtersKey]).includes(`author:${user}:check`);
return <div key={user} className={`sidebarAnnos-filterUser${active ? "-active" : ""}`}
@@ -109,11 +111,10 @@ export class SidebarAnnos extends React.Component<FieldViewProps & ExtraProps> {
{user}
</div>;
};
- // return !this.props.layoutDoc._showSidebar ? (null) :
- // <div className="sidebarAnnos-container" style={{
+ // TODO: Calculation of the topbar is hardcoded and different for text nodes - it should all be the same and all be part of SidebarAnnos
return !this.props.showSidebar ? (null) :
<div style={{
- position: "absolute", pointerEvents: this.props.isContentActive() ? "all" : undefined, top: 0, right: 0,
+ position: "absolute", pointerEvents: this.props.isContentActive() ? "all" : undefined, top: this.props.rootDoc.type !== DocumentType.RTF && StrCast(this.props.rootDoc._showTitle) === "title" ? 15 : 0, right: 0,
background: this.props.styleProvider?.(this.props.rootDoc, this.props, StyleProp.WidgetColor),
width: `${this.panelWidth()}px`,
height: "100%"
@@ -121,7 +122,7 @@ export class SidebarAnnos extends React.Component<FieldViewProps & ExtraProps> {
<div className="sidebarAnnos-tagList" style={{ height: this.filtersHeight(), width: this.panelWidth() }}
onWheel={e => e.stopPropagation()}>
{this.allUsers.map(renderUsers)}
- {this.allHashtags.map(renderTag)}
+ {this.allMetadata.map(renderMeta)}
</div>
<div style={{ width: "100%", height: this.panelHeight(), position: "relative" }}>
<CollectionStackingView {...OmitKeys(this.props, ["NativeWidth", "NativeHeight", "setContentView"]).omit} ref={this._stackRef}
@@ -129,13 +130,13 @@ export class SidebarAnnos extends React.Component<FieldViewProps & ExtraProps> {
NativeHeight={returnZero}
PanelHeight={this.panelHeight}
PanelWidth={this.panelWidth}
- styleProvider={this.sidebarStyleProvider}
docFilters={this.docFilters}
scaleField={this.sidebarKey + "-scale"}
- setHeight={(height) => this.props.setHeight(height + this.filtersHeight())}
+ setHeight={this.setHeightCallback}
isAnnotationOverlay={false}
select={emptyFunction}
scaling={returnOne}
+ childShowTitle={this.showTitle}
whenChildContentsActiveChanged={this.props.whenChildContentsActiveChanged}
childHideDecorationTitle={returnTrue}
removeDocument={this.removeDocument}
diff --git a/src/client/views/StyleProvider.tsx b/src/client/views/StyleProvider.tsx
index ed09acc97..c5614506b 100644
--- a/src/client/views/StyleProvider.tsx
+++ b/src/client/views/StyleProvider.tsx
@@ -21,6 +21,7 @@ import "./nodes/FilterBox.scss";
import "./StyleProvider.scss";
import React = require("react");
import Color = require('color');
+import { lightOrDark } from '../../Utils';
export enum StyleLayers {
Background = "background"
@@ -88,34 +89,33 @@ export function DefaultStyleProvider(doc: Opt<Doc>, props: Opt<DocumentViewProps
switch (property.split(":")[0]) {
case StyleProp.TreeViewIcon: return Doc.toIcon(doc, isOpen);
case StyleProp.DocContents: return undefined;
- case StyleProp.WidgetColor: return isAnnotated ? "lightBlue" : darkScheme() ? "lightgrey" : "dimgrey";
+ case StyleProp.WidgetColor: return isAnnotated ? Colors.LIGHT_BLUE : darkScheme() ? "lightgrey" : "dimgrey";
case StyleProp.Opacity: return Cast(doc?._opacity, "number", Cast(doc?.opacity, "number", null));
case StyleProp.HideLinkButton: return props?.hideLinkButton || (!selected && (doc?.isLinkButton || doc?.hideLinkButton));
case StyleProp.FontSize: return StrCast(doc?.[fieldKey + "fontSize"]);
- case StyleProp.ShowTitle: return doc && !doc.presentationTargetDoc && StrCast(doc._showTitle,
- !Doc.IsSystem(doc) && doc.type === DocumentType.RTF ?
- (doc.author === Doc.CurrentUserEmail ? StrCast(Doc.UserDoc().showTitle) : "author;creationDate") : "") || "";
+ case StyleProp.ShowTitle: return (doc && !doc.presentationTargetDoc &&
+ StrCast(doc._showTitle,
+ props?.showTitle?.() ||
+ (!Doc.IsSystem(doc) && [DocumentType.COL, DocumentType.RTF, DocumentType.IMG, DocumentType.VID].includes(doc.type as any) ?
+ (doc.author === Doc.CurrentUserEmail ? StrCast(Doc.UserDoc().showTitle) :
+ "author;creationDate") : "")) || "");
case StyleProp.Color:
+ if (MainView.Instance.LastButton === doc) return Colors.DARK_GRAY;
const docColor: Opt<string> = StrCast(doc?.[fieldKey + "color"], StrCast(doc?._color));
if (docColor) return docColor;
const backColor = backgroundCol();
if (!backColor) return undefined;
- const nonAlphaColor = backColor.startsWith("#") ? (backColor as string).substring(0, 7) :
- backColor.startsWith("rgba") ? backColor.replace(/,.[^,]*\)/, ")").replace("rgba", "rgb") : backColor;
- const col = Color(nonAlphaColor).rgb();
- const colsum = (col.red() + col.green() + col.blue());
- if (colsum / col.alpha() > 400 || col.alpha() < 0.25) return Colors.DARK_GRAY;
- return Colors.WHITE;
+ return lightOrDark(backColor);
case StyleProp.Hidden: return BoolCast(doc?._hidden);
case StyleProp.BorderRounding: return StrCast(doc?.[fieldKey + "borderRounding"], doc?._viewType === CollectionViewType.Pile ? "50%" : "");
case StyleProp.TitleHeight: return 15;
case StyleProp.BorderPath: return comicStyle() && props?.renderDepth ? { path: wavyBorderPath(props?.PanelWidth?.() || 0, props?.PanelHeight?.() || 0), fill: wavyBorderPath(props?.PanelWidth?.() || 0, props?.PanelHeight?.() || 0, .08), width: 3 } : { path: undefined, width: 0 };
case StyleProp.JitterRotation: return comicStyle() ? random(-1, 1, NumCast(doc?.x), NumCast(doc?.y)) * ((props?.PanelWidth() || 0) > (props?.PanelHeight() || 0) ? 5 : 10) : 0;
- case StyleProp.HeaderMargin: return ([CollectionViewType.Stacking, CollectionViewType.Masonry].includes(doc?._viewType as any) ||
+ case StyleProp.HeaderMargin: return ([CollectionViewType.Stacking, CollectionViewType.Masonry, CollectionViewType.Tree].includes(doc?._viewType as any) ||
doc?.type === DocumentType.RTF) && showTitle() && !StrCast(doc?.showTitle).includes(":hover") ? 15 : 0;
case StyleProp.BackgroundColor: {
+ if (MainView.Instance.LastButton === doc) return Colors.LIGHT_GRAY;
let docColor: Opt<string> = StrCast(doc?.[fieldKey + "backgroundColor"], StrCast(doc?._backgroundColor, isCaption ? "rgba(0,0,0,0.4)" : ""));
- if (MainView.Instance.LastButton === doc) return darkScheme() ? Colors.MEDIUM_GRAY : Colors.LIGHT_GRAY;
switch (doc?.type) {
case DocumentType.PRESELEMENT: docColor = docColor || (darkScheme() ? "" : ""); break;
case DocumentType.PRES: docColor = docColor || (darkScheme() ? Colors.DARK_GRAY : Colors.WHITE); break;
diff --git a/src/client/views/TemplateMenu.tsx b/src/client/views/TemplateMenu.tsx
index 5491a81e6..ff3f92364 100644
--- a/src/client/views/TemplateMenu.tsx
+++ b/src/client/views/TemplateMenu.tsx
@@ -141,6 +141,7 @@ export class TemplateMenu extends React.Component<TemplateMenuProps> {
onCheckedClick={this.scriptField}
onChildClick={this.scriptField}
dropAction={undefined}
+ isAnyChildContentActive={returnFalse}
isContentActive={returnTrue}
bringToFront={emptyFunction}
focus={emptyFunction}
diff --git a/src/client/views/collections/CollectionDockingView.tsx b/src/client/views/collections/CollectionDockingView.tsx
index cae08e1f4..5325d5827 100644
--- a/src/client/views/collections/CollectionDockingView.tsx
+++ b/src/client/views/collections/CollectionDockingView.tsx
@@ -428,7 +428,7 @@ export class CollectionDockingView extends CollectionSubView(doc => doc) {
const emptyPane = CurrentUserUtils.EmptyPane;
emptyPane["dragFactory-count"] = NumCast(emptyPane["dragFactory-count"]) + 1;
const docToAdd = Docs.Create.FreeformDocument([], {
- _width: this.props.PanelWidth(), _height: this.props.PanelHeight(), _fitWidth: true, title: `Untitled Tab ${NumCast(emptyPane["dragFactory-count"])}`,
+ _width: this.props.PanelWidth(), _height: this.props.PanelHeight(), _backgroundGridShow: true, _fitWidth: true, title: `Untitled Tab ${NumCast(emptyPane["dragFactory-count"])}`,
});
this.props.Document.isShared && inheritParentAcls(this.props.Document, docToAdd);
CollectionDockingView.AddSplit(docToAdd, "", stack);
@@ -453,7 +453,7 @@ export class CollectionDockingView extends CollectionSubView(doc => doc) {
const emptyPane = CurrentUserUtils.EmptyPane;
emptyPane["dragFactory-count"] = NumCast(emptyPane["dragFactory-count"]) + 1;
const docToAdd = Docs.Create.FreeformDocument([], {
- _width: this.props.PanelWidth(), _height: this.props.PanelHeight(), _fitWidth: true, title: `Untitled Tab ${NumCast(emptyPane["dragFactory-count"])}`
+ _width: this.props.PanelWidth(), _height: this.props.PanelHeight(), _fitWidth: true, _backgroundGridShow: true, title: `Untitled Tab ${NumCast(emptyPane["dragFactory-count"])}`
});
this.props.Document.isShared && inheritParentAcls(this.props.Document, docToAdd);
CollectionDockingView.AddSplit(docToAdd, "", stack);
diff --git a/src/client/views/collections/CollectionLinearView.tsx b/src/client/views/collections/CollectionLinearView.tsx
deleted file mode 100644
index 52c836556..000000000
--- a/src/client/views/collections/CollectionLinearView.tsx
+++ /dev/null
@@ -1,193 +0,0 @@
-import { Tooltip } from '@material-ui/core';
-import { action, IReactionDisposer, observable, reaction, runInAction } from 'mobx';
-import { observer } from 'mobx-react';
-import * as React from 'react';
-import { Doc, HeightSym, WidthSym } from '../../../fields/Doc';
-import { documentSchema } from '../../../fields/documentSchemas';
-import { Id } from '../../../fields/FieldSymbols';
-import { makeInterface } from '../../../fields/Schema';
-import { BoolCast, NumCast, ScriptCast, StrCast } from '../../../fields/Types';
-import { emptyFunction, returnEmptyDoclist, returnFalse, returnTrue, Utils } from '../../../Utils';
-import { DragManager } from '../../util/DragManager';
-import { Transform } from '../../util/Transform';
-import { DocumentLinksButton } from '../nodes/DocumentLinksButton';
-import { DocumentView } from '../nodes/DocumentView';
-import { LinkDescriptionPopup } from '../nodes/LinkDescriptionPopup';
-import { StyleProp } from '../StyleProvider';
-import "./CollectionLinearView.scss";
-import { CollectionSubView } from './CollectionSubView';
-import { CollectionViewType } from './CollectionView';
-
-
-type LinearDocument = makeInterface<[typeof documentSchema,]>;
-const LinearDocument = makeInterface(documentSchema);
-
-@observer
-export class CollectionLinearView extends CollectionSubView(LinearDocument) {
- @observable public addMenuToggle = React.createRef<HTMLInputElement>();
- @observable private _selectedIndex = -1;
- private _dropDisposer?: DragManager.DragDropDisposer;
- private _widthDisposer?: IReactionDisposer;
- private _selectedDisposer?: IReactionDisposer;
-
- componentWillUnmount() {
- this._dropDisposer?.();
- this._widthDisposer?.();
- this._selectedDisposer?.();
- this.childLayoutPairs.map((pair, ind) => ScriptCast(pair.layout.proto?.onPointerUp)?.script.run({ this: pair.layout.proto }, console.log));
- }
-
- componentDidMount() {
- this._widthDisposer = reaction(() => 5 + (this.layoutDoc.linearViewIsExpanded ? this.childDocs.length * (this.rootDoc[HeightSym]()) : 10),
- width => this.childDocs.length && (this.layoutDoc._width = width),
- { fireImmediately: true }
- );
-
- this._selectedDisposer = reaction(
- () => NumCast(this.layoutDoc.selectedIndex),
- (i) => runInAction(() => {
- this._selectedIndex = i;
- let selected: any = undefined;
- this.childLayoutPairs.map(async (pair, ind) => {
- const isSelected = this._selectedIndex === ind;
- if (isSelected) {
- selected = pair;
- }
- else {
- ScriptCast(pair.layout.proto?.onPointerUp)?.script.run({ this: pair.layout.proto }, console.log);
- }
- });
- if (selected && selected.layout) {
- ScriptCast(selected.layout.proto?.onPointerDown)?.script.run({ this: selected.layout.proto }, console.log);
- }
- }),
- { fireImmediately: true }
- );
- }
- protected createDashEventsTarget = (ele: HTMLDivElement) => { //used for stacking and masonry view
- this._dropDisposer && this._dropDisposer();
- if (ele) {
- this._dropDisposer = DragManager.MakeDropTarget(ele, this.onInternalDrop.bind(this), this.layoutDoc);
- }
- }
-
- dimension = () => NumCast(this.rootDoc._height); // 2 * the padding
- getTransform = (ele: React.RefObject<HTMLDivElement>) => () => {
- if (!ele.current) return Transform.Identity();
- const { scale, translateX, translateY } = Utils.GetScreenTransform(ele.current);
- return new Transform(-translateX, -translateY, 1);
- }
-
- @action
- exitLongLinks = () => {
- if (DocumentLinksButton.StartLink) {
- if (DocumentLinksButton.StartLink.Document) {
- action((e: React.PointerEvent<HTMLDivElement>) => {
- Doc.UnBrushDoc(DocumentLinksButton.StartLink?.Document as Doc);
- });
- }
- }
- DocumentLinksButton.StartLink = undefined;
- DocumentLinksButton.StartLinkView = undefined;
- }
-
- @action
- changeDescriptionSetting = () => {
- if (LinkDescriptionPopup.showDescriptions) {
- if (LinkDescriptionPopup.showDescriptions === "ON") {
- LinkDescriptionPopup.showDescriptions = "OFF";
- LinkDescriptionPopup.descriptionPopup = false;
- } else {
- LinkDescriptionPopup.showDescriptions = "ON";
- }
- } else {
- LinkDescriptionPopup.showDescriptions = "OFF";
- LinkDescriptionPopup.descriptionPopup = false;
- }
- }
-
- render() {
- const guid = Utils.GenerateGuid();
- const flexDir: any = StrCast(this.Document.flexDirection);
- const backgroundColor = this.props.styleProvider?.(this.rootDoc, this.props, StyleProp.BackgroundColor);
- const color = this.props.styleProvider?.(this.rootDoc, this.props, StyleProp.Color);
-
- const menuOpener = <label htmlFor={`${guid}`} style={{ pointerEvents: "all", cursor: "pointer", background: backgroundColor === color ? "black" : backgroundColor, }}
- onPointerDown={e => e.stopPropagation()} >
- <p>{BoolCast(this.layoutDoc.linearViewIsExpanded) ? "–" : "+"}</p>
- </label>;
-
- return <div className="collectionLinearView-outer">
- <div className="collectionLinearView" ref={this.createDashEventsTarget} >
- <Tooltip title={<><div className="dash-tooltip">{BoolCast(this.layoutDoc.linearViewIsExpanded) ? "Close menu" : "Open menu"}</div></>} placement="top">
- {menuOpener}
- </Tooltip>
- <input id={`${guid}`} type="checkbox" checked={BoolCast(this.layoutDoc.linearViewIsExpanded)} ref={this.addMenuToggle}
- onChange={action(() => this.layoutDoc.linearViewIsExpanded = this.addMenuToggle.current!.checked)} />
-
- <div className="collectionLinearView-content" style={{ height: this.dimension(), flexDirection: flexDir }}>
- {this.childLayoutPairs.map((pair, ind) => {
- const nested = pair.layout._viewType === CollectionViewType.Linear;
- const dref = React.createRef<HTMLDivElement>();
- const scalable = pair.layout.onClick || pair.layout.onDragStart;
- return <div className={`collectionLinearView-docBtn` + (scalable ? "-scalable" : "")} key={pair.layout[Id]} ref={dref}
- style={{
- pointerEvents: "all",
- minWidth: 30,
- width: nested ? pair.layout[WidthSym]() : this.dimension(),
- height: nested && pair.layout.linearViewIsExpanded ? pair.layout[HeightSym]() : this.dimension(),
- }} >
- <DocumentView
- Document={pair.layout}
- DataDoc={pair.data}
- isContentActive={returnFalse}
- isDocumentActive={returnTrue}
- addDocument={this.props.addDocument}
- moveDocument={this.props.moveDocument}
- addDocTab={this.props.addDocTab}
- pinToPres={emptyFunction}
- rootSelected={this.props.isSelected}
- removeDocument={this.props.removeDocument}
- ScreenToLocalTransform={this.getTransform(dref)}
- PanelWidth={nested ? pair.layout[WidthSym] : this.dimension}
- PanelHeight={nested ? pair.layout[HeightSym] : this.dimension}
- renderDepth={this.props.renderDepth + 1}
- focus={emptyFunction}
- styleProvider={this.props.styleProvider}
- layerProvider={this.props.layerProvider}
- docViewPath={returnEmptyDoclist}
- whenChildContentsActiveChanged={emptyFunction}
- bringToFront={emptyFunction}
- docFilters={this.props.docFilters}
- docRangeFilters={this.props.docRangeFilters}
- searchFilterDocs={this.props.searchFilterDocs}
- ContainingCollectionView={undefined}
- ContainingCollectionDoc={undefined} />
- </div>;
- })}
- </div>
- {DocumentLinksButton.StartLink ? <span className="bottomPopup-background" style={{
- pointerEvents: "all"
- }}
- onPointerDown={e => e.stopPropagation()} >
- <span className="bottomPopup-text" >
- Creating link from: <b>{DocumentLinksButton.AnnotationId ? "Annotation in " : " "} {StrCast(DocumentLinksButton.StartLink.title).length < 51 ? DocumentLinksButton.StartLink.title : StrCast(DocumentLinksButton.StartLink.title).slice(0, 50) + '...'}</b>
- </span>
-
- <Tooltip title={<><div className="dash-tooltip">{"Toggle description pop-up"} </div></>} placement="top">
- <span className="bottomPopup-descriptions" onClick={this.changeDescriptionSetting}>
- Labels: {LinkDescriptionPopup.showDescriptions ? LinkDescriptionPopup.showDescriptions : "ON"}
- </span>
- </Tooltip>
-
- <Tooltip title={<><div className="dash-tooltip">Exit linking mode</div></>} placement="top">
- <span className="bottomPopup-exit" onClick={this.exitLongLinks}>
- Stop
- </span>
- </Tooltip>
-
- </span> : null}
- </div>
- </div>;
- }
-} \ No newline at end of file
diff --git a/src/client/views/collections/CollectionMenu.scss b/src/client/views/collections/CollectionMenu.scss
index f04b19ef7..c35f088a6 100644
--- a/src/client/views/collections/CollectionMenu.scss
+++ b/src/client/views/collections/CollectionMenu.scss
@@ -1,628 +1,659 @@
@import "../global/globalCssVariables";
-.collectionMenu-cont {
- position: relative;
- display: inline-flex;
- width: 100%;
- opacity: 0.9;
- z-index: 901;
- transition: top .5s;
- background: $dark-gray;
- color: $white;
- transform-origin: top left;
- top: 0;
- width: 100%;
-
- .recordButtonOutline {
- border-radius: 100%;
- width: 18px;
- height: 18px;
- border: solid 1px $white;
- display: flex;
- align-items: center;
- justify-content: center;
- }
-
- .recordButtonInner {
- border-radius: 100%;
- width: 70%;
- height: 70%;
- background: $white;
- }
-
- .collectionMenu {
- display: flex;
- height: 100%;
- overflow: visible;
- z-index: 901;
- border: unset;
-
- .collectionMenu-divider {
- height: 100%;
- margin-left: 3px;
- margin-right: 3px;
- width: 2px;
- background-color: $medium-gray;
- }
-
- .collectionViewBaseChrome {
- display: flex;
- align-items: center;
-
- .collectionViewBaseChrome-viewPicker {
- font-size: $small-text;
- outline-color: $black;
- color: $white;
- border: none;
- background: $dark-gray;
- }
-
- .collectionViewBaseChrome-viewPicker:focus {
- outline: none;
- border: none;
- }
-
- .collectionViewBaseChrome-viewPicker:active {
- outline-color: $black;
- }
-
- .collectionViewBaseChrome-button {
- font-size: $small-text;
- text-transform: uppercase;
- letter-spacing: 2px;
- background: $white;
- color: $pink;
- outline-color: $black;
- border: none;
- padding: 12px 10px 11px 10px;
- margin-left: 10px;
- }
-
- .collectionViewBaseChrome-cmdPicker {
- margin-left: 3px;
- margin-right: 0px;
- font-size: $small-text;
- text-transform: capitalize;
- color: $white;
- border: none;
- background: $dark-gray;
- }
-
- .collectionViewBaseChrome-cmdPicker:focus {
- border: none;
- outline: none;
- }
-
- .commandEntry-outerDiv {
- pointer-events: all;
- background-color: transparent;
- display: flex;
- flex-direction: row;
- align-items: center;
- justify-content: center;
- height: 100%;
- overflow: hidden;
-
- .commandEntry-drop {
- color: $white;
- width: 30px;
- margin-top: auto;
- margin-bottom: auto;
- }
- }
-
- .commandEntry-outerDiv:hover{
- background-color: $drop-shadow;
-
- .collectionViewBaseChrome-viewPicker,
- .collectionViewBaseChrome-cmdPicker{
- background: $dark-gray;
- }
- }
-
- .collectionViewBaseChrome-collapse {
- transition: all .5s, opacity 0.3s;
- position: absolute;
- width: 30px;
- transform-origin: top left;
- pointer-events: all;
- // margin-top: 10px;
- }
-
- @media only screen and (max-device-width: 480px) {
- .collectionViewBaseChrome-collapse {
- display: none;
- }
- }
-
- .collectionViewBaseChrome-template,
- .collectionViewBaseChrome-viewModes {
- align-items: center;
- height: 100%;
- display: flex;
- background: transparent;
- color: $medium-gray;
- justify-content: center;
- }
-
- .collectionViewBaseChrome-viewSpecs {
- margin-left: 5px;
- display: grid;
- border: none;
- border-right: solid $medium-gray 1px;
-
- .collectionViewBaseChrome-filterIcon {
- position: relative;
- display: flex;
- margin: auto;
- background: $dark-gray;
- color: $white;
- width: 30px;
- height: 30px;
- align-items: center;
- justify-content: center;
- border: none;
- border-right: solid $medium-gray 1px;
- }
-
- .collectionViewBaseChrome-viewSpecsInput {
- padding: 12px 10px 11px 10px;
- border: 0px;
- color: $medium-gray;
- text-align: center;
- letter-spacing: 2px;
- outline-color: $black;
- font-size: $small-text;
- background: $white;
- height: 100%;
- width: 75px;
- }
-
- .collectionViewBaseChrome-viewSpecsMenu {
- overflow: hidden;
- transition: height .5s, display .5s;
- position: absolute;
- top: 60px;
- z-index: 100;
- display: flex;
- flex-direction: column;
- background: $white;
- box-shadow: $medium-gray 2px 2px 4px;
-
- .qs-datepicker {
- left: unset;
- right: 0;
- }
-
- .collectionViewBaseChrome-viewSpecsMenu-row {
- display: grid;
- grid-template-columns: 150px 200px 150px;
- margin-top: 10px;
- margin-right: 10px;
-
- .collectionViewBaseChrome-viewSpecsMenu-rowLeft,
- .collectionViewBaseChrome-viewSpecsMenu-rowMiddle,
- .collectionViewBaseChrome-viewSpecsMenu-rowRight {
- font-size: $small-text;
- letter-spacing: 2px;
- color: $medium-gray;
- margin-left: 10px;
- padding: 5px;
- border: none;
- outline-color: $black;
- }
- }
-
- .collectionViewBaseChrome-viewSpecsMenu-lastRow {
- display: grid;
- grid-template-columns: 1fr 1fr 1fr;
- grid-gap: 10px;
- margin: 10px;
- }
- }
- }
- }
-
- .collectionStackingViewChrome-cont,
- .collectionTreeViewChrome-cont,
- .collection3DCarouselViewChrome-cont {
- display: flex;
- justify-content: space-between;
- }
-
- .collectionGridViewChrome-cont {
- display: flex;
- margin-left: 10;
-
- .collectionGridViewChrome-viewPicker {
- font-size: $small-text;
- //text-transform: uppercase;
- //letter-spacing: 2px;
- background: $dark-gray;
- color: $white;
- outline-color: $black;
- color: $white;
- border: none;
- border-right: solid $medium-gray 1px;
- }
-
- .collectionGridViewChrome-viewPicker:active {
- outline-color: $black;
- }
-
- .grid-control {
- align-self: center;
- display: flex;
- flex-direction: row;
- margin-right: 5px;
-
- .grid-icon {
- margin-right: 5px;
- align-self: center;
- }
-
- .flexLabel {
- margin-bottom: 0;
- }
-
- .collectionGridViewChrome-entryBox {
- width: 50%;
- color: $black;
- }
-
- .collectionGridViewChrome-columnButton {
- color: $black;
- }
- }
- }
-
- .collectionStackingViewChrome-sort,
- .collectionTreeViewChrome-sort {
- display: flex;
- align-items: center;
- justify-content: space-between;
-
- .collectionStackingViewChrome-sortIcon,
- .collectionTreeViewChrome-sortIcon {
- transition: transform .5s;
- margin-left: 10px;
- }
- }
-
- button:hover {
- transform: scale(1);
- }
-
-
- .collectionStackingViewChrome-pivotField-cont,
- .collectionTreeViewChrome-pivotField-cont,
- .collection3DCarouselViewChrome-scrollSpeed-cont {
- justify-self: right;
- align-items: center;
- display: flex;
- grid-auto-columns: auto;
- font-size: $small-text;
- letter-spacing: 2px;
-
- .collectionStackingViewChrome-pivotField-label,
- .collectionTreeViewChrome-pivotField-label,
- .collection3DCarouselViewChrome-scrollSpeed-label {
- grid-column: 1;
- margin-right: 7px;
- user-select: none;
- font-family: $sans-serif;
- letter-spacing: normal;
- }
-
- .collectionStackingViewChrome-sortIcon {
- transition: transform .5s;
- grid-column: 3;
- text-align: center;
- display: flex;
- justify-content: center;
- align-items: center;
- cursor: pointer;
- width: 25px;
- height: 25px;
- border-radius: 100%;
- }
-
- .collectionStackingViewChrome-sortIcon:hover {
- background-color: $drop-shadow;
- }
-
- .collectionStackingViewChrome-pivotField,
- .collectionTreeViewChrome-pivotField,
- .collection3DCarouselViewChrome-scrollSpeed {
- color: $white;
- grid-column: 2;
- grid-row: 1;
- width: 90%;
- min-width: 100px;
- display: flex;
- height: 80%;
- border-radius: 7px;
- align-items: center;
- background: $white;
-
- .editable-view-input,
- input,
- .editableView-container-editing-oneLine,
- .editableView-container-editing {
- margin: auto;
- border: 0px;
- color: $light-gray !important;
- text-align: center;
- letter-spacing: 2px;
- outline-color: $black;
- height: 100%;
- }
-
- .react-autosuggest__container {
- margin: 0;
- color: $medium-gray;
- padding: 0px;
- }
- }
- }
-
- .collectionStackingViewChrome-pivotField:hover,
- .collectionTreeViewChrome-pivotField:hover,
- .collection3DCarouselViewChrome-scrollSpeed:hover {
- cursor: text;
- }
-
- }
-}
-
-.collectionMenu-webUrlButtons {
- margin-left: 44;
- background: lightGray;
+.collectionMenu-container {
display: flex;
-}
-
-.webBox-urlEditor {
- position: relative;
- opacity: 0.9;
- z-index: 901;
- transition: top .5s;
-
- .urlEditor {
- display: grid;
- grid-template-columns: 1fr auto;
- padding-bottom: 10px;
- overflow: hidden;
- margin-top: 5px;
- height: 35px;
-
- .editorBase {
- display: flex;
-
- .editor-collapse {
- transition: all .5s, opacity 0.3s;
- position: absolute;
- width: 40px;
- transform-origin: top left;
- }
-
- .switchToText {
- color: $medium-gray;
- }
-
- .switchToText:hover {
- color: $dark-gray;
- }
- }
-
- button:hover {
- transform: scale(1);
- }
- }
-}
-
-.collectionMenu-urlInput {
- padding: 12px 10px 11px 10px;
- border: 0px;
- color: $black;
- font-size: $small-text;
- letter-spacing: 2px;
- outline-color: $black;
- background: $white;
- width: 100%;
- min-width: 350px;
- margin-right: 10px;
- height: 100%;
-}
-
-.collectionFreeFormMenu-cont {
- display: inline-flex;
position: relative;
+ align-content: center;
+ justify-content: space-between;
+ background-color: $dark-gray;
+ height: 35px;
+ border-bottom: $standard-border;
+ padding-right: 5px;
align-items: center;
- height: 100%;
-
- .color-previewI {
- width: 60%;
- top: 80%;
- position: absolute;
- height: 4px;
- }
-
- .color-previewII {
- width: 80%;
- height: 80%;
- margin-left: 10%;
- position: absolute;
- bottom: 5;
- }
-
- .btn-group {
- display: grid;
- grid-template-columns: auto auto auto auto;
- margin: auto;
- /* Make the buttons appear below each other */
- }
- .btn-draw {
- display: inline-flex;
- margin: auto;
- /* Make the buttons appear below each other */
- }
-
- .fwdKeyframe,
- .numKeyframe,
- .backKeyframe {
+ .collectionMenu-hardCodedButton {
cursor: pointer;
- position: relative;
- width: 20;
- height: 30;
- bottom: 0;
- background: $dark-gray;
- display: inline-flex;
- align-items: center;
color: $white;
- }
-
- .backKeyframe {
- svg {
- display: block;
- margin: auto;
- }
- }
-
-
- .numKeyframe {
- flex-direction: column;
- padding-top: 5px;
- }
-
- .fwdKeyframe {
- svg {
- display: block;
- margin: auto;
- }
-
- border-right: solid $medium-gray 1px;
- }
-}
-
-.collectionSchemaViewChrome-cont {
- display: flex;
- font-size: $small-text;
-
- .collectionSchemaViewChrome-toggle {
- display: flex;
- margin-left: 10px;
- }
-
- .collectionSchemaViewChrome-label {
- text-transform: uppercase;
- letter-spacing: 2px;
- margin-right: 5px;
+ width: 25px;
+ height: 25px;
+ padding: 5;
+ text-align: center;
display: flex;
- flex-direction: column;
justify-content: center;
- }
-
- .collectionSchemaViewChrome-toggler {
- width: 100px;
- height: 35px;
- background-color: $black;
+ align-items: center;
position: relative;
- }
-
- .collectionSchemaViewChrome-togglerButton {
- width: 47px;
- height: 30px;
- background-color: $light-gray;
- // position: absolute;
- transition: all 0.5s ease;
- // top: 3px;
- margin-top: 3px;
- color: $medium-gray;
- letter-spacing: 2px;
- text-transform: uppercase;
- display: flex;
- flex-direction: column;
- justify-content: center;
- text-align: center;
+ transition: 0.2s;
+ border-radius: 3px;
- &.on {
- margin-left: 3px;
- }
-
- &.off {
- margin-left: 50px;
+ &:hover {
+ background-color: rgba(0, 0, 0, 0.2);
}
}
}
-
-.commandEntry-outerDiv {
- display: flex;
- flex-direction: column;
- height: 40px;
-}
-
-.commandEntry-inputArea {
- display: flex;
- flex-direction: row;
- width: 150px;
- margin: auto auto auto auto;
-}
-
-.react-autosuggest__container {
- position: relative;
- width: 100%;
- margin-left: 5px;
- margin-right: 5px;
-}
-
-.react-autosuggest__input {
- border: 1px solid $light-gray;
- border-radius: 4px;
- width: 100%;
-}
-
-.react-autosuggest__input--focused {
- outline: none;
-}
-
-.react-autosuggest__input--open {
- border-bottom-left-radius: 0;
- border-bottom-right-radius: 0;
-}
-
-.react-autosuggest__suggestions-container {
- display: none;
-}
-
-.react-autosuggest__suggestions-container--open {
- display: block;
- position: fixed;
- overflow-y: auto;
- max-height: 400px;
- width: 180px;
- border: 1px solid $light-gray;
- background-color: $white;
- font-family: $sans-serif;
- font-weight: 300;
- font-size: $large-header;
- border-bottom-left-radius: 4px;
- border-bottom-right-radius: 4px;
- z-index: 2;
-}
-
-.react-autosuggest__suggestions-list {
- margin: 0;
- padding: 0;
- list-style-type: none;
-}
-
-.react-autosuggest__suggestion {
- cursor: pointer;
- padding: 10px 20px;
-}
-
-.react-autosuggest__suggestion--highlighted {
- background-color: $light-gray;
-} \ No newline at end of file
+// .collectionMenu-cont {
+// position: relative;
+// display: inline-flex;
+// width: 100%;
+// opacity: 0.9;
+// z-index: 901;
+// transition: top .5s;
+// background: $dark-gray;
+// color: $white;
+// transform-origin: top left;
+// top: 0;
+// width: 100%;
+
+// .recordButtonOutline {
+// border-radius: 100%;
+// width: 18px;
+// height: 18px;
+// border: solid 1px $white;
+// display: flex;
+// align-items: center;
+// justify-content: center;
+// }
+
+// .recordButtonInner {
+// border-radius: 100%;
+// width: 70%;
+// height: 70%;
+// background: $white;
+// }
+
+// .collectionMenu {
+// display: flex;
+// height: 100%;
+// overflow: visible;
+// z-index: 901;
+// border: unset;
+
+// .collectionMenu-divider {
+// height: 100%;
+// margin-left: 3px;
+// margin-right: 3px;
+// width: 2px;
+// background-color: $medium-gray;
+// }
+
+// .collectionViewBaseChrome {
+// display: flex;
+// align-items: center;
+
+// .collectionViewBaseChrome-viewPicker {
+// font-size: $small-text;
+// outline-color: $black;
+// color: $white;
+// border: none;
+// background: $dark-gray;
+// }
+
+// .collectionViewBaseChrome-viewPicker:focus {
+// outline: none;
+// border: none;
+// }
+
+// .collectionViewBaseChrome-viewPicker:active {
+// outline-color: $black;
+// }
+
+// .collectionViewBaseChrome-button {
+// font-size: $small-text;
+// text-transform: uppercase;
+// letter-spacing: 2px;
+// background: $white;
+// color: $pink;
+// outline-color: $black;
+// border: none;
+// padding: 12px 10px 11px 10px;
+// margin-left: 10px;
+// }
+
+// .collectionViewBaseChrome-cmdPicker {
+// margin-left: 3px;
+// margin-right: 0px;
+// font-size: $small-text;
+// text-transform: capitalize;
+// color: $white;
+// border: none;
+// background: $dark-gray;
+// }
+
+// .collectionViewBaseChrome-cmdPicker:focus {
+// border: none;
+// outline: none;
+// }
+
+// .commandEntry-outerDiv {
+// pointer-events: all;
+// background-color: transparent;
+// display: flex;
+// flex-direction: row;
+// align-items: center;
+// justify-content: center;
+// height: 100%;
+// overflow: hidden;
+
+// .commandEntry-drop {
+// color: $white;
+// width: 30px;
+// margin-top: auto;
+// margin-bottom: auto;
+// }
+// }
+
+// .commandEntry-outerDiv:hover{
+// background-color: $drop-shadow;
+
+// .collectionViewBaseChrome-viewPicker,
+// .collectionViewBaseChrome-cmdPicker{
+// background: $dark-gray;
+// }
+// }
+
+// .collectionViewBaseChrome-collapse {
+// transition: all .5s, opacity 0.3s;
+// position: absolute;
+// width: 30px;
+// transform-origin: top left;
+// pointer-events: all;
+// // margin-top: 10px;
+// }
+
+// @media only screen and (max-device-width: 480px) {
+// .collectionViewBaseChrome-collapse {
+// display: none;
+// }
+// }
+
+// .collectionViewBaseChrome-template,
+// .collectionViewBaseChrome-viewModes {
+// align-items: center;
+// height: 100%;
+// display: flex;
+// background: transparent;
+// color: $medium-gray;
+// justify-content: center;
+// }
+
+// .collectionViewBaseChrome-viewSpecs {
+// margin-left: 5px;
+// display: grid;
+// border: none;
+// border-right: solid $medium-gray 1px;
+
+// .collectionViewBaseChrome-filterIcon {
+// position: relative;
+// display: flex;
+// margin: auto;
+// background: $dark-gray;
+// color: $white;
+// width: 30px;
+// height: 30px;
+// align-items: center;
+// justify-content: center;
+// border: none;
+// border-right: solid $medium-gray 1px;
+// }
+
+// .collectionViewBaseChrome-viewSpecsInput {
+// padding: 12px 10px 11px 10px;
+// border: 0px;
+// color: $medium-gray;
+// text-align: center;
+// letter-spacing: 2px;
+// outline-color: $black;
+// font-size: $small-text;
+// background: $white;
+// height: 100%;
+// width: 75px;
+// }
+
+// .collectionViewBaseChrome-viewSpecsMenu {
+// overflow: hidden;
+// transition: height .5s, display .5s;
+// position: absolute;
+// top: 60px;
+// z-index: 100;
+// display: flex;
+// flex-direction: column;
+// background: $white;
+// box-shadow: $medium-gray 2px 2px 4px;
+
+// .qs-datepicker {
+// left: unset;
+// right: 0;
+// }
+
+// .collectionViewBaseChrome-viewSpecsMenu-row {
+// display: grid;
+// grid-template-columns: 150px 200px 150px;
+// margin-top: 10px;
+// margin-right: 10px;
+
+// .collectionViewBaseChrome-viewSpecsMenu-rowLeft,
+// .collectionViewBaseChrome-viewSpecsMenu-rowMiddle,
+// .collectionViewBaseChrome-viewSpecsMenu-rowRight {
+// font-size: $small-text;
+// letter-spacing: 2px;
+// color: $medium-gray;
+// margin-left: 10px;
+// padding: 5px;
+// border: none;
+// outline-color: $black;
+// }
+// }
+
+// .collectionViewBaseChrome-viewSpecsMenu-lastRow {
+// display: grid;
+// grid-template-columns: 1fr 1fr 1fr;
+// grid-gap: 10px;
+// margin: 10px;
+// }
+// }
+// }
+// }
+
+// .collectionStackingViewChrome-cont,
+// .collectionTreeViewChrome-cont,
+// .collection3DCarouselViewChrome-cont {
+// display: flex;
+// justify-content: space-between;
+// }
+
+// .collectionGridViewChrome-cont {
+// display: flex;
+// margin-left: 10;
+
+// .collectionGridViewChrome-viewPicker {
+// font-size: $small-text;
+// //text-transform: uppercase;
+// //letter-spacing: 2px;
+// background: $dark-gray;
+// color: $white;
+// outline-color: $black;
+// color: $white;
+// border: none;
+// border-right: solid $medium-gray 1px;
+// }
+
+// .collectionGridViewChrome-viewPicker:active {
+// outline-color: $black;
+// }
+
+// .grid-control {
+// align-self: center;
+// display: flex;
+// flex-direction: row;
+// margin-right: 5px;
+
+// .grid-icon {
+// margin-right: 5px;
+// align-self: center;
+// }
+
+// .flexLabel {
+// margin-bottom: 0;
+// }
+
+// .collectionGridViewChrome-entryBox {
+// width: 50%;
+// color: $black;
+// }
+
+// .collectionGridViewChrome-columnButton {
+// color: $black;
+// }
+// }
+// }
+
+// .collectionStackingViewChrome-sort,
+// .collectionTreeViewChrome-sort {
+// display: flex;
+// align-items: center;
+// justify-content: space-between;
+
+// .collectionStackingViewChrome-sortIcon,
+// .collectionTreeViewChrome-sortIcon {
+// transition: transform .5s;
+// margin-left: 10px;
+// }
+// }
+
+// button:hover {
+// transform: scale(1);
+// }
+
+
+// .collectionStackingViewChrome-pivotField-cont,
+// .collectionTreeViewChrome-pivotField-cont,
+// .collection3DCarouselViewChrome-scrollSpeed-cont {
+// justify-self: right;
+// align-items: center;
+// display: flex;
+// grid-auto-columns: auto;
+// font-size: $small-text;
+// letter-spacing: 2px;
+
+// .collectionStackingViewChrome-pivotField-label,
+// .collectionTreeViewChrome-pivotField-label,
+// .collection3DCarouselViewChrome-scrollSpeed-label {
+// grid-column: 1;
+// margin-right: 7px;
+// user-select: none;
+// font-family: $sans-serif;
+// letter-spacing: normal;
+// }
+
+// .collectionStackingViewChrome-sortIcon {
+// transition: transform .5s;
+// grid-column: 3;
+// text-align: center;
+// display: flex;
+// justify-content: center;
+// align-items: center;
+// cursor: pointer;
+// width: 25px;
+// height: 25px;
+// border-radius: 100%;
+// }
+
+// .collectionStackingViewChrome-sortIcon:hover {
+// background-color: $drop-shadow;
+// }
+
+// .collectionStackingViewChrome-pivotField,
+// .collectionTreeViewChrome-pivotField,
+// .collection3DCarouselViewChrome-scrollSpeed {
+// color: $white;
+// grid-column: 2;
+// grid-row: 1;
+// width: 90%;
+// min-width: 100px;
+// display: flex;
+// height: 80%;
+// border-radius: 7px;
+// align-items: center;
+// background: $white;
+
+// .editable-view-input,
+// input,
+// .editableView-container-editing-oneLine,
+// .editableView-container-editing {
+// margin: auto;
+// border: 0px;
+// color: $light-gray !important;
+// text-align: center;
+// letter-spacing: 2px;
+// outline-color: $black;
+// height: 100%;
+// }
+
+// .react-autosuggest__container {
+// margin: 0;
+// color: $medium-gray;
+// padding: 0px;
+// }
+// }
+// }
+
+// .collectionStackingViewChrome-pivotField:hover,
+// .collectionTreeViewChrome-pivotField:hover,
+// .collection3DCarouselViewChrome-scrollSpeed:hover {
+// cursor: text;
+// }
+
+// }
+// }
+
+// .collectionMenu-webUrlButtons {
+// margin-left: 44;
+// background: lightGray;
+// display: flex;
+// }
+
+// .webBox-urlEditor {
+// position: relative;
+// opacity: 0.9;
+// z-index: 901;
+// transition: top .5s;
+
+// .urlEditor {
+// display: grid;
+// grid-template-columns: 1fr auto;
+// padding-bottom: 10px;
+// overflow: hidden;
+// margin-top: 5px;
+// height: 35px;
+
+// .editorBase {
+// display: flex;
+
+// .editor-collapse {
+// transition: all .5s, opacity 0.3s;
+// position: absolute;
+// width: 40px;
+// transform-origin: top left;
+// }
+
+// .switchToText {
+// color: $medium-gray;
+// }
+
+// .switchToText:hover {
+// color: $dark-gray;
+// }
+// }
+
+// button:hover {
+// transform: scale(1);
+// }
+// }
+// }
+
+// .collectionMenu-urlInput {
+// padding: 12px 10px 11px 10px;
+// border: 0px;
+// color: $black;
+// font-size: $small-text;
+// letter-spacing: 2px;
+// outline-color: $black;
+// background: $white;
+// width: 100%;
+// min-width: 350px;
+// margin-right: 10px;
+// height: 100%;
+// }
+
+// .collectionFreeFormMenu-cont {
+// display: inline-flex;
+// position: relative;
+// align-items: center;
+// height: 100%;
+
+// .color-previewI {
+// width: 60%;
+// top: 80%;
+// position: absolute;
+// height: 4px;
+// }
+
+// .color-previewII {
+// width: 80%;
+// height: 80%;
+// margin-left: 10%;
+// position: absolute;
+// bottom: 5;
+// }
+
+// .btn-group {
+// display: grid;
+// grid-template-columns: auto auto auto auto;
+// margin: auto;
+// /* Make the buttons appear below each other */
+// }
+
+// .btn-draw {
+// display: inline-flex;
+// margin: auto;
+// /* Make the buttons appear below each other */
+// }
+
+// .fwdKeyframe,
+// .numKeyframe,
+// .backKeyframe {
+// cursor: pointer;
+// position: relative;
+// width: 20;
+// height: 30;
+// bottom: 0;
+// background: $dark-gray;
+// display: inline-flex;
+// align-items: center;
+// color: $white;
+// }
+
+// .backKeyframe {
+// svg {
+// display: block;
+// margin: auto;
+// }
+// }
+
+
+// .numKeyframe {
+// flex-direction: column;
+// padding-top: 5px;
+// }
+
+// .fwdKeyframe {
+// svg {
+// display: block;
+// margin: auto;
+// }
+
+// border-right: solid $medium-gray 1px;
+// }
+// }
+
+// .collectionSchemaViewChrome-cont {
+// display: flex;
+// font-size: $small-text;
+
+// .collectionSchemaViewChrome-toggle {
+// display: flex;
+// margin-left: 10px;
+// }
+
+// .collectionSchemaViewChrome-label {
+// text-transform: uppercase;
+// letter-spacing: 2px;
+// margin-right: 5px;
+// display: flex;
+// flex-direction: column;
+// justify-content: center;
+// }
+
+// .collectionSchemaViewChrome-toggler {
+// width: 100px;
+// height: 35px;
+// background-color: $black;
+// position: relative;
+// }
+
+// .collectionSchemaViewChrome-togglerButton {
+// width: 47px;
+// height: 30px;
+// background-color: $light-gray;
+// // position: absolute;
+// transition: all 0.5s ease;
+// // top: 3px;
+// margin-top: 3px;
+// color: $medium-gray;
+// letter-spacing: 2px;
+// text-transform: uppercase;
+// display: flex;
+// flex-direction: column;
+// justify-content: center;
+// text-align: center;
+
+// &.on {
+// margin-left: 3px;
+// }
+
+// &.off {
+// margin-left: 50px;
+// }
+// }
+// }
+
+
+// .commandEntry-outerDiv {
+// display: flex;
+// flex-direction: column;
+// height: 40px;
+// }
+
+// .commandEntry-inputArea {
+// display: flex;
+// flex-direction: row;
+// width: 150px;
+// margin: auto auto auto auto;
+// }
+
+// .react-autosuggest__container {
+// position: relative;
+// width: 100%;
+// margin-left: 5px;
+// margin-right: 5px;
+// }
+
+// .react-autosuggest__input {
+// border: 1px solid $light-gray;
+// border-radius: 4px;
+// width: 100%;
+// }
+
+// .react-autosuggest__input--focused {
+// outline: none;
+// }
+
+// .react-autosuggest__input--open {
+// border-bottom-left-radius: 0;
+// border-bottom-right-radius: 0;
+// }
+
+// .react-autosuggest__suggestions-container {
+// display: none;
+// }
+
+// .react-autosuggest__suggestions-container--open {
+// display: block;
+// position: fixed;
+// overflow-y: auto;
+// max-height: 400px;
+// width: 180px;
+// border: 1px solid $light-gray;
+// background-color: $white;
+// font-family: $sans-serif;
+// font-weight: 300;
+// font-size: $large-header;
+// border-bottom-left-radius: 4px;
+// border-bottom-right-radius: 4px;
+// z-index: 2;
+// }
+
+// .react-autosuggest__suggestions-list {
+// margin: 0;
+// padding: 0;
+// list-style-type: none;
+// }
+
+// .react-autosuggest__suggestion {
+// cursor: pointer;
+// padding: 10px 20px;
+// }
+
+// .react-autosuggest__suggestion--highlighted {
+// background-color: $light-gray;
+// } \ No newline at end of file
diff --git a/src/client/views/collections/CollectionMenu.tsx b/src/client/views/collections/CollectionMenu.tsx
index a5f54c342..131f5ba46 100644
--- a/src/client/views/collections/CollectionMenu.tsx
+++ b/src/client/views/collections/CollectionMenu.tsx
@@ -2,7 +2,7 @@ import React = require("react");
import { IconProp } from '@fortawesome/fontawesome-svg-core';
import { FontAwesomeIcon, FontAwesomeIconProps } from "@fortawesome/react-fontawesome";
import { Tooltip } from "@material-ui/core";
-import { action, computed, Lambda, observable, reaction, runInAction } from "mobx";
+import { action, computed, Lambda, observable, reaction, runInAction, trace } from "mobx";
import { observer } from "mobx-react";
import { ColorState } from "react-color";
import { Doc, DocListCast, Opt } from "../../../fields/Doc";
@@ -15,37 +15,47 @@ import { RichTextField } from "../../../fields/RichTextField";
import { listSpec } from "../../../fields/Schema";
import { ScriptField } from "../../../fields/ScriptField";
import { BoolCast, Cast, NumCast, StrCast } from "../../../fields/Types";
-import { emptyFunction, setupMoveUpEvents, Utils } from "../../../Utils";
+import { emptyFunction, returnEmptyDoclist, returnEmptyFilter, returnFalse, returnTrue, setupMoveUpEvents, Utils } from "../../../Utils";
+import { Docs } from "../../documents/Documents";
import { DocumentType } from "../../documents/DocumentTypes";
import { CurrentUserUtils } from "../../util/CurrentUserUtils";
import { DragManager } from "../../util/DragManager";
import { Scripting } from "../../util/Scripting";
import { SelectionManager } from "../../util/SelectionManager";
+import { Transform } from "../../util/Transform";
import { undoBatch } from "../../util/UndoManager";
import { AntimodeMenu, AntimodeMenuProps } from "../AntimodeMenu";
import { EditableView } from "../EditableView";
import { GestureOverlay } from "../GestureOverlay";
-import { ActiveFillColor, ActiveInkColor, SetActiveArrowEnd, SetActiveArrowStart, SetActiveBezierApprox, SetActiveFillColor, SetActiveInkColor, SetActiveInkWidth, ActiveArrowStart, ActiveArrowEnd } from "../InkingStroke";
+import { ActiveFillColor, ActiveInkColor, SetActiveArrowEnd, SetActiveArrowStart, SetActiveBezierApprox, SetActiveFillColor, SetActiveInkColor, SetActiveInkWidth } from "../InkingStroke";
+import { LightboxView } from "../LightboxView";
import { CollectionFreeFormDocumentView } from "../nodes/CollectionFreeFormDocumentView";
import { DocumentView } from "../nodes/DocumentView";
+import { FormattedTextBox } from "../nodes/formattedText/FormattedTextBox";
import { RichTextMenu } from "../nodes/formattedText/RichTextMenu";
import { PresBox } from "../nodes/trails/PresBox";
+import { DefaultStyleProvider } from "../StyleProvider";
+import { CollectionDockingView } from "./CollectionDockingView";
+import { CollectionLinearView } from "./collectionLinear";
import "./CollectionMenu.scss";
import { CollectionViewType, COLLECTION_BORDER_WIDTH } from "./CollectionView";
import { TabDocView } from "./TabDocView";
-import { LightboxView } from "../LightboxView";
-import { Docs } from "../../documents/Documents";
-import { DocumentManager } from "../../util/DocumentManager";
-import { CollectionDockingView } from "./CollectionDockingView";
-import { FormattedTextBox } from "../nodes/formattedText/FormattedTextBox";
+import { Colors } from "../global/globalEnums";
+
+interface CollectionMenuProps {
+ panelHeight: () => number;
+ panelWidth: () => number;
+}
@observer
-export class CollectionMenu extends AntimodeMenu<AntimodeMenuProps> {
+export class CollectionMenu extends AntimodeMenu<CollectionMenuProps>{
@observable static Instance: CollectionMenu;
@observable SelectedCollection: DocumentView | undefined;
@observable FieldKey: string;
+ private _docBtnRef = React.createRef<HTMLDivElement>();
+
constructor(props: any) {
super(props);
this.FieldKey = "";
@@ -57,7 +67,7 @@ export class CollectionMenu extends AntimodeMenu<AntimodeMenuProps> {
componentDidMount() {
reaction(() => SelectionManager.Views().length && SelectionManager.Views()[0],
- (doc) => doc && this.SetSelection(doc));
+ view => view && this.SetSelection(view));
}
@action
@@ -82,34 +92,92 @@ export class CollectionMenu extends AntimodeMenu<AntimodeMenuProps> {
}
}
+ buttonBarXf = () => {
+ if (!this._docBtnRef.current) return Transform.Identity();
+ const { scale, translateX, translateY } = Utils.GetScreenTransform(this._docBtnRef.current);
+ return new Transform(-translateX, -translateY, 1 / scale);
+ }
+
+ @computed get contMenuButtons() {
+ const selDoc = Doc.UserDoc().contextMenuBtns;
+ return !(selDoc instanceof Doc) ? (null) : <div className="collectionMenu-contMenuButtons" ref={this._docBtnRef} style={{ height: this.props.panelHeight() }} >
+ <CollectionLinearView
+ Document={selDoc}
+ DataDoc={undefined}
+ fieldKey={"data"}
+ dropAction={"alias"}
+ setHeight={returnFalse}
+ styleProvider={DefaultStyleProvider}
+ layerProvider={undefined}
+ rootSelected={returnTrue}
+ bringToFront={emptyFunction}
+ select={emptyFunction}
+ isContentActive={returnTrue}
+ isAnyChildContentActive={returnFalse}
+ isSelected={returnFalse}
+ docViewPath={returnEmptyDoclist}
+ moveDocument={returnFalse}
+ CollectionView={undefined}
+ addDocument={returnFalse}
+ addDocTab={returnFalse}
+ pinToPres={emptyFunction}
+ removeDocument={returnFalse}
+ ScreenToLocalTransform={this.buttonBarXf}
+ PanelWidth={this.props.panelWidth}
+ PanelHeight={this.props.panelHeight}
+ renderDepth={0}
+ focus={emptyFunction}
+ whenChildContentsActiveChanged={emptyFunction}
+ docFilters={returnEmptyFilter}
+ docRangeFilters={returnEmptyFilter}
+ searchFilterDocs={returnEmptyDoclist}
+ ContainingCollectionView={undefined}
+ ContainingCollectionDoc={undefined} />
+ </div>;
+ }
+
render() {
- const button = <Tooltip title={<div className="dash-tooltip">Pin Menu</div>} key="pin menu" placement="bottom">
- <button className="antimodeMenu-button" onClick={this.toggleMenuPin} style={{ backgroundColor: "#121721" }}>
- <FontAwesomeIcon icon="thumbtack" size="lg" style={{ transitionProperty: "transform", transitionDuration: "0.1s", transform: `rotate(${this.Pinned ? 45 : 0}deg)` }} />
- </button>
- </Tooltip>;
const propIcon = CurrentUserUtils.propertiesWidth > 0 ? "angle-double-right" : "angle-double-left";
const propTitle = CurrentUserUtils.propertiesWidth > 0 ? "Close Properties Panel" : "Open Properties Panel";
const prop = <Tooltip title={<div className="dash-tooltip">{propTitle}</div>} key="properties" placement="bottom">
- <button className="antimodeMenu-button" key="properties" style={{ backgroundColor: "#424242" }}
+ <div className="collectionMenu-hardCodedButton"
+ style={{ backgroundColor: CurrentUserUtils.propertiesWidth > 0 ? Colors.MEDIUM_BLUE : undefined }}
+ key="properties"
onPointerDown={this.toggleProperties}>
<FontAwesomeIcon icon={propIcon} size="lg" />
- </button>
+ </div>
</Tooltip>;
- return this.getElement(!this.SelectedCollection ? [/*button*/] :
- [<CollectionViewBaseChrome key="chrome"
- docView={this.SelectedCollection}
- fieldKey={this.SelectedCollection.LayoutFieldKey}
- type={StrCast(this.SelectedCollection?.props.Document._viewType, CollectionViewType.Invalid) as CollectionViewType} />,
- prop,
- /*button*/]);
+ // NEW BUTTONS
+ //dash col linear view buttons
+ const contMenuButtons =
+ <div className="collectionMenu-container">
+ {this.contMenuButtons}
+ {prop}
+ </div>;
+
+ return contMenuButtons;
+
+ // const button = <Tooltip title={<div className="dash-tooltip">Pin Menu</div>} key="pin menu" placement="bottom">
+ // <button className="antimodeMenu-button" onClick={this.toggleMenuPin} style={{ backgroundColor: "#121721" }}>
+ // <FontAwesomeIcon icon="thumbtack" size="lg" style={{ transitionProperty: "transform", transitionDuration: "0.1s", transform: `rotate(${this.Pinned ? 45 : 0}deg)` }} />
+ // </button>
+ // </Tooltip>;
+
+ // OLD BUTTONS
+ // return this.getElement(!this.SelectedCollection ? [/*button*/] :
+ // [<CollectionViewBaseChrome key="chrome"
+ // docView={this.SelectedCollection}
+ // fieldKey={this.SelectedCollection.LayoutFieldKey}
+ // type={StrCast(this.SelectedCollection?.props.Document._viewType, CollectionViewType.Invalid) as CollectionViewType} />,
+ // prop,
+ // /*button*/]);
}
}
-interface CollectionMenuProps {
+interface CollectionViewMenuProps {
type: CollectionViewType;
fieldKey: string;
docView: DocumentView;
@@ -118,7 +186,7 @@ interface CollectionMenuProps {
const stopPropagation = (e: React.SyntheticEvent) => e.stopPropagation();
@observer
-export class CollectionViewBaseChrome extends React.Component<CollectionMenuProps> {
+export class CollectionViewBaseChrome extends React.Component<CollectionViewMenuProps> {
//(!)?\(\(\(doc.(\w+) && \(doc.\w+ as \w+\).includes\(\"(\w+)\"\)
get document() { return this.props.docView?.props.Document; }
@@ -375,10 +443,8 @@ export class CollectionViewBaseChrome extends React.Component<CollectionMenuProp
</div>);
}
- @computed get selectedDocumentView() {
- return SelectionManager.Views().length ? SelectionManager.Views()[0] : undefined;
- }
- @computed get selectedDoc() { return this.selectedDocumentView?.rootDoc; }
+ @computed get selectedDocumentView() { return SelectionManager.Views().lastElement(); }
+ @computed get selectedDoc() { return SelectionManager.Docs().lastElement(); }
@computed get notACollection() {
if (this.selectedDoc) {
const layoutField = Doc.LayoutField(this.selectedDoc);
@@ -486,8 +552,8 @@ export class CollectionViewBaseChrome extends React.Component<CollectionMenuProp
@undoBatch
onAliasButtonMoved = (e: PointerEvent) => {
const contentDiv = this.selectedDocumentView?.ContentDiv;
- if (contentDiv) {
- const dragData = new DragManager.DocumentDragData([this.selectedDocumentView!.props.Document]);
+ if (contentDiv && this.selectedDoc) {
+ const dragData = new DragManager.DocumentDragData([this.selectedDoc]);
const offset = [e.clientX - contentDiv.getBoundingClientRect().x, e.clientY - contentDiv.getBoundingClientRect().y];
dragData.defaultDropAction = "alias";
dragData.canEmbed = true;
@@ -564,14 +630,14 @@ export class CollectionViewBaseChrome extends React.Component<CollectionMenuProp
}
@observer
-export class CollectionDockingChrome extends React.Component<CollectionMenuProps> {
+export class CollectionDockingChrome extends React.Component<CollectionViewMenuProps> {
render() {
return (null);
}
}
@observer
-export class CollectionFreeFormViewChrome extends React.Component<CollectionMenuProps & { isOverlay: boolean, isDoc?: boolean }> {
+export class CollectionFreeFormViewChrome extends React.Component<CollectionViewMenuProps & { isOverlay: boolean, isDoc?: boolean }> {
public static Instance: CollectionFreeFormViewChrome;
constructor(props: any) {
super(props);
@@ -582,11 +648,9 @@ export class CollectionFreeFormViewChrome extends React.Component<CollectionMenu
return this.document[this.props.docView.LayoutFieldKey + (this.props.isOverlay ? "-annotations" : "")];
}
@computed get childDocs() { return DocListCast(this.dataField); }
- @computed get selectedDocumentView() { return SelectionManager.Views().length ? SelectionManager.Views()[0] : undefined; }
- @computed get selectedDoc() { return this.selectedDocumentView?.rootDoc; }
- @computed get isText() {
- return this.selectedDoc?.type === DocumentType.RTF || (RichTextMenu.Instance?.view as any) ? true : false;
- }
+ @computed get selectedDocumentView() { return SelectionManager.Views().lastElement(); }
+ @computed get selectedDoc() { return SelectionManager.Docs().lastElement(); }
+ @computed get isText() { return this.selectedDoc?.type === DocumentType.RTF || (RichTextMenu.Instance?.view as any) ? true : false; }
@undoBatch
@action
@@ -615,12 +679,12 @@ export class CollectionFreeFormViewChrome extends React.Component<CollectionMenu
private _palette = ["#D0021B", "#F5A623", "#F8E71C", "#8B572A", "#7ED321", "#417505", "#9013FE", "#4A90E2", "#50E3C2", "#B8E986", "#000000", "#4A4A4A", "#9B9B9B", "#FFFFFF", ""];
private _width = ["1", "5", "10", "100"];
private _dotsize = [10, 20, 30, 40];
- private _draw = ["∿", "⎯", "→", "↔︎", "ロ", "O"];
- private _head = ["", "", "", "arrow", "", ""];
- private _end = ["", "", "arrow", "arrow", "", ""];
- private _shapePrims = ["", "line", "line", "line", "rectangle", "circle"];
- private _title = ["pen", "line", "line with arrow", "line with double arrows", "square", "circle",];
- private _faName = ["pen-fancy", "minus", "long-arrow-alt-right", "arrows-alt-h", "square", "circle"];
+ private _draw = ["∿", "=", "⎯", "→", "↔︎", "ロ", "O"];
+ private _head = ["", "", "", "", "arrow", "", ""];
+ private _end = ["", "", "", "arrow", "arrow", "", ""];
+ private _shapePrims = ["", "", "line", "line", "line", "rectangle", "circle"];
+ private _title = ["pen", "highlighter", "line", "line with arrow", "line with double arrows", "square", "circle"];
+ private _faName = ["pen-fancy", "highlighter", "minus", "long-arrow-alt-right", "arrows-alt-h", "square", "circle"];
@observable _selectedPrimitive = this._shapePrims.length;
@observable _keepPrimitiveMode = false; // for whether primitive selection enters a one-shot or persistent mode
@observable _colorBtn = false;
@@ -630,6 +694,7 @@ export class CollectionFreeFormViewChrome extends React.Component<CollectionMenu
@action clearKeepPrimitiveMode() { this._selectedPrimitive = this._shapePrims.length; }
@action primCreated() {
if (!this._keepPrimitiveMode) { //get out of ink mode after each stroke=
+ if (CurrentUserUtils.SelectedTool === InkTool.Highlighter && GestureOverlay.Instance.SavedColor) SetActiveInkColor(GestureOverlay.Instance.SavedColor);
CurrentUserUtils.SelectedTool = InkTool.None;
this._selectedPrimitive = this._shapePrims.length;
SetActiveArrowStart("none");
@@ -670,7 +735,13 @@ export class CollectionFreeFormViewChrome extends React.Component<CollectionMenu
this._keepPrimitiveMode = keep;
if (this._selectedPrimitive !== i) {
this._selectedPrimitive = i;
- CurrentUserUtils.SelectedTool = InkTool.Pen;
+ if (this._title[i] === "highlighter") {
+ CurrentUserUtils.SelectedTool = InkTool.Highlighter;
+ GestureOverlay.Instance.SavedColor = ActiveInkColor();
+ SetActiveInkColor("rgba(245, 230, 95, 0.75)");
+ } else {
+ CurrentUserUtils.SelectedTool = InkTool.Pen;
+ }
SetActiveArrowStart(this._head[i]);
SetActiveArrowEnd(this._end[i]);
SetActiveBezierApprox("300");
@@ -760,7 +831,6 @@ export class CollectionFreeFormViewChrome extends React.Component<CollectionMenu
</div>;
}
- @observable viewType = this.selectedDoc?._viewType;
render() {
return !this.props.docView.layoutDoc ? (null) :
@@ -798,7 +868,7 @@ export class CollectionFreeFormViewChrome extends React.Component<CollectionMenu
}
}
@observer
-export class CollectionStackingViewChrome extends React.Component<CollectionMenuProps> {
+export class CollectionStackingViewChrome extends React.Component<CollectionViewMenuProps> {
@observable private _currentKey: string = "";
@observable private suggestions: string[] = [];
@@ -919,7 +989,7 @@ export class CollectionStackingViewChrome extends React.Component<CollectionMenu
@observer
-export class CollectionSchemaViewChrome extends React.Component<CollectionMenuProps> {
+export class CollectionSchemaViewChrome extends React.Component<CollectionViewMenuProps> {
// private _textwrapAllRows: boolean = Cast(this.document.textwrappedSchemaRows, listSpec("string"), []).length > 0;
get document() { return this.props.docView.props.Document; }
@@ -967,7 +1037,7 @@ export class CollectionSchemaViewChrome extends React.Component<CollectionMenuPr
}
@observer
-export class CollectionTreeViewChrome extends React.Component<CollectionMenuProps> {
+export class CollectionTreeViewChrome extends React.Component<CollectionViewMenuProps> {
get document() { return this.props.docView.props.Document; }
get sortAscending() {
@@ -1004,7 +1074,7 @@ export class CollectionTreeViewChrome extends React.Component<CollectionMenuProp
// Enter scroll speed for 3D Carousel
@observer
-export class Collection3DCarouselViewChrome extends React.Component<CollectionMenuProps> {
+export class Collection3DCarouselViewChrome extends React.Component<CollectionViewMenuProps> {
get document() { return this.props.docView.props.Document; }
@computed get scrollSpeed() {
return this.document._autoScrollSpeed;
@@ -1045,7 +1115,7 @@ export class Collection3DCarouselViewChrome extends React.Component<CollectionMe
* Chrome for grid view.
*/
@observer
-export class CollectionGridViewChrome extends React.Component<CollectionMenuProps> {
+export class CollectionGridViewChrome extends React.Component<CollectionViewMenuProps> {
private clicked: boolean = false;
private entered: boolean = false;
@@ -1226,3 +1296,4 @@ Scripting.addGlobal(function gotoFrame(doc: any, newFrame: any) {
CollectionFreeFormDocumentView.updateKeyframe(childDocs, currentFrame || 0);
doc._currentFrame = newFrame === undefined ? 0 : Math.max(0, newFrame);
});
+
diff --git a/src/client/views/collections/CollectionSchemaView.tsx b/src/client/views/collections/CollectionSchemaView.tsx
index 1efea96be..6a22acae8 100644
--- a/src/client/views/collections/CollectionSchemaView.tsx
+++ b/src/client/views/collections/CollectionSchemaView.tsx
@@ -18,6 +18,7 @@ import { SnappingManager } from "../../util/SnappingManager";
import { Transform } from "../../util/Transform";
import { undoBatch } from "../../util/UndoManager";
import { COLLECTION_BORDER_WIDTH, SCHEMA_DIVIDER_WIDTH } from '../../views/global/globalCssVariables.scss';
+import { SchemaTable } from "../collections/collectionSchema/SchemaTable";
import { ContextMenu } from "../ContextMenu";
import { ContextMenuProps } from "../ContextMenuItem";
import '../DocumentDecorations.scss';
@@ -25,7 +26,6 @@ import { DocumentView } from "../nodes/DocumentView";
import { DefaultStyleProvider } from "../StyleProvider";
import "./CollectionSchemaView.scss";
import { CollectionSubView } from "./CollectionSubView";
-import { SchemaTable } from "../collections/collectionSchema/SchemaTable";
// bcz: need to add drag and drop of rows and columns. This seems like it might work for rows: https://codesandbox.io/s/l94mn1q657
export enum ColumnType {
@@ -338,7 +338,7 @@ export class CollectionSchemaView extends CollectionSubView(doc => doc) {
{this.renderColors(this._col)}
<div className="collectionSchema-headerMenu-group">
<button onClick={() => { this.deleteColumn(this._col.heading); }}
- >Delete Column</button>
+ >Hide Column</button>
</div>
</div>;
}
diff --git a/src/client/views/collections/CollectionStackedTimeline.scss b/src/client/views/collections/CollectionStackedTimeline.scss
index e456c0664..59c21210a 100644
--- a/src/client/views/collections/CollectionStackedTimeline.scss
+++ b/src/client/views/collections/CollectionStackedTimeline.scss
@@ -1,70 +1,94 @@
+@import "../global/globalCssVariables.scss";
+
.collectionStackedTimeline {
+ position: absolute;
+ width: 100%;
+ height: 100%;
+ z-index: 1000;
+ overflow: hidden;
+ top: 0px;
+
+ .collectionStackedTimeline-trim-shade {
position: absolute;
- width: 100%;
height: 100%;
- border: gray solid 1px;
- border-radius: 3px;
- z-index: 1000;
- overflow: hidden;
- top: 0px;
+ background-color: $dark-gray;
+ opacity: 0.3;
+ }
- .collectionStackedTimeline-selector {
- position: absolute;
- width: 10px;
- top: 2.5%;
- height: 95%;
- background: lightblue;
- border-radius: 5px;
- opacity: 0.3;
- z-index: 500;
- border-style: solid;
- border-color: darkblue;
- border-width: 1px;
- }
+ .collectionStackedTimeline-trim-controls {
+ height: 100%;
+ position: absolute;
+ box-sizing: border-box;
+ border: 2px solid $medium-blue;
+ display: flex;
+ justify-content: space-between;
+ max-width: 100%;
- .collectionStackedTimeline-current {
- width: 1px;
- height: 100%;
- background-color: red;
- position: absolute;
- top: 0px;
- pointer-events: none;
+ .collectionStackedTimeline-trim-handle {
+ background-color: $medium-blue;
+ height: 100%;
+ width: 5px;
+ cursor: ew-resize;
}
+ }
- .collectionStackedTimeline-marker-timeline {
- position: absolute;
- top: 2.5%;
- height: 95%;
- border-radius: 4px;
- &:hover {
- opacity: 1;
- }
+ .collectionStackedTimeline-selector {
+ position: absolute;
+ width: 10px;
+ top: 2.5%;
+ height: 95%;
+ background: $light-blue;
+ border-radius: 3px;
+ opacity: 0.3;
+ z-index: 500;
+ border-style: solid;
+ border-color: $medium-blue;
+ border-width: 1px;
+ }
- .collectionStackedTimeline-left-resizer,
- .collectionStackedTimeline-resizer {
- background: dimgrey;
- position: absolute;
- top: 0;
- height: 100%;
- width: 10px;
- pointer-events: all;
- cursor: ew-resize;
- z-index: 100;
- }
- .collectionStackedTimeline-resizer {
- right: 0;
- }
- .collectionStackedTimeline-left-resizer {
- left: 0;
- }
+ .collectionStackedTimeline-current {
+ width: 1px;
+ height: 100%;
+ background-color: $pink;
+ position: absolute;
+ top: 0px;
+ pointer-events: none;
+ }
+
+ .collectionStackedTimeline-marker-timeline {
+ position: absolute;
+ top: 2.5%;
+ height: 95%;
+ border-radius: 4px;
+ &:hover {
+ opacity: 1;
}
- .collectionStackedTimeline-waveform {
- position: absolute;
- width: 100%;
- height: 100%;
- top: 0;
- left: 0;
- pointer-events: none;
+ .collectionStackedTimeline-left-resizer,
+ .collectionStackedTimeline-resizer {
+ background: $medium-gray;
+ position: absolute;
+ top: 0;
+ height: 100%;
+ width: 10px;
+ pointer-events: all;
+ cursor: ew-resize;
+ z-index: 100;
+ }
+ .collectionStackedTimeline-resizer {
+ right: 0;
}
-} \ No newline at end of file
+ .collectionStackedTimeline-left-resizer {
+ left: 0;
+ }
+ }
+
+ .collectionStackedTimeline-waveform {
+ position: absolute;
+ width: 100%;
+ height: 100%;
+ top: 0;
+ left: 0;
+ pointer-events: none;
+ }
+}
diff --git a/src/client/views/collections/CollectionStackedTimeline.tsx b/src/client/views/collections/CollectionStackedTimeline.tsx
index a2c95df6e..65022fdfd 100644
--- a/src/client/views/collections/CollectionStackedTimeline.tsx
+++ b/src/client/views/collections/CollectionStackedTimeline.tsx
@@ -1,5 +1,12 @@
import React = require("react");
-import { action, computed, IReactionDisposer, observable, reaction, runInAction } from "mobx";
+import {
+ action,
+ computed,
+ IReactionDisposer,
+ observable,
+ reaction,
+ runInAction,
+} from "mobx";
import { observer } from "mobx-react";
import { computedFn } from "mobx-utils";
import { Doc, DocListCast } from "../../../fields/Doc";
@@ -8,7 +15,16 @@ import { List } from "../../../fields/List";
import { listSpec, makeInterface } from "../../../fields/Schema";
import { ComputedField, ScriptField } from "../../../fields/ScriptField";
import { Cast, NumCast } from "../../../fields/Types";
-import { emptyFunction, formatTime, OmitKeys, returnFalse, returnOne, setupMoveUpEvents, StopEvent, returnTrue } from "../../../Utils";
+import {
+ emptyFunction,
+ formatTime,
+ OmitKeys,
+ returnFalse,
+ returnOne,
+ setupMoveUpEvents,
+ StopEvent,
+ returnTrue,
+} from "../../../Utils";
import { Docs } from "../../documents/Documents";
import { LinkManager } from "../../util/LinkManager";
import { Scripting } from "../../util/Scripting";
@@ -18,9 +34,18 @@ import { undoBatch } from "../../util/UndoManager";
import { AudioWaveform } from "../AudioWaveform";
import { CollectionSubView } from "../collections/CollectionSubView";
import { LightboxView } from "../LightboxView";
-import { DocAfterFocusFunc, DocFocusFunc, DocumentView, DocumentViewProps } from "../nodes/DocumentView";
+import {
+ DocAfterFocusFunc,
+ DocFocusFunc,
+ DocumentView,
+ DocumentViewProps,
+} from "../nodes/DocumentView";
import { LabelBox } from "../nodes/LabelBox";
import "./CollectionStackedTimeline.scss";
+import { Colors } from "../global/globalEnums";
+import { DocumentManager } from "../../util/DocumentManager";
+import { SnappingManager } from "../../util/SnappingManager";
+import { DragManager } from "../../util/DragManager";
type PanZoomDocument = makeInterface<[]>;
const PanZoomDocument = makeInterface();
@@ -36,11 +61,21 @@ export type CollectionStackedTimelineProps = {
endTag: string;
mediaPath: string;
dictationKey: string;
+ trimming: boolean;
+ trimStart: number;
+ trimEnd: number;
+ trimDuration: number;
+ setStartTrim: (newStart: number) => void;
+ setEndTrim: (newEnd: number) => void;
};
@observer
-export class CollectionStackedTimeline extends CollectionSubView<PanZoomDocument, CollectionStackedTimelineProps>(PanZoomDocument) {
- @observable static SelectingRegion: CollectionStackedTimeline | undefined = undefined;
+export class CollectionStackedTimeline extends CollectionSubView<
+ PanZoomDocument,
+ CollectionStackedTimelineProps
+>(PanZoomDocument) {
+ @observable static SelectingRegion: CollectionStackedTimeline | undefined =
+ undefined;
static RangeScript: ScriptField;
static LabelScript: ScriptField;
static RangePlayScript: ScriptField;
@@ -50,48 +85,111 @@ export class CollectionStackedTimeline extends CollectionSubView<PanZoomDocument
private _markerStart: number = 0;
@observable _markerEnd: number = 0;
- get duration() { return this.props.duration; }
- @computed get currentTime() { return NumCast(this.layoutDoc._currentTimecode); }
+ get minLength() {
+ const rect = this._timeline?.getBoundingClientRect();
+ if (rect) {
+ return 0.05 * this.duration;
+ }
+ return 0;
+ }
+
+ get trimStart() {
+ return this.props.trimStart;
+ }
+
+ get trimEnd() {
+ return this.props.trimEnd;
+ }
+
+ get duration() {
+ return this.props.duration;
+ }
+
+ @computed get currentTime() {
+ return NumCast(this.layoutDoc._currentTimecode);
+ }
@computed get selectionContainer() {
- return CollectionStackedTimeline.SelectingRegion !== this ? (null) : <div className="collectionStackedTimeline-selector" style={{
- left: `${Math.min(NumCast(this._markerStart), NumCast(this._markerEnd)) / this.duration * 100}%`,
- width: `${Math.abs(this._markerStart - this._markerEnd) / this.duration * 100}%`
- }} />;
+ return CollectionStackedTimeline.SelectingRegion !== this ? null : (
+ <div
+ className="collectionStackedTimeline-selector"
+ style={{
+ left: `${((Math.min(this._markerStart, this._markerEnd) - this.trimStart) / this.props.trimDuration) * 100}%`,
+ width: `${(Math.abs(this._markerStart - this._markerEnd) / this.props.trimDuration) * 100}%`,
+ }}
+ />
+ );
}
constructor(props: any) {
super(props);
// onClick play scripts
- CollectionStackedTimeline.RangeScript = CollectionStackedTimeline.RangeScript || ScriptField.MakeFunction(`scriptContext.clickAnchor(this, clientX)`, { self: Doc.name, scriptContext: "any", clientX: "number" })!;
- CollectionStackedTimeline.RangePlayScript = CollectionStackedTimeline.RangePlayScript || ScriptField.MakeFunction(`scriptContext.playOnClick(this, clientX)`, { self: Doc.name, scriptContext: "any", clientX: "number" })!;
+ CollectionStackedTimeline.RangeScript =
+ CollectionStackedTimeline.RangeScript ||
+ ScriptField.MakeFunction(`scriptContext.clickAnchor(this, clientX)`, {
+ self: Doc.name,
+ scriptContext: "any",
+ clientX: "number",
+ })!;
+ CollectionStackedTimeline.RangePlayScript =
+ CollectionStackedTimeline.RangePlayScript ||
+ ScriptField.MakeFunction(`scriptContext.playOnClick(this, clientX)`, {
+ self: Doc.name,
+ scriptContext: "any",
+ clientX: "number",
+ })!;
}
- componentDidMount() { document.addEventListener("keydown", this.keyEvents, true); }
+ componentDidMount() {
+ document.addEventListener("keydown", this.keyEvents, true);
+ }
componentWillUnmount() {
document.removeEventListener("keydown", this.keyEvents, true);
- if (CollectionStackedTimeline.SelectingRegion === this) runInAction(() => CollectionStackedTimeline.SelectingRegion = undefined);
+ if (CollectionStackedTimeline.SelectingRegion === this) {
+ runInAction(
+ () => (CollectionStackedTimeline.SelectingRegion = undefined)
+ );
+ }
}
- anchorStart = (anchor: Doc) => NumCast(anchor._timecodeToShow, NumCast(anchor[this.props.startTag]));
+ anchorStart = (anchor: Doc) =>
+ NumCast(anchor._timecodeToShow, NumCast(anchor[this.props.startTag]))
anchorEnd = (anchor: Doc, val: any = null) => {
const endVal = NumCast(anchor[this.props.endTag], val);
- return NumCast(anchor._timecodeToHide, endVal === undefined ? null : endVal);
+ return NumCast(
+ anchor._timecodeToHide,
+ endVal === undefined ? null : endVal
+ );
}
- toTimeline = (screen_delta: number, width: number) => Math.max(0, Math.min(this.duration, screen_delta / width * this.duration));
+ toTimeline = (screen_delta: number, width: number) => {
+ return Math.max(
+ this.trimStart,
+ Math.min(this.trimEnd, (screen_delta / width) * this.props.trimDuration + this.trimStart));
+ }
+
rangeClickScript = () => CollectionStackedTimeline.RangeScript;
rangePlayScript = () => CollectionStackedTimeline.RangePlayScript;
// for creating key anchors with key events
@action
keyEvents = (e: KeyboardEvent) => {
- if (!(e.target instanceof HTMLInputElement) && this.props.isSelected(true)) {
+ if (
+ !(e.target instanceof HTMLInputElement) &&
+ this.props.isSelected(true)
+ ) {
switch (e.key) {
case " ":
if (!CollectionStackedTimeline.SelectingRegion) {
this._markerStart = this._markerEnd = this.currentTime;
CollectionStackedTimeline.SelectingRegion = this;
} else {
- CollectionStackedTimeline.createAnchor(this.rootDoc, this.dataDoc, this.props.fieldKey, this.props.startTag, this.props.endTag, this.currentTime);
+ CollectionStackedTimeline.createAnchor(
+ this.rootDoc,
+ this.dataDoc,
+ this.props.fieldKey,
+ this.props.startTag,
+ this.props.endTag,
+ this.currentTime
+ );
CollectionStackedTimeline.SelectingRegion = undefined;
}
}
@@ -101,7 +199,10 @@ export class CollectionStackedTimeline extends CollectionSubView<PanZoomDocument
getLinkData(l: Doc) {
let la1 = l.anchor1 as Doc;
let la2 = l.anchor2 as Doc;
- const linkTime = NumCast(la2[this.props.startTag], NumCast(la1[this.props.startTag]));
+ const linkTime = NumCast(
+ la2[this.props.startTag],
+ NumCast(la1[this.props.startTag])
+ );
if (Doc.AreProtosEqual(la1, this.dataDoc)) {
la1 = l.anchor2 as Doc;
la2 = l.anchor1 as Doc;
@@ -118,10 +219,18 @@ export class CollectionStackedTimeline extends CollectionSubView<PanZoomDocument
const wasPlaying = this.props.playing();
if (wasPlaying) this.props.Pause();
const wasSelecting = CollectionStackedTimeline.SelectingRegion === this;
- setupMoveUpEvents(this, e,
- action(e => {
- if (!wasSelecting && CollectionStackedTimeline.SelectingRegion !== this) {
- this._markerStart = this._markerEnd = this.toTimeline(clientX - rect.x, rect.width);
+ setupMoveUpEvents(
+ this,
+ e,
+ action((e) => {
+ if (
+ !wasSelecting &&
+ CollectionStackedTimeline.SelectingRegion !== this
+ ) {
+ this._markerStart = this._markerEnd = this.toTimeline(
+ clientX - rect.x,
+ rect.width
+ );
CollectionStackedTimeline.SelectingRegion = this;
}
this._markerEnd = this.toTimeline(e.clientX - rect.x, rect.width);
@@ -134,32 +243,147 @@ export class CollectionStackedTimeline extends CollectionSubView<PanZoomDocument
this._markerStart = this._markerEnd;
this._markerEnd = tmp;
}
- if (!isClick && CollectionStackedTimeline.SelectingRegion === this && (Math.abs(movement[0]) > 15)) {
- CollectionStackedTimeline.createAnchor(this.rootDoc, this.dataDoc, this.props.fieldKey, this.props.startTag, this.props.endTag,
- this._markerStart, this._markerEnd);
+ if (
+ !isClick &&
+ CollectionStackedTimeline.SelectingRegion === this &&
+ Math.abs(movement[0]) > 15 &&
+ !this.props.trimming
+ ) {
+ const anchor = CollectionStackedTimeline.createAnchor(
+ this.rootDoc,
+ this.dataDoc,
+ this.props.fieldKey,
+ this.props.startTag,
+ this.props.endTag,
+ this._markerStart,
+ this._markerEnd
+ );
+ setTimeout(() => DocumentManager.Instance.getDocumentView(anchor)?.select(false));
}
- (!isClick || !wasSelecting) && (CollectionStackedTimeline.SelectingRegion = undefined);
+ (!isClick || !wasSelecting) &&
+ (CollectionStackedTimeline.SelectingRegion = undefined);
}),
(e, doubleTap) => {
this.props.select(false);
- e.shiftKey && CollectionStackedTimeline.createAnchor(this.rootDoc, this.dataDoc, this.props.fieldKey, this.props.startTag, this.props.endTag, this.currentTime);
+ e.shiftKey &&
+ CollectionStackedTimeline.createAnchor(
+ this.rootDoc,
+ this.dataDoc,
+ this.props.fieldKey,
+ this.props.startTag,
+ this.props.endTag,
+ this.currentTime
+ );
!wasPlaying && doubleTap && this.props.Play();
},
- this.props.isSelected(true) || this.props.isContentActive(), undefined,
- () => !wasPlaying && this.props.setTime((clientX - rect.x) / rect.width * this.duration));
+ this.props.isSelected(true) || this.props.isContentActive(),
+ undefined,
+ () => {
+ !wasPlaying &&
+ (this.props.trimming && this.duration ?
+ this.props.setTime(((clientX - rect.x) / rect.width) * this.duration)
+ :
+ this.props.setTime(((clientX - rect.x) / rect.width) * this.props.trimDuration + this.trimStart)
+ );
+ }
+ );
}
+
+ }
+
+ @action
+ trimLeft = (e: React.PointerEvent): void => {
+ const rect = this._timeline?.getBoundingClientRect();
+ const clientX = e.movementX;
+ setupMoveUpEvents(
+ this,
+ e,
+ action((e, [], []) => {
+ if (rect && this.props.isContentActive()) {
+ this.props.setStartTrim(Math.min(
+ Math.max(
+ this.trimStart + (e.movementX / rect.width) * this.duration,
+ 0
+ ),
+ this.trimEnd - this.minLength
+ ));
+ }
+ return false;
+ }),
+ emptyFunction,
+ action((e, doubleTap) => {
+ if (doubleTap) {
+ this.props.setStartTrim(0);
+ }
+ })
+ );
+ }
+
+ @action
+ trimRight = (e: React.PointerEvent): void => {
+ const rect = this._timeline?.getBoundingClientRect();
+ const clientX = e.movementX;
+ setupMoveUpEvents(
+ this,
+ e,
+ action((e, [], []) => {
+ if (rect && this.props.isContentActive()) {
+ this.props.setEndTrim(Math.max(
+ Math.min(
+ this.trimEnd + (e.movementX / rect.width) * this.duration,
+ this.duration
+ ),
+ this.trimStart + this.minLength
+ ));
+ }
+ return false;
+ }),
+ emptyFunction,
+ action((e, doubleTap) => {
+ if (doubleTap) {
+ this.props.setEndTrim(this.duration);
+ }
+ })
+ );
+ }
+
+ @action
+ internalDocDrop(e: Event, de: DragManager.DropEvent, docDragData: DragManager.DocumentDragData, xp: number) {
+ if (!de.embedKey && this.props.layerProvider?.(this.props.Document) !== false && this.props.Document._isGroup) return false;
+ if (!super.onInternalDrop(e, de)) return false;
+
+
+ // determine x coordinate of drop and assign it to the documents being dragged --- see internalDocDrop of collectionFreeFormView.tsx for how it's done when dropping onto a 2D freeform view
+
+ return true;
+ }
+
+ onInternalDrop = (e: Event, de: DragManager.DropEvent) => {
+ if (de.complete.docDragData?.droppedDocuments.length) return this.internalDocDrop(e, de, de.complete.docDragData, 0);
+ return false;
}
@undoBatch
@action
- static createAnchor(rootDoc: Doc, dataDoc: Doc, fieldKey: string, startTag: string, endTag: string, anchorStartTime?: number, anchorEndTime?: number) {
+ static createAnchor(
+ rootDoc: Doc,
+ dataDoc: Doc,
+ fieldKey: string,
+ startTag: string,
+ endTag: string,
+ anchorStartTime?: number,
+ anchorEndTime?: number
+ ) {
if (anchorStartTime === undefined) return rootDoc;
const anchor = Docs.Create.LabelDocument({
- title: ComputedField.MakeFunction(`"#" + formatToTime(self["${startTag}"]) + "-" + formatToTime(self["${endTag}"])`) as any,
+ title: ComputedField.MakeFunction(
+ `"#" + formatToTime(self["${startTag}"]) + "-" + formatToTime(self["${endTag}"])`
+ ) as any,
+ _stayInCollection: true,
useLinkSmallAnchor: true,
hideLinkButton: true,
annotationOn: rootDoc,
- _timelineLabel: true
+ _timelineLabel: true,
});
Doc.GetProto(anchor)[startTag] = anchorStartTime;
Doc.GetProto(anchor)[endTag] = anchorEndTime;
@@ -179,7 +403,10 @@ export class CollectionStackedTimeline extends CollectionSubView<PanZoomDocument
if (this.props.playing()) this.props.Pause();
else this.props.playFrom(seekTimeInSeconds, endTime);
} else {
- if (seekTimeInSeconds < NumCast(this.layoutDoc._currentTimecode) && endTime > NumCast(this.layoutDoc._currentTimecode)) {
+ if (
+ seekTimeInSeconds < NumCast(this.layoutDoc._currentTimecode) &&
+ endTime > NumCast(this.layoutDoc._currentTimecode)
+ ) {
if (!this.layoutDoc.autoPlayAnchors && this.props.playing()) {
this.props.Pause();
} else {
@@ -194,39 +421,60 @@ export class CollectionStackedTimeline extends CollectionSubView<PanZoomDocument
@action
clickAnchor = (anchorDoc: Doc, clientX: number) => {
- if (anchorDoc.isLinkButton) LinkManager.FollowLink(undefined, anchorDoc, this.props, false);
+ if (anchorDoc.isLinkButton) {
+ LinkManager.FollowLink(undefined, anchorDoc, this.props, false);
+ }
const seekTimeInSeconds = this.anchorStart(anchorDoc) - 0.25;
const endTime = this.anchorEnd(anchorDoc);
- if (seekTimeInSeconds < NumCast(this.layoutDoc._currentTimecode) + 1e-4 && endTime > NumCast(this.layoutDoc._currentTimecode) - 1e-4) {
+ if (
+ seekTimeInSeconds < NumCast(this.layoutDoc._currentTimecode) + 1e-4 &&
+ endTime > NumCast(this.layoutDoc._currentTimecode) - 1e-4
+ ) {
if (this.props.playing()) this.props.Pause();
else if (this.layoutDoc.autoPlayAnchors) this.props.Play();
else if (!this.layoutDoc.autoPlayAnchors) {
const rect = this._timeline?.getBoundingClientRect();
- rect && this.props.setTime(this.toTimeline(clientX - rect.x, rect.width));
+ rect &&
+ this.props.setTime(this.toTimeline(clientX - rect.x, rect.width));
}
} else {
- if (this.layoutDoc.autoPlayAnchors) this.props.playFrom(seekTimeInSeconds, endTime);
- else this.props.setTime(seekTimeInSeconds);
+ if (this.layoutDoc.autoPlayAnchors) {
+ this.props.playFrom(seekTimeInSeconds, endTime);
+ }
+ else {
+ this.props.setTime(seekTimeInSeconds);
+ }
}
return { select: true };
}
-
// makes sure no anchors overlaps each other by setting the correct position and width
- getLevel = (m: Doc, placed: { anchorStartTime: number, anchorEndTime: number, level: number }[]) => {
+ getLevel = (
+ m: Doc,
+ placed: { anchorStartTime: number; anchorEndTime: number; level: number }[]
+ ) => {
const timelineContentWidth = this.props.PanelWidth();
const x1 = this.anchorStart(m);
- const x2 = this.anchorEnd(m, x1 + 10 / timelineContentWidth * this.duration);
+ const x2 = this.anchorEnd(
+ m,
+ x1 + (10 / timelineContentWidth) * this.duration
+ );
let max = 0;
- const overlappedLevels = new Set(placed.map(p => {
- const y1 = p.anchorStartTime;
- const y2 = p.anchorEndTime;
- if ((x1 >= y1 && x1 <= y2) || (x2 >= y1 && x2 <= y2) ||
- (y1 >= x1 && y1 <= x2) || (y2 >= x1 && y2 <= x2)) {
- max = Math.max(max, p.level);
- return p.level;
- }
- }));
+ const overlappedLevels = new Set(
+ placed.map((p) => {
+ const y1 = p.anchorStartTime;
+ const y2 = p.anchorEndTime;
+ if (
+ (x1 >= y1 && x1 <= y2) ||
+ (x2 >= y1 && x2 <= y2) ||
+ (y1 >= x1 && y1 <= x2) ||
+ (y2 >= x1 && y2 <= x2)
+ ) {
+ max = Math.max(max, p.level);
+ return p.level;
+ }
+ })
+ );
let level = max + 1;
for (let j = max; j >= 0; j--) !overlappedLevels.has(j) && (level = j);
@@ -235,82 +483,185 @@ export class CollectionStackedTimeline extends CollectionSubView<PanZoomDocument
}
dictationHeightPercent = 50;
- dictationHeight = () => this.props.PanelHeight() * (100 - this.dictationHeightPercent) / 100;
- timelineContentHeight = () => this.props.PanelHeight() * this.dictationHeightPercent / 100;
- dictationScreenToLocalTransform = () => this.props.ScreenToLocalTransform().translate(0, -this.timelineContentHeight());
+ dictationHeight = () =>
+ (this.props.PanelHeight() * (100 - this.dictationHeightPercent)) / 100
+ timelineContentHeight = () =>
+ (this.props.PanelHeight() * this.dictationHeightPercent) / 100
+ dictationScreenToLocalTransform = () =>
+ this.props
+ .ScreenToLocalTransform()
+ .translate(0, -this.timelineContentHeight())
@computed get renderDictation() {
const dictation = Cast(this.dataDoc[this.props.dictationKey], Doc, null);
- return !dictation ? (null) : <div style={{ position: "absolute", height: "100%", top: this.timelineContentHeight(), background: "tan" }}>
- <DocumentView {...OmitKeys(this.props, ["NativeWidth", "NativeHeight", "setContentView"]).omit}
- Document={dictation}
- PanelHeight={this.dictationHeight}
- isAnnotationOverlay={true}
- isDocumentActive={returnFalse}
- select={emptyFunction}
- scaling={returnOne}
- xMargin={25}
- yMargin={10}
- ScreenToLocalTransform={this.dictationScreenToLocalTransform}
- whenChildContentsActiveChanged={emptyFunction}
- removeDocument={returnFalse}
- moveDocument={returnFalse}
- addDocument={returnFalse}
- CollectionView={undefined}
- renderDepth={this.props.renderDepth + 1}>
- </DocumentView>
- </div>;
+ return !dictation ? null : (
+ <div
+ style={{
+ position: "absolute",
+ height: "100%",
+ top: this.timelineContentHeight(),
+ background: Colors.LIGHT_BLUE,
+ }}
+ >
+ <DocumentView
+ {...OmitKeys(this.props, [
+ "NativeWidth",
+ "NativeHeight",
+ "setContentView",
+ ]).omit}
+ Document={dictation}
+ PanelHeight={this.dictationHeight}
+ isAnnotationOverlay={true}
+ isDocumentActive={returnFalse}
+ select={emptyFunction}
+ scaling={returnOne}
+ xMargin={25}
+ yMargin={10}
+ ScreenToLocalTransform={this.dictationScreenToLocalTransform}
+ whenChildContentsActiveChanged={emptyFunction}
+ removeDocument={returnFalse}
+ moveDocument={returnFalse}
+ addDocument={returnFalse}
+ CollectionView={undefined}
+ renderDepth={this.props.renderDepth + 1}
+ ></DocumentView>
+ </div>
+ );
}
@computed get renderAudioWaveform() {
- return !this.props.mediaPath ? (null) :
- <div className="collectionStackedTimeline-waveform" >
+ return !this.props.mediaPath ? null : (
+ <div className="collectionStackedTimeline-waveform">
<AudioWaveform
duration={this.duration}
mediaPath={this.props.mediaPath}
- dataDoc={this.dataDoc}
- PanelHeight={this.timelineContentHeight} />
- </div>;
+ layoutDoc={this.layoutDoc}
+ PanelHeight={this.timelineContentHeight}
+ trimming={this.props.trimming}
+ />
+ </div>
+ );
}
+
currentTimecode = () => this.currentTime;
render() {
const timelineContentWidth = this.props.PanelWidth();
- const overlaps: { anchorStartTime: number, anchorEndTime: number, level: number }[] = [];
- const drawAnchors = this.childDocs.map(anchor => ({ level: this.getLevel(anchor, overlaps), anchor }));
+ const overlaps: {
+ anchorStartTime: number;
+ anchorEndTime: number;
+ level: number;
+ }[] = [];
+ const drawAnchors = this.childDocs.map((anchor) => ({
+ level: this.getLevel(anchor, overlaps),
+ anchor,
+ }));
const maxLevel = overlaps.reduce((m, o) => Math.max(m, o.level), 0) + 2;
- const isActive = this.props.isContentActive() || this.props.isSelected(false);
- return <div className="collectionStackedTimeline" ref={(timeline: HTMLDivElement | null) => this._timeline = timeline}
- onClick={e => isActive && StopEvent(e)} onPointerDown={e => isActive && this.onPointerDownTimeline(e)}>
- {drawAnchors.map(d => {
- const start = this.anchorStart(d.anchor);
- const end = this.anchorEnd(d.anchor, start + 10 / timelineContentWidth * this.duration);
- const left = start / this.duration * timelineContentWidth;
- const top = d.level / maxLevel * this.timelineContentHeight();
- const timespan = end - start;
- return this.props.Document.hideAnchors ? (null) :
- <div className={"collectionStackedTimeline-marker-timeline"} key={d.anchor[Id]}
- style={{ left, top, width: `${timespan / this.duration * timelineContentWidth}px`, height: `${this.timelineContentHeight() / maxLevel}px` }}
- onClick={e => { this.props.playFrom(start, this.anchorEnd(d.anchor)); e.stopPropagation(); }} >
- <StackedTimelineAnchor {...this.props}
- mark={d.anchor}
- rangeClickScript={this.rangeClickScript}
- rangePlayScript={this.rangePlayScript}
- left={left}
- top={top}
- width={timelineContentWidth * timespan / this.duration}
- height={this.timelineContentHeight() / maxLevel}
- toTimeline={this.toTimeline}
- layoutDoc={this.layoutDoc}
- currentTimecode={this.currentTimecode}
- _timeline={this._timeline}
- stackedTimeline={this}
- />
- </div>;
- })}
- {this.selectionContainer}
- {this.renderAudioWaveform}
- {this.renderDictation}
-
- <div className="collectionStackedTimeline-current" style={{ left: `${this.currentTime / this.duration * 100}%` }} />
- </div>;
+ const isActive =
+ this.props.isContentActive() || this.props.isSelected(false);
+ return (<div ref={this.createDashEventsTarget} style={{ pointerEvents: SnappingManager.GetIsDragging() ? "all" : undefined }}>
+ <div
+ className="collectionStackedTimeline"
+ ref={(timeline: HTMLDivElement | null) => (this._timeline = timeline)}
+ onClick={(e) => isActive && StopEvent(e)}
+ onPointerDown={(e) => isActive && this.onPointerDownTimeline(e)}
+ >
+ {drawAnchors.map((d) => {
+
+ const start = this.anchorStart(d.anchor);
+ const end = this.anchorEnd(
+ d.anchor,
+ start + (10 / timelineContentWidth) * this.duration
+ );
+ const left = this.props.trimming ?
+ (start / this.duration) * timelineContentWidth
+ : (start - this.trimStart) / this.props.trimDuration * timelineContentWidth;
+ const top = (d.level / maxLevel) * this.timelineContentHeight();
+ const timespan = end - start;
+ const width = (timespan / this.props.trimDuration) * timelineContentWidth;
+ const height = this.timelineContentHeight() / maxLevel;
+ return this.props.Document.hideAnchors ? null : (
+ <div
+ className={"collectionStackedTimeline-marker-timeline"}
+ key={d.anchor[Id]}
+ style={{
+ left,
+ top,
+ width: `${width}px`,
+ height: `${height}px`,
+ }}
+ onClick={(e) => {
+ this.props.playFrom(start, this.anchorEnd(d.anchor));
+ e.stopPropagation();
+ }}
+ >
+ <StackedTimelineAnchor
+ {...this.props}
+ mark={d.anchor}
+ rangeClickScript={this.rangeClickScript}
+ rangePlayScript={this.rangePlayScript}
+ left={left}
+ top={top}
+ width={width}
+ height={height}
+ toTimeline={this.toTimeline}
+ layoutDoc={this.layoutDoc}
+ currentTimecode={this.currentTimecode}
+ _timeline={this._timeline}
+ stackedTimeline={this}
+ trimStart={this.trimStart}
+ trimEnd={this.trimEnd}
+ />
+ </div>
+ );
+ })}
+ {!this.props.trimming && this.selectionContainer}
+ {this.renderAudioWaveform}
+ {this.renderDictation}
+
+ <div
+ className="collectionStackedTimeline-current"
+ style={{
+ left: this.props.trimming
+ ? `${(this.currentTime / this.duration) * 100}%`
+ : `${(this.currentTime - this.trimStart) / (this.trimEnd - this.trimStart) * 100}%`,
+ }}
+ />
+
+ {this.props.trimming && (
+ <>
+ <div
+ className="collectionStackedTimeline-trim-shade"
+ style={{ width: `${(this.trimStart / this.duration) * 100}%` }}
+ ></div>
+
+ <div
+ className="collectionStackedTimeline-trim-controls"
+ style={{
+ left: `${(this.trimStart / this.duration) * 100}%`,
+ width: `${((this.trimEnd - this.trimStart) / this.duration) * 100
+ }%`,
+ }}
+ >
+ <div
+ className="collectionStackedTimeline-trim-handle"
+ onPointerDown={this.trimLeft}
+ ></div>
+ <div
+ className="collectionStackedTimeline-trim-handle"
+ onPointerDown={this.trimRight}
+ ></div>
+ </div>
+
+ <div
+ className="collectionStackedTimeline-trim-shade"
+ style={{
+ left: `${(this.trimEnd / this.duration) * 100}%`,
+ width: `${((this.duration - this.trimEnd) / this.duration) * 100
+ }%`,
+ }}
+ ></div>
+ </>
+ )}
+ </div>
+ </div>);
}
}
@@ -335,6 +686,8 @@ interface StackedTimelineAnchorProps {
currentTimecode: () => number;
isSelected: (outsideReaction?: boolean) => boolean;
stackedTimeline: CollectionStackedTimeline;
+ trimStart: number;
+ trimEnd: number;
}
@observer
class StackedTimelineAnchor extends React.Component<StackedTimelineAnchorProps> {
@@ -345,22 +698,41 @@ class StackedTimelineAnchor extends React.Component<StackedTimelineAnchorProps>
this._lastTimecode = this.props.currentTimecode();
}
componentDidMount() {
- this._disposer = reaction(() => this.props.currentTimecode(),
+ this._disposer = reaction(
+ () => this.props.currentTimecode(),
(time) => {
- const dictationDoc = Cast(this.props.layoutDoc["data-dictation"], Doc, null);
- const isDictation = dictationDoc && DocListCast(this.props.mark.links).some(link => Cast(link.anchor1, Doc, null)?.annotationOn === dictationDoc);
- if (!LightboxView.LightboxDoc
+ const dictationDoc = Cast(
+ this.props.layoutDoc["data-dictation"],
+ Doc,
+ null
+ );
+ const isDictation =
+ dictationDoc &&
+ DocListCast(this.props.mark.links).some(
+ (link) =>
+ Cast(link.anchor1, Doc, null)?.annotationOn === dictationDoc
+ );
+ if (
+ !LightboxView.LightboxDoc &&
// bcz: when should links be followed? we don't want to move away from the video to follow a link but we can open it in a sidebar/etc. But we don't know that upfront.
// for now, we won't follow any links when the lightbox is oepn to avoid "losing" the video.
/*(isDictation || !Doc.AreProtosEqual(LightboxView.LightboxDoc, this.props.layoutDoc))*/
- && DocListCast(this.props.mark.links).length &&
+ DocListCast(this.props.mark.links).length &&
time > NumCast(this.props.mark[this.props.startTag]) &&
time < NumCast(this.props.mark[this.props.endTag]) &&
- this._lastTimecode < NumCast(this.props.mark[this.props.startTag])) {
- LinkManager.FollowLink(undefined, this.props.mark, this.props as any as DocumentViewProps, false, true);
+ this._lastTimecode < NumCast(this.props.mark[this.props.startTag])
+ ) {
+ LinkManager.FollowLink(
+ undefined,
+ this.props.mark,
+ this.props as any as DocumentViewProps,
+ false,
+ true
+ );
}
this._lastTimecode = time;
- });
+ }
+ );
}
componentWillUnmount() {
this._disposer?.();
@@ -373,57 +745,136 @@ class StackedTimelineAnchor extends React.Component<StackedTimelineAnchorProps>
return this.props.toTimeline(e.clientX - rect.x, rect.width);
};
const changeAnchor = (anchor: Doc, left: boolean, time: number) => {
- const timelineOnly = Cast(anchor[this.props.startTag], "number", null) !== undefined;
- if (timelineOnly) Doc.SetInPlace(anchor, left ? this.props.startTag : this.props.endTag, time, true);
- else left ? anchor._timecodeToShow = time : anchor._timecodeToHide = time;
+ const timelineOnly =
+ Cast(anchor[this.props.startTag], "number", null) !== undefined;
+ if (timelineOnly) {
+ Doc.SetInPlace(
+ anchor,
+ left ? this.props.startTag : this.props.endTag,
+ time,
+ true
+ );
+ }
+ else {
+ left
+ ? (anchor._timecodeToShow = time)
+ : (anchor._timecodeToHide = time);
+ }
return false;
};
- setupMoveUpEvents(this, e,
+ setupMoveUpEvents(
+ this,
+ e,
(e) => changeAnchor(anchor, left, newTime(e)),
(e) => {
this.props.setTime(newTime(e));
this.props._timeline?.releasePointerCapture(e.pointerId);
},
- emptyFunction);
+ emptyFunction
+ );
}
- renderInner = computedFn(function (this: StackedTimelineAnchor, mark: Doc, script: undefined | (() => ScriptField), doublescript: undefined | (() => ScriptField), x: number, y: number, width: number, height: number) {
+
+ @action
+ computeTitle = () => {
+ const start = Math.max(NumCast(this.props.mark[this.props.startTag]), this.props.trimStart) - this.props.trimStart;
+ const end = Math.min(NumCast(this.props.mark[this.props.endTag]), this.props.trimEnd) - this.props.trimStart;
+ return `#${formatTime(start)}-${formatTime(end)}`;
+ }
+
+ renderInner = computedFn(function (
+ this: StackedTimelineAnchor,
+ mark: Doc,
+ script: undefined | (() => ScriptField),
+ doublescript: undefined | (() => ScriptField),
+ x: number,
+ y: number,
+ width: number,
+ height: number
+ ) {
const anchor = observable({ view: undefined as any });
- const focusFunc = (doc: Doc, willZoom?: boolean, scale?: number, afterFocus?: DocAfterFocusFunc, docTransform?: Transform) => {
+ const focusFunc = (
+ doc: Doc,
+ willZoom?: boolean,
+ scale?: number,
+ afterFocus?: DocAfterFocusFunc,
+ docTransform?: Transform
+ ) => {
this.props.playLink(mark);
this.props.focus(doc, { willZoom, scale, afterFocus, docTransform });
};
return {
- anchor, view: <DocumentView key="view" {...OmitKeys(this.props, ["NativeWidth", "NativeHeight"]).omit}
- ref={action((r: DocumentView | null) => anchor.view = r)}
- Document={mark}
- DataDoc={undefined}
- renderDepth={this.props.renderDepth + 1}
- LayoutTemplate={undefined}
- LayoutTemplateString={LabelBox.LayoutString("data")}
- isDocumentActive={returnFalse}
- PanelWidth={() => width}
- PanelHeight={() => height}
- ScreenToLocalTransform={() => this.props.ScreenToLocalTransform().translate(-x, -y)}
- focus={focusFunc}
- rootSelected={returnFalse}
- onClick={script}
- onDoubleClick={this.props.layoutDoc.autoPlayAnchors ? undefined : doublescript}
- ignoreAutoHeight={false}
- hideResizeHandles={true}
- bringToFront={emptyFunction}
- scriptContext={this.props.stackedTimeline} />
+ anchor,
+ view: (
+ <DocumentView
+ key="view"
+ {...OmitKeys(this.props, ["NativeWidth", "NativeHeight"]).omit}
+ ref={action((r: DocumentView | null) => (anchor.view = r))}
+ Document={mark}
+ DataDoc={undefined}
+ renderDepth={this.props.renderDepth + 1}
+ LayoutTemplate={undefined}
+ LayoutTemplateString={LabelBox.LayoutStringWithTitle(LabelBox, "data", this.computeTitle())}
+ isDocumentActive={returnFalse}
+ PanelWidth={() => width}
+ PanelHeight={() => height}
+ ScreenToLocalTransform={() =>
+ this.props.ScreenToLocalTransform().translate(-x, -y)
+ }
+ focus={focusFunc}
+ rootSelected={returnFalse}
+ onClick={script}
+ onDoubleClick={
+ this.props.layoutDoc.autoPlayAnchors ? undefined : doublescript
+ }
+ ignoreAutoHeight={false}
+ hideResizeHandles={true}
+ bringToFront={emptyFunction}
+ scriptContext={this.props.stackedTimeline}
+ />
+ ),
};
});
+
render() {
- const inner = this.renderInner(this.props.mark, this.props.rangeClickScript, this.props.rangePlayScript, this.props.left, this.props.top, this.props.width, this.props.height);
- return <>
- {inner.view}
- {!inner.anchor.view || !SelectionManager.IsSelected(inner.anchor.view) ? (null) :
- <>
- <div key="left" className="collectionStackedTimeline-left-resizer" onPointerDown={e => this.onAnchorDown(e, this.props.mark, true)} />
- <div key="right" className="collectionStackedTimeline-resizer" onPointerDown={e => this.onAnchorDown(e, this.props.mark, false)} />
- </>}
- </>;
+ const inner = this.renderInner(
+ this.props.mark,
+ this.props.rangeClickScript,
+ this.props.rangePlayScript,
+ this.props.left,
+ this.props.top,
+ this.props.width,
+ this.props.height
+ );
+ return (
+ <>
+ {inner.view}
+ {!inner.anchor.view ||
+ !SelectionManager.IsSelected(inner.anchor.view) ? null : (
+ <>
+ <div
+ key="left"
+ className="collectionStackedTimeline-left-resizer"
+ onPointerDown={(e) => this.onAnchorDown(e, this.props.mark, true)}
+ />
+ <div
+ key="right"
+ className="collectionStackedTimeline-resizer"
+ onPointerDown={(e) =>
+ this.onAnchorDown(e, this.props.mark, false)
+ }
+ />
+ </>
+ )}
+ </>
+ );
}
}
-Scripting.addGlobal(function formatToTime(time: number): any { return formatTime(time); }); \ No newline at end of file
+Scripting.addGlobal(function formatToTime(time: number): any {
+ return formatTime(time);
+});
+Scripting.addGlobal(function min(num1: number, num2: number): number {
+ return Math.min(num1, num2);
+});
+Scripting.addGlobal(function max(num1: number, num2: number): number {
+ return Math.max(num1, num2);
+}); \ No newline at end of file
diff --git a/src/client/views/collections/CollectionStackingView.scss b/src/client/views/collections/CollectionStackingView.scss
index 4b123c8b6..2f002736d 100644
--- a/src/client/views/collections/CollectionStackingView.scss
+++ b/src/client/views/collections/CollectionStackingView.scss
@@ -14,6 +14,30 @@
width: 100%;
}
+// TODO:glr Turn this into a seperate class
+.documentButtonMenu {
+ position: relative;
+ height: fit-content;
+ border-bottom: $standard-border;
+ display: flex;
+ justify-content: center;
+ flex-direction: column;
+ align-items: center;
+ align-content: center;
+ padding: 5px 0 5px 0;
+
+ .documentExplanation {
+ width: 90%;
+ margin: 5px;
+ font-size: 11px;
+ background-color: $light-blue;
+ color: $medium-blue;
+ padding: 10px;
+ border-radius: 10px;
+ border: solid 2px $medium-blue;
+ }
+}
+
.collectionStackingView,
.collectionMasonryView {
height: 100%;
diff --git a/src/client/views/collections/CollectionStackingView.tsx b/src/client/views/collections/CollectionStackingView.tsx
index b9bc83d49..648ff5087 100644
--- a/src/client/views/collections/CollectionStackingView.tsx
+++ b/src/client/views/collections/CollectionStackingView.tsx
@@ -3,7 +3,7 @@ import { FontAwesomeIcon } from "@fortawesome/react-fontawesome";
import { CursorProperty } from "csstype";
import { action, computed, IReactionDisposer, observable, reaction, runInAction } from "mobx";
import { observer } from "mobx-react";
-import { DataSym, Doc, HeightSym, Opt, WidthSym } from "../../../fields/Doc";
+import { DataSym, Doc, HeightSym, Opt, WidthSym, DocListCast } from "../../../fields/Doc";
import { collectionSchema, documentSchema } from "../../../fields/documentSchemas";
import { Id } from "../../../fields/FieldSymbols";
import { List } from "../../../fields/List";
@@ -11,7 +11,7 @@ import { listSpec, makeInterface } from "../../../fields/Schema";
import { SchemaHeaderField } from "../../../fields/SchemaHeaderField";
import { BoolCast, Cast, NumCast, ScriptCast, StrCast } from "../../../fields/Types";
import { TraceMobx } from "../../../fields/util";
-import { emptyFunction, returnFalse, returnZero, setupMoveUpEvents, smoothScroll, Utils } from "../../../Utils";
+import { emptyFunction, returnFalse, returnZero, setupMoveUpEvents, smoothScroll, Utils, returnTrue, returnEmptyDoclist, returnEmptyFilter } from "../../../Utils";
import { DocUtils, Docs } from "../../documents/Documents";
import { DragManager, dropActionType } from "../../util/DragManager";
import { SnappingManager } from "../../util/SnappingManager";
@@ -23,12 +23,14 @@ import { EditableView } from "../EditableView";
import { LightboxView } from "../LightboxView";
import { CollectionFreeFormDocumentView } from "../nodes/CollectionFreeFormDocumentView";
import { DocFocusOptions, DocumentView, DocumentViewProps, ViewAdjustment } from "../nodes/DocumentView";
-import { StyleProp } from "../StyleProvider";
+import { StyleProp, DefaultStyleProvider } from "../StyleProvider";
import { CollectionMasonryViewFieldRow } from "./CollectionMasonryViewFieldRow";
import "./CollectionStackingView.scss";
import { CollectionStackingViewFieldColumn } from "./CollectionStackingViewFieldColumn";
import { CollectionSubView } from "./CollectionSubView";
import { CollectionViewType } from "./CollectionView";
+import { FontIconBox } from "../nodes/button/FontIconBox";
+import { CurrentUserUtils } from "../../util/CurrentUserUtils";
const _global = (window /* browser */ || global /* node */) as any;
type StackingDocument = makeInterface<[typeof collectionSchema, typeof documentSchema]>;
@@ -144,7 +146,7 @@ export class CollectionStackingView extends CollectionSubView<StackingDocument,
() => this.layoutDoc._columnHeaders = new List()
);
this._autoHeightDisposer = reaction(() => this.layoutDoc._autoHeight,
- () => this.props.setHeight(Math.min(NumCast(this.layoutDoc._maxHeight, Number.MAX_SAFE_INTEGER),
+ autoHeight => autoHeight && this.props.setHeight(Math.min(NumCast(this.layoutDoc._maxHeight, Number.MAX_SAFE_INTEGER),
this.headerMargin + (this.isStackingView ?
Math.max(...this.refList.map(r => Number(getComputedStyle(r).height.replace("px", "")))) :
this.refList.reduce((p, r) => p + Number(getComputedStyle(r).height.replace("px", "")), 0)))));
@@ -234,6 +236,7 @@ export class CollectionStackingView extends CollectionSubView<StackingDocument,
dontCenter={this.props.childIgnoreNativeSize ? "xy" : undefined}
dontRegisterView={dataDoc ? true : BoolCast(this.layoutDoc.childDontRegisterViews, this.props.dontRegisterView)}
rootSelected={this.rootSelected}
+ showTitle={this.props.childShowTitle}
dropAction={StrCast(this.layoutDoc.childDropAction) as dropActionType}
onClick={this.onChildClickHandler}
onDoubleClick={this.onChildDoubleClickHandler}
@@ -514,6 +517,47 @@ export class CollectionStackingView extends CollectionSubView<StackingDocument,
return sections.map((section, i) => this.isStackingView ? this.sectionStacking(section[0], section[1]) : this.sectionMasonry(section[0], section[1], i === 0));
}
+ @computed get buttonMenu() {
+ const menuDoc: Doc = Cast(this.rootDoc.buttonMenuDoc, Doc, null);
+ // TODO:glr Allow support for multiple buttons
+ if (menuDoc) {
+ const width: number = NumCast(menuDoc._width, 30);
+ const height: number = NumCast(menuDoc._height, 30);
+ console.log(menuDoc.title, width, height);
+ return (<div className="buttonMenu-docBtn"
+ style={{ width: width, height: height }}>
+ <DocumentView
+ Document={menuDoc}
+ DataDoc={menuDoc}
+ isContentActive={this.props.isContentActive}
+ isDocumentActive={returnTrue}
+ addDocument={this.props.addDocument}
+ moveDocument={this.props.moveDocument}
+ addDocTab={this.props.addDocTab}
+ pinToPres={emptyFunction}
+ rootSelected={this.props.isSelected}
+ removeDocument={this.props.removeDocument}
+ ScreenToLocalTransform={Transform.Identity}
+ PanelWidth={() => 35}
+ PanelHeight={() => 35}
+ renderDepth={this.props.renderDepth}
+ focus={emptyFunction}
+ styleProvider={this.props.styleProvider}
+ layerProvider={this.props.layerProvider}
+ docViewPath={returnEmptyDoclist}
+ whenChildContentsActiveChanged={emptyFunction}
+ bringToFront={emptyFunction}
+ docFilters={this.props.docFilters}
+ docRangeFilters={this.props.docRangeFilters}
+ searchFilterDocs={this.props.searchFilterDocs}
+ ContainingCollectionView={undefined}
+ ContainingCollectionDoc={undefined}
+ />
+ </div>
+ );
+ }
+ }
+
@computed get nativeWidth() { return this.props.NativeWidth?.() ?? Doc.NativeWidth(this.layoutDoc); }
@computed get nativeHeight() { return this.props.NativeHeight?.() ?? Doc.NativeHeight(this.layoutDoc); }
@@ -529,34 +573,49 @@ export class CollectionStackingView extends CollectionSubView<StackingDocument,
SetValue: this.addGroup,
contents: "+ ADD A GROUP"
};
+ const buttonMenu = this.rootDoc.buttonMenu;
+ const noviceExplainer = this.rootDoc.explainer;
return (
- <div className="collectionStackingMasonry-cont" >
- <div className={this.isStackingView ? "collectionStackingView" : "collectionMasonryView"}
- ref={this.createRef}
- style={{
- overflowY: this.props.isContentActive() ? "auto" : "hidden",
- background: this.props.styleProvider?.(this.rootDoc, this.props, StyleProp.BackgroundColor),
- pointerEvents: this.backgroundEvents ? "all" : undefined
- }}
- onScroll={action(e => this._scroll = e.currentTarget.scrollTop)}
- onDrop={this.onExternalDrop.bind(this)}
- onContextMenu={this.onContextMenu}
- onWheel={e => this.props.isContentActive(true) && e.stopPropagation()} >
- {this.renderedSections}
- {!this.showAddAGroup ? (null) :
- <div key={`${this.props.Document[Id]}-addGroup`} className="collectionStackingView-addGroupButton"
- style={{ width: !this.isStackingView ? "100%" : this.columnWidth / this.numGroupColumns - 10, marginTop: 10 }}>
- <EditableView {...editableViewProps} />
- </div>}
- {/* {this.chromeHidden || !this.props.isSelected() ? (null) :
- <Switch
- onChange={this.onToggle}
- onClick={this.onToggle}
- defaultChecked={true}
- checkedChildren="edit"
- unCheckedChildren="view"
- />} */}
- </div> </div>
+ <>
+ {buttonMenu || noviceExplainer ? <div className="documentButtonMenu">
+ {buttonMenu ? this.buttonMenu : null}
+ {Doc.UserDoc().noviceMode && noviceExplainer ?
+ <div className="documentExplanation">
+ {noviceExplainer}
+ </div>
+ : null
+ }
+ </div> : null}
+ <div className="collectionStackingMasonry-cont" >
+ <div className={this.isStackingView ? "collectionStackingView" : "collectionMasonryView"}
+ ref={this.createRef}
+ style={{
+ overflowY: this.props.isContentActive() ? "auto" : "hidden",
+ background: this.props.styleProvider?.(this.rootDoc, this.props, StyleProp.BackgroundColor),
+ pointerEvents: this.backgroundEvents ? "all" : undefined
+ }}
+ onScroll={action(e => this._scroll = e.currentTarget.scrollTop)}
+ onDrop={this.onExternalDrop.bind(this)}
+ onContextMenu={this.onContextMenu}
+ onWheel={e => this.props.isContentActive(true) && e.stopPropagation()} >
+ {this.renderedSections}
+ {!this.showAddAGroup ? (null) :
+ <div key={`${this.props.Document[Id]}-addGroup`} className="collectionStackingView-addGroupButton"
+ style={{ width: !this.isStackingView ? "100%" : this.columnWidth / this.numGroupColumns - 10, marginTop: 10 }}>
+ <EditableView {...editableViewProps} />
+ </div>}
+ {/* {this.chromeHidden || !this.props.isSelected() ? (null) :
+ <Switch
+ onChange={this.onToggle}
+ onClick={this.onToggle}
+ defaultChecked={true}
+ checkedChildren="edit"
+ unCheckedChildren="view"
+ />} */}
+ </div>
+ </div>
+ </>
+
);
}
}
diff --git a/src/client/views/collections/CollectionStackingViewFieldColumn.tsx b/src/client/views/collections/CollectionStackingViewFieldColumn.tsx
index 47733994b..58289a161 100644
--- a/src/client/views/collections/CollectionStackingViewFieldColumn.tsx
+++ b/src/client/views/collections/CollectionStackingViewFieldColumn.tsx
@@ -111,7 +111,7 @@ export class CollectionStackingViewFieldColumn extends React.Component<CSVFieldC
@action pointerEntered = () => SnappingManager.GetIsDragging() && (this._background = "#b4b4b4");
@action pointerLeave = () => this._background = "inherit";
- textCallback = (char: string) => this.addNewTextDoc("", false, true);
+ textCallback = (char: string) => this.addNewTextDoc("-typed text-", false, true);
@action
addNewTextDoc = (value: string, shiftDown?: boolean, forceEmptyNote?: boolean) => {
diff --git a/src/client/views/collections/CollectionSubView.tsx b/src/client/views/collections/CollectionSubView.tsx
index 2f07c0241..cb8b55cb2 100644
--- a/src/client/views/collections/CollectionSubView.tsx
+++ b/src/client/views/collections/CollectionSubView.tsx
@@ -1,6 +1,6 @@
import { action, computed, IReactionDisposer, reaction, observable, runInAction } from "mobx";
import CursorField from "../../../fields/CursorField";
-import { Doc, Opt, Field, DocListCast, AclPrivate } from "../../../fields/Doc";
+import { Doc, Opt, Field, DocListCast, AclPrivate, StrListCast } from "../../../fields/Doc";
import { Id, ToString } from "../../../fields/FieldSymbols";
import { List } from "../../../fields/List";
import { listSpec } from "../../../fields/Schema";
@@ -23,6 +23,7 @@ import ReactLoading from 'react-loading';
export interface SubCollectionViewProps extends CollectionViewProps {
CollectionView: Opt<CollectionView>;
SetSubView?: (subView: any) => void;
+ isAnyChildContentActive: () => boolean;
}
export function CollectionSubView<T, X>(schemaCtor: (doc: Doc) => T, moreProps?: X) {
@@ -88,12 +89,13 @@ export function CollectionSubView<T, X>(schemaCtor: (doc: Doc) => T, moreProps?:
get childDocList() {
return Cast(this.dataField, listSpec(Doc));
}
- collectionFilters = () => this._focusFilters ?? Cast(this.props.Document._docFilters, listSpec("string"), []);
+ collectionFilters = () => this._focusFilters ?? StrListCast(this.props.Document._docFilters);
collectionRangeDocFilters = () => this._focusRangeFilters ?? Cast(this.props.Document._docRangeFilters, listSpec("string"), []);
- childDocFilters = () => [...this.props.docFilters(), ...this.collectionFilters()];
+ childDocFilters = () => [...(this.props.docFilters?.().filter(f => Utils.IsRecursiveFilter(f)) || []), ...this.collectionFilters()];
+ unrecursiveDocFilters = () => [...(this.props.docFilters?.().filter(f => !Utils.IsRecursiveFilter(f)) || [])];
childDocRangeFilters = () => [...(this.props.docRangeFilters?.() || []), ...this.collectionRangeDocFilters()];
IsFiltered = () => this.collectionFilters().length || this.collectionRangeDocFilters().length ? "hasFilter" :
- this.props.docFilters().length || this.props.docRangeFilters().length ? "inheritsFilter" : undefined
+ this.props.docFilters?.().filter(f => Utils.IsRecursiveFilter(f)).length || this.props.docRangeFilters().length ? "inheritsFilter" : undefined
searchFilterDocs = () => this.props.searchFilterDocs?.() ?? DocListCast(this.props.Document._searchFilterDocs);
@computed.struct get childDocs() {
TraceMobx();
@@ -113,10 +115,10 @@ export function CollectionSubView<T, X>(schemaCtor: (doc: Doc) => T, moreProps?:
const viewSpecScript = Cast(this.props.Document.viewSpecScript, ScriptField);
const childDocs = viewSpecScript ? docs.filter(d => viewSpecScript.script.run({ doc: d }, console.log).result) : docs;
- const docFilters = this.childDocFilters();
+ const childDocFilters = this.childDocFilters();
const docRangeFilters = this.childDocRangeFilters();
const searchDocs = this.searchFilterDocs();
- if (this.props.Document.dontRegisterView || (!docFilters.length && !docRangeFilters.length && !searchDocs.length)) {
+ if (this.props.Document.dontRegisterView || (!childDocFilters.length && !this.unrecursiveDocFilters().length && !docRangeFilters.length && !searchDocs.length)) {
return childDocs.filter(cd => !cd.cookies); // remove any documents that require a cookie if there are no filters to provide one
}
@@ -127,24 +129,27 @@ export function CollectionSubView<T, X>(schemaCtor: (doc: Doc) => T, moreProps?:
const docsforFilter: Doc[] = [];
childDocs.forEach((d) => {
// if (DocUtils.Excluded(d, docFilters)) return;
- let notFiltered = d.z || Doc.IsSystem(d) || ((!searchDocs.length || searchDocs.includes(d)) && (DocUtils.FilterDocs([d], docFilters, docRangeFilters, viewSpecScript, this.props.Document).length > 0));
- const fieldKey = Doc.LayoutFieldKey(d);
- const annos = !Field.toString(Doc.LayoutField(d) as Field).includes("CollectionView");
- const data = d[annos ? fieldKey + "-annotations" : fieldKey];
- if (data !== undefined) {
- let subDocs = DocListCast(data);
- if (subDocs.length > 0) {
- let newarray: Doc[] = [];
- notFiltered = notFiltered || (!searchDocs.length && DocUtils.FilterDocs(subDocs, docFilters, docRangeFilters, viewSpecScript, d).length);
- while (subDocs.length > 0 && !notFiltered) {
- newarray = [];
- subDocs.forEach((t) => {
- const fieldKey = Doc.LayoutFieldKey(t);
- const annos = !Field.toString(Doc.LayoutField(t) as Field).includes("CollectionView");
- notFiltered = notFiltered || ((!searchDocs.length || searchDocs.includes(t)) && ((!docFilters.length && !docRangeFilters.length) || DocUtils.FilterDocs([t], docFilters, docRangeFilters, viewSpecScript, d).length));
- DocListCast(t[annos ? fieldKey + "-annotations" : fieldKey]).forEach((newdoc) => newarray.push(newdoc));
- });
- subDocs = newarray;
+ let notFiltered = d.z || Doc.IsSystem(d) || (DocUtils.FilterDocs([d], this.unrecursiveDocFilters(), docRangeFilters, viewSpecScript, this.props.Document).length > 0);
+ if (notFiltered) {
+ notFiltered = ((!searchDocs.length || searchDocs.includes(d)) && (DocUtils.FilterDocs([d], childDocFilters, docRangeFilters, viewSpecScript, this.props.Document).length > 0));
+ const fieldKey = Doc.LayoutFieldKey(d);
+ const annos = !Field.toString(Doc.LayoutField(d) as Field).includes("CollectionView");
+ const data = d[annos ? fieldKey + "-annotations" : fieldKey];
+ if (data !== undefined) {
+ let subDocs = DocListCast(data);
+ if (subDocs.length > 0) {
+ let newarray: Doc[] = [];
+ notFiltered = notFiltered || (!searchDocs.length && DocUtils.FilterDocs(subDocs, childDocFilters, docRangeFilters, viewSpecScript, d).length);
+ while (subDocs.length > 0 && !notFiltered) {
+ newarray = [];
+ subDocs.forEach((t) => {
+ const fieldKey = Doc.LayoutFieldKey(t);
+ const annos = !Field.toString(Doc.LayoutField(t) as Field).includes("CollectionView");
+ notFiltered = notFiltered || ((!searchDocs.length || searchDocs.includes(t)) && ((!childDocFilters.length && !docRangeFilters.length) || DocUtils.FilterDocs([t], childDocFilters, docRangeFilters, viewSpecScript, d).length));
+ DocListCast(t[annos ? fieldKey + "-annotations" : fieldKey]).forEach((newdoc) => newarray.push(newdoc));
+ });
+ subDocs = newarray;
+ }
}
}
}
@@ -211,7 +216,7 @@ export function CollectionSubView<T, X>(schemaCtor: (doc: Doc) => T, moreProps?:
const targetDocments = DocListCast(this.dataDoc[this.props.fieldKey]);
const someMoved = !docDragData.userDropAction && docDragData.draggedDocuments.some(drag => targetDocments.includes(drag));
if (someMoved) docDragData.droppedDocuments = docDragData.droppedDocuments.map((drop, i) => targetDocments.includes(docDragData.draggedDocuments[i]) ? docDragData.draggedDocuments[i] : drop);
- if ((!dropAction || dropAction === "move" || someMoved) && docDragData.moveDocument) {
+ if ((!dropAction || dropAction === "same" || dropAction === "move" || someMoved) && docDragData.moveDocument) {
const movedDocs = docDragData.droppedDocuments.filter((d, i) => docDragData.draggedDocuments[i] === d);
const addedDocs = docDragData.droppedDocuments.filter((d, i) => docDragData.draggedDocuments[i] !== d);
if (movedDocs.length) {
@@ -316,12 +321,8 @@ export function CollectionSubView<T, X>(schemaCtor: (doc: Doc) => T, moreProps?:
}
});
} else {
- let srcUrl: string | undefined;
- let srcWeb: Doc | undefined;
- if (SelectionManager.Views().length) {
- srcWeb = SelectionManager.Views()[0].props.Document;
- srcUrl = (srcWeb.data as WebField).url?.href?.match(/http[s]?:\/\/[^/]*/)?.[0];
- }
+ const srcWeb = SelectionManager.Docs().lastElement();
+ const srcUrl = (srcWeb?.data as WebField).url?.href?.match(/http[s]?:\/\/[^/]*/)?.[0];
const reg = new RegExp(Utils.prepend(""), "g");
const modHtml = srcUrl ? html.replace(reg, srcUrl) : html;
const htmlDoc = Docs.Create.HtmlDocument(modHtml, { ...options, title: "-web page-", _width: 300, _height: 300 });
@@ -486,7 +487,5 @@ import { FormattedTextBox, GoogleRef } from "../nodes/formattedText/FormattedTex
import { CollectionView, CollectionViewType, CollectionViewProps } from "./CollectionView";
import { SelectionManager } from "../../util/SelectionManager";
import { OverlayView } from "../OverlayView";
-import { Hypothesis } from "../../util/HypothesisUtils";
import { GetEffectiveAcl, TraceMobx } from "../../../fields/util";
-import { FilterBox } from "../nodes/FilterBox";
diff --git a/src/client/views/collections/CollectionTreeView.scss b/src/client/views/collections/CollectionTreeView.scss
index ec461ab94..d370d21ab 100644
--- a/src/client/views/collections/CollectionTreeView.scss
+++ b/src/client/views/collections/CollectionTreeView.scss
@@ -1,5 +1,8 @@
@import "../global/globalCssVariables";
+.collectionTreeView-container {
+ transform-origin: top left;
+}
.collectionTreeView-dropTarget {
border-width: $COLLECTION_BORDER_WIDTH;
border-color: transparent;
@@ -35,6 +38,11 @@
width: max-content;
}
+ .no-indent-outline {
+ padding-left: 0;
+ width: 100%;
+ }
+
.editableView-container {
font-weight: bold;
}
diff --git a/src/client/views/collections/CollectionTreeView.tsx b/src/client/views/collections/CollectionTreeView.tsx
index a78034dca..3852987b9 100644
--- a/src/client/views/collections/CollectionTreeView.tsx
+++ b/src/client/views/collections/CollectionTreeView.tsx
@@ -1,15 +1,16 @@
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome';
-import { action, computed, reaction, IReactionDisposer, observable } from "mobx";
+import { action, computed, IReactionDisposer, observable, reaction } from "mobx";
import { observer } from "mobx-react";
-import { DataSym, Doc, DocListCast, HeightSym, Opt, WidthSym, StrListCast } from '../../../fields/Doc';
+import { DataSym, Doc, DocListCast, HeightSym, Opt, StrListCast, WidthSym } from '../../../fields/Doc';
import { Id } from '../../../fields/FieldSymbols';
-import { List } from '../../../fields/List';
+import { InkTool } from '../../../fields/InkField';
import { Document, listSpec } from '../../../fields/Schema';
import { ScriptField } from '../../../fields/ScriptField';
import { BoolCast, Cast, NumCast, ScriptCast, StrCast } from '../../../fields/Types';
import { TraceMobx } from '../../../fields/util';
-import { returnEmptyDoclist, returnEmptyFilter, returnFalse, returnTrue } from '../../../Utils';
+import { returnEmptyDoclist, returnEmptyFilter, returnFalse, returnTrue, emptyFunction } from '../../../Utils';
import { DocUtils } from '../../documents/Documents';
+import { CurrentUserUtils } from '../../util/CurrentUserUtils';
import { DocumentManager } from '../../util/DocumentManager';
import { DragManager, dropActionType } from "../../util/DragManager";
import { SelectionManager } from '../../util/SelectionManager';
@@ -25,9 +26,7 @@ import { CollectionSubView } from "./CollectionSubView";
import "./CollectionTreeView.scss";
import { TreeView } from "./TreeView";
import React = require("react");
-import { InkTool } from '../../../fields/InkField';
-import { CurrentUserUtils } from '../../util/CurrentUserUtils';
-import { CollectionView, CollectionViewType } from './CollectionView';
+import { Transform } from '../../util/Transform';
const _global = (window /* browser */ || global /* node */) as any;
export type collectionTreeViewProps = {
@@ -63,7 +62,9 @@ export class CollectionTreeView extends CollectionSubView<Document, Partial<coll
this.props.isSelected(outsideReaction) || this._isAnyChildContentActive ||
this.props.rootSelected(outsideReaction)) ? true : false)
+ isDisposing = false;
componentWillUnmount() {
+ this.isDisposing = true;
super.componentWillUnmount();
this.treedropDisposer?.();
Object.values(this._disposers).forEach(disposer => disposer?.());
@@ -78,15 +79,16 @@ export class CollectionTreeView extends CollectionSubView<Document, Partial<coll
refList: Set<any> = new Set();
observer: any;
computeHeight = () => {
- const hgt = this.paddingTop() + 26/* bcz: ugh: title bar height hack ... get ref and compute instead */ +
- Array.from(this.refList).reduce((p, r) => p + Number(getComputedStyle(r).height.replace("px", "")), 0);
- this.props.setHeight(hgt);
+ if (this.isDisposing) return;
+ const bodyHeight = Array.from(this.refList).reduce((p, r) => p + Number(getComputedStyle(r).height.replace("px", "")), this.paddingTop() + this.paddingBot());
+ this.layoutDoc._autoHeightMargins = bodyHeight;
+ this.props.setHeight(this.documentTitleHeight() + bodyHeight);
}
unobserveHeight = (ref: any) => {
this.refList.delete(ref);
this.rootDoc.autoHeight && this.computeHeight();
}
- observerHeight = (ref: any) => {
+ observeHeight = (ref: any) => {
if (ref) {
this.refList.add(ref);
this.observer = new _global.ResizeObserver(action((entries: any) => {
@@ -106,7 +108,7 @@ export class CollectionTreeView extends CollectionSubView<Document, Partial<coll
protected onInternalPreDrop = (e: Event, de: DragManager.DropEvent, targetAction: dropActionType) => {
const dragData = de.complete.docDragData;
if (dragData) {
- const isInTree = () => dragData.draggedDocuments.some(d => d.context === this.doc && this.childDocs.includes(d));
+ const isInTree = () => Doc.AreProtosEqual(dragData.treeViewDoc, this.props.Document) || dragData.draggedDocuments.some(d => d.context === this.doc && this.childDocs.includes(d));
dragData.dropAction = targetAction && !isInTree() ? targetAction : this.doc === dragData?.treeViewDoc ? "same" : dragData.dropAction;
}
}
@@ -201,6 +203,7 @@ export class CollectionTreeView extends CollectionSubView<Document, Partial<coll
NativeWidth={this.documentTitleWidth}
NativeHeight={this.documentTitleHeight}
focus={this.props.focus}
+ treeViewDoc={this.props.Document}
ScreenToLocalTransform={this.titleTransform}
docFilters={returnEmptyFilter}
docRangeFilters={returnEmptyFilter}
@@ -219,8 +222,9 @@ export class CollectionTreeView extends CollectionSubView<Document, Partial<coll
}
childContextMenuItems = () => {
const customScripts = Cast(this.doc.childContextMenuScripts, listSpec(ScriptField), []);
- const filterScripts = Cast(this.doc.childContextMenuFilters, listSpec(ScriptField), []);
- return StrListCast(this.doc.childContextMenuLabels).map((label, i) => ({ script: customScripts[i], filter: filterScripts[i], label }));
+ const customFilters = Cast(this.doc.childContextMenuFilters, listSpec(ScriptField), []);
+ const icons = StrListCast(this.doc.childContextMenuIcons);
+ return StrListCast(this.doc.childContextMenuLabels).map((label, i) => ({ script: customScripts[i], filter: customFilters[i], icon: icons[i], label }));
}
@computed get treeViewElements() {
TraceMobx();
@@ -253,50 +257,111 @@ export class CollectionTreeView extends CollectionSubView<Document, Partial<coll
true,
this.whenChildContentsActiveChanged,
this.props.dontRegisterView || Cast(this.props.Document.childDontRegisterViews, "boolean", null),
- this.observerHeight,
+ this.observeHeight,
this.unobserveHeight,
this.childContextMenuItems()
);
}
@computed get titleBar() {
const hideTitle = this.props.treeViewHideTitle || this.doc.treeViewHideTitle;
- return hideTitle ? (null) : (this.doc.treeViewType === "outline" ? this.documentTitle : this.editableTitle)(this.treeChildren);
+ return hideTitle ? (null) : (this.outlineMode ? this.documentTitle : this.editableTitle)(this.treeChildren);
}
- @computed get renderClearButton() {
- return !this.doc.treeViewShowClearButton ? (null) : <div key="toolbar">
- <button className="toolbar-button round-button" title="Empty" onClick={undoBatch(action(() => Doc.GetProto(this.doc)[this.props.fieldKey] = undefined))}>
- <FontAwesomeIcon icon={"trash"} size="sm" />
- </button>
- </div >;
+ return35 = () => 35;
+ @computed get buttonMenu() {
+ const menuDoc: Doc = Cast(this.rootDoc.buttonMenuDoc, Doc, null);
+ // To create a multibutton menu add a CollectionLinearView
+ if (menuDoc) {
+
+ const width: number = NumCast(menuDoc._width, 30);
+ const height: number = NumCast(menuDoc._height, 30);
+ console.log(menuDoc.title, width, height);
+ return (<div className="buttonMenu-docBtn"
+ style={{ width: width, height: height }}>
+ <DocumentView
+ Document={menuDoc}
+ DataDoc={menuDoc}
+ isContentActive={this.props.isContentActive}
+ isDocumentActive={returnTrue}
+ addDocument={this.props.addDocument}
+ moveDocument={this.props.moveDocument}
+ addDocTab={this.props.addDocTab}
+ pinToPres={emptyFunction}
+ rootSelected={this.props.isSelected}
+ removeDocument={this.props.removeDocument}
+ ScreenToLocalTransform={Transform.Identity}
+ PanelWidth={this.return35}
+ PanelHeight={this.return35}
+ renderDepth={this.props.renderDepth + 1}
+ focus={emptyFunction}
+ styleProvider={this.props.styleProvider}
+ layerProvider={this.props.layerProvider}
+ docViewPath={returnEmptyDoclist}
+ whenChildContentsActiveChanged={emptyFunction}
+ bringToFront={emptyFunction}
+ docFilters={this.props.docFilters}
+ docRangeFilters={this.props.docRangeFilters}
+ searchFilterDocs={this.props.searchFilterDocs}
+ ContainingCollectionView={undefined}
+ ContainingCollectionDoc={undefined}
+ />
+ </div>);
+ }
}
+ @observable _explainerHeight: number = 0;
+
+ @computed get nativeWidth() { return Doc.NativeWidth(this.Document, undefined, true); }
+ @computed get nativeHeight() { return Doc.NativeHeight(this.Document, undefined, true); }
+
+ @computed get contentScaling() {
+ const nw = this.nativeWidth;
+ const nh = this.nativeHeight;
+ const hscale = nh ? this.props.PanelHeight() / nh : 1;
+ const wscale = nw ? this.props.PanelWidth() / nw : 1;
+ return wscale < hscale ? wscale : hscale;
+ }
paddingX = () => NumCast(this.doc._xPadding, 15);
paddingTop = () => NumCast(this.doc._yPadding, 20);
+ paddingBot = () => NumCast(this.doc._yPadding, 20);
documentTitleWidth = () => Math.min(this.layoutDoc?.[WidthSym](), this.panelWidth());
- documentTitleHeight = () => Math.min(this.layoutDoc?.[HeightSym](), (StrCast(this.layoutDoc?._fontSize) ? Number(StrCast(this.layoutDoc?._fontSize, "32px").replace("px", "")) : NumCast(this.layoutDoc?._fontSize)) * 2);
+ documentTitleHeight = () => (this.layoutDoc?.[HeightSym]() || 0) - NumCast(this.layoutDoc.autoHeightMargins);
titleTransform = () => this.props.ScreenToLocalTransform().translate(-NumCast(this.doc._xPadding, 10), -NumCast(this.doc._yPadding, 20));
truncateTitleWidth = () => this.treeViewtruncateTitleWidth;
onChildClick = () => this.props.onChildClick?.() || ScriptCast(this.doc.onChildClick);
- panelWidth = () => this.props.PanelWidth() - 2 * this.paddingX();
+ panelWidth = () => (this.props.PanelWidth() - 2 * this.paddingX()) * (this.props.scaling?.() || 1);
render() {
TraceMobx();
const background = () => this.props.styleProvider?.(this.doc, this.props, StyleProp.BackgroundColor);
const pointerEvents = () => !this.props.isContentActive() && !SnappingManager.GetIsDragging() ? "none" : undefined;
+ const buttonMenu = this.rootDoc.buttonMenu;
+ const noviceExplainer = this.rootDoc.explainer;
return !(this.doc instanceof Doc) || !this.treeChildren ? (null) :
- <div className="collectionTreeView-container" onContextMenu={this.onContextMenu}>
- <div className="collectionTreeView-dropTarget"
- style={{ background: background(), paddingLeft: `${this.paddingX()}px`, paddingRight: `${this.paddingX()}px`, paddingTop: `${this.paddingTop()}px`, pointerEvents: pointerEvents() }}
- onWheel={e => e.stopPropagation()}
- onDrop={this.onTreeDrop}
- ref={this.createTreeDropTarget}>
- {this.titleBar}
- {this.renderClearButton}
- <ul className="no-indent">
- {this.treeViewElements}
- </ul>
- </div >
- </div>;
+ <>
+ {this.titleBar}
+ <div className="collectionTreeView-container"
+ style={this.outlineMode ? { transform: `scale(${this.contentScaling})`, width: `calc(${100 / this.contentScaling}%)` } : {}}
+ onContextMenu={this.onContextMenu}>
+ {buttonMenu || noviceExplainer ? <div className="documentButtonMenu" ref={action((r: HTMLDivElement) => r && (this._explainerHeight = r.getBoundingClientRect().height))}>
+ {buttonMenu ? this.buttonMenu : null}
+ {Doc.UserDoc().noviceMode && noviceExplainer ?
+ <div className="documentExplanation">
+ {noviceExplainer}
+ </div>
+ : null
+ }
+ </div> : null}
+ <div className="collectionTreeView-dropTarget"
+ style={{ background: background(), height: `calc(100% - ${this._explainerHeight}px)`, paddingLeft: `${this.paddingX()}px`, paddingRight: `${this.paddingX()}px`, paddingBottom: `${this.paddingBot()}px`, paddingTop: `${this.paddingTop()}px`, pointerEvents: pointerEvents() }}
+ onWheel={e => e.stopPropagation()}
+ onDrop={this.onTreeDrop}
+ ref={this.createTreeDropTarget}>
+ <ul className={`no-indent${this.outlineMode ? "-outline" : ""}`} >
+ {this.treeViewElements}
+ </ul>
+ </div >
+ </div>
+ </>;
}
} \ No newline at end of file
diff --git a/src/client/views/collections/CollectionView.tsx b/src/client/views/collections/CollectionView.tsx
index 2485c0f6a..0dd1e6e36 100644
--- a/src/client/views/collections/CollectionView.tsx
+++ b/src/client/views/collections/CollectionView.tsx
@@ -24,7 +24,7 @@ import { CollectionCarouselView } from './CollectionCarouselView';
import { CollectionDockingView } from "./CollectionDockingView";
import { CollectionFreeFormView } from './collectionFreeForm/CollectionFreeFormView';
import { CollectionGridView } from './collectionGrid/CollectionGridView';
-import { CollectionLinearView } from './CollectionLinearView';
+import { CollectionLinearView } from './collectionLinear';
import CollectionMapView from './MapView/CollectionMapView';
import { CollectionMulticolumnView } from './collectionMulticolumn/CollectionMulticolumnView';
import { CollectionMultirowView } from './collectionMulticolumn/CollectionMultirowView';
@@ -36,6 +36,8 @@ import { CollectionTimeView } from './CollectionTimeView';
import { CollectionTreeView } from "./CollectionTreeView";
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome';
import './CollectionView.scss';
+import { returnEmptyString } from '../../../Utils';
+import { InkTool } from '../../../fields/InkField';
export const COLLECTION_BORDER_WIDTH = 2;
const path = require('path');
@@ -62,13 +64,14 @@ export enum CollectionViewType {
export interface CollectionViewProps extends FieldViewProps {
isAnnotationOverlay?: boolean; // is the collection an annotation overlay (eg an overlay on an image/video/etc)
layoutEngine?: () => string;
- setPreviewCursor?: (func: (x: number, y: number, drag: boolean) => void) => void;
+ setPreviewCursor?: (func: (x: number, y: number, drag: boolean, hide: boolean) => void) => void;
// property overrides for child documents
children?: never | (() => JSX.Element[]) | React.ReactNode;
childDocuments?: Doc[]; // used to override the documents shown by the sub collection to an explicit list (see LinkBox)
childDocumentsActive?: () => boolean;// whether child documents can be dragged if collection can be dragged (eg., in a when a Pile document is in startburst mode)
childFitWidth?: () => boolean;
+ childShowTitle?: () => string;
childOpacity?: () => number;
childContextMenuItems?: () => { script: ScriptField, label: string }[];
childHideTitle?: () => boolean; // whether to hide the documentdecorations title for children
@@ -84,7 +87,7 @@ export interface CollectionViewProps extends FieldViewProps {
type CollectionDocument = makeInterface<[typeof documentSchema]>;
const CollectionDocument = makeInterface(documentSchema);
@observer
-export class CollectionView extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps & CollectionViewProps, CollectionDocument>(CollectionDocument, "") {
+export class CollectionView extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps & CollectionViewProps, CollectionDocument>(CollectionDocument) {
public static LayoutString(fieldStr: string) { return FieldView.LayoutString(CollectionView, fieldStr); }
@observable private static _safeMode = false;
@@ -92,6 +95,11 @@ export class CollectionView extends ViewBoxAnnotatableComponent<ViewBoxAnnotatab
protected _multiTouchDisposer?: InteractionUtils.MultiTouchEventDisposer;
+ constructor(props: any) {
+ super(props);
+ runInAction(() => this._annotationKeySuffix = returnEmptyString);
+ }
+
get collectionViewType(): CollectionViewType | undefined {
const viewField = StrCast(this.layoutDoc._viewType);
if (CollectionView._safeMode) {
@@ -113,7 +121,7 @@ export class CollectionView extends ViewBoxAnnotatableComponent<ViewBoxAnnotatab
// const imageProtos = children.filter(doc => Cast(doc.data, ImageField)).map(Doc.GetProto);
// const allTagged = imageProtos.length > 0 && imageProtos.every(image => image.googlePhotosTags);
// return !allTagged ? (null) : <img id={"google-tags"} src={"/assets/google_tags.png"} />;
- this.isContentActive();
+ //this.isContentActive();
}
screenToLocalTransform = () => this.props.renderDepth ? this.props.ScreenToLocalTransform() : this.props.ScreenToLocalTransform().scale(this.props.PanelWidth() / this.bodyPanelWidth());
@@ -158,7 +166,7 @@ export class CollectionView extends ViewBoxAnnotatableComponent<ViewBoxAnnotatab
!Doc.UserDoc().noviceMode && subItems.push({ description: "Map", event: () => func(CollectionViewType.Map), icon: "globe-americas" });
subItems.push({ description: "Grid", event: () => func(CollectionViewType.Grid), icon: "th-list" });
- if (!Doc.IsSystem(this.rootDoc) && !this.rootDoc.annotationOn) {
+ if (!Doc.IsSystem(this.rootDoc) && !this.rootDoc.isGroup && !this.rootDoc.annotationOn) {
const existingVm = ContextMenu.Instance.findByDescription(category);
const catItems = existingVm && "subitems" in existingVm ? existingVm.subitems : [];
catItems.push({ description: "Add a Perspective...", addDivider: true, noexpand: true, subitems: subItems, icon: "eye" });
@@ -247,6 +255,9 @@ export class CollectionView extends ViewBoxAnnotatableComponent<ViewBoxAnnotatab
@observable _subView: any = undefined;
+ isContentActive = (outsideReaction?: boolean) => {
+ return this.props.isContentActive() ? true : false;
+ }
render() {
TraceMobx();
const props: SubCollectionViewProps = {
@@ -256,6 +267,8 @@ export class CollectionView extends ViewBoxAnnotatableComponent<ViewBoxAnnotatab
moveDocument: this.moveDocument,
removeDocument: this.removeDocument,
isContentActive: this.isContentActive,
+ isAnyChildContentActive: this.isAnyChildContentActive,
+ whenChildContentsActiveChanged: this.whenChildContentsActiveChanged,
PanelWidth: this.bodyPanelWidth,
PanelHeight: this.props.PanelHeight,
ScreenToLocalTransform: this.screenToLocalTransform,
diff --git a/src/client/views/collections/TabDocView.scss b/src/client/views/collections/TabDocView.scss
index dddccd18c..0d045bada 100644
--- a/src/client/views/collections/TabDocView.scss
+++ b/src/client/views/collections/TabDocView.scss
@@ -1,3 +1,6 @@
+@import "../global/globalCssVariables.scss";
+
+
input.lm_title:focus,
input.lm_title {
max-width: unset !important;
@@ -57,12 +60,11 @@ input.lm_title {
}
}
-.miniMap-hidden,
.miniMap {
position: absolute;
overflow: hidden;
- right: 10;
- bottom: 10;
+ right: 15;
+ bottom: 15;
border: solid 1px;
width: 100%;
height: 100%;
@@ -81,17 +83,21 @@ input.lm_title {
}
.miniMap-hidden {
+ cursor: pointer;
position: absolute;
- bottom: 0;
- right: 0;
- width: 45px;
- height: 45px;
- transform: translate(20px, 20px) rotate(45deg);
- border-radius: 30px;
+ bottom: 5;
+ display: flex;
+ right: 5;
+ width: 25px;
+ height: 25px;
+ border-radius: 3px;
padding: 2px;
+ justify-content: center;
+ align-items: center;
+ align-content: center;
+ background-color: $light-gray;
- > svg {
- margin-top: 3px;
- transform: translate(0px, 7px);
+ &:hover {
+ box-shadow: none;
}
}
diff --git a/src/client/views/collections/TabDocView.tsx b/src/client/views/collections/TabDocView.tsx
index e6e71a3c4..73c065482 100644
--- a/src/client/views/collections/TabDocView.tsx
+++ b/src/client/views/collections/TabDocView.tsx
@@ -11,7 +11,6 @@ import { DataSym, Doc, DocListCast, DocListCastAsync, HeightSym, Opt, WidthSym }
import { Id } from '../../../fields/FieldSymbols';
import { FieldId } from "../../../fields/RefField";
import { BoolCast, Cast, NumCast, StrCast } from "../../../fields/Types";
-import { TraceMobx } from '../../../fields/util';
import { emptyFunction, lightOrDark, returnEmptyDoclist, returnFalse, returnTrue, setupMoveUpEvents, Utils } from "../../../Utils";
import { DocServer } from "../../DocServer";
import { DocUtils } from '../../documents/Documents';
@@ -34,6 +33,7 @@ import { CollectionView, CollectionViewType } from './CollectionView';
import "./TabDocView.scss";
import React = require("react");
import Color = require('color');
+import { Colors, Shadows } from '../global/globalEnums';
const _global = (window /* browser */ || global /* node */) as any;
interface TabDocViewProps {
@@ -124,6 +124,8 @@ export class TabDocView extends React.Component<TabDocViewProps> {
tab.element[0].prepend(iconWrap);
tab._disposers.layerDisposer = reaction(() => ({ layer: tab.DashDoc.activeLayer, color: this.tabColor }),
({ layer, color }) => {
+ // console.log("TabDocView: " + this.tabColor);
+ // console.log("lightOrDark: " + lightOrDark(this.tabColor));
const textColor = lightOrDark(this.tabColor); //not working with StyleProp.Color
titleEle.style.color = textColor;
titleEle.style.backgroundColor = "transparent";
@@ -132,12 +134,6 @@ export class TabDocView extends React.Component<TabDocViewProps> {
moreInfoDrag.style.backgroundColor = textColor;
tab.element[0].style.background = !layer ? color : "dimgrey";
}, { fireImmediately: true });
- // TODO:glr fix
- // tab.element[0].style.borderTopRightRadius = "8px";
- // tab.element[0].children[1].appendChild(toggle);
- // tab._disposers.layerDisposer = reaction(() =>
- // ({ layer: tab.DashDoc.activeLayer, color: this.tabColor }),
- // ({ layer, color }) => toggle.style.background = !layer ? color : "dimgrey", { fireImmediately: true });
}
// shifts the focus to this tab when another tab is dragged over it
tab.element[0].onmouseenter = (e: MouseEvent) => {
@@ -313,6 +309,14 @@ export class TabDocView extends React.Component<TabDocViewProps> {
return CollectionDockingView.AddSplit(doc, locationParams, this.stack);
}
}
+ remDocTab = (doc: Doc | Doc[]) => {
+ if (doc === this._document) {
+ SelectionManager.DeselectAll();
+ CollectionDockingView.CloseSplit(this._document);
+ return true;
+ }
+ return false;
+ }
getCurrentFrame = () => {
return NumCast(Cast(PresBox.Instance.childDocs[PresBox.Instance.itemIndex].presentationTargetDoc, Doc, null)._currentFrame);
@@ -349,7 +353,6 @@ export class TabDocView extends React.Component<TabDocViewProps> {
@computed get layerProvider() { return this._document && DefaultLayerProvider(this._document); }
@computed get docView() {
- TraceMobx();
return !this._activated || !this._document || this._document._viewType === CollectionViewType.Docking ? (null) :
<><DocumentView key={this._document[Id]} ref={action((r: DocumentView) => this._view = r)}
renderDepth={0}
@@ -366,7 +369,7 @@ export class TabDocView extends React.Component<TabDocViewProps> {
docRangeFilters={CollectionDockingView.Instance.childDocRangeFilters}
searchFilterDocs={CollectionDockingView.Instance.searchFilterDocs}
addDocument={undefined}
- removeDocument={undefined}
+ removeDocument={this.remDocTab}
addDocTab={this.addDocTab}
ScreenToLocalTransform={this.ScreenToLocalTransform}
dontCenter={"y"}
@@ -384,8 +387,16 @@ export class TabDocView extends React.Component<TabDocViewProps> {
background={this.miniMapColor}
document={this._document}
tabView={this.tabView} />
- <Tooltip style={{ display: this.disableMinimap() ? "none" : undefined }} key="ttip" title={<div className="dash-tooltip">{"toggle minimap"}</div>}>
- <div className="miniMap-hidden" onPointerDown={e => e.stopPropagation()} onClick={action(e => { e.stopPropagation(); this._document!.hideMinimap = !this._document!.hideMinimap; })} >
+ <Tooltip key="ttip" title={<div className="dash-tooltip">{this._document.hideMinimap ? "Open minimap" : "Close minimap"}</div>}>
+ <div className="miniMap-hidden"
+ style={{
+ display: this.disableMinimap() || this._document._viewType !== "freeform" ? "none" : undefined,
+ color: this._document.hideMinimap ? Colors.BLACK : Colors.WHITE,
+ backgroundColor: this._document.hideMinimap ? Colors.LIGHT_GRAY : Colors.MEDIUM_BLUE,
+ boxShadow: this._document.hideMinimap ? Shadows.STANDARD_SHADOW : undefined
+ }}
+ onPointerDown={e => e.stopPropagation()}
+ onClick={action(e => { e.stopPropagation(); this._document!.hideMinimap = !this._document!.hideMinimap; })} >
<FontAwesomeIcon icon={"globe-asia"} size="lg" />
</div>
</Tooltip>
@@ -393,7 +404,6 @@ export class TabDocView extends React.Component<TabDocViewProps> {
}
render() {
- this.tab && CollectionDockingView.Instance.tabMap.delete(this.tab);
return (
<div className="collectionDockingView-content" style={{
fontFamily: Doc.UserDoc().renderStyle === "comic" ? "Comic Sans MS" : undefined,
@@ -475,7 +485,8 @@ export class TabMinimapView extends React.Component<TabMinimapViewProps> {
childLayoutTemplate={this.childLayoutTemplate} // bcz: Ugh .. should probably be rendering a CollectionView or the minimap should be part of the collectionFreeFormView to avoid having to set stuff like this.
noOverlay={true} // don't render overlay Docs since they won't scale
setHeight={returnFalse}
- isContentActive={returnTrue}
+ isContentActive={returnFalse}
+ isAnyChildContentActive={returnFalse}
select={emptyFunction}
dropAction={undefined}
isSelected={returnFalse}
diff --git a/src/client/views/collections/TreeView.tsx b/src/client/views/collections/TreeView.tsx
index 3ee9dbf59..97de097e0 100644
--- a/src/client/views/collections/TreeView.tsx
+++ b/src/client/views/collections/TreeView.tsx
@@ -9,7 +9,7 @@ import { listSpec } from '../../../fields/Schema';
import { ComputedField, ScriptField } from '../../../fields/ScriptField';
import { BoolCast, Cast, NumCast, ScriptCast, StrCast } from '../../../fields/Types';
import { TraceMobx } from '../../../fields/util';
-import { emptyFunction, returnEmptyDoclist, returnEmptyFilter, returnEmptyString, returnFalse, returnTrue, simulateMouseClick, Utils } from '../../../Utils';
+import { emptyFunction, returnEmptyDoclist, returnEmptyFilter, returnEmptyString, returnFalse, returnTrue, simulateMouseClick, Utils, returnOne } from '../../../Utils';
import { Docs, DocUtils } from '../../documents/Documents';
import { DocumentType } from "../../documents/DocumentTypes";
import { CurrentUserUtils } from '../../util/CurrentUserUtils';
@@ -54,7 +54,7 @@ export interface TreeViewProps {
indentDocument?: (editTitle: boolean) => void;
outdentDocument?: (editTitle: boolean) => void;
ScreenToLocalTransform: () => Transform;
- contextMenuItems: { script: ScriptField, filter: ScriptField, label: string }[];
+ contextMenuItems: { script: ScriptField, filter: ScriptField, icon: string, label: string }[];
dontRegisterView?: boolean;
styleProvider?: StyleProviderFunc | undefined;
treeViewHideHeaderFields: () => boolean;
@@ -154,8 +154,8 @@ export class TreeView extends React.Component<TreeViewProps> {
} else {
// choose an appropriate alias or make one. --- choose the first alias that (1) user owns, (2) has no context field ... otherwise make a new alias
// this.props.addDocTab(CurrentUserUtils.ActiveDashboard.isShared ? Doc.MakeAlias(this.props.document) : this.props.document, "add:right");
- // choose an appropriate alias or make one -- -- choose the first alias that (1) the user owns, (2) has no context field - if I own it and someone else does not have it open,, otherwise create an alias
- this.props.addDocTab(this.props.document, "add:right");
+ const bestAlias = DocListCast(this.props.document.aliases).find(doc => !doc.context && doc.author === Doc.CurrentUserEmail);
+ this.props.addDocTab(bestAlias ?? Doc.MakeAlias(this.props.document), "add:right");
}
}
@@ -240,10 +240,13 @@ export class TreeView extends React.Component<TreeViewProps> {
}
makeFolder = () => {
- const folder = Docs.Create.TreeDocument([], { title: "-folder-", _stayInCollection: true, isFolder: true });
+ const folder = Docs.Create.TreeDocument([], { title: "Untitled folder", _stayInCollection: true, isFolder: true });
TreeView._editTitleOnLoad = { id: folder[Id], parent: this.props.parentTreeView };
return this.props.addDocument(folder);
}
+ deleteFolder = () => {
+ return this.props.removeDoc?.(this.doc);
+ }
preTreeDrop = (e: Event, de: DragManager.DropEvent, targetAction: dropActionType) => {
const dragData = de.complete.docDragData;
@@ -296,7 +299,7 @@ export class TreeView extends React.Component<TreeViewProps> {
const aspect = Doc.NativeAspect(layoutDoc);
if (layoutDoc._fitWidth) return Math.min(this.props.panelWidth() - treeBulletWidth(), layoutDoc[WidthSym]());
if (aspect) return Math.min(layoutDoc[WidthSym](), Math.min(this.MAX_EMBED_HEIGHT * aspect, this.props.panelWidth() - treeBulletWidth()));
- return Math.min(this.props.panelWidth() - treeBulletWidth(), Doc.NativeWidth(layoutDoc) ? layoutDoc[WidthSym]() : this.layoutDoc[WidthSym]());
+ return Math.min((this.props.panelWidth() - treeBulletWidth()) / (this.props.treeView.props.scaling?.() || 1), Doc.NativeWidth(layoutDoc) ? layoutDoc[WidthSym]() : this.layoutDoc[WidthSym]());
}
docHeight = () => {
const layoutDoc = this.layoutDoc;
@@ -365,7 +368,7 @@ export class TreeView extends React.Component<TreeViewProps> {
return rows;
}
- rtfWidth = () => Math.min(this.layoutDoc?.[WidthSym](), this.props.panelWidth() - treeBulletWidth());
+ rtfWidth = () => Math.min(this.layoutDoc?.[WidthSym](), (this.props.panelWidth() - treeBulletWidth())) / (this.props.treeView.props.scaling?.() || 1);
rtfHeight = () => this.rtfWidth() <= this.layoutDoc?.[WidthSym]() ? Math.min(this.layoutDoc?.[HeightSym](), this.MAX_EMBED_HEIGHT) : this.MAX_EMBED_HEIGHT;
rtfOutlineHeight = () => Math.max(this.layoutDoc?.[HeightSym](), treeBulletWidth());
expandPanelHeight = () => {
@@ -512,10 +515,12 @@ export class TreeView extends React.Component<TreeViewProps> {
DocumentViewInternal.SelectAfterContextMenu = true;
}
contextMenuItems = () => {
- const makeFolder = { script: ScriptField.MakeFunction(`scriptContext.makeFolder()`, { scriptContext: "any" })!, label: "New Folder" };
- const openAlias = { script: ScriptField.MakeFunction(`openOnRight(getAlias(self))`)!, label: "Open Alias" };
- const focusDoc = { script: ScriptField.MakeFunction(`DocFocusOrOpen(self)`)!, label: "Focus or Open" };
- return [...this.props.contextMenuItems.filter(mi => !mi.filter ? true : mi.filter.script.run({ doc: this.doc })?.result), ... (this.doc.isFolder ? [makeFolder] :
+ const makeFolder = { script: ScriptField.MakeFunction(`scriptContext.makeFolder()`, { scriptContext: "any" })!, icon: "folder-plus", label: "New Folder" };
+ const deleteFolder = { script: ScriptField.MakeFunction(`scriptContext.deleteFolder()`, { scriptContext: "any" })!, icon: "folder-plus", label: "Delete Folder" };
+ const folderOp = this.childDocs?.length ? makeFolder : deleteFolder;
+ const openAlias = { script: ScriptField.MakeFunction(`openOnRight(getAlias(self))`)!, icon: "copy", label: "Open Alias" };
+ const focusDoc = { script: ScriptField.MakeFunction(`DocFocusOrOpen(self)`)!, icon: "eye", label: "Focus or Open" };
+ return [...this.props.contextMenuItems.filter(mi => !mi.filter ? true : mi.filter.script.run({ doc: this.doc })?.result), ... (this.doc.isFolder ? [folderOp] :
Doc.IsSystem(this.doc) ? [] :
this.props.treeView.fileSysMode && this.doc === Doc.GetProto(this.doc) ?
[openAlias, makeFolder] :
@@ -525,7 +530,8 @@ export class TreeView extends React.Component<TreeViewProps> {
childContextMenuItems = () => {
const customScripts = Cast(this.doc.childContextMenuScripts, listSpec(ScriptField), []);
const customFilters = Cast(this.doc.childContextMenuFilters, listSpec(ScriptField), []);
- return StrListCast(this.doc.childContextMenuLabels).map((label, i) => ({ script: customScripts[i], filter: customFilters[i], label }));
+ const icons = StrListCast(this.doc.childContextMenuIcons);
+ return StrListCast(this.doc.childContextMenuLabels).map((label, i) => ({ script: customScripts[i], filter: customFilters[i], icon: icons[i], label }));
}
onChildClick = () => this.props.onChildClick?.() ?? (this._editTitleScript?.() || ScriptCast(this.doc.treeChildClick));
@@ -544,7 +550,7 @@ export class TreeView extends React.Component<TreeViewProps> {
switch (property.split(":")[0]) {
case StyleProp.Opacity: return this.props.treeView.outlineMode ? undefined : 1;
case StyleProp.BackgroundColor: return this.selected ? "#7089bb" : StrCast(doc._backgroundColor, StrCast(doc.backgroundColor));
- case StyleProp.DocContents: return testDocProps(props) && !props?.treeViewDoc ? (null) :
+ case StyleProp.DocContents: return this.props.treeView.outlineMode ? (null) :
<div className="treeView-label" style={{ // just render a title for a tree view label (identified by treeViewDoc being set in 'props')
maxWidth: props?.PanelWidth() || undefined,
background: props?.styleProvider?.(doc, props, StyleProp.BackgroundColor),
@@ -646,6 +652,7 @@ export class TreeView extends React.Component<TreeViewProps> {
searchFilterDocs={returnEmptyDoclist}
ContainingCollectionView={undefined}
ContainingCollectionDoc={this.props.treeView.props.Document}
+ ContentScaling={returnOne}
/>;
const buttons = this.props.styleProvider?.(this.doc, this.props.treeView.props, StyleProp.Decorations + (Doc.IsSystem(this.props.containerCollection) ? ":afterHeader" : ""));
@@ -702,10 +709,12 @@ export class TreeView extends React.Component<TreeViewProps> {
hideDecorationTitle={this.props.treeView.outlineMode}
hideResizeHandles={this.props.treeView.outlineMode}
focus={this.refocus}
+ ContentScaling={returnOne}
hideLinkButton={BoolCast(this.props.treeView.props.Document.childHideLinkButton)}
dontRegisterView={BoolCast(this.props.treeView.props.Document.childDontRegisterViews, this.props.dontRegisterView)}
ScreenToLocalTransform={this.docTransform}
renderDepth={this.props.renderDepth + 1}
+ treeViewDoc={this.props.treeView?.props.Document}
rootSelected={returnTrue}
layerProvider={returnTrue}
docViewPath={this.props.treeView.props.docViewPath}
@@ -832,7 +841,7 @@ export class TreeView extends React.Component<TreeViewProps> {
dontRegisterView: boolean | undefined,
observerHeight: (ref: any) => void,
unobserveHeight: (ref: any) => void,
- contextMenuItems: ({ script: ScriptField, filter: ScriptField, label: string }[])
+ contextMenuItems: ({ script: ScriptField, filter: ScriptField, label: string, icon: string }[])
) {
const viewSpecScript = Cast(conainerCollection.viewSpecScript, ScriptField);
if (viewSpecScript) {
@@ -849,6 +858,7 @@ export class TreeView extends React.Component<TreeViewProps> {
}
const dentDoc = (editTitle: boolean, newParent: Doc, addAfter: Doc | undefined, parent: TreeView | CollectionTreeView | undefined) => {
+ if (parent instanceof TreeView && parent.props.treeView.fileSysMode && !newParent.isFolder) return;
const fieldKey = Doc.LayoutFieldKey(newParent);
if (remove && fieldKey && Cast(newParent[fieldKey], listSpec(Doc)) !== undefined) {
remove(child);
@@ -865,7 +875,7 @@ export class TreeView extends React.Component<TreeViewProps> {
const childLayout = Doc.Layout(pair.layout);
const rowHeight = () => {
const aspect = Doc.NativeAspect(childLayout);
- return aspect ? Math.min(childLayout[WidthSym](), rowWidth()) / aspect : childLayout[HeightSym]();
+ return (aspect ? Math.min(childLayout[WidthSym](), rowWidth()) / aspect : childLayout[HeightSym]());
};
return <TreeView key={child[Id]} ref={r => treeViewRefs.set(child, r ? r : undefined)}
document={pair.layout}
diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormLinkView.tsx b/src/client/views/collections/collectionFreeForm/CollectionFreeFormLinkView.tsx
index a8f5e6dd2..3b3e069d8 100644
--- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormLinkView.tsx
+++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormLinkView.tsx
@@ -2,14 +2,16 @@ import { action, computed, IReactionDisposer, observable, reaction } from "mobx"
import { observer } from "mobx-react";
import { Doc } from "../../../../fields/Doc";
import { Id } from "../../../../fields/FieldSymbols";
+import { List } from "../../../../fields/List";
import { NumCast, StrCast } from "../../../../fields/Types";
import { emptyFunction, setupMoveUpEvents, Utils } from '../../../../Utils';
-import { DocumentType } from "../../../documents/DocumentTypes";
+import { LinkManager } from "../../../util/LinkManager";
import { SnappingManager } from "../../../util/SnappingManager";
import { DocumentView } from "../../nodes/DocumentView";
import "./CollectionFreeFormLinkView.scss";
import React = require("react");
+
export interface CollectionFreeFormLinkViewProps {
A: DocumentView;
B: DocumentView;
@@ -40,8 +42,8 @@ export class CollectionFreeFormLinkView extends React.Component<CollectionFreeFo
if (SnappingManager.GetIsDragging() || !A.ContentDiv || !B.ContentDiv) return;
setTimeout(action(() => this._opacity = 1), 0); // since the render code depends on querying the Dom through getBoudndingClientRect, we need to delay triggering render()
setTimeout(action(() => (!LinkDocs.length || !linkDoc.linkDisplay) && (this._opacity = 0.05)), 750); // this will unhighlight the link line.
- const acont = A.rootDoc.type === DocumentType.LINK ? A.ContentDiv.getElementsByClassName("linkAnchorBox-cont") : [];
- const bcont = B.rootDoc.type === DocumentType.LINK ? B.ContentDiv.getElementsByClassName("linkAnchorBox-cont") : [];
+ const acont = A.ContentDiv.getElementsByClassName("linkAnchorBox-cont");
+ const bcont = B.ContentDiv.getElementsByClassName("linkAnchorBox-cont");
const adiv = acont.length ? acont[0] : A.ContentDiv;
const bdiv = bcont.length ? bcont[0] : B.ContentDiv;
const a = adiv.getBoundingClientRect();
@@ -66,8 +68,10 @@ export class CollectionFreeFormLinkView extends React.Component<CollectionFreeFo
} else {
const m = targetAhyperlink.getBoundingClientRect();
const mp = A.props.ScreenToLocalTransform().transformPoint(m.right, m.top + 5);
- linkDoc.anchor1_x = Math.min(1, mp[0] / A.props.PanelWidth()) * 100;
- linkDoc.anchor1_y = Math.min(1, mp[1] / A.props.PanelHeight()) * 100;
+ const mpx = mp[0] / A.props.PanelWidth();
+ const mpy = mp[1] / A.props.PanelHeight();
+ if (mpx >= 0 && mpx <= 1) linkDoc.anchor1_x = mpx * 100;
+ if (mpy >= 0 && mpy <= 1) linkDoc.anchor1_y = mpy * 100;
}
if (!targetBhyperlink) {
if (linkDoc.linkAutoMove) {
@@ -77,8 +81,10 @@ export class CollectionFreeFormLinkView extends React.Component<CollectionFreeFo
} else {
const m = targetBhyperlink.getBoundingClientRect();
const mp = B.props.ScreenToLocalTransform().transformPoint(m.right, m.top + 5);
- linkDoc.anchor2_x = Math.min(1, mp[0] / B.props.PanelWidth()) * 100;
- linkDoc.anchor2_y = Math.min(1, mp[1] / B.props.PanelHeight()) * 100;
+ const mpx = mp[0] / B.props.PanelWidth();
+ const mpy = mp[1] / B.props.PanelHeight();
+ if (mpx >= 0 && mpx <= 1) linkDoc.anchor2_x = mpx * 100;
+ if (mpy >= 0 && mpy <= 1) linkDoc.anchor2_y = mpy * 100;
}
}
@@ -137,8 +143,8 @@ export class CollectionFreeFormLinkView extends React.Component<CollectionFreeFo
if (!A.ContentDiv || !B.ContentDiv || !LinkDocs.length) return undefined;
const acont = A.ContentDiv.getElementsByClassName("linkAnchorBox-cont");
const bcont = B.ContentDiv.getElementsByClassName("linkAnchorBox-cont");
- const adiv = (acont.length ? acont[0] : A.ContentDiv);
- const bdiv = (bcont.length ? bcont[0] : B.ContentDiv);
+ const adiv = acont.length ? acont[0] : A.ContentDiv;
+ const bdiv = bcont.length ? bcont[0] : B.ContentDiv;
for (let apdiv = adiv; apdiv; apdiv = apdiv.parentElement as any) if ((apdiv as any).hidden) return;
for (let bpdiv = bdiv; bpdiv; bpdiv = bpdiv.parentElement as any) if ((bpdiv as any).hidden) return;
const a = adiv.getBoundingClientRect();
@@ -173,8 +179,14 @@ export class CollectionFreeFormLinkView extends React.Component<CollectionFreeFo
render() {
if (!this.renderData) return (null);
const { a, b, pt1norm, pt2norm, aActive, bActive, textX, textY, pt1, pt2 } = this.renderData;
+ LinkManager.currentLink = this.props.LinkDocs[0];
+ const linkRelationship = StrCast(LinkManager.currentLink?.linkRelationship); //get string representing relationship
+ const linkRelationshipList = Doc.UserDoc().linkRelationshipList as List<string>;
+ const linkColorList = Doc.UserDoc().linkColorList as List<string>;
+ //access stroke color using index of the relationship in the color list (default black)
+ const strokeColor = linkRelationshipList.indexOf(linkRelationship) === -1 ? "black" : linkColorList[linkRelationshipList.indexOf(linkRelationship)];
return !a.width || !b.width || ((!this.props.LinkDocs[0].linkDisplay) && !aActive && !bActive) ? (null) : (<>
- <path className="collectionfreeformlinkview-linkLine" style={{ opacity: this._opacity, strokeDasharray: "2 2" }}
+ <path className="collectionfreeformlinkview-linkLine" style={{ opacity: this._opacity, strokeDasharray: "2 2", stroke: strokeColor }}
d={`M ${pt1[0]} ${pt1[1]} C ${pt1[0] + pt1norm[0]} ${pt1[1] + pt1norm[1]}, ${pt2[0] + pt2norm[0]} ${pt2[1] + pt2norm[1]}, ${pt2[0]} ${pt2[1]}`} />
{textX === undefined ? (null) : <text className="collectionfreeformlinkview-linkText" x={textX} y={textY} onPointerDown={this.pointerDown} >
{StrCast(this.props.LinkDocs[0].description)}
diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormLinksView.tsx b/src/client/views/collections/collectionFreeForm/CollectionFreeFormLinksView.tsx
index 5e0b31754..dacbb3508 100644
--- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormLinksView.tsx
+++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormLinksView.tsx
@@ -1,29 +1,17 @@
import { computed } from "mobx";
import { observer } from "mobx-react";
-import { Doc } from "../../../../fields/Doc";
import { Id } from "../../../../fields/FieldSymbols";
-import { Utils } from "../../../../Utils";
import { DocumentManager } from "../../../util/DocumentManager";
-import { DocumentView } from "../../nodes/DocumentView";
import "./CollectionFreeFormLinksView.scss";
import { CollectionFreeFormLinkView } from "./CollectionFreeFormLinkView";
import React = require("react");
-import { DocumentType } from "../../../documents/DocumentTypes";
@observer
export class CollectionFreeFormLinksView extends React.Component {
@computed get uniqueConnections() {
- const connections = DocumentManager.Instance.LinkedDocumentViews
- .filter(c => c.a.props.Document.type === DocumentType.LINK || c.b.props.Document.type === DocumentType.LINK)
- .reduce((drawnPairs, connection) => {
- const matchingPairs = drawnPairs.filter(pair => connection.a === pair.a && connection.b === pair.b);
- matchingPairs.forEach(drawnPair => drawnPair.l.add(connection.l));
- if (!matchingPairs.length) drawnPairs.push({ a: connection.a, b: connection.b, l: new Set<Doc>([connection.l]) });
- return drawnPairs;
- }, [] as { a: DocumentView, b: DocumentView, l: Set<Doc> }[]);
- const set = new Map<Doc, { a: DocumentView, b: DocumentView, l: Doc[] }>();
- connections.map(c => !set.has(Array.from(c.l)[0]) && set.set(Array.from(c.l)[0], { a: c.a, b: c.b, l: Array.from(c.l) }));
- return Array.from(set.values()).map(c => <CollectionFreeFormLinkView key={c.l[0][Id]} A={c.a} B={c.b} LinkDocs={c.l} />);
+ return Array.from(new Set(DocumentManager.Instance.LinkedDocumentViews)).map(c =>
+ <CollectionFreeFormLinkView key={c.l[Id]} A={c.a} B={c.b} LinkDocs={[c.l]} />
+ );
}
render() {
diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx
index d09d9b9d7..be0b078ec 100644
--- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx
+++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx
@@ -1,6 +1,7 @@
import { action, computed, IReactionDisposer, observable, reaction, runInAction } from "mobx";
import { observer } from "mobx-react";
import { computedFn } from "mobx-utils";
+import { DateField } from "../../../../fields/DateField";
import { Doc, HeightSym, Opt, StrListCast, WidthSym } from "../../../../fields/Doc";
import { collectionSchema, documentSchema } from "../../../../fields/documentSchemas";
import { Id } from "../../../../fields/FieldSymbols";
@@ -17,6 +18,7 @@ import { aggregateBounds, emptyFunction, intersectRect, returnFalse, setupMoveUp
import { CognitiveServices } from "../../../cognitive_services/CognitiveServices";
import { DocServer } from "../../../DocServer";
import { Docs, DocUtils } from "../../../documents/Documents";
+import { DocumentType } from "../../../documents/DocumentTypes";
import { CurrentUserUtils } from "../../../util/CurrentUserUtils";
import { DocumentManager } from "../../../util/DocumentManager";
import { DragManager, dropActionType } from "../../../util/DragManager";
@@ -48,8 +50,7 @@ import { CollectionFreeFormRemoteCursors } from "./CollectionFreeFormRemoteCurso
import "./CollectionFreeFormView.scss";
import { MarqueeView } from "./MarqueeView";
import React = require("react");
-import { DocumentType } from "../../../documents/DocumentTypes";
-import { DateField } from "../../../../fields/DateField";
+import Color = require("color");
export const panZoomSchema = createSchema({
_panX: "number",
@@ -74,6 +75,8 @@ export type collectionFreeformViewProps = {
scaleField?: string;
noOverlay?: boolean; // used to suppress docs in the overlay (z) layer (ie, for minimap since overlay doesn't scale)
engineProps?: any;
+ dontRenderDocuments?: boolean; // used for annotation overlays which need to distribute documents into different freeformviews with different mixBlendModes depending on whether they are trnasparent or not.
+ // However, this screws up interactions since only the top layer gets events. so we render the freeformview a 3rd time with all documents in order to get interaction events (eg., marquee) but we don't actually want to display the documents.
};
@observer
@@ -115,7 +118,7 @@ export class CollectionFreeFormView extends CollectionSubView<PanZoomDocument, P
@computed get views() { return this._layoutElements.filter(ele => ele.bounds && !ele.bounds.z).map(ele => ele.ele); }
@computed get backgroundEvents() { return this.props.layerProvider?.(this.layoutDoc) === false && SnappingManager.GetIsDragging(); }
- @computed get backgroundActive() { return this.props.layerProvider?.(this.layoutDoc) === false && (this.props.ContainingCollectionView?.isContentActive() || this.props.isContentActive()); }
+ @computed get backgroundActive() { return this.props.layerProvider?.(this.layoutDoc) === false && this.props.isContentActive(); }
@computed get fitToContentVals() {
return {
bounds: { ...this.contentBounds, cx: (this.contentBounds.x + this.contentBounds.r) / 2, cy: (this.contentBounds.y + this.contentBounds.b) / 2 },
@@ -168,6 +171,7 @@ export class CollectionFreeFormView extends CollectionSubView<PanZoomDocument, P
getContainerTransform = () => this.cachedGetContainerTransform.copy();
getTransformOverlay = () => this.getContainerTransform().translate(1, 1);
getActiveDocuments = () => this.childLayoutPairs.filter(pair => this.isCurrent(pair.layout)).map(pair => pair.layout);
+ isAnyChildContentActive = () => this.props.isAnyChildContentActive();
addLiveTextBox = (newBox: Doc) => {
FormattedTextBox.SelectOnLoad = newBox[Id];// track the new text box so we can give it a prop that tells it to focus itself when it's displayed
this.addDocument(newBox);
@@ -179,7 +183,7 @@ export class CollectionFreeFormView extends CollectionSubView<PanZoomDocument, P
addDocument = (newBox: Doc | Doc[]) => {
let retVal = false;
if (newBox instanceof Doc) {
- if (retVal = this.props.addDocument?.(newBox) || false) {
+ if (retVal = (this.props.addDocument?.(newBox) || false)) {
this.bringToFront(newBox);
this.updateCluster(newBox);
}
@@ -205,25 +209,6 @@ export class CollectionFreeFormView extends CollectionSubView<PanZoomDocument, P
return retVal;
}
- updateGroupBounds = () => {
- if (!this.props.Document._isGroup) return;
- const clist = this.childDocs.map(cd => ({ x: NumCast(cd.x), y: NumCast(cd.y), width: cd[WidthSym](), height: cd[HeightSym]() }));
- const cbounds = aggregateBounds(clist, 0, 0);
- const c = [NumCast(this.layoutDoc.x) + this.layoutDoc[WidthSym]() / 2, NumCast(this.layoutDoc.y) + this.layoutDoc[HeightSym]() / 2];
- const p = [NumCast(this.layoutDoc._panX), NumCast(this.layoutDoc._panY)];
- const pbounds = {
- x: (cbounds.x - p[0]) * this.zoomScaling() + c[0], y: (cbounds.y - p[1]) * this.zoomScaling() + c[1],
- r: (cbounds.r - p[0]) * this.zoomScaling() + c[0], b: (cbounds.b - p[1]) * this.zoomScaling() + c[1]
- };
-
- this.layoutDoc._width = (pbounds.r - pbounds.x);
- this.layoutDoc._height = (pbounds.b - pbounds.y);
- this.layoutDoc._panX = (cbounds.r + cbounds.x) / 2;
- this.layoutDoc._panY = (cbounds.b + cbounds.y) / 2;
- this.layoutDoc.x = pbounds.x;
- this.layoutDoc.y = pbounds.y;
- }
-
isCurrent(doc: Doc) {
const dispTime = NumCast(doc._timecodeToShow, -1);
const endTime = NumCast(doc._timecodeToHide, dispTime + 1.5);
@@ -265,8 +250,6 @@ export class CollectionFreeFormView extends CollectionSubView<PanZoomDocument, P
!StrListCast(d._layerTags).includes(StyleLayers.Background) && (d._raiseWhenDragged === undefined ? Doc.UserDoc()._raiseWhenDragged : d._raiseWhenDragged) && (d.zIndex = zsorted.length + 1 + i); // bringToFront
}
- this.updateGroupBounds();
-
(docDragData.droppedDocuments.length === 1 || de.shiftKey) && this.updateClusterDocs(docDragData.droppedDocuments);
return true;
}
@@ -506,7 +489,7 @@ export class CollectionFreeFormView extends CollectionSubView<PanZoomDocument, P
const points = ge.points;
const B = this.getTransform().transformBounds(ge.bounds.left, ge.bounds.top, ge.bounds.width, ge.bounds.height);
const inkDoc = Docs.Create.InkDocument(ActiveInkColor(), CurrentUserUtils.SelectedTool, ActiveInkWidth(), ActiveInkBezierApprox(), ActiveFillColor(), ActiveArrowStart(), ActiveArrowEnd(), ActiveDash(), points,
- { title: "ink stroke", x: B.x - Number(ActiveInkWidth()) / 2, y: B.y - Number(ActiveInkWidth()) / 2, _width: B.width + Number(ActiveInkWidth()), _height: B.height + Number(ActiveInkWidth()) });
+ { title: "ink stroke", x: B.x - ActiveInkWidth() / 2, y: B.y - ActiveInkWidth() / 2, _width: B.width + ActiveInkWidth(), _height: B.height + ActiveInkWidth() });
this.addDocument(inkDoc);
e.stopPropagation();
break;
@@ -1031,7 +1014,7 @@ export class CollectionFreeFormView extends CollectionSubView<PanZoomDocument, P
docFilters={this.childDocFilters}
docRangeFilters={this.childDocRangeFilters}
searchFilterDocs={this.searchFilterDocs}
- isContentActive={this.isAnnotationOverlay ? this.props.isContentActive : returnFalse}
+ isContentActive={returnFalse}
isDocumentActive={this.props.childDocumentsActive ? this.props.isDocumentActive : this.isContentActive}
focus={this.focusDocument}
addDocTab={this.addDocTab}
@@ -1048,7 +1031,8 @@ export class CollectionFreeFormView extends CollectionSubView<PanZoomDocument, P
freezeDimensions={this.props.childFreezeDimensions}
dropAction={StrCast(this.props.Document.childDropAction) as dropActionType}
bringToFront={this.bringToFront}
- dontRegisterView={this.props.dontRegisterView}
+ showTitle={this.props.childShowTitle}
+ dontRegisterView={this.props.dontRenderDocuments || this.props.dontRegisterView}
pointerEvents={this.backgroundActive || this.props.childPointerEvents ? "all" :
(this.props.viewDefDivClick || (engine === "pass" && !this.props.isSelected(true))) ? "none" : undefined}
jitterRotation={this.props.styleProvider?.(childLayout, this.props, StyleProp.JitterRotation) || 0}
@@ -1231,6 +1215,30 @@ export class CollectionFreeFormView extends CollectionSubView<PanZoomDocument, P
{ fireImmediately: true, name: "doLayout" });
this._marqueeRef.current?.addEventListener("dashDragAutoScroll", this.onDragAutoScroll as any);
+
+ this._disposers.groupBounds = reaction(() => {
+ if (this.props.Document._isGroup && this.childDocs.length === this.childDocList?.length) {
+ const clist = this.childDocs.map(cd => ({ x: NumCast(cd.x), y: NumCast(cd.y), width: cd[WidthSym](), height: cd[HeightSym]() }));
+ return aggregateBounds(clist, NumCast(this.layoutDoc._xPadding), NumCast(this.layoutDoc._yPadding));
+ }
+ return undefined;
+ },
+ (cbounds) => {
+ if (cbounds) {
+ const c = [NumCast(this.layoutDoc.x) + this.layoutDoc[WidthSym]() / 2, NumCast(this.layoutDoc.y) + this.layoutDoc[HeightSym]() / 2];
+ const p = [NumCast(this.layoutDoc._panX), NumCast(this.layoutDoc._panY)];
+ const pbounds = {
+ x: (cbounds.x - p[0]) * this.zoomScaling() + c[0], y: (cbounds.y - p[1]) * this.zoomScaling() + c[1],
+ r: (cbounds.r - p[0]) * this.zoomScaling() + c[0], b: (cbounds.b - p[1]) * this.zoomScaling() + c[1]
+ };
+ this.layoutDoc._width = (pbounds.r - pbounds.x);
+ this.layoutDoc._height = (pbounds.b - pbounds.y);
+ this.layoutDoc._panX = (cbounds.r + cbounds.x) / 2;
+ this.layoutDoc._panY = (cbounds.b + cbounds.y) / 2;
+ this.layoutDoc.x = pbounds.x;
+ this.layoutDoc.y = pbounds.y;
+ }
+ }, { fireImmediately: true });
}
componentWillUnmount() {
@@ -1322,8 +1330,10 @@ export class CollectionFreeFormView extends CollectionSubView<PanZoomDocument, P
!options && ContextMenu.Instance.addItem({ description: "Options...", subitems: optionItems, icon: "eye" });
const mores = ContextMenu.Instance.findByDescription("More...");
const moreItems = mores && "subitems" in mores ? mores.subitems : [];
- moreItems.push({ description: "Export collection", icon: "download", event: async () => Doc.Zip(this.props.Document) });
- moreItems.push({ description: "Import exported collection", icon: "upload", event: ({ x, y }) => this.importDocument(x, y) });
+ if (!Doc.UserDoc().noviceMode) {
+ moreItems.push({ description: "Export collection", icon: "download", event: async () => Doc.Zip(this.props.Document) });
+ moreItems.push({ description: "Import exported collection", icon: "upload", event: ({ x, y }) => this.importDocument(x, y) });
+ }
!mores && ContextMenu.Instance.addItem({ description: "More...", subitems: moreItems, icon: "eye" });
}
@@ -1395,6 +1405,7 @@ export class CollectionFreeFormView extends CollectionSubView<PanZoomDocument, P
}
chooseGridSpace = (gridSpace: number): number => {
+ if (!this.zoomScaling()) return 50;
const divisions = this.props.PanelWidth() / this.zoomScaling() / gridSpace + 3;
return divisions < 60 ? gridSpace : this.chooseGridSpace(gridSpace * 10);
}
@@ -1452,8 +1463,8 @@ export class CollectionFreeFormView extends CollectionSubView<PanZoomDocument, P
getContainerTransform={this.getContainerTransform}
getTransform={this.getTransform}
isAnnotationOverlay={this.isAnnotationOverlay}>
- <div ref={this._marqueeRef}>
- {this.layoutDoc["_backgroundGrid-show"] ? this.backgroundGrid : (null)}
+ <div ref={this._marqueeRef} style={{ display: this.props.dontRenderDocuments ? "none" : undefined }}>
+ {this.layoutDoc._backgroundGridShow ? this.backgroundGrid : (null)}
<CollectionFreeFormViewPannableContents
isAnnotationOverlay={this.isAnnotationOverlay}
transform={this.contentTransform}
@@ -1479,6 +1490,14 @@ export class CollectionFreeFormView extends CollectionSubView<PanZoomDocument, P
return wscale < hscale ? wscale : hscale;
}
+ private groupDropDisposer?: DragManager.DragDropDisposer;
+ protected createGroupEventsTarget = (ele: HTMLDivElement) => { //used for stacking and masonry view
+ this.groupDropDisposer?.();
+ if (ele) {
+ this.groupDropDisposer = DragManager.MakeDropTarget(ele, this.onInternalDrop.bind(this), this.layoutDoc, this.onInternalPreDrop.bind(this));
+ }
+ }
+
render() {
TraceMobx();
const clientRect = this._mainCont?.getBoundingClientRect();
@@ -1522,7 +1541,7 @@ export class CollectionFreeFormView extends CollectionSubView<PanZoomDocument, P
</div>}
{this.props.Document._isGroup && SnappingManager.GetIsDragging() && (this.ChildDrag || this.props.layerProvider?.(this.props.Document) === false) ?
- <div className="collectionFreeForm-groupDropper" ref={this.createDashEventsTarget} style={{
+ <div className="collectionFreeForm-groupDropper" ref={this.createGroupEventsTarget} style={{
width: this.ChildDrag ? "10000" : "100%",
height: this.ChildDrag ? "10000" : "100%",
left: this.ChildDrag ? "-5000" : 0,
diff --git a/src/client/views/collections/collectionFreeForm/MarqueeView.tsx b/src/client/views/collections/collectionFreeForm/MarqueeView.tsx
index d0243850f..81f6307d1 100644
--- a/src/client/views/collections/collectionFreeForm/MarqueeView.tsx
+++ b/src/client/views/collections/collectionFreeForm/MarqueeView.tsx
@@ -41,7 +41,7 @@ interface MarqueeViewProps {
trySelectCluster: (addToSel: boolean) => boolean;
nudge?: (x: number, y: number, nudgeTime?: number) => boolean;
ungroup?: () => void;
- setPreviewCursor?: (func: (x: number, y: number, drag: boolean) => void) => void;
+ setPreviewCursor?: (func: (x: number, y: number, drag: boolean, hide: boolean) => void) => void;
}
@observer
export class MarqueeView extends React.Component<SubCollectionViewProps & MarqueeViewProps>
@@ -211,7 +211,7 @@ export class MarqueeView extends React.Component<SubCollectionViewProps & Marque
// allow marquee if right click OR alt+left click
if (e.button === 2 || (e.button === 0 && e.altKey)) {
// if (e.altKey || (MarqueeView.DragMarquee && this.props.active(true))) {
- this.setPreviewCursor(e.clientX, e.clientY, true);
+ this.setPreviewCursor(e.clientX, e.clientY, true, false);
// (!e.altKey) && e.stopPropagation(); // bcz: removed so that you can alt-click on button in a collection to switch link following behaviors.
e.preventDefault();
// }
@@ -284,8 +284,13 @@ export class MarqueeView extends React.Component<SubCollectionViewProps & Marque
else if (document.getSelection()) { document.getSelection()?.empty(); }
}
- setPreviewCursor = action((x: number, y: number, drag: boolean) => {
- if (drag) {
+ setPreviewCursor = action((x: number, y: number, drag: boolean, hide: boolean) => {
+ if (hide) {
+ this._downX = this._lastX = x;
+ this._downY = this._lastY = y;
+ this._commandExecuted = false;
+ PreviewCursor.Visible = false;
+ } else if (drag) {
this._downX = this._lastX = x;
this._downY = this._lastY = y;
this._commandExecuted = false;
@@ -313,7 +318,7 @@ export class MarqueeView extends React.Component<SubCollectionViewProps & Marque
if (!(e.nativeEvent as any).marqueeHit) {
(e.nativeEvent as any).marqueeHit = true;
if (!this.props.trySelectCluster(e.shiftKey)) {
- this.setPreviewCursor(e.clientX, e.clientY, false);
+ this.setPreviewCursor(e.clientX, e.clientY, false, false);
} else e.stopPropagation();
}
}
@@ -443,8 +448,8 @@ export class MarqueeView extends React.Component<SubCollectionViewProps & Marque
syntaxHighlight = (e: KeyboardEvent | React.PointerEvent | undefined) => {
const selected = this.marqueeSelect(false);
if (e instanceof KeyboardEvent ? e.key === "i" : true) {
- const inks = selected.filter(s => s.proto?.type === DocumentType.INK);
- const setDocs = selected.filter(s => s.proto?.type === DocumentType.RTF && s.color);
+ const inks = selected.filter(s => s.type === DocumentType.INK);
+ const setDocs = selected.filter(s => s.type === DocumentType.RTF && s.color);
const sets = setDocs.map((sd) => Cast(sd.data, RichTextField)?.Text as string);
const colors = setDocs.map(sd => FieldValue(sd.color) as string);
const wordToColor = new Map<string, string>();
diff --git a/src/client/views/collections/collectionFreeForm/index.ts b/src/client/views/collections/collectionFreeForm/index.ts
new file mode 100644
index 000000000..702dc8d42
--- /dev/null
+++ b/src/client/views/collections/collectionFreeForm/index.ts
@@ -0,0 +1,7 @@
+export * from "./CollectionFreeFormLayoutEngines";
+export * from "./CollectionFreeFormLinkView";
+export * from "./CollectionFreeFormLinksView";
+export * from "./CollectionFreeFormRemoteCursors";
+export * from "./CollectionFreeFormView";
+export * from "./MarqueeOptionsMenu";
+export * from "./MarqueeView"; \ No newline at end of file
diff --git a/src/client/views/collections/collectionGrid/index.ts b/src/client/views/collections/collectionGrid/index.ts
new file mode 100644
index 000000000..be5d5667a
--- /dev/null
+++ b/src/client/views/collections/collectionGrid/index.ts
@@ -0,0 +1,2 @@
+export * from "./Grid";
+export * from "./CollectionGridView"; \ No newline at end of file
diff --git a/src/client/views/collections/CollectionLinearView.scss b/src/client/views/collections/collectionLinear/CollectionLinearView.scss
index 46e40489b..8fe804466 100644
--- a/src/client/views/collections/CollectionLinearView.scss
+++ b/src/client/views/collections/collectionLinear/CollectionLinearView.scss
@@ -1,15 +1,31 @@
-@import "../global/globalCssVariables";
-@import "../_nodeModuleOverrides";
+@import "../../global/globalCssVariables";
+@import "../../_nodeModuleOverrides";
.collectionLinearView-outer {
overflow: visible;
height: 100%;
pointer-events: none;
+ &.true {
+ padding-left: 5px;
+ padding-right: 5px;
+ border-left: $standard-border;
+ background-color: $medium-blue-alt;
+ }
+
+ >input:not(:checked)~&.true {
+ background-color: transparent;
+ }
+
.collectionLinearView {
display: flex;
height: 100%;
align-items: center;
+ gap: 5px;
+
+ .collectionView {
+ overflow: visible !important;
+ }
>span {
background: $dark-gray;
@@ -41,7 +57,7 @@
}
.bottomPopup-descriptions {
- cursor:pointer;
+ cursor: pointer;
display: inline;
white-space: nowrap;
padding-left: 8px;
@@ -54,7 +70,7 @@
}
.bottomPopup-exit {
- cursor:pointer;
+ cursor: pointer;
display: inline;
white-space: nowrap;
margin-right: 10px;
@@ -67,29 +83,26 @@
}
>label {
- margin-top: "auto";
- margin-bottom: "auto";
- background: $dark-gray;
- color: $white;
- display: inline-block;
- border-radius: 18px;
- font-size: 12.5px;
- width: 18px;
- height: 18px;
- margin-top: auto;
- margin-bottom: auto;
- margin-right: 3px;
+ pointer-events: all;
cursor: pointer;
+ background-color: $medium-blue;
+ padding: 5;
+ border-radius: 2px;
+ height: 25;
+ min-width: 25;
+ margin: 0;
+ color: $white;
+ display: flex;
+ font-weight: 100;
+ width: fit-content;
transition: transform 0.2s;
- }
-
- label p {
- padding-left: 5px;
- }
+ align-items: center;
+ justify-content: center;
+ transition: 0.2s;
- label:hover {
- background: $medium-gray;
- transform: scale(1.15);
+ &:hover{
+ filter: brightness(0.85);
+ }
}
>input {
@@ -110,13 +123,11 @@
display: flex;
opacity: 1;
position: relative;
- margin-top: auto;
.collectionLinearView-docBtn,
.collectionLinearView-docBtn-scalable {
position: relative;
margin: auto;
- margin-left: 3px;
transform-origin: center 80%;
}
diff --git a/src/client/views/collections/collectionLinear/CollectionLinearView.tsx b/src/client/views/collections/collectionLinear/CollectionLinearView.tsx
new file mode 100644
index 000000000..7fe95fef0
--- /dev/null
+++ b/src/client/views/collections/collectionLinear/CollectionLinearView.tsx
@@ -0,0 +1,226 @@
+import { FontAwesomeIcon } from '@fortawesome/react-fontawesome';
+import { Tooltip } from '@material-ui/core';
+import { action, IReactionDisposer, observable, reaction, runInAction } from 'mobx';
+import { observer } from 'mobx-react';
+import * as React from 'react';
+import { Doc, HeightSym, Opt, WidthSym } from '../../../../fields/Doc';
+import { documentSchema } from '../../../../fields/documentSchemas';
+import { Id } from '../../../../fields/FieldSymbols';
+import { makeInterface } from '../../../../fields/Schema';
+import { BoolCast, NumCast, ScriptCast, StrCast } from '../../../../fields/Types';
+import { emptyFunction, returnEmptyDoclist, returnTrue, Utils } from '../../../../Utils';
+import { DragManager } from '../../../util/DragManager';
+import { Transform } from '../../../util/Transform';
+import { Colors, Shadows } from '../../global/globalEnums';
+import { DocumentLinksButton } from '../../nodes/DocumentLinksButton';
+import { DocumentView } from '../../nodes/DocumentView';
+import { LinkDescriptionPopup } from '../../nodes/LinkDescriptionPopup';
+import { StyleProp } from '../../StyleProvider';
+import { CollectionSubView } from '../CollectionSubView';
+import { CollectionViewType } from '../CollectionView';
+import "./CollectionLinearView.scss";
+
+
+type LinearDocument = makeInterface<[typeof documentSchema,]>;
+const LinearDocument = makeInterface(documentSchema);
+
+@observer
+export class CollectionLinearView extends CollectionSubView(LinearDocument) {
+ @observable public addMenuToggle = React.createRef<HTMLInputElement>();
+ @observable private _selectedIndex = -1;
+ private _dropDisposer?: DragManager.DragDropDisposer;
+ private _widthDisposer?: IReactionDisposer;
+ private _selectedDisposer?: IReactionDisposer;
+
+ componentWillUnmount() {
+ this._dropDisposer?.();
+ this._widthDisposer?.();
+ this._selectedDisposer?.();
+ this.childLayoutPairs.map((pair, ind) => ScriptCast(pair.layout.proto?.onPointerUp)?.script.run({ this: pair.layout.proto }, console.log));
+ }
+
+ componentDidMount() {
+ this._widthDisposer = reaction(() => 5 + (this.layoutDoc.linearViewIsExpanded ? this.childDocs.length * (this.rootDoc[HeightSym]()) : 10),
+ width => this.childDocs.length && (this.layoutDoc._width = width),
+ { fireImmediately: true }
+ );
+
+ this._selectedDisposer = reaction(
+ () => NumCast(this.layoutDoc.selectedIndex),
+ (i) => runInAction(() => {
+ this._selectedIndex = i;
+ let selected: any = undefined;
+ this.childLayoutPairs.map(async (pair, ind) => {
+ const isSelected = this._selectedIndex === ind;
+ if (isSelected) {
+ selected = pair;
+ }
+ else {
+ ScriptCast(pair.layout.proto?.onPointerUp)?.script.run({ this: pair.layout.proto }, console.log);
+ }
+ });
+ if (selected && selected.layout) {
+ ScriptCast(selected.layout.proto?.onPointerDown)?.script.run({ this: selected.layout.proto }, console.log);
+ }
+ }),
+ { fireImmediately: true }
+ );
+ }
+ protected createDashEventsTarget = (ele: HTMLDivElement) => { //used for stacking and masonry view
+ this._dropDisposer && this._dropDisposer();
+ if (ele) {
+ this._dropDisposer = DragManager.MakeDropTarget(ele, this.onInternalDrop.bind(this), this.layoutDoc);
+ }
+ }
+
+ dimension = () => NumCast(this.rootDoc._height); // 2 * the padding
+ getTransform = (ele: Opt<HTMLDivElement>) => {
+ if (!ele) return Transform.Identity();
+ const { scale, translateX, translateY } = Utils.GetScreenTransform(ele);
+ return new Transform(-translateX, -translateY, 1);
+ }
+
+ @action
+ exitLongLinks = () => {
+ if (DocumentLinksButton.StartLink) {
+ if (DocumentLinksButton.StartLink.Document) {
+ action((e: React.PointerEvent<HTMLDivElement>) => {
+ Doc.UnBrushDoc(DocumentLinksButton.StartLink?.Document as Doc);
+ });
+ }
+ }
+ DocumentLinksButton.StartLink = undefined;
+ DocumentLinksButton.StartLinkView = undefined;
+ }
+
+ @action
+ changeDescriptionSetting = () => {
+ if (LinkDescriptionPopup.showDescriptions) {
+ if (LinkDescriptionPopup.showDescriptions === "ON") {
+ LinkDescriptionPopup.showDescriptions = "OFF";
+ LinkDescriptionPopup.descriptionPopup = false;
+ } else {
+ LinkDescriptionPopup.showDescriptions = "ON";
+ }
+ } else {
+ LinkDescriptionPopup.showDescriptions = "OFF";
+ LinkDescriptionPopup.descriptionPopup = false;
+ }
+ }
+
+ myContextMenu = (e: React.MouseEvent) => {
+ console.log("STOPPING");
+ e.stopPropagation();
+ e.preventDefault();
+ }
+
+
+ getDisplayDoc = (doc: Doc) => {
+ const nested = doc._viewType === CollectionViewType.Linear;
+ const hidden = doc.hidden === true;
+
+ let dref: Opt<HTMLDivElement>;
+ const docXf = () => this.getTransform(dref);
+ // const scalable = pair.layout.onClick || pair.layout.onDragStart;
+ return hidden ? (null) : <div className={`collectionLinearView-docBtn`} key={doc[Id]} ref={r => dref = r || undefined}
+ style={{
+ pointerEvents: "all",
+ width: nested ? undefined : NumCast(doc._width),
+ height: nested ? undefined : NumCast(doc._height),
+ marginLeft: !nested ? 2.5 : 0,
+ marginRight: !nested ? 2.5 : 0,
+ // width: NumCast(pair.layout._width),
+ // height: NumCast(pair.layout._height),
+ }} >
+ <DocumentView
+ Document={doc}
+ isContentActive={this.props.isContentActive}
+ isDocumentActive={returnTrue}
+ addDocument={this.props.addDocument}
+ moveDocument={this.props.moveDocument}
+ addDocTab={this.props.addDocTab}
+ pinToPres={emptyFunction}
+ rootSelected={this.props.isSelected}
+ removeDocument={this.props.removeDocument}
+ ScreenToLocalTransform={docXf}
+ PanelWidth={nested ? doc[WidthSym] : this.dimension}
+ PanelHeight={nested ? doc[HeightSym] : this.dimension}
+ renderDepth={this.props.renderDepth + 1}
+ focus={emptyFunction}
+ styleProvider={this.props.styleProvider}
+ layerProvider={this.props.layerProvider}
+ docViewPath={returnEmptyDoclist}
+ whenChildContentsActiveChanged={emptyFunction}
+ bringToFront={emptyFunction}
+ docFilters={this.props.docFilters}
+ docRangeFilters={this.props.docRangeFilters}
+ searchFilterDocs={this.props.searchFilterDocs}
+ ContainingCollectionView={undefined}
+ ContainingCollectionDoc={undefined} />
+ </div>;
+ }
+
+ render() {
+ const guid = Utils.GenerateGuid(); // Generate a unique ID to use as the label
+ const flexDir: any = StrCast(this.Document.flexDirection); // Specify direction of linear view content
+ const flexGap: number = NumCast(this.Document.flexGap); // Specify the gap between linear view content
+ const expandable: boolean = BoolCast(this.props.Document.linearViewExpandable); // Specify whether it is expandable or not
+ const floating: boolean = BoolCast(this.props.Document.linearViewFloating); // Specify whether it is expandable or not
+
+ const backgroundColor = this.props.styleProvider?.(this.rootDoc, this.props, StyleProp.BackgroundColor);
+ const color = this.props.styleProvider?.(this.rootDoc, this.props, StyleProp.Color);
+ const icon: string = StrCast(this.props.Document.icon); // Menu opener toggle
+ const menuOpener = <label htmlFor={`${guid}`}
+ style={{
+ boxShadow: floating ? Shadows.STANDARD_SHADOW : undefined,
+ color: BoolCast(this.layoutDoc.linearViewIsExpanded) ? undefined : Colors.BLACK,
+ backgroundColor: backgroundColor === color ? "black" : BoolCast(this.layoutDoc.linearViewIsExpanded) ? undefined : Colors.LIGHT_GRAY
+ }}
+ onPointerDown={e => e.stopPropagation()} >
+ <div className="collectionLinearView-menuOpener">
+ {BoolCast(this.layoutDoc.linearViewIsExpanded) ? icon ? icon : <FontAwesomeIcon icon={"minus"} /> : icon ? icon : <FontAwesomeIcon icon={"plus"} />}
+ </div>
+ </label>;
+
+ return <div className={`collectionLinearView-outer ${this.layoutDoc.linearViewSubMenu}`} style={{ backgroundColor: BoolCast(this.layoutDoc.linearViewIsExpanded) ? undefined : "transparent" }}>
+ <div className="collectionLinearView" ref={this.createDashEventsTarget}
+ onContextMenu={this.myContextMenu} >
+ {!expandable ? (null) : <Tooltip title={<><div className="dash-tooltip">{BoolCast(this.props.Document.linearViewIsExpanded) ? "Close" : "Open"}</div></>} placement="top">
+ {menuOpener}
+ </Tooltip>}
+ <input id={`${guid}`} type="checkbox" checked={BoolCast(this.props.Document.linearViewIsExpanded)} ref={this.addMenuToggle}
+ onChange={action(() => this.props.Document.linearViewIsExpanded = this.addMenuToggle.current!.checked)} />
+
+ <div className="collectionLinearView-content"
+ style={{
+ height: this.dimension(),
+ flexDirection: flexDir,
+ gap: flexGap
+ }}>
+ {this.childLayoutPairs.map(pair => this.getDisplayDoc(pair.layout))}
+ </div>
+ {DocumentLinksButton.StartLink && StrCast(this.layoutDoc.title) === "docked buttons" ? <span className="bottomPopup-background" style={{
+ pointerEvents: "all"
+ }}
+ onPointerDown={e => e.stopPropagation()} >
+ <span className="bottomPopup-text" >
+ Creating link from: <b>{DocumentLinksButton.AnnotationId ? "Annotation in " : " "} {StrCast(DocumentLinksButton.StartLink.title).length < 51 ? DocumentLinksButton.StartLink.title : StrCast(DocumentLinksButton.StartLink.title).slice(0, 50) + '...'}</b>
+ </span>
+
+ <Tooltip title={<><div className="dash-tooltip">{"Toggle description pop-up"} </div></>} placement="top">
+ <span className="bottomPopup-descriptions" onClick={this.changeDescriptionSetting}>
+ Labels: {LinkDescriptionPopup.showDescriptions ? LinkDescriptionPopup.showDescriptions : "ON"}
+ </span>
+ </Tooltip>
+
+ <Tooltip title={<><div className="dash-tooltip">Exit linking mode</div></>} placement="top">
+ <span className="bottomPopup-exit" onClick={this.exitLongLinks}>
+ Stop
+ </span>
+ </Tooltip>
+
+ </span> : null}
+ </div>
+ </div>;
+ }
+} \ No newline at end of file
diff --git a/src/client/views/collections/collectionLinear/index.ts b/src/client/views/collections/collectionLinear/index.ts
new file mode 100644
index 000000000..ff73e14ae
--- /dev/null
+++ b/src/client/views/collections/collectionLinear/index.ts
@@ -0,0 +1 @@
+export * from "./CollectionLinearView"; \ No newline at end of file
diff --git a/src/client/views/collections/collectionSchema/CollectionSchemaCells.tsx b/src/client/views/collections/collectionSchema/CollectionSchemaCells.tsx
index fd99abce5..ed196349e 100644
--- a/src/client/views/collections/collectionSchema/CollectionSchemaCells.tsx
+++ b/src/client/views/collections/collectionSchema/CollectionSchemaCells.tsx
@@ -293,12 +293,12 @@ export class CollectionSchemaCell extends React.Component<CellProps> {
}
}
const script = CompileScript(inputSansCommas, { requiredType: type, typecheck: false, editable: true, addReturn: true, params: { this: Doc.name, $r: "number", $c: "number", $: "any" } });
- const changeMade = value.length !== value.length || value.length - 2 !== value.length;
+ const changeMade = value.length - 2 !== value.length;
script.compiled && (retVal = this.applyToDoc(changeMade ? this._rowDoc : this._rowDataDoc, this.props.row, this.props.col, script.run));
// handle booleans
} else if (inputIsBool) {
const script = CompileScript(value, { requiredType: type, typecheck: false, editable: true, addReturn: true, params: { this: Doc.name, $r: "number", $c: "number", $: "any" } });
- const changeMade = value.length !== value.length || value.length - 2 !== value.length;
+ const changeMade = value.length - 2 !== value.length;
script.compiled && (retVal = this.applyToDoc(changeMade ? this._rowDoc : this._rowDataDoc, this.props.row, this.props.col, script.run));
}
}
diff --git a/src/client/views/collections/collectionSchema/CollectionSchemaHeaders.tsx b/src/client/views/collections/collectionSchema/CollectionSchemaHeaders.tsx
index aaa50ba67..a25f962df 100644
--- a/src/client/views/collections/collectionSchema/CollectionSchemaHeaders.tsx
+++ b/src/client/views/collections/collectionSchema/CollectionSchemaHeaders.tsx
@@ -191,7 +191,7 @@ export class CollectionSchemaColumnMenu extends React.Component<ColumnMenuProps>
{this.renderSorting()}
{this.renderColors()}
<div className="collectionSchema-headerMenu-group">
- <button onClick={() => this.props.deleteColumn(this.props.columnField.heading)}>Delete Column</button>
+ <button onClick={() => this.props.deleteColumn(this.props.columnField.heading)}>Hide Column</button>
</div>
</>
}
@@ -413,7 +413,7 @@ export class KeysDropdown extends React.Component<KeysDropdownProps> {
bool = fields ? fields[1] === "check" : false;
}
return <div key={key} className="key-option" style={{
- border: "1px solid lightgray", paddingLeft: 5, textAlign: "left",
+ paddingLeft: 5, textAlign: "left",
width: this.props.width, maxWidth: this.props.width, overflowX: "hidden", background: "white", backgroundColor: "white",
}}
>
@@ -489,8 +489,10 @@ export class KeysDropdown extends React.Component<KeysDropdownProps> {
}
render() {
return (
- <div style={{ display: "flex" }} ref={this.setNode}>
- <FontAwesomeIcon onClick={e => { this.props.openHeader(this.props.col, e.clientX, e.clientY); e.stopPropagation(); }} icon={this.props.icon} size="lg" style={{ display: "inline", paddingBottom: "1px", paddingTop: "4px", cursor: "hand" }} />
+ <div style={{ display: "flex", width: '100%', alignContent: 'center', alignItems: 'center' }} ref={this.setNode}>
+ <div className="schema-icon" onClick={e => { this.props.openHeader(this.props.col, e.clientX, e.clientY); e.stopPropagation(); }}>
+ <FontAwesomeIcon icon={this.props.icon} size="lg" style={{ display: "inline" }} />
+ </div>
{/* <FontAwesomeIcon icon={fa.faSearchMinus} size="lg" style={{ display: "inline", paddingBottom: "1px", paddingTop: "4px", cursor: "hand" }} onClick={e => {
runInAction(() => { this._isOpen === undefined ? this._isOpen = true : this._isOpen = !this._isOpen })
diff --git a/src/client/views/collections/collectionSchema/CollectionSchemaMovableRow.tsx b/src/client/views/collections/collectionSchema/CollectionSchemaMovableRow.tsx
index f48906ba5..0e19ef3d9 100644
--- a/src/client/views/collections/collectionSchema/CollectionSchemaMovableRow.tsx
+++ b/src/client/views/collections/collectionSchema/CollectionSchemaMovableRow.tsx
@@ -134,9 +134,9 @@ export class MovableRow extends React.Component<MovableRowProps> {
<div className="collectionSchema-row-wrapper" onKeyPress={this.onKeyDown} ref={this._header} onPointerEnter={this.onPointerEnter} onPointerLeave={this.onPointerLeave}>
<ReactTableDefaults.TrComponent onKeyPress={this.onKeyDown} >
<div className="row-dragger">
- <div className="row-option" style={{ left: 5 }} onClick={undoBatch(() => this.props.removeDoc(this.props.rowInfo.original))}><FontAwesomeIcon icon="trash" size="sm" /></div>
- <div className="row-option" style={{ cursor: "grab", left: 25 }} ref={reference} onPointerDown={onItemDown}><FontAwesomeIcon icon="grip-vertical" size="sm" /></div>
- <div className="row-option" style={{ left: 40 }} onClick={() => this.props.addDocTab(this.props.rowInfo.original, "add:right")}><FontAwesomeIcon icon="external-link-alt" size="sm" /></div>
+ <div className="row-option" onClick={undoBatch(() => this.props.removeDoc(this.props.rowInfo.original))}><FontAwesomeIcon icon="trash" size="sm" /></div>
+ <div className="row-option" style={{ cursor: "grab" }} ref={reference} onPointerDown={onItemDown}><FontAwesomeIcon icon="grip-vertical" size="sm" /></div>
+ <div className="row-option" onClick={() => this.props.addDocTab(this.props.rowInfo.original, "add:right")}><FontAwesomeIcon icon="external-link-alt" size="sm" /></div>
</div>
{children}
</ReactTableDefaults.TrComponent>
diff --git a/src/client/views/collections/collectionSchema/CollectionSchemaView.scss b/src/client/views/collections/collectionSchema/CollectionSchemaView.scss
index 40cdcd14b..3074ce66e 100644
--- a/src/client/views/collections/collectionSchema/CollectionSchemaView.scss
+++ b/src/client/views/collections/collectionSchema/CollectionSchemaView.scss
@@ -108,9 +108,7 @@
}
.rt-th {
padding: 0;
- border: solid lightgray;
- border-width: 0 1px;
- border-bottom: 2px solid lightgray;
+ border-left: solid 1px $light-gray;
}
}
.rt-th {
@@ -213,6 +211,8 @@
}
}
+
+
.collectionSchemaView-header {
height: 100%;
color: gray;
@@ -227,6 +227,15 @@ button.add-column {
width: 28px;
}
+.collectionSchemaView-menuOptions-wrapper {
+ background: rgb(241, 239, 235);
+ display: flex;
+ cursor: default;
+ height: 100%;
+ align-content: center;
+ align-items: center;
+}
+
.collectionSchema-header-menuOptions {
color: black;
width: 180px;
@@ -272,6 +281,9 @@ button.add-column {
width: 10px;
}
}
+
+
+
.keys-dropdown {
position: relative;
//width: 100%;
@@ -287,26 +299,7 @@ button.add-column {
font-weight: normal;
}
}
- .keys-options-wrapper {
- width: 100%;
- max-height: 150px;
- overflow-y: scroll;
- position: absolute;
- top: 28px;
- box-shadow: 0 10px 16px rgba(0, 0, 0, 0.1);
- background-color: white;
- .key-option {
- background-color: white;
- border: 1px solid lightgray;
- padding: 2px 3px;
- &:not(:first-child) {
- border-top: 0;
- }
- &:hover {
- background-color: $light-gray;
- }
- }
- }
+
}
.columnMenu-colors {
display: flex;
@@ -325,11 +318,53 @@ button.add-column {
}
}
+.schema-icon {
+ cursor: pointer;
+ width: 25px;
+ height: 25px;
+ display: flex;
+ align-items: center;
+ justify-content: center;
+ align-content: center;
+ background-color: $medium-blue;
+ color: white;
+ margin-right: 5px;
+ font-size: 10px;
+ border-radius: 3px;
+
+}
+
+.keys-options-wrapper {
+ position: absolute;
+ text-align: left;
+ height: fit-content;
+ top: 100%;
+ z-index: 21;
+ background-color: #ffffff;
+ box-shadow: 0px 3px 4px rgba(0,0,0,30%);
+ padding: 1px;
+ .key-option {
+ cursor: pointer;
+ color: #000000;
+ width: 100%;
+ height: 25px;
+ font-weight: 400;
+ display: flex;
+ justify-content: left;
+ align-items: center;
+ padding-left: 5px;
+ &:hover {
+ background-color: $light-gray;
+ }
+ }
+}
+
.collectionSchema-row {
height: 100%;
background-color: white;
&.row-focused .rt-td {
- background-color: #bfffc0; //$light-gray;
+ background-color: $light-blue; //$light-gray;
+ overflow: visible;
}
&.row-wrapped {
.rt-td {
@@ -338,39 +373,40 @@ button.add-column {
}
.row-dragger {
display: flex;
- justify-content: space-around;
- //flex: 50 0 auto;
- width: 0;
- max-width: 50px;
- //height: 100%;
+ justify-content: space-evenly;
+ width: 58px;
+ position: absolute;
+ /* max-width: 50px; */
min-height: 30px;
align-items: center;
color: lightgray;
background-color: white;
transition: color 0.1s ease;
.row-option {
- // padding: 5px;
+ color: black;
cursor: pointer;
- position: absolute;
+ position: relative;
transition: color 0.1s ease;
display: flex;
flex-direction: column;
justify-content: center;
z-index: 2;
+ border-radius: 3px;
+ padding: 3px;
&:hover {
- color: gray;
+ background-color: $light-gray;
}
}
}
.collectionSchema-row-wrapper {
&.row-above {
- border-top: 1px solid red;
+ border-top: 1px solid $medium-blue;
}
&.row-below {
- border-bottom: 1px solid red;
+ border-bottom: 1px solid $medium-blue;
}
&.row-inside {
- border: 1px solid red;
+ border: 2px dashed $medium-blue;
}
.row-dragging {
background-color: blue;
@@ -383,24 +419,32 @@ button.add-column {
height: unset;
}
+.collectionSchemaView-cellContents {
+ width: 100%;
+}
+
.collectionSchemaView-cellWrapper {
+ display: flex;
height: 100%;
- padding: 4px;
text-align: left;
padding-left: 19px;
position: relative;
+ align-items: center;
+ align-content: center;
&:focus {
outline: none;
}
&.editing {
padding: 0;
+ box-shadow: 0px 3px 4px rgba(0, 0, 0, 0.3);
+ transform: scale(1.1);
+ z-index: 40;
input {
outline: 0;
border: none;
- background-color: rgb(255, 217, 217);
+ background-color: $white;
width: 100%;
height: 100%;
- padding: 2px 3px;
min-height: 26px;
}
}
diff --git a/src/client/views/collections/collectionSchema/CollectionSchemaView.tsx b/src/client/views/collections/collectionSchema/CollectionSchemaView.tsx
index fed64b620..dfe99ffc8 100644
--- a/src/client/views/collections/collectionSchema/CollectionSchemaView.tsx
+++ b/src/client/views/collections/collectionSchema/CollectionSchemaView.tsx
@@ -338,7 +338,7 @@ export class CollectionSchemaView extends CollectionSubView(doc => doc) {
{this.renderColors(this._col)}
<div className="collectionSchema-headerMenu-group">
<button onClick={() => { this.deleteColumn(this._col.heading); }}
- >Delete Column</button>
+ >Hide Column</button>
</div>
</div>;
}
diff --git a/src/client/views/collections/collectionSchema/SchemaTable.tsx b/src/client/views/collections/collectionSchema/SchemaTable.tsx
index abe549072..3833f968b 100644
--- a/src/client/views/collections/collectionSchema/SchemaTable.tsx
+++ b/src/client/views/collections/collectionSchema/SchemaTable.tsx
@@ -194,10 +194,10 @@ export class SchemaTable extends React.Component<SchemaTableProps> {
const sortIcon = col.desc === undefined ? "caret-right" : col.desc === true ? "caret-down" : "caret-up";
const header = <div className="collectionSchemaView-menuOptions-wrapper" style={{ background: col.color, padding: "2px", display: "flex", cursor: "default", height: "100%", }}>
{keysDropdown}
- <div onClick={e => this.changeSorting(col)} style={{ width: 21, padding: 1, display: "inline", zIndex: 1, background: "inherit", cursor: "hand" }}>
+ <div onClick={e => this.changeSorting(col)} style={{ width: 21, padding: 1, display: "inline", zIndex: 1, background: "inherit", cursor: "pointer" }}>
<FontAwesomeIcon icon={sortIcon} size="lg" />
</div>
- {this.props.Document._chromeHidden || this.props.addDocument == returnFalse ? undefined : <div className="collectionSchemaView-addRow" onClick={this.createRow}>+ new</div>}
+ {/* {this.props.Document._chromeHidden || this.props.addDocument == returnFalse ? undefined : <div className="collectionSchemaView-addRow" onClick={this.createRow}>+ new</div>} */}
</div>;
return {
@@ -562,7 +562,7 @@ export class SchemaTable extends React.Component<SchemaTableProps> {
onPointerDown={this.props.onPointerDown} onClick={this.props.onClick} onWheel={e => this.props.active(true) && e.stopPropagation()}
onDrop={e => this.props.onDrop(e, {})} onContextMenu={this.onContextMenu} >
{this.reactTable}
- {this.props.Document._chromeHidden || this.props.addDocument == returnFalse ? undefined : <div className="collectionSchemaView-addRow" onClick={this.createRow}>+ new</div>}
+ {this.props.Document._chromeHidden || this.props.addDocument === returnFalse ? undefined : <div className="collectionSchemaView-addRow" onClick={this.createRow}>+ new</div>}
{!this._showDoc ? (null) :
<div className="collectionSchemaView-documentPreview" ref="overlay"
style={{
diff --git a/src/client/views/global/globalCssVariables.scss b/src/client/views/global/globalCssVariables.scss
index 7556f8b8a..95bd44c1f 100644
--- a/src/client/views/global/globalCssVariables.scss
+++ b/src/client/views/global/globalCssVariables.scss
@@ -1,6 +1,7 @@
@import url("https://fonts.googleapis.com/css2?family=Roboto&display=swap");
// colors
$white: #ffffff;
+$off-white: #fdfdfd;
$light-gray: #dfdfdf;
$medium-gray: #9f9f9f;
$dark-gray: #323232;
@@ -8,6 +9,7 @@ $black: #000000;
$light-blue: #bdddf5;
$medium-blue: #4476f7;
+$medium-blue-alt: #4476f73d;
$pink: #e0217d;
$yellow: #f5d747;
@@ -15,6 +17,7 @@ $close-red: #e48282;
$drop-shadow: "#32323215";
+
//padding
$minimum-padding: 4px;
$medium-padding: 16px;
@@ -24,7 +27,8 @@ $large-padding: 32px;
$icon-size: 28px;
// fonts
-$sans-serif: "Roboto", sans-serif;
+$sans-serif: "Roboto",
+sans-serif;
$large-header: 16px;
$body-text: 12px;
$small-text: 9px;
@@ -43,7 +47,14 @@ $radialMenu-zindex: 100000; // context menu shows up over everything
// borders
$standard-border: solid 1px #9f9f9f;
-$searchpanel-height: 32px;
+// border radius
+$standard-border-radius: 3px;
+
+// shadow
+$standard-box-shadow: 0px 3px 4px rgba(0, 0, 0, 0.3);
+
+
+$dashboardselector-height: 32px;
$mainTextInput-zindex: 999; // then text input overlay so that it's context menu will appear over decorations, etc
$docDecorations-zindex: 998; // then doc decorations appear over everything else
$remoteCursors-zindex: 997; // ... not sure what level the remote cursors should go -- is this right?
@@ -52,7 +63,7 @@ $SCHEMA_DIVIDER_WIDTH: 4;
$MINIMIZED_ICON_SIZE: 24;
$MAX_ROW_HEIGHT: 44px;
$DFLT_IMAGE_NATIVE_DIM: 900px;
-$MENU_PANEL_WIDTH: 60px;
+$LEFT_MENU_WIDTH: 60px;
$TREE_BULLET_WIDTH: 20px;
:export {
@@ -63,8 +74,8 @@ $TREE_BULLET_WIDTH: 20px;
MAX_ROW_HEIGHT: $MAX_ROW_HEIGHT;
SEARCH_THUMBNAIL_SIZE: $search-thumnail-size;
ANTIMODEMENU_HEIGHT: $antimodemenu-height;
- SEARCH_PANEL_HEIGHT: $searchpanel-height;
+ DASHBOARD_SELECTOR_HEIGHT: $dashboardselector-height;
DFLT_IMAGE_NATIVE_DIM: $DFLT_IMAGE_NATIVE_DIM;
- MENU_PANEL_WIDTH: $MENU_PANEL_WIDTH;
+ LEFT_MENU_WIDTH: $LEFT_MENU_WIDTH;
TREE_BULLET_WIDTH: $TREE_BULLET_WIDTH;
-}
+} \ No newline at end of file
diff --git a/src/client/views/global/globalCssVariables.scss.d.ts b/src/client/views/global/globalCssVariables.scss.d.ts
index 11e62e1eb..59c2b3585 100644
--- a/src/client/views/global/globalCssVariables.scss.d.ts
+++ b/src/client/views/global/globalCssVariables.scss.d.ts
@@ -7,9 +7,9 @@ interface IGlobalScss {
MAX_ROW_HEIGHT: string;
SEARCH_THUMBNAIL_SIZE: string;
ANTIMODEMENU_HEIGHT: string;
- SEARCH_PANEL_HEIGHT: string;
+ DASHBOARD_SELECTOR_HEIGHT: string;
DFLT_IMAGE_NATIVE_DIM: string;
- MENU_PANEL_WIDTH: string;
+ LEFT_MENU_WIDTH: string;
TREE_BULLET_WIDTH: string;
}
declare const globalCssVariables: IGlobalScss;
diff --git a/src/client/views/global/globalEnums.tsx b/src/client/views/global/globalEnums.tsx
index 2aeb8e338..56779c37c 100644
--- a/src/client/views/global/globalEnums.tsx
+++ b/src/client/views/global/globalEnums.tsx
@@ -5,6 +5,7 @@ export enum Colors {
LIGHT_GRAY = "#DFDFDF",
WHITE = "#FFFFFF",
MEDIUM_BLUE = "#4476F7",
+ MEDIUM_BLUE_ALT = "#4476f73d", // REDUCED OPACITY
LIGHT_BLUE = "#BDDDF5",
PINK = "#E0217D",
YELLOW = "#F5D747",
@@ -35,4 +36,8 @@ export enum IconSizes {
export enum Borders {
STANDARD = "solid 1px #9F9F9F"
+}
+
+export enum Shadows {
+ STANDARD_SHADOW = "0px 3px 4px rgba(0, 0, 0, 0.3)"
} \ No newline at end of file
diff --git a/src/client/views/linking/LinkEditor.scss b/src/client/views/linking/LinkEditor.scss
index e45a91d57..abd413f57 100644
--- a/src/client/views/linking/LinkEditor.scss
+++ b/src/client/views/linking/LinkEditor.scss
@@ -106,6 +106,24 @@
}
}
+.linkEditor-relationship-dropdown {
+ position: absolute;
+ width: 154px;
+ max-height: 90px;
+ overflow: auto;
+ background: white;
+
+ p {
+ padding: 3px;
+ cursor: pointer;
+ border: 1px solid $medium-gray;
+ }
+
+ p:hover {
+ background: $light-blue;
+ }
+}
+
.linkEditor-followingDropdown {
padding-left: 26px;
padding-right: 6.5px;
diff --git a/src/client/views/linking/LinkEditor.tsx b/src/client/views/linking/LinkEditor.tsx
index f74b422d3..240a71c3e 100644
--- a/src/client/views/linking/LinkEditor.tsx
+++ b/src/client/views/linking/LinkEditor.tsx
@@ -2,11 +2,12 @@ import { FontAwesomeIcon } from "@fortawesome/react-fontawesome";
import { Tooltip } from "@material-ui/core";
import { action, computed, observable } from "mobx";
import { observer } from "mobx-react";
-import { Doc } from "../../../fields/Doc";
+import { Doc, StrListCast } from "../../../fields/Doc";
import { DateCast, StrCast } from "../../../fields/Types";
import { LinkManager } from "../../util/LinkManager";
import { undoBatch } from "../../util/UndoManager";
import './LinkEditor.scss';
+import { LinkRelationshipSearch } from "./LinkRelationshipSearch";
import React = require("react");
@@ -26,6 +27,8 @@ export class LinkEditor extends React.Component<LinkEditorProps> {
@computed get infoIcon() { if (this.showInfo) { return "chevron-up"; } return "chevron-down"; }
@observable private buttonColor: string = "";
@observable private relationshipButtonColor: string = "";
+ @observable private relationshipSearchVisibility: string = "none";
+ @observable private searchIsActive: boolean = false;
//@observable description = this.props.linkDoc.description ? StrCast(this.props.linkDoc.description) : "DESCRIPTION";
@@ -39,12 +42,40 @@ export class LinkEditor extends React.Component<LinkEditorProps> {
setRelationshipValue = action((value: string) => {
if (LinkManager.currentLink) {
LinkManager.currentLink.linkRelationship = value;
+ const linkRelationshipList = StrListCast(Doc.UserDoc().linkRelationshipList);
+ const linkColorList = StrListCast(Doc.UserDoc().linkColorList);
+ // if the relationship does not exist in the list, add it and a corresponding unique randomly generated color
+ if (linkRelationshipList && !linkRelationshipList.includes(value)) {
+ linkRelationshipList.push(value);
+ const randColor = "rgb(" + Math.floor(Math.random() * 255) + "," + Math.floor(Math.random() * 255) + "," + Math.floor(Math.random() * 255) + ")";
+ linkColorList.push(randColor);
+ }
this.relationshipButtonColor = "rgb(62, 133, 55)";
setTimeout(action(() => this.relationshipButtonColor = ""), 750);
return true;
}
});
+ /**
+ * returns list of strings with possible existing relationships that contain what is currently in the input field
+ */
+ @action
+ getRelationshipResults = () => {
+ const query = this.relationship; //current content in input box
+ const linkRelationshipList = StrListCast(Doc.UserDoc().linkRelationshipList);
+ if (linkRelationshipList) {
+ return linkRelationshipList.filter(rel => rel.includes(query));
+ }
+ }
+
+ /**
+ * toggles visibility of the relationship search results when the input field is focused on
+ */
+ @action
+ toggleRelationshipResults = () => {
+ this.relationshipSearchVisibility = this.relationshipSearchVisibility === "none" ? "block" : "none";
+ }
+
@undoBatch
setDescripValue = action((value: string) => {
if (LinkManager.currentLink) {
@@ -55,7 +86,7 @@ export class LinkEditor extends React.Component<LinkEditorProps> {
}
});
- onKey = (e: React.KeyboardEvent<HTMLInputElement>) => {
+ onDescriptionKey = (e: React.KeyboardEvent<HTMLInputElement>) => {
if (e.key === "Enter") {
this.setDescripValue(this.description);
document.getElementById('input')?.blur();
@@ -69,16 +100,38 @@ export class LinkEditor extends React.Component<LinkEditorProps> {
}
}
- onDown = () => this.setDescripValue(this.description);
- onRelationshipDown = () => this.setRelationshipValue(this.description);
+ onDescriptionDown = () => this.setDescripValue(this.description);
+ onRelationshipDown = () => this.setRelationshipValue(this.relationship);
+
+ onBlur = () => {
+ //only hide the search results if the user clicks out of the input AND not on any of the search results
+ // i.e. if search is not active
+ if (!this.searchIsActive) {
+ this.toggleRelationshipResults();
+ }
+ }
+ onFocus = () => {
+ this.toggleRelationshipResults();
+ }
+ toggleSearchIsActive = () => {
+ this.searchIsActive = !this.searchIsActive;
+ }
@action
- handleChange = (e: React.ChangeEvent<HTMLInputElement>) => { this.description = e.target.value; }
+ handleDescriptionChange = (e: React.ChangeEvent<HTMLInputElement>) => { this.description = e.target.value; }
@action
- handleRelationshipChange = (e: React.ChangeEvent<HTMLInputElement>) => { this.relationship = e.target.value; }
-
+ handleRelationshipChange = (e: React.ChangeEvent<HTMLInputElement>) => {
+ this.relationship = e.target.value;
+ }
+ @action
+ handleRelationshipSearchChange = (result: string) => {
+ this.setRelationshipValue(result);
+ this.toggleRelationshipResults();
+ this.relationship = result;
+ }
@computed
get editRelationship() {
+ //NOTE: confusingly, the classnames for the following relationship JSX elements are the same as the for the description elements for shared CSS
return <div className="linkEditor-description">
<div className="linkEditor-description-label">Link Relationship:</div>
<div className="linkEditor-description-input">
@@ -87,11 +140,18 @@ export class LinkEditor extends React.Component<LinkEditorProps> {
style={{ width: "100%" }}
id="input"
value={this.relationship}
- placeholder={"enter link label"}
- // color={"rgb(88, 88, 88)"}
+ placeholder={"Enter link relationship"}
onKeyDown={this.onRelationshipKey}
onChange={this.handleRelationshipChange}
+ onFocus={this.onFocus}
+ onBlur={this.onBlur}
></input>
+ <LinkRelationshipSearch
+ results={this.getRelationshipResults()}
+ display={this.relationshipSearchVisibility}
+ handleRelationshipSearchChange={this.handleRelationshipSearchChange}
+ toggleSearch={this.toggleSearchIsActive}
+ />
</div>
<div className="linkEditor-description-add-button"
style={{ background: this.relationshipButtonColor }}
@@ -110,15 +170,14 @@ export class LinkEditor extends React.Component<LinkEditorProps> {
style={{ width: "100%" }}
id="input"
value={this.description}
- placeholder={"enter link label"}
- // color={"rgb(88, 88, 88)"}
- onKeyDown={this.onKey}
- onChange={this.handleChange}
+ placeholder={"Enter link description"}
+ onKeyDown={this.onDescriptionKey}
+ onChange={this.handleDescriptionChange}
></input>
</div>
<div className="linkEditor-description-add-button"
style={{ background: this.buttonColor }}
- onPointerDown={this.onDown}>Set</div>
+ onPointerDown={this.onDescriptionDown}>Set</div>
</div>
</div>;
}
@@ -149,35 +208,35 @@ export class LinkEditor extends React.Component<LinkEditorProps> {
<div className="linkEditor-followingDropdown-option"
onPointerDown={() => this.changeFollowBehavior("default")}>
Default
- </div>
+ </div>
<div className="linkEditor-followingDropdown-option"
onPointerDown={() => this.changeFollowBehavior("add:left")}>
Always open in new left pane
- </div>
+ </div>
<div className="linkEditor-followingDropdown-option"
onPointerDown={() => this.changeFollowBehavior("add:right")}>
Always open in new right pane
- </div>
+ </div>
<div className="linkEditor-followingDropdown-option"
onPointerDown={() => this.changeFollowBehavior("replace:right")}>
Always replace right tab
- </div>
+ </div>
<div className="linkEditor-followingDropdown-option"
onPointerDown={() => this.changeFollowBehavior("replace:left")}>
Always replace left tab
- </div>
+ </div>
<div className="linkEditor-followingDropdown-option"
onPointerDown={() => this.changeFollowBehavior("fullScreen")}>
Always open full screen
- </div>
+ </div>
<div className="linkEditor-followingDropdown-option"
onPointerDown={() => this.changeFollowBehavior("add")}>
Always open in a new tab
- </div>
+ </div>
<div className="linkEditor-followingDropdown-option"
onPointerDown={() => this.changeFollowBehavior("replace")}>
Replace Tab
- </div>
+ </div>
{this.props.linkDoc.linksToAnnotation ?
<div className="linkEditor-followingDropdown-option"
onPointerDown={() => this.changeFollowBehavior("openExternal")}>
diff --git a/src/client/views/linking/LinkMenu.tsx b/src/client/views/linking/LinkMenu.tsx
index 6fc860447..53fe3f682 100644
--- a/src/client/views/linking/LinkMenu.tsx
+++ b/src/client/views/linking/LinkMenu.tsx
@@ -41,7 +41,7 @@ export class LinkMenu extends React.Component<Props> {
/**
* maps each link to a JSX element to be rendered
- * @param groups LinkManager containing info of all of the links
+ * @param groups containing info of all of the links
* @returns list of link JSX elements if there at least one linked element
*/
renderAllGroups = (groups: Map<string, Array<Doc>>): Array<JSX.Element> => {
diff --git a/src/client/views/linking/LinkMenuGroup.tsx b/src/client/views/linking/LinkMenuGroup.tsx
index c7586a467..cb6571f92 100644
--- a/src/client/views/linking/LinkMenuGroup.tsx
+++ b/src/client/views/linking/LinkMenuGroup.tsx
@@ -1,5 +1,5 @@
import { observer } from "mobx-react";
-import { Doc } from "../../../fields/Doc";
+import { Doc, StrListCast } from "../../../fields/Doc";
import { Id } from "../../../fields/FieldSymbols";
import { Cast } from "../../../fields/Types";
import { LinkManager } from "../../util/LinkManager";
@@ -20,6 +20,23 @@ interface LinkMenuGroupProps {
export class LinkMenuGroup extends React.Component<LinkMenuGroupProps> {
private _menuRef = React.createRef<HTMLDivElement>();
+ getBackgroundColor = (): string => {
+ const linkRelationshipList = StrListCast(Doc.UserDoc().linkRelationshipList);
+ const linkColorList = StrListCast(Doc.UserDoc().linkColorList);
+ let color = "white";
+ // if this link's relationship property is not default "link", set its color
+ if (linkRelationshipList) {
+ const relationshipIndex = linkRelationshipList.indexOf(this.props.groupType);
+ const RGBcolor: string = linkColorList[relationshipIndex];
+ if (RGBcolor) {
+ //set opacity to 0.25 by modifiying the rgb string
+ color = RGBcolor.slice(0, RGBcolor.length - 1) + ", 0.25)";
+ console.log(color);
+ }
+ }
+ return color;
+ }
+
render() {
const set = new Set<Doc>(this.props.group);
const groupItems = Array.from(set.keys()).map(linkDoc => {
@@ -39,7 +56,7 @@ export class LinkMenuGroup extends React.Component<LinkMenuGroupProps> {
return (
<div className="linkMenu-group" ref={this._menuRef}>
- <div className="linkMenu-group-name">
+ <div className="linkMenu-group-name" style={{ background: this.getBackgroundColor() }}>
<p className={this.props.groupType === "*" || this.props.groupType === "" ? "" : "expand-one"}> {this.props.groupType}:</p>
</div>
<div className="linkMenu-group-wrapper">
diff --git a/src/client/views/linking/LinkPopup.scss b/src/client/views/linking/LinkPopup.scss
index 8ae65158d..60c9ebfcd 100644
--- a/src/client/views/linking/LinkPopup.scss
+++ b/src/client/views/linking/LinkPopup.scss
@@ -5,7 +5,7 @@
height: 200px;
width: 200px;
position: absolute;
- padding: 15px;
+ // padding: 15px;
border-radius: 3px;
input {
diff --git a/src/client/views/linking/LinkPopup.tsx b/src/client/views/linking/LinkPopup.tsx
index df469c53b..c8be9069c 100644
--- a/src/client/views/linking/LinkPopup.tsx
+++ b/src/client/views/linking/LinkPopup.tsx
@@ -1,33 +1,21 @@
-import { IconProp } from '@fortawesome/fontawesome-svg-core';
-import { FontAwesomeIcon } from '@fortawesome/react-fontawesome';
-import { Tooltip } from '@material-ui/core';
-import { action, observable, runInAction } from 'mobx';
+import { action, observable } from 'mobx';
import { observer } from "mobx-react";
-import { Doc, DocListCast } from '../../../fields/Doc';
-import { Cast, StrCast } from '../../../fields/Types';
-import { WebField } from '../../../fields/URLField';
-import { emptyFunction, setupMoveUpEvents, returnFalse, returnTrue, returnEmptyDoclist, returnEmptyFilter } from '../../../Utils';
-import { DocumentType } from '../../documents/DocumentTypes';
-import { DocumentManager } from '../../util/DocumentManager';
-import { DragManager } from '../../util/DragManager';
-import { Hypothesis } from '../../util/HypothesisUtils';
-import { LinkManager } from '../../util/LinkManager';
-import { undoBatch } from '../../util/UndoManager';
-import { DocumentLinksButton } from '../nodes/DocumentLinksButton';
-import { DocumentView, DocumentViewSharedProps } from '../nodes/DocumentView';
-import { LinkDocPreview } from '../nodes/LinkDocPreview';
-import './LinkPopup.scss';
-import React = require("react");
+import { EditorView } from 'prosemirror-view';
+import { emptyFunction, returnEmptyDoclist, returnEmptyFilter, returnFalse, returnTrue } from '../../../Utils';
+import { DocUtils } from '../../documents/Documents';
import { CurrentUserUtils } from '../../util/CurrentUserUtils';
-import { DefaultStyleProvider } from '../StyleProvider';
import { Transform } from '../../util/Transform';
-import { DocUtils } from '../../documents/Documents';
-import { SearchBox } from '../search/SearchBox';
-import { EditorView } from 'prosemirror-view';
+import { undoBatch } from '../../util/UndoManager';
import { FormattedTextBox } from '../nodes/formattedText/FormattedTextBox';
+import { SearchBox } from '../search/SearchBox';
+import { DefaultStyleProvider } from '../StyleProvider';
+import './LinkPopup.scss';
+import React = require("react");
+import { Doc, Opt } from '../../../fields/Doc';
interface LinkPopupProps {
showPopup: boolean;
+ linkFrom?: () => Doc | undefined;
// groupType: string;
// linkDoc: Doc;
// docView: DocumentView;
@@ -62,9 +50,10 @@ export class LinkPopup extends React.Component<LinkPopupProps> {
render() {
const popupVisibility = this.props.showPopup ? "block" : "none";
+ const linkDoc = this.props.linkFrom ? this.props.linkFrom : undefined;
return (
<div className="linkPopup-container" style={{ display: popupVisibility }}>
- <div className="linkPopup-url-container">
+ {/* <div className="linkPopup-url-container">
<input autoComplete="off" type="text" value={this.linkURL} placeholder="Enter URL..." onChange={this.onLinkChange} />
<button onPointerDown={e => this.makeLinkToURL(this.linkURL, "add:right")}
style={{ display: "block", margin: "10px auto", }}>Apply hyperlink</button>
@@ -72,14 +61,17 @@ export class LinkPopup extends React.Component<LinkPopupProps> {
<div className="divider">
<div className="line"></div>
<p className="divider-text">or</p>
- </div>
+ </div> */}
<div className="linkPopup-document-search-container">
{/* <i></i>
<input defaultValue={""} autoComplete="off" type="text" placeholder="Search for Document..." id="search-input"
className="linkPopup-searchBox searchBox-input" /> */}
- <SearchBox Document={CurrentUserUtils.MySearchPanelDoc}
+ <SearchBox
+ Document={CurrentUserUtils.MySearchPanelDoc}
DataDoc={CurrentUserUtils.MySearchPanelDoc}
+ linkFrom={linkDoc}
+ linkSearch={true}
fieldKey="data"
dropAction="move"
isSelected={returnTrue}
diff --git a/src/client/views/linking/LinkRelationshipSearch.tsx b/src/client/views/linking/LinkRelationshipSearch.tsx
new file mode 100644
index 000000000..53da880e4
--- /dev/null
+++ b/src/client/views/linking/LinkRelationshipSearch.tsx
@@ -0,0 +1,63 @@
+import { observer } from "mobx-react";
+import './LinkEditor.scss';
+import React = require("react");
+
+interface LinkRelationshipSearchProps {
+ results: string[] | undefined;
+ display: string;
+ //callback fn to set rel + hide dropdown upon setting
+ handleRelationshipSearchChange: (result: string) => void;
+ toggleSearch: () => void;
+}
+@observer
+export class LinkRelationshipSearch extends React.Component<LinkRelationshipSearchProps> {
+
+ handleResultClick = (e: React.MouseEvent) => {
+ const relationship = (e.target as HTMLParagraphElement).textContent;
+ if (relationship) {
+ this.props.handleRelationshipSearchChange(relationship);
+ }
+ }
+
+ handleMouseEnter = () => {
+ this.props.toggleSearch();
+ }
+
+ handleMouseLeave = () => {
+ this.props.toggleSearch();
+ }
+
+ /**
+ * Render an empty div to increase the height of LinkEditor to accommodate 2+ results
+ */
+ emptyDiv = () => {
+ if (this.props.results && this.props.results.length > 2 && this.props.display === "block") {
+ return <div style={{ height: "50px" }} />;
+ }
+ }
+
+ render() {
+ return (
+ <div className="linkEditor-relationship-dropdown-container">
+ <div className="linkEditor-relationship-dropdown"
+ style={{ display: this.props.display }}
+ onMouseEnter={this.handleMouseEnter}
+ onMouseLeave={this.handleMouseLeave}
+ >
+ { // return a dropdown of relationship results if there exist results
+ this.props.results
+ ? this.props.results.map(result => {
+ return <p key={result} onClick={this.handleResultClick}>
+ {result}
+ </p>;
+ })
+ : <p>No matching relationships</p>
+ }
+ </div>
+
+ {/*Render an empty div to increase the height of LinkEditor to accommodate 2+ results */}
+ {this.emptyDiv()}
+ </div>
+ );
+ }
+} \ No newline at end of file
diff --git a/src/client/views/nodes/AudioBox.scss b/src/client/views/nodes/AudioBox.scss
index 3fcb024df..a6494e540 100644
--- a/src/client/views/nodes/AudioBox.scss
+++ b/src/client/views/nodes/AudioBox.scss
@@ -1,3 +1,6 @@
+@import "../global/globalCssVariables.scss";
+
+
.audiobox-container,
.audiobox-container-interactive {
width: 100%;
@@ -19,10 +22,12 @@
height: 100%;
align-items: center;
display: inherit;
- background: dimgray;
+ background: $medium-gray;
left: 0px;
+ color: $dark-gray;
+
&:hover {
- color: white;
+ color: $black;
cursor: pointer;
}
}
@@ -44,9 +49,17 @@
.audiobox-record-interactive,
.audiobox-record {
pointer-events: all;
+ cursor: pointer;
width: 100%;
height: 100%;
position: relative;
+ display: flex;
+ flex-direction: row;
+ align-items: center;
+ justify-content: center;
+ gap: 10px;
+ color: white;
+ font-weight: bold;
}
.audiobox-record {
@@ -61,25 +74,37 @@
position: relative;
padding-right: 5px;
display: flex;
- background-color: red;
+ flex-direction: row;
+ justify-content: center;
+ align-items: center;
+ gap: 7px;
+ background-color: $medium-blue;
+ padding: 10px;
.time {
position: relative;
height: 100%;
width: 100%;
- font-size: 20;
+ font-size: 16px;
text-align: center;
- top: 5;
+ display: flex;
+ justify-content: center;
+ align-items: center;
+ font-weight: bold;
}
.buttons {
+ cursor: pointer;
position: relative;
margin-top: auto;
margin-bottom: auto;
width: 25px;
+ width: 25px;
padding: 5px;
- &:hover{
- background-color: crimson;
+ color: $dark-gray;
+
+ &:hover {
+ color: $black;
}
}
}
@@ -89,16 +114,15 @@
height: 100%;
position: relative;
display: flex;
- padding-left: 2px;
- background: black;
+ background: $dark-gray;
.audiobox-dictation {
position: absolute;
- width: 30px;
+ width: 40px;
height: 100%;
align-items: center;
display: inherit;
- background: dimgray;
+ background: $medium-gray;
left: 0px;
}
@@ -109,20 +133,32 @@
position: relative;
padding-right: 5px;
display: flex;
+ flex-direction: column;
+ justify-content: center;
- .audiobox-playhead {
+ .audiobox-buttons {
position: relative;
margin-top: auto;
margin-bottom: auto;
- margin-right: 2px;
- height: 25px;
- padding: 2px;
+ width: 30px;
+ height: 30px;
border-radius: 50%;
- background-color: black;
- color: white;
+ background-color: $dark-gray;
+ color: $white;
+ display: flex;
+ align-items: center;
+ justify-content: center;
+ left: 5px;
+
&:hover {
- background-color: grey;
- color: lightgrey;
+ background-color: $black;
+ }
+
+ svg {
+ width: 100%;
+ position: absolute;
+ border-width: "thin";
+ border-color: "white";
}
}
@@ -131,30 +167,29 @@
margin-top: auto;
margin-bottom: auto;
width: 25px;
- padding: 2px;
align-items: center;
display: inherit;
- background: dimgray;
+ background: $medium-gray;
}
.audiobox-timeline {
position: absolute;
width: 100%;
- border: gray solid 1px;
- border-radius: 3px;
z-index: 1000;
overflow: hidden;
+ border-right: 5px solid black;
}
.audioBox-total-time,
.audioBox-current-time {
position: absolute;
- font-size: 8;
+ font-size: $small-text;
top: 100%;
- color: white;
+ color: $white;
}
+
.audioBox-current-time {
- left: 30px;
+ left: 42px;
}
.audioBox-total-time {
@@ -164,7 +199,6 @@
}
}
-
@media only screen and (max-device-width: 480px) {
.audiobox-dictation {
font-size: 5em;
@@ -180,9 +214,9 @@
font-size: 3em;
}
- .audiobox-container .audiobox-controls .audiobox-player .audiobox-playhead,
+ .audiobox-container .audiobox-controls .audiobox-player .audiobox-buttons,
.audiobox-container .audiobox-controls .audiobox-player .audiobox-dictation,
- .audiobox-container-interactive .audiobox-controls .audiobox-player .audiobox-playhead {
+ .audiobox-container-interactive .audiobox-controls .audiobox-player .audiobox-buttons {
width: 70px;
}
} \ No newline at end of file
diff --git a/src/client/views/nodes/AudioBox.tsx b/src/client/views/nodes/AudioBox.tsx
index 82bad971d..c79828470 100644
--- a/src/client/views/nodes/AudioBox.tsx
+++ b/src/client/views/nodes/AudioBox.tsx
@@ -1,6 +1,13 @@
import React = require("react");
import { FontAwesomeIcon } from "@fortawesome/react-fontawesome";
-import { action, computed, IReactionDisposer, observable, reaction, runInAction } from "mobx";
+import {
+ action,
+ computed,
+ IReactionDisposer,
+ observable,
+ reaction,
+ runInAction,
+} from "mobx";
import { observer } from "mobx-react";
import { DateField } from "../../../fields/DateField";
import { Doc, DocListCast, Opt } from "../../../fields/Doc";
@@ -9,7 +16,7 @@ import { makeInterface } from "../../../fields/Schema";
import { ComputedField } from "../../../fields/ScriptField";
import { Cast, NumCast } from "../../../fields/Types";
import { AudioField, nullAudio } from "../../../fields/URLField";
-import { emptyFunction, formatTime, Utils } from "../../../Utils";
+import { emptyFunction, formatTime } from "../../../Utils";
import { DocUtils } from "../../documents/Documents";
import { Networking } from "../../Network";
import { CurrentUserUtils } from "../../util/CurrentUserUtils";
@@ -17,23 +24,34 @@ import { SnappingManager } from "../../util/SnappingManager";
import { CollectionStackedTimeline } from "../collections/CollectionStackedTimeline";
import { ContextMenu } from "../ContextMenu";
import { ContextMenuProps } from "../ContextMenuItem";
-import { ViewBoxAnnotatableComponent, ViewBoxAnnotatableProps } from "../DocComponent";
+import {
+ ViewBoxAnnotatableComponent,
+ ViewBoxAnnotatableProps,
+} from "../DocComponent";
import "./AudioBox.scss";
-import { FieldView, FieldViewProps } from './FieldView';
+import { FieldView, FieldViewProps } from "./FieldView";
import { LinkDocPreview } from "./LinkDocPreview";
+import { faLessThan } from "@fortawesome/free-solid-svg-icons";
+import { Colors } from "../global/globalEnums";
+
declare class MediaRecorder {
- constructor(e: any); // whatever MediaRecorder has
+ constructor(e: any); // whatever MediaRecorder has
}
type AudioDocument = makeInterface<[typeof documentSchema]>;
const AudioDocument = makeInterface(documentSchema);
@observer
-export class AudioBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps & FieldViewProps, AudioDocument>(AudioDocument) {
- public static LayoutString(fieldKey: string) { return FieldView.LayoutString(AudioBox, fieldKey); }
+export class AudioBox extends ViewBoxAnnotatableComponent<
+ ViewBoxAnnotatableProps & FieldViewProps,
+ AudioDocument
+>(AudioDocument) {
+ public static LayoutString(fieldKey: string) {
+ return FieldView.LayoutString(AudioBox, fieldKey);
+ }
public static Enabled = false;
- static playheadWidth = 30; // width of playhead
- static heightPercent = 80; // height of timeline in percent of height of audioBox.
+ static playheadWidth = 40; // width of playhead
+ static heightPercent = 75; // height of timeline in percent of height of audioBox.
static Instance: AudioBox;
_disposers: { [name: string]: IReactionDisposer } = {};
@@ -47,35 +65,82 @@ export class AudioBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp
_stream: MediaStream | undefined;
_start: number = 0;
_play: any = null;
+ _ended: boolean = false;
@observable static _scrubTime = 0;
@observable _markerEnd: number = 0;
@observable _position: number = 0;
@observable _waveHeight: Opt<number> = this.layoutDoc._height;
@observable _paused: boolean = false;
- @computed get mediaState(): undefined | "pendingRecording" | "recording" | "paused" | "playing" { return this.dataDoc.mediaState as (undefined | "pendingRecording" | "recording" | "paused" | "playing"); }
- set mediaState(value) { this.dataDoc.mediaState = value; }
- public static SetScrubTime = action((timeInMillisFrom1970: number) => { AudioBox._scrubTime = 0; AudioBox._scrubTime = timeInMillisFrom1970; });
- @computed get recordingStart() { return Cast(this.dataDoc[this.props.fieldKey + "-recordingStart"], DateField)?.date.getTime(); }
- @computed get duration() { return NumCast(this.dataDoc[`${this.fieldKey}-duration`]); }
- @computed get anchorDocs() { return DocListCast(this.dataDoc[this.annotationKey]); }
- @computed get links() { return DocListCast(this.dataDoc.links); }
- @computed get pauseTime() { return this._pauseEnd - this._pauseStart; } // total time paused to update the correct time
- @computed get heightPercent() { return AudioBox.heightPercent; }
+ @observable _trimming: boolean = false;
+ @observable _trimStart: number = NumCast(this.layoutDoc.clipStart) ? NumCast(this.layoutDoc.clipStart) : 0;
+ @observable _trimEnd: number = NumCast(this.layoutDoc.clipEnd) ? NumCast(this.layoutDoc.clipEnd)
+ : this.duration;
+
+ @computed get mediaState():
+ | undefined
+ | "pendingRecording"
+ | "recording"
+ | "paused"
+ | "playing" {
+ return this.dataDoc.mediaState as
+ | undefined
+ | "pendingRecording"
+ | "recording"
+ | "paused"
+ | "playing";
+ }
+ set mediaState(value) {
+ this.dataDoc.mediaState = value;
+ }
+ public static SetScrubTime = action((timeInMillisFrom1970: number) => {
+ AudioBox._scrubTime = 0;
+ AudioBox._scrubTime = timeInMillisFrom1970;
+ });
+ @computed get recordingStart() {
+ return Cast(
+ this.dataDoc[this.props.fieldKey + "-recordingStart"],
+ DateField
+ )?.date.getTime();
+ }
+ @computed get duration() {
+ return NumCast(this.dataDoc[`${this.fieldKey}-duration`]);
+ }
+ @computed get trimDuration() {
+ return this._trimming && this._trimEnd ? this.duration : this._trimEnd - this._trimStart;
+ }
+ @computed get anchorDocs() {
+ return DocListCast(this.dataDoc[this.annotationKey]);
+ }
+ @computed get links() {
+ return DocListCast(this.dataDoc.links);
+ }
+ @computed get pauseTime() {
+ return this._pauseEnd - this._pauseStart;
+ } // total time paused to update the correct time
+ @computed get heightPercent() {
+ return AudioBox.heightPercent;
+ }
constructor(props: Readonly<ViewBoxAnnotatableProps & FieldViewProps>) {
super(props);
AudioBox.Instance = this;
if (this.duration === undefined) {
- runInAction(() => this.Document[this.fieldKey + "-duration"] = this.Document.duration);
+ runInAction(
+ () =>
+ (this.Document[this.fieldKey + "-duration"] = this.Document.duration)
+ );
}
}
getLinkData(l: Doc) {
let la1 = l.anchor1 as Doc;
let la2 = l.anchor2 as Doc;
- const linkTime = this._stackedTimeline.current?.anchorStart(la2) || this._stackedTimeline.current?.anchorStart(la1) || 0;
+ const linkTime =
+ this._stackedTimeline.current?.anchorStart(la2) ||
+ this._stackedTimeline.current?.anchorStart(la1) ||
+ 0;
if (Doc.AreProtosEqual(la1, this.dataDoc)) {
la1 = l.anchor2 as Doc;
la2 = l.anchor1 as Doc;
@@ -84,16 +149,26 @@ export class AudioBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp
}
getAnchor = () => {
- return CollectionStackedTimeline.createAnchor(this.rootDoc, this.dataDoc, this.annotationKey,
- "_timecodeToShow" /* audioStart */, "_timecodeToHide" /* audioEnd */, this._ele?.currentTime ||
- Cast(this.props.Document._currentTimecode, "number", null) || (this.mediaState === "recording" ? (Date.now() - (this.recordingStart || 0)) / 1000 : undefined))
- || this.rootDoc;
+ return (
+ CollectionStackedTimeline.createAnchor(
+ this.rootDoc,
+ this.dataDoc,
+ this.annotationKey,
+ "_timecodeToShow" /* audioStart */,
+ "_timecodeToHide" /* audioEnd */,
+ this._ele?.currentTime ||
+ Cast(this.props.Document._currentTimecode, "number", null) ||
+ (this.mediaState === "recording"
+ ? (Date.now() - (this.recordingStart || 0)) / 1000
+ : undefined)
+ ) || this.rootDoc
+ );
}
componentWillUnmount() {
- Object.values(this._disposers).forEach(disposer => disposer?.());
+ Object.values(this._disposers).forEach((disposer) => disposer?.());
const ind = DocUtils.ActiveRecordings.indexOf(this);
- ind !== -1 && (DocUtils.ActiveRecordings.splice(ind, 1));
+ ind !== -1 && DocUtils.ActiveRecordings.splice(ind, 1);
}
@action
@@ -102,39 +177,68 @@ export class AudioBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp
this.mediaState = this.path ? "paused" : undefined;
+ this.layoutDoc.clipStart = this.layoutDoc.clipStart ? this.layoutDoc.clipStart : 0;
+ this.layoutDoc.clipEnd = this.layoutDoc.clipEnd ? this.layoutDoc.clipEnd : this.duration ? this.duration : undefined;
+
+ this.path && this.setAnchorTime(NumCast(this.layoutDoc.clipStart));
+ this.path && this.timecodeChanged();
+
this._disposers.triggerAudio = reaction(
- () => !LinkDocPreview.LinkInfo && this.props.renderDepth !== -1 ? NumCast(this.Document._triggerAudio, null) : undefined,
- start => start !== undefined && setTimeout(() => {
- this.playFrom(start);
+ () =>
+ !LinkDocPreview.LinkInfo && this.props.renderDepth !== -1
+ ? NumCast(this.Document._triggerAudio, null)
+ : undefined,
+ (start) =>
+ start !== undefined &&
setTimeout(() => {
- this.Document._currentTimecode = start;
- this.Document._triggerAudio = undefined;
- }, 10);
- }), // wait for mainCont and try again to play
+ this.playFrom(start);
+ setTimeout(() => {
+ this.Document._currentTimecode = start;
+ this.Document._triggerAudio = undefined;
+ }, 10);
+ }), // wait for mainCont and try again to play
{ fireImmediately: true }
);
this._disposers.audioStop = reaction(
- () => this.props.renderDepth !== -1 && !LinkDocPreview.LinkInfo ? Cast(this.Document._audioStop, "number", null) : undefined,
- audioStop => audioStop !== undefined && setTimeout(() => {
- this.Pause();
- setTimeout(() => this.Document._audioStop = undefined, 10);
- }), // wait for mainCont and try again to play
+ () =>
+ this.props.renderDepth !== -1 && !LinkDocPreview.LinkInfo
+ ? Cast(this.Document._audioStop, "number", null)
+ : undefined,
+ (audioStop) =>
+ audioStop !== undefined &&
+ setTimeout(() => {
+ this.Pause();
+ setTimeout(() => (this.Document._audioStop = undefined), 10);
+ }), // wait for mainCont and try again to play
{ fireImmediately: true }
);
}
// for updating the timecode
+ @action
timecodeChanged = () => {
const htmlEle = this._ele;
if (this.mediaState !== "recording" && htmlEle) {
- htmlEle.duration && htmlEle.duration !== Infinity && runInAction(() => this.dataDoc[this.fieldKey + "-duration"] = htmlEle.duration);
- this.links.map(l => this.getLinkData(l)).forEach(({ la1, la2, linkTime }) => {
- if (linkTime > NumCast(this.layoutDoc._currentTimecode) && linkTime < htmlEle.currentTime) {
- Doc.linkFollowHighlight(la1);
- }
- });
+ htmlEle.duration &&
+ htmlEle.duration !== Infinity &&
+ runInAction(
+ () => (this.dataDoc[this.fieldKey + "-duration"] = htmlEle.duration)
+ );
+ this.layoutDoc.clipEnd = this.layoutDoc.clipEnd ? Math.min(this.duration, NumCast(this.layoutDoc.clipEnd)) : this.duration;
+ this._trimEnd = this._trimEnd ? Math.min(this.duration, this._trimEnd) : this.duration;
+ this.links
+ .map((l) => this.getLinkData(l))
+ .forEach(({ la1, la2, linkTime }) => {
+ if (
+ linkTime > NumCast(this.layoutDoc._currentTimecode) &&
+ linkTime < htmlEle.currentTime
+ ) {
+ Doc.linkFollowHighlight(la1);
+ }
+ });
this.layoutDoc._currentTimecode = htmlEle.currentTime;
+
}
}
@@ -146,12 +250,13 @@ export class AudioBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp
// play audio for documents created during recording
playFromTime = (absoluteTime: number) => {
- this.recordingStart && this.playFrom((absoluteTime - this.recordingStart) / 1000);
+ this.recordingStart &&
+ this.playFrom((absoluteTime - this.recordingStart) / 1000);
}
// play back the audio from time
@action
- playFrom = (seekTimeInSeconds: number, endTime: number = this.duration) => {
+ playFrom = (seekTimeInSeconds: number, endTime: number = this._trimEnd, fullPlay: boolean = false) => {
clearTimeout(this._play);
if (Number.isNaN(this._ele?.duration)) {
setTimeout(() => this.playFrom(seekTimeInSeconds, endTime), 500);
@@ -162,12 +267,20 @@ export class AudioBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp
} else {
this.Pause();
}
- } else if (seekTimeInSeconds <= this._ele.duration) {
- this._ele.currentTime = seekTimeInSeconds;
+ } else if (this._trimStart <= endTime && seekTimeInSeconds <= this._trimEnd) {
+ const start = Math.max(this._trimStart, seekTimeInSeconds);
+ const end = Math.min(this._trimEnd, endTime);
+ this._ele.currentTime = start;
this._ele.play();
- runInAction(() => this.mediaState = "playing");
+ runInAction(() => (this.mediaState = "playing"));
if (endTime !== this.duration) {
- this._play = setTimeout(() => this.Pause(), (endTime - seekTimeInSeconds) * 1000); // use setTimeout to play a specific duration
+ this._play = setTimeout(
+ () => {
+ this._ended = fullPlay ? true : this._ended;
+ this.Pause();
+ },
+ (end - start) * 1000
+ ); // use setTimeout to play a specific duration
}
} else {
this.Pause();
@@ -182,7 +295,8 @@ export class AudioBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp
if (this._paused) {
this._pausedTime += (new Date().getTime() - this._recordStart) / 1000;
} else {
- this.layoutDoc._currentTimecode = (new Date().getTime() - this._recordStart - this.pauseTime) / 1000;
+ this.layoutDoc._currentTimecode =
+ (new Date().getTime() - this._recordStart - this.pauseTime) / 1000;
}
}
}
@@ -191,7 +305,9 @@ export class AudioBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp
recordAudioAnnotation = async () => {
this._stream = await navigator.mediaDevices.getUserMedia({ audio: true });
this._recorder = new MediaRecorder(this._stream);
- this.dataDoc[this.props.fieldKey + "-recordingStart"] = new DateField(new Date());
+ this.dataDoc[this.props.fieldKey + "-recordingStart"] = new DateField(
+ new Date()
+ );
DocUtils.ActiveRecordings.push(this);
this._recorder.ondataavailable = async (e: any) => {
const [{ result }] = await Networking.UploadFilesToServer(e.data);
@@ -200,7 +316,7 @@ export class AudioBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp
}
};
this._recordStart = new Date().getTime();
- runInAction(() => this.mediaState = "recording");
+ runInAction(() => (this.mediaState = "recording"));
setTimeout(this.updateRecordTime, 0);
this._recorder.start();
setTimeout(() => this._recorder && this.stopRecording(), 60 * 60 * 1000); // stop after an hour
@@ -209,21 +325,49 @@ export class AudioBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp
// context menu
specificContextMenu = (e: React.MouseEvent): void => {
const funcs: ContextMenuProps[] = [];
- funcs.push({ description: (this.layoutDoc.hideAnchors ? "Don't hide" : "Hide") + " anchors", event: () => this.layoutDoc.hideAnchors = !this.layoutDoc.hideAnchors, icon: "expand-arrows-alt" });
- funcs.push({ description: (this.layoutDoc.dontAutoPlayFollowedLinks ? "" : "Don't") + " play when link is selected", event: () => this.layoutDoc.dontAutoPlayFollowedLinks = !this.layoutDoc.dontAutoPlayFollowedLinks, icon: "expand-arrows-alt" });
- funcs.push({ description: (this.layoutDoc.autoPlayAnchors ? "Don't auto play" : "Auto play") + " anchors onClick", event: () => this.layoutDoc.autoPlayAnchors = !this.layoutDoc.autoPlayAnchors, icon: "expand-arrows-alt" });
- ContextMenu.Instance?.addItem({ description: "Options...", subitems: funcs, icon: "asterisk" });
+ funcs.push({
+ description:
+ (this.layoutDoc.hideAnchors ? "Don't hide" : "Hide") + " anchors",
+ event: () => (this.layoutDoc.hideAnchors = !this.layoutDoc.hideAnchors),
+ icon: "expand-arrows-alt",
+ });
+ funcs.push({
+ description:
+ (this.layoutDoc.dontAutoPlayFollowedLinks ? "" : "Don't") +
+ " play when link is selected",
+ event: () =>
+ (this.layoutDoc.dontAutoPlayFollowedLinks =
+ !this.layoutDoc.dontAutoPlayFollowedLinks),
+ icon: "expand-arrows-alt",
+ });
+ funcs.push({
+ description:
+ (this.layoutDoc.autoPlayAnchors ? "Don't auto play" : "Auto play") +
+ " anchors onClick",
+ event: () =>
+ (this.layoutDoc.autoPlayAnchors = !this.layoutDoc.autoPlayAnchors),
+ icon: "expand-arrows-alt",
+ });
+ ContextMenu.Instance?.addItem({
+ description: "Options...",
+ subitems: funcs,
+ icon: "asterisk",
+ });
}
// stops the recording
stopRecording = action(() => {
this._recorder.stop();
this._recorder = undefined;
- this.dataDoc[this.fieldKey + "-duration"] = (new Date().getTime() - this._recordStart - this.pauseTime) / 1000;
+ this.dataDoc[this.fieldKey + "-duration"] =
+ (new Date().getTime() - this._recordStart - this.pauseTime) / 1000;
this.mediaState = "paused";
+ this._trimEnd = this.duration;
+ this.layoutDoc.clipStart = 0;
+ this.layoutDoc.clipEnd = this.duration;
this._stream?.getAudioTracks()[0].stop();
const ind = DocUtils.ActiveRecordings.indexOf(this);
- ind !== -1 && (DocUtils.ActiveRecordings.splice(ind, 1));
+ ind !== -1 && DocUtils.ActiveRecordings.splice(ind, 1);
});
// button for starting and stopping the recording
@@ -236,17 +380,37 @@ export class AudioBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp
// for play button
Play = (e?: any) => {
- this.playFrom(this._ele!.paused ? this._ele!.currentTime : -1);
+ let start;
+ if (this._ended || this._ele!.currentTime === this.duration) {
+ start = this._trimStart;
+ this._ended = false;
+ }
+ else {
+ start = this._ele!.currentTime;
+ }
+
+ this.playFrom(start, this._trimEnd, true);
e?.stopPropagation?.();
}
// creates a text document for dictation
onFile = (e: any) => {
- const newDoc = CurrentUserUtils.GetNewTextDoc("", NumCast(this.props.Document.x), NumCast(this.props.Document.y) + NumCast(this.props.Document._height) + 10,
- NumCast(this.props.Document._width), 2 * NumCast(this.props.Document._height));
+ const newDoc = CurrentUserUtils.GetNewTextDoc(
+ "",
+ NumCast(this.props.Document.x),
+ NumCast(this.props.Document.y) +
+ NumCast(this.props.Document._height) +
+ 10,
+ NumCast(this.props.Document._width),
+ 2 * NumCast(this.props.Document._height)
+ );
Doc.GetProto(newDoc).recordingSource = this.dataDoc;
- Doc.GetProto(newDoc).recordingStart = ComputedField.MakeFunction(`self.recordingSource["${this.props.fieldKey}-recordingStart"]`);
- Doc.GetProto(newDoc).mediaState = ComputedField.MakeFunction("self.recordingSource.mediaState");
+ Doc.GetProto(newDoc).recordingStart = ComputedField.MakeFunction(
+ `self.recordingSource["${this.props.fieldKey}-recordingStart"]`
+ );
+ Doc.GetProto(newDoc).mediaState = ComputedField.MakeFunction(
+ "self.recordingSource.mediaState"
+ );
this.props.addDocument?.(newDoc);
e.stopPropagation();
}
@@ -261,13 +425,13 @@ export class AudioBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp
// returns the path of the audio file
@computed get path() {
const field = Cast(this.props.Document[this.props.fieldKey], AudioField);
- const path = (field instanceof AudioField) ? field.url.href : "";
+ const path = field instanceof AudioField ? field.url.href : "";
return path === nullAudio ? "" : path;
}
// returns the html audio element
@computed get audio() {
- return <audio ref={this.setRef} className={`audiobox-control${this.isContentActive() ? "-interactive" : ""}`}>
+ return <audio ref={this.setRef} className={`audiobox-control${this.props.isContentActive() ? "-interactive" : ""}`}>
<source src={this.path} type="audio/mpeg" />
Not supported.
</audio>;
@@ -295,98 +459,256 @@ export class AudioBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp
playLink = (link: Doc) => {
const stack = this._stackedTimeline.current;
if (link.annotationOn === this.rootDoc) {
- if (!this.layoutDoc.dontAutoPlayFollowedLinks) this.playFrom(stack?.anchorStart(link) || 0, stack?.anchorEnd(link));
- else this._ele!.currentTime = this.layoutDoc._currentTimecode = (stack?.anchorStart(link) || 0);
+ if (!this.layoutDoc.dontAutoPlayFollowedLinks) {
+ this.playFrom(stack?.anchorStart(link) || 0, stack?.anchorEnd(link));
+ } else {
+ this._ele!.currentTime = this.layoutDoc._currentTimecode =
+ stack?.anchorStart(link) || 0;
+ }
+ } else {
+ this.links
+ .filter((l) => l.anchor1 === link || l.anchor2 === link)
+ .forEach((l) => {
+ const { la1, la2 } = this.getLinkData(l);
+ const startTime = stack?.anchorStart(la1) || stack?.anchorStart(la2);
+ const endTime = stack?.anchorEnd(la1) || stack?.anchorEnd(la2);
+ if (startTime !== undefined) {
+ if (!this.layoutDoc.dontAutoPlayFollowedLinks) {
+ endTime
+ ? this.playFrom(startTime, endTime)
+ : this.playFrom(startTime);
+ } else {
+ this._ele!.currentTime = this.layoutDoc._currentTimecode =
+ startTime;
+ }
+ }
+ });
}
- else {
- this.links.filter(l => l.anchor1 === link || l.anchor2 === link).forEach(l => {
- const { la1, la2 } = this.getLinkData(l);
- const startTime = stack?.anchorStart(la1) || stack?.anchorStart(la2);
- const endTime = stack?.anchorEnd(la1) || stack?.anchorEnd(la2);
- if (startTime !== undefined) {
- if (!this.layoutDoc.dontAutoPlayFollowedLinks) endTime ? this.playFrom(startTime, endTime) : this.playFrom(startTime);
- else this._ele!.currentTime = this.layoutDoc._currentTimecode = startTime;
- }
- });
+ }
+
+ // shows trim controls
+ @action
+ startTrim = () => {
+ if (!this.duration) {
+ this.timecodeChanged();
}
+ if (this.mediaState === "playing") {
+ this.Pause();
+ }
+ this._trimming = true;
+ }
+
+ // hides trim controls and displays new clip
+ @action
+ finishTrim = () => {
+ if (this.mediaState === "playing") {
+ this.Pause();
+ }
+ this.layoutDoc.clipStart = this._trimStart;
+ this.layoutDoc.clipEnd = this._trimEnd;
+ this._trimming = false;
+ this.setAnchorTime(Math.max(Math.min(this._trimEnd, this._ele!.currentTime), this._trimStart));
+ }
+
+ @action
+ setStartTrim = (newStart: number) => {
+ this._trimStart = newStart;
+ }
+
+ @action
+ setEndTrim = (newEnd: number) => {
+ this._trimEnd = newEnd;
}
isActiveChild = () => this._isAnyChildContentActive;
- timelineWhenChildContentsActiveChanged = (isActive: boolean) => this.props.whenChildContentsActiveChanged(runInAction(() => this._isAnyChildContentActive = isActive));
- timelineScreenToLocal = () => this.props.ScreenToLocalTransform().translate(-AudioBox.playheadWidth, -(100 - this.heightPercent) / 200 * this.props.PanelHeight());
- setAnchorTime = (time: number) => this._ele!.currentTime = this.layoutDoc._currentTimecode = time;
- timelineHeight = () => this.props.PanelHeight() * this.heightPercent / 100 * this.heightPercent / 100; // panelHeight * heightPercent is player height. * heightPercent is timeline height (as per css inline)
+ timelineWhenChildContentsActiveChanged = (isActive: boolean) =>
+ this.props.whenChildContentsActiveChanged(
+ runInAction(() => (this._isAnyChildContentActive = isActive))
+ )
+ timelineScreenToLocal = () =>
+ this.props
+ .ScreenToLocalTransform()
+ .translate(
+ -AudioBox.playheadWidth,
+ (-(100 - this.heightPercent) / 200) * this.props.PanelHeight()
+ )
+ setAnchorTime = (time: number) => {
+ (this._ele!.currentTime = this.layoutDoc._currentTimecode = time);
+ }
+
+ timelineHeight = () =>
+ (((this.props.PanelHeight() * this.heightPercent) / 100) *
+ this.heightPercent) /
+ 100 // panelHeight * heightPercent is player height. * heightPercent is timeline height (as per css inline)
timelineWidth = () => this.props.PanelWidth() - AudioBox.playheadWidth;
@computed get renderTimeline() {
- return <CollectionStackedTimeline ref={this._stackedTimeline} {...this.props}
- fieldKey={this.annotationKey}
- dictationKey={this.fieldKey + "-dictation"}
- mediaPath={this.path}
- renderDepth={this.props.renderDepth + 1}
- startTag={"_timecodeToShow" /* audioStart */}
- endTag={"_timecodeToHide" /* audioEnd */}
- focus={DocUtils.DefaultFocus}
- bringToFront={emptyFunction}
- CollectionView={undefined}
- duration={this.duration}
- playFrom={this.playFrom}
- setTime={this.setAnchorTime}
- playing={this.playing}
- whenChildContentsActiveChanged={this.timelineWhenChildContentsActiveChanged}
- removeDocument={this.removeDocument}
- ScreenToLocalTransform={this.timelineScreenToLocal}
- Play={this.Play}
- Pause={this.Pause}
- isContentActive={this.isContentActive}
- playLink={this.playLink}
- PanelWidth={this.timelineWidth}
- PanelHeight={this.timelineHeight}
- />;
+ return (
+ <CollectionStackedTimeline
+ ref={this._stackedTimeline}
+ {...this.props}
+ fieldKey={this.annotationKey}
+ dictationKey={this.fieldKey + "-dictation"}
+ mediaPath={this.path}
+ renderDepth={this.props.renderDepth + 1}
+ startTag={"_timecodeToShow" /* audioStart */}
+ endTag={"_timecodeToHide" /* audioEnd */}
+ focus={DocUtils.DefaultFocus}
+ bringToFront={emptyFunction}
+ CollectionView={undefined}
+ duration={this.duration}
+ playFrom={this.playFrom}
+ setTime={this.setAnchorTime}
+ playing={this.playing}
+ whenChildContentsActiveChanged={
+ this.timelineWhenChildContentsActiveChanged
+ }
+ moveDocument={this.moveDocument}
+ addDocument={this.addDocument}
+ removeDocument={this.removeDocument}
+ ScreenToLocalTransform={this.timelineScreenToLocal}
+ Play={this.Play}
+ Pause={this.Pause}
+ isContentActive={this.props.isContentActive}
+ isAnyChildContentActive={this.isAnyChildContentActive}
+ playLink={this.playLink}
+ PanelWidth={this.timelineWidth}
+ PanelHeight={this.timelineHeight}
+ trimming={this._trimming}
+ trimStart={this._trimStart}
+ trimEnd={this._trimEnd}
+ trimDuration={this.trimDuration}
+ setStartTrim={this.setStartTrim}
+ setEndTrim={this.setEndTrim}
+ />
+ );
}
render() {
- const interactive = SnappingManager.GetIsDragging() || this.isContentActive() ? "-interactive" : "";
- return <div className="audiobox-container"
- onContextMenu={this.specificContextMenu}
- onClick={!this.path && !this._recorder ? this.recordAudioAnnotation : undefined}
- style={{ pointerEvents: this.props.layerProvider?.(this.layoutDoc) === false ? "none" : undefined }}>
- {!this.path ?
- <div className="audiobox-buttons">
- <div className="audiobox-dictation" onClick={this.onFile}>
- <FontAwesomeIcon style={{ width: "30px", background: !this.layoutDoc.dontAutoPlayFollowedLinks ? "yellow" : "rgba(0,0,0,0)" }} icon="file-alt" size={this.props.PanelHeight() < 36 ? "1x" : "2x"} />
- </div>
- {this.mediaState === "recording" || this.mediaState === "paused" ?
- <div className="recording" onClick={e => e.stopPropagation()}>
- <div className="buttons" onClick={this.recordClick}>
- <FontAwesomeIcon icon={"stop"} size={this.props.PanelHeight() < 36 ? "1x" : "2x"} />
+ const interactive =
+ SnappingManager.GetIsDragging() || this.props.isContentActive()
+ ? "-interactive"
+ : "";
+ return (
+ <div
+ className="audiobox-container"
+ onContextMenu={this.specificContextMenu}
+ onClick={
+ !this.path && !this._recorder ? this.recordAudioAnnotation : undefined
+ }
+ style={{
+ pointerEvents:
+ this.props.layerProvider?.(this.layoutDoc) === false
+ ? "none"
+ : undefined,
+ }}
+ >
+ {!this.path ? (
+ <div className="audiobox-buttons">
+ <div className="audiobox-dictation" onClick={this.onFile}>
+ <FontAwesomeIcon
+ style={{
+ width: "30px"
+ }}
+ icon="file-alt"
+ size={this.props.PanelHeight() < 36 ? "1x" : "2x"}
+ />
+ </div>
+ {this.mediaState === "recording" || this.mediaState === "paused" ? (
+ <div className="recording" onClick={(e) => e.stopPropagation()}>
+ <div className="recording-buttons" onClick={this.recordClick}>
+ <FontAwesomeIcon
+ icon={"stop"}
+ size={this.props.PanelHeight() < 36 ? "1x" : "2x"}
+ />
+ </div>
+ <div
+ className="recording-buttons"
+ onClick={this._paused ? this.recordPlay : this.recordPause}
+ >
+ <FontAwesomeIcon
+ icon={this._paused ? "play" : "pause"}
+ size={this.props.PanelHeight() < 36 ? "1x" : "2x"}
+ />
+ </div>
+ <div className="time">
+ {formatTime(
+ Math.round(NumCast(this.layoutDoc._currentTimecode))
+ )}
+ </div>
</div>
- <div className="buttons" onClick={this._paused ? this.recordPlay : this.recordPause}>
- <FontAwesomeIcon icon={this._paused ? "play" : "pause"} size={this.props.PanelHeight() < 36 ? "1x" : "2x"} />
+ ) : (
+ <div
+ className={`audiobox-record${interactive}`}
+ style={{ backgroundColor: Colors.DARK_GRAY }}
+ >
+ <FontAwesomeIcon icon="microphone" />
+ RECORD
+ </div>
+ )}
+ </div>
+ ) : (
+ <div
+ className="audiobox-controls"
+ style={{
+ pointerEvents:
+ this._isAnyChildContentActive || this.props.isContentActive()
+ ? "all"
+ : "none",
+ }}
+ >
+ <div className="audiobox-dictation" />
+ <div
+ className="audiobox-player"
+ style={{ height: `${AudioBox.heightPercent}%` }}
+ >
+ <div
+ className="audiobox-buttons"
+ title={this.mediaState === "paused" ? "play" : "pause"}
+ onClick={this.mediaState === "paused" ? this.Play : this.Pause}
+ >
+ {" "}
+ <FontAwesomeIcon
+ icon={this.mediaState === "paused" ? "play" : "pause"}
+ size={"1x"}
+ />
+ </div>
+ <div
+ className="audiobox-buttons"
+ title={this._trimming ? "finish" : "trim"}
+ onClick={this._trimming ? this.finishTrim : this.startTrim}
+ >
+ <FontAwesomeIcon
+ icon={this._trimming ? "check" : "cut"}
+ size={"1x"}
+ />
+ </div>
+ <div
+ className="audiobox-timeline"
+ style={{
+ top: 0,
+ height: `100%`,
+ left: AudioBox.playheadWidth,
+ width: `calc(100% - ${AudioBox.playheadWidth}px)`,
+ background: "white",
+ }}
+ >
+ {this.renderTimeline}
+ </div>
+ {this.audio}
+ <div className="audioBox-current-time">
+ {this._trimming ?
+ formatTime(Math.round(NumCast(this.layoutDoc._currentTimecode)))
+ : formatTime(Math.round(NumCast(this.layoutDoc._currentTimecode) - NumCast(this._trimStart)))}
+ </div>
+ <div className="audioBox-total-time">
+ {this._trimming || !this._trimEnd ?
+ formatTime(Math.round(NumCast(this.duration)))
+ : formatTime(Math.round(NumCast(this.trimDuration)))}
+ </div>
</div>
- <div className="time">{formatTime(Math.round(NumCast(this.layoutDoc._currentTimecode)))}</div>
</div>
- :
- <button className={`audiobox-record${interactive}`} style={{ backgroundColor: "black" }}>
- RECORD
- </button>}
- </div> :
- <div className="audiobox-controls" style={{ pointerEvents: this._isAnyChildContentActive || this.isContentActive() ? "all" : "none" }} >
- <div className="audiobox-dictation" />
- <div className="audiobox-player" style={{ height: `${AudioBox.heightPercent}%` }} >
- <div className="audiobox-playhead" style={{ width: AudioBox.playheadWidth }} title={this.mediaState === "paused" ? "play" : "pause"} onClick={this.Play}> <FontAwesomeIcon style={{ width: "100%", position: "absolute", left: "0px", top: "5px", borderWidth: "thin", borderColor: "white" }} icon={this.mediaState === "paused" ? "play" : "pause"} size={"1x"} /></div>
- <div className="audiobox-timeline" style={{ top: 0, height: `100%`, left: AudioBox.playheadWidth, width: `calc(100% - ${AudioBox.playheadWidth}px)`, background: "white" }}>
- {this.renderTimeline}
- </div>
- {this.audio}
- <div className="audioBox-current-time">
- {formatTime(Math.round(NumCast(this.layoutDoc._currentTimecode)))}
- </div>
- <div className="audioBox-total-time">
- {formatTime(Math.round(this.duration))}
- </div>
- </div>
- </div>
- }
- </div>;
+ )}
+ </div>
+ );
}
-} \ No newline at end of file
+}
diff --git a/src/client/views/nodes/CollectionFreeFormDocumentView.tsx b/src/client/views/nodes/CollectionFreeFormDocumentView.tsx
index 092823603..9cc4b1f9a 100644
--- a/src/client/views/nodes/CollectionFreeFormDocumentView.tsx
+++ b/src/client/views/nodes/CollectionFreeFormDocumentView.tsx
@@ -17,8 +17,8 @@ import { InkingStroke } from "../InkingStroke";
import { StyleProp } from "../StyleProvider";
import "./CollectionFreeFormDocumentView.scss";
import { DocumentView, DocumentViewProps } from "./DocumentView";
-import { FieldViewProps } from "./FieldView";
import React = require("react");
+import Color = require("color");
export interface CollectionFreeFormDocumentViewProps extends DocumentViewProps {
dataProvider?: (doc: Doc, replica: string) => { x: number, y: number, zIndex?: number, opacity?: number, highlight?: boolean, z: number, transition?: string } | undefined;
@@ -164,6 +164,8 @@ export class CollectionFreeFormDocumentView extends DocComponent<CollectionFreeF
PanelWidth: this.panelWidth,
PanelHeight: this.panelHeight,
};
+ const background = this.props.styleProvider?.(this.rootDoc, this.props, StyleProp.BackgroundColor);
+ const mixBlendMode = StrCast(this.layoutDoc.mixBlendMode) as any || (background && Color(background).alpha() !== 1 ? "multiply" : undefined);
return <div className={"collectionFreeFormDocumentView-container"}
style={{
outline: this.Highlight ? "orange solid 2px" : "",
@@ -172,7 +174,7 @@ export class CollectionFreeFormDocumentView extends DocComponent<CollectionFreeF
transform: this.transform,
transition: this.props.dataTransition ? this.props.dataTransition : this.dataProvider ? this.dataProvider.transition : StrCast(this.layoutDoc.dataTransition),
zIndex: this.ZInd,
- mixBlendMode: StrCast(this.layoutDoc.mixBlendMode) as any,
+ mixBlendMode,
display: this.ZInd === -99 ? "none" : undefined
}} >
<DocumentView {...divProps} ref={action((r: DocumentView | null) => this._contentView = r)} />
diff --git a/src/client/views/nodes/ComparisonBox.tsx b/src/client/views/nodes/ComparisonBox.tsx
index 153176afc..6708a08ee 100644
--- a/src/client/views/nodes/ComparisonBox.tsx
+++ b/src/client/views/nodes/ComparisonBox.tsx
@@ -1,17 +1,18 @@
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome';
import { action, observable } from 'mobx';
import { observer } from "mobx-react";
-import { Doc } from '../../../fields/Doc';
+import { Doc, Opt } from '../../../fields/Doc';
import { documentSchema } from '../../../fields/documentSchemas';
import { createSchema, makeInterface } from '../../../fields/Schema';
import { Cast, NumCast, StrCast } from '../../../fields/Types';
-import { emptyFunction, OmitKeys, setupMoveUpEvents } from '../../../Utils';
+import { emptyFunction, OmitKeys, returnFalse, setupMoveUpEvents } from '../../../Utils';
import { DragManager } from '../../util/DragManager';
import { SnappingManager } from '../../util/SnappingManager';
import { undoBatch } from '../../util/UndoManager';
import { ViewBoxAnnotatableComponent, ViewBoxAnnotatableProps } from '../DocComponent';
+import { StyleProp } from '../StyleProvider';
import "./ComparisonBox.scss";
-import { DocumentView } from './DocumentView';
+import { DocumentView, DocumentViewProps } from './DocumentView';
import { FieldView, FieldViewProps } from './FieldView';
import React = require("react");
@@ -71,6 +72,11 @@ export class ComparisonBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatabl
delete this.dataDoc[fieldKey];
}
+ docStyleProvider = (doc: Opt<Doc>, props: Opt<DocumentViewProps>, property: string): any => {
+ if (property === StyleProp.PointerEvents) return "none";
+ return this.props.styleProvider?.(doc, props, property);
+ }
+
render() {
const clipWidth = NumCast(this.layoutDoc._clipWidth) + "%";
const clearButton = (which: string) => {
@@ -84,6 +90,9 @@ export class ComparisonBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatabl
const whichDoc = Cast(this.dataDoc[`compareBox-${which}`], Doc, null);
return whichDoc ? <>
<DocumentView {...OmitKeys(this.props, ["NativeWidth", "NativeHeight"]).omit}
+ isContentActive={returnFalse}
+ isDocumentActive={returnFalse}
+ styleProvider={this.docStyleProvider}
Document={whichDoc}
DataDoc={undefined}
pointerEvents={"none"} />
@@ -102,7 +111,7 @@ export class ComparisonBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatabl
};
return (
- <div className={`comparisonBox${this.isContentActive() || SnappingManager.GetIsDragging() ? "-interactive" : ""}` /* change className to easily disable/enable pointer events in CSS */}>
+ <div className={`comparisonBox${this.props.isContentActive() || SnappingManager.GetIsDragging() ? "-interactive" : ""}` /* change className to easily disable/enable pointer events in CSS */}>
{displayBox("after", 1, this.props.PanelWidth() - 3)}
<div className="clip-div" style={{ width: clipWidth, transition: this._animating, background: StrCast(this.layoutDoc._backgroundColor, "gray") }}>
{displayBox("before", 0, 0)}
diff --git a/src/client/views/nodes/DocumentContentsView.tsx b/src/client/views/nodes/DocumentContentsView.tsx
index b6fc04b73..005133eb0 100644
--- a/src/client/views/nodes/DocumentContentsView.tsx
+++ b/src/client/views/nodes/DocumentContentsView.tsx
@@ -23,7 +23,7 @@ import "./DocumentView.scss";
import { EquationBox } from "./EquationBox";
import { FieldView, FieldViewProps } from "./FieldView";
import { FilterBox } from "./FilterBox";
-import { FontIconBox } from "./FontIconBox";
+import { FontIconBox } from "./button/FontIconBox";
import { FormattedTextBox, FormattedTextBoxProps } from "./formattedText/FormattedTextBox";
import { FunctionPlotBox } from "./FunctionPlotBox";
import { ImageBox } from "./ImageBox";
@@ -114,7 +114,6 @@ export class DocumentContentsView extends React.Component<DocumentViewProps & Fo
scaling?: () => number,
setHeight: (height: number) => void,
layoutKey: string,
- hideOnLeave?: boolean,
}> {
@computed get layout(): string {
TraceMobx();
@@ -202,7 +201,8 @@ export class DocumentContentsView extends React.Component<DocumentViewProps & Fo
if (splits.length > 1) {
const code = XRegExp.matchRecursive(splits[1], "{", "}", "", { valueNames: ["between", "left", "match", "right", "between"] });
layoutFrame = splits[0] + ` ${func}={props.${func}} ` + splits[1].substring(code[1].end + 1);
- return ScriptField.MakeScript(code[1].value, { this: Doc.name, self: Doc.name, scale: "number", value: "string" });
+ const script = code[1].value.replace(/^‘/, "").replace(/’$/, ""); // ‘’ are not valid quotes in javascript so get rid of them -- they may be present to make it easier to write complex scripts - see headerTemplate in currentUserUtils.ts
+ return ScriptField.MakeScript(script, { this: Doc.name, self: Doc.name, scale: "number", value: "string" });
}
return undefined;
// add input function to props
diff --git a/src/client/views/nodes/DocumentLinksButton.scss b/src/client/views/nodes/DocumentLinksButton.scss
index b37b68249..228e1bdcb 100644
--- a/src/client/views/nodes/DocumentLinksButton.scss
+++ b/src/client/views/nodes/DocumentLinksButton.scss
@@ -50,6 +50,7 @@
width: 80%;
height: 80%;
font-size: 100%;
+ font-family: 'Roboto';
transition: 0.2s ease all;
&:hover {
diff --git a/src/client/views/nodes/DocumentLinksButton.tsx b/src/client/views/nodes/DocumentLinksButton.tsx
index 7648e866e..93cd02d93 100644
--- a/src/client/views/nodes/DocumentLinksButton.tsx
+++ b/src/client/views/nodes/DocumentLinksButton.tsx
@@ -2,25 +2,24 @@ import { FontAwesomeIcon } from "@fortawesome/react-fontawesome";
import { Tooltip } from "@material-ui/core";
import { action, computed, observable, runInAction } from "mobx";
import { observer } from "mobx-react";
-import { Doc, DocListCast, Opt, WidthSym, DocListCastAsync } from "../../../fields/Doc";
-import { emptyFunction, setupMoveUpEvents, returnFalse, Utils, emptyPath } from "../../../Utils";
+import { Doc, DocListCast, DocListCastAsync, Opt, WidthSym } from "../../../fields/Doc";
+import { Id } from "../../../fields/FieldSymbols";
+import { Cast, StrCast } from "../../../fields/Types";
import { TraceMobx } from "../../../fields/util";
-import { DocUtils, Docs } from "../../documents/Documents";
+import { emptyFunction, returnFalse, setupMoveUpEvents } from "../../../Utils";
+import { DocServer } from "../../DocServer";
+import { Docs, DocUtils } from "../../documents/Documents";
import { DragManager } from "../../util/DragManager";
+import { Hypothesis } from "../../util/HypothesisUtils";
import { LinkManager } from "../../util/LinkManager";
import { undoBatch, UndoManager } from "../../util/UndoManager";
+import { Colors } from "../global/globalEnums";
+import { LightboxView } from "../LightboxView";
+import './DocumentLinksButton.scss';
import { DocumentView } from "./DocumentView";
-import { StrCast, Cast } from "../../../fields/Types";
import { LinkDescriptionPopup } from "./LinkDescriptionPopup";
-import { Hypothesis } from "../../util/HypothesisUtils";
-import { Id } from "../../../fields/FieldSymbols";
import { TaskCompletionBox } from "./TaskCompletedBox";
import React = require("react");
-import './DocumentLinksButton.scss';
-import { DocServer } from "../../DocServer";
-import { LightboxView } from "../LightboxView";
-import { cat } from "shelljs";
-import { Colors } from "../global/globalEnums";
const higflyout = require("@hig/flyout");
export const { anchorPoints } = higflyout;
@@ -266,6 +265,7 @@ export class DocumentLinksButton extends React.Component<DocumentLinksButtonProp
style={{
backgroundColor: Colors.LIGHT_BLUE,
color: Colors.BLACK,
+ fontSize: "20px",
width: btnDim,
height: btnDim,
}}>
diff --git a/src/client/views/nodes/DocumentView.tsx b/src/client/views/nodes/DocumentView.tsx
index a29f2f662..e8a78d75c 100644
--- a/src/client/views/nodes/DocumentView.tsx
+++ b/src/client/views/nodes/DocumentView.tsx
@@ -13,7 +13,7 @@ import { BoolCast, Cast, NumCast, ScriptCast, StrCast } from "../../../fields/Ty
import { AudioField } from "../../../fields/URLField";
import { GetEffectiveAcl, SharingPermissions, TraceMobx } from '../../../fields/util';
import { MobileInterface } from '../../../mobile/MobileInterface';
-import { emptyFunction, hasDescendantTarget, OmitKeys, returnVal, Utils, returnTrue } from "../../../Utils";
+import { emptyFunction, hasDescendantTarget, OmitKeys, returnTrue, returnVal, Utils, lightOrDark, simulateMouseClick } from "../../../Utils";
import { GooglePhotos } from '../../apis/google_docs/GooglePhotosClientUtils';
import { Docs, DocUtils } from "../../documents/Documents";
import { DocumentType } from '../../documents/DocumentTypes';
@@ -25,6 +25,7 @@ import { InteractionUtils } from '../../util/InteractionUtils';
import { LinkManager } from '../../util/LinkManager';
import { Scripting } from '../../util/Scripting';
import { SelectionManager } from "../../util/SelectionManager";
+import { ColorScheme } from "../../util/SettingsManager";
import { SharingManager } from '../../util/SharingManager';
import { SnappingManager } from '../../util/SnappingManager';
import { Transform } from "../../util/Transform";
@@ -41,13 +42,14 @@ import { CollectionFreeFormDocumentView } from "./CollectionFreeFormDocumentView
import { DocumentContentsView } from "./DocumentContentsView";
import { DocumentLinksButton } from './DocumentLinksButton';
import "./DocumentView.scss";
+import { FormattedTextBox } from "./formattedText/FormattedTextBox";
import { LinkAnchorBox } from './LinkAnchorBox';
import { LinkDocPreview } from "./LinkDocPreview";
-import { PresBox } from './trails/PresBox';
import { RadialMenu } from './RadialMenu';
-import React = require("react");
import { ScriptingBox } from "./ScriptingBox";
-import { FormattedTextBox } from "./formattedText/FormattedTextBox";
+import { PresBox } from './trails/PresBox';
+import React = require("react");
+import { IconProp } from "@fortawesome/fontawesome-svg-core";
const { Howl } = require('howler');
interface Window {
@@ -84,10 +86,16 @@ export interface DocComponentView {
reverseNativeScaling?: () => boolean; // DocumentView's setup screenToLocal based on the doc having a nativeWidth/Height. However, some content views (e.g., FreeFormView w/ fitToBox set) may ignore the native dimensions so this flags the DocumentView to not do Nativre scaling.
shrinkWrap?: () => void; // requests a document to display all of its contents with no white space. currently only implemented (needed?) for freeform views
menuControls?: () => JSX.Element; // controls to display in the top menu bar when the document is selected.
+ isAnyChildContentActive?: () => boolean; // is any child content of the document active
getKeyFrameEditing?: () => boolean; // whether the document is in keyframe editing mode (if it is, then all hidden documents that are not active at the keyframe time will still be shown)
setKeyFrameEditing?: (set: boolean) => void; // whether the document is in keyframe editing mode (if it is, then all hidden documents that are not active at the keyframe time will still be shown)
playFrom?: (time: number, endTime?: number) => void;
setFocus?: () => void;
+ componentUI?: (boundsLeft: number, boundsTop: number) => JSX.Element;
+ fieldKey?: string;
+ annotationKey?: string;
+ getTitle?: () => string;
+ getScrollHeight?: () => number;
}
export interface DocumentViewSharedProps {
renderDepth: number;
@@ -108,6 +116,7 @@ export interface DocumentViewSharedProps {
docFilters: () => string[];
docRangeFilters: () => string[];
searchFilterDocs: () => Doc[];
+ showTitle?: () => string;
whenChildContentsActiveChanged: (isActive: boolean) => void;
rootSelected: (outsideReaction?: boolean) => boolean; // whether the root of a template has been selected
addDocTab: (doc: Doc, where: string) => boolean;
@@ -132,7 +141,7 @@ export interface DocumentViewSharedProps {
export interface DocumentViewProps extends DocumentViewSharedProps {
// properties specific to DocumentViews but not to FieldView
freezeDimensions?: boolean;
- hideResizeHandles?: boolean; // whether to suppress DocumentDecorations when this document is selected
+ hideResizeHandles?: boolean; // whether to suppress DocumentDecorations when this document is selected
hideTitle?: boolean; // forces suppression of title. e.g, treeView document labels suppress titles in case they are globally active via settings
hideDecorationTitle?: boolean; // forces suppression of title. e.g, treeView document labels suppress titles in case they are globally active via settings
treeViewDoc?: Doc;
@@ -146,7 +155,7 @@ export interface DocumentViewProps extends DocumentViewSharedProps {
NativeWidth?: () => number;
NativeHeight?: () => number;
LayoutTemplate?: () => Opt<Doc>;
- contextMenuItems?: () => { script: ScriptField, label: string }[];
+ contextMenuItems?: () => { script: ScriptField, filter?: ScriptField, label: string, icon: string }[];
onClick?: () => ScriptField;
onDoubleClick?: () => ScriptField;
onPointerDown?: () => ScriptField;
@@ -180,9 +189,9 @@ export class DocumentViewInternal extends DocComponent<DocumentViewInternalProps
private _dropDisposer?: DragManager.DragDropDisposer;
private _holdDisposer?: InteractionUtils.MultiTouchEventDisposer;
protected _multiTouchDisposer?: InteractionUtils.MultiTouchEventDisposer;
- _componentView: Opt<DocComponentView>; // needs to be accessed from DocumentView wrapper class
+ @observable _componentView: Opt<DocComponentView>; // needs to be accessed from DocumentView wrapper class
- private get topMost() { return this.props.renderDepth === 0; }
+ private get topMost() { return this.props.renderDepth === 0 && !LightboxView.LightboxDoc; }
public get displayName() { return "DocumentView(" + this.props.Document.title + ")"; } // this makes mobx trace() statements more descriptive
public get ContentDiv() { return this._mainCont.current; }
public get LayoutFieldKey() { return Doc.LayoutFieldKey(this.layoutDoc); }
@@ -202,7 +211,7 @@ export class DocumentViewInternal extends DocComponent<DocumentViewInternalProps
@computed get finalLayoutKey() { return StrCast(this.Document.layoutKey, "layout"); }
@computed get nativeWidth() { return this.props.NativeWidth(); }
@computed get nativeHeight() { return this.props.NativeHeight(); }
- @computed get onClickHandler() { return this.props.onClick?.() ?? Cast(this.Document.onfClick, ScriptField, Cast(this.layoutDoc.onClick, ScriptField, null)); }
+ @computed get onClickHandler() { return this.props.onClick?.() ?? Cast(this.Document.onClick, ScriptField, Cast(this.layoutDoc.onClick, ScriptField, null)); }
@computed get onDoubleClickHandler() { return this.props.onDoubleClick?.() ?? (Cast(this.layoutDoc.onDoubleClick, ScriptField, null) ?? this.Document.onDoubleClick); }
@computed get onPointerDownHandler() { return this.props.onPointerDown?.() ?? ScriptCast(this.Document.onPointerDown); }
@computed get onPointerUpHandler() { return this.props.onPointerUp?.() ?? ScriptCast(this.Document.onPointerUp); }
@@ -426,7 +435,7 @@ export class DocumentViewInternal extends DocComponent<DocumentViewInternalProps
});
// after a timeout, the right _componentView should have been created, so call it to update its view spec values
setTimeout(() => this._componentView?.setViewSpec?.(anchor, LinkDocPreview.LinkInfo ? true : false));
- const focusSpeed = this._componentView?.scrollFocus?.(anchor, !LinkDocPreview.LinkInfo); // bcz: smooth parameter should really be passed into focus() instead of inferred here
+ const focusSpeed = this._componentView?.scrollFocus?.(anchor, !LinkDocPreview.LinkInfo); // bcz: smooth parameter should really be passed into focus() instead of inferred here
const endFocus = focusSpeed === undefined ? options?.afterFocus : async (moved: boolean) => options?.afterFocus ? options?.afterFocus(true) : ViewAdjustment.doNothing;
this.props.focus(options?.docTransform ? anchor : this.rootDoc, {
...options, afterFocus: (didFocus: boolean) =>
@@ -459,7 +468,6 @@ export class DocumentViewInternal extends DocComponent<DocumentViewInternalProps
} else if (!Doc.IsSystem(this.rootDoc)) {
UndoManager.RunInBatch(() =>
LightboxView.AddDocTab(this.rootDoc, "lightbox", this.props.LayoutTemplate?.())
- //this.props.addDocTab((this.rootDoc._fullScreenView as Doc) || this.rootDoc, "lightbox")
, "double tap");
SelectionManager.DeselectAll();
Doc.UnBrushDoc(this.props.Document);
@@ -521,19 +529,20 @@ export class DocumentViewInternal extends DocComponent<DocumentViewInternalProps
// don't preventDefault anymore. Goldenlayout, PDF text selection and RTF text selection all need it to go though
//if (this.props.isSelected(true) && this.rootDoc.type !== DocumentType.PDF && this.layoutDoc._viewType !== CollectionViewType.Docking) e.preventDefault();
}
- document.removeEventListener("pointermove", this.onPointerMove);
+ if (this.props.isDocumentActive?.()) {
+ document.removeEventListener("pointermove", this.onPointerMove);
+ document.addEventListener("pointermove", this.onPointerMove);
+ }
document.removeEventListener("pointerup", this.onPointerUp);
- document.addEventListener("pointermove", this.onPointerMove);
document.addEventListener("pointerup", this.onPointerUp);
}
}
onPointerMove = (e: PointerEvent): void => {
+ if (e.cancelBubble) return;
if ((InteractionUtils.IsType(e, InteractionUtils.PENTYPE) || [InkTool.Highlighter, InkTool.Pen].includes(CurrentUserUtils.SelectedTool))) return;
- if (e.cancelBubble && this.props.isDocumentActive?.()) {
- document.removeEventListener("pointermove", this.onPointerMove); // stop listening to pointerMove if something else has stopPropagated it (e.g., the MarqueeView)
- }
- else if (!e.cancelBubble && (this.props.isDocumentActive?.() || this.layoutDoc.onDragStart) && !this.layoutDoc._lockedPosition && !CurrentUserUtils.OverlayDocs.includes(this.layoutDoc)) {
+
+ if ((this.props.isDocumentActive?.() || this.layoutDoc.onDragStart) && !this.layoutDoc._lockedPosition && !CurrentUserUtils.OverlayDocs.includes(this.layoutDoc)) {
if (Math.abs(this._downX - e.clientX) > 3 || Math.abs(this._downY - e.clientY) > 3) {
if (!e.altKey && (!this.topMost || this.layoutDoc.onDragStart || this.onClickHandler) && (e.buttons === 1 || InteractionUtils.IsType(e, InteractionUtils.TOUCHTYPE))) {
document.removeEventListener("pointermove", this.onPointerMove);
@@ -600,7 +609,7 @@ export class DocumentViewInternal extends DocComponent<DocumentViewInternalProps
}
@undoBatch deleteClicked = () => this.props.removeDocument?.(this.props.Document);
- @undoBatch toggleDetail = () => this.Document.onClick = ScriptField.MakeScript(`toggleDetail(self, "${this.Document.layoutKey}")`);
+ @undoBatch setToggleDetail = () => this.Document.onClick = ScriptField.MakeScript(`toggleDetail(documentView, "${StrCast(this.Document.layoutKey).replace("layout_", "")}")`, { documentView: "any" });
@undoBatch @action
drop = async (e: Event, de: DragManager.DropEvent) => {
@@ -630,7 +639,7 @@ export class DocumentViewInternal extends DocComponent<DocumentViewInternalProps
makeIntoPortal = async () => {
const portalLink = this.allLinks.find(d => d.anchor1 === this.props.Document);
if (!portalLink) {
- const portal = Docs.Create.FreeformDocument([], { _width: NumCast(this.layoutDoc._width) + 10, _height: NumCast(this.layoutDoc._height), _fitWidth: true, title: StrCast(this.props.Document.title) + ".portal" });
+ const portal = Docs.Create.FreeformDocument([], { _width: NumCast(this.layoutDoc._width) + 10, _height: NumCast(this.layoutDoc._height), _fitWidth: true, title: StrCast(this.props.Document.title) + " [Portal]" });
DocUtils.MakeLink({ doc: this.props.Document }, { doc: portal }, "portal to");
}
this.Document.followLinkLocation = "inPlace";
@@ -643,7 +652,7 @@ export class DocumentViewInternal extends DocComponent<DocumentViewInternalProps
if (e && this.rootDoc._hideContextMenu && Doc.UserDoc().noviceMode) {
e.preventDefault();
e.stopPropagation();
- !this.props.isSelected(true) && SelectionManager.SelectView(this.props.DocumentView(), false);
+ //!this.props.isSelected(true) && SelectionManager.SelectView(this.props.DocumentView(), false);
}
// the touch onContextMenu is button 0, the pointer onContextMenu is button 2
if (e) {
@@ -663,18 +672,35 @@ export class DocumentViewInternal extends DocComponent<DocumentViewInternalProps
const cm = ContextMenu.Instance;
if (!cm || (e as any)?.nativeEvent?.SchemaHandled) return;
+ if (e && !(e.nativeEvent as any).dash) {
+ const onDisplay = () => setTimeout(() => {
+ DocumentViewInternal.SelectAfterContextMenu && !this.props.isSelected(true) && SelectionManager.SelectView(this.props.DocumentView(), false); // on a mac, the context menu is triggered on mouse down, but a YouTube video becaomes interactive when selected which means that the context menu won't show up. by delaying the selection until hopefully after the pointer up, the context menu will appear.
+ setTimeout(() => {
+ const ele = document.elementFromPoint(e.clientX, e.clientY);
+ simulateMouseClick(ele, e.clientX, e.clientY, e.screenX, e.screenY);
+ });
+ });
+ if (navigator.userAgent.includes("Macintosh")) {
+ cm.displayMenu((e?.pageX || pageX || 0) - 15, (e?.pageY || pageY || 0) - 15, undefined, undefined, onDisplay);
+ }
+ else {
+ onDisplay();
+ }
+ return;
+ }
+
const customScripts = Cast(this.props.Document.contextMenuScripts, listSpec(ScriptField), []);
StrListCast(this.Document.contextMenuLabels).forEach((label, i) =>
cm.addItem({ description: label, event: () => customScripts[i]?.script.run({ documentView: this, this: this.layoutDoc, scriptContext: this.props.scriptContext, self: this.rootDoc }), icon: "sticky-note" }));
this.props.contextMenuItems?.().forEach(item =>
- item.label && cm.addItem({ description: item.label, event: () => item.script.script.run({ this: this.layoutDoc, scriptContext: this.props.scriptContext, self: this.rootDoc }), icon: "sticky-note" }));
+ item.label && cm.addItem({ description: item.label, event: () => item.script.script.run({ this: this.layoutDoc, scriptContext: this.props.scriptContext, self: this.rootDoc }), icon: item.icon as IconProp }));
if (!this.props.Document.isFolder) {
const templateDoc = Cast(this.props.Document[StrCast(this.props.Document.layoutKey)], Doc, null);
const appearance = cm.findByDescription("UI Controls...");
const appearanceItems: ContextMenuProps[] = appearance && "subitems" in appearance ? appearance.subitems : [];
!Doc.UserDoc().noviceMode && templateDoc && appearanceItems.push({ description: "Open Template ", event: () => this.props.addDocTab(templateDoc, "add:right"), icon: "eye" });
- appearanceItems.push({
+ !Doc.UserDoc().noviceMode && appearanceItems.push({
description: "Add a Field", event: () => {
const alias = Doc.MakeAlias(this.rootDoc);
alias.layout = FormattedTextBox.LayoutString("newfield");
@@ -698,13 +724,15 @@ export class DocumentViewInternal extends DocComponent<DocumentViewInternalProps
const zorders = cm.findByDescription("ZOrder...");
const zorderItems: ContextMenuProps[] = zorders && "subitems" in zorders ? zorders.subitems : [];
- zorderItems.push({ description: "Bring to Front", event: () => SelectionManager.Views().forEach(dv => dv.props.bringToFront(dv.rootDoc, false)), icon: "expand-arrows-alt" });
- zorderItems.push({ description: "Send to Back", event: () => SelectionManager.Views().forEach(dv => dv.props.bringToFront(dv.rootDoc, true)), icon: "expand-arrows-alt" });
- zorderItems.push({ description: this.rootDoc._raiseWhenDragged !== false ? "Keep ZIndex when dragged" : "Allow ZIndex to change when dragged", event: undoBatch(action(() => this.rootDoc._raiseWhenDragged = this.rootDoc._raiseWhenDragged === undefined ? false : undefined)), icon: "expand-arrows-alt" });
+ if (this.props.bringToFront !== emptyFunction) {
+ zorderItems.push({ description: "Bring to Front", event: () => SelectionManager.Views().forEach(dv => dv.props.bringToFront(dv.rootDoc, false)), icon: "expand-arrows-alt" });
+ zorderItems.push({ description: "Send to Back", event: () => SelectionManager.Views().forEach(dv => dv.props.bringToFront(dv.rootDoc, true)), icon: "expand-arrows-alt" });
+ zorderItems.push({ description: this.rootDoc._raiseWhenDragged !== false ? "Keep ZIndex when dragged" : "Allow ZIndex to change when dragged", event: undoBatch(action(() => this.rootDoc._raiseWhenDragged = this.rootDoc._raiseWhenDragged === undefined ? false : undefined)), icon: "expand-arrows-alt" });
+ }
!zorders && cm.addItem({ description: "ZOrder...", subitems: zorderItems, icon: "compass" });
onClicks.push({ description: "Enter Portal", event: this.makeIntoPortal, icon: "window-restore" });
- onClicks.push({ description: "Toggle Detail", event: () => this.Document.onClick = ScriptField.MakeScript(`toggleDetail(self, "${this.Document.layoutKey}")`), icon: "concierge-bell" });
+ !Doc.UserDoc().noviceMode && onClicks.push({ description: "Toggle Detail", event: this.setToggleDetail, icon: "concierge-bell" });
onClicks.push({ description: (this.Document.followLinkZoom ? "Don't" : "") + " zoom following link", event: () => this.Document.followLinkZoom = !this.Document.followLinkZoom, icon: this.Document.ignoreClick ? "unlock" : "lock" });
if (!this.Document.annotationOn) {
@@ -767,7 +795,6 @@ export class DocumentViewInternal extends DocComponent<DocumentViewInternalProps
if (!this.topMost) e?.stopPropagation(); // DocumentViews should stop propagation of this event
cm.displayMenu((e?.pageX || pageX || 0) - 15, (e?.pageY || pageY || 0) - 15);
- DocumentViewInternal.SelectAfterContextMenu && !this.props.isSelected(true) && setTimeout(() => SelectionManager.SelectView(this.props.DocumentView(), false), 300); // on a mac, the context menu is triggered on mouse down, but a YouTube video becaomes interactive when selected which means that the context menu won't show up. by delaying the selection until hopefully after the pointer up, the context menu will appear.
}
rootSelected = (outsideReaction?: boolean) => this.props.isSelected(outsideReaction) || (this.props.Document.rootDocument && this.props.rootSelected?.(outsideReaction)) || false;
@@ -776,8 +803,16 @@ export class DocumentViewInternal extends DocComponent<DocumentViewInternalProps
contentScaling = () => this.ContentScale;
onClickFunc = () => this.onClickHandler;
setHeight = (height: number) => this.layoutDoc._height = height;
- setContentView = (view: { getAnchor?: () => Doc, forward?: () => boolean, back?: () => boolean }) => this._componentView = view;
- isContentActive = (outsideReaction?: boolean) => this.props.isContentActive() ? true : false;
+ setContentView = action((view: { getAnchor?: () => Doc, forward?: () => boolean, back?: () => boolean }) => this._componentView = view);
+ isContentActive = (outsideReaction?: boolean) => {
+ return CurrentUserUtils.SelectedTool !== InkTool.None ||
+ SnappingManager.GetIsDragging() ||
+ this.props.rootSelected() ||
+ this.props.Document.forceActive ||
+ this.props.isSelected(outsideReaction) ||
+ this._componentView?.isAnyChildContentActive?.() ||
+ this.props.isContentActive() ? true : false;
+ }
@computed get contents() {
TraceMobx();
const audioView = !this.layoutDoc._showAudio ? (null) :
@@ -792,7 +827,7 @@ export class DocumentViewInternal extends DocComponent<DocumentViewInternalProps
</div>;
return <div className="documentView-contentsView"
style={{
- pointerEvents: this.props.contentPointerEvents as any,
+ pointerEvents: this.rootDoc.type !== DocumentType.INK && ((this.props.contentPointerEvents as any) || (this.isContentActive())) ? "all" : "none",
height: this.headerMargin ? `calc(100% - ${this.headerMargin}px)` : undefined,
}}>
<DocumentContentsView key={1} {...this.props}
@@ -809,7 +844,9 @@ export class DocumentViewInternal extends DocComponent<DocumentViewInternalProps
layoutKey={this.finalLayoutKey} />
{this.layoutDoc.hideAllLinks ? (null) : this.allLinkEndpoints}
{this.hideLinkButton ? (null) :
- <DocumentLinksButton View={this.props.DocumentView()} Offset={[this.topMost ? 0 : -15, undefined, undefined, this.topMost ? 10 : -20]} />}
+ <div style={{ transformOrigin: "top left", transform: `scale(${Math.min(1, this.props.ScreenToLocalTransform().scale(this.props.ContentScaling?.() || 1).Scale)})` }}>
+ <DocumentLinksButton View={this.props.DocumentView()} Offset={[this.topMost ? 0 : -15, undefined, undefined, this.topMost ? 10 : -20]} />
+ </div>}
{audioView}
</div>;
@@ -832,16 +869,28 @@ export class DocumentViewInternal extends DocComponent<DocumentViewInternalProps
default: return this.props.styleProvider?.(doc, props, property);
}
}
- @computed get directLinks() { TraceMobx(); return LinkManager.Instance.getAllDirectLinks(this.rootDoc); }
+ // We need to use allrelatedLinks to get not just links to the document as a whole, but links to
+ // anchors that are not rendered as DocumentViews (marked as 'unrendered' with their 'annotationOn' set to this document). e.g.,
+ // - PDF text regions are rendered as an Annotations without generating a DocumentView, '
+ // - RTF selections are rendered via Prosemirror and have a mark which contains the Document ID for the annotation link
+ // - and links to PDF/Web docs at a certain scroll location never create an explicit view.
+ // For each of these, we create LinkAnchorBox's on the border of the DocumentView.
+ @computed get directLinks() {
+ TraceMobx(); return LinkManager.Instance.getAllRelatedLinks(this.rootDoc).filter(link =>
+ Doc.AreProtosEqual(link.anchor1 as Doc, this.rootDoc) ||
+ Doc.AreProtosEqual(link.anchor2 as Doc, this.rootDoc) ||
+ ((link.anchor1 as Doc).unrendered && Doc.AreProtosEqual((link.anchor1 as Doc).annotationOn as Doc, this.rootDoc)) ||
+ ((link.anchor2 as Doc).unrendered && Doc.AreProtosEqual((link.anchor2 as Doc).annotationOn as Doc, this.rootDoc))
+ );
+ }
@computed get allLinks() { TraceMobx(); return LinkManager.Instance.getAllRelatedLinks(this.rootDoc); }
@computed get allLinkEndpoints() { // the small blue dots that mark the endpoints of links
TraceMobx();
- if (this.props.LayoutTemplateString?.includes(LinkAnchorBox.name)) return null;
+ if (this.layoutDoc.unrendered || this.props.LayoutTemplateString?.includes(LinkAnchorBox.name)) return null;
if (this.layoutDoc.presBox || this.rootDoc.type === DocumentType.LINK || this.props.dontRegisterView) return (null);
- // need to use allLinks for RTF since embedded linked text anchors are not rendered with DocumentViews. All other documents render their anchors with nested DocumentViews so we just need to render the directLinks here
- const filtered = DocUtils.FilterDocs(this.rootDoc.type === DocumentType.RTF ? this.allLinks : this.directLinks, this.props.docFilters?.() ?? [], []).filter(d => !d.hidden);
+ const filtered = DocUtils.FilterDocs(this.directLinks, this.props.docFilters?.() ?? [], []).filter(d => !d.hidden);
return filtered.map((link, i) =>
- <div className="documentView-anchorCont" key={i + 1}>
+ <div className="documentView-anchorCont" key={link[Id]}>
<DocumentView {...this.props}
Document={link}
PanelWidth={this.anchorPanelWidth}
@@ -913,31 +962,50 @@ export class DocumentViewInternal extends DocComponent<DocumentViewInternalProps
const showTitleHover = this.ShowTitle?.includes(":hover");
const showCaption = !this.props.hideCaptions && this.Document._viewType !== CollectionViewType.Carousel ? StrCast(this.layoutDoc._showCaption) : undefined;
const captionView = !showCaption ? (null) :
- <div className="documentView-captionWrapper">
+ <div className="documentView-captionWrapper"
+ style={{ pointerEvents: this.onClickHandler || this.Document.ignoreClick ? "none" : this.isContentActive() || this.props.isDocumentActive?.() ? "all" : undefined, }}>
<FormattedTextBox {...OmitKeys(this.props, ['children']).omit}
yPadding={10}
xPadding={10}
fieldKey={showCaption}
fontSize={Math.min(32, 12 * this.props.ScreenToLocalTransform().Scale)}
- hideOnLeave={true}
styleProvider={this.captionStyleProvider}
dontRegisterView={true}
+ isContentActive={this.isContentActive}
onClick={this.onClickFunc}
/>
</div>;
+ const targetDoc = (showTitle?.startsWith("_") ? this.layoutDoc : this.rootDoc);
+ const background = StrCast(SharingManager.Instance.users.find(users => users.user.email === this.dataDoc.author)?.sharingDoc.userColor, [DocumentType.RTF, DocumentType.COL].includes(this.rootDoc.type as any) ? StrCast(Doc.SharingDoc().userColor) : "rgba(0,0,0,0.4)");
const titleView = !showTitle ? (null) :
<div className={`documentView-titleWrapper${showTitleHover ? "-hover" : ""}`} key="title" style={{
position: this.headerMargin ? "relative" : "absolute",
height: this.titleHeight,
- background: StrCast(SharingManager.Instance.users.find(users => users.user.email === this.dataDoc.author)?.sharingDoc.userColor, this.rootDoc.type === DocumentType.RTF ? StrCast(Doc.SharingDoc().userColor) : "rgba(0,0,0,0.4)"),
- pointerEvents: this.onClickHandler || this.Document.ignoreClick ? "none" : undefined,
+ color: lightOrDark(background),
+ background,
+ pointerEvents: this.onClickHandler || this.Document.ignoreClick ? "none" : this.isContentActive() || this.props.isDocumentActive?.() ? "all" : undefined,
}}>
<EditableView ref={this._titleRef}
- contents={showTitle === "title" ? StrCast((this.dataDoc || this.props.Document).title) : showTitle.split(";").map(field => field + ":" + (this.dataDoc || this.props.Document)[field]?.toString()).join(" ")}
+ contents={showTitle.split(";").map(field => field.trim()).map(field => targetDoc[field]?.toString()).join("\\")}
display={"block"}
fontSize={10}
- GetValue={() => Field.toString((this.dataDoc || this.props.Document)[showTitle.split(";")[0]] as any as Field)}
- SetValue={undoBatch((value) => showTitle.includes("Date") ? true : (Doc.GetProto(this.dataDoc || this.props.Document)[showTitle] = value) ? true : true)}
+ GetValue={() => showTitle.split(";").length === 1 ? showTitle + "=" + Field.toString(targetDoc[showTitle.split(";")[0]] as any as Field) : "#" + showTitle}
+ SetValue={undoBatch(input => {
+ if (input?.startsWith("#")) {
+ if (this.props.showTitle) {
+ this.rootDoc._showTitle = input?.substring(1) ? input.substring(1) : undefined;
+ } else {
+ Doc.UserDoc().showTitle = input?.substring(1) ? input.substring(1) : "creationDate";
+ }
+ return true;
+ } else {
+ var value = input.replace(new RegExp(showTitle + "="), "");
+ if (showTitle !== "title" && Number(value).toString() === value) value = Number(value);
+ if (showTitle.includes("Date") || showTitle === "author") return true;
+ return Doc.SetInPlace(targetDoc, showTitle, value, true) ? true : true;
+ }
+ return true;
+ })}
/>
</div>;
return this.props.hideTitle || (!showTitle && !showCaption) ?
@@ -949,12 +1017,13 @@ export class DocumentViewInternal extends DocComponent<DocumentViewInternalProps
}
@computed get renderDoc() {
TraceMobx();
+ const isButton: boolean = this.props.Document.type === DocumentType.FONTICON;
if (!(this.props.Document instanceof Doc) || GetEffectiveAcl(this.props.Document[DataSym]) === AclPrivate || this.hidden) return null;
return this.docContents ??
<div className={`documentView-node${this.topMost ? "-topmost" : ""}`}
id={this.props.Document[Id]}
style={{
- background: this.backgroundColor,
+ background: isButton ? undefined : this.backgroundColor,
opacity: this.opacity,
color: StrCast(this.layoutDoc.color, "inherit"),
fontFamily: StrCast(this.Document._fontFamily, "inherit"),
@@ -969,8 +1038,9 @@ export class DocumentViewInternal extends DocComponent<DocumentViewInternalProps
</div>;
}
render() {
+ TraceMobx();
const highlightIndex = this.props.LayoutTemplateString ? (Doc.IsHighlighted(this.props.Document) ? 6 : 0) : Doc.isBrushedHighlightedDegree(this.props.Document); // bcz: Argh!! need to identify a tree view doc better than a LayoutTemlatString
- const highlightColor = (CurrentUserUtils.ActiveDashboard?.darkScheme ?
+ const highlightColor = (Doc.UserDoc().colorScheme === ColorScheme.Dark ?
["transparent", "#65350c", "#65350c", "yellow", "magenta", "cyan", "orange"] :
["transparent", "#4476F7", "#4476F7", "yellow", "magenta", "cyan", "orange"])[highlightIndex];
const highlightStyle = ["solid", "dashed", "solid", "solid", "solid", "solid", "solid"][highlightIndex];
@@ -982,6 +1052,8 @@ export class DocumentViewInternal extends DocComponent<DocumentViewInternalProps
const internal = PresBox.EffectsProvider(this.layoutDoc, this.renderDoc) || this.renderDoc;
const boxShadow = this.props.treeViewDoc ? null : highlighting && this.borderRounding && highlightStyle !== "dashed" ? `0 0 0 ${highlightIndex}px ${highlightColor}` :
this.boxShadow || (this.props.Document.isTemplateForField ? "black 0.2vw 0.2vw 0.8vw" : undefined);
+
+ // Return surrounding highlight
return <div className={DocumentView.ROOT_DIV} ref={this._mainCont}
onContextMenu={this.onContextMenu}
onKeyDown={this.onKeyDown}
@@ -1044,7 +1116,7 @@ export class DocumentView extends React.Component<DocumentViewProps> {
return this.docView?._componentView?.reverseNativeScaling?.() ? 0 :
returnVal(this.props.NativeHeight?.(), Doc.NativeHeight(this.layoutDoc, this.props.DataDoc, this.props.freezeDimensions));
}
- @computed get shouldNotScale() { return (this.fitWidth && !this.nativeWidth) || [CollectionViewType.Docking, CollectionViewType.Tree].includes(this.Document._viewType as any); }
+ @computed get shouldNotScale() { return (this.fitWidth && !this.nativeWidth) || this.props.treeViewDoc || [CollectionViewType.Docking].includes(this.Document._viewType as any); }
@computed get effectiveNativeWidth() { return this.shouldNotScale ? 0 : (this.nativeWidth || NumCast(this.layoutDoc.width)); }
@computed get effectiveNativeHeight() { return this.shouldNotScale ? 0 : (this.nativeHeight || NumCast(this.layoutDoc.height)); }
@computed get nativeScaling() {
@@ -1059,7 +1131,7 @@ export class DocumentView extends React.Component<DocumentViewProps> {
@computed get panelWidth() { return this.effectiveNativeWidth ? this.effectiveNativeWidth * this.nativeScaling : this.props.PanelWidth(); }
@computed get panelHeight() {
if (this.effectiveNativeHeight) {
- return Math.min(this.props.PanelHeight(), Math.max(NumCast(this.layoutDoc.scrollHeight), this.effectiveNativeHeight) * this.nativeScaling);
+ return Math.min(this.props.PanelHeight(), Math.max(this.ComponentView?.getScrollHeight?.() ?? NumCast(this.layoutDoc.scrollHeight), this.effectiveNativeHeight) * this.nativeScaling);
}
return this.props.PanelHeight();
}
@@ -1135,21 +1207,22 @@ export class DocumentView extends React.Component<DocumentViewProps> {
}
componentWillUnmount() {
Object.values(this._disposers).forEach(disposer => disposer?.());
- !this.props.dontRegisterView && DocumentManager.Instance.RemoveView(this);
+ !BoolCast(this.props.Document.dontRegisterView, this.props.dontRegisterView) && DocumentManager.Instance.RemoveView(this);
}
render() {
TraceMobx();
const xshift = () => (this.props.Document.isInkMask ? InkingStroke.MaskDim : Math.abs(this.Xshift) <= 0.001 ? this.props.PanelWidth() : undefined);
const yshift = () => (this.props.Document.isInkMask ? InkingStroke.MaskDim : Math.abs(this.Yshift) <= 0.001 ? this.props.PanelHeight() : undefined);
+ const isButton: boolean = this.props.Document.type === DocumentType.FONTICON || this.props.Document._viewType === CollectionViewType.Linear;
return (<div className="contentFittingDocumentView">
{!this.props.Document || !this.props.PanelWidth() ? (null) : (
<div className="contentFittingDocumentView-previewDoc" ref={this.ContentRef}
style={{
position: this.props.Document.isInkMask ? "absolute" : undefined,
- transform: `translate(${this.centeringX}px, ${this.centeringY}px)`,
- width: xshift() ?? `${100 * (this.props.PanelWidth() - this.Xshift * 2) / this.props.PanelWidth()}%`,
- height: yshift() ?? (this.fitWidth ? `${this.panelHeight}px` :
+ transform: isButton ? undefined : `translate(${this.centeringX}px, ${this.centeringY}px)`,
+ width: isButton ? "100%" : xshift() ?? `${100 * (this.props.PanelWidth() - this.Xshift * 2) / this.props.PanelWidth()}%`,
+ height: isButton ? undefined : yshift() ?? (this.fitWidth ? `${this.panelHeight}px` :
`${100 * this.effectiveNativeHeight / this.effectiveNativeWidth * this.props.PanelWidth() / this.props.PanelHeight()}%`),
}}>
<DocumentViewInternal {...this.props}
@@ -1165,14 +1238,13 @@ export class DocumentView extends React.Component<DocumentViewProps> {
ScreenToLocalTransform={this.screenToLocalTransform}
focus={this.props.focus || emptyFunction}
bringToFront={emptyFunction}
- ref={action((r: DocumentViewInternal | null) => this.docView = r)} />
+ ref={action((r: DocumentViewInternal | null) => r && (this.docView = r))} />
</div>)}
</div>);
}
}
-Scripting.addGlobal(function toggleDetail(doc: any, layoutKey: string, otherKey: string = "layout") {
- const dv = DocumentManager.Instance.getDocumentView(doc);
- if (dv?.props.Document.layoutKey === layoutKey) dv?.switchViews(otherKey !== "layout", otherKey.replace("layout_", ""));
- else dv?.switchViews(true, layoutKey.replace("layout_", ""));
+Scripting.addGlobal(function toggleDetail(dv: DocumentView, detailLayoutKeySuffix: string) {
+ if (dv.Document.layoutKey === "layout_" + detailLayoutKeySuffix) dv.switchViews(false, "layout");
+ else dv.switchViews(true, detailLayoutKeySuffix);
}); \ No newline at end of file
diff --git a/src/client/views/nodes/FieldView.tsx b/src/client/views/nodes/FieldView.tsx
index ebbc1138a..ee81e106a 100644
--- a/src/client/views/nodes/FieldView.tsx
+++ b/src/client/views/nodes/FieldView.tsx
@@ -2,11 +2,10 @@ import React = require("react");
import { computed } from "mobx";
import { observer } from "mobx-react";
import { DateField } from "../../../fields/DateField";
-import { Doc, Field, FieldResult, Opt } from "../../../fields/Doc";
+import { Doc, Field, FieldResult } from "../../../fields/Doc";
import { List } from "../../../fields/List";
-import { VideoField, WebField } from "../../../fields/URLField";
+import { WebField } from "../../../fields/URLField";
import { DocumentViewSharedProps } from "./DocumentView";
-import { VideoBox } from "./VideoBox";
//
// these properties get assigned through the render() method of the DocumentView when it creates this node.
diff --git a/src/client/views/nodes/FilterBox.tsx b/src/client/views/nodes/FilterBox.tsx
index beefc4a82..e9f19bf9e 100644
--- a/src/client/views/nodes/FilterBox.tsx
+++ b/src/client/views/nodes/FilterBox.tsx
@@ -9,7 +9,7 @@ import { List } from "../../../fields/List";
import { RichTextField } from "../../../fields/RichTextField";
import { listSpec, makeInterface } from "../../../fields/Schema";
import { ComputedField, ScriptField } from "../../../fields/ScriptField";
-import { Cast, StrCast } from "../../../fields/Types";
+import { Cast, StrCast, NumCast } from "../../../fields/Types";
import { emptyFunction, returnEmptyDoclist, returnEmptyFilter, returnFalse, returnTrue } from "../../../Utils";
import { Docs } from "../../documents/Documents";
import { DocumentType } from "../../documents/DocumentTypes";
@@ -79,10 +79,16 @@ export class FilterBox extends ViewBoxBaseComponent<FieldViewProps, FilterBoxDoc
* @returns the relevant doc according to the value of FilterBox._filterScope i.e. either the Current Dashboard or the Current Collection
*/
@computed static get targetDoc() {
+ return SelectionManager.Docs().length ? SelectionManager.Docs()[0] : CurrentUserUtils.ActiveDashboard;
+ }
+ @computed static get targetDocChildKey() {
if (SelectionManager.Views().length) {
- return SelectionManager.Views()[0]?.Document.type === DocumentType.COL ? SelectionManager.Views()[0].Document : SelectionManager.Views()[0]?.props.ContainingCollectionDoc!;
+ return SelectionManager.Views()[0].ComponentView?.annotationKey || SelectionManager.Views()[0].ComponentView?.fieldKey || "data";
}
- return CurrentUserUtils.ActiveDashboard;
+ return "data";
+ }
+ @computed static get targetDocChildren() {
+ return DocListCast(FilterBox.targetDoc?.[FilterBox.targetDocChildKey] || CurrentUserUtils.ActiveDashboard.data);
}
@observable _loaded = false;
@@ -100,7 +106,7 @@ export class FilterBox extends ViewBoxBaseComponent<FieldViewProps, FilterBoxDoc
const targetDoc = FilterBox.targetDoc;
if (this._loaded && targetDoc) {
const allDocs = new Set<Doc>();
- const activeTabs = DocListCast(targetDoc.data);
+ const activeTabs = FilterBox.targetDocChildren;
SearchBox.foreachRecursiveDoc(activeTabs, (depth, doc) => allDocs.add(doc));
setTimeout(action(() => this._allDocs = Array.from(allDocs)));
}
@@ -133,8 +139,7 @@ export class FilterBox extends ViewBoxBaseComponent<FieldViewProps, FilterBoxDoc
return this.activeAttributes.map(attribute => StrCast(attribute.title));
}
- gatherFieldValues(dashboard: Doc, facetKey: string) {
- const childDocs = DocListCast(dashboard.data);
+ gatherFieldValues(childDocs: Doc[], facetKey: string) {
const valueSet = new Set<string>();
let rtFields = 0;
childDocs.forEach((d) => {
@@ -194,13 +199,13 @@ export class FilterBox extends ViewBoxBaseComponent<FieldViewProps, FilterBoxDoc
* Responds to clicking the check box in the flyout menu
*/
facetClick = (facetHeader: string) => {
- const { targetDoc } = FilterBox;
+ const { targetDoc, targetDocChildren } = FilterBox;
const found = this.activeAttributes.findIndex(doc => doc.title === facetHeader);
if (found !== -1) {
this.removeFilter(facetHeader);
} else {
- const allCollectionDocs = DocListCast((targetDoc.data as any)?.[0].data);
- const facetValues = this.gatherFieldValues(targetDoc, facetHeader);
+ const allCollectionDocs = targetDocChildren;
+ const facetValues = this.gatherFieldValues(targetDocChildren, facetHeader);
let nonNumbers = 0;
let minVal = Number.MAX_VALUE, maxVal = -Number.MAX_VALUE;
@@ -248,7 +253,7 @@ export class FilterBox extends ViewBoxBaseComponent<FieldViewProps, FilterBoxDoc
newFacet.layoutKey = "layout";
newFacet.type = DocumentType.COL;
newFacet.target = targetDoc;
- newFacet.data = ComputedField.MakeFunction(`readFacetData(self.target, "${facetHeader}")`);
+ newFacet.data = ComputedField.MakeFunction(`readFacetData(self.target, "${FilterBox.targetDocChildKey}", "${facetHeader}")`);
}
newFacet.hideContextMenu = true;
Doc.AddDocToList(this.dataDoc, this.props.fieldKey, newFacet);
@@ -339,7 +344,7 @@ export class FilterBox extends ViewBoxBaseComponent<FieldViewProps, FilterBoxDoc
);
}
setTreeHeight = (hgt: number) => {
- this.layoutDoc._height = hgt + 140; // 50? need to add all the border sizes together.
+ this.layoutDoc._height = NumCast(this.layoutDoc._autoHeightMargins) + 150; // need to add all the border sizes together.
}
/**
@@ -409,6 +414,7 @@ export class FilterBox extends ViewBoxBaseComponent<FieldViewProps, FilterBoxDoc
renderDepth={1}
dropAction={this.props.dropAction}
ScreenToLocalTransform={this.props.ScreenToLocalTransform}
+ isAnyChildContentActive={returnFalse}
addDocTab={returnFalse}
pinToPres={returnFalse}
isSelected={returnFalse}
@@ -479,9 +485,9 @@ Scripting.addGlobal(function determineCheckedState(layoutDoc: Doc, facetHeader:
}
return undefined;
});
-Scripting.addGlobal(function readFacetData(layoutDoc: Doc, facetHeader: string) {
+Scripting.addGlobal(function readFacetData(layoutDoc: Doc, childKey: string, facetHeader: string) {
const allCollectionDocs = new Set<Doc>();
- const activeTabs = DocListCast(layoutDoc.data);
+ const activeTabs = DocListCast(layoutDoc[childKey]);
SearchBox.foreachRecursiveDoc(activeTabs, (depth: number, doc: Doc) => allCollectionDocs.add(doc));
const set = new Set<string>();
if (facetHeader === "tags") allCollectionDocs.forEach(child => Field.toString(child[facetHeader] as Field).split(":").forEach(key => set.add(key)));
diff --git a/src/client/views/nodes/FontIconBox.scss b/src/client/views/nodes/FontIconBox.scss
deleted file mode 100644
index 718af2c16..000000000
--- a/src/client/views/nodes/FontIconBox.scss
+++ /dev/null
@@ -1,103 +0,0 @@
-@import "../global/globalCssVariables";
-
-.fontIconBox-label {
- color: $white;
- margin-right: 4px;
- margin-top: 1px;
- position: relative;
- text-align: center;
- font-size: 7px;
- letter-spacing: normal;
- background-color: inherit;
- border-radius: 8px;
- margin-top: -8px;
- padding: 0;
- width: 100%;
-}
-
-.fontIconBadge-container {
- position:absolute;
- z-index: 1000;
- top: 12px;
-
- .fontIconBadge {
- position: absolute;
- top: -10px;
- right: -10px;
- color: $white;
- background: $pink;
- font-weight: 300;
- border-radius: 100%;
- width: 25px;
- height: 25px;
- text-align: center;
- padding-top: 4px;
- font-size: 12px;
- }
-}
-
-.menuButton-circle,
-.menuButton-round {
- border-radius: 100%;
- background-color: $dark-gray;
- padding: 0;
-
- .fontIconBox-label {
- //margin-left: -10px; // button padding is 10px;
- bottom: 0;
- position: absolute;
- }
-
- &:hover {
- background-color: $light-gray;
- }
-}
-
-.menuButton-square {
- padding-top: 3px;
- padding-bottom: 3px;
- background-color: $dark-gray;
-
- .fontIconBox-label {
- border-radius: 0px;
- margin-top: 0px;
- border-radius: "inherit";
- }
-}
-
-.menuButton,
-.menuButton-circle,
-.menuButton-round,
-.menuButton-square {
- margin-left: -5%;
- width: 110%;
- height: 100%;
- pointer-events: all;
- touch-action: none;
-
- .menuButton-wrap {
- touch-action: none;
- border-radius: 8px;
- width: 100%;
- }
-
- .menuButton-icon-square {
- width: auto;
- height: 29px;
- padding: 4px;
- }
-
- svg {
- width: 95% !important;
- height: 95%;
- }
-}
-.menuButton-round {
- width: 100%;
- svg {
- width: 50% !important;
- height: 50%;
- position: relative;
- bottom: 2px;
- }
-} \ No newline at end of file
diff --git a/src/client/views/nodes/FontIconBox.tsx b/src/client/views/nodes/FontIconBox.tsx
deleted file mode 100644
index 0d415e238..000000000
--- a/src/client/views/nodes/FontIconBox.tsx
+++ /dev/null
@@ -1,96 +0,0 @@
-import { FontAwesomeIcon } from '@fortawesome/react-fontawesome';
-import { Tooltip } from '@material-ui/core';
-import { observer } from 'mobx-react';
-import * as React from 'react';
-import { AclPrivate, Doc, DocListCast } from '../../../fields/Doc';
-import { createSchema, makeInterface } from '../../../fields/Schema';
-import { ScriptField } from '../../../fields/ScriptField';
-import { Cast, StrCast } from '../../../fields/Types';
-import { GetEffectiveAcl } from '../../../fields/util';
-import { emptyFunction, returnFalse, setupMoveUpEvents } from "../../../Utils";
-import { DragManager } from '../../util/DragManager';
-import { ContextMenu } from '../ContextMenu';
-import { DocComponent } from '../DocComponent';
-import { StyleProp } from '../StyleProvider';
-import { FieldView, FieldViewProps } from './FieldView';
-import './FontIconBox.scss';
-import { Colors } from '../global/globalEnums';
-const FontIconSchema = createSchema({
- icon: "string",
-});
-
-type FontIconDocument = makeInterface<[typeof FontIconSchema]>;
-const FontIconDocument = makeInterface(FontIconSchema);
-@observer
-export class FontIconBox extends DocComponent<FieldViewProps, FontIconDocument>(FontIconDocument) {
- public static LayoutString(fieldKey: string) { return FieldView.LayoutString(FontIconBox, fieldKey); }
- showTemplate = (): void => {
- const dragFactory = Cast(this.layoutDoc.dragFactory, Doc, null);
- dragFactory && this.props.addDocTab(dragFactory, "add:right");
- }
- dragAsTemplate = (): void => { this.layoutDoc.onDragStart = ScriptField.MakeFunction('getCopy(this.dragFactory, true)'); };
- useAsPrototype = (): void => { this.layoutDoc.onDragStart = ScriptField.MakeFunction('makeDelegate(this.dragFactory, true)'); };
-
- specificContextMenu = (): void => {
- if (!Doc.UserDoc().noviceMode) {
- const cm = ContextMenu.Instance;
- cm.addItem({ description: "Show Template", event: this.showTemplate, icon: "tag" });
- cm.addItem({ description: "Use as Render Template", event: this.dragAsTemplate, icon: "tag" });
- cm.addItem({ description: "Use as Prototype", event: this.useAsPrototype, icon: "tag" });
- }
- }
-
- render() {
- const label = StrCast(this.rootDoc.label, StrCast(this.rootDoc.title));
- const color = this.props.styleProvider?.(this.rootDoc, this.props, StyleProp.Color);
- const backgroundColor = this.props.styleProvider?.(this.rootDoc, this.props, StyleProp.BackgroundColor);
- const shape = StrCast(this.layoutDoc.iconShape, label ? "round" : "circle");
- const icon = StrCast(this.dataDoc.icon, "user") as any;
- const presSize = shape === 'round' ? 25 : 30;
- const presTrailsIcon = <img src={`/assets/${"presTrails.png"}`}
- style={{ width: presSize, height: presSize, filter: `invert(${color === Colors.DARK_GRAY ? "0%" : "100%"})`, marginBottom: "5px" }} />;
- const button = <button className={`menuButton-${shape}`} onContextMenu={this.specificContextMenu}
- style={{ backgroundColor: backgroundColor, }}>
- <div className="menuButton-wrap">
- {icon === 'pres-trail' ? presTrailsIcon : <FontAwesomeIcon className={`menuButton-icon-${shape}`} icon={icon} color={color}
- size={this.layoutDoc.iconShape === "square" ? "sm" : "sm"} />}
- {!label ? (null) : <div className="fontIconBox-label" style={{ color, backgroundColor }}> {label} </div>}
- <FontIconBadge collection={Cast(this.rootDoc.watchedDocuments, Doc, null)} />
- </div>
- </button>;
- return !this.layoutDoc.toolTip ? button :
- <Tooltip title={<div className="dash-tooltip">{StrCast(this.layoutDoc.toolTip)}</div>}>
- {button}
- </Tooltip>;
- }
-}
-
-interface FontIconBadgeProps {
- collection: Doc | undefined;
-}
-
-@observer
-export class FontIconBadge extends React.Component<FontIconBadgeProps> {
- _notifsRef = React.createRef<HTMLDivElement>();
-
- onPointerDown = (e: React.PointerEvent) => {
- setupMoveUpEvents(this, e,
- (e: PointerEvent) => {
- const dragData = new DragManager.DocumentDragData([this.props.collection!]);
- DragManager.StartDocumentDrag([this._notifsRef.current!], dragData, e.x, e.y);
- return true;
- },
- returnFalse, emptyFunction, false);
- }
-
- render() {
- if (!(this.props.collection instanceof Doc)) return (null);
- const length = DocListCast(this.props.collection.data).filter(d => GetEffectiveAcl(d) !== AclPrivate).length; // Object.keys(d).length).length; // filter out any documents that we can't read
- return <div className="fontIconBadge-container" style={{ width: 15, height: 15, top: 12 }} ref={this._notifsRef}>
- <div className="fontIconBadge" style={length > 0 ? { "display": "initial" } : { "display": "none" }}
- onPointerDown={this.onPointerDown} >
- {length}
- </div>
- </div>;
- }
-} \ No newline at end of file
diff --git a/src/client/views/nodes/ImageBox.tsx b/src/client/views/nodes/ImageBox.tsx
index 2c0106960..b41bfd3ea 100644
--- a/src/client/views/nodes/ImageBox.tsx
+++ b/src/client/views/nodes/ImageBox.tsx
@@ -1,19 +1,21 @@
-import { action, computed, IReactionDisposer, observable, ObservableMap, reaction, runInAction } from 'mobx';
+import { action, computed, IReactionDisposer, observable, ObservableMap, reaction, runInAction, trace } from 'mobx';
import { observer } from "mobx-react";
import { DataSym, Doc, DocListCast, WidthSym } from '../../../fields/Doc';
import { documentSchema } from '../../../fields/documentSchemas';
import { Id } from '../../../fields/FieldSymbols';
+import { InkTool } from '../../../fields/InkField';
import { List } from '../../../fields/List';
import { ObjectField } from '../../../fields/ObjectField';
import { createSchema, makeInterface } from '../../../fields/Schema';
import { ComputedField } from '../../../fields/ScriptField';
-import { Cast, NumCast, StrCast } from '../../../fields/Types';
+import { Cast, NumCast } from '../../../fields/Types';
import { ImageField } from '../../../fields/URLField';
import { TraceMobx } from '../../../fields/util';
-import { emptyFunction, OmitKeys, returnOne, Utils, returnFalse } from '../../../Utils';
+import { emptyFunction, OmitKeys, returnFalse, returnOne, setupMoveUpEvents, Utils } from '../../../Utils';
import { GooglePhotos } from '../../apis/google_docs/GooglePhotosClientUtils';
import { CognitiveServices, Confidence, Service, Tag } from '../../cognitive_services/CognitiveServices';
import { Networking } from '../../Network';
+import { CurrentUserUtils } from '../../util/CurrentUserUtils';
import { DragManager } from '../../util/DragManager';
import { undoBatch } from '../../util/UndoManager';
import { ContextMenu } from "../../views/ContextMenu";
@@ -21,15 +23,13 @@ import { CollectionFreeFormView } from '../collections/collectionFreeForm/Collec
import { ContextMenuProps } from '../ContextMenuItem';
import { ViewBoxAnnotatableComponent, ViewBoxAnnotatableProps } from '../DocComponent';
import { MarqueeAnnotator } from '../MarqueeAnnotator';
+import { AnchorMenu } from '../pdf/AnchorMenu';
import { StyleProp } from '../StyleProvider';
import { FaceRectangles } from './FaceRectangles';
import { FieldView, FieldViewProps } from './FieldView';
import "./ImageBox.scss";
import React = require("react");
-import { InkTool } from '../../../fields/InkField';
-import { CurrentUserUtils } from '../../util/CurrentUserUtils';
-import { AnchorMenu } from '../pdf/AnchorMenu';
-import { Docs } from '../../documents/Documents';
+import { SnappingManager } from '../../util/SnappingManager';
const path = require('path');
export const pageSchema = createSchema({
@@ -144,9 +144,9 @@ export class ImageBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp
const funcs: ContextMenuProps[] = [];
funcs.push({ description: "Rotate Clockwise 90", event: this.rotate, icon: "expand-arrows-alt" });
funcs.push({ description: `Show ${this.layoutDoc._showFullRes ? "Dynamic Res" : "Full Res"}`, event: this.resolution, icon: "expand-arrows-alt" });
+ funcs.push({ description: "Copy path", event: () => Utils.CopyText(this.choosePath(field.url)), icon: "expand-arrows-alt" });
if (!Doc.UserDoc().noviceMode) {
funcs.push({ description: "Export to Google Photos", event: () => GooglePhotos.Transactions.UploadImages([this.props.Document]), icon: "caret-square-right" });
- funcs.push({ description: "Copy path", event: () => Utils.CopyText(field.url.href), icon: "expand-arrows-alt" });
const existingAnalyze = ContextMenu.Instance?.findByDescription("Analyzers...");
const modes: ContextMenuProps[] = existingAnalyze && "subitems" in existingAnalyze ? existingAnalyze.subitems : [];
@@ -294,7 +294,8 @@ export class ImageBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp
<div className="imageBox-fader" >
<img key="paths" ref={this._imgRef}
src={srcpath}
- style={{ transform, transformOrigin }} draggable={false}
+ style={{ transform, transformOrigin }}
+ draggable={false}
width={nativeWidth} />
{fadepath === srcpath ? (null) : <div className="imageBox-fadeBlocker">
<img className="imageBox-fadeaway" key={"fadeaway"} ref={this._imgRef}
@@ -330,11 +331,13 @@ export class ImageBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp
TraceMobx();
return <div className="imageBox-annotationLayer" style={{ height: this.props.PanelHeight() }} ref={this._annotationLayer} />;
}
- @action
marqueeDown = (e: React.PointerEvent) => {
- if (!e.altKey && e.button === 0 && this.layoutDoc._viewScale === 1 && this.isContentActive(true) && ![InkTool.Highlighter, InkTool.Pen].includes(CurrentUserUtils.SelectedTool)) {
- this._marqueeing = [e.clientX, e.clientY];
- e.stopPropagation();
+ if (!e.altKey && e.button === 0 && this.layoutDoc._viewScale === 1 && this.props.isContentActive(true) && ![InkTool.Highlighter, InkTool.Pen].includes(CurrentUserUtils.SelectedTool)) {
+ setupMoveUpEvents(this, e, action(e => {
+ MarqueeAnnotator.clearAnnotations(this._savedAnnotations);
+ this._marqueeing = [e.clientX, e.clientY];
+ return true;
+ }), returnFalse, () => MarqueeAnnotator.clearAnnotations(this._savedAnnotations), false);
}
}
@action
@@ -365,7 +368,6 @@ export class ImageBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp
ScreenToLocalTransform={this.screenToLocalTransform}
scaling={returnOne}
select={emptyFunction}
- isContentActive={this.isContentActive}
whenChildContentsActiveChanged={this.whenChildContentsActiveChanged}
removeDocument={this.removeDocument}
moveDocument={this.moveDocument}
diff --git a/src/client/views/nodes/LabelBox.tsx b/src/client/views/nodes/LabelBox.tsx
index 6a7793ff0..db1ae0537 100644
--- a/src/client/views/nodes/LabelBox.tsx
+++ b/src/client/views/nodes/LabelBox.tsx
@@ -20,11 +20,26 @@ const LabelSchema = createSchema({});
type LabelDocument = makeInterface<[typeof LabelSchema, typeof documentSchema]>;
const LabelDocument = makeInterface(LabelSchema, documentSchema);
+export interface LabelBoxProps {
+ label?: string;
+}
+
@observer
-export class LabelBox extends ViewBoxBaseComponent<FieldViewProps, LabelDocument>(LabelDocument) {
+export class LabelBox extends ViewBoxBaseComponent<(FieldViewProps & LabelBoxProps), LabelDocument>(LabelDocument) {
public static LayoutString(fieldKey: string) { return FieldView.LayoutString(LabelBox, fieldKey); }
+ public static LayoutStringWithTitle(fieldType: { name: string }, fieldStr: string, label: string) {
+ return `<${fieldType.name} fieldKey={'${fieldStr}'} label={'${label}'} {...props} />`; //e.g., "<ImageBox {...props} fieldKey={"data} />"
+ }
private dropDisposer?: DragManager.DragDropDisposer;
+ componentDidMount() {
+ this.props.setContentView?.(this);
+ }
+
+ getTitle() {
+ return this.props.label || "";
+ }
+
protected createDropTarget = (ele: HTMLDivElement) => {
this.dropDisposer?.();
if (ele) {
@@ -65,8 +80,8 @@ export class LabelBox extends ViewBoxBaseComponent<FieldViewProps, LabelDocument
render() {
const params = Cast(this.paramsDoc["onClick-paramFieldKeys"], listSpec("string"), []);
const missingParams = params?.filter(p => !this.paramsDoc[p]);
- params?.map(p => DocListCast(this.paramsDoc[p])); // bcz: really hacky form of prefetching ...
- const label = typeof this.rootDoc[this.fieldKey] === "string" ? StrCast(this.rootDoc[this.fieldKey]) : StrCast(this.rootDoc.title);
+ params?.map(p => DocListCast(this.paramsDoc[p])); // bcz: really hacky form of prefetching ...
+ const label = this.props.label ? this.props.label : typeof this.rootDoc[this.fieldKey] === "string" ? StrCast(this.rootDoc[this.fieldKey]) : StrCast(this.rootDoc.title);
return (
<div className="labelBox-outerDiv"
onMouseLeave={action(() => this._mouseOver = false)}
diff --git a/src/client/views/nodes/LinkAnchorBox.tsx b/src/client/views/nodes/LinkAnchorBox.tsx
index 8f9959693..1e0172d24 100644
--- a/src/client/views/nodes/LinkAnchorBox.tsx
+++ b/src/client/views/nodes/LinkAnchorBox.tsx
@@ -3,7 +3,6 @@ import { action, observable } from "mobx";
import { observer } from "mobx-react";
import { Doc } from "../../../fields/Doc";
import { documentSchema } from "../../../fields/documentSchemas";
-import { Id } from "../../../fields/FieldSymbols";
import { makeInterface } from "../../../fields/Schema";
import { Cast, NumCast, StrCast } from "../../../fields/Types";
import { TraceMobx } from "../../../fields/util";
diff --git a/src/client/views/nodes/LinkBox.tsx b/src/client/views/nodes/LinkBox.tsx
index c65ba9c69..55ea45bb8 100644
--- a/src/client/views/nodes/LinkBox.tsx
+++ b/src/client/views/nodes/LinkBox.tsx
@@ -30,6 +30,7 @@ export class LinkBox extends ViewBoxBaseComponent<FieldViewProps, LinkDocument>(
dontRegisterView={true}
renderDepth={this.props.renderDepth + 1}
CollectionView={undefined}
+ isAnyChildContentActive={returnFalse}
isContentActive={this.isContentActiveFunc}
addDocument={returnFalse}
removeDocument={returnFalse}
diff --git a/src/client/views/nodes/LinkDescriptionPopup.tsx b/src/client/views/nodes/LinkDescriptionPopup.tsx
index 30b272a9a..b62a4dd56 100644
--- a/src/client/views/nodes/LinkDescriptionPopup.tsx
+++ b/src/client/views/nodes/LinkDescriptionPopup.tsx
@@ -54,7 +54,7 @@ export class LinkDescriptionPopup extends React.Component<{}> {
}}>
<input className="linkDescriptionPopup-input"
onKeyPress={e => e.key === "Enter" && this.onDismiss(true)}
- placeholder={"(optional) enter link label..."}
+ placeholder={"(Optional) Enter link description..."}
onChange={(e) => this.descriptionChanged(e)}>
</input>
<div className="linkDescriptionPopup-btn">
@@ -65,4 +65,4 @@ export class LinkDescriptionPopup extends React.Component<{}> {
</div>
</div>;
}
-} \ No newline at end of file
+} \ No newline at end of file
diff --git a/src/client/views/nodes/PDFBox.scss b/src/client/views/nodes/PDFBox.scss
index 72dec6e4c..f44355929 100644
--- a/src/client/views/nodes/PDFBox.scss
+++ b/src/client/views/nodes/PDFBox.scss
@@ -1,3 +1,5 @@
+@import "../global/globalCssVariables.scss";
+
.pdfBox,
.pdfBox-interactive {
display: inline-block;
@@ -18,12 +20,13 @@
top: 0;
left: 0;
+ // glr: This should really be the same component as text and PDFs
.pdfBox-sidebarBtn {
- background: #121721;
+ background: $black;
height: 25px;
width: 25px;
- right: 0;
- color: white;
+ right: 5px;
+ color: $white;
display: flex;
position: absolute;
align-items: center;
@@ -31,6 +34,13 @@
border-radius: 3px;
pointer-events: all;
z-index: 1; // so it appears on top of the document's title, if shown
+
+ box-shadow: $standard-box-shadow;
+ transition: 0.2s;
+
+ &:hover{
+ filter: brightness(0.85);
+ }
}
.pdfBox-pageNums {
diff --git a/src/client/views/nodes/PDFBox.tsx b/src/client/views/nodes/PDFBox.tsx
index e3c09646f..972dcc0be 100644
--- a/src/client/views/nodes/PDFBox.tsx
+++ b/src/client/views/nodes/PDFBox.tsx
@@ -3,13 +3,13 @@ import { action, computed, IReactionDisposer, observable, reaction, runInAction
import { observer } from "mobx-react";
import * as Pdfjs from "pdfjs-dist";
import "pdfjs-dist/web/pdf_viewer.css";
-import { Doc, Opt, WidthSym, DocListCast } from "../../../fields/Doc";
+import { Doc, DocListCast, Opt, WidthSym } from "../../../fields/Doc";
import { documentSchema } from '../../../fields/documentSchemas';
import { makeInterface } from "../../../fields/Schema";
-import { Cast, NumCast, StrCast, BoolCast } from '../../../fields/Types';
+import { Cast, NumCast, StrCast } from '../../../fields/Types';
import { PdfField } from "../../../fields/URLField";
import { TraceMobx } from '../../../fields/util';
-import { Utils, setupMoveUpEvents, emptyFunction, returnOne } from '../../../Utils';
+import { emptyFunction, returnOne, setupMoveUpEvents, Utils } from '../../../Utils';
import { Docs } from '../../documents/Documents';
import { KeyCodes } from '../../util/KeyCodes';
import { undoBatch } from '../../util/UndoManager';
@@ -17,13 +17,14 @@ import { panZoomSchema } from '../collections/collectionFreeForm/CollectionFreeF
import { ContextMenu } from '../ContextMenu';
import { ContextMenuProps } from '../ContextMenuItem';
import { ViewBoxAnnotatableComponent, ViewBoxAnnotatableProps } from "../DocComponent";
+import { Colors } from '../global/globalEnums';
+import { AnchorMenu } from '../pdf/AnchorMenu';
import { PDFViewer } from "../pdf/PDFViewer";
import { SidebarAnnos } from '../SidebarAnnos';
import { FieldView, FieldViewProps } from './FieldView';
import { pageSchema } from "./ImageBox";
import "./PDFBox.scss";
import React = require("react");
-import { AnchorMenu } from '../pdf/AnchorMenu';
type PdfDocument = makeInterface<[typeof documentSchema, typeof panZoomSchema, typeof pageSchema]>;
const PdfDocument = makeInterface(documentSchema, panZoomSchema, pageSchema);
@@ -78,9 +79,9 @@ export class PDFBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps
const anchor =
AnchorMenu.Instance?.GetAnchor() ??
Docs.Create.TextanchorDocument({
- title: StrCast(this.rootDoc.title + " " + this.layoutDoc._scrollTop),
- annotationOn: this.rootDoc,
+ title: StrCast(this.rootDoc.title + "@" + this.layoutDoc._scrollTop?.toFixed(0)),
y: NumCast(this.layoutDoc._scrollTop),
+ unrendered: true
});
this.addDocument(anchor);
return anchor;
@@ -179,9 +180,9 @@ export class PDFBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps
</>;
const searchTitle = `${!this._searching ? "Open" : "Close"} Search Bar`;
const curPage = this.Document._curPage || 1;
- return !this.isContentActive() ? (null) :
+ return !this.props.isContentActive() ? (null) :
<div className="pdfBox-ui" onKeyDown={e => [KeyCodes.BACKSPACE, KeyCodes.DELETE].includes(e.keyCode) ? e.stopPropagation() : true}
- onPointerDown={e => e.stopPropagation()} style={{ display: this.isContentActive() ? "flex" : "none" }}>
+ onPointerDown={e => e.stopPropagation()} style={{ display: this.props.isContentActive() ? "flex" : "none" }}>
<div className="pdfBox-overlayCont" onPointerDown={(e) => e.stopPropagation()} style={{ left: `${this._searching ? 0 : 100}%` }}>
<button className="pdfBox-overlayButton" title={searchTitle} />
<input className="pdfBox-searchBar" placeholder="Search" ref={this._searchRef} onChange={this.searchStringChanged}
@@ -210,11 +211,15 @@ export class PDFBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps
onClick={action(() => this._pageControls = !this._pageControls)} />
{this._pageControls ? pageBtns : (null)}
</div>
- <button className="pdfBox-sidebarBtn" title="Toggle Sidebar"
- style={{ display: !this.isContentActive() ? "none" : undefined }}
+ <div className="pdfBox-sidebarBtn" key="sidebar" title="Toggle Sidebar"
+ style={{
+ display: !this.props.isContentActive() ? "none" : undefined,
+ top: StrCast(this.rootDoc._showTitle) === "title" ? 20 : 5,
+ backgroundColor: this.SidebarShown ? Colors.MEDIUM_BLUE : Colors.BLACK
+ }}
onPointerDown={this.sidebarBtnDown} >
- <FontAwesomeIcon icon={"chevron-left"} size="sm" />
- </button>
+ <FontAwesomeIcon style={{ color: Colors.WHITE }} icon={"comment-alt"} size="sm" />
+ </div>
</div>;
}
sidebarWidth = () => !this.SidebarShown ? 0 :
@@ -223,15 +228,13 @@ export class PDFBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps
specificContextMenu = (e: React.MouseEvent): void => {
const funcs: ContextMenuProps[] = [];
- funcs.push({ description: "Copy path", event: () => this.pdfUrl && Utils.CopyText(this.pdfUrl.url.pathname), icon: "expand-arrows-alt" });
- funcs.push({ description: "Toggle Fit Width " + (this.Document._fitWidth ? "Off" : "On"), event: () => this.Document._fitWidth = !this.Document._fitWidth, icon: "expand-arrows-alt" });
- funcs.push({ description: "Toggle Annotation View ", event: () => this.Document._showSidebar = !this.Document._showSidebar, icon: "expand-arrows-alt" });
- funcs.push({ description: "Toggle Sidebar ", event: () => this.toggleSidebar(), icon: "expand-arrows-alt" });
+ funcs.push({ description: "Copy path", event: () => this.pdfUrl && Utils.CopyText(Utils.prepend("") + this.pdfUrl.url.pathname), icon: "expand-arrows-alt" });
+ //funcs.push({ description: "Toggle Sidebar ", event: () => this.toggleSidebar(), icon: "expand-arrows-alt" });
ContextMenu.Instance.addItem({ description: "Options...", subitems: funcs, icon: "asterisk" });
}
@computed get renderTitleBox() {
- const classname = "pdfBox" + (this.isContentActive() ? "-interactive" : "");
+ const classname = "pdfBox" + (this.props.isContentActive() ? "-interactive" : "");
return <div className={classname} >
<div className="pdfBox-title-outer">
<strong className="pdfBox-title" >{this.props.Document.title}</strong>
@@ -270,7 +273,7 @@ export class PDFBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps
dataDoc={this.dataDoc}
pdf={this._pdf!}
url={this.pdfUrl!.url.pathname}
- isContentActive={this.isContentActive}
+ isContentActive={this.props.isContentActive}
anchorMenuClick={this.anchorMenuClick}
loaded={!Doc.NativeAspect(this.dataDoc) ? this.loaded : undefined}
setPdfViewer={this.setPdfViewer}
@@ -287,14 +290,13 @@ export class PDFBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps
rootDoc={this.rootDoc}
layoutDoc={this.layoutDoc}
dataDoc={this.dataDoc}
- // usePanelWidth={false}
+ setHeight={emptyFunction}
nativeWidth={this._previewNativeWidth ?? NumCast(this.layoutDoc._nativeWidth)}
showSidebar={this.SidebarShown}
whenChildContentsActiveChanged={this.whenChildContentsActiveChanged}
sidebarAddDocument={this.sidebarAddDocument}
moveDocument={this.moveDocument}
removeDocument={this.removeDocument}
- isContentActive={this.isContentActive}
/>
{this.settingsPanel()}
</div>;
diff --git a/src/client/views/nodes/ScreenshotBox.tsx b/src/client/views/nodes/ScreenshotBox.tsx
index f0db0b594..7ad96bf05 100644
--- a/src/client/views/nodes/ScreenshotBox.tsx
+++ b/src/client/views/nodes/ScreenshotBox.tsx
@@ -175,8 +175,7 @@ export class ScreenshotBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatabl
@computed get content() {
if (this.rootDoc.videoWall) return (null);
- const interactive = CurrentUserUtils.SelectedTool !== InkTool.None || !this.props.isSelected() ? "" : "-interactive";
- return <video className={"videoBox-content" + interactive} key="video"
+ return <video className={"videoBox-content"} key="video"
ref={r => {
this._videoRef = r;
setTimeout(() => {
diff --git a/src/client/views/nodes/VideoBox.scss b/src/client/views/nodes/VideoBox.scss
index f593f74fb..cdd36eb3b 100644
--- a/src/client/views/nodes/VideoBox.scss
+++ b/src/client/views/nodes/VideoBox.scss
@@ -49,63 +49,28 @@
// pointer-events: all;
// }
-.videoBox-time{
- color : white;
- top :25px;
- left : 25px;
+.videoBox-ui {
position: absolute;
- background-color: rgba(50, 50, 50, 0.2);
- transform-origin: left top;
- pointer-events:all;
+ flex-direction: row;
+ right: 5px;
+ top: 5px;
+ display: none;
+ background-color: rgba(0, 0, 0, 0.6);
}
-.videoBox-snapshot{
+.videoBox-time, .videoBox-snapshot, .videoBox-timelineButton, .videoBox-play, .videoBox-full {
color : white;
- top :25px;
- right : 25px;
- position: absolute;
- background-color:rgba(50, 50, 50, 0.2);
+ position: relative;
transform-origin: left top;
pointer-events:all;
- cursor: default;
-}
-
-.videoBox-timelineButton {
- position: absolute;
- display: flex;
- align-items: center;
- z-index: 1010;
- bottom: 5px;
- right: 5px;
- color: white;
+ padding-right: 5px;
cursor: pointer;
- background: dimgrey;
- width: 20px;
- height: 20px;
-}
-.videoBox-play {
- width: 25px;
- height: 20px;
- bottom: 25px;
- left : 25px;
- position: absolute;
- color : white;
- background-color: rgba(50, 50, 50, 0.2);
- border-radius: 4px;
- text-align: center;
- transform-origin: left bottom;
- pointer-events:all;
+ &:hover {
+ background-color: gray;
+ }
}
-.videoBox-full {
- width: 25px;
- height: 20px;
- bottom: 25px;
- right : 25px;
- position: absolute;
- color : white;
- background-color: rgba(50, 50, 50, 0.2);
- border-radius: 4px;
- text-align: center;
- transform-origin: right bottom;
- pointer-events:all;
+.videoBox:hover {
+ .videoBox-ui {
+ display: flex;
+ }
} \ No newline at end of file
diff --git a/src/client/views/nodes/VideoBox.tsx b/src/client/views/nodes/VideoBox.tsx
index ce45c01e6..90de3227f 100644
--- a/src/client/views/nodes/VideoBox.tsx
+++ b/src/client/views/nodes/VideoBox.tsx
@@ -9,7 +9,7 @@ import { InkTool } from "../../../fields/InkField";
import { makeInterface } from "../../../fields/Schema";
import { Cast, NumCast, StrCast } from "../../../fields/Types";
import { AudioField, nullAudio, VideoField } from "../../../fields/URLField";
-import { emptyFunction, formatTime, OmitKeys, returnOne, setupMoveUpEvents, Utils } from "../../../Utils";
+import { emptyFunction, formatTime, OmitKeys, returnOne, setupMoveUpEvents, Utils, returnFalse } from "../../../Utils";
import { Docs, DocUtils } from "../../documents/Documents";
import { Networking } from "../../Network";
import { CurrentUserUtils } from "../../util/CurrentUserUtils";
@@ -28,6 +28,8 @@ import { LinkDocPreview } from "./LinkDocPreview";
import "./VideoBox.scss";
import { DragManager } from "../../util/DragManager";
import { DocumentManager } from "../../util/DocumentManager";
+import { DocumentType } from "../../documents/DocumentTypes";
+import { Tooltip } from "@material-ui/core";
const path = require('path');
type VideoDocument = makeInterface<[typeof documentSchema]>;
@@ -49,7 +51,7 @@ export class VideoBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp
private _annotationLayer: React.RefObject<HTMLDivElement> = React.createRef();
private _playRegionTimer: any = null;
private _playRegionDuration = 0;
- @observable static _showControls: boolean;
+ @observable static _nativeControls: boolean;
@observable _marqueeing: number[] | undefined;
@observable _savedAnnotations = new ObservableMap<number, HTMLDivElement[]>();
@observable _screenCapture = false;
@@ -125,7 +127,7 @@ export class VideoBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp
this.updateTimecode();
}
- @action public FullScreen() {
+ @action public FullScreen = () => {
this._fullScreen = true;
this.player && this.player.requestFullscreen();
try {
@@ -137,7 +139,6 @@ export class VideoBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp
@action public Snapshot(downX?: number, downY?: number) {
const width = (this.layoutDoc._width || 0);
- const height = (this.layoutDoc._height || 0);
const canvas = document.createElement('canvas');
canvas.width = 640;
canvas.height = 640 * Doc.NativeHeight(this.layoutDoc) / (Doc.NativeWidth(this.layoutDoc) || 1);
@@ -208,11 +209,6 @@ export class VideoBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp
componentDidMount() {
this.props.setContentView?.(this); // this tells the DocumentView that this AudioBox is the "content" of the document. this allows the DocumentView to indirectly call getAnchor() on the AudioBox when making a link.
- this._disposers.selection = reaction(() => this.props.isSelected(),
- selected => !selected && setTimeout(() => {
- Array.from(this._savedAnnotations.values()).forEach(v => v.forEach(a => a.remove()));
- this._savedAnnotations.clear();
- }));
this._disposers.triggerVideo = reaction(
() => !LinkDocPreview.LinkInfo && this.props.renderDepth !== -1 ? NumCast(this.Document._triggerVideo, null) : undefined,
time => time !== undefined && setTimeout(() => {
@@ -281,10 +277,9 @@ export class VideoBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp
if (field) {
const url = field.url.href;
const subitems: ContextMenuProps[] = [];
- subitems.push({ description: "Copy path", event: () => { Utils.CopyText(url); }, icon: "expand-arrows-alt" });
- subitems.push({ description: "Toggle Show Controls", event: action(() => VideoBox._showControls = !VideoBox._showControls), icon: "expand-arrows-alt" });
- subitems.push({ description: "Take Snapshot", event: () => this.Snapshot(), icon: "expand-arrows-alt" });
- subitems.push({
+ subitems.push({ description: "Full Screen", event: this.FullScreen, icon: "expand" });
+ subitems.push({ description: "Take Snapshot", event: this.Snapshot, icon: "expand-arrows-alt" });
+ this.rootDoc.type === DocumentType.SCREENSHOT && subitems.push({
description: "Screen Capture", event: (async () => {
runInAction(() => this._screenCapture = !this._screenCapture);
this._videoRef!.srcObject = !this._screenCapture ? undefined : await (navigator.mediaDevices as any).getDisplayMedia({ video: true });
@@ -292,6 +287,8 @@ export class VideoBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp
});
subitems.push({ description: (this.layoutDoc.dontAutoPlayFollowedLinks ? "" : "Don't") + " play when link is selected", event: () => this.layoutDoc.dontAutoPlayFollowedLinks = !this.layoutDoc.dontAutoPlayFollowedLinks, icon: "expand-arrows-alt" });
subitems.push({ description: (this.layoutDoc.autoPlayAnchors ? "Don't auto play" : "Auto play") + " anchors onClick", event: () => this.layoutDoc.autoPlayAnchors = !this.layoutDoc.autoPlayAnchors, icon: "expand-arrows-alt" });
+ subitems.push({ description: "Toggle Native Controls", event: action(() => VideoBox._nativeControls = !VideoBox._nativeControls), icon: "expand-arrows-alt" });
+ subitems.push({ description: "Copy path", event: () => { Utils.CopyText(url); }, icon: "expand-arrows-alt" });
ContextMenu.Instance.addItem({ description: "Options...", subitems: subitems, icon: "video" });
}
}
@@ -310,12 +307,12 @@ export class VideoBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp
const interactive = CurrentUserUtils.SelectedTool !== InkTool.None || !this.props.isSelected() ? "" : "-interactive";
const style = "videoBox-content" + (this._fullScreen ? "-fullScreen" : "") + interactive;
return !field ? <div key="loading">Loading</div> :
- <div className="container" key="container" style={{ pointerEvents: this._isAnyChildContentActive || this.isContentActive() ? "all" : "none" }}>
+ <div className="container" key="container" style={{ mixBlendMode: "multiply", pointerEvents: this.props.isContentActive() ? "all" : "none" }}>
<div className={`${style}`} style={{ width: "100%", height: "100%", left: "0px" }}>
<video key="video" autoPlay={this._screenCapture} ref={this.setVideoRef}
style={{ height: "100%", width: "auto", display: "flex", margin: "auto" }}
onCanPlay={this.videoLoad}
- controls={VideoBox._showControls}
+ controls={VideoBox._nativeControls}
onPlay={() => this.Play()}
onSeeked={this.updateTimecode}
onPause={() => this.Pause()}
@@ -324,10 +321,10 @@ export class VideoBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp
Not supported.
</video>
{!this.audiopath || this.audiopath === field.url.href ? (null) :
- <audio ref={this.setAudioRef} className={`audiobox-control${this.isContentActive() ? "-interactive" : ""}`}>
+ <audio ref={this.setAudioRef} className={`audiobox-control${this.props.isContentActive() ? "-interactive" : ""}`}>
<source src={this.audiopath} type="audio/mpeg" />
- Not supported.
- </audio>}
+ Not supported.
+ </audio>}
</div>
</div>;
}
@@ -380,26 +377,36 @@ export class VideoBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp
}
private get uIButtons() {
const curTime = (this.layoutDoc._currentTimecode || 0);
- return ([<div className="videoBox-time" key="time" onPointerDown={this.onResetDown} >
- <span>{"" + formatTime(curTime)}</span>
- <span style={{ fontSize: 8 }}>{" " + Math.round((curTime - Math.trunc(curTime)) * 100)}</span>
- </div>,
- <div className="videoBox-snapshot" key="snap" onPointerDown={this.onSnapshotDown} >
- <FontAwesomeIcon icon="camera" size="lg" />
- </div>,
- <div className="videoBox-timelineButton" key="timeline" onPointerDown={this.onTimelineHdlDown} style={{ bottom: `${100 - this.heightPercent}%` }}>
- <FontAwesomeIcon icon={"eye"} size="lg" />
- </div>,
- VideoBox._showControls ? (null) : [
- // <div className="control-background">
- <div className="videoBox-play" key="play" onPointerDown={this.onPlayDown} >
- <FontAwesomeIcon icon={this._playing ? "pause" : "play"} size="lg" />
- </div>,
- <div className="videoBox-full" key="full" onPointerDown={this.onFullDown} >
- F
- {/* </div> */}
- </div>
- ]]);
+ const nonNativeControls = [
+ <Tooltip title={<div className="dash-tooltip">{"playback"}</div>} key="play" placement="bottom">
+ <div className="videoBox-play" onPointerDown={this.onPlayDown} >
+ <FontAwesomeIcon icon={this._playing ? "pause" : "play"} size="lg" />
+ </div>
+ </Tooltip>,
+ <Tooltip title={<div className="dash-tooltip">{"timecode"}</div>} key="time" placement="bottom">
+ <div className="videoBox-time" onPointerDown={this.onResetDown} >
+ <span>{formatTime(curTime)}</span>
+ <span style={{ fontSize: 8 }}>{" " + Math.floor((curTime - Math.trunc(curTime)) * 100).toString().padStart(2, "0")}</span>
+ </div>
+ </Tooltip>,
+ <Tooltip title={<div className="dash-tooltip">{"view full screen"}</div>} key="full" placement="bottom">
+ <div className="videoBox-full" onPointerDown={this.FullScreen}>
+ <FontAwesomeIcon icon="expand" size="lg" />
+ </div>
+ </Tooltip>];
+ return <div className="videoBox-ui">
+ {[...(VideoBox._nativeControls ? [] : nonNativeControls),
+ <Tooltip title={<div className="dash-tooltip">{"snapshot current frame"}</div>} key="snap" placement="bottom">
+ <div className="videoBox-snapshot" onPointerDown={this.onSnapshotDown} >
+ <FontAwesomeIcon icon="camera" size="lg" />
+ </div>
+ </Tooltip>,
+ <Tooltip title={<div className="dash-tooltip">{"show annotation timeline"}</div>} key="timeline" placement="bottom">
+ <div className="videoBox-timelineButton" onPointerDown={this.onTimelineHdlDown}>
+ <FontAwesomeIcon icon="eye" size="lg" />
+ </div>
+ </Tooltip>,]}
+ </div>;
}
onPlayDown = () => this._playing ? this.Pause() : this.Play();
@@ -422,7 +429,7 @@ export class VideoBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp
setupMoveUpEvents(this, e,
action((e: PointerEvent) => {
this._clicking = false;
- if (this.isContentActive()) {
+ if (this.props.isContentActive()) {
const local = this.props.ScreenToLocalTransform().scale(this.props.scaling?.() || 1).transformPoint(e.clientX, e.clientY);
this.layoutDoc._timelineHeightPercent = Math.max(0, Math.min(100, local[1] / this.props.PanelHeight() * 100));
}
@@ -431,7 +438,7 @@ export class VideoBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp
() => {
this.layoutDoc._timelineHeightPercent = this.heightPercent !== 100 ? 100 : VideoBox.heightPercent;
setTimeout(action(() => this._clicking = false), 500);
- }, this.isContentActive(), this.isContentActive());
+ }, this.props.isContentActive(), this.props.isContentActive());
});
onResetDown = (e: React.PointerEvent) => {
@@ -453,7 +460,7 @@ export class VideoBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp
return <iframe key={this._youtubeIframeId} id={`${this.youtubeVideoId + this._youtubeIframeId}-player`}
onPointerLeave={this.updateTimecode}
onLoad={this.youtubeIframeLoaded} className={`${style}`} width={Doc.NativeWidth(this.layoutDoc) || 640} height={Doc.NativeHeight(this.layoutDoc) || 390}
- src={`https://www.youtube.com/embed/${this.youtubeVideoId}?enablejsapi=1&rel=0&showinfo=1&autoplay=0&mute=1&start=${start}&modestbranding=1&controls=${VideoBox._showControls ? 1 : 0}`} />;
+ src={`https://www.youtube.com/embed/${this.youtubeVideoId}?enablejsapi=1&rel=0&showinfo=1&autoplay=0&mute=1&start=${start}&modestbranding=1&controls=${VideoBox._nativeControls ? 1 : 0}`} />;
}
@action.bound
@@ -522,14 +529,20 @@ export class VideoBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp
playFrom={this.playFrom}
setTime={this.setAnchorTime}
playing={this.playing}
+ isAnyChildContentActive={this.isAnyChildContentActive}
whenChildContentsActiveChanged={this.timelineWhenChildContentsActiveChanged}
removeDocument={this.removeDocument}
ScreenToLocalTransform={this.timelineScreenToLocal}
Play={this.Play}
Pause={this.Pause}
- isContentActive={this.isContentActive}
playLink={this.playLink}
PanelHeight={this.timelineHeight}
+ trimming={false}
+ trimStart={0}
+ trimEnd={this.duration}
+ trimDuration={this.duration}
+ setStartTrim={() => { }}
+ setEndTrim={() => { }}
/>
</div>;
}
@@ -538,9 +551,15 @@ export class VideoBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp
return <div className="imageBox-annotationLayer" style={{ transition: this.transition, height: `${this.heightPercent}%` }} ref={this._annotationLayer} />;
}
- marqueeDown = action((e: React.PointerEvent) => {
- if (!e.altKey && e.button === 0 && this.layoutDoc._viewScale === 1 && this.isContentActive(true) && ![InkTool.Highlighter, InkTool.Pen].includes(CurrentUserUtils.SelectedTool)) this._marqueeing = [e.clientX, e.clientY];
- });
+ marqueeDown = (e: React.PointerEvent) => {
+ if (!e.altKey && e.button === 0 && this.layoutDoc._viewScale === 1 && this.props.isContentActive(true) && ![InkTool.Highlighter, InkTool.Pen].includes(CurrentUserUtils.SelectedTool)) {
+ setupMoveUpEvents(this, e, action(e => {
+ MarqueeAnnotator.clearAnnotations(this._savedAnnotations);
+ this._marqueeing = [e.clientX, e.clientY];
+ return true;
+ }), returnFalse, () => MarqueeAnnotator.clearAnnotations(this._savedAnnotations), false);
+ }
+ }
finishMarquee = action(() => {
this._marqueeing = undefined;
@@ -557,7 +576,7 @@ export class VideoBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp
}
marqueeFitScaling = () => (this.props.scaling?.() || 1) * this.heightPercent / 100;
marqueeOffset = () => [this.panelWidth() / 2 * (1 - this.heightPercent / 100) / (this.heightPercent / 100), 0];
- timelineDocFilter = () => ["_timelineLabel:true:x"];
+ timelineDocFilter = () => [`_timelineLabel:true,${Utils.noRecursionHack}:x`];
render() {
const borderRad = this.props.styleProvider?.(this.layoutDoc, this.props, StyleProp.BorderRounding);
const borderRadius = borderRad?.includes("px") ? `${Number(borderRad.split("px")[0]) / this.scaling()}px` : borderRad;
@@ -579,7 +598,6 @@ export class VideoBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp
ScreenToLocalTransform={this.screenToLocalTransform}
docFilters={this.timelineDocFilter}
select={emptyFunction}
- isContentActive={this.isContentActive}
scaling={returnOne}
whenChildContentsActiveChanged={this.whenChildContentsActiveChanged}
removeDocument={this.removeDocument}
@@ -610,4 +628,4 @@ export class VideoBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp
}
}
-VideoBox._showControls = true; \ No newline at end of file
+VideoBox._nativeControls = false; \ No newline at end of file
diff --git a/src/client/views/nodes/WebBox.scss b/src/client/views/nodes/WebBox.scss
index 19b69ff5a..417a17d96 100644
--- a/src/client/views/nodes/WebBox.scss
+++ b/src/client/views/nodes/WebBox.scss
@@ -10,7 +10,7 @@
background: #121721;
height: 25px;
width: 25px;
- right: 0;
+ right: 5px;
display: flex;
position: absolute;
align-items: center;
@@ -18,6 +18,13 @@
border-radius: 3px;
pointer-events: all;
z-index: 1; // so it appears on top of the document's title, if shown
+
+ box-shadow: $standard-box-shadow;
+ transition: 0.2s;
+
+ &:hover{
+ filter: brightness(0.85);
+ }
}
.pdfViewerDash-dragAnnotationBox {
diff --git a/src/client/views/nodes/WebBox.tsx b/src/client/views/nodes/WebBox.tsx
index 142193476..19135b6dd 100644
--- a/src/client/views/nodes/WebBox.tsx
+++ b/src/client/views/nodes/WebBox.tsx
@@ -15,7 +15,6 @@ import { WebField } from "../../../fields/URLField";
import { TraceMobx } from "../../../fields/util";
import { emptyFunction, getWordAtPoint, OmitKeys, returnFalse, returnOne, setupMoveUpEvents, smoothScroll, Utils } from "../../../Utils";
import { Docs } from "../../documents/Documents";
-import { DocumentType } from '../../documents/DocumentTypes';
import { CurrentUserUtils } from "../../util/CurrentUserUtils";
import { Scripting } from "../../util/Scripting";
import { SnappingManager } from "../../util/SnappingManager";
@@ -25,6 +24,7 @@ import { ContextMenu } from "../ContextMenu";
import { ContextMenuProps } from "../ContextMenuItem";
import { ViewBoxAnnotatableComponent, ViewBoxAnnotatableProps } from "../DocComponent";
import { DocumentDecorations } from "../DocumentDecorations";
+import { Colors } from "../global/globalEnums";
import { LightboxView } from "../LightboxView";
import { MarqueeAnnotator } from "../MarqueeAnnotator";
import { AnchorMenu } from "../pdf/AnchorMenu";
@@ -44,7 +44,7 @@ const WebDocument = makeInterface(documentSchema);
export class WebBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps & FieldViewProps, WebDocument>(WebDocument) {
public static LayoutString(fieldKey: string) { return FieldView.LayoutString(WebBox, fieldKey); }
public static openSidebarWidth = 250;
- private _setPreviewCursor: undefined | ((x: number, y: number, drag: boolean) => void);
+ private _setPreviewCursor: undefined | ((x: number, y: number, drag: boolean, hide: boolean) => void);
private _mainCont: React.RefObject<HTMLDivElement> = React.createRef();
private _outerRef: React.RefObject<HTMLDivElement> = React.createRef();
private _disposers: { [name: string]: IReactionDisposer } = {};
@@ -52,16 +52,16 @@ export class WebBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps
private _keyInput = React.createRef<HTMLInputElement>();
private _initialScroll: Opt<number>;
private _sidebarRef = React.createRef<SidebarAnnos>();
- @observable private _urlHash: string = "";
@observable private _scrollTimer: any;
@observable private _overlayAnnoInfo: Opt<Doc>;
@observable private _marqueeing: number[] | undefined;
- @observable private _url: string = "hello";
@observable private _isAnnotating = false;
@observable private _iframeClick: HTMLIFrameElement | undefined = undefined;
@observable private _iframe: HTMLIFrameElement | null = null;
@observable private _savedAnnotations = new ObservableMap<number, HTMLDivElement[]>();
- @observable private _scrollHeight = 1500;
+ @observable private _scrollHeight = NumCast(this.layoutDoc.scrollHeight, 1500);
+ @computed get _url() { return this.webField?.toString() || ""; }
+ @computed get _urlHash() { return this._url ? WebBox.urlHash(this._url) + "" : ""; }
@computed get scrollHeight() { return this._scrollHeight; }
@computed get allAnnotations() { return DocListCast(this.dataDoc[this.annotationKey]); }
@computed get inlineTextAnnotations() { return this.allAnnotations.filter(a => a.textInlineAnnotations); }
@@ -69,33 +69,29 @@ export class WebBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps
constructor(props: any) {
super(props);
- if (true) {// his.webField) {
- Doc.SetNativeWidth(this.dataDoc, Doc.NativeWidth(this.dataDoc) || 850);
- Doc.SetNativeHeight(this.dataDoc, Doc.NativeHeight(this.dataDoc) || this.Document[HeightSym]() / this.Document[WidthSym]() * 850);
- }
- if (this.layoutDoc[this.fieldKey + "-contentWidth"] === undefined) {
- this.layoutDoc[this.fieldKey + "-contentWidth"] = Doc.NativeWidth(this.layoutDoc);
- }
+ // if (true) {// his.webField) {
+ // Doc.SetNativeWidth(this.dataDoc, Doc.NativeWidth(this.dataDoc) || 850);
+ // Doc.SetNativeHeight(this.dataDoc, Doc.NativeHeight(this.dataDoc) || this.Document[HeightSym]() / this.Document[WidthSym]() * 850);
+ // }
}
async componentDidMount() {
this.props.setContentView?.(this); // this tells the DocumentView that this AudioBox is the "content" of the document. this allows the DocumentView to indirectly call getAnchor() on the AudioBox when making a link.
runInAction(() => {
- this._url = this.webField?.toString() || "";
- this._urlHash = WebBox.urlHash(this._url) + "";
- this._annotationKey = this._urlHash + "-annotations";
+ this._annotationKeySuffix = () => this._urlHash + "-annotations";
// bcz: need to make sure that doc.data-annotations points to the currently active web page's annotations (this could/should be when the doc is created)
this.dataDoc[this.fieldKey + "-annotations"] = ComputedField.MakeFunction(`copyField(this["${this.fieldKey}-"+urlHash(this["${this.fieldKey}"]?.url?.toString())+"-annotations"`);
this.dataDoc[this.fieldKey + "-sidebar"] = ComputedField.MakeFunction(`copyField(this["${this.fieldKey}-"+urlHash(this["${this.fieldKey}"]?.url?.toString())+"-sidebar"`);
});
- this._disposers.selection = reaction(() => this.props.isSelected(),
- selected => !selected && setTimeout(() => {
- // Array.from(this._savedAnnotations.values()).forEach(v => v.forEach(a => a.remove()));
- // this._savedAnnotations.clear();
- })
- );
+ this._disposers.autoHeight = reaction(() => this.layoutDoc._autoHeight,
+ autoHeight => {
+ if (autoHeight) {
+ this.layoutDoc._nativeHeight = NumCast(this.props.Document[this.props.fieldKey + "-nativeHeight"]);
+ this.props.setHeight(NumCast(this.props.Document[this.props.fieldKey + "-nativeHeight"]) * (this.props.scaling?.() || 1));
+ }
+ });
if (this.webField?.href.indexOf("youtube") !== -1) {
const youtubeaspect = 400 / 315;
@@ -188,8 +184,8 @@ export class WebBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps
AnchorMenu.Instance?.GetAnchor(this._savedAnnotations) ??
Docs.Create.WebanchorDocument(this._url, {
title: StrCast(this.rootDoc.title + " " + this.layoutDoc._scrollTop),
- annotationOn: this.rootDoc,
- y: NumCast(this.layoutDoc._scrollTop)
+ y: NumCast(this.layoutDoc._scrollTop),
+ unrendered: true
});
this.addDocumentWrapper(anchor);
return anchor;
@@ -214,6 +210,8 @@ export class WebBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps
const mainContBounds = Utils.GetScreenTransform(this._mainCont.current!);
const scale = (this.props.scaling?.() || 1) * mainContBounds.scale;
const word = getWordAtPoint(e.target, e.clientX, e.clientY);
+ this._setPreviewCursor?.(e.clientX, e.clientY, false, true);
+ MarqueeAnnotator.clearAnnotations(this._savedAnnotations);
this._marqueeing = [e.clientX * scale + mainContBounds.translateX,
e.clientY * scale + mainContBounds.translateY - NumCast(this.layoutDoc._scrollTop) * scale];
if (word) {
@@ -228,6 +226,8 @@ export class WebBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps
}
}
+ getScrollHeight = () => this._scrollHeight;
+
isFirefox = () => {
return "InstallTrigger" in window; // navigator.userAgent.indexOf("Chrome") !== -1;
}
@@ -306,9 +306,7 @@ export class WebBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps
const history = Cast(this.dataDoc[this.fieldKey + "-history"], listSpec("string"), []);
if (future.length) {
this.dataDoc[this.fieldKey + "-history"] = new List<string>([...history, this._url]);
- this.dataDoc[this.fieldKey] = new WebField(new URL(this._url = future.pop()!));
- this._urlHash = WebBox.urlHash(this._url) + "";
- this._annotationKey = this._urlHash + "-annotations";
+ this.dataDoc[this.fieldKey] = new WebField(new URL(future.pop()!));
return true;
}
return false;
@@ -321,16 +319,15 @@ export class WebBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps
if (history.length) {
if (future === undefined) this.dataDoc[this.fieldKey + "-future"] = new List<string>([this._url]);
else this.dataDoc[this.fieldKey + "-future"] = new List<string>([...future, this._url]);
- this.dataDoc[this.fieldKey] = new WebField(new URL(this._url = history.pop()!));
- this._urlHash = WebBox.urlHash(this._url) + "";
- this._annotationKey = this._urlHash + "-annotations";
+ this.dataDoc[this.fieldKey] = new WebField(new URL(history.pop()!));
+ console.log(this._urlHash);
return true;
}
return false;
}
static urlHash = (s: string) => {
- return s.split('').reduce((a: any, b: any) => { a = ((a << 5) - a) + b.charCodeAt(0); return a & a; }, 0);
+ return Math.abs(s.split('').reduce((a: any, b: any) => { a = ((a << 5) - a) + b.charCodeAt(0); return a & a; }, 0));
}
@action
@@ -342,17 +339,10 @@ export class WebBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps
const history = Cast(this.dataDoc[this.fieldKey + "-history"], listSpec("string"));
const url = this.webField?.toString();
if (url && !preview) {
- if (history === undefined) {
- this.dataDoc[this.fieldKey + "-history"] = new List<string>([url]);
- } else {
- this.dataDoc[this.fieldKey + "-history"] = new List<string>([...history, url]);
- }
+ this.dataDoc[this.fieldKey + "-history"] = new List<string>([...(history || []), url]);
this.layoutDoc._scrollTop = 0;
future && (future.length = 0);
}
- this._url = newUrl;
- this._urlHash = WebBox.urlHash(this._url) + "";
- this._annotationKey = this._urlHash + "-annotations";
if (!preview) this.dataDoc[this.fieldKey] = new WebField(new URL(newUrl));
} catch (e) {
console.log("WebBox URL error:" + this._url);
@@ -405,27 +395,36 @@ export class WebBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps
const cm = ContextMenu.Instance;
const funcs: ContextMenuProps[] = [];
funcs.push({ description: (this.layoutDoc.useCors ? "Don't Use" : "Use") + " Cors", event: () => this.layoutDoc.useCors = !this.layoutDoc.useCors, icon: "snowflake" });
- funcs.push({ description: (this.layoutDoc[this.fieldKey + "-contentWidth"] ? "Unfreeze" : "Freeze") + " Content Width", event: () => this.layoutDoc[this.fieldKey + "-contentWidth"] = this.layoutDoc[this.fieldKey + "-contentWidth"] ? undefined : Doc.NativeWidth(this.layoutDoc), icon: "snowflake" });
- funcs.push({ description: "Toggle Annotation View ", event: () => this.Document._showSidebar = !this.Document._showSidebar, icon: "expand-arrows-alt" });
+ funcs.push({
+ description: (!this.layoutDoc.allowReflow ? "Allow" : "Prevent") + " Reflow", event: () => {
+ const nw = !this.layoutDoc.allowReflow ? undefined : Doc.NativeWidth(this.layoutDoc) - this.sidebarWidth() / (this.props.scaling?.() || 1);
+ this.layoutDoc.allowReflow = !nw;
+ if (nw) {
+ Doc.SetInPlace(this.layoutDoc, this.fieldKey + "-nativeWidth", nw, true);
+ }
+ }, icon: "snowflake"
+ });
cm.addItem({ description: "Options...", subitems: funcs, icon: "asterisk" });
}
@action
onMarqueeDown = (e: React.PointerEvent) => {
- if (!e.altKey && e.button === 0 && this.isContentActive(true) && ![InkTool.Highlighter, InkTool.Pen].includes(CurrentUserUtils.SelectedTool)) {
- this._marqueeing = [e.clientX, e.clientY];
- this.props.select(false);
+ if (!e.altKey && e.button === 0 && this.props.isContentActive(true) && ![InkTool.Highlighter, InkTool.Pen].includes(CurrentUserUtils.SelectedTool)) {
+ setupMoveUpEvents(this, e, action(e => {
+ MarqueeAnnotator.clearAnnotations(this._savedAnnotations);
+ this._marqueeing = [e.clientX, e.clientY];
+ return true;
+ }), returnFalse, () => MarqueeAnnotator.clearAnnotations(this._savedAnnotations), false);
}
}
@action finishMarquee = (x?: number, y?: number) => {
this._marqueeing = undefined;
this._isAnnotating = false;
this._iframeClick = undefined;
- x !== undefined && y !== undefined && this._setPreviewCursor?.(x, y, false);
+ x !== undefined && y !== undefined && this._setPreviewCursor?.(x, y, false, false);
}
- @computed
- get urlContent() {
+ @computed get urlContent() {
const field = this.dataDoc[this.props.fieldKey];
let view;
if (field instanceof HtmlField) {
@@ -492,8 +491,8 @@ export class WebBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps
NumCast(this.layoutDoc.nativeWidth)
@computed get content() {
- return <div className={"webBox-cont" + (!this.props.docViewPath().lastElement()?.docView?._pendingDoubleClick && this.isContentActive() && CurrentUserUtils.SelectedTool === InkTool.None && !DocumentDecorations.Instance?.Interacting ? "-interactive" : "")}
- style={{ width: NumCast(this.layoutDoc[this.fieldKey + "-contentWidth"]) || `${100 / (this.props.scaling?.() || 1)}%`, }}>
+ return <div className={"webBox-cont" + (!this.props.docViewPath().lastElement()?.docView?._pendingDoubleClick && this.props.isContentActive() && CurrentUserUtils.SelectedTool === InkTool.None && !DocumentDecorations.Instance?.Interacting ? "-interactive" : "")}
+ style={{ width: !this.layoutDoc.allowReflow ? NumCast(this.layoutDoc[this.fieldKey + "-nativeWidth"]) || `100%` : "100%", }}>
{this.urlContent}
</div>;
}
@@ -511,17 +510,42 @@ export class WebBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps
@computed get SidebarShown() { return this._showSidebar || this.layoutDoc._showSidebar ? true : false; }
showInfo = action((anno: Opt<Doc>) => this._overlayAnnoInfo = anno);
- setPreviewCursor = (func?: (x: number, y: number, drag: boolean) => void) => this._setPreviewCursor = func;
+ setPreviewCursor = (func?: (x: number, y: number, drag: boolean, hide: boolean) => void) => this._setPreviewCursor = func;
panelWidth = () => this.props.PanelWidth() / (this.props.scaling?.() || 1) - this.sidebarWidth(); // (this.Document.scrollHeight || Doc.NativeHeight(this.Document) || 0);
panelHeight = () => this.props.PanelHeight() / (this.props.scaling?.() || 1); // () => this._pageSizes.length && this._pageSizes[0] ? this._pageSizes[0].width : Doc.NativeWidth(this.Document);
scrollXf = () => this.props.ScreenToLocalTransform().translate(0, NumCast(this.layoutDoc._scrollTop));
anchorMenuClick = () => this._sidebarRef.current?.anchorMenuClick;
+ transparentFilter = () => [...this.props.docFilters(), Utils.IsTransparentFilter()];
+ opaqueFilter = () => [...this.props.docFilters(), Utils.IsOpaqueFilter()];
render() {
const pointerEvents = this.props.layerProvider?.(this.layoutDoc) === false ? "none" : undefined;
const previewScale = this._previewNativeWidth ? 1 - this.sidebarWidth() / this._previewNativeWidth : 1;
const scale = previewScale * (this.props.scaling?.() || 1);
+ const renderAnnotations = (docFilters?: () => string[]) =>
+ <CollectionFreeFormView {...OmitKeys(this.props, ["NativeWidth", "NativeHeight", "setContentView"]).omit}
+ renderDepth={this.props.renderDepth + 1}
+ isAnnotationOverlay={true}
+ fieldKey={this.annotationKey}
+ CollectionView={undefined}
+ setPreviewCursor={this.setPreviewCursor}
+ PanelWidth={this.panelWidth}
+ PanelHeight={this.panelHeight}
+ ScreenToLocalTransform={this.scrollXf}
+ scaling={returnOne}
+ dropAction={"alias"}
+ docFilters={docFilters || this.props.docFilters}
+ dontRenderDocuments={docFilters ? false : true}
+ select={emptyFunction}
+ ContentScaling={returnOne}
+ bringToFront={emptyFunction}
+ whenChildContentsActiveChanged={this.whenChildContentsActiveChanged}
+ removeDocument={this.removeDocument}
+ moveDocument={this.moveDocument}
+ addDocument={this.sidebarAddDocument}
+ childPointerEvents={true}
+ pointerEvents={CurrentUserUtils.SelectedTool !== InkTool.None || this._isAnnotating || SnappingManager.GetIsDragging() ? "all" : "none"} />;
return (
- <div className="webBox" ref={this._mainCont} style={{ pointerEvents: this.isContentActive() ? "all" : this.isContentActive() || SnappingManager.GetIsDragging() ? undefined : "none" }} >
+ <div className="webBox" ref={this._mainCont} style={{ pointerEvents: this.props.isContentActive() ? "all" : this.props.isContentActive() || SnappingManager.GetIsDragging() ? undefined : "none" }} >
<div className={`webBox-container`} style={{ pointerEvents }} onContextMenu={this.specificContextMenu}>
<base target="_blank" />
<div className={"webBox-outerContent"} ref={this._outerRef}
@@ -537,27 +561,11 @@ export class WebBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps
>
<div className={"webBox-innerContent"} style={{ height: NumCast(this.scrollHeight, 50), pointerEvents }}>
{this.content}
- <CollectionFreeFormView {...OmitKeys(this.props, ["NativeWidth", "NativeHeight", "setContentView"]).omit}
- renderDepth={this.props.renderDepth + 1}
- isAnnotationOverlay={true}
- fieldKey={this.annotationKey}
- CollectionView={undefined}
- setPreviewCursor={this.setPreviewCursor}
- PanelWidth={this.panelWidth}
- PanelHeight={this.panelHeight}
- ScreenToLocalTransform={this.scrollXf}
- scaling={returnOne}
- dropAction={"alias"}
- select={emptyFunction}
- isContentActive={returnFalse}
- ContentScaling={returnOne}
- bringToFront={emptyFunction}
- whenChildContentsActiveChanged={this.whenChildContentsActiveChanged}
- removeDocument={this.removeDocument}
- moveDocument={this.moveDocument}
- addDocument={this.sidebarAddDocument}
- childPointerEvents={true}
- pointerEvents={this._isAnnotating || SnappingManager.GetIsDragging() ? "all" : "none"} />
+ <div style={{ mixBlendMode: "multiply" }}>
+ {renderAnnotations(this.transparentFilter)}
+ </div>
+ {renderAnnotations(this.opaqueFilter)}
+ {SnappingManager.GetIsDragging() ? (null) : renderAnnotations()}
{this.annotationLayer}
</div>
</div>
@@ -581,19 +589,22 @@ export class WebBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps
rootDoc={this.rootDoc}
layoutDoc={this.layoutDoc}
dataDoc={this.dataDoc}
- // usePanelWidth={false}
+ setHeight={emptyFunction}
nativeWidth={this._previewNativeWidth ?? NumCast(this.layoutDoc._nativeWidth)}
showSidebar={this.SidebarShown}
sidebarAddDocument={this.sidebarAddDocument}
moveDocument={this.moveDocument}
removeDocument={this.removeDocument}
- isContentActive={this.isContentActive}
/>
- <button className="webBox-overlayButton-sidebar" key="sidebar" title="Toggle Sidebar"
- style={{ display: !this.isContentActive() ? "none" : undefined }}
+ <div className="webBox-overlayButton-sidebar" key="sidebar" title="Toggle Sidebar"
+ style={{
+ display: !this.props.isContentActive() ? "none" : undefined,
+ top: StrCast(this.rootDoc._showTitle) === "title" ? 20 : 5,
+ backgroundColor: this.SidebarShown ? Colors.MEDIUM_BLUE : Colors.BLACK
+ }}
onPointerDown={this.sidebarBtnDown} >
- <FontAwesomeIcon style={{ color: "white" }} icon={"chevron-left"} size="sm" />
- </button>
+ <FontAwesomeIcon style={{ color: Colors.WHITE }} icon={"comment-alt"} size="sm" />
+ </div>
</div>);
}
}
diff --git a/src/client/views/nodes/button/ButtonInterface.ts b/src/client/views/nodes/button/ButtonInterface.ts
new file mode 100644
index 000000000..0aa2ac8e1
--- /dev/null
+++ b/src/client/views/nodes/button/ButtonInterface.ts
@@ -0,0 +1,12 @@
+import { Doc } from "../../../../fields/Doc";
+import { IconProp } from "@fortawesome/fontawesome-svg-core";
+import { ButtonType } from "./FontIconBox";
+
+export interface IButtonProps {
+ type: string | ButtonType;
+ rootDoc: Doc;
+ label: any;
+ icon: IconProp;
+ color: string;
+ backgroundColor: string;
+} \ No newline at end of file
diff --git a/src/client/views/nodes/button/ButtonScripts.ts b/src/client/views/nodes/button/ButtonScripts.ts
new file mode 100644
index 000000000..bb4dd8bc9
--- /dev/null
+++ b/src/client/views/nodes/button/ButtonScripts.ts
@@ -0,0 +1,14 @@
+import { Scripting } from "../../../util/Scripting";
+import { SelectionManager } from "../../../util/SelectionManager";
+
+// toggle: Set overlay status of selected document
+Scripting.addGlobal(function changeView(view: string) {
+ const selected = SelectionManager.Views().length ? SelectionManager.Views()[0] : undefined;
+ selected ? selected.Document._viewType = view : console.log("[FontIconBox.tsx] changeView failed");
+});
+
+// toggle: Set overlay status of selected document
+Scripting.addGlobal(function toggleOverlay() {
+ const selected = SelectionManager.Views().length ? SelectionManager.Views()[0] : undefined;
+ selected ? selected.props.CollectionFreeFormDocumentView?.().float() : console.log("failed");
+}); \ No newline at end of file
diff --git a/src/client/views/nodes/button/FontIconBadge.scss b/src/client/views/nodes/button/FontIconBadge.scss
new file mode 100644
index 000000000..78f506e57
--- /dev/null
+++ b/src/client/views/nodes/button/FontIconBadge.scss
@@ -0,0 +1,11 @@
+.fontIconBadge {
+ background: red;
+ width: 15px;
+ height: 15px;
+ top: 8px;
+ display: block;
+ position: absolute;
+ right: 5;
+ border-radius: 50%;
+ text-align: center;
+} \ No newline at end of file
diff --git a/src/client/views/nodes/button/FontIconBadge.tsx b/src/client/views/nodes/button/FontIconBadge.tsx
new file mode 100644
index 000000000..cf86b5e07
--- /dev/null
+++ b/src/client/views/nodes/button/FontIconBadge.tsx
@@ -0,0 +1,37 @@
+import { observer } from "mobx-react";
+import * as React from "react";
+import { AclPrivate, Doc, DocListCast } from "../../../../fields/Doc";
+import { GetEffectiveAcl } from "../../../../fields/util";
+import { emptyFunction, returnFalse, setupMoveUpEvents } from "../../../../Utils";
+import { DragManager } from "../../../util/DragManager";
+import "./FontIconBadge.scss";
+
+interface FontIconBadgeProps {
+ collection: Doc | undefined;
+}
+
+@observer
+export class FontIconBadge extends React.Component<FontIconBadgeProps> {
+ _notifsRef = React.createRef<HTMLDivElement>();
+
+ onPointerDown = (e: React.PointerEvent) => {
+ setupMoveUpEvents(this, e,
+ (e: PointerEvent) => {
+ const dragData = new DragManager.DocumentDragData([this.props.collection!]);
+ DragManager.StartDocumentDrag([this._notifsRef.current!], dragData, e.x, e.y);
+ return true;
+ },
+ returnFalse, emptyFunction, false);
+ }
+
+ render() {
+ if (!(this.props.collection instanceof Doc)) return (null);
+ const length = DocListCast(this.props.collection.data).filter(d => GetEffectiveAcl(d) !== AclPrivate).length; // Object.keys(d).length).length; // filter out any documents that we can't read
+ return <div className="fontIconBadge-container" ref={this._notifsRef}>
+ <div className="fontIconBadge" style={length > 0 ? { "display": "initial" } : { "display": "none" }}
+ onPointerDown={this.onPointerDown} >
+ {length}
+ </div>
+ </div>;
+ }
+} \ No newline at end of file
diff --git a/src/client/views/nodes/button/FontIconBox.scss b/src/client/views/nodes/button/FontIconBox.scss
new file mode 100644
index 000000000..079c767b9
--- /dev/null
+++ b/src/client/views/nodes/button/FontIconBox.scss
@@ -0,0 +1,411 @@
+@import "../../global/globalCssVariables";
+
+.menuButton {
+ height: 100%;
+ display: flex;
+ justify-content: center;
+ align-items: center;
+ font-size: 80%;
+ border-radius: $standard-border-radius;
+ transition: 0.15s;
+
+ .menuButton-wrap {
+ grid-column: 1;
+ justify-content: center;
+ align-items: center;
+ text-align: center;
+ }
+
+ .fontIconBox-label {
+ color: $white;
+ position: relative;
+ text-align: center;
+ font-size: 7px;
+ letter-spacing: normal;
+ background-color: inherit;
+ margin-top: 5px;
+ border-radius: 8px;
+ padding: 0;
+ width: 100%;
+ font-family: 'ROBOTO';
+ text-transform: uppercase;
+ font-weight: bold;
+ transition: 0.15s;
+
+
+ }
+
+ .fontIconBox-icon {
+ width: 80%;
+ height: 80%;
+ }
+
+ &.clickBtn {
+ cursor: pointer;
+
+ &:hover {
+ background-color: rgba(0, 0, 0, 0.3) !important;
+ }
+
+ svg {
+ width: 50% !important;
+ height: 50%;
+ }
+ }
+
+ &.textBtn {
+ display: grid;
+ /* grid-row: auto; */
+ grid-auto-flow: column;
+ cursor: pointer;
+ width: 100%;
+ justify-content: center;
+ align-items: center;
+ justify-items: center;
+
+ &:hover {
+ filter:brightness(0.85) !important;
+ }
+ }
+
+ &.tglBtn {
+ cursor: pointer;
+
+ &.switch {
+ //TOGGLE
+
+ .switch {
+ position: relative;
+ display: inline-block;
+ width: 100%;
+ height: 25px;
+ margin: 0;
+ }
+
+ .switch input {
+ opacity: 0;
+ width: 0;
+ height: 0;
+ }
+
+ .slider {
+ position: absolute;
+ cursor: pointer;
+ top: 0;
+ left: 0;
+ right: 0;
+ bottom: 0;
+ background-color: lightgrey;
+ -webkit-transition: .4s;
+ transition: .4s;
+ }
+
+ .slider:before {
+ position: absolute;
+ content: "";
+ height: 21px;
+ width: 21px;
+ left: 2px;
+ bottom: 2px;
+ background-color: $white;
+ -webkit-transition: .4s;
+ transition: .4s;
+ }
+
+ input:checked+.slider {
+ background-color: $medium-blue;
+ }
+
+ input:focus+.slider {
+ box-shadow: 0 0 1px $medium-blue;
+ }
+
+ input:checked+.slider:before {
+ -webkit-transform: translateX(26px);
+ -ms-transform: translateX(26px);
+ transform: translateX(26px);
+ }
+
+ /* Rounded sliders */
+ .slider.round {
+ border-radius: $standard-border-radius;
+ }
+
+ .slider.round:before {
+ border-radius: $standard-border-radius;
+ }
+ }
+
+ svg {
+ width: 50% !important;
+ height: 50%;
+ }
+
+ &:hover {
+ background-color: rgba(0, 0, 0, 0.3);
+ }
+ }
+
+ &.toolBtn {
+ cursor: pointer;
+ width: 100%;
+ border-radius: 100%;
+
+ svg {
+ width: 60% !important;
+ height: 60%;
+ }
+ }
+
+ &.menuBtn {
+ cursor: pointer !important;
+ border-radius: 0px;
+ flex-direction: column;
+
+ svg {
+ width: 45% !important;
+ height: 45%;
+ }
+
+ &:hover{
+ filter: brightness(0.85);
+ }
+ }
+
+
+
+ &.colorBtn {
+ color: black;
+ cursor: pointer;
+ flex-direction: column;
+ background: transparent;
+
+ .colorButton-color {
+ margin-top: 3px;
+ width: 80%;
+ height: 3px;
+ }
+
+ .menuButton-dropdownBox {
+ position: absolute;
+ width: fit-content;
+ height: fit-content;
+ color: black;
+ top: 100%;
+ left: 0;
+ z-index: 21;
+ background-color: #e3e3e3;
+ box-shadow: 0px 3px 4px rgba(0, 0, 0, 0.3);
+ border-radius: 3px;
+ }
+
+ &:hover {
+ background-color: rgba(0, 0, 0, 0.3) !important;
+ }
+ }
+
+ &.drpdownList {
+ width: 100%;
+ display: grid;
+ grid-auto-columns: 80px 20px;
+ justify-items: center;
+ font-family: 'Roboto';
+ white-space: nowrap;
+ text-overflow: ellipsis;
+ font-size: 13;
+ font-weight: 600;
+ overflow: hidden;
+ cursor: pointer;
+ background: transparent;
+ align-content: center;
+ align-items: center;
+
+ &:hover {
+ background-color: rgba(0, 0, 0, 0.3) !important;
+ }
+
+ .menuButton-dropdownList {
+ position: absolute;
+ width: 150px;
+ height: fit-content;
+ top: 100%;
+ z-index: 21;
+ background-color: $white;
+ box-shadow: 0px 3px 4px rgba(0, 0, 0, 0.3);
+ padding: 1px;
+
+ .list-item {
+ color: $black;
+ width: 100%;
+ height: 25px;
+ font-weight: 400;
+ display: flex;
+ justify-content: left;
+ align-items: center;
+ padding-left: 5px;
+ }
+
+ .list-item:hover {
+ background-color: lightgrey;
+ }
+ }
+ }
+
+ &.numBtn {
+ cursor: pointer;
+ background: transparent;
+
+ &:hover {
+ background-color: rgba(0, 0, 0, 0.3) !important;
+ }
+
+ &.slider {
+ color: $white;
+ cursor: pointer;
+ flex-direction: column;
+ background: transparent;
+
+ .menu-slider {
+ width: 100px;
+ }
+
+ .menuButton-dropdownBox {
+ position: absolute;
+ width: fit-content;
+ height: fit-content;
+ top: 100%;
+ z-index: 21;
+ background-color: #e3e3e3;
+ box-shadow: 0px 3px 4px rgba(0, 0, 0, 0.3);
+ border-radius: $standard-border-radius;
+ }
+ }
+
+ .button {
+ width: 25%;
+ display: flex;
+ align-items: center;
+ justify-content: center;
+
+ &.number {
+ width: 50%;
+
+ .button-input {
+ background: none;
+ border: none;
+ text-align: right;
+ width: 100%;
+ color: $white;
+ height: 100%;
+ text-align: center;
+ }
+
+ .button-input:focus {
+ outline: none;
+ }
+ }
+ }
+
+ &.list {
+ width: 100%;
+ justify-content: space-around;
+ border: $standard-border;
+
+ .menuButton-dropdownList {
+ position: absolute;
+ width: fit-content;
+ height: fit-content;
+ min-width: 50%;
+ max-height: 50vh;
+ overflow-y: scroll;
+ top: 100%;
+ z-index: 21;
+ background-color: $white;
+ box-shadow: 0px 3px 4px rgba(0, 0, 0, 0.3);
+ padding: 1px;
+
+ .list-item {
+ color: $black;
+ width: 100%;
+ height: 25px;
+ font-weight: 400;
+ display: flex;
+ justify-content: center;
+ align-items: center;
+ }
+
+ .list-item:hover {
+ background-color: lightgrey;
+ }
+ }
+ }
+ }
+
+ &.editableText {
+ cursor: text;
+ display: flex;
+ flex-direction: row;
+ gap: 5px;
+ padding-left: 10px;
+ justify-content: flex-start;
+ color: black;
+ background-color: $light-gray;
+ padding: 5px;
+ padding-left: 10px;
+ width: 100%;
+ height: 100%;
+ }
+
+ &.drpDownBtn {
+ cursor: pointer;
+ background: transparent;
+ border: solid 0.5px grey;
+
+ &.true {
+ background: rgba(0, 0, 0, 0.3);
+ }
+
+ .menuButton-dropdownBox {
+ position: absolute;
+ width: 150px;
+ height: 250px;
+ top: 100%;
+ background-color: #e3e3e3;
+ box-shadow: 0px 3px 4px rgba(0, 0, 0, 0.3);
+ border-radius: $standard-border-radius;
+ }
+ }
+
+ .menuButton-dropdown {
+ display: flex;
+ justify-content: center;
+ align-items: center;
+ font-size: 15px;
+ grid-column: 2;
+ border-radius: 0px 7px 7px 0px;
+ width: 13px;
+ height: 100%;
+ right: 0;
+ }
+
+ .menuButton-dropdown-header {
+ width: 100%;
+ font-weight: 300;
+ padding: 5px;
+ overflow: hidden;
+ font-size: 12px;
+ white-space: nowrap;
+ text-overflow: ellipsis;
+ }
+
+ .dropbox-background {
+ width: 100vw;
+ height: 100vh;
+ top: 0;
+ z-index: 20;
+ left: 0;
+ background: transparent;
+ position: fixed;
+ }
+
+} \ No newline at end of file
diff --git a/src/client/views/nodes/button/FontIconBox.tsx b/src/client/views/nodes/button/FontIconBox.tsx
new file mode 100644
index 000000000..9d1ef937f
--- /dev/null
+++ b/src/client/views/nodes/button/FontIconBox.tsx
@@ -0,0 +1,904 @@
+import { IconProp } from '@fortawesome/fontawesome-svg-core';
+import { FontAwesomeIcon } from '@fortawesome/react-fontawesome';
+import { Tooltip } from '@material-ui/core';
+import { action, computed, observable } from 'mobx';
+import { observer } from 'mobx-react';
+import * as React from 'react';
+import { ColorState, SketchPicker } from 'react-color';
+import { Doc, StrListCast } from '../../../../fields/Doc';
+import { InkTool } from '../../../../fields/InkField';
+import { createSchema, makeInterface } from '../../../../fields/Schema';
+import { ScriptField } from '../../../../fields/ScriptField';
+import { BoolCast, Cast, NumCast, StrCast } from '../../../../fields/Types';
+import { WebField } from '../../../../fields/URLField';
+import { DocumentType } from '../../../documents/DocumentTypes';
+import { Scripting } from "../../../util/Scripting";
+import { SelectionManager } from '../../../util/SelectionManager';
+import { ColorScheme } from '../../../util/SettingsManager';
+import { UndoManager, undoBatch } from '../../../util/UndoManager';
+import { CollectionViewType } from '../../collections/CollectionView';
+import { ContextMenu } from '../../ContextMenu';
+import { DocComponent } from '../../DocComponent';
+import { EditableView } from '../../EditableView';
+import { GestureOverlay } from '../../GestureOverlay';
+import { Colors } from '../../global/globalEnums';
+import { SetActiveInkColor, ActiveFillColor, SetActiveFillColor, ActiveInkWidth, ActiveInkColor, SetActiveInkWidth } from '../../InkingStroke';
+import { StyleProp } from '../../StyleProvider';
+import { FieldView, FieldViewProps } from '.././FieldView';
+import { RichTextMenu } from '../formattedText/RichTextMenu';
+import { Utils } from '../../../../Utils';
+import { IButtonProps } from './ButtonInterface';
+import { FontIconBadge } from './FontIconBadge';
+import './FontIconBox.scss';
+import { WebBox } from '../WebBox';
+const FontIconSchema = createSchema({
+ icon: "string",
+});
+
+export enum ButtonType {
+ TextButton = "textBtn",
+ MenuButton = "menuBtn",
+ DropdownList = "drpdownList",
+ DropdownButton = "drpdownBtn",
+ ClickButton = "clickBtn",
+ DoubleButton = "dblBtn",
+ ToggleButton = "tglBtn",
+ ColorButton = "colorBtn",
+ ToolButton = "toolBtn",
+ NumberButton = "numBtn",
+ EditableText = "editableText"
+}
+
+export enum NumButtonType {
+ Slider = "slider",
+ DropdownOptions = "list",
+ Inline = "inline"
+}
+
+export interface ButtonProps extends FieldViewProps {
+ type?: ButtonType;
+}
+
+type FontIconDocument = makeInterface<[typeof FontIconSchema]>;
+const FontIconDocument = makeInterface(FontIconSchema);
+@observer
+export class FontIconBox extends DocComponent<ButtonProps, FontIconDocument>(FontIconDocument) {
+ public static LayoutString(fieldKey: string) { return FieldView.LayoutString(FontIconBox, fieldKey); }
+ showTemplate = (): void => {
+ const dragFactory = Cast(this.layoutDoc.dragFactory, Doc, null);
+ dragFactory && this.props.addDocTab(dragFactory, "add:right");
+ }
+ dragAsTemplate = (): void => { this.layoutDoc.onDragStart = ScriptField.MakeFunction('getCopy(this.dragFactory, true)'); };
+ useAsPrototype = (): void => { this.layoutDoc.onDragStart = ScriptField.MakeFunction('makeDelegate(this.dragFactory, true)'); };
+
+ specificContextMenu = (): void => {
+ if (!Doc.UserDoc().noviceMode) {
+ const cm = ContextMenu.Instance;
+ cm.addItem({ description: "Show Template", event: this.showTemplate, icon: "tag" });
+ cm.addItem({ description: "Use as Render Template", event: this.dragAsTemplate, icon: "tag" });
+ cm.addItem({ description: "Use as Prototype", event: this.useAsPrototype, icon: "tag" });
+ }
+ }
+
+ // Determining UI Specs
+ @observable private label = StrCast(this.rootDoc.label, StrCast(this.rootDoc.title));
+ @observable private icon = StrCast(this.dataDoc.icon, "user") as any;
+ @observable private dropdown: boolean = BoolCast(this.rootDoc.dropDownOpen);
+ @observable private buttonList: string[] = StrListCast(this.rootDoc.btnList);
+ @observable private type = StrCast(this.rootDoc.btnType);
+
+ /**
+ * Types of buttons in dash:
+ * - Main menu button (LHS)
+ * - Tool button
+ * - Expandable button (CollectionLinearView)
+ * - Button inside of CollectionLinearView vs. outside of CollectionLinearView
+ * - Action button
+ * - Dropdown button
+ * - Color button
+ * - Dropdown list
+ * - Number button
+ **/
+
+ _batch: UndoManager.Batch | undefined = undefined;
+ /**
+ * Number button
+ */
+ @computed get numberButton() {
+ const numBtnType: string = StrCast(this.rootDoc.numBtnType);
+ const setValue = (value: number) => {
+ // Script for running the toggle
+ const script: string = StrCast(this.rootDoc.script) + "(" + value + ")";
+ ScriptField.MakeScript(script)?.script.run();
+ };
+
+ // Script for checking the outcome of the toggle
+ const checkScript: string = StrCast(this.rootDoc.script) + "(0, true)";
+ const checkResult: number = ScriptField.MakeScript(checkScript)?.script.run().result;
+
+
+ if (numBtnType === NumButtonType.Slider) {
+ const dropdown =
+ <div
+ className="menuButton-dropdownBox"
+ onPointerDown={e => e.stopPropagation()}
+ >
+ <input type="range" step="1" min={NumCast(this.rootDoc.numBtnMin, 0)} max={NumCast(this.rootDoc.numBtnMax, 100)} value={checkResult}
+ className={"menu-slider"} id="slider"
+ onPointerDown={() => this._batch = UndoManager.StartBatch("presDuration")}
+ onPointerUp={() => this._batch?.end()}
+ onChange={e => { e.stopPropagation(); setValue(Number(e.target.value)); }}
+ />
+ </div>;
+ return (
+ <div
+ className={`menuButton ${this.type} ${numBtnType}`}
+ onClick={action(() => this.rootDoc.dropDownOpen = !this.rootDoc.dropDownOpen)}
+ >
+ {checkResult}
+ {this.rootDoc.dropDownOpen ? dropdown : null}
+ </div>
+ );
+ } else if (numBtnType === NumButtonType.DropdownOptions) {
+ const items: number[] = [];
+ for (let i = 0; i < 100; i++) {
+ if (i % 2 === 0) {
+ items.push(i);
+ }
+ }
+ const list = items.map((value) => {
+ return <div className="list-item" key={`${value}`}
+ style={{
+ backgroundColor: value === checkResult ? Colors.LIGHT_BLUE : undefined
+ }}
+ onClick={() => setValue(value)}>
+ {value}
+ </div>;
+ });
+ return (
+ <div
+ className={`menuButton ${this.type} ${numBtnType}`}
+ >
+ <div className={`button`} onClick={action((e) => setValue(checkResult - 1))}>
+ <FontAwesomeIcon className={`fontIconBox-icon-${this.type}`} icon={"minus"} />
+ </div>
+ <div
+ className={`button ${'number'}`}
+ onPointerDown={(e) => {
+ e.stopPropagation();
+ e.preventDefault();
+ }}
+ onClick={action(() => this.rootDoc.dropDownOpen = !this.rootDoc.dropDownOpen)}
+ >
+ <input
+ style={{ width: 30 }}
+ className="button-input"
+ type="number"
+ value={checkResult}
+ onChange={action((e) => setValue(Number(e.target.value)))}
+ />
+ </div>
+ <div className={`button`} onClick={action((e) => setValue(checkResult + 1))}>
+ <FontAwesomeIcon className={`fontIconBox-icon-${this.type}`} icon={"plus"} />
+ </div>
+
+ {this.rootDoc.dropDownOpen ?
+ <div>
+ <div className="menuButton-dropdownList"
+ style={{ left: "25%" }}>
+ {list}
+ </div>
+ <div className="dropbox-background" onClick={(e) => { e.stopPropagation(); this.rootDoc.dropDownOpen = false; }} />
+ </div> : null}
+
+ </div>
+ );
+ } else {
+ return (
+ <div>
+
+ </div>
+ );
+ }
+
+
+ }
+
+ /**
+ * Dropdown button
+ */
+ @computed get dropdownButton() {
+ const active: string = StrCast(this.rootDoc.dropDownOpen);
+ const color = this.props.styleProvider?.(this.rootDoc, this.props, StyleProp.Color);
+ const backgroundColor = this.props.styleProvider?.(this.rootDoc, this.props, StyleProp.BackgroundColor);
+ return (
+ <div className={`menuButton ${this.type} ${active}`}
+ style={{ color: color, backgroundColor: backgroundColor, borderBottomLeftRadius: this.dropdown ? 0 : undefined }}
+ onClick={action(() => this.rootDoc.dropDownOpen = !this.rootDoc.dropDownOpen)}>
+ <FontAwesomeIcon className={`fontIconBox-icon-${this.type}`} icon={this.icon} color={color} />
+ {!this.label || !Doc.UserDoc()._showLabel ? (null) : <div className="fontIconBox-label" style={{ color: color, backgroundColor: backgroundColor }}> {this.label} </div>}
+ <div
+ className="menuButton-dropdown"
+ style={{ borderBottomRightRadius: this.dropdown ? 0 : undefined }}>
+ <FontAwesomeIcon icon={'caret-down'} color={color} size="sm" />
+ </div>
+ {this.rootDoc.dropDownOpen ?
+ <div className="menuButton-dropdownBox">
+ {/* DROPDOWN BOX CONTENTS */}
+ </div> : null}
+ </div>
+ );
+ }
+
+ /**
+ * Dropdown list
+ */
+ @computed get dropdownListButton() {
+ const active: string = StrCast(this.rootDoc.dropDownOpen);
+ const color = this.props.styleProvider?.(this.rootDoc, this.props, StyleProp.Color);
+ const backgroundColor = this.props.styleProvider?.(this.rootDoc, this.props, StyleProp.BackgroundColor);
+
+ const script: string = StrCast(this.rootDoc.script);
+
+ let noviceList: string[] = [];
+ let text: string | undefined;
+ let dropdown = true;
+ let icon: IconProp = "caret-down";
+
+ if (script === 'setView') {
+ const selected = SelectionManager.Docs().lastElement();
+ if (selected) {
+ if (StrCast(selected.type) === DocumentType.COL) {
+ text = StrCast(selected._viewType);
+ } else {
+ dropdown = false;
+ text = selected.type === DocumentType.RTF ? "Text" : StrCast(selected.type);
+ icon = Doc.toIcon(selected);
+ }
+ } else {
+ dropdown = false;
+ icon = "globe-asia";
+ text = "User Default";
+ }
+ noviceList = [CollectionViewType.Freeform, CollectionViewType.Schema, CollectionViewType.Stacking];
+ } else if (script === 'setFont') {
+ const selected = SelectionManager.Docs().lastElement();
+ text = StrCast((selected?.type === DocumentType.RTF ? selected : Doc.UserDoc())._fontFamily);
+ noviceList = ["Roboto", "Times New Roman", "Arial", "Georgia",
+ "Comic Sans MS", "Tahoma", "Impact", "Crimson Text"];
+ }
+
+ // Get items to place into the list
+ const list = this.buttonList.map((value) => {
+ if (Doc.UserDoc().noviceMode && !noviceList.includes(value)) {
+ return;
+ }
+ const click = () => {
+ const s = ScriptField.MakeScript(script + '("' + value + '")');
+ if (s) {
+ s.script.run().result;
+ }
+ };
+ return <div className="list-item" key={`${value}`}
+ style={{
+ fontFamily: script === 'setFont' ? value : undefined,
+ backgroundColor: value === text ? Colors.LIGHT_BLUE : undefined
+ }}
+ onClick={click}>
+ {value[0].toUpperCase() + value.slice(1)}
+ </div>;
+ });
+
+ const label = !this.label || !Doc.UserDoc()._showLabel ? (null) :
+ <div className="fontIconBox-label" style={{ color: color, backgroundColor: backgroundColor, position: "absolute" }}>
+ {this.label}
+ </div>;
+
+ return (
+ <div className={`menuButton ${this.type} ${active}`}
+ style={{ backgroundColor: this.rootDoc.dropDownOpen ? Colors.MEDIUM_BLUE : backgroundColor, color: color, display: dropdown ? undefined : "flex" }}
+ onClick={dropdown ? () => this.rootDoc.dropDownOpen = !this.rootDoc.dropDownOpen : undefined}>
+ {dropdown ? (null) : <FontAwesomeIcon style={{ marginLeft: 5 }} className={`fontIconBox-icon-${this.type}`} icon={icon} color={color} />}
+ <div className="menuButton-dropdown-header">
+ {text && text[0].toUpperCase() + text.slice(1)}
+ </div>
+ {label}
+ {!dropdown ? (null) : <div className="menuButton-dropDown">
+ <FontAwesomeIcon icon={icon} color={color} size="sm" />
+ </div>}
+ {this.rootDoc.dropDownOpen ?
+ <div>
+ <div className="menuButton-dropdownList"
+ style={{ left: 0 }}>
+ {list}
+ </div>
+ <div className="dropbox-background" onClick={(e) => { e.stopPropagation(); this.rootDoc.dropDownOpen = false; }} />
+ </div>
+ : null}
+ </div>
+ );
+ }
+
+ /**
+ * Color button
+ */
+ @computed get colorButton() {
+ const active: string = StrCast(this.rootDoc.dropDownOpen);
+ const color = this.props.styleProvider?.(this.rootDoc, this.props, StyleProp.Color);
+ const backgroundColor = this.props.styleProvider?.(this.rootDoc, this.props, StyleProp.BackgroundColor);
+
+ const script: string = StrCast(this.rootDoc.script);
+ const scriptCheck: string = script + "(undefined, true)";
+ const boolResult = ScriptField.MakeScript(scriptCheck)?.script.run().result;
+
+ const colorOptions: string[] = ['#D0021B', '#F5A623', '#F8E71C', '#8B572A', '#7ED321', '#417505',
+ '#9013FE', '#4A90E2', '#50E3C2', '#B8E986', '#000000', '#4A4A4A', '#9B9B9B',
+ '#FFFFFF', '#f1efeb', "transparent"];
+
+ const colorBox = (func: (color: ColorState) => void) => <SketchPicker
+ disableAlpha={false}
+ onChange={func}
+ color={boolResult ? boolResult : "#FFFFFF"}
+ presetColors={colorOptions} />;
+ const label = !this.label || !Doc.UserDoc()._showLabel ? (null) :
+ <div className="fontIconBox-label" style={{ color: color, backgroundColor: backgroundColor, position: "absolute" }}>
+ {this.label}
+ </div>;
+
+ const dropdownCaret = <div
+ className="menuButton-dropDown"
+ style={{ borderBottomRightRadius: this.dropdown ? 0 : undefined }}>
+ <FontAwesomeIcon icon={'caret-down'} color={color} size="sm" />
+ </div>;
+
+ const click = (value: ColorState) => {
+ const s = ScriptField.MakeScript(script + '("' + Utils.colorString(value) + '", false)');
+ s && undoBatch(() => s.script.run().result)();
+ };
+ return (
+ <div className={`menuButton ${this.type} ${active}`}
+ style={{ color: color, borderBottomLeftRadius: this.dropdown ? 0 : undefined }}
+ onClick={() => this.rootDoc.dropDownOpen = !this.rootDoc.dropDownOpen}
+ onPointerDown={e => e.stopPropagation()}>
+ <FontAwesomeIcon className={`fontIconBox-icon-${this.type}`} icon={this.icon} color={color} />
+ <div className="colorButton-color" style={{ backgroundColor: boolResult ? boolResult : "#FFFFFF" }} />
+ {label}
+ {/* {dropdownCaret} */}
+ {this.rootDoc.dropDownOpen ?
+ <div>
+ <div className="menuButton-dropdownBox"
+ onPointerDown={e => e.stopPropagation()}
+ onClick={e => e.stopPropagation()}>
+ {colorBox(click)}
+ </div>
+ <div className="dropbox-background" onClick={(e) => { e.stopPropagation(); this.rootDoc.dropDownOpen = false; }} />
+ </div>
+ : null}
+ </div>
+ );
+ }
+
+ @computed get toggleButton() {
+ // Determine the type of toggle button
+ const switchToggle: boolean = BoolCast(this.rootDoc.switchToggle);
+ const buttonText: string = StrCast(this.rootDoc.buttonText);
+ // Colors
+ const color = this.props.styleProvider?.(this.rootDoc, this.props, StyleProp.Color);
+ const backgroundColor = this.props.styleProvider?.(this.rootDoc, this.props, StyleProp.BackgroundColor);
+
+ // Button label
+ const label = !this.label || !Doc.UserDoc()._showLabel ? (null) :
+ <div className="fontIconBox-label" style={{ color: color, backgroundColor: backgroundColor, position: "absolute" }}>
+ {this.label}
+ </div>;
+
+ if (switchToggle) {
+ return (
+ <div className={`menuButton ${this.type} ${'switch'}`}>
+ {buttonText ? buttonText : null}
+ <label className="switch">
+ <input type="checkbox"
+ checked={backgroundColor === Colors.MEDIUM_BLUE}
+ />
+ <span className="slider round"></span>
+ </label>
+ </div>
+ );
+ } else {
+ return (
+ <div className={`menuButton ${this.type}`}
+ style={{ opacity: 1, backgroundColor: backgroundColor, color: color }}>
+ <FontAwesomeIcon className={`fontIconBox-icon-${this.type}`} icon={this.icon} color={color} />
+ {label}
+ </div>
+ );
+ }
+ }
+
+
+
+ /**
+ * Default
+ */
+ @computed get defaultButton() {
+ const color = this.props.styleProvider?.(this.rootDoc, this.props, StyleProp.Color);
+ const backgroundColor = this.props.styleProvider?.(this.rootDoc, this.props, StyleProp.BackgroundColor);
+ const active: string = StrCast(this.rootDoc.dropDownOpen);
+ return (
+ <div className={`menuButton ${this.type}`} onContextMenu={this.specificContextMenu}
+ style={{ backgroundColor: "transparent", borderBottomLeftRadius: this.dropdown ? 0 : undefined }}>
+ <div className="menuButton-wrap">
+ <FontAwesomeIcon className={`menuButton-icon-${this.type}`} icon={this.icon} color={"black"} size={"sm"} />
+ {!this.label || !Doc.UserDoc()._showLabel ? (null) : <div className="fontIconBox-label" style={{ color: color, backgroundColor: backgroundColor }}> {this.label} </div>}
+ </div>
+ </div>
+ );
+ }
+
+ @computed get editableText() {
+ // Script for running the toggle
+ const script: string = StrCast(this.rootDoc.script);
+
+ // Script for checking the outcome of the toggle
+ const checkScript: string = StrCast(this.rootDoc.script) + "('', true)";
+
+ // Function to run the script
+ const checkResult = ScriptField.MakeScript(checkScript)?.script.run().result;
+
+ const setValue = (value: string, shiftDown?: boolean): boolean => {
+ ScriptField.MakeScript(script + "('" + value + "')")?.script.run();
+ return true;
+ };
+ return (
+ <div className="menuButton editableText">
+ <FontAwesomeIcon className={`fontIconBox-icon-${this.type}`} icon={"lock"} />
+ <div style={{ width: "calc(100% - .875em)", paddingLeft: "4px" }}>
+ <EditableView GetValue={() => checkResult} SetValue={setValue} contents={checkResult} />
+ </div>
+ </div>
+ );
+ }
+
+
+ render() {
+ const color = this.props.styleProvider?.(this.rootDoc, this.props, StyleProp.Color);
+ const backgroundColor = this.props.styleProvider?.(this.rootDoc, this.props, StyleProp.BackgroundColor);
+ const dark: boolean = Doc.UserDoc().colorScheme === ColorScheme.Dark;
+
+ const label = !this.label || !Doc.UserDoc()._showLabel ? (null) :
+ <div className="fontIconBox-label" style={{ color: color, backgroundColor: backgroundColor, position: "absolute" }}>
+ {this.label}
+ </div>;
+
+ const menuLabel = !this.label || !Doc.UserDoc()._showMenuLabel ? (null) :
+ <div className="fontIconBox-label" style={{ color: color, backgroundColor: "transparent" }}>
+ {this.label}
+ </div>;
+
+ const buttonProps: IButtonProps = {
+ type: this.type,
+ rootDoc: this.rootDoc,
+ label: label,
+ backgroundColor: backgroundColor,
+ icon: this.icon,
+ color: color
+ };
+
+ const buttonText = StrCast(this.rootDoc.buttonText);
+
+ // TODO:glr Add label of button type
+ let button = this.defaultButton;
+
+ switch (this.type) {
+ case ButtonType.TextButton:
+ button = (
+ <div className={`menuButton ${this.type}`} style={{ color: color, backgroundColor: backgroundColor, opacity: 1, gridAutoColumns: `${NumCast(this.rootDoc._height)} auto` }}>
+ <FontAwesomeIcon className={`fontIconBox-icon-${this.type}`} icon={this.icon} color={color} />
+ {buttonText ?
+ <div className="button-text">
+ {buttonText}
+ </div>
+ : null}
+ {label}
+ </div>
+ );
+ // button = <TextButton {...buttonProps}></TextButton>
+ break;
+ case ButtonType.EditableText:
+ button = this.editableText;
+ break;
+ case ButtonType.NumberButton:
+ button = this.numberButton;
+ break;
+ case ButtonType.DropdownButton:
+ button = this.dropdownButton;
+ break;
+ case ButtonType.DropdownList:
+ button = this.dropdownListButton;
+ break;
+ case ButtonType.ColorButton:
+ button = this.colorButton;
+ break;
+ case ButtonType.ToolButton:
+ button = (
+ <div className={`menuButton ${this.type}`} style={{ opacity: 1, backgroundColor: backgroundColor, color: color }}>
+ <FontAwesomeIcon className={`fontIconBox-icon-${this.type}`} icon={this.icon} color={color} />
+ {label}
+ </div>
+ );
+ break;
+ case ButtonType.ToggleButton:
+ button = this.toggleButton;
+ // button = <ToggleButton {...buttonProps}></ToggleButton>
+ break;
+ case ButtonType.ClickButton:
+ button = (
+ <div className={`menuButton ${this.type}`} style={{ color: color, backgroundColor: backgroundColor, opacity: 1 }}>
+ <FontAwesomeIcon className={`fontIconBox-icon-${this.type}`} icon={this.icon} color={color} />
+ {label}
+ </div>
+ );
+ break;
+ case ButtonType.MenuButton:
+ const trailsIcon = <img src={`/assets/${"presTrails.png"}`}
+ style={{ width: 30, height: 30, filter: `invert(${color === Colors.DARK_GRAY ? "0%" : "100%"})` }} />;
+ button = (
+ <div className={`menuButton ${this.type}`} style={{ color: color, backgroundColor: backgroundColor }}>
+ {this.icon === "pres-trail" ? trailsIcon : <FontAwesomeIcon className={`fontIconBox-icon-${this.type}`} icon={this.icon} color={color} />}
+ {menuLabel}
+ <FontIconBadge collection={Cast(this.rootDoc.watchedDocuments, Doc, null)} />
+ </div >
+ );
+ break;
+ default:
+ break;
+ }
+
+ return !this.layoutDoc.toolTip || this.type === ButtonType.DropdownList || this.type === ButtonType.ColorButton || this.type === ButtonType.NumberButton || this.type === ButtonType.EditableText ? button :
+ <Tooltip title={<div className="dash-tooltip">{StrCast(this.layoutDoc.toolTip)}</div>}>
+ {button}
+ </Tooltip>;
+ }
+}
+
+
+// toggle: Set overlay status of selected document
+Scripting.addGlobal(function setView(view: string) {
+ const selected = SelectionManager.Docs().lastElement();
+ selected ? selected._viewType = view : console.log("[FontIconBox.tsx] changeView failed");
+});
+
+
+// toggle: Set overlay status of selected document
+Scripting.addGlobal(function setBackgroundColor(color?: string, checkResult?: boolean) {
+ const selected = SelectionManager.Docs().lastElement();
+ if (checkResult) {
+ if (selected) {
+ return selected._backgroundColor;
+ } else {
+ return "#FFFFFF";
+ }
+ }
+ if (selected?.type === DocumentType.INK) selected.fillColor = color;
+ if (selected) selected._backgroundColor = color;
+ Doc.UserDoc()._fontColor = color;
+});
+
+// toggle: Set overlay status of selected document
+Scripting.addGlobal(function setHeaderColor(color?: string, checkResult?: boolean) {
+ if (checkResult) {
+ return Doc.SharingDoc().userColor;
+ }
+ Doc.SharingDoc().userColor = undefined;
+ Doc.GetProto(Doc.SharingDoc()).userColor = color;
+ Doc.UserDoc().showTitle = color === "transparent" ? undefined : StrCast(Doc.UserDoc().showTitle, "creationDate");
+});
+
+// toggle: Set overlay status of selected document
+Scripting.addGlobal(function toggleOverlay(checkResult?: boolean) {
+ const selected = SelectionManager.Views().length ? SelectionManager.Views()[0] : undefined;
+ if (checkResult && selected) {
+ if (NumCast(selected.Document.z) >= 1) return Colors.MEDIUM_BLUE;
+ else return "transparent";
+ }
+ selected ? selected.props.CollectionFreeFormDocumentView?.().float() : console.log("[FontIconBox.tsx] toggleOverlay failed");
+});
+
+/** TEXT
+ * setFont
+ * setFontSize
+ * toggleBold
+ * toggleUnderline
+ * toggleItalic
+ * setAlignment
+ * toggleBold
+ * toggleItalic
+ * toggleUnderline
+ **/
+
+// toggle: Set overlay status of selected document
+Scripting.addGlobal(function setFont(font: string, checkResult?: boolean) {
+ SelectionManager.Docs().map(doc => doc._fontFamily = font);
+ const editorView = RichTextMenu.Instance.TextView?.EditorView;
+ editorView?.state && RichTextMenu.Instance.setFontFamily(font, editorView);
+ Doc.UserDoc()._fontFamily = font;
+ return Doc.UserDoc()._fontFamily;
+});
+
+Scripting.addGlobal(function getActiveTextInfo(info: "family" | "size" | "color" | "highlight") {
+ const editorView = RichTextMenu.Instance.TextView?.EditorView;
+ const style = editorView?.state && RichTextMenu.Instance.getActiveFontStylesOnSelection();
+ switch (info) {
+ case "family": return style?.activeColors[0];
+ case "size": return style?.activeSizes[0];
+ case "color": return style?.activeColors[0];
+ case "highlight": return style?.activeHighlights[0];
+ }
+});
+
+Scripting.addGlobal(function setAlignment(align: "left" | "right" | "center", checkResult?: boolean) {
+ const editorView = RichTextMenu.Instance?.TextView?.EditorView;
+ if (checkResult) {
+ let active: string;
+ if (editorView) {
+ active = editorView?.state && RichTextMenu.Instance.getActiveAlignment();
+ } else {
+ active = StrCast(Doc.UserDoc().textAlign);
+ }
+ if (active === align) return Colors.MEDIUM_BLUE;
+ else return "transparent";
+ }
+ SelectionManager.Docs().map(doc => doc.textAlign = align);
+ switch (align) {
+ case "left":
+ editorView?.state && RichTextMenu.Instance.alignLeft(editorView, editorView.dispatch);
+ break;
+ case "center":
+ editorView?.state && RichTextMenu.Instance.alignCenter(editorView, editorView.dispatch);
+ break;
+ case "right":
+ editorView?.state && RichTextMenu.Instance.alignRight(editorView, editorView.dispatch);
+ break;
+ default:
+ break;
+ }
+ Doc.UserDoc().textAlign = align;
+});
+
+Scripting.addGlobal(function setBulletList(mapStyle: "bullet" | "decimal", checkResult?: boolean) {
+ const editorView = RichTextMenu.Instance?.TextView?.EditorView;
+ if (checkResult) {
+ const active = editorView?.state && RichTextMenu.Instance.getActiveListStyle();
+ if (active === mapStyle) return Colors.MEDIUM_BLUE;
+ else return "transparent";
+ }
+ if (editorView) {
+ const active = editorView?.state && RichTextMenu.Instance.getActiveListStyle();
+ if (active === mapStyle) {
+ editorView?.state && RichTextMenu.Instance.changeListType(editorView.state.schema.nodes.ordered_list.create({ mapStyle: "" }));
+ } else {
+ editorView?.state && RichTextMenu.Instance.changeListType(editorView.state.schema.nodes.ordered_list.create({ mapStyle: mapStyle }));
+ }
+ }
+});
+
+// toggle: Set overlay status of selected document
+Scripting.addGlobal(function setFontColor(color?: string, checkResult?: boolean) {
+ const selected = SelectionManager.Docs().lastElement();
+ const editorView = RichTextMenu.Instance.TextView?.EditorView;
+
+ if (checkResult) {
+ if (selected) {
+ return selected._fontColor;
+ } else {
+ return Doc.UserDoc()._fontColor;
+ }
+ }
+
+ if (selected) {
+ selected._fontColor = color;
+ if (color) {
+ editorView?.state && RichTextMenu.Instance.setColor(color, editorView, editorView?.dispatch);
+ }
+ }
+ Doc.UserDoc()._fontColor = color;
+});
+
+// toggle: Set overlay status of selected document
+Scripting.addGlobal(function setFontHighlight(color?: string, checkResult?: boolean) {
+ const selected = SelectionManager.Docs().lastElement();
+ const editorView = RichTextMenu.Instance.TextView?.EditorView;
+
+ if (checkResult) {
+ if (selected) {
+ return selected._fontHighlight;
+ } else {
+ return Doc.UserDoc()._fontHighlight;
+ }
+ }
+ if (selected) {
+ selected._fontColor = color;
+ if (color) {
+ editorView?.state && RichTextMenu.Instance.setHighlight(color, editorView, editorView?.dispatch);
+ }
+ }
+ Doc.UserDoc()._fontHighlight = color;
+});
+
+
+
+// toggle: Set overlay status of selected document
+Scripting.addGlobal(function setFontSize(size: string, checkResult?: boolean) {
+ if (checkResult) {
+ const size: number = parseInt(StrCast(Doc.UserDoc()._fontSize), 10);
+ return size;
+ }
+ const editorView = RichTextMenu.Instance.TextView?.EditorView;
+ editorView?.state && RichTextMenu.Instance.setFontSize(Number(size), editorView);
+ Doc.UserDoc()._fontSize = size + "px";
+});
+
+Scripting.addGlobal(function toggleBold(checkResult?: boolean) {
+ if (checkResult) {
+ const editorView = RichTextMenu.Instance.TextView?.EditorView;
+ if (editorView) {
+ const bold: boolean = editorView?.state && RichTextMenu.Instance.getBoldStatus();
+ if (bold) return Colors.MEDIUM_BLUE;
+ else return "transparent";
+ }
+ else return "transparent";
+ }
+ const editorView = RichTextMenu.Instance.TextView?.EditorView;
+ if (editorView) {
+ editorView?.state && RichTextMenu.Instance.toggleBold(editorView, true);
+ }
+ SelectionManager.Docs().filter(doc => StrCast(doc.type) === DocumentType.RTF).map(doc => doc.bold = !doc.bold);
+ Doc.UserDoc().bold = !Doc.UserDoc().bold;
+ return Doc.UserDoc().bold;
+});
+
+Scripting.addGlobal(function toggleUnderline(checkResult?: boolean) {
+ if (checkResult) {
+ return "transparent";
+ }
+ const editorView = RichTextMenu.Instance.TextView?.EditorView;
+ if (editorView) {
+ editorView?.state && RichTextMenu.Instance.toggleUnderline(editorView, true);
+ }
+ SelectionManager.Docs().filter(doc => StrCast(doc.type) === DocumentType.RTF).map(doc => doc.underline = !doc.underline);
+ Doc.UserDoc().underline = !Doc.UserDoc().underline;
+ return Doc.UserDoc().underline;
+});
+
+Scripting.addGlobal(function toggleItalic(checkResult?: boolean) {
+ if (checkResult) {
+ return "transparent";
+ }
+ const editorView = RichTextMenu.Instance.TextView?.EditorView;
+ if (editorView) {
+ editorView?.state && RichTextMenu.Instance.toggleItalic(editorView, true);
+ }
+ SelectionManager.Docs().filter(doc => StrCast(doc.type) === DocumentType.RTF).map(doc => doc.italic = !doc.italic);
+ Doc.UserDoc().italic = !Doc.UserDoc().italic;
+ return Doc.UserDoc().italic;
+});
+
+
+
+
+/** INK
+ * setActiveInkTool
+ * setStrokeWidth
+ * setStrokeColor
+ **/
+
+Scripting.addGlobal(function setActiveInkTool(tool: string, checkResult?: boolean) {
+ if (checkResult) {
+ if (Doc.UserDoc().activeInkTool === tool && GestureOverlay.Instance.InkShape === "" || GestureOverlay.Instance.InkShape === tool) return Colors.MEDIUM_BLUE;
+ else return "transparent";
+ }
+ if (tool === "circle") {
+ Doc.UserDoc().activeInkTool = "pen";
+ GestureOverlay.Instance.InkShape = tool;
+ } else if (tool === "square") {
+ Doc.UserDoc().activeInkTool = "pen";
+ GestureOverlay.Instance.InkShape = tool;
+ } else if (tool === "line") {
+ Doc.UserDoc().activeInkTool = "pen";
+ GestureOverlay.Instance.InkShape = tool;
+ } else if (tool) {
+ if (Doc.UserDoc().activeInkTool === tool && GestureOverlay.Instance.InkShape === "" || GestureOverlay.Instance.InkShape === tool) {
+ GestureOverlay.Instance.InkShape = "";
+ Doc.UserDoc().activeInkTool = InkTool.None;
+ } else {
+ Doc.UserDoc().activeInkTool = tool;
+ }
+ } else {
+ Doc.UserDoc().activeInkTool = InkTool.None;
+ }
+});
+
+// toggle: Set overlay status of selected document
+Scripting.addGlobal(function setFillColor(color?: string, checkResult?: boolean) {
+ const selected = SelectionManager.Docs().lastElement();
+ if (checkResult) {
+ if (selected?.type === DocumentType.INK) {
+ return StrCast(selected._backgroundColor);
+ }
+ return ActiveFillColor();
+ }
+ SetActiveFillColor(StrCast(color));
+ SelectionManager.Docs().filter(doc => doc.type === DocumentType.INK).map(doc => doc.fillColor = color);
+});
+
+Scripting.addGlobal(function setStrokeWidth(width: number, checkResult?: boolean) {
+ if (checkResult) {
+ const selected = SelectionManager.Docs().lastElement();
+ if (selected?.type === DocumentType.INK) {
+ return NumCast(selected.strokeWidth);
+ }
+ return ActiveInkWidth();
+ }
+ SetActiveInkWidth(width.toString());
+ SelectionManager.Docs().filter(doc => doc.type === DocumentType.INK).map(doc => doc.strokeWidth = Number(width));
+});
+
+// toggle: Set overlay status of selected document
+Scripting.addGlobal(function setStrokeColor(color?: string, checkResult?: boolean) {
+ if (checkResult) {
+ const selected = SelectionManager.Docs().lastElement();
+ if (selected?.type === DocumentType.INK) {
+ return StrCast(selected.color);
+ }
+ return ActiveInkColor();
+ }
+ SetActiveInkColor(StrCast(color));
+ SelectionManager.Docs().filter(doc => doc.type === DocumentType.INK).map(doc => doc.color = String(color));
+});
+
+
+/** WEB
+ * webSetURL
+ **/
+Scripting.addGlobal(function webSetURL(url: string, checkResult?: boolean) {
+ const selected = SelectionManager.Views().lastElement();
+ if (selected?.rootDoc.type === DocumentType.WEB) {
+ if (checkResult) {
+ return StrCast(selected.rootDoc.data, Cast(selected.rootDoc.data, WebField, null)?.url?.href);
+ }
+ (selected.ComponentView as WebBox).submitURL(url);
+ //selected.rootDoc.data = new WebField(url);
+ }
+});
+Scripting.addGlobal(function webForward() {
+ const selected = SelectionManager.Views().lastElement();
+ if (selected?.rootDoc.type === DocumentType.WEB) {
+ (selected.ComponentView as WebBox).forward();
+ }
+});
+Scripting.addGlobal(function webBack() {
+ const selected = SelectionManager.Views().lastElement();
+ if (selected?.rootDoc.type === DocumentType.WEB) {
+ (selected.ComponentView as WebBox).back();
+ }
+});
+
+
+/** Schema
+ * toggleSchemaPreview
+ **/
+Scripting.addGlobal(function toggleSchemaPreview(checkResult?: boolean) {
+ const selected = SelectionManager.Docs().lastElement();
+ if (checkResult && selected) {
+ const result: boolean = NumCast(selected.schemaPreviewWidth) > 0;
+ if (result) return Colors.MEDIUM_BLUE;
+ else return "transparent";
+ }
+ else if (selected) {
+ if (NumCast(selected.schemaPreviewWidth) > 0) {
+ selected.schemaPreviewWidth = 200;
+ } else {
+ selected.schemaPreviewWidth = 0;
+ }
+ }
+}); \ No newline at end of file
diff --git a/src/client/views/nodes/button/colorDropdown/ColorDropdown.tsx b/src/client/views/nodes/button/colorDropdown/ColorDropdown.tsx
new file mode 100644
index 000000000..235495250
--- /dev/null
+++ b/src/client/views/nodes/button/colorDropdown/ColorDropdown.tsx
@@ -0,0 +1,75 @@
+import { FontAwesomeIcon } from '@fortawesome/react-fontawesome';
+import React, { Component } from 'react';
+import { BoolCast, StrCast } from '../../../../../fields/Types';
+import { IButtonProps } from '../ButtonInterface';
+import { ColorState, SketchPicker } from 'react-color';
+import { ScriptField } from '../../../../../fields/ScriptField';
+import { Doc } from '../../../../../fields/Doc';
+
+export class ColorDropdown extends Component<IButtonProps> {
+ render() {
+ const active: string = StrCast(this.props.rootDoc.dropDownOpen);
+
+ const script: string = StrCast(this.props.rootDoc.script);
+ const scriptCheck: string = script + "(undefined, true)";
+ const boolResult = ScriptField.MakeScript(scriptCheck)?.script.run().result;
+
+ const stroke: boolean = false;
+ // if (script === "setStrokeColor") {
+ // stroke = true;
+ // const checkWidth = ScriptField.MakeScript("setStrokeWidth(0, true)")?.script.run().result;
+ // const width = 20 + (checkWidth / 100) * 70;
+ // const height = 20 + (checkWidth / 100) * 70;
+ // strokeIcon = (<div style={{ borderRadius: "100%", width: width + '%', height: height + '%', backgroundColor: boolResult ? boolResult : "#FFFFFF" }} />);
+ // }
+
+ const colorOptions: string[] = ['#D0021B', '#F5A623', '#F8E71C', '#8B572A', '#7ED321', '#417505',
+ '#9013FE', '#4A90E2', '#50E3C2', '#B8E986', '#000000', '#4A4A4A', '#9B9B9B',
+ '#FFFFFF', '#f1efeb'];
+
+ const colorBox = (func: (color: ColorState) => void) => <SketchPicker
+ disableAlpha={!stroke}
+ onChange={func} color={boolResult ? boolResult : "#FFFFFF"}
+ presetColors={colorOptions} />;
+ const label = !this.props.label || !Doc.UserDoc()._showLabel ? (null) :
+ <div className="fontIconBox-label" style={{ color: this.props.color, backgroundColor: this.props.backgroundColor, position: "absolute" }}>
+ {this.props.label}
+ </div>;
+
+ const dropdownCaret = <div
+ className="menuButton-dropDown"
+ style={{ borderBottomRightRadius: active ? 0 : undefined }}>
+ <FontAwesomeIcon icon={'caret-down'} color={this.props.color} size="sm" />
+ </div>;
+
+ const click = (value: ColorState) => {
+ const hex: string = value.hex;
+ const s = ScriptField.MakeScript(script + '("' + hex + '", false)');
+ if (s) {
+ s.script.run().result;
+ }
+ };
+ return (
+ <div className={`menuButton ${this.props.type} ${active}`}
+ style={{ color: this.props.color, borderBottomLeftRadius: active ? 0 : undefined }}
+ onClick={() => this.props.rootDoc.dropDownOpen = !this.props.rootDoc.dropDownOpen}
+ onPointerDown={e => e.stopPropagation()}>
+ <FontAwesomeIcon className={`fontIconBox-icon-${this.props.type}`} icon={this.props.icon} color={this.props.color} />
+ <div className="colorButton-color"
+ style={{ backgroundColor: boolResult ? boolResult : "#FFFFFF" }} />
+ {label}
+ {/* {dropdownCaret} */}
+ {this.props.rootDoc.dropDownOpen ?
+ <div>
+ <div className="menuButton-dropdownBox"
+ onPointerDown={e => e.stopPropagation()}
+ onClick={e => e.stopPropagation()}>
+ {colorBox(click)}
+ </div>
+ <div className="dropbox-background" onClick={(e) => { e.stopPropagation(); this.props.rootDoc.dropDownOpen = false; }} />
+ </div>
+ : null}
+ </div>
+ );
+ }
+} \ No newline at end of file
diff --git a/src/client/views/nodes/button/colorDropdown/index.ts b/src/client/views/nodes/button/colorDropdown/index.ts
new file mode 100644
index 000000000..1147d6457
--- /dev/null
+++ b/src/client/views/nodes/button/colorDropdown/index.ts
@@ -0,0 +1 @@
+export * from './ColorDropdown'; \ No newline at end of file
diff --git a/src/client/views/nodes/button/textButton/TextButton.tsx b/src/client/views/nodes/button/textButton/TextButton.tsx
new file mode 100644
index 000000000..e18590a95
--- /dev/null
+++ b/src/client/views/nodes/button/textButton/TextButton.tsx
@@ -0,0 +1,17 @@
+import { FontAwesomeIcon } from '@fortawesome/react-fontawesome';
+import React, { Component } from 'react';
+import { BoolCast } from '../../../../../fields/Types';
+import { IButtonProps } from '../ButtonInterface';
+
+export class TextButton extends Component<IButtonProps> {
+ render() {
+ const type = this.props.type;
+ // Determine the type of toggle button
+ const buttonText: boolean = BoolCast(this.props.rootDoc.switchToggle);
+
+ return (<div className={`menuButton ${this.props.type}`} style={{ opacity: 1, backgroundColor: this.props.backgroundColor, color: this.props.color }}>
+ <FontAwesomeIcon className={`fontIconBox-icon-${this.props.type}`} icon={this.props.icon} color={this.props.color} />
+ {this.props.label}
+ </div>);
+ }
+} \ No newline at end of file
diff --git a/src/client/views/nodes/button/textButton/index.ts b/src/client/views/nodes/button/textButton/index.ts
new file mode 100644
index 000000000..01d62eb7e
--- /dev/null
+++ b/src/client/views/nodes/button/textButton/index.ts
@@ -0,0 +1 @@
+export * from './TextButton'; \ No newline at end of file
diff --git a/src/client/views/nodes/button/toggleButton/ToggleButton.tsx b/src/client/views/nodes/button/toggleButton/ToggleButton.tsx
new file mode 100644
index 000000000..dca6487d8
--- /dev/null
+++ b/src/client/views/nodes/button/toggleButton/ToggleButton.tsx
@@ -0,0 +1,34 @@
+import { FontAwesomeIcon } from '@fortawesome/react-fontawesome';
+import React, { Component } from 'react';
+import { BoolCast } from '../../../../../fields/Types';
+import { Colors } from '../../../global/globalEnums';
+import { IButtonProps } from '../ButtonInterface';
+
+export class ToggleButton extends Component<IButtonProps> {
+ render() {
+ const type = this.props.type;
+ // Determine the type of toggle button
+ const switchToggle: boolean = BoolCast(this.props.rootDoc.switchToggle);
+
+ if (switchToggle) {
+ return (
+ <div className={`menuButton ${type} ${'switch'}`}>
+ <label className="switch">
+ <input type="checkbox"
+ checked={this.props.backgroundColor === Colors.MEDIUM_BLUE}
+ />
+ <span className="slider round"></span>
+ </label>
+ </div>
+ );
+ } else {
+ return (
+ <div className={`menuButton ${type}`}
+ style={{ opacity: 1, backgroundColor: this.props.backgroundColor, color: this.props.color }}>
+ <FontAwesomeIcon className={`fontIconBox-icon-${type}`} icon={this.props.icon} color={this.props.color} />
+ {this.props.label}
+ </div>
+ );
+ }
+ }
+} \ No newline at end of file
diff --git a/src/client/views/nodes/button/toggleButton/index.ts b/src/client/views/nodes/button/toggleButton/index.ts
new file mode 100644
index 000000000..cdb9c527c
--- /dev/null
+++ b/src/client/views/nodes/button/toggleButton/index.ts
@@ -0,0 +1 @@
+export * from './ToggleButton'; \ No newline at end of file
diff --git a/src/client/views/nodes/formattedText/DashFieldView.tsx b/src/client/views/nodes/formattedText/DashFieldView.tsx
index 62f65cdae..34908e54b 100644
--- a/src/client/views/nodes/formattedText/DashFieldView.tsx
+++ b/src/client/views/nodes/formattedText/DashFieldView.tsx
@@ -82,7 +82,7 @@ export class DashFieldViewInternal extends React.Component<IDashFieldViewInterna
// set the display of the field's value (checkbox for booleans, span of text for strings)
@computed get fieldValueContent() {
if (this._dashDoc) {
- const dashVal = this._dashDoc[DataSym][this._fieldKey] ?? this._dashDoc[this._fieldKey] ?? (this._fieldKey === "PARAMS" ? this._textBoxDoc[this._fieldKey] : "");
+ const dashVal = this._dashDoc[this._fieldKey] ?? this._dashDoc[DataSym][this._fieldKey] ?? (this._fieldKey === "PARAMS" ? this._textBoxDoc[this._fieldKey] : "");
const fval = dashVal instanceof List ? dashVal.join(this.multiValueDelimeter) : StrCast(dashVal).startsWith(":=") || dashVal === "" ? Doc.Layout(this._textBoxDoc)[this._fieldKey] : dashVal;
const boolVal = Cast(fval, "boolean", null);
const strVal = Field.toString(fval as Field) || "";
diff --git a/src/client/views/nodes/formattedText/FormattedTextBox.scss b/src/client/views/nodes/formattedText/FormattedTextBox.scss
index 3cedab1a4..27817f317 100644
--- a/src/client/views/nodes/formattedText/FormattedTextBox.scss
+++ b/src/client/views/nodes/formattedText/FormattedTextBox.scss
@@ -67,13 +67,27 @@ audiotag:hover {
.formattedTextBox-sidebar-handle {
position: absolute;
top: 0;
+ left: 17px;
//top: calc(50% - 17.5px); // use this to center vertically -- make sure it looks okay for slide views
- width: 10px;
- height: 100%;
- max-height: 35px;
- background: lightgray;
- border-radius: 20px;
+ width: 17px;
+ height: 17px;
+ font-size: 11px;
+ border-radius: 3px;
+ color: white;
+ background: $medium-gray;
+ border-radius: 5px;
+ display: flex;
+ justify-content: center;
+ align-items: center;
cursor:grabbing;
+ box-shadow: $standard-box-shadow;
+ // transition: 0.2s;
+ opacity: 0.3;
+ &:hover{
+ opacity: 1 !important;
+ filter: brightness(0.85);
+ }
+
}
.formattedTextBox-sidebar,
@@ -414,12 +428,7 @@ footnote::after {
.formattedTextBox-sidebar-handle {
position: absolute;
- top: 0;
- //top: calc(50% - 17.5px); // use this to center vertically -- make sure it looks okay for slide views
- width: 10px;
- height: 35px;
background: lightgray;
- border-radius: 20px;
cursor: grabbing;
}
diff --git a/src/client/views/nodes/formattedText/FormattedTextBox.tsx b/src/client/views/nodes/formattedText/FormattedTextBox.tsx
index 12064fccf..63d2c1007 100644
--- a/src/client/views/nodes/formattedText/FormattedTextBox.tsx
+++ b/src/client/views/nodes/formattedText/FormattedTextBox.tsx
@@ -1,6 +1,6 @@
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome';
import { isEqual } from "lodash";
-import { action, computed, IReactionDisposer, reaction, runInAction, observable } from "mobx";
+import { action, computed, IReactionDisposer, reaction, runInAction, observable, trace } from "mobx";
import { observer } from "mobx-react";
import { baseKeymap, selectAll } from "prosemirror-commands";
import { history } from "prosemirror-history";
@@ -63,11 +63,12 @@ import { SummaryView } from "./SummaryView";
import applyDevTools = require("prosemirror-dev-tools");
import React = require("react");
import { SidebarAnnos } from '../../SidebarAnnos';
+import { Colors } from '../../global/globalEnums';
+import { IconProp } from '@fortawesome/fontawesome-svg-core';
const translateGoogleApi = require("translate-google-api");
export interface FormattedTextBoxProps {
makeLink?: () => Opt<Doc>; // bcz: hack: notifies the text document when the container has made a link. allows the text doc to react and setup a hyeprlink for any selected text
- hideOnLeave?: boolean; // used by DocumentView for setting caption's hide on leave (bcz: would prefer to have caption-hideOnLeave field set or something similar)
xPadding?: number; // used to override document's settings for xMargin --- see CollectionCarouselView
yPadding?: number;
noSidebar?: boolean;
@@ -213,10 +214,16 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
@action
setupAnchorMenu = () => {
AnchorMenu.Instance.Status = "marquee";
+
+ AnchorMenu.Instance.OnClick = (e: PointerEvent) => {
+ !this.layoutDoc.showSidebar && this.toggleSidebar();
+ this._sidebarRef.current?.anchorMenuClick(this.getAnchor());
+ };
AnchorMenu.Instance.Highlight = action((color: string, isLinkButton: boolean) => {
- this._editorView?.state && RichTextMenu.Instance.insertHighlight(color, this._editorView.state, this._editorView?.dispatch);
+ this._editorView?.state && RichTextMenu.Instance.setHighlight(color, this._editorView, this._editorView?.dispatch);
return undefined;
});
+ AnchorMenu.Instance.onMakeAnchor = this.getAnchor;
/**
* This function is used by the PDFmenu to create an anchor highlight and a new linked text annotation.
* It also initiates a Drag/Drop interaction to place the text annotation.
@@ -428,9 +435,12 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
view.dispatch(view.state.tr.removeMark(start, end, nmark).addMark(start, end, nmark));
}
protected createDropTarget = (ele: HTMLDivElement) => {
- this.ProseRef = ele;
this._dropDisposer?.();
- ele && (this._dropDisposer = DragManager.MakeDropTarget(ele, this.drop.bind(this), this.layoutDoc));
+ this.ProseRef = ele;
+ if (ele) {
+ this.setupEditor(this.config, this.props.fieldKey);
+ this._dropDisposer = DragManager.MakeDropTarget(ele, this.drop.bind(this), this.layoutDoc);
+ }
// if (this.autoHeight) this.tryUpdateScrollHeight();
}
@@ -570,14 +580,28 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
const cm = ContextMenu.Instance;
const changeItems: ContextMenuProps[] = [];
- changeItems.push({ description: "plain", event: undoBatch(() => Doc.setNativeView(this.rootDoc)), icon: "eye" });
+ changeItems.push({
+ description: "plain", event: undoBatch(() => {
+ Doc.setNativeView(this.rootDoc);
+ this.layoutDoc.autoHeightMargins = undefined;
+ }), icon: "eye"
+ });
+ changeItems.push({
+ description: "metadata", event: undoBatch(() => {
+ this.dataDoc.layout_meta = Cast(Doc.UserDoc().emptyHeader, Doc, null)?.layout;
+ this.rootDoc.layoutKey = "layout_meta";
+ setTimeout(() => this.rootDoc._headerHeight = this.rootDoc._autoHeightMargins = 50, 50);
+ }), icon: "eye"
+ });
const noteTypesDoc = Cast(Doc.UserDoc()["template-notes"], Doc, null);
DocListCast(noteTypesDoc?.data).forEach(note => {
+ const icon: IconProp = StrCast(note.icon) as IconProp;
changeItems.push({
description: StrCast(note.title), event: undoBatch(() => {
+ this.layoutDoc.autoHeightMargins = undefined;
Doc.setNativeView(this.rootDoc);
DocUtils.makeCustomViewClicked(this.rootDoc, Docs.Create.TreeDocument, StrCast(note.title), note);
- }), icon: "eye"
+ }), icon: icon
});
});
!Doc.UserDoc().noviceMode && changeItems.push({ description: "FreeForm", event: () => DocUtils.makeCustomViewClicked(this.rootDoc, Docs.Create.FreeformDocument, "freeform"), icon: "eye" });
@@ -709,7 +733,7 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
const splitter = state.schema.marks.splitter.create({ id: Utils.GenerateGuid() });
let tr = state.tr.addMark(sel.from, sel.to, splitter);
if (sel.from !== sel.to) {
- const anchor = anchorDoc ?? Docs.Create.TextanchorDocument({ title: this._editorView?.state.doc.textBetween(sel.from, sel.to) });
+ const anchor = anchorDoc ?? Docs.Create.TextanchorDocument({ title: this._editorView?.state.doc.textBetween(sel.from, sel.to), unrendered: true });
const href = targetHref ?? Doc.localServerPath(anchor);
if (anchor !== anchorDoc) this.addDocument(anchor);
tr.doc.nodesBetween(sel.from, sel.to, (node: any, pos: number, parent: any) => {
@@ -801,11 +825,15 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
this._disposers.breakupDictation = reaction(() => DocumentManager.Instance.RecordingEvent, this.breakupDictation);
this._disposers.autoHeight = reaction(() => this.autoHeight, autoHeight => autoHeight && this.tryUpdateScrollHeight());
this._disposers.scrollHeight = reaction(() => ({ scrollHeight: this.scrollHeight, autoHeight: this.autoHeight, width: NumCast(this.layoutDoc._width) }),
- ({ width, scrollHeight, autoHeight }) => width && autoHeight && this.resetNativeHeight(scrollHeight)
+ ({ width, scrollHeight, autoHeight }) => {
+ width && autoHeight && this.resetNativeHeight(scrollHeight);
+ }, { fireImmediately: true }
);
this._disposers.componentHeights = reaction( // set the document height when one of the component heights changes and autoHeight is on
() => ({ sidebarHeight: this.sidebarHeight, textHeight: this.textHeight, autoHeight: this.autoHeight, marginsHeight: this.autoHeightMargins }),
- ({ sidebarHeight, textHeight, autoHeight, marginsHeight }) => autoHeight && this.props.setHeight(marginsHeight + Math.max(sidebarHeight, textHeight)));
+ ({ sidebarHeight, textHeight, autoHeight, marginsHeight }) => {
+ autoHeight && this.props.setHeight(marginsHeight + Math.max(sidebarHeight, textHeight));
+ }, { fireImmediately: true });
this._disposers.links = reaction(() => DocListCast(this.Document.links), // if a link is deleted, then remove all hyperlinks that reference it from the text's marks
newLinks => {
this._cachedLinks.forEach(l => !newLinks.includes(l) && this.RemoveLinkFromDoc(l));
@@ -860,8 +888,6 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
}
);
- this.setupEditor(this.config, this.props.fieldKey);
-
this._disposers.search = reaction(() => Doc.IsSearchMatch(this.rootDoc),
search => search ? this.highlightSearchTerms([Doc.SearchQuery()], search.searchMatch < 0) : this.unhighlightSearchTerms(),
{ fireImmediately: Doc.IsSearchMatchUnmemoized(this.rootDoc) ? true : false });
@@ -901,7 +927,7 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
}, { fireImmediately: true }
);
quickScroll = undefined;
- this.tryUpdateScrollHeight();
+ setTimeout(this.tryUpdateScrollHeight, 10);
}
pushToGoogleDoc = async () => {
@@ -1140,8 +1166,8 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
}
selectOnLoad && this._editorView!.focus();
// add user mark for any first character that was typed since the user mark that gets set in KeyPress won't have been called yet.
- if (!this._editorView!.state.storedMarks?.some(mark => mark.type === schema.marks.user_mark)) {
- this._editorView!.state.storedMarks = [...(this._editorView!.state.storedMarks ?? []), schema.marks.user_mark.create({ userid: Doc.CurrentUserEmail, modified: Math.floor(Date.now() / 1000) })];
+ if (this._editorView && !this._editorView.state.storedMarks?.some(mark => mark.type === schema.marks.user_mark)) {
+ this._editorView.state.storedMarks = [...(this._editorView.state.storedMarks ?? []), schema.marks.user_mark.create({ userid: Doc.CurrentUserEmail, modified: Math.floor(Date.now() / 1000) })];
}
}
@@ -1210,7 +1236,7 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
if ((e.nativeEvent as any).formattedHandled) {
console.log("handled");
}
- if (!(e.nativeEvent as any).formattedHandled && this.isContentActive(true)) {
+ if (!(e.nativeEvent as any).formattedHandled && this.props.isContentActive(true)) {
const editor = this._editorView!;
const pcords = editor.posAtCoords({ left: e.clientX, top: e.clientY });
!this.props.isSelected(true) && editor.dispatch(editor.state.tr.setSelection(new TextSelection(editor.state.doc.resolve(pcords?.pos || 0))));
@@ -1356,6 +1382,7 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
this._undoTyping = undefined;
return wasUndoing;
}
+
@action
onBlur = (e: any) => {
FormattedTextBox.Focused === this && (FormattedTextBox.Focused = undefined);
@@ -1444,18 +1471,15 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
const margins = 2 * NumCast(this.layoutDoc._yMargin, this.props.yPadding || 0);
const children = this.ProseRef?.children.length ? Array.from(this.ProseRef.children[0].children) : undefined;
if (children) {
- var proseHeight = !this.ProseRef ? 0 : children.reduce((p, child) => p + Number(getComputedStyle(child).height.replace("px", "")), margins);
- var scrollHeight = this.ProseRef && Math.min(NumCast(this.layoutDoc.docMaxAutoHeight, proseHeight), proseHeight);
+ const proseHeight = !this.ProseRef ? 0 : children.reduce((p, child) => p + Number(getComputedStyle(child).height.replace("px", "")), margins);
+ const scrollHeight = this.ProseRef && Math.min(NumCast(this.layoutDoc.docMaxAutoHeight, proseHeight), proseHeight);
if (scrollHeight && this.props.renderDepth && !this.props.dontRegisterView) { // if top === 0, then the text box is growing upward (as the overlay caption) which doesn't contribute to the height computation
const setScrollHeight = () => this.rootDoc[this.fieldKey + "-scrollHeight"] = scrollHeight;
if (this.rootDoc === this.layoutDoc.doc || this.layoutDoc.resolvedDataDoc) {
setScrollHeight();
- setTimeout(() => {
- proseHeight = !this.ProseRef ? 0 : children.reduce((p, child) => p + Number(getComputedStyle(child).height.replace("px", "")), margins);
- scrollHeight = this.ProseRef && Math.min(NumCast(this.layoutDoc.docMaxAutoHeight, proseHeight), proseHeight);
- scrollHeight && setScrollHeight();
- }, 10);
- } else setTimeout(setScrollHeight, 10); // if we have a template that hasn't been resolved yet, we can't set the height or we'd be setting it on the unresolved template. So set a timeout and hope its arrived...
+ } else {
+ setTimeout(setScrollHeight, 10); // if we have a template that hasn't been resolved yet, we can't set the height or we'd be setting it on the unresolved template. So set a timeout and hope its arrived...
+ }
}
}
}
@@ -1480,11 +1504,18 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
@computed get sidebarHandle() {
TraceMobx();
const annotated = DocListCast(this.dataDoc[this.SidebarKey]).filter(d => d?.author).length;
- return (!annotated && !this.isContentActive()) ? (null) : <div className="formattedTextBox-sidebar-handle" onPointerDown={this.sidebarDown}
- style={{
- left: `max(0px, calc(100% - ${this.sidebarWidthPercent} ${this.sidebarWidth() ? "- 5px" : "- 10px"}))`,
- background: this.props.styleProvider?.(this.rootDoc, this.props, StyleProp.WidgetColor + (annotated ? ":annotated" : ""))
- }} />;
+ const color = !annotated ? Colors.WHITE : Colors.BLACK;
+ const backgroundColor = !annotated ? this.sidebarWidth() ? Colors.MEDIUM_BLUE : Colors.BLACK : this.props.styleProvider?.(this.rootDoc, this.props, StyleProp.WidgetColor + (annotated ? ":annotated" : ""));
+ return (!annotated && (!this.props.isContentActive() || SnappingManager.GetIsDragging())) ? (null) :
+ <div className="formattedTextBox-sidebar-handle" onPointerDown={this.sidebarDown}
+ style={{
+ left: `max(0px, calc(100% - ${this.sidebarWidthPercent} - 17px))`,
+ backgroundColor: backgroundColor,
+ color: color,
+ opacity: annotated ? 1 : undefined
+ }} >
+ <FontAwesomeIcon icon={"comment-alt"} />
+ </div>;
}
@computed get sidebarCollection() {
const renderComponent = (tag: string) => {
@@ -1504,7 +1535,6 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
sidebarAddDocument={this.sidebarAddDocument}
moveDocument={this.moveDocument}
removeDocument={this.removeDocument}
- isContentActive={this.isContentActive}
/> :
<ComponentTag
{...OmitKeys(this.props, ["NativeWidth", "NativeHeight", "setContentView"]).omit}
@@ -1517,7 +1547,6 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
scaleField={this.SidebarKey + "-scale"}
isAnnotationOverlay={false}
select={emptyFunction}
- isContentActive={this.isContentActive}
scaling={this.sidebarContentScaling}
whenChildContentsActiveChanged={this.whenChildContentsActiveChanged}
removeDocument={this.sidebarRemDocument}
@@ -1539,8 +1568,8 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
render() {
TraceMobx();
const selected = this.props.isSelected();
- const active = this.isContentActive();
- const scale = this.props.hideOnLeave ? 1 : (this.props.scaling?.() || 1) * NumCast(this.layoutDoc._viewScale, 1);
+ const active = this.props.isContentActive();
+ const scale = (this.props.scaling?.() || 1) * NumCast(this.layoutDoc._viewScale, 1);
const rounded = StrCast(this.layoutDoc.borderRounding) === "100%" ? "-rounded" : "";
const interactive = (CurrentUserUtils.SelectedTool === InkTool.None || SnappingManager.GetIsDragging()) && (this.layoutDoc.z || this.props.layerProvider?.(this.layoutDoc) !== false);
if (!selected && FormattedTextBoxComment.textBox === this) setTimeout(FormattedTextBoxComment.Hide);
@@ -1549,16 +1578,17 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
const selPad = Math.min(margins, 10);
const padding = Math.max(margins + ((selected && !this.layoutDoc._singleLine) || minimal ? -selPad : 0), 0);
const selPaddingClass = selected && !this.layoutDoc._singleLine && margins >= 10 ? "-selected" : "";
- return (
+ const styleFromString = this.styleFromLayoutString(scale); // this converts any expressions in the format string to style props. e.g., <FormattedTextBox height='{this._headerHeight}px' >
+ return (styleFromString?.height === "0px" ? (null) :
<div className="formattedTextBox-cont"
- onWheel={e => this.isContentActive() && e.stopPropagation()}
+ onWheel={e => this.props.isContentActive() && e.stopPropagation()}
style={{
transform: this.props.dontScale ? undefined : `scale(${scale})`,
transformOrigin: this.props.dontScale ? undefined : "top left",
width: this.props.dontScale ? undefined : `${100 / scale}%`,
height: this.props.dontScale ? undefined : `${100 / scale}%`,
// overflowY: this.layoutDoc._autoHeight ? "hidden" : undefined,
- ...this.styleFromLayoutString(scale) // this converts any expressions in the format string to style props. e.g., <FormattedTextBox height='{this._headerHeight}px' >
+ ...styleFromString
}}>
<div className={`formattedTextBox-cont`} ref={this._ref}
style={{
diff --git a/src/client/views/nodes/formattedText/RichTextMenu.scss b/src/client/views/nodes/formattedText/RichTextMenu.scss
index c94e93541..8afa0f6b5 100644
--- a/src/client/views/nodes/formattedText/RichTextMenu.scss
+++ b/src/client/views/nodes/formattedText/RichTextMenu.scss
@@ -2,6 +2,7 @@
.button-dropdown-wrapper {
position: relative;
+ display: flex;
.dropdown-button {
width: 15px;
diff --git a/src/client/views/nodes/formattedText/RichTextMenu.tsx b/src/client/views/nodes/formattedText/RichTextMenu.tsx
index 82ad2b7db..9904a7939 100644
--- a/src/client/views/nodes/formattedText/RichTextMenu.tsx
+++ b/src/client/views/nodes/formattedText/RichTextMenu.tsx
@@ -37,11 +37,6 @@ export class RichTextMenu extends AntimodeMenu<AntimodeMenuProps> {
public editorProps: FieldViewProps & FormattedTextBoxProps | undefined;
public _brushMap: Map<string, Set<Mark>> = new Map();
- private fontSizeOptions: { mark: Mark | null, title: string, label: string, command: any, hidden?: boolean, style?: {} }[];
- private fontFamilyOptions: { mark: Mark | null, title: string, label: string, command: any, hidden?: boolean, style?: {} }[];
- private listTypeOptions: { node: NodeType | any | null, title: string, label: string, command: any, style?: {} }[];
- private fontColors: (string | undefined)[];
- private highlightColors: (string | undefined)[];
@observable private collapsed: boolean = false;
@observable private boldActive: boolean = false;
@@ -76,70 +71,6 @@ export class RichTextMenu extends AntimodeMenu<AntimodeMenuProps> {
this._canFade = false;
//this.Pinned = BoolCast(Doc.UserDoc()["menuRichText-pinned"]);
runInAction(() => this.Pinned = true);
-
- this.fontSizeOptions = [
- { mark: schema.marks.pFontSize.create({ fontSize: 7 }), title: "Set font size", label: "7px", command: this.changeFontSize },
- { mark: schema.marks.pFontSize.create({ fontSize: 8 }), title: "Set font size", label: "8px", command: this.changeFontSize },
- { mark: schema.marks.pFontSize.create({ fontSize: 9 }), title: "Set font size", label: "9px", command: this.changeFontSize },
- { mark: schema.marks.pFontSize.create({ fontSize: 10 }), title: "Set font size", label: "10px", command: this.changeFontSize },
- { mark: schema.marks.pFontSize.create({ fontSize: 12 }), title: "Set font size", label: "12px", command: this.changeFontSize },
- { mark: schema.marks.pFontSize.create({ fontSize: 14 }), title: "Set font size", label: "14px", command: this.changeFontSize },
- { mark: schema.marks.pFontSize.create({ fontSize: 16 }), title: "Set font size", label: "16px", command: this.changeFontSize },
- { mark: schema.marks.pFontSize.create({ fontSize: 18 }), title: "Set font size", label: "18px", command: this.changeFontSize },
- { mark: schema.marks.pFontSize.create({ fontSize: 20 }), title: "Set font size", label: "20px", command: this.changeFontSize },
- { mark: schema.marks.pFontSize.create({ fontSize: 24 }), title: "Set font size", label: "24px", command: this.changeFontSize },
- { mark: schema.marks.pFontSize.create({ fontSize: 32 }), title: "Set font size", label: "32px", command: this.changeFontSize },
- { mark: schema.marks.pFontSize.create({ fontSize: 48 }), title: "Set font size", label: "48px", command: this.changeFontSize },
- { mark: schema.marks.pFontSize.create({ fontSize: 72 }), title: "Set font size", label: "72px", command: this.changeFontSize },
- { mark: null, title: "", label: "...", command: unimplementedFunction, hidden: true },
- { mark: null, title: "", label: "13px", command: unimplementedFunction, hidden: true }, // this is here because the default size is 13, but there is no actual 13pt option
- ];
-
- this.fontFamilyOptions = [
- { mark: schema.marks.pFontFamily.create({ family: "Times New Roman" }), title: "Set font family", label: "Times New Roman", command: this.changeFontFamily, style: { fontFamily: "Times New Roman" } },
- { mark: schema.marks.pFontFamily.create({ family: "Arial" }), title: "Set font family", label: "Arial", command: this.changeFontFamily, style: { fontFamily: "Arial" } },
- { mark: schema.marks.pFontFamily.create({ family: "Georgia" }), title: "Set font family", label: "Georgia", command: this.changeFontFamily, style: { fontFamily: "Georgia" } },
- { mark: schema.marks.pFontFamily.create({ family: "Comic Sans MS" }), title: "Set font family", label: "Comic Sans MS", command: this.changeFontFamily, style: { fontFamily: "Comic Sans MS" } },
- { mark: schema.marks.pFontFamily.create({ family: "Tahoma" }), title: "Set font family", label: "Tahoma", command: this.changeFontFamily, style: { fontFamily: "Tahoma" } },
- { mark: schema.marks.pFontFamily.create({ family: "Impact" }), title: "Set font family", label: "Impact", command: this.changeFontFamily, style: { fontFamily: "Impact" } },
- { mark: schema.marks.pFontFamily.create({ family: "Crimson Text" }), title: "Set font family", label: "Crimson Text", command: this.changeFontFamily, style: { fontFamily: "Crimson Text" } },
- { mark: null, title: "", label: "various", command: unimplementedFunction, hidden: true },
- // { mark: null, title: "", label: "default", command: unimplementedFunction, hidden: true },
- ];
-
- this.listTypeOptions = [
- { node: schema.nodes.ordered_list.create({ mapStyle: "bullet" }), title: "Set list type", label: ":", command: this.changeListType },
- { node: schema.nodes.ordered_list.create({ mapStyle: "decimal" }), title: "Set list type", label: "1.1", command: this.changeListType },
- { node: schema.nodes.ordered_list.create({ mapStyle: "multi" }), title: "Set list type", label: "A.1", command: this.changeListType },
- { node: schema.nodes.ordered_list.create({ mapStyle: "" }), title: "Set list type", label: "<none>", command: this.changeListType },
- //{ node: undefined, title: "Set list type", label: "Remove", command: this.changeListType },
- ];
-
- this.fontColors = [
- DarkPastelSchemaPalette.get("pink2"),
- DarkPastelSchemaPalette.get("purple4"),
- DarkPastelSchemaPalette.get("bluegreen1"),
- DarkPastelSchemaPalette.get("yellow4"),
- DarkPastelSchemaPalette.get("red2"),
- DarkPastelSchemaPalette.get("bluegreen7"),
- DarkPastelSchemaPalette.get("bluegreen5"),
- DarkPastelSchemaPalette.get("orange1"),
- "#757472",
- "#000"
- ];
-
- this.highlightColors = [
- PastelSchemaPalette.get("pink2"),
- PastelSchemaPalette.get("purple4"),
- PastelSchemaPalette.get("bluegreen1"),
- PastelSchemaPalette.get("yellow4"),
- PastelSchemaPalette.get("red2"),
- PastelSchemaPalette.get("bluegreen7"),
- PastelSchemaPalette.get("bluegreen5"),
- PastelSchemaPalette.get("orange1"),
- "white",
- "transparent"
- ];
}
componentDidMount() {
@@ -211,6 +142,17 @@ export class RichTextMenu extends AntimodeMenu<AntimodeMenuProps> {
}
}
+ getBoldStatus() {
+ if (this.view && this.TextView.props.isSelected(true)) {
+ const path = (this.view.state.selection.$from as any).path;
+ for (let i = path.length - 3; i < path.length && i >= 0; i -= 3) {
+ if (path[i]?.type === this.view.state.schema.nodes.paragraph || path[i]?.type === this.view.state.schema.nodes.heading) {
+ return path[i].attrs.strong;
+ }
+ }
+ }
+ }
+
// finds font sizes and families in selection
getActiveAlignment() {
if (this.view && this.TextView.props.isSelected(true)) {
@@ -347,104 +289,58 @@ export class RichTextMenu extends AntimodeMenu<AntimodeMenuProps> {
});
}
- createButton(faIcon: string, title: string, isActive: boolean = false, command?: any, onclick?: any) {
- const self = this;
- function onClick(e: React.PointerEvent) {
- e.preventDefault();
- e.stopPropagation();
- self.TextView?.endUndoTypingBatch();
- UndoManager.RunInBatch(() => {
- self.view && command && command(self.view.state, self.view.dispatch, self.view);
- self.view && onclick && onclick(self.view.state, self.view.dispatch, self.view);
- }, "rich text menu command");
- self.setActiveMarkButtons(self.getActiveMarksOnSelection());
- }
-
- return (
- <Tooltip title={<div className="dash-tooltip">{title}</div>} key={title} placement="bottom">
- <button className={"antimodeMenu-button" + (isActive ? " active" : "")} onPointerDown={onClick}>
- <FontAwesomeIcon icon={faIcon as IconProp} size="lg" />
- </button>
- </Tooltip>
- );
+ toggleBold = (view: EditorView, forceBool?: boolean) => {
+ const mark = view.state.schema.mark(view.state.schema.marks.strong, { strong: forceBool });
+ this.setMark(mark, view.state, view.dispatch, false);
+ view.focus();
}
- createMarksDropdown(activeOption: string, options: { mark: Mark | null, title: string, label: string, command: (mark: Mark, view: EditorView) => void, hidden?: boolean, style?: {} }[], key: string, setter: (val: string) => void): JSX.Element {
- const items = options.map(({ title, label, hidden, style }) => {
- if (hidden) {
- return <option value={label} title={title} key={label} style={style ? style : {}} hidden>{label}</option>;
- }
- return <option value={label} title={title} key={label} style={style ? style : {}}>{label}</option>;
- });
-
- const self = this;
- function onChange(e: React.ChangeEvent<HTMLSelectElement>) {
- e.stopPropagation();
- e.preventDefault();
- self.TextView?.endUndoTypingBatch();
- UndoManager.RunInBatch(() => {
- options.forEach(({ label, mark, command }) => {
- if (e.target.value === label && mark) {
- if (!self.TextView?.props.isSelected(true)) {
- switch (mark.type) {
- case schema.marks.pFontFamily: setter(Doc.UserDoc().fontFamily = mark.attrs.family); break;
- case schema.marks.pFontSize: setter(Doc.UserDoc().fontSize = mark.attrs.fontSize.toString() + "px"); break;
- }
- }
- else self.view && mark && command(mark, self.view);
- }
- });
- }, "text mark dropdown");
- }
-
- return <Tooltip key={key} title={<div className="dash-tooltip">{key}</div>} placement="bottom">
- <select onChange={onChange} value={activeOption}>{items}</select>
- </Tooltip>;
+ toggleUnderline = (view: EditorView, forceBool?: boolean) => {
+ const mark = view.state.schema.mark(view.state.schema.marks.underline, { underline: forceBool });
+ this.setMark(mark, view.state, view.dispatch, false);
+ view.focus();
}
- createNodesDropdown(activeMap: string, options: { node: NodeType | any | null, title: string, label: string, command: (node: NodeType | any) => void, hidden?: boolean, style?: {} }[], key: string, setter: (val: string) => {}): JSX.Element {
- const activeOption = activeMap === "bullet" ? ":" : activeMap === "decimal" ? "1.1" : activeMap === "multi" ? "A.1" : "<none>";
- const items = options.map(({ title, label, hidden, style }) => {
- if (hidden) {
- return <option value={label} title={title} key={label} style={style ? style : {}} hidden>{label}</option>;
- }
- return <option value={label} title={title} key={label} style={style ? style : {}}>{label}</option>;
- });
-
- const self = this;
- function onChange(val: string) {
- self.TextView.endUndoTypingBatch();
- options.forEach(({ label, node, command }) => {
- if (val === label && node) {
- if (self.TextView.props.isSelected(true)) {
- UndoManager.RunInBatch(() => self.view && node && command(node), "nodes dropdown");
- setter(val);
- }
- }
- });
- }
-
- return <Tooltip key={key} title={<div className="dash-tooltip">{key}</div>} placement="bottom">
- <select value={activeOption} onChange={e => onChange(e.target.value)}>{items}</select>
- </Tooltip>;
+ toggleItalic = (view: EditorView, forceBool?: boolean) => {
+ const mark = view.state.schema.mark(view.state.schema.marks.em, { em: forceBool });
+ this.setMark(mark, view.state, view.dispatch, false);
+ view.focus();
}
- changeFontSize = (mark: Mark, view: EditorView) => {
- const fmark = view.state.schema.marks.pFontSize.create({ fontSize: mark.attrs.fontSize });
+
+ setFontSize = (size: number, view: EditorView) => {
+ const fmark = view.state.schema.marks.pFontSize.create({ fontSize: size });
this.setMark(fmark, view.state, (tx: any) => view.dispatch(tx.addStoredMark(fmark)), true);
view.focus();
this.updateMenu(view, undefined, this.props);
}
- changeFontFamily = (mark: Mark, view: EditorView) => {
- const fmark = view.state.schema.marks.pFontFamily.create({ family: mark.attrs.family });
+ setFontFamily = (family: string, view: EditorView) => {
+ const fmark = view.state.schema.marks.pFontFamily.create({ family: family });
this.setMark(fmark, view.state, (tx: any) => view.dispatch(tx.addStoredMark(fmark)), true);
view.focus();
this.updateMenu(view, undefined, this.props);
}
+ setHighlight(color: String, view: EditorView, dispatch: any) {
+ const highlightMark = view.state.schema.mark(view.state.schema.marks.marker, { highlight: color });
+ if (view.state.selection.empty) return false;
+ view.focus();
+ this.setMark(highlightMark, view.state, dispatch, false);
+ }
+
+ setColor(color: String, view: EditorView, dispatch: any) {
+ const colorMark = view.state.schema.mark(view.state.schema.marks.pFontColor, { color: color });
+ if (view.state.selection.empty) {
+ dispatch(view.state.tr.addStoredMark(colorMark));
+ return false;
+ }
+ this.setMark(colorMark, view.state, dispatch, true);
+ view.focus();
+ }
+
// TODO: remove doesn't work
- //remove all node type and apply the passed-in one to the selected text
+ // remove all node type and apply the passed-in one to the selected text
changeListType = (nodeType: Node | undefined) => {
if (!this.view || (nodeType as any)?.attrs.mapStyle === "") return;
@@ -490,25 +386,27 @@ export class RichTextMenu extends AntimodeMenu<AntimodeMenuProps> {
dispatch?.(tr.replaceSelectionWith(newNode).removeMark(tr.selection.from - 1, tr.selection.from, mark));
return true;
}
- alignCenter = (state: EditorState<any>, dispatch: any) => {
- return this.TextView.props.isSelected(true) && this.alignParagraphs(state, "center", dispatch);
+ alignCenter = (view: EditorView, dispatch: any) => {
+ return this.TextView.props.isSelected(true) && this.alignParagraphs(view, "center", dispatch);
}
- alignLeft = (state: EditorState<any>, dispatch: any) => {
- return this.TextView.props.isSelected(true) && this.alignParagraphs(state, "left", dispatch);
+ alignLeft = (view: EditorView, dispatch: any) => {
+ return this.TextView.props.isSelected(true) && this.alignParagraphs(view, "left", dispatch);
}
- alignRight = (state: EditorState<any>, dispatch: any) => {
- return this.TextView.props.isSelected(true) && this.alignParagraphs(state, "right", dispatch);
+ alignRight = (view: EditorView, dispatch: any) => {
+ return this.TextView.props.isSelected(true) && this.alignParagraphs(view, "right", dispatch);
}
- alignParagraphs(state: EditorState<any>, align: "left" | "right" | "center", dispatch: any) {
- var tr = state.tr;
- state.doc.nodesBetween(state.selection.from, state.selection.to, (node, pos, parent, index) => {
+ alignParagraphs(view: EditorView, align: "left" | "right" | "center", dispatch: any) {
+ var tr = view.state.tr;
+ view.state.doc.nodesBetween(view.state.selection.from, view.state.selection.to, (node, pos, parent, index) => {
if (node.type === schema.nodes.paragraph || node.type === schema.nodes.heading) {
tr = tr.setNodeMarkup(pos, node.type, { ...node.attrs, align }, node.marks);
return false;
}
+ view.focus();
return true;
});
+ view.focus();
dispatch?.(tr);
return true;
}
@@ -597,47 +495,6 @@ export class RichTextMenu extends AntimodeMenu<AntimodeMenuProps> {
}
_brushNameRef = React.createRef<HTMLInputElement>();
- createBrushButton() {
- const self = this;
- const onBrushClick = (e: React.MouseEvent) => {
- e.preventDefault();
- e.stopPropagation();
- self.TextView.endUndoTypingBatch();
- UndoManager.RunInBatch(() => self.view && self.fillBrush(self.view.state, self.view.dispatch), "rt brush");
- };
-
- let label = "Stored marks: ";
- if (this.brushMarks && this.brushMarks.size > 0) {
- this.brushMarks.forEach((mark: Mark) => {
- const markType = mark.type;
- label += markType.name;
- label += ", ";
- });
- label = label.substring(0, label.length - 2);
- } else {
- label = "No marks are currently stored";
- }
-
- //onPointerDown={onBrushClick}
-
- const button = <Tooltip title={<div className="dash-tooltip">style brush</div>} placement="bottom">
- <button className="antimodeMenu-button" onClick={onBrushClick} style={this.brushMarks?.size > 0 ? { backgroundColor: "121212" } : {}}>
- <FontAwesomeIcon icon="paint-roller" size="lg" style={{ transitionProperty: "transform", transitionDuration: "0.1s", transform: `rotate(${this.brushMarks?.size > 0 ? 45 : 0}deg)` }} />
- </button>
- </Tooltip>;
-
- const dropdownContent =
- <div className="dropdown">
- <p>{label}</p>
- <button onPointerDown={this.clearBrush}>Clear brush</button>
- <input placeholder="-brush name-" ref={this._brushNameRef} onKeyPress={this.onBrushNameKeyPress} />
- </div>;
-
- return (
- <ButtonDropdown view={this.view} key={"brush dropdown"} button={button} openDropdownOnButton={false} dropdownContent={dropdownContent} />
- );
- }
-
@action
clearBrush() {
RichTextMenu.Instance.brushMarks = new Set();
@@ -666,123 +523,14 @@ export class RichTextMenu extends AntimodeMenu<AntimodeMenuProps> {
}
}
- @action toggleColorDropdown() { this.showColorDropdown = !this.showColorDropdown; }
- @action setActiveColor(color: string) { this.activeFontColor = color; }
get TextView() { return (this.view as any)?.TextView as FormattedTextBox; }
get TextViewFieldKey() { return this.TextView?.props.fieldKey; }
- createColorButton() {
- const self = this;
- function onColorClick(e: React.PointerEvent) {
- e.preventDefault();
- e.stopPropagation();
- self.TextView.endUndoTypingBatch();
- if (self.view) {
- UndoManager.RunInBatch(() => self.view && self.insertColor(self.activeFontColor, self.view.state, self.view.dispatch), "rt menu color");
- self.view.focus();
- self.updateMenu(self.view, undefined, self.props);
- }
- }
- function changeColor(e: React.PointerEvent, color: string) {
- e.preventDefault();
- e.stopPropagation();
- self.setActiveColor(color);
- self.TextView.endUndoTypingBatch();
- if (self.view) {
- UndoManager.RunInBatch(() => self.view && self.insertColor(self.activeFontColor, self.view.state, self.view.dispatch), "rt menu color");
- self.view.focus();
- self.updateMenu(self.view, undefined, self.props);
- }
- }
-
- // onPointerDown={onColorClick}
- const button = <Tooltip title={<div className="dash-tooltip">set font color</div>} placement="bottom">
- <button className="antimodeMenu-button color-preview-button">
- <FontAwesomeIcon icon="palette" size="lg" />
- <div className="color-preview" style={{ backgroundColor: this.activeFontColor }}></div>
- </button>
- </Tooltip>;
-
- const dropdownContent =
- <div className="dropdown" >
- <p>Change font color:</p>
- <div className="color-wrapper">
- {this.fontColors.map(color => {
- if (color) {
- return this.activeFontColor === color ?
- <button className="color-button active" key={"active" + color} style={{ backgroundColor: color }} onPointerDown={e => changeColor(e, color)}></button> :
- <button className="color-button" key={"other" + color} style={{ backgroundColor: color }} onPointerDown={e => changeColor(e, color)}></button>;
- }
- })}
- </div>
- </div>;
- return (
- <ButtonDropdown view={this.view} key={"color dropdown"} button={button} dropdownContent={dropdownContent} openDropdownOnButton={true} />
- );
- }
- public insertColor(color: String, state: EditorState<any>, dispatch: any) {
- const colorMark = state.schema.mark(state.schema.marks.pFontColor, { color: color });
- if (state.selection.empty) {
- dispatch(state.tr.addStoredMark(colorMark));
- return false;
- }
- this.setMark(colorMark, state, dispatch, true);
- }
-
- @action toggleHighlightDropdown() { this.showHighlightDropdown = !this.showHighlightDropdown; }
@action setActiveHighlight(color: string) { this.activeHighlightColor = color; }
- createHighlighterButton() {
- const self = this;
- function onHighlightClick(e: React.PointerEvent) {
- e.preventDefault();
- e.stopPropagation();
- self.TextView.endUndoTypingBatch();
- UndoManager.RunInBatch(() => self.view && self.insertHighlight(self.activeHighlightColor, self.view.state, self.view.dispatch), "rt highligher");
- }
- function changeHighlight(e: React.PointerEvent, color: string) {
- e.preventDefault();
- e.stopPropagation();
- self.setActiveHighlight(color);
- self.TextView.endUndoTypingBatch();
- UndoManager.RunInBatch(() => self.view && self.insertHighlight(self.activeHighlightColor, self.view.state, self.view.dispatch), "rt highlighter");
- }
-
- //onPointerDown={onHighlightClick}
- const button = <Tooltip title={<div className="dash-tooltip">set highlight color</div>} placement="bottom">
- <button className="antimodeMenu-button color-preview-button" key="highilghter-button" >
- <FontAwesomeIcon icon="highlighter" size="lg" />
- <div className="color-preview" style={{ backgroundColor: this.activeHighlightColor }}></div>
- </button>
- </Tooltip>;
-
- const dropdownContent =
- <div className="dropdown">
- <p>Change highlight color:</p>
- <div className="color-wrapper">
- {this.highlightColors.map(color => {
- if (color) {
- return this.activeHighlightColor === color ?
- <button className="color-button active" key={`active ${color}`} style={{ backgroundColor: color }} onPointerDown={e => changeHighlight(e, color)}>{color === "transparent" ? "X" : ""}</button> :
- <button className="color-button" key={`inactive ${color}`} style={{ backgroundColor: color }} onPointerDown={e => changeHighlight(e, color)}>{color === "transparent" ? "X" : ""}</button>;
- }
- })}
- </div>
- </div>;
-
- return (
- <ButtonDropdown view={this.view} key={"highlighter"} button={button} dropdownContent={dropdownContent} openDropdownOnButton={true} />
- );
- }
-
- insertHighlight(color: String, state: EditorState<any>, dispatch: any) {
- if (state.selection.empty) return false;
- toggleMark(state.schema.marks.marker, { highlight: color })(state, dispatch);
- }
- @action toggleLinkDropdown() { this.showLinkDropdown = !this.showLinkDropdown; }
@action setCurrentLink(link: string) { this.currentLink = link; }
createLinkButton() {
@@ -828,7 +576,7 @@ export class RichTextMenu extends AntimodeMenu<AntimodeMenuProps> {
if (linkDoc instanceof Doc) {
const anchor1 = await Cast(linkDoc.anchor1, Doc);
const anchor2 = await Cast(linkDoc.anchor2, Doc);
- const currentDoc = SelectionManager.Views().length && SelectionManager.Views()[0].props.Document;
+ const currentDoc = SelectionManager.Docs().lastElement();
if (currentDoc && anchor1 && anchor2) {
if (Doc.AreProtosEqual(currentDoc, anchor1)) {
return StrCast(anchor2.title);
@@ -852,7 +600,6 @@ export class RichTextMenu extends AntimodeMenu<AntimodeMenuProps> {
@undoBatch
makeLinkToURL = (target: string, lcoation: string) => {
((this.view as any)?.TextView as FormattedTextBox).makeLinkAnchor(undefined, "onRadd:rightight", target, target);
- console.log((this.view as any)?.TextView);
}
@undoBatch
@@ -921,95 +668,70 @@ export class RichTextMenu extends AntimodeMenu<AntimodeMenuProps> {
return ref_node;
}
- @action onPointerEnter(e: React.PointerEvent) { RichTextMenu.Instance.overMenu = false; }
- @action onPointerLeave(e: React.PointerEvent) { RichTextMenu.Instance.overMenu = false; }
-
- @action
- toggleMenuPin = (e: React.MouseEvent) => {
- Doc.UserDoc()["menuRichText-pinned"] = this.Pinned = !this.Pinned;
- if (!this.Pinned) {
- this.fadeOut(true);
- }
- }
-
- @action
- protected toggleCollapse = (e: React.MouseEvent) => {
- this.collapsed = !this.collapsed;
- setTimeout(() => {
- const x = Math.min(this._left, window.innerWidth - RichTextMenu.Instance.width);
- RichTextMenu.Instance.jumpTo(x, this._top, true);
- }, 0);
- }
-
render() {
- TraceMobx();
- const row1 = <div className="antimodeMenu-row" key="row 1" style={{ display: this.collapsed ? "none" : undefined }}>{[
- //!this.collapsed ? this.getDragger() : (null),
- // !this.Pinned ? (null) : <div key="frag1"> {[
- // this.createButton("bold", "Bold", this.boldActive, toggleMark(schema.marks.strong)),
- // this.createButton("italic", "Italic", this.italicsActive, toggleMark(schema.marks.em)),
- // this.createButton("underline", "Underline", this.underlineActive, toggleMark(schema.marks.underline)),
- // this.createButton("strikethrough", "Strikethrough", this.strikethroughActive, toggleMark(schema.marks.strikethrough)),
- // this.createButton("superscript", "Superscript", this.superscriptActive, toggleMark(schema.marks.superscript)),
- // this.createButton("subscript", "Subscript", this.subscriptActive, toggleMark(schema.marks.subscript)),
- // <div className="richTextMenu-divider" key="divider" />
- // ]}</div>,
- this.createButton("bold", "Bold", this.boldActive, toggleMark(schema.marks.strong)),
- this.createButton("italic", "Italic", this.italicsActive, toggleMark(schema.marks.em)),
- this.createButton("underline", "Underline", this.underlineActive, toggleMark(schema.marks.underline)),
- this.createButton("strikethrough", "Strikethrough", this.strikethroughActive, toggleMark(schema.marks.strikethrough)),
- this.createButton("superscript", "Superscript", this.superscriptActive, toggleMark(schema.marks.superscript)),
- this.createButton("subscript", "Subscript", this.subscriptActive, toggleMark(schema.marks.subscript)),
- this.createColorButton(),
- this.createHighlighterButton(),
- this.createLinkButton(),
- this.createBrushButton(),
- <div className="collectionMenu-divider" key="divider 2" />,
- this.createButton("align-left", "Align Left", this.activeAlignment === "left", this.alignLeft),
- this.createButton("align-center", "Align Center", this.activeAlignment === "center", this.alignCenter),
- this.createButton("align-right", "Align Right", this.activeAlignment === "right", this.alignRight),
- this.createButton("indent", "Inset More", undefined, this.insetParagraph),
- this.createButton("outdent", "Inset Less", undefined, this.outsetParagraph),
- this.createButton("hand-point-left", "Hanging Indent", undefined, this.hangingIndentParagraph),
- this.createButton("hand-point-right", "Indent", undefined, this.indentParagraph),
- ]}</div>;
-
- const row2 = <div className="antimodeMenu-row row-2" key="row2">
- {this.collapsed ? this.getDragger() : (null)}
- <div key="row 2" style={{ display: this.collapsed ? "none" : undefined }}>
- <div className="collectionMenu-divider" key="divider 3" />
- {[this.createMarksDropdown(this.activeFontSize, this.fontSizeOptions, "font size", action((val: string) => {
- this.activeFontSize = val;
- SelectionManager.Views().map(dv => dv.props.Document._fontSize = val);
- })),
- this.createMarksDropdown(this.activeFontFamily, this.fontFamilyOptions, "font family", action((val: string) => {
- this.activeFontFamily = val;
- SelectionManager.Views().map(dv => dv.props.Document._fontFamily = val);
- })),
- <div className="collectionMenu-divider" key="divider 4" />,
- this.createNodesDropdown(this.activeListType, this.listTypeOptions, "list type", () => ({})),
- this.createButton("sort-amount-down", "Summarize", undefined, this.insertSummarizer),
- this.createButton("quote-left", "Blockquote", undefined, this.insertBlockquote),
- this.createButton("minus", "Horizontal Rule", undefined, this.insertHorizontalRule)
- ]}
- </div>
- {/* <div key="collapser">
- {<div key="collapser">
- <button className="antimodeMenu-button" key="collapse menu" title="Collapse menu" onClick={this.toggleCollapse} style={{ backgroundColor: this.collapsed ? "#121212" : "", width: 25 }}>
- <FontAwesomeIcon icon="chevron-left" size="lg" style={{ transitionProperty: "transform", transitionDuration: "0.3s", transform: `rotate(${this.collapsed ? 180 : 0}deg)` }} />
- </button>
- </div> }
- <button className="antimodeMenu-button" key="pin menu" title="Pin menu" onClick={this.toggleMenuPin} style={{ backgroundColor: this.Pinned ? "#121212" : "", display: this.collapsed ? "none" : undefined }}>
- <FontAwesomeIcon icon="thumbtack" size="lg" style={{ transitionProperty: "transform", transitionDuration: "0.1s", transform: `rotate(${this.Pinned ? 45 : 0}deg)` }} />
- </button>
- </div> */}
- </div>;
-
- return (
- <div className="richTextMenu" onPointerEnter={this.onPointerEnter} onPointerLeave={this.onPointerLeave} >
- {this.getElementWithRows([row1, row2], 2, false)}
- </div>
- );
+ return null;
+ // TraceMobx();
+ // const row1 = <div className="antimodeMenu-row" key="row 1" style={{ display: this.collapsed ? "none" : undefined }}>{[
+ // //!this.collapsed ? this.getDragger() : (null),
+ // // !this.Pinned ? (null) : <div key="frag1"> {[
+ // // this.createButton("bold", "Bold", this.boldActive, toggleMark(schema.marks.strong)),
+ // // this.createButton("italic", "Italic", this.italicsActive, toggleMark(schema.marks.em)),
+ // // this.createButton("underline", "Underline", this.underlineActive, toggleMark(schema.marks.underline)),
+ // // this.createButton("strikethrough", "Strikethrough", this.strikethroughActive, toggleMark(schema.marks.strikethrough)),
+ // // this.createButton("superscript", "Superscript", this.superscriptActive, toggleMark(schema.marks.superscript)),
+ // // this.createButton("subscript", "Subscript", this.subscriptActive, toggleMark(schema.marks.subscript)),
+ // // <div className="richTextMenu-divider" key="divider" />
+ // // ]}</div>,
+ // this.createButton("bold", "Bold", this.boldActive, toggleMark(schema.marks.strong)),
+ // this.createButton("italic", "Italic", this.italicsActive, toggleMark(schema.marks.em)),
+ // this.createButton("underline", "Underline", this.underlineActive, toggleMark(schema.marks.underline)),
+ // this.createButton("strikethrough", "Strikethrough", this.strikethroughActive, toggleMark(schema.marks.strikethrough)),
+ // this.createButton("superscript", "Superscript", this.superscriptActive, toggleMark(schema.marks.superscript)),
+ // this.createButton("subscript", "Subscript", this.subscriptActive, toggleMark(schema.marks.subscript)),
+ // this.createColorButton(),
+ // this.createHighlighterButton(),
+ // this.createLinkButton(),
+ // this.createBrushButton(),
+ // <div className="collectionMenu-divider" key="divider 2" />,
+ // this.createButton("align-left", "Align Left", this.activeAlignment === "left", this.alignLeft),
+ // this.createButton("align-center", "Align Center", this.activeAlignment === "center", this.alignCenter),
+ // this.createButton("align-right", "Align Right", this.activeAlignment === "right", this.alignRight),
+ // this.createButton("indent", "Inset More", undefined, this.insetParagraph),
+ // this.createButton("outdent", "Inset Less", undefined, this.outsetParagraph),
+ // this.createButton("hand-point-left", "Hanging Indent", undefined, this.hangingIndentParagraph),
+ // this.createButton("hand-point-right", "Indent", undefined, this.indentParagraph),
+ // ]}</div>;
+
+ // const row2 = <div className="antimodeMenu-row row-2" key="row2">
+ // {this.collapsed ? this.getDragger() : (null)}
+ // <div key="row 2" style={{ display: this.collapsed ? "none" : undefined }}>
+ // <div className="collectionMenu-divider" key="divider 3" />
+ // {[this.createMarksDropdown(this.activeFontSize, this.fontSizeOptions, "font size", action((val: string) => {
+ // this.activeFontSize = val;
+ // SelectionManager.Views().map(dv => dv.props.Document._fontSize = val);
+ // })),
+ // this.createMarksDropdown(this.activeFontFamily, this.fontFamilyOptions, "font family", action((val: string) => {
+ // this.activeFontFamily = val;
+ // SelectionManager.Views().map(dv => dv.props.Document._fontFamily = val);
+ // })),
+ // <div className="collectionMenu-divider" key="divider 4" />,
+ // this.createNodesDropdown(this.activeListType, this.listTypeOptions, "list type", () => ({})),
+ // this.createButton("sort-amount-down", "Summarize", undefined, this.insertSummarizer),
+ // this.createButton("quote-left", "Blockquote", undefined, this.insertBlockquote),
+ // this.createButton("minus", "Horizontal Rule", undefined, this.insertHorizontalRule)
+ // ]}
+ // </div>
+ // {/* <div key="collapser">
+ // {<div key="collapser">
+ // <button className="antimodeMenu-button" key="collapse menu" title="Collapse menu" onClick={this.toggleCollapse} style={{ backgroundColor: this.collapsed ? "#121212" : "", width: 25 }}>
+ // <FontAwesomeIcon icon="chevron-left" size="lg" style={{ transitionProperty: "transform", transitionDuration: "0.3s", transform: `rotate(${this.collapsed ? 180 : 0}deg)` }} />
+ // </button>
+ // </div> }
+ // <button className="antimodeMenu-button" key="pin menu" title="Pin menu" onClick={this.toggleMenuPin} style={{ backgroundColor: this.Pinned ? "#121212" : "", display: this.collapsed ? "none" : undefined }}>
+ // <FontAwesomeIcon icon="thumbtack" size="lg" style={{ transitionProperty: "transform", transitionDuration: "0.1s", transform: `rotate(${this.Pinned ? 45 : 0}deg)` }} />
+ // </button>
+ // </div> */}
+ // </div>;
}
}
diff --git a/src/client/views/nodes/trails/PresBox.tsx b/src/client/views/nodes/trails/PresBox.tsx
index 033371e96..f34b4a8ac 100644
--- a/src/client/views/nodes/trails/PresBox.tsx
+++ b/src/client/views/nodes/trails/PresBox.tsx
@@ -171,8 +171,8 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
this.layoutDoc._gridGap = 0;
this.layoutDoc._yMargin = 0;
this.turnOffEdit(true);
- DocListCastAsync((Doc.UserDoc().myPresentations as Doc).data).then(pres =>
- !pres?.includes(this.rootDoc) && Doc.AddDocToList(Doc.UserDoc().myPresentations as Doc, "data", this.rootDoc));
+ DocListCastAsync((Doc.UserDoc().myTrails as Doc).data).then(pres =>
+ !pres?.includes(this.rootDoc) && Doc.AddDocToList(Doc.UserDoc().myTrails as Doc, "data", this.rootDoc));
this._disposers.selection = reaction(() => SelectionManager.Views(),
views => views.some(view => view.props.Document === this.rootDoc) && this.updateCurrentPresentation());
}
@@ -407,11 +407,11 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
LightboxView.SetLightboxDoc(targetDoc);
} else if (curDoc.presMovement === PresMovement.Pan && targetDoc) {
LightboxView.SetLightboxDoc(undefined);
- await DocumentManager.Instance.jumpToDocument(targetDoc, false, openInTab, srcContext, undefined, undefined, undefined, includesDoc || tab ? undefined : resetSelection); // documents open in new tab instead of on right
+ await DocumentManager.Instance.jumpToDocument(targetDoc, false, openInTab, srcContext, undefined, undefined, undefined, includesDoc || tab ? undefined : resetSelection, undefined, true); // documents open in new tab instead of on right
} else if ((curDoc.presMovement === PresMovement.Zoom || curDoc.presMovement === PresMovement.Jump) && targetDoc) {
LightboxView.SetLightboxDoc(undefined);
//awaiting jump so that new scale can be found, since jumping is async
- await DocumentManager.Instance.jumpToDocument(targetDoc, true, openInTab, srcContext, undefined, undefined, undefined, includesDoc || tab ? undefined : resetSelection); // documents open in new tab instead of on right
+ await DocumentManager.Instance.jumpToDocument(targetDoc, true, openInTab, srcContext, undefined, undefined, undefined, includesDoc || tab ? undefined : resetSelection, undefined, true); // documents open in new tab instead of on right
}
// After navigating to the document, if it is added as a presPinView then it will
// adjust the pan and scale to that of the pinView when it was added.
@@ -419,8 +419,6 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
// if targetDoc is not displayed but one of its aliases is, then we need to modify that alias, not the original target
this.navigateToView(targetDoc, activeItem);
}
- // TODO: Add progressivize for navigating web (storing websites for given frames)
-
}
/**
@@ -614,7 +612,7 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
this.layoutDoc.presStatus = PresStatus.Edit;
Doc.RemoveDocFromList((Doc.UserDoc().myOverlayDocs as Doc), undefined, this.rootDoc);
CollectionDockingView.AddSplit(this.rootDoc, "right");
- } else if (this.layoutDoc.context && docView) {
+ } else if ((true || this.layoutDoc.context) && docView) {
console.log("case 2");
this.layoutDoc.presStatus = PresStatus.Edit;
clearTimeout(this._presTimer);
@@ -2239,7 +2237,7 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
const isMini: boolean = this.toolbarWidth <= 100;
return (
<div className="presBox-buttons" style={{ display: !this.rootDoc._chromeHidden ? "none" : undefined }}>
- {isMini ? (null) : <select className="presBox-viewPicker"
+ {isMini || Doc.UserDoc().noviceMode ? (null) : <select className="presBox-viewPicker"
style={{ display: this.layoutDoc.presStatus === "edit" ? "block" : "none" }}
onPointerDown={e => e.stopPropagation()}
onChange={this.viewChanged}
diff --git a/src/client/views/pdf/AnchorMenu.scss b/src/client/views/pdf/AnchorMenu.scss
index b7afb26a5..6990bdcf1 100644
--- a/src/client/views/pdf/AnchorMenu.scss
+++ b/src/client/views/pdf/AnchorMenu.scss
@@ -4,6 +4,35 @@
padding: 5px;
grid-template-columns: 90px 20px 90px;
}
+.anchorMenu-highlighter {
+ padding-right: 5px;
+ .antimodeMenu-button {
+ padding: 0;
+ padding: 0;
+ padding-right: 0px;
+ padding-left: 0px;
+ width: 5px;
+ }
+}
+.anchor-color-preview-button {
+ width: 25px !important;
+ .anchor-color-preview {
+ display: flex;
+ flex-direction: column;
+ padding-right: 3px;
+ width: unset !important;
+ .color-preview {
+ width: 60%;
+ top: 80%;
+ height: 4px;
+ position: relative;
+ top: unset;
+ width: 15px;
+ margin-top: 5px;
+ display: block;
+ }
+ }
+}
.color-wrapper {
display: flex;
diff --git a/src/client/views/pdf/AnchorMenu.tsx b/src/client/views/pdf/AnchorMenu.tsx
index 55816ed52..ad3afb775 100644
--- a/src/client/views/pdf/AnchorMenu.tsx
+++ b/src/client/views/pdf/AnchorMenu.tsx
@@ -41,10 +41,11 @@ export class AnchorMenu extends AntimodeMenu<AntimodeMenuProps> {
@observable private highlightColor: string = "rgba(245, 230, 95, 0.616)";
@observable private _showLinkPopup: boolean = false;
- @observable public _colorBtn = false;
@observable public Highlighting: boolean = false;
@observable public Status: "marquee" | "annotation" | "" = "";
+ public onMakeAnchor: () => Opt<Doc> = () => undefined; // Method to get anchor from text search
+
public OnClick: (e: PointerEvent) => void = unimplementedFunction;
public StartDrag: (e: PointerEvent, ele: HTMLElement) => void = unimplementedFunction;
public Highlight: (color: string, isPushpin: boolean) => Opt<Doc> = (color: string, isPushpin: boolean) => undefined;
@@ -65,7 +66,10 @@ export class AnchorMenu extends AntimodeMenu<AntimodeMenuProps> {
componentDidMount() {
this._disposer = reaction(() => SelectionManager.Views(),
- selected => AnchorMenu.Instance.fadeOut(true));
+ selected => {
+ this._showLinkPopup = false;
+ AnchorMenu.Instance.fadeOut(true);
+ });
}
pointerDown = (e: React.PointerEvent) => {
@@ -80,6 +84,7 @@ export class AnchorMenu extends AntimodeMenu<AntimodeMenuProps> {
if (!this.Highlight(this.highlightColor, false) && this.Pinned) {
this.Highlighting = !this.Highlighting;
}
+ AnchorMenu.Instance.fadeOut(true);
}
@action
@@ -91,9 +96,11 @@ export class AnchorMenu extends AntimodeMenu<AntimodeMenuProps> {
@computed get highlighter() {
const button =
- <button className="antimodeMenu-button color-preview-button" title="" key="highlighter-button" onClick={this.highlightClicked}>
- <FontAwesomeIcon icon="highlighter" size="lg" style={{ transition: "transform 0.1s", transform: this.Highlighting ? "" : "rotate(-45deg)" }} />
- <div className="color-preview" style={{ backgroundColor: this.highlightColor }}></div>
+ <button className="antimodeMenu-button anchor-color-preview-button" title="" key="highlighter-button" onClick={this.highlightClicked}>
+ <div className="anchor-color-preview" >
+ <FontAwesomeIcon icon="highlighter" size="lg" style={{ transition: "transform 0.1s", transform: this.Highlighting ? "" : "rotate(-45deg)" }} />
+ <div className="color-preview" style={{ backgroundColor: this.highlightColor }}></div>
+ </div>
</button>;
const dropdownContent =
@@ -111,7 +118,9 @@ export class AnchorMenu extends AntimodeMenu<AntimodeMenuProps> {
</div>;
return (
<Tooltip key="highlighter" title={<div className="dash-tooltip">{"Click to Highlight"}</div>}>
- <ButtonDropdown key={"highlighter"} button={button} dropdownContent={dropdownContent} pdf={true} />
+ <div className="anchorMenu-highlighter">
+ <ButtonDropdown key={"highlighter"} button={button} dropdownContent={dropdownContent} pdf={true} />
+ </div>
</Tooltip>
);
}
@@ -145,14 +154,14 @@ export class AnchorMenu extends AntimodeMenu<AntimodeMenuProps> {
<FontAwesomeIcon icon="comment-alt" size="lg" />
</button>
</Tooltip>,
-
- //NOTE: link popup is currently incomplete
- // <Tooltip key="link" title={<div className="dash-tooltip">{"Link selected text to document or URL"}</div>}>
- // <button className="antimodeMenu-button link" onPointerDown={this.toggleLinkPopup} style={{}}>
- // <FontAwesomeIcon icon="link" size="lg" />
- // </button>
- // </Tooltip>,
- // <LinkPopup showPopup={this._showLinkPopup} />
+ //NOTE: link popup is currently in progress
+ <Tooltip key="link" title={<div className="dash-tooltip">{"Find document to link to selected text"}</div>}>
+ <button className="antimodeMenu-button link" onPointerDown={this.toggleLinkPopup} style={{}}>
+ <FontAwesomeIcon style={{ position: "absolute", transform: "scale(1.5)" }} icon={"search"} size="lg" />
+ <FontAwesomeIcon style={{ position: "absolute", transform: "scale(0.5)", transformOrigin: "top left", top: 12, left: 12 }} icon={"link"} size="lg" />
+ </button>
+ </Tooltip>,
+ <LinkPopup key="popup" showPopup={this._showLinkPopup} linkFrom={this.onMakeAnchor} />
] : [
<Tooltip key="trash" title={<div className="dash-tooltip">{"Remove Link Anchor"}</div>}>
<button className="antimodeMenu-button" onPointerDown={this.Delete}>
diff --git a/src/client/views/pdf/PDFViewer.tsx b/src/client/views/pdf/PDFViewer.tsx
index ee553fd43..d953c6b6c 100644
--- a/src/client/views/pdf/PDFViewer.tsx
+++ b/src/client/views/pdf/PDFViewer.tsx
@@ -2,14 +2,13 @@ import { action, computed, IReactionDisposer, observable, ObservableMap, reactio
import { observer } from "mobx-react";
import * as Pdfjs from "pdfjs-dist";
import "pdfjs-dist/web/pdf_viewer.css";
-import { DataSym, Doc, DocListCast, Field, HeightSym, Opt, WidthSym } from "../../../fields/Doc";
+import { Doc, DocListCast, Field, HeightSym, Opt, WidthSym } from "../../../fields/Doc";
import { Id } from "../../../fields/FieldSymbols";
import { InkTool } from "../../../fields/InkField";
-import { createSchema } from "../../../fields/Schema";
import { Cast, NumCast, ScriptCast, StrCast } from "../../../fields/Types";
import { PdfField } from "../../../fields/URLField";
import { TraceMobx } from "../../../fields/util";
-import { addStyleSheet, addStyleSheetRule, clearStyleSheetRules, emptyFunction, OmitKeys, smoothScroll, Utils, returnFalse } from "../../../Utils";
+import { addStyleSheet, addStyleSheetRule, clearStyleSheetRules, emptyFunction, OmitKeys, smoothScroll, Utils } from "../../../Utils";
import { DocUtils } from "../../documents/Documents";
import { Networking } from "../../Network";
import { CurrentUserUtils } from "../../util/CurrentUserUtils";
@@ -69,7 +68,7 @@ export class PDFViewer extends React.Component<IViewerProps> {
private _pdfViewer: any;
private _styleRule: any; // stylesheet rule for making hyperlinks clickable
private _retries = 0; // number of times tried to create the PDF viewer
- private _setPreviewCursor: undefined | ((x: number, y: number, drag: boolean) => void);
+ private _setPreviewCursor: undefined | ((x: number, y: number, drag: boolean, hide: boolean) => void);
private _annotationLayer: React.RefObject<HTMLDivElement> = React.createRef();
private _disposers: { [name: string]: IReactionDisposer } = {};
private _viewer: React.RefObject<HTMLDivElement> = React.createRef();
@@ -119,9 +118,11 @@ export class PDFViewer extends React.Component<IViewerProps> {
this._mainCont.current?.addEventListener("scroll", e => (e.target as any).scrollLeft = 0);
this._disposers.autoHeight = reaction(() => this.props.layoutDoc._autoHeight,
- () => {
- this.props.layoutDoc._nativeHeight = NumCast(this.props.Document[this.props.fieldKey + "-nativeHeight"]);
- this.props.setHeight(NumCast(this.props.Document[this.props.fieldKey + "-nativeHeight"]) * (this.props.scaling?.() || 1));
+ autoHeight => {
+ if (autoHeight) {
+ this.props.layoutDoc._nativeHeight = NumCast(this.props.Document[this.props.fieldKey + "-nativeHeight"]);
+ this.props.setHeight(NumCast(this.props.Document[this.props.fieldKey + "-nativeHeight"]) * (this.props.scaling?.() || 1));
+ }
});
this._disposers.searchMatch = reaction(() => Doc.IsSearchMatch(this.props.rootDoc),
@@ -371,10 +372,11 @@ export class PDFViewer extends React.Component<IViewerProps> {
this._downY = e.clientY;
if ((this.props.Document._viewScale || 1) !== 1) return;
if ((e.button !== 0 || e.altKey) && this.props.isContentActive(true)) {
- this._setPreviewCursor?.(e.clientX, e.clientY, true);
+ this._setPreviewCursor?.(e.clientX, e.clientY, true, false);
}
if (!e.altKey && e.button === 0 && this.props.isContentActive(true) && ![InkTool.Highlighter, InkTool.Pen].includes(CurrentUserUtils.SelectedTool)) {
this.props.select(false);
+ MarqueeAnnotator.clearAnnotations(this._savedAnnotations);
this._marqueeing = [e.clientX, e.clientY];
if (e.target && ((e.target as any).className.includes("endOfContent") || ((e.target as any).parentElement.className !== "textLayer"))) {
this._textSelecting = false;
@@ -382,10 +384,7 @@ export class PDFViewer extends React.Component<IViewerProps> {
} else {
// if textLayer is hit, then we select text instead of using a marquee so clear out the marquee.
setTimeout(action(() => this._marqueeing = undefined), 100); // bcz: hack .. anchor menu is setup within MarqueeAnnotator so we need to at least create the marqueeAnnotator even though we aren't using it.
- // clear out old marquees and initialize menu for new selection
- AnchorMenu.Instance.Status = "marquee";
- Array.from(this._savedAnnotations.values()).forEach(v => v.forEach(a => a.remove()));
- this._savedAnnotations.clear();
+
this._styleRule = addStyleSheetRule(PDFViewer._annotationStyle, "htmlAnnotation", { "pointer-events": "none" });
document.addEventListener("pointerup", this.onSelectEnd);
document.addEventListener("pointermove", this.onSelectMove);
@@ -454,12 +453,12 @@ export class PDFViewer extends React.Component<IViewerProps> {
if (this._setPreviewCursor && e.button === 0 &&
Math.abs(e.clientX - this._downX) < Utils.DRAG_THRESHOLD &&
Math.abs(e.clientY - this._downY) < Utils.DRAG_THRESHOLD) {
- this._setPreviewCursor(e.clientX, e.clientY, false);
+ this._setPreviewCursor(e.clientX, e.clientY, false, false);
}
// e.stopPropagation(); // bcz: not sure why this was here. We need to allow the DocumentView to get clicks to process doubleClicks
}
- setPreviewCursor = (func?: (x: number, y: number, drag: boolean) => void) => this._setPreviewCursor = func;
+ setPreviewCursor = (func?: (x: number, y: number, drag: boolean, hide: boolean) => void) => this._setPreviewCursor = func;
getCoverImage = () => {
if (!this.props.Document[HeightSym]() || !Doc.NativeHeight(this.props.Document)) {
@@ -508,16 +507,12 @@ export class PDFViewer extends React.Component<IViewerProps> {
overlayTransform = () => this.scrollXf().scale(1 / this._zoomed);
panelWidth = () => this.props.PanelWidth() / (this.props.scaling?.() || 1); // (this.Document.scrollHeight || Doc.NativeHeight(this.Document) || 0);
panelHeight = () => this.props.PanelHeight() / (this.props.scaling?.() || 1); // () => this._pageSizes.length && this._pageSizes[0] ? this._pageSizes[0].width : Doc.NativeWidth(this.Document);
+ transparentFilter = () => [...this.props.docFilters(), Utils.IsTransparentFilter()];
+ opaqueFilter = () => [...this.props.docFilters(), Utils.IsOpaqueFilter()];
@computed get overlayLayer() {
- return <div className={`pdfViewerDash-overlay${CurrentUserUtils.SelectedTool !== InkTool.None || SnappingManager.GetIsDragging() ? "-inking" : ""}`}
- style={{
- pointerEvents: SnappingManager.GetIsDragging() ? "all" : undefined,
- mixBlendMode: this.allAnnotations.some(anno => anno.mixBlendMode) ? "hard-light" : undefined,
- transform: `scale(${this._zoomed})`
- }}>
+ const renderAnnotations = (docFilters?: () => string[]) =>
<CollectionFreeFormView {...OmitKeys(this.props, ["NativeWidth", "NativeHeight", "setContentView"]).omit}
isAnnotationOverlay={true}
- isContentActive={returnFalse}
fieldKey={this.props.fieldKey + "-annotations"}
setPreviewCursor={this.setPreviewCursor}
PanelHeight={this.panelHeight}
@@ -526,10 +521,30 @@ export class PDFViewer extends React.Component<IViewerProps> {
select={emptyFunction}
ContentScaling={this.contentZoom}
bringToFront={emptyFunction}
+ docFilters={docFilters || this.props.docFilters}
+ dontRenderDocuments={docFilters ? false : true}
CollectionView={undefined}
ScreenToLocalTransform={this.overlayTransform}
renderDepth={this.props.renderDepth + 1}
- childPointerEvents={true} />
+ childPointerEvents={true} />;
+ return <div>
+ <div className={`pdfViewerDash-overlay${CurrentUserUtils.SelectedTool !== InkTool.None || SnappingManager.GetIsDragging() ? "-inking" : ""}`}
+ style={{
+ pointerEvents: SnappingManager.GetIsDragging() ? "all" : undefined,
+ mixBlendMode: "multiply",
+ transform: `scale(${this._zoomed})`
+ }}>
+ {renderAnnotations(this.transparentFilter)}
+ </div>
+ <div className={`pdfViewerDash-overlay${CurrentUserUtils.SelectedTool !== InkTool.None || SnappingManager.GetIsDragging() ? "-inking" : ""}`}
+ style={{
+ pointerEvents: SnappingManager.GetIsDragging() ? "all" : undefined,
+ mixBlendMode: this.allAnnotations.some(anno => anno.mixBlendMode) ? "hard-light" : undefined,
+ transform: `scale(${this._zoomed})`
+ }}>
+ {renderAnnotations(this.opaqueFilter)}
+ {SnappingManager.GetIsDragging() ? (null) : renderAnnotations()}
+ </div>
</div>;
}
@computed get pdfViewerDiv() {
diff --git a/src/client/views/search/SearchBox.scss b/src/client/views/search/SearchBox.scss
index 2586ef2ee..e8865b918 100644
--- a/src/client/views/search/SearchBox.scss
+++ b/src/client/views/search/SearchBox.scss
@@ -78,8 +78,10 @@
.searchBox-result-title {
display: relative;
float: left;
- width: calc(100% - 60px);
+ width: calc(100% - 45px);
text-align: left;
+ overflow: hidden;
+ text-overflow: ellipsis;
}
.searchBox-result-type {
@@ -87,7 +89,7 @@
margin-top: 6px;
display: relative;
float: right;
- width: 60px;
+ width: 45px;
text-align: right;
color: #222;
}
diff --git a/src/client/views/search/SearchBox.tsx b/src/client/views/search/SearchBox.tsx
index b07879674..9c353e9d0 100644
--- a/src/client/views/search/SearchBox.tsx
+++ b/src/client/views/search/SearchBox.tsx
@@ -7,23 +7,32 @@ import { Id } from '../../../fields/FieldSymbols';
import { createSchema, makeInterface } from '../../../fields/Schema';
import { StrCast } from '../../../fields/Types';
import { DocumentType } from "../../documents/DocumentTypes";
-import { DocumentManager } from "../../util/DocumentManager";
import { CollectionDockingView } from "../collections/CollectionDockingView";
import { ViewBoxBaseComponent } from "../DocComponent";
import { FieldView, FieldViewProps } from '../nodes/FieldView';
import "./SearchBox.scss";
+import { DocumentManager } from '../../util/DocumentManager';
+import { DocUtils } from '../../documents/Documents';
+import { Tooltip } from "@material-ui/core";
-export const searchSchema = createSchema({ Document: Doc });
+export const searchSchema = createSchema({
+ Document: Doc
+});
type SearchBoxDocument = makeInterface<[typeof documentSchema, typeof searchSchema]>;
const SearchBoxDocument = makeInterface(documentSchema, searchSchema);
+export interface SearchBoxProps extends FieldViewProps {
+ linkSearch: boolean;
+ linkFrom?: (() => Doc | undefined) | undefined;
+}
+
/**
* This is the SearchBox component. It represents the search box input and results in
* the search panel on the left side of the screen.
*/
@observer
-export class SearchBox extends ViewBoxBaseComponent<FieldViewProps, SearchBoxDocument>(SearchBoxDocument) {
+export class SearchBox extends ViewBoxBaseComponent<SearchBoxProps, SearchBoxDocument>(SearchBoxDocument) {
public static LayoutString(fieldKey: string) { return FieldView.LayoutString(SearchBox, fieldKey); }
public static Instance: SearchBox;
@@ -100,6 +109,17 @@ export class SearchBox extends ViewBoxBaseComponent<FieldViewProps, SearchBoxDoc
this._selectedResult = doc;
});
+ makeLink = action((linkTo: Doc) => {
+ console.log(linkTo.title);
+ if (this.props.linkFrom) {
+ const linkFrom = this.props.linkFrom();
+ if (linkFrom) {
+ console.log(linkFrom.title);
+ DocUtils.MakeLink({ doc: linkFrom }, { doc: linkTo }, "Link");
+ }
+ }
+ });
+
/**
* @param {Doc[]} docs - docs to be searched through recursively
* @param {number, Doc => void} func - function to be called on each doc
@@ -157,10 +177,10 @@ export class SearchBox extends ViewBoxBaseComponent<FieldViewProps, SearchBoxDoc
* right side of each search result.
*/
static formatType(type: String): String {
- if (type == "pdf") {
+ if (type === "pdf") {
return "PDF";
}
- else if (type == "image") {
+ else if (type === "image") {
return "Img";
}
@@ -180,28 +200,25 @@ export class SearchBox extends ViewBoxBaseComponent<FieldViewProps, SearchBoxDoc
const blockedTypes = [DocumentType.PRESELEMENT, DocumentType.KVP, DocumentType.FILTER, DocumentType.SEARCH, DocumentType.SEARCHITEM, DocumentType.FONTICON, DocumentType.BUTTON, DocumentType.SCRIPTING];
const blockedKeys = ["x", "y", "proto", "width", "autoHeight", "acl-Override", "acl-Public", "context", "zIndex", "height", "text-scrollHeight", "text-height", "cloneFieldFilter", "isPrototype", "text-annotations",
"dragFactory-count", "text-noTemplate", "aliases", "system", "layoutKey", "baseProto", "xMargin", "yMargin", "links", "layout", "layout_keyValue", "fitWidth", "viewType", "title-custom",
- "panX", "panY", "viewScale"]
+ "panX", "panY", "viewScale"];
const collection = CollectionDockingView.Instance;
query = query.toLowerCase();
- this._results = []
- this._selectedResult = undefined
+ this._results = [];
+ this._selectedResult = undefined;
if (collection !== undefined) {
const docs = DocListCast(collection.rootDoc[Doc.LayoutFieldKey(collection.rootDoc)]);
- const docIDs: String[] = []
- console.log(docs.length)
+ const docIDs: String[] = [];
SearchBox.foreachRecursiveDoc(docs, (depth: number, doc: Doc) => {
const dtype = StrCast(doc.type, "string") as DocumentType;
if (dtype && !blockedTypes.includes(dtype) && !docIDs.includes(doc[Id]) && depth > 0) {
const hlights = new Set<string>();
SearchBox.documentKeys(doc).forEach(key => Field.toString(doc[key] as Field).toLowerCase().includes(query) && hlights.add(key));
- blockedKeys.forEach(key => {
- hlights.delete(key);
- })
+ blockedKeys.forEach(key => hlights.delete(key));
Array.from(hlights.keys()).length > 0 && this._results.push([doc, Array.from(hlights.keys())]);
}
- docIDs.push(doc[Id])
+ docIDs.push(doc[Id]);
});
}
}
@@ -225,7 +242,7 @@ export class SearchBox extends ViewBoxBaseComponent<FieldViewProps, SearchBoxDoc
submitSearch = async () => {
this.resetSearch();
- let query = StrCast(this._searchString);
+ const query = StrCast(this._searchString);
Doc.SetSearchQuery(query);
this._results = [];
@@ -262,11 +279,9 @@ export class SearchBox extends ViewBoxBaseComponent<FieldViewProps, SearchBoxDoc
*/
@computed
public get selectOptions() {
- const selectValues = ["all", "rtf", "image", "pdf", "web", "video", "audio", "collection"]
+ const selectValues = ["all", "rtf", "image", "pdf", "web", "video", "audio", "collection"];
- return selectValues.map(value => {
- return <option key={value} value={value}>{SearchBox.formatType(value)}</option>
- })
+ return selectValues.map(value => <option key={value} value={value}>{SearchBox.formatType(value)}</option>);
}
/**
@@ -275,46 +290,54 @@ export class SearchBox extends ViewBoxBaseComponent<FieldViewProps, SearchBoxDoc
render() {
var validResults = 0;
+ const isLinkSearch: boolean = this.props.linkSearch;
+
+
const results = this._results.map(result => {
var className = "searchBox-results-scroll-view-result";
- if (this._selectedResult == result[0]) {
- className += " searchBox-results-scroll-view-result-selected"
+ if (this._selectedResult === result[0]) {
+ className += " searchBox-results-scroll-view-result-selected";
}
- if (this._docTypeString == "all" || this._docTypeString == result[0].type) {
+ const formattedType = SearchBox.formatType(StrCast(result[0].type));
+ const title = result[0].title;
+
+ if (this._docTypeString === "all" || this._docTypeString === result[0].type) {
validResults++;
return (
- <div key={result[0][Id]} onClick={() => this.onResultClick(result[0])} className={className}>
- <div className="searchBox-result-title">
- {result[0].title}
- </div>
- <div className="searchBox-result-type">
- {SearchBox.formatType(StrCast(result[0].type))}
+ <Tooltip key={result[0][Id]} placement={"right"} title={<><div className="dash-tooltip">{title}</div></>}>
+ <div onClick={isLinkSearch ? () => this.makeLink(result[0]) : () => this.onResultClick(result[0])} className={className}>
+ <div className="searchBox-result-title">
+ {title}
+ </div>
+ <div className="searchBox-result-type">
+ {formattedType}
+ </div>
+ <div className="searchBox-result-keys">
+ {result[1].join(", ")}
+ </div>
</div>
- <div className="searchBox-result-keys">
- {result[1].join(", ")}
- </div>
- </div>
- )
+ </Tooltip>
+ );
}
return null;
- })
+ });
results.filter(result => result);
return (
<div style={{ pointerEvents: "all" }} className="searchBox-container">
- <div className="searchBox-bar">
- <select name="type" id="searchBox-type" className="searchBox-type" onChange={this.onSelectChange}>
+ <div className="searchBox-bar" >
+ {isLinkSearch ? (null) : <select name="type" id="searchBox-type" className="searchBox-type" onChange={this.onSelectChange}>
{this.selectOptions}
- </select>
- <input defaultValue={""} autoComplete="off" onChange={this.onInputChange} type="text" placeholder="Search..." id="search-input" className="searchBox-input" ref={this._inputRef} />
+ </select>}
+ <input defaultValue={""} autoComplete="off" onChange={this.onInputChange} onKeyPress={e => e.key === "Enter" ? this.submitSearch() : null} type="text" placeholder="Search..." id="search-input" className="searchBox-input" style={{ width: isLinkSearch ? "100%" : undefined, borderRadius: isLinkSearch ? "5px" : undefined }} ref={this._inputRef} />
</div >
<div className="searchBox-results-container">
<div className="searchBox-results-count">
- {`${validResults}` + " result" + (validResults == 1 ? "" : "s")}
+ {`${validResults}` + " result" + (validResults === 1 ? "" : "s")}
</div>
<div className="searchBox-results-scroll-view">
{results}
diff --git a/src/client/views/topbar/TopBar.scss b/src/client/views/topbar/TopBar.scss
index 2ecbb536b..923f1892e 100644
--- a/src/client/views/topbar/TopBar.scss
+++ b/src/client/views/topbar/TopBar.scss
@@ -22,7 +22,7 @@
.topBar-icon {
cursor: pointer;
- font-size: 12px;
+ font-size: 12.5px;
font-family: 'Roboto';
width: fit-content;
display: flex;
@@ -31,18 +31,20 @@
align-items: center;
justify-self: center;
align-self: center;
- border-radius: 5px;
+ border-radius: $standard-border-radius;
padding: 5px;
- transition: linear 0.1s;
+ transition: linear 0.2s;
color: $black;
background-color: $light-gray;
- }
- .topBar-icon:hover {
- background-color: $light-blue;
+ &:hover {
+ background-color: darken($color: $light-gray, $amount: 20);
+ }
}
-
+
+
+
.topbar-center {
grid-column: 2;
display: inline-flex;
@@ -53,12 +55,13 @@
.topbar-dashboards {
display: flex;
flex-direction: row;
+ gap: 5px;
}
.topbar-lozenge-dashboard {
display: flex;
-
+
.topbar-dashSelect {
border: none;
@@ -155,9 +158,9 @@
}
&.topbar-input {
- margin:5px;
- border-radius:20px;
- border:$dark-gray;
+ margin: 5px;
+ border-radius: 20px;
+ border: $dark-gray;
display: block;
width: 130px;
-webkit-transition: width 0.4s;
diff --git a/src/client/views/topbar/TopBar.tsx b/src/client/views/topbar/TopBar.tsx
index 05edb975c..d5254e315 100644
--- a/src/client/views/topbar/TopBar.tsx
+++ b/src/client/views/topbar/TopBar.tsx
@@ -28,7 +28,7 @@ export class TopBar extends React.Component {
{`${Doc.CurrentUserEmail}`}
</div>
<div className="topbar-icon" onClick={() => window.location.assign(Utils.prepend("/logout"))}>
- {"Sign out"}
+ {"Log out"}
</div>
</div>
<div className="topbar-center" >
@@ -51,7 +51,8 @@ export class TopBar extends React.Component {
</div>
</div>
<div className="topbar-right" >
- <div className="topbar-icon">
+ <div className="topbar-icon" onClick={() => window.open(
+ "https://brown-dash.github.io/Dash-Documentation/", "_blank")}>
{"Help"}<FontAwesomeIcon icon="question-circle"></FontAwesomeIcon>
</div>
<div className="topbar-icon" onClick={() => SettingsManager.Instance.open()}>
diff --git a/src/fields/Doc.ts b/src/fields/Doc.ts
index 28d2e0441..49dfb14a7 100644
--- a/src/fields/Doc.ts
+++ b/src/fields/Doc.ts
@@ -25,6 +25,7 @@ import { deleteProperty, GetEffectiveAcl, getField, getter, inheritParentAcls, m
import JSZip = require("jszip");
import { CurrentUserUtils } from "../client/util/CurrentUserUtils";
import { IconProp } from "@fortawesome/fontawesome-svg-core";
+import Color = require("color");
export namespace Field {
export function toKeyValueString(doc: Doc, key: string): string {
@@ -1088,6 +1089,13 @@ export namespace Doc {
}
export function matchFieldValue(doc: Doc, key: string, value: any): boolean {
+ if (Utils.HasTransparencyFilter(value)) {
+ const isTransparent = (color: string) => color !== "" && (Color(color).alpha() !== 1);
+ return isTransparent(StrCast(doc[key]));
+ }
+ if (typeof value === "string") {
+ value = value.replace(`,${Utils.noRecursionHack}`, "");
+ }
const fieldVal = doc[key];
if (Cast(fieldVal, listSpec("string"), []).length) {
const vals = Cast(fieldVal, listSpec("string"), []);
@@ -1129,7 +1137,7 @@ export namespace Doc {
// filters document in a container collection:
// all documents with the specified value for the specified key are included/excluded
// based on the modifiers :"check", "x", undefined
- export function setDocFilter(container: Opt<Doc>, key: string, value: any, modifiers: "remove" | "match" | "check" | "x", toggle?: boolean, fieldSuffix?: string, append: boolean = true) {
+ export function setDocFilter(container: Opt<Doc>, key: string, value: any, modifiers: "remove" | "match" | "check" | "x" | "exists", toggle?: boolean, fieldSuffix?: string, append: boolean = true) {
if (!container) return;
const filterField = "_" + (fieldSuffix ? fieldSuffix + "-" : "") + "docFilters";
const docFilters = Cast(container[filterField], listSpec("string"), []);
diff --git a/src/fields/InkField.ts b/src/fields/InkField.ts
index 1270a2dab..f16e143d8 100644
--- a/src/fields/InkField.ts
+++ b/src/fields/InkField.ts
@@ -1,8 +1,8 @@
+import { createSimpleSchema, list, object, serializable } from "serializr";
+import { Scripting } from "../client/util/Scripting";
import { Deserializable } from "../client/util/SerializationHelper";
-import { serializable, custom, createSimpleSchema, list, object, map } from "serializr";
+import { Copy, ToScriptString, ToString } from "./FieldSymbols";
import { ObjectField } from "./ObjectField";
-import { Copy, ToScriptString, ToString, Update } from "./FieldSymbols";
-import { Scripting } from "../client/util/Scripting";
// Helps keep track of the current ink tool in use.
export enum InkTool {
diff --git a/src/fields/documentSchemas.ts b/src/fields/documentSchemas.ts
index b114fcf2d..c35c52699 100644
--- a/src/fields/documentSchemas.ts
+++ b/src/fields/documentSchemas.ts
@@ -15,7 +15,6 @@ export const documentSchema = createSchema({
// "Location" properties in a very general sense
_curPage: "number", // current page of a page based document
_currentFrame: "number", // current frame of a frame based collection (e.g., a progressive slide)
- _fullScreenView: Doc, // alias to display when double-clicking to open document in a full-screen view
lastFrame: "number", // last frame of a frame based collection (e.g., a progressive slide)
activeFrame: "number", // the active frame of a frame based animated document
_currentTimecode: "number", // current play back time of a temporal document (video / audio)
diff --git a/src/server/DashUploadUtils.ts b/src/server/DashUploadUtils.ts
index a617571ae..7b83d09ef 100644
--- a/src/server/DashUploadUtils.ts
+++ b/src/server/DashUploadUtils.ts
@@ -56,12 +56,12 @@ export namespace DashUploadUtils {
const size = "content-length";
const type = "content-type";
- const { imageFormats, videoFormats, applicationFormats, audioFormats } = AcceptableMedia;
+ const { imageFormats, videoFormats, applicationFormats, audioFormats } = AcceptableMedia; //TODO:glr
export function uploadYoutube(videoId: string): Promise<Upload.FileResponse> {
console.log("UPLOAD " + videoId);
return new Promise<Upload.FileResponse<Upload.FileInformation>>((res, rej) => {
- exec('/usr/local/bin/youtube-dl -o ' + (videoId + ".mp4") + ' https://www.youtube.com/watch?v=' + videoId + ' -f `/usr/local/bin/youtube-dl https://www.youtube.com/watch?v=' + videoId + ' -F | grep "(best)" | sed -e "s/ .*//"`',
+ exec('youtube-dl -o ' + (videoId + ".mp4") + ' https://www.youtube.com/watch?v=' + videoId + ' -f "best[filesize<50M]"',
(error: any, stdout: any, stderr: any) => {
if (error) console.log(`error: ${error.message}`);
else if (stderr) console.log(`stderr: ${stderr}`);
@@ -242,18 +242,23 @@ export namespace DashUploadUtils {
const { headers } = (await new Promise<any>((resolve, reject) => {
request.head(resolvedUrl, (error, res) => error ? reject(error) : resolve(res));
}).catch(error => console.error(error)));
- // Compute the native width and height ofthe image with an npm module
- const { width: nativeWidth, height: nativeHeight }: RequestedImageSize = await requestImageSize(resolvedUrl);
- // Bundle up the information into an object
- return {
- source,
- contentSize: parseInt(headers[size]),
- contentType: headers[type],
- nativeWidth,
- nativeHeight,
- filename,
- ...results
- };
+ try {
+ // Compute the native width and height ofthe image with an npm module
+ const { width: nativeWidth, height: nativeHeight } = await requestImageSize(resolvedUrl);
+ // Bundle up the information into an object
+ return {
+ source,
+ contentSize: parseInt(headers[size]),
+ contentType: headers[type],
+ nativeWidth,
+ nativeHeight,
+ filename,
+ ...results
+ };
+ } catch (e) {
+ console.log(e);
+ return e;
+ }
};
/**
diff --git a/src/server/index.ts b/src/server/index.ts
index 9687c3b23..f8c32103b 100644
--- a/src/server/index.ts
+++ b/src/server/index.ts
@@ -16,6 +16,7 @@ import UserManager from './ApiManagers/UserManager';
import UtilManager from './ApiManagers/UtilManager';
import { GoogleCredentialsLoader, SSL } from './apis/google/CredentialsLoader';
import { GoogleApiServerUtils } from "./apis/google/GoogleApiServerUtils";
+import { DashSessionAgent } from "./DashSession/DashSessionAgent";
import { AppliedSessionAgent } from "./DashSession/Session/agents/applied_session_agent";
import { DashUploadUtils } from './DashUploadUtils';
import { Database } from './database';
@@ -23,7 +24,6 @@ import { Logger } from "./ProcessFactory";
import RouteManager, { Method, PublicHandler } from './RouteManager';
import RouteSubscriber from './RouteSubscriber';
import initializeServer, { resolvedPorts } from './server_Initialization';
-import { DashSessionAgent } from "./DashSession/DashSessionAgent";
export const AdminPriviliges: Map<string, boolean> = new Map();
export const onWindows = process.platform === "win32";