set up web box classes

1 files changed, 117 insertions, 0 deletions

diff --git a/src/views/nodes/FieldTextBox.tsx b/src/views/nodes/FieldTextBox.tsx
new file mode 100644
index 000000000..dbac3906a
--- /dev/null
+++ b/src/views/nodes/FieldTextBox.tsx
@@ -0,0 +1,117 @@
+import { Key, KeyStore } from "../../fields/Key";
+import { Document } from "../../fields/Document";
+import { observer } from "mobx-react";
+import { TextField } from "../../fields/TextField";
+import React = require("react")
+import { action, observable, reaction, IReactionDisposer } from "mobx";
+
+import {schema} from "prosemirror-schema-basic";
+import {EditorState, Transaction} from "prosemirror-state"
+import {EditorView} from "prosemirror-view"
+import {keymap} from "prosemirror-keymap"
+import {baseKeymap} from "prosemirror-commands"
+import {undo, redo, history} from "prosemirror-history"
+import { Opt } from "../../fields/Field";
+
+interface IProps {
+    fieldKey:Key;
+    doc:Document;
+}
+
+// FieldTextBox: Displays an editable plain text node that maps to a specified Key of a Document
+//
+//  HTML Markup:  <FieldTextBox Doc={Document's ID} FieldKey={Key's name + "Key"}
+// 
+//  In Code, the node's HTML is specified in the document's parameterized structure as:
+//        document.SetField(KeyStore.Layout,  "<FieldTextBox doc={doc} fieldKey={<KEYNAME>Key} />");
+//  and the node's binding to the specified document KEYNAME as:
+//        document.SetField(KeyStore.LayoutKeys, new ListField([KeyStore.<KEYNAME>]));
+//  The Jsx parser at run time will bind:
+//        'fieldKey' property to the Key stored in LayoutKeys
+//    and 'doc' property to the document that is being rendered
+//
+//  When rendered() by React, this extracts the TextController from the Document stored at the 
+//  specified Key and assigns it to an HTML input node.  When changes are made tot his node, 
+//  this will edit the document and assign the new value to that field.
+//
+@observer
+export class FieldTextBox extends React.Component<IProps> {
+    private _ref: React.RefObject<HTMLDivElement>;
+    private _editorView: Opt<EditorView>;
+    private _reactionDisposer: Opt<IReactionDisposer>;
+
+    constructor(props:IProps) {
+        super(props);
+
+        this._ref = React.createRef();
+
+        this.onChange = this.onChange.bind(this);
+    }
+
+    dispatchTransaction = (tx: Transaction) => {
+        if(this._editorView) {
+            const state = this._editorView.state.apply(tx);
+            this._editorView.updateState(state);
+            const {doc, fieldKey} = this.props;
+            doc.SetFieldValue(fieldKey, JSON.stringify(state.toJSON()), TextField);
+        }
+    }
+
+    componentDidMount() {
+        let state:EditorState;
+        const {doc, fieldKey} = this.props;
+        const config = {
+            schema,
+            plugins: [
+                history(),
+                keymap({"Mod-z": undo, "Mod-y": redo}),
+                keymap(baseKeymap)
+            ]
+        };
+
+        let field = doc.GetFieldT(fieldKey, TextField);
+        if(field) {
+            state = EditorState.fromJSON(config, JSON.parse(field.Data));
+        } else {
+            state = EditorState.create(config);
+        }
+        if(this._ref.current) {
+            this._editorView = new EditorView(this._ref.current, {
+                state,
+                dispatchTransaction: this.dispatchTransaction
+            });
+        }
+
+        this._reactionDisposer = reaction(() => {
+            const field = this.props.doc.GetFieldT(this.props.fieldKey, TextField);
+            return field ? field.Data : undefined;
+        }, (field) => {
+            if(field && this._editorView) {
+                this._editorView.updateState(EditorState.fromJSON(config, JSON.parse(field)));
+            }
+        })
+    }
+
+    componentWillUnmount() {
+        if(this._editorView) {
+            this._editorView.destroy();
+        }
+        if(this._reactionDisposer) {
+            this._reactionDisposer();
+        }
+    }
+
+    shouldComponentUpdate() {
+        return false;
+    }
+
+    @action
+    onChange(e: React.ChangeEvent<HTMLInputElement>) {
+        const {fieldKey, doc} = this.props;
+        doc.SetFieldValue(fieldKey, e.target.value, TextField);
+    }
+
+    render() {
+        return (<div ref={this._ref} />)
+    }
+}
\ No newline at end of file