aboutsummaryrefslogtreecommitdiff
path: root/src/views/nodes/FieldTextBox.tsx
diff options
context:
space:
mode:
Diffstat (limited to 'src/views/nodes/FieldTextBox.tsx')
-rw-r--r--src/views/nodes/FieldTextBox.tsx117
1 files changed, 117 insertions, 0 deletions
diff --git a/src/views/nodes/FieldTextBox.tsx b/src/views/nodes/FieldTextBox.tsx
new file mode 100644
index 000000000..dbac3906a
--- /dev/null
+++ b/src/views/nodes/FieldTextBox.tsx
@@ -0,0 +1,117 @@
+import { Key, KeyStore } from "../../fields/Key";
+import { Document } from "../../fields/Document";
+import { observer } from "mobx-react";
+import { TextField } from "../../fields/TextField";
+import React = require("react")
+import { action, observable, reaction, IReactionDisposer } from "mobx";
+
+import {schema} from "prosemirror-schema-basic";
+import {EditorState, Transaction} from "prosemirror-state"
+import {EditorView} from "prosemirror-view"
+import {keymap} from "prosemirror-keymap"
+import {baseKeymap} from "prosemirror-commands"
+import {undo, redo, history} from "prosemirror-history"
+import { Opt } from "../../fields/Field";
+
+interface IProps {
+ fieldKey:Key;
+ doc:Document;
+}
+
+// FieldTextBox: Displays an editable plain text node that maps to a specified Key of a Document
+//
+// HTML Markup: <FieldTextBox Doc={Document's ID} FieldKey={Key's name + "Key"}
+//
+// In Code, the node's HTML is specified in the document's parameterized structure as:
+// document.SetField(KeyStore.Layout, "<FieldTextBox doc={doc} fieldKey={<KEYNAME>Key} />");
+// and the node's binding to the specified document KEYNAME as:
+// document.SetField(KeyStore.LayoutKeys, new ListField([KeyStore.<KEYNAME>]));
+// The Jsx parser at run time will bind:
+// 'fieldKey' property to the Key stored in LayoutKeys
+// and 'doc' property to the document that is being rendered
+//
+// When rendered() by React, this extracts the TextController from the Document stored at the
+// specified Key and assigns it to an HTML input node. When changes are made tot his node,
+// this will edit the document and assign the new value to that field.
+//
+@observer
+export class FieldTextBox extends React.Component<IProps> {
+ private _ref: React.RefObject<HTMLDivElement>;
+ private _editorView: Opt<EditorView>;
+ private _reactionDisposer: Opt<IReactionDisposer>;
+
+ constructor(props:IProps) {
+ super(props);
+
+ this._ref = React.createRef();
+
+ this.onChange = this.onChange.bind(this);
+ }
+
+ dispatchTransaction = (tx: Transaction) => {
+ if(this._editorView) {
+ const state = this._editorView.state.apply(tx);
+ this._editorView.updateState(state);
+ const {doc, fieldKey} = this.props;
+ doc.SetFieldValue(fieldKey, JSON.stringify(state.toJSON()), TextField);
+ }
+ }
+
+ componentDidMount() {
+ let state:EditorState;
+ const {doc, fieldKey} = this.props;
+ const config = {
+ schema,
+ plugins: [
+ history(),
+ keymap({"Mod-z": undo, "Mod-y": redo}),
+ keymap(baseKeymap)
+ ]
+ };
+
+ let field = doc.GetFieldT(fieldKey, TextField);
+ if(field) {
+ state = EditorState.fromJSON(config, JSON.parse(field.Data));
+ } else {
+ state = EditorState.create(config);
+ }
+ if(this._ref.current) {
+ this._editorView = new EditorView(this._ref.current, {
+ state,
+ dispatchTransaction: this.dispatchTransaction
+ });
+ }
+
+ this._reactionDisposer = reaction(() => {
+ const field = this.props.doc.GetFieldT(this.props.fieldKey, TextField);
+ return field ? field.Data : undefined;
+ }, (field) => {
+ if(field && this._editorView) {
+ this._editorView.updateState(EditorState.fromJSON(config, JSON.parse(field)));
+ }
+ })
+ }
+
+ componentWillUnmount() {
+ if(this._editorView) {
+ this._editorView.destroy();
+ }
+ if(this._reactionDisposer) {
+ this._reactionDisposer();
+ }
+ }
+
+ shouldComponentUpdate() {
+ return false;
+ }
+
+ @action
+ onChange(e: React.ChangeEvent<HTMLInputElement>) {
+ const {fieldKey, doc} = this.props;
+ doc.SetFieldValue(fieldKey, e.target.value, TextField);
+ }
+
+ render() {
+ return (<div ref={this._ref} />)
+ }
+} \ No newline at end of file